summaryrefslogtreecommitdiffstats
path: root/src (follow)
Commit message (Expand)AuthorAgeFilesLines
* dynarmic: Inline exclusive memory accessesmerry2022-02-2716-7/+113
* Merge pull request #7932 from bunnei/extended-mem-layoutbunnei2022-02-2621-55/+91
|\
| * hle: kernel: KSystemControl: Use 6GB memory layout when "use_extended_memory_layout" setting is enabled.bunnei2022-02-211-20/+4
| * core: device_memory: Use memory size reported by KSystemControl.bunnei2022-02-213-7/+5
| * settings: Add a new "use_extended_memory_layout" setting.bunnei2022-02-217-0/+22
| * core: hle: kernel: Remove resource limit hack for PhysicalMemory.bunnei2022-02-211-7/+0
| * core: hle: kernel: KProcess: Pass in KResourceLimit on process creation.bunnei2022-02-214-9/+30
| * core: hle: kernel: KEvent: Pass in owner KProcess on event creation.bunnei2022-02-214-12/+8
| * core: hle: kernel: KResourceLimit: Add a helper function for creating a KResourceLimit for a process.bunnei2022-02-212-0/+22
* | Merge pull request #7953 from ameerj/radv-rdna2-crashbunnei2022-02-261-4/+21
|\ \
| * | vulkan_device: Blacklist RADV on RDNA2 from VK_EXT_vertex_input_dynamic_stateAmeer J2022-02-261-4/+21
* | | Merge pull request #7948 from Morph1984/11-11-10-floatMai M2022-02-262-0/+4
|\ \ \
| * | | maxwell_to_(gl/vk): Add 11_11_10 float vertex formatMorph2022-02-252-0/+4
| |/ /
* | | Merge pull request #7939 from asLody/fb-format-gbra8bunnei2022-02-251-0/+2
|\ \ \
| * | | vk_blit_screen: Add missing format bgra8Lody2022-02-241-0/+2
| |/ /
* | | Merge pull request #7927 from german77/amiibobunnei2022-02-251-0/+10
|\ \ \
| * | | yuzu: Remove amiibos on drag and dropgerman772022-02-201-0/+10
* | | | Merge pull request #7859 from german77/battery_againbunnei2022-02-246-34/+27
|\ \ \ \ | |_|/ / |/| | |
| * | | input_common: Remove battery duplicated struct and update every button pressgerman772022-02-076-34/+27
* | | | service: am: Update enum names to match documentationNarr the Reg2022-02-224-16/+51
* | | | Merge pull request #7913 from voidanix/anv-fixbunnei2022-02-213-2/+21
|\ \ \ \ | |_|_|/ |/| | |
| * | | vulkan_device: fix missing format in ANVvoidanix2022-02-213-2/+21
| | |/ | |/|
* | | Merge pull request #7919 from bunnei/phys-mem-updatesbunnei2022-02-213-131/+506
|\ \ \
| * | | fixup! core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-193-38/+18
| * | | core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-193-113/+508
* | | | Merge pull request #7920 from bunnei/fix-unmap-pagesbunnei2022-02-211-3/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | core: hle: kernel: KPageTable: Fix UnmapPages.bunnei2022-02-191-3/+2
| |/ /
* | | Merge pull request #7867 from german77/amiibobunnei2022-02-197-254/+949
|\ \ \ | |/ / |/| |
| * | nfp: Allow files without password datagerman772022-02-132-9/+24
| * | nfp: Separate nfc tag from amiibo dataNarr the Reg2022-02-103-44/+76
| * | nfp: Address compiler issuesgerman772022-02-092-27/+27
| * | nfp: Validate amiibo filesNarr the Reg2022-02-082-41/+145
| * | yuzu: Allow to open and remove the amiibogerman772022-02-083-5/+24
| * | nfp: Improve implementationgerman772022-02-084-189/+672
| * | nfp: Move IUser class to header and add missing enum and structsgerman772022-02-072-257/+299
| * | nfp: Sort functions by command numbergerman772022-02-071-79/+79
| |/
* | Merge pull request #7900 from german77/enterbunnei2022-02-182-0/+6
|\ \
| * | yuzu: config: Fix mapping issues with the enter keyNarr the Reg2022-02-152-0/+6
* | | common: Add NullVisitor default constructorWunkolo2022-02-171-0/+3
* | | Merge pull request #7866 from xerpi/svc-OutputDebugString32-CreateCodeMemory32-ControlCodeMemory32Mai M2022-02-172-4/+40
|\ \ \
| * | | kernel: svc: Add OutputDebugString32, CreateCodeMemory32, ControlCodeMemory32Sergi Granell2022-02-152-4/+40
| |/ /
* | | Merge pull request #7878 from german77/mnppbunnei2022-02-176-0/+71
|\ \ \
| * | | service/mnpp: Stub mnpp_appNarr the Reg2022-02-116-0/+71
| | |/ | |/|
* | | Merge pull request #7899 from Kelebek1/testMorph2022-02-161-9/+9
|\ \ \
| * | | Dump patched exefs rather than baseKelebek12022-02-151-9/+9
* | | | Merge pull request #7877 from lat9nq/upd_revbunnei2022-02-151-1/+3
|\ \ \ \
| * | | | audio_core: Update current process revisionlat9nq2022-02-111-1/+3
* | | | | Merge pull request #7891 from Morph1984/buffer_to_string_viewbunnei2022-02-152-0/+26
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | common: fs_util: Add buffer to string view utility functionsMorph2022-02-142-0/+26
* | | | | Merge pull request #7871 from german77/svc2bunnei2022-02-151-77/+77
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | svc: Set unique names for function tablesNarr the Reg2022-02-091-77/+77
| | |_|/ | |/| |
* | | | debugger: console: Set console output codepage to UTF-8Morph2022-02-141-0/+1
| |/ / |/| |
* | | hid: Stub IsUsbFullKeyControllerEnabledlat9nq2022-02-122-1/+12
* | | Merge pull request #7852 from Morph1984/new-uuidbunnei2022-02-1131-193/+370
|\ \ \ | |_|/ |/| |
| * | common: uuid: Use sizeof(u64) instead of 8 in Hash()Morph2022-02-101-5/+5
| * | common: uuid: Return an invalid UUID if conversion from string failsMorph2022-02-051-14/+39
| * | general: Rename NewUUID to UUID, and remove the previous UUID implMorph2022-02-0541-598/+415
| * | profile: Migrate to the new UUID implementationMorph2022-02-0514-127/+131
| * | common: uuid: Add AsU128()Morph2022-02-052-0/+9
| * | hle: ipc_helpers: Ignore -Wclass-memaccessMorph2022-02-051-0/+8
| * | service: Migrate to the new UUID implementationMorph2022-02-059-45/+36
| * | input/hid: Migrate to the new UUID implementationMorph2022-02-0516-56/+57
| * | common: Implement NewUUIDMorph2022-02-053-0/+322
* | | Merge pull request #7861 from german77/user_featuresbunnei2022-02-107-62/+95
|\ \ \
| * | | yuzu: Mute audio when in backgroundgerman772022-02-076-4/+27
| * | | yuzu: Add docked, GPU accuracy and adapting filter hotkeysgerman772022-02-074-58/+68
| | |/ | |/|
* | | Merge pull request #7860 from german77/no-more-driftbunnei2022-02-103-4/+30
|\ \ \
| * | | yuzu: Add auto center on right clickgerman772022-02-073-4/+30
| |/ /
* | | hle: kernel: KCodeMemory: Remove unused QueryMemory.bunnei2022-02-091-1/+0
* | | hle: kernel: KCodeMemory: Correct m_page_group number of pages.bunnei2022-02-091-2/+3
|/ /
* | Merge pull request #7847 from tech-ticks/masterMorph2022-02-062-1/+46
|\ \
| * | service: pm: Implement AtmosphereGetProcessInfotech-ticks2022-02-042-1/+46
* | | Merge pull request #7851 from lat9nq/cmd-add-motionMorph2022-02-061-8/+28
|\ \ \
| * | | config: Support motion inputslat9nq2022-02-051-8/+28
* | | | Merge pull request #7849 from Morph1984/qt-frameless-windowbunnei2022-02-051-0/+2
|\ \ \ \ | |_|_|/ |/| | |
| * | | main: Always remove the frameless window flag when restoring UI stateMorph2022-02-041-0/+2
* | | | Merge pull request #7842 from german77/vibration_testbunnei2022-02-055-8/+95
|\ \ \ \
| * | | | yuzu: config: Vibrate the controller while configuring vibration strengthNarr the Reg2022-02-025-8/+95
* | | | | Merge pull request #7839 from german77/batterybunnei2022-02-054-39/+59
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | yuzu: ui: Improve battery symbolsNarr the Reg2022-02-024-39/+59
| |/ / /
* | | / input_common: Remove unused core includeMorph2022-02-041-1/+0
| |_|/ |/| |
* | | Merge pull request #7811 from german77/analog-modbunnei2022-02-031-4/+26
|\ \ \
| * | | input_common: Use attributes for analog range modifiersgerman772022-01-311-4/+26
* | | | Merge pull request #7814 from FernandoS27/another-bug-in-my-schedulebunnei2022-02-032-4/+6
|\ \ \ \
| * | | | Vulkan: Fix Scheduler Chunks when their FuncType is 0.Fernando Sahmkow2022-01-312-4/+6
| |/ / /
* | | | Merge pull request #7835 from bunnei/page-table-lockbunnei2022-02-032-34/+46
|\ \ \ \ | |_|_|/ |/| | |
| * | | hle: kernel: KPageTable: Migrate locks to KScopedLightLock.bunnei2022-02-022-34/+46
* | | | Merge pull request #7838 from lioncash/noncopyMorph2022-02-0220-150/+228
|\ \ \ \
| * | | | common_types: Remove NonCopyable structLioncash2022-02-021-10/+0
| * | | | general: Replace NonCopyable struct with equivalentsLioncash2022-02-0212-129/+219
| * | | | general: Move deleted copy/move constructor/assignment operators to public interfaceLioncash2022-02-027-11/+9
* | | | | Merge pull request #7834 from german77/repeatbunnei2022-02-021-0/+1
|\ \ \ \ \
| * | | | | yuzu: Disable auto repeat on hotkeys againNarr the Reg2022-02-021-0/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #7806 from ameerj/atomic64-fallbacksbunnei2022-02-0211-3/+582
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | emit_glsl_atomic: Implement 32x2 fallback atomic opsameerj2022-01-301-9/+55
| * | | | lower_int64_to_int32: Add 64-bit atomic fallbacksameerj2022-01-303-11/+76
| * | | | shaders: Add U64->U32x2 Atomic fallback functionsameerj2022-01-309-1/+469
| |/ / /
* | | | Merge pull request #7807 from german77/moar-buttonsbunnei2022-02-024-3/+22
|\ \ \ \ | |_|_|/ |/| | |
| * | | input_common: Add home and hard touch press buttons to UDP controllersgerman772022-01-304-3/+22
| |/ /
* | | Merge pull request #7833 from lioncash/file-sysMorph2022-02-023-8/+18
|\ \ \
| * | | configure_filesystem: Add missing changeEvent() overrideLioncash2022-02-022-0/+10
| * | | configure_filesystem: Normalize member function casingLioncash2022-02-023-8/+8
| | |/ | |/|
* | | Merge pull request #7792 from german77/translatebunnei2022-02-021-16/+16
|\ \ \ | |/ / |/| |
| * | hotkeys: Don't translate hotkey buttonsgerman772022-01-281-16/+16
* | | Merge pull request #7809 from Morph1984/clock-constantsbunnei2022-02-023-11/+19
|\ \ \
| * | | common: wall_clock: Check precision against the emulated CPU and CNTFRQMorph2022-01-302-8/+12
| * | | common: wall_clock: Utilize constants for ms, us, and ns ratiosMorph2022-01-303-5/+9
| | |/ | |/|
* | | Merge pull request #7831 from lioncash/motionMorph2022-02-011-18/+20
|\ \ \
| * | | configure_motion_touch: Use functor versions of invokeMethodLioncash2022-02-011-18/+20
* | | | configure_input_player: Eliminate variable shadowingLioncash2022-02-011-4/+5
* | | | configure_input_player: std::move input setters in HandleClickLioncash2022-02-011-1/+1
* | | | configure_input_player: Avoid unnecessary ParamPackage copiesLioncash2022-02-011-6/+6
|/ / /
* | | yuzu/game_list: Use non-deprecated version of QString's split() functionLioncash2022-02-011-1/+1
* | | Merge pull request #7825 from lioncash/nodisc2Morph2022-02-011-3/+2
|\ \ \
| * | | common/file: Remove [[nodiscard]] from Open()Lioncash2022-02-011-3/+2
| |/ /
* | | Merge pull request #7824 from lioncash/scacheMorph2022-02-012-4/+3
|\ \ \
| * | | video_core/shader_cache: Remove unused algorithm includeLioncash2022-02-011-1/+0
| * | | video_core/shader_cache: Take std::span in RemoveShadersFromStorage()Lioncash2022-02-012-3/+3
| |/ /
* | | Merge pull request #7821 from german77/espada_agudabunnei2022-02-011-1/+1
|\ \ \
| * | | svc: Add 32 bit SynchronizePreemptionStateNarr the Reg2022-02-011-1/+1
| |/ /
* | | Rasterizer: Refactor inlineToMemory.Fernando Sahmkow2022-02-019-15/+16
* | | GPU: Improve syncing.Fernando Sahmkow2022-01-291-3/+10
* | | Rasterizer: Implement Inline2Memory Acceleration.Fernando Sahmkow2022-01-2914-6/+122
* | | Inline2Memory: Flush before writting buffer.Fernando Sahmkow2022-01-292-2/+3
|/ /
* | Merge pull request #7791 from german77/wall_clockMorph2022-01-291-1/+3
|\ \
| * | wall_clock: use standard wall clock if rtsc frequency is too lowgerman772022-01-281-1/+3
| |/
* | spirv_atomic: Define U32x2 storage buffers for 64-bit storage atomicsameerj2022-01-292-3/+3
* | Merge pull request #7784 from german77/ds5Morph2022-01-291-2/+3
|\ \
| * | input_common: Add DS5 to HD rumble listNarr the Reg2022-01-271-2/+3
* | | Merge pull request #7787 from bunnei/scheduler-deadlock-fixMorph2022-01-292-23/+24
|\ \ \
| * | | hle: kernel: KScheduler: Fix deadlock with core waiting for a thread lock that has migrated.bunnei2022-01-272-23/+24
* | | | Merge pull request #7788 from ameerj/stream-buffer-beginMorph2022-01-291-0/+2
|\ \ \ \
| * | | | buffer_cache: Reduce stream buffer allocations when expanding from the leftameerj2022-01-271-0/+2
| |/ / /
* | | | Merge pull request #7786 from ameerj/vmnmx-selMorph2022-01-291-12/+6
|\ \ \ \
| * | | | video_minimum_maximum: Implement src operand selectorsameerj2022-01-271-12/+6
| |/ / /
* | | | emit_spirv: Add Xfb execution mode when transform feedback is usedameerj2022-01-281-3/+9
* | | | Merge pull request #7770 from german77/motion-thresholdbunnei2022-01-284-6/+24
|\ \ \ \ | |/ / / |/| | |
| * | | input_common: Add option to configure gyro thresholdgerman772022-01-244-6/+24
| | |/ | |/|
* | | Merge pull request #7783 from lioncash/abi-cexprMorph2022-01-272-9/+9
|\ \ \
| * | | common/xbyak_api: Make BuildRegSet() constexprLioncash2022-01-262-9/+9
* | | | Merge pull request #7762 from bunnei/un-map-improvebunnei2022-01-273-111/+108
|\ \ \ \ | |/ / / |/| | |
| * | | core: hle: kernel: KPageTable: Various improvements to MapPages and UnmapPages.bunnei2022-01-231-22/+25
| * | | core: hle: kernel: KPageTable: MapProcessCode: Various cleanup.bunnei2022-01-231-11/+12
| * | | core: hle: kernel: KPageTable: ReserveTransferMemory: Various cleanup.bunnei2022-01-231-6/+6
| * | | core: hle: kernel: KPageTable: ResetTransferMemory: Various cleanup.bunnei2022-01-231-6/+5
| * | | core: hle: kernel: KPageTable: SetMemoryAttribute: Various cleanup.bunnei2022-01-231-2/+3
| * | | core: hle: kernel: KPageTable: Assert valid address on GetPhysicalAddr.bunnei2022-01-221-1/+3
| * | | core: hle: kernel: KPageTable: Operate: Assert lock ownership.bunnei2022-01-221-2/+2
| * | | core: hle: kernel: KPageTable: SetHeapSize: Cleanup & take physical memory lock.bunnei2022-01-221-4/+7
| * | | core: hle: kernel: Refactor Un/MapPhysicalMemory to remove unnecessary methods.bunnei2022-01-222-50/+39
| * | | core: hle: kernel: Rename Un/Map to Un/MapMeory.bunnei2022-01-223-7/+6
* | | | Merge pull request #7780 from lioncash/macrobunnei2022-01-269-213/+204
|\ \ \ \ | |_|_|/ |/| | |
| * | | video_core/macro: Add missing <cstring> headerLioncash2022-01-251-2/+3
| * | | video_core/macro_interpreter: Move impl class to the cpp fileLioncash2022-01-252-84/+86
| * | | video_core/macro_hle: Return unique_ptr directly from GetHLEProgram()Lioncash2022-01-253-7/+7
| * | | video_core/macro: Remove unused parameter from Execute()Lioncash2022-01-253-4/+3
| * | | video_core/macro_jit_x64: Remove unused impl class memberLioncash2022-01-251-1/+0
| * | | video_core/macro_jit_x64: Decouple PersistentCallerSavedRegs() from implLioncash2022-01-251-5/+4
| * | | video_core/macro_jit_x64: Move impl class into cpp fileLioncash2022-01-252-87/+86
| * | | video_core/macro_hle: Move impl class into cpp fileLioncash2022-01-252-27/+19
| | |/ | |/|
* | | Merge pull request #7769 from german77/no-controlbunnei2022-01-266-3/+28
|\ \ \
| * | | yuzu: Add setting to disable controller navigationgerman772022-01-246-3/+28
| |/ /
* | | Merge pull request #7768 from Moonlacer/fsr-1.0.2bunnei2022-01-261-1/+1
|\ \ \
| * | | Update FSR to 1.0.2Moonlacer2022-01-231-1/+1
| |/ /
* | | Merge pull request #7777 from lioncash/nodiscMorph2022-01-251-2/+1
|\ \ \
| * | | shader_recompiler: Remove unnecessary [[nodiscard]]Lioncash2022-01-251-2/+1
| |/ /
* | | Merge pull request #7779 from lioncash/gpu-ifaceMorph2022-01-251-16/+0
|\ \ \
| * | | gpu: Tidy up forward declarationsLioncash2022-01-251-10/+0
| * | | gpu: Remove obsoleted CDMAPusher() accessorsLioncash2022-01-251-6/+0
| |/ /
* | | Merge pull request #7778 from lioncash/commaMorph2022-01-251-1/+1
|\ \ \
| * | | vk_fsr: Replace comma operator with semicolonLioncash2022-01-251-1/+1
| |/ /
* | | Merge pull request #7774 from lioncash/mappingMorph2022-01-255-13/+18
|\ \ \
| * | | input_common/input_engine: Ensure PadIdentifier UUIDs have a valid initial stateLioncash2022-01-241-1/+1
| * | | input_common/input_mapping: Simplify UUID validity checksLioncash2022-01-241-3/+3
| * | | input_common/input_mapping: Add missing includesLioncash2022-01-242-1/+6
| * | | input_common/input_mapping: Remove const from return valueLioncash2022-01-244-4/+4
| * | | input_common/input_mapping: Default constructorLioncash2022-01-241-1/+1
| * | | input_common/main: Pass MappingData by const reference in callbacksLioncash2022-01-242-3/+3
| |/ /
* | | Merge pull request #7773 from lioncash/udp-deprecatedMorph2022-01-252-6/+6
|\ \ \
| * | | input_common/udp_client: Replace deprecated from_string()/to_ulong() functionsLioncash2022-01-241-2/+2
| * | | input_common/udp_client: Prevent unnecessary string copiesLioncash2022-01-242-4/+4
| |/ /
* | | Merge pull request #7771 from lioncash/assertMorph2022-01-251-2/+0
|\ \ \
| * | | kernel/k_affinity_mask: Remove duplicated assertLioncash2022-01-241-2/+0
| |/ /
* | | Merge pull request #7765 from bunnei/update-thread-countbunnei2022-01-253-24/+21
|\ \ \
| * | | hle: kernel: KThread: Improve Increment/Decrement RunningThreadCount.bunnei2022-01-233-24/+21
| |/ /
* | | Merge pull request #7760 from german77/inverted_keyboardbunnei2022-01-251-25/+34
|\ \ \ | |/ / |/| |
| * | yuzu: Add modifiers for keyboardNarr the Reg2022-01-221-25/+34
* | | Merge pull request #7716 from german77/volumebunnei2022-01-224-28/+18
|\ \ \ | |_|/ |/| |
| * | audio/stream: Adjust volume scale factorgerman772022-01-161-2/+2
| * | yuzu: Add volume up/down hotkeysgerman772022-01-163-4/+16
| * | yuzu: Remove speed limit hotkeysgerman772022-01-153-24/+2
* | | Merge pull request #7735 from german77/udp_batterybunnei2022-01-222-0/+25
|\ \ \
| * | | input_common: Report battery for UDP controllersNarr the Reg2022-01-172-0/+25
| |/ /
* | | Merge pull request #7737 from bunnei/fix-dummy-thread-leakbunnei2022-01-229-40/+120
|\ \ \ | |_|/ |/| |
| * | hle: kernel: KThread: Ensure host (dummy) threads block on locking.bunnei2022-01-224-0/+89
| * | hle: kernel: Remove redundant tracking of dummy threads.bunnei2022-01-211-9/+3
| * | hle: kernel: KThread: DummyThread can be waited, ensure wait_queue is not nullptr.bunnei2022-01-211-6/+6
| * | hle: kernel: KThread: Decrease DummyThread priority to ensure it is never scheduled.bunnei2022-01-213-2/+5
| * | hle: kernel: service_thread: Ensure dummy thread is closed & destroyed on thread exit.bunnei2022-01-211-0/+5
| * | hle: kernel: KServerSession: Remove hack for CompleteSyncRequest.bunnei2022-01-211-11/+0
| * | hle: kernel: KServerSession: Simplify CompleteSyncRequest EndWait.bunnei2022-01-212-12/+2
| * | hle: kernel: KThread: Ensure dummy threads never call EndWait.bunnei2022-01-211-0/+5
| * | hle: kernel: KScheduler: Ensure dummy threads are never scheduled.bunnei2022-01-211-0/+5
| * | hle: kernel: KThread: Rename thread_type_for_debugging -> thread_type.bunnei2022-01-213-6/+6
* | | Merge pull request #7752 from Morph1984/SetCpuOverclockEnabledbunnei2022-01-221-1/+13
|\ \ \
| * | | service: apm: Stub ISession SetCpuOverclockEnabledMorph2022-01-211-1/+13
* | | | service/wlan: Update function tablesLioncash2022-01-211-1/+1
* | | | service/usb: Update function tablesLioncash2022-01-211-27/+15
* | | | service/set: Update function tablesLioncash2022-01-211-0/+2
* | | | service/ns: Update function tablesLioncash2022-01-211-0/+6
* | | | service/nim: Update unknown function table entriesLioncash2022-01-211-0/+6
* | | | service/friend: Update unknown function table entriesLioncash2022-01-211-6/+6
* | | | service/filsystem: Update fsp-srv function tableLioncash2022-01-211-0/+3
* | | | service/btm: Update function tablesLioncash2022-01-211-0/+30
* | | | service/audio: Update audctl unknown function namesLioncash2022-01-211-8/+8
* | | | service/am: Update omm function tablesLioncash2022-01-211-0/+1
* | | | service/acc: Update unknown function namesLioncash2022-01-212-4/+4
* | | | Merge pull request #7755 from v1993/someone-in-here-lacks-system-wide-themingbunnei2022-01-212-6/+11
|\ \ \ \
| * | | | Use Default Colorful theme by default outside of Windowsv19932022-01-212-6/+11
* | | | | Merge pull request #7731 from v1993/xfb-varying-check-fixbunnei2022-01-212-6/+8
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | shader_recompiler: fix potential OOB accessv19932022-01-172-6/+8
* | | | | Merge pull request #7695 from Morph1984/is-pow2bunnei2022-01-211-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | common: bit_util: Add IsPow2 helper functionMorph2022-01-111-0/+6
* | | | | Merge pull request #7710 from german77/just-shake-itbunnei2022-01-211-1/+1
|\ \ \ \ \
| * | | | | core/hid: Increment shake forceNarr the Reg2022-01-141-1/+1
* | | | | | video_core: constify AVCodec for ffmpeg >= 5.0Jan Beich2022-01-201-1/+1
| |_|_|/ / |/| | | |
* | | | | Merge pull request #7726 from german77/clampMorph2022-01-191-1/+2
|\ \ \ \ \
| * | | | | service/hid: Initialize applet_resource on SetNpadAnalogStickUseCenterClampgerman772022-01-191-1/+2
* | | | | | vulkan_device: Fix sType for VkPhysicalDeviceShaderAtomicInt64FeaturesGeorg Lehmann2022-01-191-1/+1
* | | | | | Merge pull request #7701 from bunnei/clear-mem-pagesbunnei2022-01-195-16/+34
|\ \ \ \ \ \
| * | | | | | hle: kernel: k_memory_manager: Clear pages on allocation & free.bunnei2022-01-155-16/+34
* | | | | | | Merge pull request #7715 from gidoly/patch-4bunnei2022-01-191-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Xbox controller default name nit pickgidoly2022-01-151-2/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #7725 from german77/mouse_in_motionbunnei2022-01-195-1/+64
|\ \ \ \ \ \
| * | | | | | input_common: Reintroduce motion from mouse and use button namesgerman772022-01-175-1/+64
| |/ / / / /
* | | | | | Merge pull request #7712 from bunnei/fix-thread-exitbunnei2022-01-1811-39/+181
|\ \ \ \ \ \
| * | | | | | core: hle: kernel: KThread: Integrate with KWorkerTask and implement DoWorkerTaskImpl.bunnei2022-01-152-2/+28
| * | | | | | core: hle: kernel: KProcess: Integrate with KWorkerTask and add unimplemented DoWorkerTaskImpl.bunnei2022-01-152-3/+9
| * | | | | | core: hle: kernel: KThread: Replace Suspend with UpdateState & various updates.bunnei2022-01-152-33/+26
| * | | | | | core: hle: kernel: Instantiate a kernel instance of KWorkerTaskManager.bunnei2022-01-152-0/+18
| * | | | | | core: hle: kernel: Add KWorkerTask and KWorkerTaskManager.bunnei2022-01-154-0/+96
| * | | | | | common: fiber: YieldTo: Avoid hard crash on nullptr previous_fiber.bunnei2022-01-151-1/+4
* | | | | | | Merge pull request #7724 from ameerj/astc_new_nvbunnei2022-01-181-34/+46
|\ \ \ \ \ \ \
| * | | | | | | astc_decoder: Combine FastReplicate functions to work around new NV driver bugameerj2022-01-161-34/+46
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7732 from v1993/patch-7bunnei2022-01-181-2/+0
|\ \ \ \ \ \ \
| * | | | | | | hle: remove no-op codeValeri2022-01-171-2/+0
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #7730 from v1993/patch-6Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \
| * | | | | | | input_common: nitpick about SetHatButton usageValeri2022-01-171-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7729 from v1993/patch-5Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \
| * | | | | | | input_common: fix copy-paste errorValeri2022-01-171-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #7728 from v1993/patch-4Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \
| * | | | | | | hid: fix std::transform callValeri2022-01-171-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #7727 from v1993/patch-3Mai M2022-01-171-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Correct assignment source for rotationsValeri2022-01-171-1/+1
| |/ / / / /
* | | | | | uisettings: Add enumeration type for themesMorph2022-01-172-3/+17
* | | | | | config: Change default theme to Dark Colorfulgidoly2022-01-171-2/+2
|/ / / / /
* | | | | Merge pull request #7713 from gidoly/patch-3bunnei2022-01-151-0/+6
|\ \ \ \ \
| * | | | | Change default name for ps controllersgidoly2022-01-151-0/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #7711 from bunnei/fix-service-thread-race-v2bunnei2022-01-151-12/+11
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | hle: kernel: Fix service_threads access to be thread safe V2.bunnei2022-01-151-12/+11
| |/ / /
* | | | Merge pull request #7707 from german77/slow-updatebunnei2022-01-151-1/+2
|\ \ \ \ | |/ / / |/| | |
| * | | service/hid: Decrease motion update rateNarr the Reg2022-01-131-1/+2
| |/ /
* | | Merge pull request #7699 from bunnei/fix-service-thread-raceMai M2022-01-141-7/+27
|\ \ \
| * | | hle: kernel: Fix service_threads access to be thread safe.bunnei2022-01-141-7/+27
* | | | Merge pull request #7698 from bunnei/mem-code-memory-updatesMai M2022-01-146-81/+107
|\ \ \ \ | |/ / / |/| | |
| * | | hle: kernel: k_page_table: Update SetProcessMemoryPermission.bunnei2022-01-126-45/+68
| * | | hle: service: ldr: UnmapCodeMemory BSS only when set.bunnei2022-01-121-3/+7
| * | | hle: kernel: k_page_table: ReadAndWrite -> UserReadWrite.bunnei2022-01-123-18/+18
| * | | hle: kernel: k_page_table: Rename *ProcessCodeMemory -> *CodeMemory.bunnei2022-01-124-20/+19
* | | | Merge pull request #7690 from Morph1984/increase-file-limit-winbunnei2022-01-141-2/+2
|\ \ \ \
| * | | | yuzu: main: Increase the open file limit on Windows to 8192Morph2022-01-101-2/+2
| | |_|/ | |/| |
* | | | Merge pull request #7700 from german77/no-gyrobunnei2022-01-141-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | core/hid: Reduce gyro threshold even moreNarr the Reg2022-01-121-1/+1
* | | | Merge pull request #7697 from abouvier/opt-testsbunnei2022-01-122-2/+5
|\ \ \ \ | |_|_|/ |/| | |
| * | | cmake: make tests optionalAlexandre Bouvier2022-01-122-2/+5
* | | | Merge pull request #7684 from bunnei/set-mem-perm-attrbunnei2022-01-125-160/+211
|\ \ \ \ | |/ / / |/| | |
| * | | core: hle: kernel: svc: Updates to SetMemoryAttribute and SetMemoryPermission.bunnei2022-01-083-45/+46
| * | | core: hle: kernel: k_page_table: Update CheckMemoryState.bunnei2022-01-084-116/+166
* | | | Merge pull request #7633 from german77/hotkeysbunnei2022-01-1115-80/+626
|\ \ \ \ | |_|_|/ |/| | |
| * | | yuzu: Add controller hotkeysgerman772022-01-0714-79/+580
| * | | core/hid: Add home and screenshot button supportgerman772022-01-073-1/+46
* | | | Merge pull request #7683 from liushuyu/fmt-8.1Morph2022-01-104-2/+27
|\ \ \ \
| * | | | logging/log.h: move enum class formatter to a separate file ...liushuyu2022-01-106-22/+32
| * | | | logging/log: use `underlying_type` instead of hardcoding typesliushuyu2022-01-091-2/+4
| * | | | logging: adapt to changes in fmt 8.1liushuyu2022-01-083-7/+20
| | |/ / | |/| |
* | | | Merge pull request #7687 from german77/tas_handleMorph2022-01-101-7/+24
|\ \ \ \ | |_|_|/ |/| | |
| * | | input_common: Handle errors on TAS scriptsgerman772022-01-081-7/+24
* | | | Merge pull request #7682 from german77/udp_fixbunnei2022-01-083-17/+30
|\ \ \ \ | |_|/ / |/| | |
| * | | yuzu: Use pad parameter to choose the correct controllergerman772022-01-072-9/+14
| * | | input_common: Fix udp motion not automapping to both sidesgerman772022-01-071-8/+16
| |/ /
* | | Merge pull request #7680 from german77/accel_mappingbunnei2022-01-082-2/+11
|\ \ \ | |/ / |/| |
| * | core/hid: Set minimum gyro thresholdgerman772022-01-071-0/+1
| * | input_common: Use accelerometer data for mappinggerman772022-01-071-2/+10
| |/
* | Merge pull request #7658 from ameerj/sparse-fixesFernando S2022-01-063-61/+44
|\ \
| * | video_core/memory_manager: Fixes for sparse memory managementameerj2021-12-312-14/+12
| * | video_core/memory_manager: Deduplicate Read/WriteBlockameerj2021-12-312-47/+32
* | | Merge pull request #7674 from lat9nq/fix-custom-highlightbunnei2022-01-061-15/+9
|\ \ \ | |_|/ |/| |
| * | configure_per_game: Initialize tabs after loading custom configurationlat9nq2022-01-051-15/+9
* | | Merge pull request #7673 from german77/no_returnMai M2022-01-052-2/+1
|\ \ \ | |/ / |/| |
| * | video_core: Remove unnecesary maybe_unused flagNarr the Reg2022-01-051-1/+1
| * | glsl: Remove unreachable returnNarr the Reg2022-01-051-1/+0
* | | Merge pull request #7636 from vonchenplus/buffer_queue_querybunnei2022-01-044-4/+9
|\ \ \
| * | | Remove invalid assertion statementFeng Chen2021-12-281-3/+0
| * | | Remove invalid header includeFeng Chen2021-12-281-1/+0
| * | | Implement few type in bufferqueue query methodFeng Chen2021-12-282-0/+9
* | | | Merge pull request #7670 from ameerj/vsync-blockFernando S2022-01-044-10/+30
|\ \ \ \ | |_|/ / |/| | |
| * | | gpu: Add shut down method to synchronize threads before destructionameerj2022-01-043-0/+15
| * | | Revert "Merge pull request #7668 from ameerj/fence-stop-token"ameerj2022-01-043-10/+15
* | | | Merge pull request #7251 from FernandoS27/shader-dumpbunnei2022-01-048-1/+98
|\ \ \ \ | |/ / / |/| | |
| * | | ShaderDecompiler: Add a debug option to dump the game's shaders.Fernando Sahmkow2022-01-048-1/+98
* | | | Merge pull request #7668 from ameerj/fence-stop-tokenbunnei2022-01-043-15/+10
|\ \ \ \
| * | | | gpu: Use std::stop_token in WaitFence for VSync threadameerj2022-01-033-15/+10
| |/ / /
* | | | Merge pull request #7664 from german77/fallbackbunnei2022-01-042-4/+36
|\ \ \ \
| * | | | core/hid: Add fallback to fullkey controllersgerman772022-01-022-4/+36
| | |_|/ | |/| |
* | | | Merge pull request #7662 from german77/uistatusbunnei2022-01-031-2/+2
|\ \ \ \
| * | | | yuzu: Fix UI elements not updating correctlygerman772022-01-021-2/+2
| |/ / /
* | | | Merge pull request #7663 from german77/appletbunnei2022-01-032-53/+68
|\ \ \ \ | |_|/ / |/| | |
| * | | controller_applet: Only populate supported controllersgerman772022-01-022-53/+68
| |/ /
* | | Merge pull request #7648 from bunnei/thread-pinningFernando S2022-01-0310-14/+140
|\ \ \
| * | | core: hle: kernel: Implement thread pinning.bunnei2021-12-3110-14/+140
* | | | Merge pull request #7624 from ameerj/intel-msaa-scaleFernando S2022-01-034-20/+35
|\ \ \ \
| * | | | vk_texture_cache: Use 3D scale helpers for MSAA texture scaling on Intel Windows driversameerj2021-12-244-20/+35
* | | | | Merge pull request #7629 from ameerj/nv-driver-fixesFernando S2022-01-0318-30/+140
|\ \ \ \ \
| * | | | | glsl: Add boolean reference workaroundameerj2021-12-306-2/+15
| * | | | | glsl_context_get_set: Add alternative cbuf type for broken driversameerj2021-12-306-24/+35
| * | | | | emit_glsl_integer: Use negation work aroundameerj2021-12-301-2/+2
| * | | | | shader: Add integer attribute get optimization passameerj2021-12-309-0/+86
| * | | | | emit_glsl_floating_point: Fix FPNeg on newer Nvidia driversameerj2021-12-251-2/+2
* | | | | | texture_cache/util: Fix s32 overflow when resolving overlapsameerj2022-01-011-5/+5
| |_|_|/ / |/| | | |
* | | | | Merge pull request #7647 from german77/toadbunnei2021-12-315-17/+23
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | core/hid: Fix controller type validationgerman772021-12-305-17/+23
* | | | | Merge pull request #7635 from bunnei/set-heap-sizebunnei2021-12-306-83/+141
|\ \ \ \ \
| * | | | | core: hle: kernel: Updated implementation of svcSetHeapSize.bunnei2021-12-286-83/+141
* | | | | | Merge pull request #7618 from goldenx86/patch-4bunnei2021-12-291-0/+9
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | Empty spacesMatías Locatti2021-12-281-1/+1
| * | | | | Changes to avoid warnings in SSE4.2 optimized SPIR-VMatías Locatti2021-12-281-0/+9
* | | | | | Merge pull request #7622 from ameerj/vk-rescale-invalid-ptrbunnei2021-12-285-8/+21
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | vk_texture_cache: Fix invalidated pointer accessameerj2021-12-245-8/+21
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7621 from bunnei/set-mem-permbunnei2021-12-284-1/+67
|\ \ \ \ \
| * | | | | core: hle: kernel: Implement SetMemoryPermission.bunnei2021-12-234-1/+67
| | |/ / / | |/| | |
* | | | | Merge pull request #7630 from ameerj/glasm-get-intbunnei2021-12-281-4/+4
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | emit_glasm_context_get_set: Fix GetAttribute return value type.ameerj2021-12-251-4/+4
| | |_|/ | |/| |
* | | | Merge pull request #7620 from bunnei/kernel-thread-x18bunnei2021-12-251-0/+2
|\ \ \ \ | |/ / / |/| | |
| * | | core: hle: kernel: KThread: X18 should be a cryptographically random number.bunnei2021-12-231-0/+2
| |/ /
* | / blit_image: Remove unused functionameerj2021-12-242-50/+0
| |/ |/|
* | Merge pull request #7614 from liushuyu/fix-linux-inhibitbunnei2021-12-233-0/+64
|\ \ | |/ |/|
| * main: reword inhibit reasonliushuyu2021-12-221-2/+3
| * main: fix wake lock in Flatpak ...liushuyu2021-12-223-0/+63
* | Merge pull request #7616 from bunnei/fix-get-idle-ticksFernando S2021-12-221-14/+9
|\ \
| * | hle: kernel: svc: GetInfo: Fix error checking with IdleTickCount.bunnei2021-12-221-14/+9
* | | Merge pull request #7375 from vonchenplus/convert_legacyFernando S2021-12-2212-293/+109
|\ \ \ | |_|/ |/| |
| * | Address format clangvonchenplus2021-12-183-38/+38
| * | Remove spirv handle legacy related codevonchenplus2021-12-184-190/+1
| * | Remove glsl handle legacy related codevonchenplus2021-12-183-103/+1
| * | Merge branch 'yuzu-emu:master' into convert_legacyFeng Chen2021-12-18334-12898/+18256
| |\ \
| * | | Implement convert legacy to genericFeng Chen2021-11-196-1/+108
* | | | Merge pull request #7599 from FernandoS27/primrestart-vulkanbunnei2021-12-223-5/+50
|\ \ \ \
| * | | | Vulkan: Fix the checks for primitive restart extension.Fernando Sahmkow2021-12-183-21/+28
| * | | | Vulkan: implement Logical Operations.Fernando Sahmkow2021-12-182-3/+3
| * | | | Vulkan: Implement VK_EXT_primitive_topology_list_restartFernando Sahmkow2021-12-183-2/+40
* | | | | Merge pull request #7602 from jbeich/freebsd-vaapibunnei2021-12-221-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | video_core/codecs: re-enable VAAPI/VDPAU on BSDs after 72aa418b0b41Jan Beich2021-12-181-1/+1
* | | | | Merge pull request #7604 from ameerj/fullscreen-render-windowbunnei2021-12-221-25/+16
|\ \ \ \ \
| * | | | | main: Refactor to reduce code duplication in ShowFullscreen()ameerj2021-12-191-25/+16
| * | | | | main: Make render window borderless fullscreen toggle on the monitor it resides inameerj2021-12-191-1/+1
| |/ / / /
* | | | | Merge pull request #7608 from Tatsh/scm-ver-overridebunnei2021-12-221-0/+5
|\ \ \ \ \
| * | | | | Allow overriding SCM version infoAndrew Udvare2021-12-211-0/+5
| | |/ / / | |/| | |
* | | | | Merge pull request #7481 from german77/gyro-biasbunnei2021-12-216-20/+32
|\ \ \ \ \
| * | | | | service/hid: Improve console motion accuracyNarr the Reg2021-12-136-20/+32
* | | | | | Merge pull request #7597 from bunnei/remove-global-lockbunnei2021-12-2011-67/+1
|\ \ \ \ \ \
| * | | | | | core: hle: Remove global HLE lock.bunnei2021-12-1811-67/+1
| | |/ / / / | |/| | | |
* | | | | | kernel: Manually destroy the current process during shut downameerj2021-12-191-1/+4
| |_|/ / / |/| | | |
* | | | | Merge pull request #7593 from german77/brrr_testMorph2021-12-185-23/+19
|\ \ \ \ \
| * | | | | core/hid: Cancel any vibration after the testNarr the Reg2021-12-165-23/+19
* | | | | | Merge pull request #7600 from bunnei/fix-kip-loadingMorph2021-12-181-1/+7
|\ \ \ \ \ \
| * | | | | | core: loader: kip: Minimal changes to fix KIP loading.bunnei2021-12-181-1/+7
* | | | | | | Merge pull request #7587 from liushuyu/fix-linux-decodingbunnei2021-12-181-0/+6
|\ \ \ \ \ \ \
| * | | | | | | video_core/codecs: (re-spin) refactor ffmpeg searching and handlingliushuyu2021-12-161-0/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7302 from VPeruS/check-deadlockbunnei2021-12-184-44/+190
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | [input_common] Move variable declaration closer to usagevperus2021-12-171-2/+2
| * | | | | | Revert of b01aa72vperus2021-11-291-35/+39
| * | | | | | [input_common] Add completion test for CalibrationConfigurationJobvperus2021-11-293-9/+151
* | | | | | | Merge pull request #7399 from ameerj/art-refactorFernando S2021-12-188-152/+147
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | vk_texture_cache: Add ABGR src format check for D24S8 conversionsameerj2021-12-051-1/+5
| * | | | | | renderer_opengl: Minor refactoring of filter selectionameerj2021-12-051-30/+20
| * | | | | | texture_cache: Fix image convert dimensions assertionameerj2021-12-051-1/+12
| * | | | | | blit_image: Refactor upscale factors usageameerj2021-12-056-62/+53
| * | | | | | vk_texture_cache: Add a function to ImageView to check if src image is rescaledameerj2021-12-052-4/+22
| * | | | | | blit_image: Refactor ConvertPipeline functionsameerj2021-12-052-29/+15
| * | | | | | blit_image: Refactor ConvertPipelineEx functionsameerj2021-12-052-33/+18
| * | | | | | vk_blit_screen: Minor refactor of filter pipeline selectionameerj2021-12-051-21/+16
| * | | | | | Revert "Merge pull request #7395 from Morph1984/resolve-comments"ameerj2021-12-053-16/+31
* | | | | | | Merge pull request #7570 from ameerj/favorites-expandedbunnei2021-12-183-7/+17
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | game_list: Add persistent setting for the favorites row expanded stateameerj2021-12-123-7/+17
* | | | | | | Merge pull request #7532 from goldenx86/patch-3bunnei2021-12-161-8/+5
|\ \ \ \ \ \ \
| * | | | | | | Suggestions from CrusadingNinjaMatías Locatti2021-12-161-2/+2
| * | | | | | | Changed linkMatías Locatti2021-12-161-1/+1
| * | | | | | | main: Update video core popupMatías Locatti2021-12-071-8/+5
* | | | | | | | Merge pull request #7551 from vonchenplus/fix_blit_image_view_mismatchingbunnei2021-12-161-1/+6
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | Fix blit image/view not compatibleFeng Chen2021-12-101-1/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7588 from Wunkolo/gibibibi-bytesbunnei2021-12-151-4/+6
|\ \ \ \ \ \ \
| * | | | | | | yuzu/main: Fix host memory byte units. GB to GiBWunkolo2021-12-151-4/+6
* | | | | | | | Revert "video_core/codecs: refactor ffmpeg searching and handling in cmake"bunnei2021-12-151-6/+0
|/ / / / / / /
* | | | | | | Merge pull request #7565 from liushuyu/fix-linux-decodingbunnei2021-12-151-0/+6
|\ \ \ \ \ \ \
| * | | | | | | CI: fix CI on Linuxliushuyu2021-12-141-3/+0
| * | | | | | | video_core/codecs: skip decoders that use hw frames ...liushuyu2021-12-141-0/+9
* | | | | | | | Merge pull request #7558 from Morph1984/unused-cpu-family-modelMai M2021-12-151-12/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | common/cpu_detect: Remove CPU family and modelMorph2021-12-141-12/+0
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #7549 from Morph1984/astc-8x5Mai M2021-12-151-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | maxwell_to_vk: Add ASTC_2D_5X4_UNORMMorph2021-12-111-1/+1
| * | | | | | | | maxwell_to_vk: Add ASTC_2D_8X5_UNORMMorph2021-12-091-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #7579 from Morph1984/swkbd-oob-array-accessMai M2021-12-151-4/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | qt_software_keyboard: Fix out of bounds array accessMorph2021-12-141-4/+19
* | | | | | | | | core/hid: Fix faulty analog triggersNarr the Reg2021-12-151-2/+2
* | | | | | | | | Merge pull request #7581 from lioncash/input-ifaceNarr the Reg2021-12-1510-155/+192
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/input: Avoid numerous large copies of CallbackStatusLioncash2021-12-149-129/+171
| * | | | | | | | | common/input: Remove unnecessary returnsLioncash2021-12-141-6/+2
| * | | | | | | | | input_poller: Add missing override specifiersLioncash2021-12-141-20/+19
* | | | | | | | | | Merge pull request #7577 from v1993/patch-2Narr the Reg2021-12-141-3/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | input/SDL: Update SDL hintsValeri2021-12-141-3/+4
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | input_mapping: Amend specification of parametersLioncash2021-12-141-14/+14
* | | | | | | | | | input_poller: Remove several unnecessary @param tagsLioncash2021-12-141-106/+106
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #7575 from lioncash/inputbunnei2021-12-1418-114/+109
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | input_engine: Fix typo in TriggerOnAxisChange() parameter nameLioncash2021-12-131-1/+1
| * | | | | | | | input_engine: Simplify PreSet* family of functionsLioncash2021-12-132-24/+14
| * | | | | | | | input_engine: Avoid redundant map lookupsLioncash2021-12-131-16/+24
| * | | | | | | | input_engine: Remove left-over namespace qualifiersLioncash2021-12-131-3/+3
| * | | | | | | | input_engine: Iterate by reference rather than by value where applicableLioncash2021-12-131-10/+10
| * | | | | | | | input_engine: Take BasicMotion by const reference with SetMotion() and TriggerOnMotionChange()Lioncash2021-12-133-6/+7
| * | | | | | | | input_engine: std::move InputIdentifier in SetCallback()Lioncash2021-12-131-1/+1
| * | | | | | | | input_engine: Pass LedStatus by const referenceLioncash2021-12-133-3/+3
| * | | | | | | | input_engine: Pass VibrationStatus by const reference in SetRumble()Lioncash2021-12-137-12/+12
| * | | | | | | | input_engine: std::move engine name where applicableLioncash2021-12-1315-29/+29
| * | | | | | | | input_engine: Remove callback clearing in constructorLioncash2021-12-131-3/+1
| * | | | | | | | input_engine: Remove unnecessary semi-colonsLioncash2021-12-131-6/+6
| * | | | | | | | input_engine: Remove unnecessary returnLioncash2021-12-131-3/+1
| |/ / / / / / /
* | | | | | | | tas_input: Avoid minor copies in Read/WriteCommandButtons()Lioncash2021-12-131-2/+2
* | | | | | | | tas_input: Remove unnecessary semicolonLioncash2021-12-131-1/+1
* | | | | | | | tas_input: Execute clear() even if emptyLioncash2021-12-131-3/+2
* | | | | | | | tas_input: Remove unnecessary includesLioncash2021-12-131-2/+2
* | | | | | | | tas_input: std::move strings into vectorLioncash2021-12-131-21/+24
* | | | | | | | tas_input: Use istringstream over stringstreamLioncash2021-12-131-2/+2
* | | | | | | | tas_input: Use u8string_view instead of u8stringLioncash2021-12-132-6/+7
* | | | | | | | tas_input: Remove unused std::smatch variableLioncash2021-12-131-2/+0
* | | | | | | | tas_input: Amend -Wdocumentation warningsLioncash2021-12-132-28/+30
* | | | | | | | tas_input: Make TasAxes enum an enum classLioncash2021-12-132-5/+14
|/ / / / / / /
* | | | | | | Remove erroneous #pragma onceValeri2021-12-131-2/+0
* | | | | | | Merge pull request #7462 from bunnei/kernel-improve-schedulingbunnei2021-12-1332-634/+895
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | hle: kernel k_scheduler: EnableScheduling: Remove redundant GetCurrentThreadPointer calls.bunnei2021-12-071-3/+5
| * | | | | | hle: kernel k_process: Remove unnecessary .at usage with thread pinning methods.bunnei2021-12-071-3/+3
| * | | | | | hle: kernel: Remove unnecessary virtual specifier on NotifyAvailable.bunnei2021-12-071-2/+2
| * | | | | | hle: kernel: Remove unnecessary virtual specifier on EndWait.bunnei2021-12-071-1/+1
| * | | | | | hle: kernel: k_light_condition_variable: Revert unnecessary license comment changes.bunnei2021-12-071-1/+1
| * | | | | | hle: kernel: k_condition_variable: Revert unnecessary style changes.bunnei2021-12-071-2/+2
| * | | | | | hle: kernel: Remove unnecessary virtual specifier on CancelWait.bunnei2021-12-076-14/+14
| * | | | | | hle: kernel: service_thread: Force stop threads on destruction.bunnei2021-12-071-1/+7
| * | | | | | hle: kernel: k_light_lock: Implement CancelWait.bunnei2021-12-071-5/+10
| * | | | | | hle: kernel: service_thread: Use std::jthread.bunnei2021-12-071-18/+19
| * | | | | | hle: kernel: k_thread: Skip reschedule on DisableDispatch with SC.bunnei2021-12-071-0/+5
| * | | | | | hle: kernel: k_thread: Rename sleeping_queue -> wait_queue.bunnei2021-12-072-17/+13
| * | | | | | hle: kernel: svc: Fix deadlock that can occur with single core.bunnei2021-12-071-10/+8
| * | | | | | hle: kernel: k_thread: Treat dummy threads as a special type.bunnei2021-12-072-1/+4
| * | | | | | hle: kernel: fix timing on thread preemptionFernandoS272021-12-071-4/+2
| * | | | | | hle: kernel: fix scheduling ops from HLE host thread.FernandoS272021-12-071-3/+3
| * | | | | | hle: kernel: Add a flag for indicating that the kernel is currently shutting down.bunnei2021-12-076-0/+49
| * | | | | | hle: kernel: KSynchronizationObject: Fix variable shadowing.bunnei2021-12-071-8/+8
| * | | | | | hle: kernel: Cleanup to match coding style.bunnei2021-12-076-26/+21
| * | | | | | hle: kernel: KProcess: Improvements for thread pinning.bunnei2021-12-072-8/+26
| * | | | | | hle: kernel: KThreadQueue: Remove deprecated code.bunnei2021-12-071-63/+0
| * | | | | | hle: kernel: KConditionVariable: Various updates & simplifications.bunnei2021-12-072-121/+65
| * | | | | | hle: kernel: KThread: Migrate to updated KThreadQueue (part 2).bunnei2021-12-071-29/+19
| * | | | | | hle: kernel: KThread: Migrate to updated KThreadQueue (part 1).bunnei2021-12-073-60/+71
| * | | | | | hle: kernel: KConditionVariable: Migrate to updated KThreadQueue.bunnei2021-12-071-12/+55
| * | | | | | hle: kernel: KServerSession: Migrate to updated KThreadQueue.bunnei2021-12-072-5/+11
| * | | | | | hle: kernel: KLightConditionVariable: Migrate to updated KThreadQueue.bunnei2021-12-073-54/+87
| * | | | | | hle: kernel: KLightLock: Migrate to updated KThreadQueue.bunnei2021-12-072-35/+36
| * | | | | | hle: kernel: KAddressArbiter: Migrate to updated KThreadQueue.bunnei2021-12-071-43/+39
| * | | | | | hle: kernel: KThread: Remove tracking of sync object from threads.bunnei2021-12-076-41/+21
| * | | | | | hle: kernel: Update KThreadQueue and migrate KSynchronizationObject.bunnei2021-12-078-75/+251
| * | | | | | core: hle: kernel: Disable dispatch count tracking on single core.bunnei2021-12-073-5/+14
| * | | | | | core: hle: kernel: k_thread: Mark KScopedDisableDispatch as nodiscard.bunnei2021-12-071-1/+1
| * | | | | | core: cpu_manager: Use invalid core_id on init and simplify shutdown.bunnei2021-12-071-7/+3
| * | | | | | core: hle: kernel: k_auto_object: Add GetName method.bunnei2021-12-071-0/+4
| * | | | | | core: hle: kernel: DisableDispatch on suspend threads.bunnei2021-12-071-0/+3
| * | | | | | core: hle: kernel: k_scheduler: Improve DisableScheduling and EnableScheduling.bunnei2021-12-071-14/+9
| * | | | | | core: cpu_manager: Use KScopedDisableDispatch.bunnei2021-12-071-7/+8
| * | | | | | core: hle: kernel: Use CurrentPhysicalCoreIndex as appropriate.bunnei2021-12-071-6/+2
| * | | | | | core: hle: kernel: k_scheduler: Remove unnecessary MakeCurrentProcess.bunnei2021-12-071-5/+0
| * | | | | | core: hle: kernel: k_scheduler: Improve ScheduleImpl.bunnei2021-12-071-6/+7
| * | | | | | core: hle: kernel: k_scheduler: Improve Unload.bunnei2021-12-071-17/+29
| * | | | | | core: hle: kernel: k_process: DisableDispatch on main thread.bunnei2021-12-071-0/+1
| * | | | | | core: hle: kernel: k_handle_table: Use KScopedDisableDispatch as necessary.bunnei2021-12-072-0/+8
| * | | | | | core: hle: kernel: k_thread: Add KScopedDisableDispatch.bunnei2021-12-072-1/+47
| * | | | | | core: hle: kernel: Ensure idle threads are closed before destroying scheduler.bunnei2021-12-073-24/+22
| * | | | | | core: hle: kernel: Reflect non-emulated threads as core 3.bunnei2021-12-077-14/+17
| |/ / / / /
* | | | | | Merge pull request #7495 from FernandoS27/text-blit-fix-againMorph2021-12-091-3/+6
|\ \ \ \ \ \
| * | | | | | Texture Cache: Fix crashes on NVIDIA.Fernando Sahmkow2021-12-041-3/+6
* | | | | | | Merge pull request #7519 from itsmeft24/masterbunnei2021-12-0912-6/+611
|\ \ \ \ \ \ \
| * | | | | | | Update k_code_memory.hitsmeft242021-12-071-6/+6
| * | | | | | | make KCodeMemory::GetSourceAddress constitsmeft242021-12-071-1/+1
| * | | | | | | fix formattingitsmeft242021-12-061-1/+6
| * | | | | | | move private members below public membersitsmeft242021-12-061-10/+11
| * | | | | | | fix formattingitsmeft242021-12-061-4/+1
| * | | | | | | fix formattingitsmeft242021-12-061-1/+1
| * | | | | | | fix formattingitsmeft242021-12-062-2/+2
| * | | | | | | Remove unnecessary includesitsmeft242021-12-062-50/+13
| * | | | | | | Add copyright noticeitsmeft242021-12-052-0/+8
| * | | | | | | Add KCodeMemory to CMakeLists.txtitsmeft242021-12-051-0/+2
| * | | | | | | kernel: svc: Implement Map/UnmapProcessMemory and Create/ControlCodeMemoryitsmeft242021-12-0511-7/+636
* | | | | | | | profiler: Use QWheelEvent position().toPoint()Morph2021-12-081-1/+1
* | | | | | | | renderer_vulkan: Add R16G16_UINTMorph2021-12-082-1/+2
* | | | | | | | Merge pull request #7525 from german77/notifabunnei2021-12-086-0/+77
|\ \ \ \ \ \ \ \
| * | | | | | | | service/notif: Add notif:a and stub ListAlarmSettings,Initializegerman772021-12-066-0/+77
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #7521 from german77/dual_single_joyconsbunnei2021-12-085-38/+174
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | service/hid: Implement SetNpadJoyAssignmentModegerman772021-12-055-38/+174
| |/ / / / / /
* | | | | | | Merge pull request #7488 from vonchenplus/support_multiple_videos_playingbunnei2021-12-088-40/+45
|\ \ \ \ \ \ \
| * | | | | | | Address feedbackFeng Chen2021-12-045-17/+27
| * | | | | | | Support multiple videos playingFeng Chen2021-12-026-41/+36
* | | | | | | | Merge pull request #7506 from heinermann/focus_crashMai M2021-12-081-8/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | Fixed #7502Adam Heinermann2021-12-051-8/+9
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #7522 from ameerj/shader-recompiler-filenamesMai M2021-12-0865-214/+282
|\ \ \ \ \ \ \ \
| * | | | | | | | emit_spirv: Reduce emit_spirv.h include overheadameerj2021-12-0620-3/+20
| * | | | | | | | glasm: Move implemented instructions from not_implemented.cppameerj2021-12-067-169/+220
| * | | | | | | | shader_recompiler: Adjust emit_context includesameerj2021-12-0637-37/+37
| * | | | | | | | shader_recompiler: Rename backend emit_context filesameerj2021-12-057-6/+6
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | CMakeLists: Specify /Zm200 when compiling in MSVCMorph2021-12-071-0/+2
| |_|_|_|/ / / |/| | | | | |
* | | | | | | Merge pull request #7524 from german77/hid_stubbunnei2021-12-062-2/+35
|\ \ \ \ \ \ \
| * | | | | | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignmentgerman772021-12-062-2/+35
| |/ / / / / /
* | | | | | | loader: Support loading subsdk{8,9}jam1garner2021-12-061-2/+3
* | | | | | | general: Add missing copyright noticesameerj2021-12-055-0/+20
|/ / / / / /
* | | / / / core/hid: Add missing controller typegerman772021-12-051-0/+2
| |_|/ / / |/| | | |
* | | | | Merge pull request #7494 from Morph1984/no-time-to-waitFernando S2021-12-051-18/+18
|\ \ \ \ \
| * | | | | native_clock: Wait for less time in EstimateRDTSCFrequencyMorph2021-12-041-18/+18
* | | | | | core/hid: Ensure only valid npad are connectedgerman772021-12-058-88/+147
| |/ / / / |/| | | |
* | | | | Merge pull request #7467 from liushuyu/fix-linux-decodingbunnei2021-12-042-66/+50
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | video_core/cmake: link against libva explicitly ...liushuyu2021-12-031-0/+1
| * | | | video_core/codecs: more fixes for VAAPI detection ...liushuyu2021-12-031-63/+25
| * | | | video_core/codec: address commentsliushuyu2021-12-031-8/+12
| * | | | video_core/codecs: more robust ffmpeg hwdecoder selection logicliushuyu2021-12-031-10/+27
* | | | | Merge pull request #7489 from Morph1984/steady-clockbunnei2021-12-047-13/+13
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | general: Replace high_resolution_clock with steady_clockMorph2021-12-027-13/+13
| |/ / /
* | | | Merge pull request #7490 from Morph1984/stub-album-save-screenshotbunnei2021-12-033-2/+15
|\ \ \ \
| * | | | service: am: ISelfController: Stub SaveCurrentScreenshotMorph2021-12-033-2/+15
| |/ / /
* | | | Merge pull request #7452 from german77/controller_navigationMorph2021-12-039-8/+285
|\ \ \ \ | |/ / / |/| | |
| * | | yuzu: Implement basic controller navigationgerman772021-12-029-8/+285
* | | | service: friend: Implement GetCompletionEventMorph2021-11-301-2/+21
|/ / /
* | | Merge pull request #7472 from Morph1984/post-kraken-cleanupNarr the Reg2021-11-3014-112/+149
|\ \ \
| * | | input_interpreter: Make use of NpadButton instead of a u64Morph2021-11-302-9/+9
| * | | npad: Return NpadButton in GetAndResetPressStateMorph2021-11-303-7/+6
| * | | core: hid: hid_types: Add "All" to NpadButtonMorph2021-11-301-0/+2
| * | | qt_controller: Make use of (Enable/Disable)AllControllerConfigurationMorph2021-11-301-8/+5
| * | | core: hid: hid_core: Add (Enable/DIsable)AllControllerConfigurationMorph2021-11-292-0/+32
| * | | general: Fix handheld typoMorph2021-11-292-17/+17
| * | | core: hid: Mark constructors as explicitMorph2021-11-292-2/+2
| * | | core: hid: Cleanup and amend documentationMorph2021-11-294-69/+76
* | | | input_common: Fix error with thread nameNarr the Reg2021-11-301-2/+1
* | | | Merge pull request #7466 from vonchenplus/add_miss_pixel_format_mappingbunnei2021-11-301-0/+2
|\ \ \ \ | |/ / / |/| | |
| * | | Add missing pixel format mappingFeng Chen2021-11-291-0/+2
| |/ /
* / / qt_controller: Fix input when the controller applet is ignoredgerman772021-11-291-0/+3
|/ /
* | Merge pull request #7396 from FernandoS27/blit-this-mfFernando S2021-11-2814-223/+168
|\ \
| * | Texture Cache: Secure insertions against deletions.Fernando Sahmkow2021-11-281-3/+13
| * | Texture Cache: Redesigning the blitting system (again).Fernando Sahmkow2021-11-273-23/+64
| * | Texture Cache: Further fix regressions.Fernando Sahmkow2021-11-261-11/+15
| * | Texture Cache: Fix issue with blitting 3D textures.Fernando Sahmkow2021-11-221-2/+4
| * | Texture Cache: Correct conversion shaders.Fernando Sahmkow2021-11-222-2/+2
| * | Texture Cache: Always copy on NVIDIA.Fernando Sahmkow2021-11-221-0/+5
| * | TextureCache: Simplify blitting of D24S8 formats and fix bugs.Fernando Sahmkow2021-11-2210-195/+73
| * | VulkanTexturECache: Use reinterpret on D32_S8 formats.Fernando Sahmkow2021-11-211-2/+7
| * | HostShaders: Fix D24S8 convertion shaders.Fernando Sahmkow2021-11-216-23/+47
| * | TextureCache: Eliminate format deduction as full depth conversion has been supported.Fernando Sahmkow2021-11-212-29/+5
* | | Merge pull request #7438 from german77/homebrew2bunnei2021-11-286-2/+146
|\ \ \
| * | | core/ns: Implement GetReadOnlyApplicationControlDataInterfaceNarr the Reg2021-11-282-1/+26
| * | | core/pdm: Stub QueryPlayStatisticsByApplicationIdAndUserAccountIdNarr the Reg2021-11-284-0/+107
| * | | core/hid: Stub GetUniquePadsFromNpadNarr the Reg2021-11-271-1/+13
* | | | settings: Add debug setting to enable all controllersgerman772021-11-288-0/+75
|/ / /
* | | Merge pull request #7255 from german77/krakenFernando S2021-11-27146-11257/+13922
|\ \ \
| * | | config: Remove vibration configurationgerman772021-11-277-104/+3
| * | | applet/controller: Enable configuring mode while the applet is opengerman772021-11-271-7/+12
| * | | input_common: Fully implement UDP controllersNarr the Reg2021-11-2612-40/+397
| * | | service/hid: Finish converting LIFO objects and address some nitsNarr the Reg2021-11-2514-95/+50
| * | | yuzu: Fix TAS from rebasegerman772021-11-253-9/+11
| * | | input_common: Move button names to the frontendgerman772021-11-2512-52/+160
| * | | input_common: Fix SDL controller with inverted axisgerman772021-11-252-24/+8
| * | | bootmanager: Use cross-platform keyboard inputgerman772021-11-253-39/+58
| * | | kraken: Address comments from reviewgerman772021-11-2517-66/+54
| * | | core/hid: Improve accuary of mouse implementationgerman772021-11-2514-48/+79
| * | | core/hid: Fully implement native mousegerman772021-11-2521-1039/+323
| * | | input_common: Allow keyboard to be backwards compatiblegerman772021-11-2510-48/+115
| * | | core/hid: Improve accuracy of the keyboard implementationgerman772021-11-2513-313/+682
| * | | core/hid: Fix keyboard alignmentgerman772021-11-252-12/+14
| * | | core/hid: Remove usage of native types, fix a couple of errors with motiongerman772021-11-2511-428/+632
| * | | settings: Remove includes of core.hgerman772021-11-2510-57/+55
| * | | service/hid: Remove includes of core.h and settings.hgerman772021-11-2529-67/+67
| * | | UI nitsLevi Behunin2021-11-251-9/+6
| * | | service/hid: Add support for new controllersgerman772021-11-252-2/+31
| * | | settings: Fix controller preview not displaying the correct controllergerman772021-11-253-4/+7
| * | | core/hid: Rename NpadType to NpadStyleIndexgerman772021-11-2515-215/+228
| * | | config: Cleanup and documentationgerman772021-11-258-99/+46
| * | | input_common: Fix motion from 3 axisgerman772021-11-251-0/+2
| * | | core/hid: Prevent Emulated controller from flapping with multiple inputs devicesgerman772021-11-255-36/+77
| * | | core/hid: Fully emulate motion from buttongerman772021-11-257-37/+97
| * | | second commit lion reviewgerman772021-11-2528-42/+73
| * | | settings: Fix Debug controller type optionsgerman772021-11-2513-95/+77
| * | | kraken: Address comments from reviewgerman772021-11-2531-466/+534
| * | | input_common: Revert deleted TAS functionsgerman772021-11-257-48/+122
| * | | core/hid: Explain better what a temporary value doesgerman772021-11-252-24/+28
| * | | input_common: Fix GC adapter initializationgerman772021-11-251-12/+12
| * | | core/hid: Update structs to 13.1.0german772021-11-2512-50/+107
| * | | core/hid: Add TAS inputgerman772021-11-256-13/+82
| * | | input_common: Fix UDP uuidgerman772021-11-253-2/+16
| * | | input_common: Add multiple vibration curvesgerman772021-11-252-15/+28
| * | | core/hid: Rework battery mappingsgerman772021-11-259-46/+109
| * | | input_common: Add manual update options to input devicesgerman772021-11-255-0/+56
| * | | service/hid: Fix memory allocated incorrectlygerman772021-11-255-7/+7
| * | | settings: Fix mouse and keyboard mappingsgerman772021-11-2510-105/+102
| * | | web_applet: Replace HIDButton with NpadButtongerman772021-11-253-36/+44
| * | | Morph review first wavegerman772021-11-2523-136/+117
| * | | service/hid: Match shared memory closer to HWgerman772021-11-252-26/+75
| * | | yuzu: Fix loading input profilesgerman772021-11-252-0/+9
| * | | kraken: Address comments from reviewgerman772021-11-2515-56/+56
| * | | service/hid: Use ring buffer for gesturesgerman772021-11-252-79/+52
| * | | service/hid: Fix gesture inputgerman772021-11-258-91/+159
| * | | configuration: Migrate controller settings to emulated controllergerman772021-11-2512-127/+141
| * | | core/hid: Fix rumble too strong at 1%german772021-11-253-13/+48
| * | | core/hid: Only signal when neededgerman772021-11-2511-153/+240
| * | | hid: Fix controller connection/disconnectiongerman772021-11-2510-65/+226
| * | | core/hid: Documment some filesgerman772021-11-254-52/+265
| * | | kraken: Fix errors from rebase and format filesgerman772021-11-2520-53/+83
| * | | core/hid: Add output devicesgerman772021-11-2520-144/+312
| * | | core: Update input interpretergerman772021-11-254-54/+18
| * | | yuzu: Update overlay appletgerman772021-11-252-16/+21
| * | | core/frontend: Update appletsgerman772021-11-252-10/+15
| * | | core: Remove frontend/inputgerman772021-11-251-217/+0
| * | | service/hid: Rewrite npad to use ring lifo and the emulated controllergerman772021-11-252-890/+605
| * | | service/hid: Update console sixaxis to the emulated consolegerman772021-11-252-28/+26
| * | | service/hid: Update mouse and keyboard to use ring lifo and the emulated devicegerman772021-11-254-158/+71
| * | | service/hid: Update touch and gestures to use ring lifo and the emulated consolegerman772021-11-254-370/+191
| * | | service/hid: Update debug pad, xpad, stubbed and controller base to use ring lifo and the emulated controllergerman772021-11-257-166/+80
| * | | service/hid: Use remove duplicated code, update namesgerman772021-11-252-64/+30
| * | | service/hid: Create ring LIFOgerman772021-11-252-1/+55
| * | | Qt_applets: Use new inputgerman772021-11-255-49/+68
| * | | settings: Cleanup settingsgerman772021-11-256-9/+16
| * | | debugger/controller: Remove TASgerman772021-11-252-46/+5
| * | | core/emu_window: Remove touch inputgerman772021-11-252-113/+15
| * | | yuzu: Update frontendgerman772021-11-2513-1010/+822
| * | | core: Register HIDgerman772021-11-253-4/+25
| * | | core/hid: Add emulated controllersgerman772021-11-259-0/+2025
| * | | yuzu_cmd: Use new inputgerman772021-11-253-45/+39
| * | | yuzu: Use new input on main and bootmanagergerman772021-11-253-68/+59
| * | | input_common: Rewrite main and add the new driversgerman772021-11-252-49/+330
| * | | input_common: Remove obsolete filesgerman772021-11-255-444/+0
| * | | input_common: Rewrite SDLgerman772021-11-256-1757/+950
| * | | input_common: Rewrite udp clientgerman772021-11-255-441/+54
| * | | input_common: Rewrite tas inputgerman772021-11-255-840/+2
| * | | input_common: Rewrite gc_adaptergerman772021-11-258-827/+848
| * | | input_common: Rewrite touchgerman772021-11-253-0/+99
| * | | input_common: Rewrite mousegerman772021-11-257-751/+217
| * | | input_common: Rewrite keyboardgerman772021-11-2511-614/+95
| * | | input_common: Move touch and analog from button. Move udp protocolgerman772021-11-2510-132/+172
| * | | input_common: Create input poller and mappinggerman772021-11-256-0/+1305
| * | | input_common: Create input_enginegerman772021-11-252-0/+585
| * | | core/hid: Move motion_input, create input converter and hid_typesgerman772021-11-256-0/+1164
| * | | core/hid: Move input_interpreter to hidgerman772021-11-254-4/+4
| * | | common: Rewrite and move core/frontend/input.h to commongerman772021-11-252-0/+243
* | | | Merge pull request #7431 from liushuyu/fix-linux-decodingbunnei2021-11-271-2/+41
|\ \ \ \
| * | | | video_core/codec: address commentsliushuyu2021-11-251-17/+11
| * | | | video_core/codecs: fix multiple decoding issues on Linux ...liushuyu2021-11-251-2/+47
* | | | | Merge pull request #7330 from MightyCreak/simplify-theme-selectionbunnei2021-11-252-25/+27
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Replace "Light" theme by "Default"Romain Failliot2021-11-142-25/+27
* | | | | Refactor menu states and shortcuts in GMainWindow. (#7419)Adam Heinermann2021-11-253-237/+175
| |/ / / |/| | |
* | | | Merge pull request #7404 from Kewlan/per-game-framerate-capbunnei2021-11-245-27/+99
|\ \ \ \
| * | | | configure_general: Allow framerate cap to be used in custom game configsKewlan2021-11-215-27/+99
* | | | | Merge pull request #7394 from Morph1984/svc-SetMemoryPermissionbunnei2021-11-225-12/+64
|\ \ \ \ \
| * | | | | kernel: svc: Move all IsValid functions to an anonymous namespaceMorph2021-11-211-3/+15
| * | | | | kernel: svc: Implement SetProcessMemoryPermissionMorph2021-11-211-1/+41
| * | | | | kernel: KPageTable: Rename SetCodeMemoryPermission to SetProcessMemoryPermissionMorph2021-11-214-8/+8
| | |_|/ / | |/| | |
* | | | | Merge pull request #7406 from heinermann/tas_menuMai M2021-11-225-57/+152
|\ \ \ \ \
| * | | | | const fixesAdam Heinermann2021-11-222-3/+3
| * | | | | Apply clang formatAdam Heinermann2021-11-221-1/+0
| * | | | | Added TAS controls to the menu under ToolsAdam Heinermann2021-11-225-57/+153
| | |/ / / | |/| | |
* | | | | arm: dynarmic: Cleanup icache op handlingjam1garner2021-11-221-10/+9
* | | | | arm: dynarmic: Implement icache op handling for 'ic iallu' instructionjam1garner2021-11-221-0/+3
* | | | | arm: dynarmic: Implement icache op handling for 'ic ivau' instructionjam1garner2021-11-221-0/+18
|/ / / /
* | | | Merge pull request #7395 from Morph1984/resolve-commentsbunnei2021-11-213-31/+16
|\ \ \ \
| * | | | vk_texture_cache: Mark VkBufferUsageFlags as static constexprMorph2021-11-211-3/+3
| * | | | vk_blit_image: Consolidate CreatePipelineTargetEx functionsMorph2021-11-212-28/+13
| |/ / /
* | | | Merge pull request #7389 from ameerj/screenshot-1xbunnei2021-11-215-20/+8
|\ \ \ \
| * | | | Fix screenshot dimensions when at 1x scaleameerj2021-11-205-20/+8
* | | | | Merge pull request #7359 from heinermann/kthread_crashbunnei2021-11-211-8/+14
|\ \ \ \ \
| * | | | | Fix crash on exit due to static scoped dummy threadsAdam Heinermann2021-11-181-8/+14
* | | | | | Merge pull request #7393 from Morph1984/pm-ams-get-pidbunnei2021-11-211-9/+38
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | service: pm: Implement AtmosphereGetProcessIdMorph2021-11-211-0/+24
| * | | | | service: pm: Add all relevant result codesMorph2021-11-211-3/+8
| * | | | | service: pm: Rename title id to program idMorph2021-11-211-6/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #7368 from FernandoS27/vulkan-convbunnei2021-11-2118-23/+595
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | TextureCache: Refactor and fix linux compiling.Fernando Sahmkow2021-11-203-9/+11
| * | | | TextureCache: Assure full conversions on depth/stencil write shaders.Fernando Sahmkow2021-11-203-6/+6
| * | | | TextureCache: Implement buffer copies on Vulkan.Fernando Sahmkow2021-11-206-9/+193
| * | | | TextureCache: Add R16G16 to D24S8 converter.Fernando Sahmkow2021-11-205-0/+38
| * | | | TextureCache: Add B10G11R11 to D24S8 converter.Fernando Sahmkow2021-11-195-13/+84
| * | | | TextureCache: Further fixes on resolve algorithm.Fernando Sahmkow2021-11-192-16/+17
| * | | | TextureCache: Implement additional D24S8 convertions.Fernando Sahmkow2021-11-196-0/+86
| * | | | TextureCache: force same image format when resolving an image.Fernando Sahmkow2021-11-192-2/+9
| * | | | TextureCache: Fix regression caused by ART and improve blit detection algorithm to be smarter.Fernando Sahmkow2021-11-192-10/+27
| * | | | Vulkan: implement D24S8 <-> RGBA8 convertions.Fernando Sahmkow2021-11-196-0/+166
| | |_|/ | |/| |
* | | | Merge pull request #7294 from vonchenplus/fix_image_update_error_when_width_too_smallbunnei2021-11-202-10/+18
|\ \ \ \
| * | | | Fix image update/download error when width too smallFeng Chen2021-11-172-10/+18
| | |/ / | |/| |
* | | | Merge pull request #7369 from Morph1984/amd-fsr-statusbarbunnei2021-11-192-6/+6
|\ \ \ \
| * | | | main: Fix default AA nameMorph2021-11-191-4/+4
| * | | | configure_graphics_ui: AMD's -> AMDMorph2021-11-191-1/+1
| * | | | main: Shorten AMD FSR status bar textMorph2021-11-191-1/+1
| | |/ / | |/| |
* | | | Merge pull request #7342 from goldenx86/patch-3bunnei2021-11-191-2/+2
|\ \ \ \
| * | | | Replace keys error pop upMatías Locatti2021-11-161-2/+2
* | | | | Merge pull request #7357 from Morph1984/s8_uintbunnei2021-11-1910-9/+64
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | renderer_vulkan: Implement S8_UINT stencil formatMorph2021-11-183-0/+18
| * | | | renderer_opengl: Implement S8_UINT stencil formatMorph2021-11-173-6/+25
| * | | | video_core: Add S8_UINT stencil formatMorph2021-11-174-3/+21
| | |/ / | |/| |
* | | | Merge pull request #7349 from ameerj/ogl-convert-imagebunnei2021-11-185-28/+49
|\ \ \ \
| * | | | gl_texture_cache: Round format conversion PBO to next power of 2ameerj2021-11-181-1/+5
| * | | | texture_cache: Use pixel format conversion when supported by the runtimeameerj2021-11-175-0/+15
| * | | | gl_texture_cache: Make FormatConversionPass more genericameerj2021-11-171-7/+12
| * | | | gl_texture_cache: Rename BGRCopyPass to FormatConversionPassameerj2021-11-172-21/+18
| |/ / /
* | | | Merge pull request #7353 from v1993/no-more-epilepsybunnei2021-11-181-1/+1
|\ \ \ \
| * | | | Prevent window flickering when holding EscValeri2021-11-171-1/+1
| | |/ / | |/| |
* | | | Merge pull request #7355 from german77/hotkey_spambunnei2021-11-181-0/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | hotkeys: Don't allow hotkeys to spamgerman772021-11-171-0/+2
* | | | TextureCache: Fix Automatic Anisotropic.Fernando Sahmkow2021-11-171-6/+5
* | | | TextureCache: OGL query device memory if possible.FernandoS272021-11-172-2/+14
* | | | TextureCache: Fix OGL cleaningFernando Sahmkow2021-11-175-0/+43
* | | | TextureCache: Add automatic anisotropic filtering and refactor code.Fernando Sahmkow2021-11-165-16/+22
* | | | TextureCache: Make a better Anisotropic setter.Fernando Sahmkow2021-11-164-24/+21
* | | | Texture Cache: revert Image changes.Fernando Sahmkow2021-11-161-0/+4
* | | | ShaderCache: Better fix for Shuffling gl_FragCoordFernando Sahmkow2021-11-161-2/+13
* | | | HostShader: fix Gaussian filter.FernandoS272021-11-161-2/+2
* | | | Texture Cahe/Shader decompiler: Resize PointSize on rescaling, refactor and make reaper more agressive on 4Gb GPUs.FernandoS272021-11-165-22/+29
* | | | texture_cache: Refactor Render Target scaling functionameerj2021-11-162-14/+24
* | | | gl_resource_manager: Ensure non EXT_framebuffer objects are createdameerj2021-11-162-13/+8
* | | | Texture Cache: Fix memory usage on ScaleDown.FernandoS272021-11-161-4/+0
* | | | OpenGL: Fix viewport/Scissor scaling on downscaling.FernandoS272021-11-161-6/+28
* | | | Vulkan: fix regression.FernandoS272021-11-161-14/+17
* | | | host_shaders: Misc copyright/style changesameerj2021-11-164-10/+12
* | | | configure_graphics.ui: Cleanup scaling options and fix duplicate name warningameerj2021-11-161-5/+5
* | | | FSR: Fix GCC build errorsameerj2021-11-163-43/+50
* | | | Vulkan: Reimplement FSR constant generation functions to avoid GCC warningsMarshall Mohror2021-11-162-9/+145
* | | | vk_blit_screen: Fix AA destruction orderameerj2021-11-161-9/+10
* | | | Presentation: Only use FP16 in scaling shaders on supported devices in VulkanMarshall Mohror2021-11-1614-116/+197
* | | | renderer_vulkan/blit_image: Use generic color state on Depth to Color blitsameerj2021-11-161-1/+1
* | | | vk_texture_cache: Refactor 3D scaling helpersameerj2021-11-162-113/+74
* | | | gl_rasterizer: Fix ScissorTest and Clear when scalingameerj2021-11-161-10/+6
* | | | gl_texture_cache: Simplify scaling proceduresameerj2021-11-162-57/+28
* | | | OpenGlTextureCache: Fix state invalidation on rescaling.Fernando Sahmkow2021-11-163-2/+17
* | | | VulkanBufferCache: Avoid adding barriers between multiple copies.Fernando Sahmkow2021-11-163-5/+43
* | | | HostShader: Fix gaussian and add attribution.Fernando Sahmkow2021-11-161-23/+19
* | | | Yuzu UI: Add button for Anti AliasFernando Sahmkow2021-11-163-0/+45
* | | | Vulkan: Fix FXAA in AMD.Fernando Sahmkow2021-11-161-2/+40
* | | | Texture Cache: Fix blitting.Fernando Sahmkow2021-11-161-2/+2
* | | | Vulkan: Implement FXAAFernandoS272021-11-163-22/+387
* | | | OpenGL: fix FXAA with scalingMarshall Mohror2021-11-162-9/+31
* | | | OpenGL: Implement FXAAMarshall Mohror2021-11-166-35/+194
* | | | Frontend: Add anti-aliasing method settingMarshall Mohror2021-11-165-0/+70
* | | | Settings: Add anti-aliasing method settingMarshall Mohror2021-11-162-0/+7
* | | | QtGUI: Add buttton to toggle the filter.FernandoS272021-11-165-1/+61
* | | | VideoCore: Add gaussian filtering.FernandoS272021-11-168-2/+140
* | | | TextureCache: Improve Reaper.FernandoS272021-11-162-14/+26
* | | | Vulkan: fix waiting on semaphore.FernandoS272021-11-161-1/+3
* | | | Update scaleforce to use FP16Marshall Mohror2021-11-161-88/+55
* | | | VideoCore: Add more rescaling option.FernandoS272021-11-163-7/+38
* | | | TextureCache: fix rescaling in aliases and overlap joins.FernandoS272021-11-164-23/+48
* | | | Presentation: Fix turning FSR on and off in settingsMarshall Mohror2021-11-161-0/+11
* | | | Video Core: fix building for GCC.Fernando Sahmkow2021-11-165-24/+42
* | | | Vulkan Rasterizer: Fix clears on integer textures.FernandoS272021-11-163-1/+84
* | | | Texture cache: fix Intel with rescaler.FernandoS272021-11-161-2/+2
* | | | TextureCache: Fix blitting filter in Vulkan and correct viewport/scissor calculation when downscaling.FernandoS272021-11-162-20/+44
* | | | Texture Cache: fix memory managment and optimize scaled downloads, uploads.Fernando Sahmkow2021-11-167-28/+57
* | | | Texture Cache: ease the requirements of textures being blacklisted.Fernando Sahmkow2021-11-162-22/+7
* | | | Vulkan: Fix Blit Depth StencilFernando Sahmkow2021-11-162-14/+20
* | | | Texture Cache: Fix downscaling and correct memory comsumption.Fernando Sahmkow2021-11-168-36/+147
* | | | Presentation: add Nearest Neighbor filter.Fernando Sahmkow2021-11-166-14/+67
* | | | vulkan: Implement FidelityFX Super ResolutionMarshall Mohror2021-11-1611-17/+643
* | | | Texture Cache: Rescale conversions between depth and colorFernandoS272021-11-166-25/+37
* | | | Texture cache: Fix memory consumption and ignore rating when a depth texture is rendered.Fernando Sahmkow2021-11-163-7/+19
* | | | vulkan: Fix rescaling push constant usageameerj2021-11-168-69/+78
* | | | Texture Cahe: Fix downscaling on SMO.Fernando Sahmkow2021-11-165-0/+11
* | | | texture_cache_base: Remove unused function declarationsameerj2021-11-161-8/+0
* | | | yuzu: Fix build errorsameerj2021-11-161-1/+1
* | | | vk_texture_cache: Use 3D to scale images when blit is unsupportedameerj2021-11-164-29/+87
* | | | texture_cache: Fix infinitely recursive ImageCanRescale checkameerj2021-11-163-10/+13
* | | | vk_texture_cache: Fix BlitScale of non-2D imagesameerj2021-11-161-10/+9
* | | | video_core: Refactor resolution scale functionameerj2021-11-164-46/+34
* | | | texture_cache: Fix image resolves when src/dst are not both scaledameerj2021-11-161-5/+8
* | | | yuzu_cmd: Read resolution_setup and scaling_filter from configlat9nq2021-11-162-0/+25
* | | | video_core,yuzu: Move UpdateRescalingInfo call to video_corelat9nq2021-11-163-5/+2
* | | | gl_texture_cache: Disable scissor test when scaling texturesameerj2021-11-161-0/+8
* | | | vk_texture_cache: Fix unsupported blit format error checkingameerj2021-11-162-9/+9
* | | | vk_texture_cache: Fix early returns on unsupported scalesameerj2021-11-162-19/+11
* | | | video_core: Misc resolution scaling related refactoringameerj2021-11-168-47/+51
* | | | texture_cache: Refactor scaled image size calculationameerj2021-11-162-12/+13
* | | | Texture Cache: Fix calculations when scaling.Fernando Sahmkow2021-11-161-0/+12
* | | | gl_texture_cache: Fix BGR pbo size for scaled texturesameerj2021-11-161-11/+10
* | | | rescaling_pass: Fix IR errors when unscalable texture types are encounteredameerj2021-11-161-0/+28
* | | | Texture Cache: Fix Rescaling on MultisampleFernando Sahmkow2021-11-163-8/+21
* | | | TextureCache: Base fixes on rescaling.Fernando Sahmkow2021-11-162-4/+6
* | | | rescaling_pass: Logic simplification and minor style cleanupameerj2021-11-162-33/+17
* | | | rescaling_pass: Scale ImageFetch offset if it existsameerj2021-11-161-59/+37
* | | | rescaling_pass: Enable PatchImageQueryDimensions on fragment stagesameerj2021-11-161-5/+4
* | | | vk_texture_cache: Simplify scaled image managementameerj2021-11-162-107/+34
* | | | gl_texture_cache: Fix scaling backup logicameerj2021-11-162-20/+16
* | | | vk_rasterizer: Fix scaling on Y_NEGATEameerj2021-11-161-3/+9
* | | | vk_texture_cache: Use nearest neighbor scaling when availableameerj2021-11-164-29/+36
* | | | gl_texture_cache: Fix depth and integer format scaling blitsameerj2021-11-162-16/+61
* | | | gl_texture_cache/rescaling_pass: minor cleanupameerj2021-11-163-16/+10
* | | | vk_texture_cache: Minor cleanupameerj2021-11-162-11/+8
* | | | rescaling_pass: Fix and simplify shuffle/fragcoord passameerj2021-11-161-26/+20
* | | | Shader: Don't rescale FragCoord if used by ShuffleFernando Sahmkow2021-11-162-2/+55
* | | | image_info: Mark MSAA textures as non-rescalableameerj2021-11-161-2/+2
* | | | bootmanager: Fix screenshot resolution factor usageameerj2021-11-167-20/+13
* | | | gl_texture_cache: Simplify scalingameerj2021-11-162-31/+39
* | | | Renderers: Unify post processing filter shadersameerj2021-11-167-211/+36
* | | | gl_texture_cache: fix scaling on uploadameerj2021-11-161-0/+7
* | | | Renderer: Implement Bicubic and ScaleForce filters.Fernando Sahmkow2021-11-1615-34/+620
* | | | Texture Cache: fix scaling on upload and stop scaling on base resolution.Fernando Sahmkow2021-11-161-14/+32
* | | | shader, video_core: Fix GCC build errorsameerj2021-11-163-14/+3
* | | | emit_spirv: Fix RescalingLayout alignmentameerj2021-11-163-4/+8
* | | | TextureCache: Fix Buffer Views Scaling.Fernando Sahmkow2021-11-162-5/+9
* | | | RescalingPass: Agregate pixels on texelFetch while on Fragment ShaderFernando Sahmkow2021-11-161-3/+97
* | | | Texture Cache: Correctly fix Blits Rescaling.Fernando Sahmkow2021-11-161-9/+12
* | | | shader: Fix TextureSize check on rescaling.Fernando Sahmkow2021-11-161-27/+21
* | | | texture_cache: Disable dst_image scaling in BlitImageameerj2021-11-161-5/+7
* | | | emit_spirv: Fix RescalingLayout alignmentameerj2021-11-162-3/+3
* | | | shader: Properly scale image reads and add GL SPIR-V supportReinUsesLisp2021-11-1625-77/+228
* | | | shader: Properly blacklist and scale image loadsReinUsesLisp2021-11-165-11/+31
* | | | texture_cache: Add getter to query if image view is rescaledReinUsesLisp2021-11-165-22/+12
* | | | vk_rasterizer: Minor style changeReinUsesLisp2021-11-161-2/+2
* | | | gl_texture_cache: Fix scaling blitsReinUsesLisp2021-11-161-20/+12
* | | | glsl/glasm: Pass and use scaling parameters in shadersReinUsesLisp2021-11-169-28/+51
* | | | gl_rasterizer: Properly scale viewports and scissorsReinUsesLisp2021-11-161-23/+24
* | | | gl_texture_cache: Fix multi layered texture Scaleameerj2021-11-161-11/+15
* | | | gl_compute_pipeline: Add downscale factor to shader uniformsameerj2021-11-161-0/+9
* | | | gl_rasterizer: Fix rescale dirty state checkingameerj2021-11-161-4/+9
* | | | gl_graphics_pipeline: Add downscale factor to shader uniformsameerj2021-11-164-5/+19
* | | | texture_cache: Fix blacklists on computeReinUsesLisp2021-11-161-1/+1
* | | | texture_cache: Simplify image view queries and blacklistingReinUsesLisp2021-11-1616-192/+192
* | | | Vulkan: Fix downscaling Blit.Fernando Sahmkow2021-11-161-14/+18
* | | | Texture Cache: Implement Rating System.Fernando Sahmkow2021-11-165-15/+47
* | | | OpenGL: set linear mag filter when blitting a downscaled image.Fernando Sahmkow2021-11-161-0/+1
* | | | Vulkan: Fix AA when rescaling.Fernando Sahmkow2021-11-161-1/+1
* | | | Texture Cache: Implement Blacklisting.Fernando Sahmkow2021-11-165-4/+90
* | | | main: Add resolution scale label in the status barMorph2021-11-162-2/+12
* | | | vulkan: Implement rescaling shader patchingReinUsesLisp2021-11-168-27/+103
* | | | vk_texture_cache: Properly scale blit source imagesReinUsesLisp2021-11-161-2/+2
* | | | vk_graphics_pipeline: Use Shader::NumDescriptors when possibleReinUsesLisp2021-11-161-18/+6
* | | | opengl: Use Shader::NumDescriptors when possibleReinUsesLisp2021-11-163-46/+20
* | | | spirv: Implement rescaling patchingReinUsesLisp2021-11-168-5/+86
* | | | shader/rescaling_pass: Patch more instructionsReinUsesLisp2021-11-161-4/+101
* | | | shader: Add IsTextureScaled opcodeReinUsesLisp2021-11-1610-0/+34
* | | | texture_cache: Add image gettersReinUsesLisp2021-11-162-0/+16
* | | | shader: Add copy constructor to instructionsReinUsesLisp2021-11-164-1/+20
* | | | shader: Add integer division opcodesReinUsesLisp2021-11-169-0/+37
* | | | common/settings: Remove unused scaling optionsReinUsesLisp2021-11-162-18/+7
* | | | shader: Fix rescaling passReinUsesLisp2021-11-161-1/+1
* | | | gl_texture_cache: Simplify rescalingameerj2021-11-162-19/+15
* | | | texture_cache: Fix typo in aliased image rescalingameerj2021-11-161-1/+1
* | | | vk_texture_cache: Simplify and optimize scaling blitsReinUsesLisp2021-11-161-106/+62
* | | | vk_texture_cache: Fix scaling blit validation errorsReinUsesLisp2021-11-161-81/+78
* | | | shader: Fix resolution scaling passReinUsesLisp2021-11-165-35/+32
* | | | shader: Add resolution down factor opcodeReinUsesLisp2021-11-169-0/+25
* | | | gl_texture_cache: Implement ScaleDownameerj2021-11-162-26/+36
* | | | gl_texture_cache: Rescale fixes for multi-layered texturesameerj2021-11-162-16/+32
* | | | Texture Cache: Implement Rescaling on Aliases and Blits.Fernando Sahmkow2021-11-161-5/+53
* | | | Fix blits with mipsReinUsesLisp2021-11-161-12/+16
* | | | Fix blitsReinUsesLisp2021-11-161-10/+10
* | | | renderer_gl: Resolution scaling fixesameerj2021-11-163-61/+107
* | | | TextureCache: Fix rescaling of ImageCopiesFernando Sahmkow2021-11-163-18/+67
* | | | TextureCache: Modify Viewports/Scissors according to Rescale.Fernando Sahmkow2021-11-166-35/+93
* | | | Settings: eliminate rescaling_factor.Fernando Sahmkow2021-11-167-37/+19
* | | | Texture Cache: More rescaling fixes.Fernando Sahmkow2021-11-164-84/+96
* | | | gl_texture_cache: WIP texture rescaleameerj2021-11-162-3/+69
* | | | Texture Cache: Implement Vulkan UpScaling & DownScalingFernando Sahmkow2021-11-166-42/+327
* | | | ShaderDecompiler: Add initial support for rescaling.Fernando Sahmkow2021-11-162-0/+73
* | | | Settings: Add resolution scaling to settings.Fernando Sahmkow2021-11-166-5/+155
* | | | VideoCore: Initial Setup for the Resolution Scaler.Fernando Sahmkow2021-11-1611-18/+255
| |/ / |/| |
* | | Merge pull request #7326 from ameerj/vp8Fernando S2021-11-1411-26/+180
|\ \ \
| * | | codes: Rename ComposeFrameHeader to ComposeFrameameerj2021-11-137-14/+14
| * | | vp8: Implement header compositionameerj2021-11-134-6/+90
| * | | codecs: Add VP8 codec classameerj2021-11-139-20/+90
| |/ /
* | | Merge pull request #7260 from vonchenplus/spirv_support_legacy_attribute_v2bunnei2021-11-143-71/+153
|\ \ \ | |_|/ |/| |
| * | Simply legacy attribute implementFeng Chen2021-11-043-152/+125
| * | Support gl_FogFragCoord attributevonchenplus2021-10-313-48/+58
| * | Support gl_BackSecondaryColor attributevonchenplus2021-10-263-0/+33
| * | Support gl_FrontSecondaryColor attributevonchenplus2021-10-263-0/+33
| * | Support gl_BackColor attributevonchenplus2021-10-263-0/+33
* | | Merge pull request #7272 from behunin/the-courteous-loggerbunnei2021-11-134-28/+41
|\ \ \ | |_|/ |/| |
| * | Refactor Logging ImplLevi Behunin2021-11-024-28/+41
* | | program_metadata: Add default ThreadInfo kernel capabilityOatmealDome2021-11-111-1/+4
* | | applets/swkbd: Fix text check message encodingMorph2021-11-081-7/+15
* | | applets/swkbd: Skip text checking if the text has been confirmedMorph2021-11-088-26/+36
* | | service/pctl: Stub EndFreeCommunicationNarr the Reg2021-11-051-1/+8
* | | vulkan_device: Add missing vulkan image format R5G6B5 in GetFormatPropertiesFeng Chen2021-11-051-0/+1
* | | Merge pull request #7279 from Morph1984/system-get-program-idMorph2021-11-0525-59/+48
|\ \ \
| * | | general: Get the current process program id directly from the systemMorph2021-11-0421-56/+42
| * | | general: Rename GetTitleID to GetProgramIDMorph2021-11-0424-43/+46
* | | | Merge pull request #7289 from ameerj/perf-stat-shutdownMorph2021-11-051-1/+1
|\ \ \ \
| * | | | core: Reorder perf_stats destruction order on Shutdownameerj2021-11-051-1/+1
| |/ / /
* | | | Merge pull request #7287 from Morph1984/stub-aocFernando S2021-11-052-0/+29
|\ \ \ \ | |/ / / |/| | |
| * | | service: aoc: Stub NotifyUnmountAddOnContentMorph2021-11-042-1/+9
| * | | service: aoc: Stub NotifyMountAddOnContent and NotifyMountAddOnContentMorph2021-11-042-0/+21
* | | | Merge pull request #7282 from ameerj/core-includesbunnei2021-11-04134-219/+8
|\ \ \ \ | |/ / / |/| | |
| * | | core: Fix transitive include build errorsameerj2021-11-045-0/+9
| * | | core: Remove unused includesameerj2021-11-04133-221/+1
* | | | service/acc: Rename Unknown160 to InitializeApplicationInfoV2german772021-11-043-3/+3
* | | | service: acc: Stub acc:u0 '160'Morph2021-11-043-0/+9
|/ / /
* | | svc: Correct WaitSynchronization num_handles param typeMorph2021-11-032-4/+4
* | | Merge pull request #7262 from FernandoS27/Buffalo-buffalo-Buffalo-buffalo-buffalobunnei2021-11-037-3/+68
|\ \ \
| * | | Shader Cahe: Fix Phi Nodes on GLASM.Fernando Sahmkow2021-11-021-1/+1
| * | | ShaderCache: Fix Phi Nodes Type on OGL.Fernando Sahmkow2021-11-013-2/+30
| * | | ShaderCache: Order Phi Arguments from farthest away to nearest.Fernando Sahmkow2021-10-315-0/+37
* | | | Merge pull request #7265 from Morph1984/gl-rasterizer-unused-includeMai M2021-11-021-4/+2
|\ \ \ \
| * | | | gl_rasterizer: Remove unused includesMorph2021-11-011-4/+2
| | |/ / | |/| |
* | | | general: Remove MakeResult helpersMorph2021-11-0213-69/+48
* | | | hle/result: Amend ResultVal documentationMorph2021-11-021-12/+10
* | | | hle/result: Reimplement ResultVal using Common::ExpectedMorph2021-11-021-117/+63
* | | | common: Implement a subset of P0323 (std::expected)Morph2021-11-022-0/+988
* | | | Merge pull request #7227 from vonchenplus/fix_memory_leak_v2bunnei2021-11-026-24/+54
|\ \ \ \ | |/ / / |/| | |
| * | | Fix dangling kernel objects when exitingFeng Chen2021-10-272-11/+13
| * | | Revert PR7009Feng Chen2021-10-272-15/+5
| * | | Fix memory leakFeng Chen2021-10-274-0/+38
| | |/ | |/|
* | | Merge pull request #7246 from german77/userimagebunnei2021-10-311-0/+11
|\ \ \
| * | | profile_manager: Resize any image bigger than 256pgerman772021-10-301-0/+11
| |/ /
* | | Merge pull request #7201 from ameerj/spirv-depth-samplingFernando S2021-10-301-5/+16
|\ \ \ | |_|/ |/| |
| * | emit_spirv_image: Fix depth image implicit lod sample in computeameerj2021-10-171-5/+16
* | | Merge pull request #6702 from lat9nq/disable-screensaverbunnei2021-10-302-1/+23
|\ \ \
| * | | yuzu qt: Disable the screensaver with SDL2lat9nq2021-10-302-1/+23
* | | | Merge pull request #7244 from Morph1984/application-lang-pt-brbunnei2021-10-304-3/+30
|\ \ \ \
| * | | | file_sys: control_metadata: Add BrazilianPortugueseMorph2021-10-292-2/+4
| * | | | ns: language: Add BrazilianPortuguese to ApplicationLanguageMorph2021-10-292-1/+26
* | | | | Merge pull request #7240 from Morph1984/resultval-remove-cvbunnei2021-10-301-2/+2
|\ \ \ \ \
| * | | | | hle/result: Remove cv-qualifiers from Arg in MakeResultMorph2021-10-281-2/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7241 from Morph1984/resultval-move-assignmentbunnei2021-10-291-2/+22
|\ \ \ \ \
| * | | | | hle/result: Declare copy/move constructor/assignment as noexceptMorph2021-10-281-3/+3
| * | | | | hle/result: Add move assignment operator in ResultValMorph2021-10-281-0/+20
| | |_|/ / | |/| | |
* | | | | Merge pull request #7243 from lat9nq/nvdrv-warnbunnei2021-10-291-0/+15
|\ \ \ \ \
| * | | | | gl_device: Force GLASM on NVIDIA drivers 495-496lat9nq2021-10-291-0/+15
| |/ / / /
* | | | | CMakeLists: Document the /GT compile optionMorph2021-10-291-0/+1
* | | | | Merge pull request #7007 from FernandoS27/intel-optionsMorph2021-10-291-0/+5
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Build System: Build with JCC Erratum MitigationFernando Sahmkow2021-09-151-0/+5
* | | | | Merge pull request #7223 from Moonlacer/geometry_property_removalAmeer J2021-10-292-9/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Geometry property removal and rewordingMoonlacer2021-10-262-9/+1
* | | | | Merge pull request #7186 from MightyCreak/fix-crash-configure-windowAmeer J2021-10-271-2/+5
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | ui: fix crash when closing configure windowRomain Failliot2021-10-151-2/+5
* | | | | Merge pull request #7193 from FernandoS27/idleMorph2021-10-252-0/+22
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | SVC: Implement svcInfo:IdleTickCountFernando Sahmkow2021-10-162-0/+22
* | | | | Merge pull request #7218 from bylaws/aswdqdsamAmeer J2021-10-252-21/+9
|\ \ \ \ \
| * | | | | Fixup channel submit IOCTL syncpoint parametersBilly Laws2021-10-242-21/+9
* | | | | | Merge pull request #7222 from FernandoS27/fix-indixed-textures-againAmeer J2021-10-241-1/+1
|\ \ \ \ \ \
| * | | | | | TexturePass: Fix clamping of images as this allowed negative indices.Fernando Sahmkow2021-10-241-1/+1
| |/ / / / /
* | | | | | Fixed ARM_Dynamic_64 StepAndrew Strelsky2021-10-241-1/+1
* | | | | | Merge pull request #7206 from vonchenplus/fix_vulkan_viewport_issueFernando S2021-10-241-0/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Fix vulkan viewport issueFeng Chen2021-10-221-0/+1
* | | | | | Merge pull request #7070 from FernandoS27/want-you-badAmeer J2021-10-246-3/+31
|\ \ \ \ \ \
| * | | | | | Vulran Rasterizer: address feedback.Fernando Sahmkow2021-10-231-3/+5
| * | | | | | Vulkan Rasterizer: Correct DepthBias/PolygonOffset on Vulkan.Fernando Sahmkow2021-09-236-3/+29
* | | | | | | Revert "input_common: Fix data race on GC implementation"Fernando S2021-10-232-120/+115
* | | | | | | Merge pull request #6515 from german77/gc_thread_safeFernando S2021-10-232-115/+120
|\ \ \ \ \ \ \
| * | | | | | | input_common: Fix data race on GC implementationRodrigo Locatti2021-08-072-115/+120
* | | | | | | | common/alignment: Fix VS2022 compilationameerj2021-10-201-1/+6
* | | | | | | | input_common: Fix VS2022 compilation errorsameerj2021-10-201-39/+35
* | | | | | | | Merge pull request #7197 from Moonlacer/tas_help_linkbunnei2021-10-201-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | add_linkMoonlacer2021-10-171-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #7198 from ameerj/settings-chronobunnei2021-10-197-24/+20
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | settings: Remove std::chrono usageameerj2021-10-177-24/+20
| |/ / / / / /
* | | | | | | Merge pull request #7173 from Morph1984/invalidate-unmapbunnei2021-10-171-0/+2
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | KPageTable: Perform ranged invalidation when unmapping code memoryMorph2021-10-131-0/+2
* | | | | | | Merge pull request #7077 from FernandoS27/face-downAmeer J2021-10-173-6/+8
|\ \ \ \ \ \ \
| * | | | | | | Shader Compiler: avoid overflowed indices on indixed samplers.Fernando Sahmkow2021-10-171-1/+2
| * | | | | | | Vulkan Query Cache: make sure to wait for the query result.Fernando Sahmkow2021-09-241-1/+2
| * | | | | | | QueryCache: Flush queries in order of running.Fernando Sahmkow2021-09-241-4/+4
* | | | | | | | Merge pull request #7127 from FernandoS27/i-saw-a-wabbitAmeer J2021-10-172-5/+14
|\ \ \ \ \ \ \ \
| * | | | | | | | Vulkan: Fix failing barrier on refresh.Fernando Sahmkow2021-10-041-1/+2
| * | | | | | | | RasterizerInterface: Correct size of CPU addresses to cache.FernandoS272021-10-041-1/+1
| * | | | | | | | Vulkan: Fix the master SemaphoreFernandoS272021-10-041-4/+12
* | | | | | | | | Merge pull request #7195 from MightyCreak/fix-warning-typoMai M2021-10-171-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | main: fix typo in warning messageRomain Failliot2021-10-161-1/+1
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | main: Add missing make_unique for uiMorph2021-10-161-1/+1
* | | | | | | | Merge pull request #7187 from FernandoS27/boy-i-say-boybunnei2021-10-164-0/+51
|\ \ \ \ \ \ \ \
| * | | | | | | | NvHost/Core: Address Feedback.Fernando Sahmkow2021-10-163-19/+27
| * | | | | | | | Suspend temporallyFernandoS272021-10-163-1/+31
| * | | | | | | | NVHost_Ctrl: Force wait if the gpu falls behind too long.FernandoS272021-10-162-0/+13
* | | | | | | | | Merge pull request #7188 from Morph1984/web-applet-includeMorph2021-10-161-0/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | qt_web_browser: Add missing QApplication includeMorph2021-10-161-0/+1
| |/ / / / / / / /
* / / / / / / / / service/vi: Stub IHOSBinderDriver::TransactParcel GetBufferHistory (#7184)Feng Chen2021-10-161-1/+11
|/ / / / / / / /
* | | | | | | | bootmanager: Forward declare System and SystemResultStatusMorph2021-10-151-1/+5
* | | | | | | | yuzu: Construct system in GMainWindowMorph2021-10-152-81/+83
* | | | | | | | core: Move ResultStatus outside of SystemMorph2021-10-157-67/+69
* | | | | | | | yuzu_cmd: Remove remaining static system instancesMorph2021-10-151-3/+2
* | | | | | | | core: Remove static system instanceMorph2021-10-152-28/+5
* | | | | | | | Merge pull request #7172 from Morph1984/out-of-boundsMai M2021-10-152-7/+7
|\ \ \ \ \ \ \ \
| * | | | | | | | string_util: Make use of std::string_view and add bounds checkingMorph2021-10-142-5/+5
| * | | | | | | | string_util: Prevent out of bounds access in u16string_view bufferMorph2021-10-141-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #7174 from MightyCreak/hide-cursor-by-defaultMai M2021-10-151-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Hide mouse cursor by defaultRomain Failliot2021-10-151-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #7185 from Morph1984/make_unique_uiMai M2021-10-1515-151/+157
|\ \ \ \ \ \ \ \
| * | | | | | | | main: Use std::unique_ptr for uiMorph2021-10-152-137/+142
| * | | | | | | | configuration: Use std::make_unique instead of operator new for uiMorph2021-10-1513-14/+15
* | | | | | | | | main: Slightly refactor NCA entry installation in InstallNCA (#7181)Creak2021-10-151-8/+6
| |/ / / / / / / |/| | | | | | |
* | | | | | | | config: Read network_interfacelat9nq2021-10-152-0/+9
|/ / / / / / /
* | | | | | | settings_ui: Better NVDEC Description For Each Video Rendering Option (#7165)Moonlacer2021-10-151-3/+3
* | | | | | | Merge pull request #6774 from lat9nq/remove-global-yuzuMorph2021-10-1475-655/+717
|\ \ \ \ \ \ \
| * | | | | | | discord_impl: Remove global system instanceslat9nq2021-10-073-6/+13
| * | | | | | | game_list: Remove global instances of Core::Systemlat9nq2021-10-075-13/+19
| * | | | | | | configuration: Add const qualifier where ablelat9nq2021-10-0718-31/+28
| * | | | | | | yuzu qt: Remove global system instances from config, WaitTree, mainlat9nq2021-10-0769-636/+688
* | | | | | | | Merge pull request #7157 from ameerj/vic-surface-sizeMorph2021-10-141-16/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | vic: Use the minimum of surface/frame dimensions when writing the final frame to the GPUameerj2021-10-111-16/+15
* | | | | | | | | Merge pull request #7142 from german77/sdl_rangebunnei2021-10-141-3/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | input_common/sdl: Fix joystick rangegerman772021-10-111-3/+4
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7158 from ameerj/window-900pbunnei2021-10-133-36/+53
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | main: Add option to reset window size to 900pameerj2021-10-113-36/+53
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #7147 from behunin/patch-1Ameer J2021-10-121-8/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | Update configure_tas.uiLevi Behunin2021-10-081-8/+0
* | | | | | | | | Merge pull request #7109 from vonchenplus/fix_h264_max__reference_num_errorAmeer J2021-10-121-1/+6
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | h264: Use max allowed max_num_ref_frames when using CPU decodingFeng Chen2021-10-101-1/+6
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | common/fs/path_util: Slightly refactor PathManagerImpl's constructorCreak2021-10-121-12/+15
* | | | | | | | | Create local variables for mouse and wheel positionsRomain Failliot2021-10-121-5/+9
* | | | | | | | | Fix a few warningsRomain Failliot2021-10-123-6/+5
* | | | | | | | | Merge pull request #7110 from vonchenplus/fix_extract_offline_romefs_errorMorph2021-10-111-0/+10
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | applets/web: Fallback to loader to get the manual romfs if none is foundFeng Chen2021-10-111-0/+10
| |/ / / / / / /
* | | | | | | | vic: Allow surface to be higher than frameValeri2021-10-091-2/+3
* | | | | | | | Merge pull request #7138 from ameerj/vic-fmtMai M2021-10-092-125/+154
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | vic: Avoid memory corruption when multiple streams with different dimensions are decodedameerj2021-10-081-0/+9
| * | | | | | | vic: Refactor frame writing methodsameerj2021-10-072-138/+146
| * | | | | | | vic: Implement RGBX frame formatameerj2021-10-072-3/+15
| | |/ / / / / | |/| | | | |
* | | | | | | kernel: hle_ipc: Foward declare KAutoObjectMorph2021-10-072-1/+2
* | | | | | | service: Reduce header include overheadMorph2021-10-0731-39/+11
|/ / / / / /
* | | | | | Merge pull request #7118 from ameerj/vc-gpu-implFernando S2021-10-0621-691/+890
|\ \ \ \ \ \
| * | | | | | nvflinger: Use jthread and stop_token for VSync threadameerj2021-10-032-32/+8
| * | | | | | nvhost_ctrl: Refactor usage of gpu.LockSync()ameerj2021-10-033-35/+16
| * | | | | | gpu: Migrate implementation to the cpp fileameerj2021-10-0319-632/+875
* | | | | | | Merge pull request #7090 from Moonlacer/tas_spacing_additionbunnei2021-10-062-146/+188
|\ \ \ \ \ \ \
| * | | | | | | configure_tas: Remove help button from dialog windowMoonlacer2021-09-291-0/+1
| * | | | | | | configure_tas: Ensure dialog buttons always stay at the bottomMoonlacer2021-09-291-146/+187
* | | | | | | | Merge pull request #7115 from ameerj/log-compilebunnei2021-10-0515-18/+53
|\ \ \ \ \ \ \ \
| * | | | | | | | common/logging: Reduce scope of fmt includeameerj2021-10-024-1/+5
| * | | | | | | | common/logging: Move Log::Entry declaration to a separate headerameerj2021-10-0212-17/+48
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #7103 from Morph1984/service-ctx-eventbunnei2021-10-0526-271/+367
|\ \ \ \ \ \ \ \
| * | | | | | | | service: Replace service event creation with ServiceContext::CreateEventMorph2021-10-0226-271/+367
* | | | | | | | | Merge pull request #7101 from ameerj/vk-tess-topologybunnei2021-10-051-1/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_graphics_pipeline: Force patch list topology when tessellation is usedameerj2021-09-281-1/+10
* | | | | | | | | | Merge pull request #7107 from astrelsky/iob_fixbunnei2021-10-041-1/+5
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | prevent access violation from iob in Memory::IsValidVirtualAddressAndrew Strelsky2021-09-301-1/+5
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #7091 from vonchenplus/fix_memroy_leakAmeer J2021-10-046-9/+114
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fix KShareMemory object leakFeng Chen2021-09-295-3/+106
| * | | | | | | | | | Fix KScopedAutoObject object leak when SendSyncRequestFeng Chen2021-09-251-6/+8
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #7111 from lat9nq/no-title-bar-versionbunnei2021-10-031-2/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | main: Don't add an extra separator when the title version is absentlat9nq2021-10-011-2/+7
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #7113 from Morph1984/no-log-ip-addrbunnei2021-10-031-2/+0
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | network: Do not log IP addressMorph2021-10-021-2/+0
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6979 from german77/joycon_namebunnei2021-10-021-2/+16
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | input_common: Add alternative string for joyconsgerman772021-09-071-2/+16
* | | | | | | | | | | service: am: Make use of Exit to exit the currently running applicationMorph2021-10-021-2/+2
* | | | | | | | | | | yuzu: main: Register a callback for ExitMorph2021-10-024-0/+17
* | | | | | | | | | | core: Add Exit and ExitCallbackMorph2021-10-022-0/+25
| |/ / / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #7102 from Morph1984/remove-boxcatbunnei2021-10-0215-964/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | CMakeLists: Remove BoxCat build optionMorph2021-09-291-4/+0
| * | | | | | | | | | settings: Remove BCAT settingsMorph2021-09-295-17/+0
| * | | | | | | | | | configure_network: Remove BCATMorph2021-09-293-208/+0
| * | | | | | | | | | service: bcat: Remove BoxCat BCAT implementationMorph2021-09-294-631/+0
| * | | | | | | | | | externals: Remove libzipMorph2021-09-291-1/+1
| * | | | | | | | | | file_sys: Remove vfs_libzipMorph2021-09-293-103/+0
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #7075 from v1993/power-of-teabunnei2021-10-011-0/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | Use subdirectory of main data directory for QtWebEngine storagev19932021-09-231-0/+3
* | | | | | | | | | Merge pull request #7061 from ameerj/dma-buffer-miscbunnei2021-09-304-39/+37
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | maxwell_dma: Minor refactoringameerj2021-09-202-33/+33
| * | | | | | | | | | buffer_cache: Minor fixesameerj2021-09-202-6/+4
* | | | | | | | | | | Merge pull request #7104 from Morph1984/styleMai M2021-09-308-10/+10
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | style: Remove extra space preceding the :: operatorMorph2021-09-298-10/+10
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #7036 from ameerj/ogl-bgr-v2bunnei2021-09-307-118/+59
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | host_shaders: Remove opengl_copy_bgra.compameerj2021-09-174-19/+0
| * | | | | | | | | | | gl_texture_cache: Migrate BGRCopyPass from util_shadersameerj2021-09-174-42/+48
| * | | | | | | | | | | util_shaders: Unify BGRA copy passesameerj2021-09-165-82/+36
* | | | | | | | | | | | Fixed invalid iterator usageAndrew Strelsky2021-09-291-1/+1
| |/ / / / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #7018 from lat9nq/splat-stubsMorph2021-09-292-26/+67
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | audin_u: Return a buffer event in RegisterBufferEventlat9nq2021-09-152-2/+12
| * | | | | | | | | | | audin_u: stub Start, RegisterBufferEvent, AppendAudioInBufferAutolat9nq2021-09-152-26/+57
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #7042 from v1993/patch-7Ameer J2021-09-282-0/+8
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | If not on Windows, disable raw inputValeri2021-09-181-0/+4
| * | | | | | | | | | Hide XInput bypass on non-Windows OSesValeri2021-09-181-0/+4
* | | | | | | | | | | Merge pull request #7076 from ameerj/amd-botwbunnei2021-09-283-11/+22
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | vk_texture_cache: Disable cube compatibility flag on non-mesa AMD GCN4 and earlierameerj2021-09-243-11/+22
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | service/es: Update to 13.0.0german772021-09-271-0/+6
* | | | | | | | | | | service/npns: Update to 13.0.0german772021-09-271-0/+1
* | | | | | | | | | | service/vi: Update to 13.0.0german772021-09-272-0/+2
* | | | | | | | | | | service/am: Update to 13.0.0german772021-09-271-0/+4
* | | | | | | | | | | service/audio: Update to 13.0.0german772021-09-272-1/+10
* | | | | | | | | | | service/hid: Update to 13.0.0german772021-09-272-0/+10
* | | | | | | | | | | service/btdrv: Update to 13.0.0german772021-09-271-0/+4
* | | | | | | | | | | service/usb: Update to 13.0.0german772021-09-271-3/+3
* | | | | | | | | | | Merge pull request #7078 from ameerj/vc-jthread-fixesMorph2021-09-262-2/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core: Fix jthread related hangs when stopping emulationameerj2021-09-242-2/+2
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | service: bsd: Stub ReadMorph2021-09-251-6/+5
* | | | | | | | | | | service: bsd: Implement ReadMorph2021-09-242-1/+15
* | | | | | | | | | | general: Update style to clang-format-12ameerj2021-09-2413-66/+62
* | | | | | | | | | | Merge pull request #7069 from lioncash/uuidMorph2021-09-245-8/+16
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | core/profile_select: Avoid uninitialized read in SelectProfile()Lioncash2021-09-231-1/+2
| * | | | | | | | | | common/uuid: Add validity checking functions to interfaceLioncash2021-09-224-7/+14
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #7068 from behunin/patch-3bunnei2021-09-241-121/+60
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Clean-up and nitsLevi Behunin2021-09-221-121/+60
| |/ / / / / / / /
* | | | | | | | | Merge pull request #7045 from behunin/patch-1bunnei2021-09-231-46/+16
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Clean-upLevi Behunin2021-09-211-44/+14
| * | | | | | | | Tas configure ui nitsLevi Behunin2021-09-191-4/+4
* | | | | | | | | Merge pull request #7003 from ameerj/unlocked-present-modebunnei2021-09-203-4/+38
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_swapchain: Use immediate present mode when mailbox is unavailable and FPS is unlockedameerj2021-09-133-4/+38
* | | | | | | | | | Merge pull request #7017 from FernandoS27/i-am-barbie-girlAmeer J2021-09-201-1/+7
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | Spir-V: Rescale the frag depth to 0,1 mode when -1,1 mode is used in Vulkan.Fernando Sahmkow2021-09-151-1/+7
* | | | | | | | | | Merge pull request #7019 from ameerj/videocore-jthreadbunnei2021-09-198-91/+49
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | vk_scheduler: Use std::jthreadameerj2021-09-162-17/+9
| * | | | | | | | | gpu: Use std::jthread for async gpu threadameerj2021-09-165-69/+18
| * | | | | | | | | threadsafe_queue: Add std::stop_token overload to PopWaitameerj2021-09-161-5/+22
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | UI: Relocate tas menu and add brief descriptiongerman772021-09-1810-68/+148
* | | | | | | | | input_common/tas: new update methodgerman772021-09-185-17/+4
* | | | | | | | | input_common/tas: Document the main classgerman772021-09-188-51/+153
* | | | | | | | | input_common/tas: Add swap controllergerman772021-09-188-39/+99
* | | | | | | | | input_common/tas: overwrite file dialoggerman772021-09-183-20/+16
* | | | | | | | | input_common/tas: Fallback to simple updateMonsterDruide12021-09-1810-102/+60
* | | | | | | | | config: Move TAS options to it's own menugerman772021-09-1819-184/+452
* | | | | | | | | core: Hacky TAS syncing & load pausingMonsterDruide12021-09-189-107/+140
* | | | | | | | | main: TAS Playback state labelMonsterDruide12021-09-182-0/+10
* | | | | | | | | settings: File selector & other settingsMonsterDruide12021-09-189-2/+104
* | | | | | | | | input_common/tas: Base playback & recording systemMonsterDruide12021-09-1814-9/+818
| |_|_|_|_|/ / / |/| | | | | | |
* | | | | | | | Merge pull request #7020 from Moonlacer/remove_audio_stretchingbunnei2021-09-188-29/+0
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | fix_clang_errorMoonlacer2021-09-161-1/+0
| * | | | | | | fix_accidental_deletionMoonlacer2021-09-161-1/+2
| * | | | | | | remove-audio-stretching-settingMoonlacer2021-09-168-30/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #6950 from german77/multiplaybunnei2021-09-188-11/+35
|\ \ \ \ \ \ \
| * | | | | | | input_common: Enable steam controllers and 8 player supportgerman772021-09-108-11/+35
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #7015 from german77/NotGoodForTerrabunnei2021-09-171-1/+14
|\ \ \ \ \ \ \
| * | | | | | | ngct: Stub MatchNarr the Reg2021-09-151-1/+14
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #7011 from ameerj/vk-validation-0x0bunnei2021-09-171-0/+1
|\ \ \ \ \ \ \
| * | | | | | | vulkan_debug_callback: Ignore InvalidCommandBuffer-VkDescriptorSet errorsameerj2021-09-141-0/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #7027 from ameerj/sorry-amdFernando S2021-09-161-14/+3
|\ \ \ \ \ \ \
| * | | | | | | vulkan_device: Reorder Float16Int8 declarationameerj2021-09-161-1/+2
| * | | | | | | Revert "Merge pull request #7006 from FernandoS27/a-motherfucking-driver"ameerj2021-09-161-13/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #7010 from Morph1984/fs-timestampbunnei2021-09-168-1/+83
|\ \ \ \ \ \ \
| * | | | | | | vfs: Partially implement GetFileTimeStampRawMorph2021-09-148-1/+83
| |/ / / / / /
* / / / / / / renderers: Log total pipeline countMorph2021-09-142-0/+4
|/ / / / / /
* | | | | | Merge pull request #7009 from ameerj/main_process_cleanupbunnei2021-09-141-3/+12
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | core: Destroy main_process during shutdownameerj2021-09-141-3/+12
| | |/ / / | |/| | |
* | | | | Merge pull request #6943 from FernandoS27/omae-wa-mou-shindeiruMorph2021-09-131-6/+20
|\ \ \ \ \
| * | | | | Vulkan: Disable VK_EXT_SAMPLER_FILTER_MINMAX in GCN AMD since it's broken.Fernando Sahmkow2021-09-131-6/+20
* | | | | | Merge pull request #7006 from FernandoS27/a-motherfucking-driverMorph2021-09-131-1/+13
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Vulkan: Blacklist Int8Float16 Extension on AMD on driver 21.9.1Fernando Sahmkow2021-09-131-1/+13
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7005 from Morph1984/enum-bitwise-shift-opsMai M2021-09-131-0/+16
|\ \ \ \ \
| * | | | | common_funcs: Add enum flag bitwise shift operator overloadsMorph2021-09-131-0/+16
* | | | | | Merge pull request #6944 from FernandoS27/dear-drunk-meMorph2021-09-133-3/+14
|\ \ \ \ \ \
| * | | | | | Vulkan/Descriptors: Increase sets per pool on AMFD propietary driver.Fernando Sahmkow2021-09-133-3/+14
* | | | | | | Merge pull request #7001 from ameerj/wario-fixFernando S2021-09-131-6/+8
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | vk_rasterizer: Fix dynamic StencilOp updating when two faces are enabledameerj2021-09-121-6/+8
* | | | | | | Merge pull request #7000 from Morph1984/create-dir-commentAmeer J2021-09-131-0/+5
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | FS: Mark recursive CreateDirectory as inaccurate and temporaryMorph2021-09-121-0/+5
* | | | | | | Merge pull request #7002 from ameerj/vk-state-unusedMai M2021-09-121-4/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | vk_state_tracker: Remove unused functionameerj2021-09-121-4/+0
| |/ / / / /
* | | | | | Merge pull request #6948 from ameerj/amd-warp-fixMorph2021-09-122-54/+109
|\ \ \ \ \ \
| * | | | | | emit_glsl_warp: Fix shuffle ops for 64-thread warp sizesameerj2021-08-311-24/+36
| * | | | | | emit_glsl_warp: Fix ballot related ops for 64-thread warp sizesameerj2021-08-311-24/+38
| * | | | | | emit_spirv_warp: Fix shuffle ops for 64-thread warp sizesameerj2021-08-311-1/+29
| * | | | | | emit_spirv_warp: Fix ballot related ops for 64-thread warp sizesameerj2021-08-311-10/+11
* | | | | | | Merge pull request #6975 from ogniK5377/acc-async-ctxMorph2021-09-124-19/+154
|\ \ \ \ \ \ \
| * | | | | | | Mark is_complete as atomicChloe Marcec2021-09-082-4/+5
| * | | | | | | Addressed issuesChloe Marcec2021-09-083-15/+14
| * | | | | | | address name shadowing with systemChloe Marcec2021-09-061-2/+2
| * | | | | | | account: EnsureTokenIdCacheAsyncChloe Marcec2021-09-064-19/+154
* | | | | | | | Merge pull request #6974 from ogniK5377/fs-recursive-createdirMorph2021-09-121-8/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | Addressed issuesChloe2021-09-081-1/+1
| * | | | | | | | FS: Recursively create directories for CreateDirectoryChloe Marcec2021-09-061-8/+13
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #6997 from ameerj/stop-emulation-confirmationMorph2021-09-121-11/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | main: Apply confirm exit setting in exit locked scenariosameerj2021-09-121-11/+9
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #6992 from german77/brainsMorph2021-09-125-3/+44
|\ \ \ \ \ \ \ \
| * | | | | | | | am: Implement GetNotificationStorageChannelEventgerman772021-09-102-2/+16
| * | | | | | | | hid: Stub SetTouchScreenConfigurationgerman772021-09-103-1/+28
* | | | | | | | | Merge pull request #6987 from Morph1984/common-errorMorph2021-09-1213-19/+43
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shader_environment: Add missing <algorithm> includeMorph2021-09-111-0/+1
| * | | | | | | | | vk_descriptor_pool: Add missing <algorithm> includeMorph2021-09-111-0/+1
| * | | | | | | | | slot_vector: Add missing <algorithm> includeMorph2021-09-111-0/+1
| * | | | | | | | | video_core/memory_manager: Add missing <algorithm> includeMorph2021-09-111-0/+2
| * | | | | | | | | kernel: Add missing <functional> includeMorph2021-09-111-0/+1
| * | | | | | | | | file_sys/kernel_executable: Add missing <string> includeMorph2021-09-111-0/+1
| * | | | | | | | | codec: Add missing <string_view> includeMorph2021-09-111-0/+1
| * | | | | | | | | common_funcs: Replace <algorithm> with <iterator>Morph2021-09-111-1/+1
| * | | | | | | | | common: Move error handling to error.cpp/hMorph2021-09-116-18/+34
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6986 from Morph1984/version-updateMorph2021-09-121-5/+12
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | api_version: Update and add AtmosphereTargetFirmwareMorph2021-09-101-5/+12
| |/ / / / / / /
* | | | | | | | Merge pull request #6846 from ameerj/nvdec-gpu-decodeFernando S2021-09-1115-121/+257
|\ \ \ \ \ \ \ \
| * | | | | | | | h264: Lower max_num_ref_framesameerj2021-08-161-1/+2
| * | | | | | | | configure_graphics: Add GPU nvdec decoding as an optionameerj2021-08-1612-27/+120
| * | | | | | | | codec: Improve libav memory alloc and cleanupameerj2021-08-162-14/+19
| * | | | | | | | codec: Fallback to CPU decoding if no compatible GPU format is foundameerj2021-08-162-22/+32
| * | | | | | | | cmake: Add VDPAU and NVDEC support to FFmpeglat9nq2021-08-161-0/+1
| * | | | | | | | codec: Replace deprecated av_init_packet usageameerj2021-08-121-9/+13
| * | | | | | | | nvdec: Implement GPU accelerated decoding for all platformsameerj2021-08-122-70/+92
* | | | | | | | | Merge pull request #6901 from ameerj/vk-clear-bitsFernando S2021-09-113-6/+24
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_rasterizer: Only clear depth and stencil buffers when set in attachment aspect maskameerj2021-08-213-6/+24
* | | | | | | | | | Merge pull request #6941 from ameerj/swapchain-srgbFernando S2021-09-115-11/+37
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vulkan_device: Enable VK_KHR_swapchain_mutable_format if availableameerj2021-08-293-0/+27
| * | | | | | | | | | vk_swapchain: Prefer linear swapchain format when presenting sRGB imagesameerj2021-08-293-11/+10
* | | | | | | | | | | Merge pull request #6953 from ameerj/anv-semaphoreFernando S2021-09-115-26/+33
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | renderer_vulkan: Wait on present semaphore at queue submitameerj2021-09-025-26/+33
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6981 from ameerj/nvflinger-hb-formatFernando S2021-09-113-7/+8
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | nvflinger: Use external surface format for framebuffer creationameerj2021-09-073-7/+8
| | |_|_|_|_|_|_|/ / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6962 from vonchenplus/spirv_support_legacy_attributebunnei2021-09-083-0/+107
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Detail adjustmentFeng Chen2021-09-081-13/+14
| * | | | | | | | | | Detail adjustmentFeng Chen2021-09-082-28/+35
| * | | | | | | | | | Re-implement get unused locationFeng Chen2021-09-071-30/+30
| * | | | | | | | | | Move attribute related definitions to spirv anonymous namespaceFeng Chen2021-09-074-30/+26
| * | | | | | | | | | Dynamic get unused locationFeng Chen2021-09-061-27/+49
| * | | | | | | | | | Implement intput and output fixed fnc texturesFeng Chen2021-09-064-19/+25
| * | | | | | | | | | Rename parametersFeng Chen2021-09-035-14/+24
| * | | | | | | | | | Fix create GraphicsPipelines crashFeng Chen2021-09-031-5/+5
| * | | | | | | | | | Add input/output locationFeng Chen2021-09-021-5/+13
| * | | | | | | | | | Add colorfront and txtcoord supportFeng Chen2021-08-315-0/+57
* | | | | | | | | | | Merge pull request #6980 from vonchenplus/fix_blend_equation_errorFernando S2021-09-081-4/+4
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Fix blend equation enum errorFeng Chen2021-09-071-4/+4
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6971 from bunnei/buffer-queue-keventAmeer J2021-09-083-14/+24
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-09-053-14/+24
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6977 from Moonlacer/masterAmeer J2021-09-072-3/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Second part of Golden's PRMoonlacer2021-09-062-3/+3
| |/ / / / / / / / / /
* | / / / / / / / / / Rename all shader cache references to pipeline cacheMatías Locatti2021-09-061-4/+4
| |/ / / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #6965 from bunnei/cpu_manager_jthreadbunnei2021-09-062-18/+13
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | core: cpu_manager: Use jthread.bunnei2021-09-042-18/+13
| | |/ / / / / / / | |/| | | | | | |
* / | | | | | | | core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-09-044-16/+30
|/ / / / / / / /
* | | | | | | | Merge pull request #6900 from ameerj/attr-reorderbunnei2021-09-027-10/+140
|\ \ \ \ \ \ \ \
| * | | | | | | | structured_control_flow: Skip reordering nested demote branches.ameerj2021-08-301-0/+11
| * | | | | | | | structured_control_flow: Conditionally invoke demote reorder passameerj2021-08-307-10/+23
| * | | | | | | | structured_control_flow: Add DemoteCombinationPassameerj2021-08-281-1/+107
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | common/logging: Add missing includegerman772021-09-021-0/+1
| |_|_|_|_|/ / |/| | | | | |
* | | | | | | Merge pull request #6897 from FernandoS27/pineapple-does-not-belong-in-pizzabunnei2021-08-3113-126/+220
|\ \ \ \ \ \ \
| * | | | | | | Garbage Collection: Make it more agressive on high priority mode.Fernando Sahmkow2021-08-293-5/+5
| * | | | | | | Garbage Collection: Adress Feedback.Fernando Sahmkow2021-08-294-17/+23
| * | | | | | | Garbage Collection: enable as default, eliminate option.Fernando Sahmkow2021-08-289-26/+2
| * | | | | | | VideoCore: Rework Garbage Collection.Fernando Sahmkow2021-08-286-101/+213
| |/ / / / / /
* | | | | | | Merge pull request #6928 from ameerj/spirv-get-frontfacebunnei2021-08-311-2/+3
|\ \ \ \ \ \ \
| * | | | | | | emit_spirv_context_get_set: Fix Get FrontFace return valueameerj2021-08-271-2/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #6879 from ameerj/decoder-assertbunnei2021-08-312-9/+3
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | vk_blit_screen: Fix non-accelerated texture size calculationameerj2021-08-162-9/+3
* | | | | | | Merge pull request #6905 from Morph1984/nifm-miscbunnei2021-08-292-137/+147
|\ \ \ \ \ \ \
| * | | | | | | service: nifm: Populate fields in GetCurrentNetworkProfileMorph2021-08-271-29/+37
| * | | | | | | service: nifm: Cleanup GetCurrentIpConfigInfoMorph2021-08-271-26/+21
| * | | | | | | network_interface: Cleanup codeMorph2021-08-271-76/+83
| * | | | | | | network_interface: Replace default return value with std::nulloptMorph2021-08-271-6/+6
* | | | | | | | Merge pull request #6921 from ameerj/vp9-unusedbunnei2021-08-292-56/+30
|\ \ \ \ \ \ \ \
| * | | | | | | | vp9_types: Minor refactor of VP9 info structs.ameerj2021-08-261-32/+29
| * | | | | | | | vp9_types: Remove unused Vp9PictureInfo membersameerj2021-08-262-24/+1
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #6927 from german77/ngctMorph2021-08-296-0/+72
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | ngct: Stub NGCT:U servicegerman772021-08-276-0/+72
| | |/ / / / / | |/| | | | |
* / | | | | | Revert "logging: Display backtrace on crash"Morph2021-08-272-114/+1
|/ / / / / /
* | | | | | Merge pull request #6870 from yzct12345/trace-back-stack-back-stack-backbunnei2021-08-272-1/+114
|\ \ \ \ \ \
| * | | | | | logging: Display backtrace on crashyzct123452021-08-132-1/+114
* | | | | | | Revert "kernel: Various improvements to scheduler"bunnei2021-08-2623-224/+140
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #6919 from ameerj/vk-int8-capabilityFernando S2021-08-253-9/+19
|\ \ \ \ \ \
| * | | | | | vulkan_device: Add a check for int8 supportameerj2021-08-253-9/+19
* | | | | | | Merge pull request #6894 from FernandoS27/bunneis-left-earAmeer J2021-08-251-0/+1
|\ \ \ \ \ \ \
| * | | | | | | GPU_MemoryManger: Fix GetSubmappedRange.Fernando Sahmkow2021-08-191-0/+1
* | | | | | | | logging: Fix log filter during initializationameerj2021-08-244-12/+16
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #6878 from BreadFish64/optimize-GetHostThreadIDAmeer J2021-08-241-10/+13
|\ \ \ \ \ \ \
| * | | | | | | kernel: Optimize GetHostThreadIDBreadFish642021-08-161-10/+13
* | | | | | | | Merge pull request #6912 from lioncash/pluralbunnei2021-08-241-1/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | CMakeLists: Ensure proper numerusform tags are generated for pluralized translationsLioncash2021-08-221-1/+8
* | | | | | | | | Merge pull request #6869 from yzct12345/shiny-logs-in-the-fireplacebunnei2021-08-238-292/+243
|\ \ \ \ \ \ \ \ \ | | |_|_|/ / / / / | |/| | | | | | |
| * | | | | | | | logging: Simplify and make thread-safeyzct123452021-08-138-292/+243
* | | | | | | | | settings: Amend language_index maximum setting rangeMorph2021-08-211-1/+1
| |_|_|_|_|/ / / |/| | | | | | |
* | | | | | | | Merge pull request #6888 from v1993/patch-3Ameer J2021-08-211-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: eliminate constant ternaryValeri2021-08-191-1/+1
* | | | | | | | | Merge pull request #6877 from MerryMage/dyn-ignore-assertsbunnei2021-08-203-3/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | xbyak: Update include pathMerry2021-08-153-3/+3
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6887 from v1993/patch-2Mai M2021-08-191-6/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | SPIR-V: Merge two ifs in EmitGetAttributeValeri2021-08-191-6/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6886 from Morph1984/error-code-64Mai M2021-08-191-6/+25
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | applet_error: Fix 64-bit error code conversionMorph2021-08-191-6/+25
| |/ / / / / / / /
* | | | | / / / / Replace QPoint with QPointF where applicableValeri2021-08-191-16/+18
| |_|_|_|/ / / / |/| | | | | | |
* | | | | | | | qt_software_keyboard: fix copy-paste errorValeri2021-08-191-1/+1
|/ / / / / / /
* | | | | | | Fix crash in logging in CreateStrayLayerValeri2021-08-191-1/+1
* | | | | | | Fix check is thread current in GetThreadContextValeri2021-08-191-1/+1
* | | | | | | Merge pull request #6832 from bunnei/scheduler-improvementsbunnei2021-08-1923-140/+224
|\ \ \ \ \ \ \
| * | | | | | | core: hle: kernel: Disable dispatch count tracking on single core.bunnei2021-08-143-5/+12
| * | | | | | | core: hle: kernel: k_thread: Mark KScopedDisableDispatch as nodiscard.bunnei2021-08-071-1/+1
| * | | | | | | core: cpu_manager: Use invalid core_id on init and simplify shutdown.bunnei2021-08-071-7/+3
| * | | | | | | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-08-073-14/+24
| * | | | | | | core: hle: kernel: k_auto_object: Add GetName method.bunnei2021-08-071-0/+4
| * | | | | | | core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-08-074-16/+30
| * | | | | | | core: hle: kernel: DisableDispatch on suspend threads.bunnei2021-08-071-0/+3
| * | | | | | | core: hle: kernel: k_scheduler: Improve DisableScheduling and EnableScheduling.bunnei2021-08-071-14/+9
| * | | | | | | core: cpu_manager: Use KScopedDisableDispatch.bunnei2021-08-071-7/+8
| * | | | | | | core: hle: kernel: Use CurrentPhysicalCoreIndex as appropriate.bunnei2021-08-071-6/+2
| * | | | | | | core: hle: kernel: k_scheduler: Remove unnecessary MakeCurrentProcess.bunnei2021-08-071-5/+0
| * | | | | | | core: hle: kernel: k_scheduler: Improve ScheduleImpl.bunnei2021-08-071-6/+7
| * | | | | | | core: hle: kernel: k_scheduler: Improve Unload.bunnei2021-08-071-17/+29
| * | | | | | | core: hle: kernel: k_process: DisableDispatch on main thread.bunnei2021-08-071-0/+1
| * | | | | | | core: hle: kernel: k_handle_table: Use KScopedDisableDispatch as necessary.bunnei2021-08-072-0/+8
| * | | | | | | core: hle: kernel: k_thread: Add KScopedDisableDispatch.bunnei2021-08-072-1/+47
| * | | | | | | core: hle: kernel: Ensure idle threads are closed before destroying scheduler.bunnei2021-08-073-24/+22
| * | | | | | | core: hle: kernel: Reflect non-emulated threads as core 3.bunnei2021-08-077-13/+15
| * | | | | | | core: cpu_manager: Use jthread.bunnei2021-08-072-18/+13
* | | | | | | | Merge pull request #6863 from spholz/fix-lan-playFernando S2021-08-1615-102/+408
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | network_interface: correct formattingSönke Holz2021-08-161-1/+1
| * | | | | | | network_interface: fix mingw-w64 buildspholz2021-08-161-1/+1
| * | | | | | | network: retrieve subnet mask and gateway infoSönke Holz2021-08-165-24/+137
| * | | | | | | configuration: fix mingw-w64 buildSönke Holz2021-08-131-2/+2
| * | | | | | | network: don't use reinterpret_cast in GetAvailableNetworkInterfacesspholz2021-08-131-7/+4
| * | | | | | | network: fix mingw-w64 buildSönke Holz2021-08-131-4/+4
| * | | | | | | network: don't use assert to check if no network interfaces are returnedSönke Holz2021-08-131-2/+4
| * | | | | | | configuration: move network_interface include to source fileSönke Holz2021-08-132-2/+1
| * | | | | | | network: use Common::BitCast instead of std::bit_castSönke Holz2021-08-131-2/+3
| * | | | | | | network: narrow down scope of "result" in win32 code forSönke Holz2021-08-131-4/+5
| * | | | | | | configuration: use tr instead of QStringLiteral for "None" item inSönke Holz2021-08-131-1/+1
| * | | | | | | network: use explicit bool conversions in GetAvailableNetworkInterfacesSönke Holz2021-08-131-1/+1
| * | | | | | | network: initialize ip_addr in GetHostIPv4Address()Sönke Holz2021-08-131-1/+1
| * | | | | | | nifm: use operator*() instead of .value() to get value of std::optionalSönke Holz2021-08-131-2/+2
| * | | | | | | nifm: treat a missing host IP address as a non-critical errorSönke Holz2021-08-131-2/+2
| * | | | | | | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-1244-1467/+1182
| |\ \ \ \ \ \ \
| * | | | | | | | network: correct formatting in network.cpp and network_interface.cppSönke Holz2021-08-122-8/+6
| * | | | | | | | configuration: add option to select network interfacespholz2021-08-1215-90/+278
| * | | | | | | | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-075-205/+52
| |\ \ \ \ \ \ \ \
| * | | | | | | | | network: GetAndLogLastError: ignore Errno::AGAINSönke Holz2021-08-071-1/+5
| * | | | | | | | | network: GetCurrentIpConfigInfo: return host IP addressSönke Holz2021-08-071-1/+4
| * | | | | | | | | network: fix fcntl cmdsSönke Holz2021-08-061-2/+2
* | | | | | | | | | Merge pull request #6861 from yzct12345/const-mempy-is-all-the-speedbunnei2021-08-151-57/+116
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | |
| * | | | | | | | | decoders: Templates allow memcpy optimizationsyzct123452021-08-121-57/+116
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | threadsafe_queue: Fix deadlockyzct123452021-08-131-6/+4
| |_|_|_|_|/ / / |/| | | | | | |
* | | | | | | | Merge pull request #6862 from german77/badsdlbunnei2021-08-131-0/+3
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | input_common: Disable sdl raw input modegerman772021-08-121-0/+3
| |/ / / / / /
* | | | | | | Merge pull request #6838 from ameerj/sws-alignbunnei2021-08-121-3/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | vic: Specify sws_scale height stride.ameerj2021-08-101-3/+2
* | | | | | | settings: Fix MSVC issueslat9nq2021-08-111-7/+22
* | | | | | | Merge pull request #6776 from lat9nq/ranged-settingsbunnei2021-08-111-26/+136
|\ \ \ \ \ \ \
| * | | | | | | settings: Use std::clamp where possiblelat9nq2021-07-311-39/+9
| * | | | | | | settings: Remove unnecessary std::move usageslat9nq2021-07-311-12/+12
| * | | | | | | settings: Fix function virtualizationlat9nq2021-07-301-12/+18
| * | | | | | | settings: Implement setting rangeslat9nq2021-07-301-18/+152
* | | | | | | | Merge pull request #6820 from yzct12345/split-cacheFernando S2021-08-1013-427/+420
|\ \ \ \ \ \ \ \
| * | | | | | | | texture_cache: Address ameerj's reviewyzct123452021-08-083-7/+4
| * | | | | | | | texture_cache: Address ameerj's reviewyzct123452021-08-074-10/+5
| * | | | | | | | texture_cache: Don't change copyright yearyzct123452021-08-054-4/+4
| * | | | | | | | texture_cache: Address ameerj's reviewyzct123452021-08-0512-1821/+1821
| * | | | | | | | texture_cache: Split templates outyzct123452021-08-057-1532/+1533
* | | | | | | | | Merge pull request #6837 from german77/no-pause-screenshotAmeer J2021-08-101-5/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | main: Avoid stopping emulation when taking a screenshotgerman772021-08-071-5/+2
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #6823 from yzct12345/memory-cleanupbunnei2021-08-102-491/+163
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | memory: Address lioncash's reviewyzct123452021-08-071-52/+6
| * | | | | | | | | memory: Dedup Read and Write and fix logging bugsyzct123452021-08-071-129/+115
| * | | | | | | | | memory: Clean up CopyBlock tooyzct123452021-08-051-36/+15
| * | | | | | | | | memory: Address lioncash's reviewyzct123452021-08-052-7/+8
| * | | | | | | | | memory: Clean up codeyzct123452021-08-052-329/+81
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6839 from ameerj/frame-cap-positonbunnei2021-08-091-30/+30
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | configure_general: Swap positions of speed limit and frame limit optionsameerj2021-08-081-30/+30
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6844 from ameerj/vp9-empty-frameMai M2021-08-092-3/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vp9: Ensure the first frame is completeameerj2021-08-082-3/+3
| |/ / / / / / / /
* | | | | | | | | yuzu-cmd/CMakeLists: Correct attribution for this function.Fernando Sahmkow2021-08-082-0/+2
* | | | | | | | | Merge pull request #6834 from K0bin/buffer-image-granularityFernando S2021-08-082-2/+8
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vulkan_memory_allocator: Respect bufferImageGranularityRobin Kertels2021-08-072-2/+8
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #6698 from german77/SDL_QoLbunnei2021-08-084-33/+76
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | input_common: Improve SDL joystick and hide toggle optiongerman772021-08-084-33/+76
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6817 from gidoly/patch-1bunnei2021-08-081-2/+5
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | Update configure_graphics_advanced.uigidoly2021-08-051-2/+5
* | | | | | | | | Merge pull request #6827 from Morph1984/uuid-hashbunnei2021-08-081-0/+11
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | common: uuid: Add hash function for UUIDMorph2021-08-061-0/+11
* | | | | | | | | Merge pull request #6830 from ameerj/nvdec-unimpld-codecbunnei2021-08-071-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | nvdec: Better logging for unimplemented codecsameerj2021-08-071-1/+1
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #6795 from sankasan/cmd-remove-cursor-fullscreenbunnei2021-08-074-0/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu-cmd: hide cursor when in fullscreensan2021-08-014-0/+9
* | | | | | | | | Merge pull request #6815 from german77/ui_improvementsbunnei2021-08-072-21/+46
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | settings_ui: Add emulated joystick position dot to controller previewgerman772021-08-042-21/+46
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6791 from ameerj/astc-optbunnei2021-08-077-421/+251
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | astc_decoder: Reduce workgroup sizeameerj2021-08-013-5/+5
| * | | | | | | | astc_decoder: Compute offset swizzles in-shaderameerj2021-08-014-109/+25
| * | | | | | | | astc_decoder: Make use of uvec4 for payload dataameerj2021-08-011-79/+43
| * | | | | | | | astc_decoder: Simplify Select2DPartitionameerj2021-08-011-38/+19
| * | | | | | | | astc_decoder: Optimize the use EncodingDataameerj2021-08-016-138/+108
| * | | | | | | | astc.h: Move data to cpp implementationameerj2021-08-012-64/+63
* | | | | | | | | Merge pull request #6799 from ameerj/vp9-fixesbunnei2021-08-075-205/+52
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | |
| * | | | | | | | nvhost_nvdec_common: Remove BufferMapameerj2021-08-072-76/+0
| * | | | | | | | vp9: Cleanup unused variablesameerj2021-08-073-58/+17
| * | | | | | | | vp9: Fix reference frame refreshesameerj2021-08-072-48/+31
| * | | | | | | | nvhost_nvdec_common: Stub UnmapBuffer Ioctlameerj2021-08-071-23/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #6822 from yzct12345/clion-assertbunnei2021-08-061-2/+6
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | assert: Verify formattingyzct123452021-08-051-2/+6
| * | | | | | | assert: Avoid empty macrosyzct123452021-08-051-2/+2
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #6813 from Morph1984/hex-string-to-uuidbunnei2021-08-052-0/+73
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | common: uuid: Add hex string to UUID constructorMorph2021-08-042-0/+73
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #6819 from Morph1984/i-am-dumbMai M2021-08-051-2/+4
|\ \ \ \ \ \
| * | | | | | applet_swkbd: Include the null terminator in the buffer size calculationMorph2021-08-051-2/+4
| |/ / / / /
* | | | | | Merge pull request #6818 from Morph1984/hex-util-bugMai M2021-08-051-1/+1
|\ \ \ \ \ \
| * | | | | | hex_util: Fix incorrect array size in AsArrayMorph2021-08-051-1/+1
| |/ / / / /
* / / / / / config: Read connected setting for controllerslat9nq2021-08-041-0/+3
|/ / / / /
* | | | | nvdec: Implement VA-API hardware video acceleration (#6713)yzct123452021-08-045-72/+175
* | | | | Merge pull request #6805 from lat9nq/fix-user-profilesMorph2021-08-031-5/+6
|\ \ \ \ \
| * | | | | config: Only read/write current_user on global configlat9nq2021-08-031-5/+6
* | | | | | network: fix ternary operator in Socket::SendTospholz2021-08-021-1/+1
|/ / / / /
* | | / / decoders: Optimize swizzle copy performance (#6790)yzct123452021-08-021-9/+43
| |_|/ / |/| | |
* | | | game_list: Make game list folder icons smaller (#6762)Malte Jürgens2021-08-016-28/+70
* | | | service: set: Correct copy amount in GetAvailableLanguageCodesMorph2021-08-011-1/+2
* | | | Merge pull request #6720 from ameerj/vk-screenshotFernando S2021-08-018-75/+247
|\ \ \ \
| * | | | renderers: Add explicit invert_y bool to screenshot callbackameerj2021-07-295-7/+7
| * | | | renderer_vulkan: Implement screenshotsameerj2021-07-292-0/+152
| * | | | vk_blit_screen: Add public CreateFramebuffer methodameerj2021-07-292-14/+18
| * | | | vk_blit_screen: Make Draw method more genericameerj2021-07-293-55/+71
* | | | | Merge pull request #6765 from ReinUsesLisp/y-negate-vkAmeer J2021-08-011-2/+7
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | vk_rasterizer: Flip viewport on Y_NEGATEReinUsesLisp2021-07-291-2/+7
* | | | | hle: api_version: Update HOS version to 12.1.0Morph2021-07-311-7/+7
* | | | | Merge pull request #6752 from Morph1984/pt-brbunnei2021-07-305-11/+20
|\ \ \ \ \
| * | | | | configure_system: Add Brazilian Portuguese to the list of languagesMorph2021-07-302-1/+6
| * | | | | service: set: Correct 4.0.0 max_entries to 0x40 (64) instead of 17Morph2021-07-301-8/+8
| * | | | | service: ns, set: Add PT_BR (Brazilian Portuguese)Morph2021-07-303-2/+6
| | |_|/ / | |/| | |
* | | | | Merge pull request #6775 from lat9nq/cmd-remove-global-corebunnei2021-07-307-12/+23
|\ \ \ \ \
| * | | | | emu_window: Remove global system instancelat9nq2021-07-307-12/+23
| |/ / / /
* | | | | Merge pull request #6759 from ReinUsesLisp/pipeline-statisticsbunnei2021-07-3019-24/+307
|\ \ \ \ \
| * | | | | renderer_vulkan: Add setting to log pipeline statisticsReinUsesLisp2021-07-2819-24/+307
| | |_|_|/ | |/| | |
* | | | | applet_swkbd: Correct string buffer size calculationMorph2021-07-301-2/+2
| |/ / / |/| | |
* | | | Merge pull request #6767 from ReinUsesLisp/fold-float-packMorph2021-07-301-0/+4
|\ \ \ \
| * | | | shader: Fold UnpackFloat2x16 and PackFloat2x16ReinUsesLisp2021-07-301-0/+4
* | | | | Merge pull request #6722 from ReinUsesLisp/xmad-optsbunnei2021-07-302-14/+195
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | shader: Fold integer FMA from Nvidia's patternReinUsesLisp2021-07-261-0/+175
| * | | | shader: Use TryInstRecursive on XMAD multiply foldingReinUsesLisp2021-07-261-14/+12
| * | | | shader: Add TryInstRecursive utility to valuesReinUsesLisp2021-07-261-0/+8
* | | | | Merge pull request #6751 from Morph1984/languagecodeAmeer J2021-07-292-42/+2
|\ \ \ \ \
| * | | | | service: ns: Remove unused ns_language headerMorph2021-07-271-42/+0
| * | | | | service: ns: Map ZH_TW and ZH_CN to Traditional/Simplified ChineseMorph2021-07-271-0/+2
* | | | | | Merge pull request #6742 from Morph1984/uuidbunnei2021-07-293-15/+15
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | common: uuid: Return a lower-case hex string in FormatMorph2021-07-273-15/+15
* | | | | | Merge pull request #6760 from ReinUsesLisp/fp16-collectbunnei2021-07-281-0/+2
|\ \ \ \ \ \
| * | | | | | shader: Mark ConvertF16F32 and ConvertF32F16 as fp16 instructionsReinUsesLisp2021-07-281-0/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #6758 from jbeich/fastmembunnei2021-07-281-2/+7
|\ \ \ \ \ \
| * | | | | | host_memory: Add workaround for FreeBSD 12Jan Beich2021-07-271-0/+5
| * | | | | | host_memory: Enable Linux implementation on FreeBSDJan Beich2021-07-271-2/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #6700 from lat9nq/fullscreen-enumbunnei2021-07-2810-63/+40
|\ \ \ \ \ \
| * \ \ \ \ \ Merge branch 'master' into fullscreen-enumlat9nq2021-07-25446-27291/+49716
| |\ \ \ \ \ \ | | | |_|/ / / | | |/| | | |
| * | | | | | configuration: Use combobox apply template where possiblelat9nq2021-07-232-35/+2
| * | | | | | general: Implement FullscreenMode enumerationlat9nq2021-07-238-28/+38
* | | | | | | Merge pull request #6671 from jls47/masterMorph2021-07-283-1/+23
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | qt_web_browser: Fix lambda capture for HIDButtonjls472021-07-271-1/+1
| * | | | | | qt_web_browser: Focus on the first link elementjls472021-07-273-0/+22
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #6749 from lioncash/rtargetbunnei2021-07-281-3/+3
|\ \ \ \ \ \
| * | | | | | render_target: Add missing initializer for size extentLioncash2021-07-271-3/+3
| |/ / / / /
* | | | | | Merge pull request #6730 from Morph1984/buf_to_stdstringbunnei2021-07-282-0/+15
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | common: fs: fs_util: Add BufferToUTF8StringMorph2021-07-272-0/+15
| |/ / / /
* | | | | Merge pull request #6748 from lioncash/engine-initRodrigo Locatti2021-07-272-2/+2
|\ \ \ \ \
| * | | | | video_core/engine: Consistently initialize rasterizer pointersLioncash2021-07-272-2/+2
| |/ / / /
* | | | | Merge pull request #6744 from lioncash/excRodrigo Locatti2021-07-271-6/+6
|\ \ \ \ \
| * | | | | exception: Make constructors explicitLioncash2021-07-271-4/+4
| * | | | | exception: Make what() member function nodiscardLioncash2021-07-271-1/+1
| * | | | | exception: Narrow down specific headerLioncash2021-07-271-1/+1
| |/ / / /
* | | | | Merge pull request #6745 from lioncash/copiesbunnei2021-07-273-5/+2
|\ \ \ \ \
| * | | | | buffer_cache: Remove unused small_vector in CommitAsyncFlushesHigh()Lioncash2021-07-271-1/+0
| * | | | | gl_shader_cache: Remove unused variableLioncash2021-07-271-1/+0
| * | | | | vk_compute_pass: Remove unused capturesLioncash2021-07-271-3/+2
| |/ / / /
* / / / / vulkan_wrapper: Fix SetObjectName() always indicating objects as imagesLioncash2021-07-271-1/+1
|/ / / /
* | | | Merge pull request #6696 from ameerj/speed-limit-renamebunnei2021-07-2718-88/+80
|\ \ \ \
| * | | | renderer_base: Removed redundant settingsameerj2021-07-243-12/+4
| * | | | general: Rename "Frame Limit" references to "Speed Limit"ameerj2021-07-2416-77/+77
| |/ / /
* | | | Merge pull request #6741 from ReinUsesLisp/stream-removeRodrigo Locatti2021-07-272-244/+0
|\ \ \ \
| * | | | vk_stream_buffer: Remove unused stream bufferReinUsesLisp2021-07-262-244/+0
* | | | | Merge pull request #6740 from K0bin/hvv-fallbackRodrigo Locatti2021-07-271-8/+21
|\ \ \ \ \
| * | | | | vk_staging_buffer_pool: Fall back to host memory when allocation failsRobin Kertels2021-07-261-8/+21
* | | | | | Merge pull request #6728 from ReinUsesLisp/null-buffer-usageRodrigo Locatti2021-07-261-3/+7
|\ \ \ \ \ \
| * | | | | | vk_buffer_cache: Add transform feedback usage to null bufferReinUsesLisp2021-07-261-3/+7
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #6729 from ReinUsesLisp/quad-indexed-barrierRodrigo Locatti2021-07-261-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | vk_compute_pass: Fix pipeline barrier for indexed quadsReinUsesLisp2021-07-261-1/+1
| |/ / / /
* | | | | Merge pull request #6724 from lioncash/nodisc-shaderRodrigo Locatti2021-07-262-4/+4
|\ \ \ \ \
| * | | | | shader_recompiler: Remove unnecessary [[nodiscard]] instancesLioncash2021-07-262-4/+4
| | |_|_|/ | |/| | |
* | | | | Merge pull request #6726 from lioncash/hguardRodrigo Locatti2021-07-261-0/+2
|\ \ \ \ \
| * | | | | emit_spirv_instructions: Add missing header guardLioncash2021-07-261-0/+2
| |/ / / /
* | | | | Merge pull request #6727 from lioncash/topologyRodrigo Locatti2021-07-261-1/+1
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | emit_glasm: Fix LINESS_ADJACENCY typo in InputPrimitive()Lioncash2021-07-261-1/+1
| |/ / /
* | | | configure_graphics: reword GLASM optionVamsi Krishna2021-07-261-1/+1
* | | | Merge pull request #6723 from lioncash/shaderRodrigo Locatti2021-07-261-0/+1
|\ \ \ \
| * | | | object_pool: Add missing return in Chunk move assignment operatorLioncash2021-07-261-0/+1
| |/ / /
* | | | Merge pull request #6725 from lioncash/control-tokenRodrigo Locatti2021-07-261-1/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | control_flow: Fix duplicate switch case in OpcodeTokenLioncash2021-07-261-1/+1
| |/ /
* | | Merge pull request #6697 from ameerj/fps-capbunnei2021-07-268-6/+49
|\ \ \ | |/ / |/| |
| * | config, nvflinger: Add FPS cap settingameerj2021-07-248-6/+49
| |/
* | Merge pull request #6575 from FernandoS27/new_settingsbunnei2021-07-252-39/+45
|\ \
| * | Update src/yuzu/main.cppFernando S2021-07-091-2/+2
| * | Settings: Eliminate ASYNC & MULTICORE Toggles and add GPU Accuracy Toggle.Fernando Sahmkow2021-07-092-39/+45
* | | Merge pull request #6709 from ameerj/screenshot-pathMorph2021-07-251-1/+1
|\ \ \
| * | | main: Fix screenshot filepath constructionameerj2021-07-251-1/+1
* | | | Merge pull request #6585 from ameerj/hadesbunnei2021-07-25425-27155/+49339
|\ \ \ \ | |/ / / |/| | |
| * | | shader: Support out of bound local memory reads and immediate writesReinUsesLisp2021-07-231-4/+21
| * | | vulkan/blit_image: Commit descriptor sets within worker threadReinUsesLisp2021-07-231-9/+7
| * | | vulkan_device: Blacklist Volta and older from VK_KHR_push_descriptorReinUsesLisp2021-07-231-4/+39
| * | | qt: Remove "experimental" from asynchronous shader building UIReinUsesLisp2021-07-231-1/+1
| * | | Revert "renderers: Disable async shader compilation"ReinUsesLisp2021-07-232-5/+3
| * | | opengl: Fix asynchronous shadersReinUsesLisp2021-07-232-4/+33
| * | | shader_environment: Receive cache version from outsideReinUsesLisp2021-07-234-16/+23
| * | | cmake: Remove shader cache versionReinUsesLisp2021-07-233-12/+1
| * | | shader: Fix disabled attribute default valuesameerj2021-07-232-2/+2
| * | | gl_device: Simplify GLASM setting logicameerj2021-07-231-15/+8
| * | | glsl: Simplify FCMP emissionameerj2021-07-231-6/+4
| * | | glsl: Update TessellationControl gl_inameerj2021-07-231-0/+28
| * | | renderer_opengl: Use ARB_separate_shader_objectsReinUsesLisp2021-07-239-116/+154
| * | | shader: Implement ISETP.Xameerj2021-07-234-44/+57
| * | | shader: Avoid usage of C++20 ranges to build in clangReinUsesLisp2021-07-2311-39/+47
| * | | glsl: Clamp shared mem size to GL_MAX_COMPUTE_SHARED_MEMORY_SIZEameerj2021-07-233-2/+12
| * | | gl_shader_cache: Properly implement asynchronous shadersReinUsesLisp2021-07-231-1/+1
| * | | shader_recompiler, video_core: Resolve clang errorslat9nq2021-07-2314-44/+40
| * | | main: Update Shader Cache menu optionsameerj2021-07-234-16/+64
| * | | renderers: Fix clang formattingameerj2021-07-234-9/+13
| * | | shader: Manually convert from array<u32> to bitset instead of using bit_castReinUsesLisp2021-07-231-2/+3
| * | | renderers: Disable async shader compilationameerj2021-07-232-3/+5
| * | | maxwell_to_vk: Add R16_SNORMReinUsesLisp2021-07-232-1/+2
| * | | configure_graphics: Mark SPIR-V as Experimental, Mesa onlylat9nq2021-07-231-1/+1
| * | | glsl: Fix tracking of info.uses_shadow_lodameerj2021-07-231-4/+4
| * | | shader: Ignore global memory ops on devices lacking int64 supportameerj2021-07-238-30/+79
| * | | vulkan_device: Add missing include algorithmlat9nq2021-07-231-0/+1
| * | | vulkan_device: Blacklist ampere devices from float16 mathameerj2021-07-232-12/+23
| * | | dual_vertex_pass: Clang formatameerj2021-07-231-14/+14
| * | | gl_shader_cache: Fixes for async shadersameerj2021-07-232-2/+25
| * | | vulkan_device: Enable VK_EXT_extended_dynamic_state on RADV 21.2 onwardReinUsesLisp2021-07-231-4/+7
| * | | emit_spirv: Workaround VK_KHR_shader_float_controls on fp16 NvidiaReinUsesLisp2021-07-234-5/+12
| * | | configure_graphics: Re-order vulkan device populatinglat9nq2021-07-231-4/+4
| * | | shader: GCC fmt 8.0.0 fixeslat9nq2021-07-237-16/+19
| * | | shader: Account for 33-bit IADD3 scenarioameerj2021-07-231-2/+10
| * | | shader: Only apply shift on register mode for IADD3ReinUsesLisp2021-07-231-10/+14
| * | | vk_rasterizer: Workaround bug in VK_EXT_vertex_input_dynamic_stateReinUsesLisp2021-07-234-19/+20
| * | | shader: Fix disabled and unwritten attributes and varyingsReinUsesLisp2021-07-233-18/+31
| * | | glsl: Fix shared and local memory declarationsameerj2021-07-231-3/+3
| * | | opengl: Implement LOP.CCameerj2021-07-232-6/+38
| * | | vk_graphics_pipeline: Implement smooth linesReinUsesLisp2021-07-235-5/+65
| * | | vk_graphics_pipeline: Implement line widthReinUsesLisp2021-07-238-8/+36
| * | | spirv: Fix code emission when descriptor aliasing is unsupportedReinUsesLisp2021-07-231-1/+2
| * | | video_core: Enable GL SPIR-V shaderslat9nq2021-07-237-38/+105
| * | | general: Add setting shader_backendlat9nq2021-07-2314-87/+182
| * | | glsl: Declare local memory in mainameerj2021-07-231-3/+3
| * | | glsl: Add passthrough geometry shader supportameerj2021-07-233-7/+27
| * | | shader: Use std::bit_cast instead of Common::BitCast for passthroughReinUsesLisp2021-07-231-2/+3
| * | | glasm: Add passthrough geometry shader supportReinUsesLisp2021-07-235-8/+33
| * | | shader: Rework varyings and implement passthrough geometry shadersReinUsesLisp2021-07-2329-331/+345
| * | | vk_graphics_pipeline: Implement conservative renderingReinUsesLisp2021-07-236-10/+44
| * | | shader: Only verify shader when graphics debugging is enabledReinUsesLisp2021-07-231-2/+7
| * | | shader: Unify shader stage typesReinUsesLisp2021-07-2315-55/+37
| * | | lower_int64_to_int32: Add missing includelat9nq2021-07-231-0/+1
| * | | shader: Emulate 64-bit integers when not supportedReinUsesLisp2021-07-236-2/+16
| * | | shader: Add int64 to int32 lowering passReinUsesLisp2021-07-233-0/+218
| * | | shader: Teach global memory base tracker to follow vectorsReinUsesLisp2021-07-231-15/+14
| * | | shader: Add constant propagation to integer vectorsReinUsesLisp2021-07-231-0/+9
| * | | glsl: Better IAdd Overflow CC fixameerj2021-07-232-11/+13
| * | | shader: Remove IAbs64ReinUsesLisp2021-07-239-26/+3
| * | | glsl: Fix IADD CCameerj2021-07-232-5/+7
| * | | shader_recompiler: Fix IADD3 input partitioningameerj2021-07-231-14/+13
| * | | shader: Move loop safety tests to code emissionReinUsesLisp2021-07-2316-108/+54
| * | | gl_graphics_pipeline: Fix assembly shaders check for transform feedbacksReinUsesLisp2021-07-231-1/+1
| * | | glsl: Remove frag color initializationameerj2021-07-231-9/+0
| * | | glasm: Implement SetAttribute ViewportMaskameerj2021-07-232-1/+10
| * | | gl_graphics_pipeline: Inline hash and operator== key functionsReinUsesLisp2021-07-232-12/+8
| * | | gl_shader_cache: Check previous pipeline before checking hash mapReinUsesLisp2021-07-235-29/+41
| * | | gl_graphics_pipeline: Port optimizations from Vulkan pipelinesReinUsesLisp2021-07-232-57/+141
| * | | emit_glsl_special: Skip initialization of frag_color0ameerj2021-07-231-1/+1
| * | | shader: Calibrate loop safety thresholdReinUsesLisp2021-07-231-1/+1
| * | | buffer_cache: Fix debugging leftoverReinUsesLisp2021-07-231-1/+1
| * | | glsl: Add missing ; in EmitSetSampleMaskMorph2021-07-231-1/+1
| * | | buffer_cache: Fix size reductions not having in mind bind sizesReinUsesLisp2021-07-231-7/+23
| * | | glsl: Fix output varying initialization when transform feedback is usedameerj2021-07-231-3/+37
| * | | shaders: Allow shader notify when async shaders is disabledameerj2021-07-232-11/+9
| * | | texture_pass: Fix is_read image qualificationameerj2021-07-231-1/+1
| * | | shader: Align constant buffer sizes to 16 bytesReinUsesLisp2021-07-231-1/+2
| * | | spirv: Properly handle devices without int8 and int16ReinUsesLisp2021-07-232-39/+67
| * | | spirv: Handle small storage buffer loads on devices with no supportReinUsesLisp2021-07-232-6/+6
| * | | vk_graphics_pipeline: Use VK_KHR_push_descriptor when availableReinUsesLisp2021-07-238-36/+88
| * | | glsl: Fix cbuf component indexing bug falbackameerj2021-07-231-7/+6
| * | | shader: Simplify MergeDualVertexProgramsReinUsesLisp2021-07-231-6/+4
| * | | shader: Properly manage attributes not written from previous stagesReinUsesLisp2021-07-2312-41/+62
| * | | glsl: Only declare fragment outputs on fragment shadersReinUsesLisp2021-07-231-4/+6
| * | | shader: Split profile and runtime info headersReinUsesLisp2021-07-2313-77/+93
| * | | shader: Add support for native 16-bit floatsReinUsesLisp2021-07-239-14/+50
| * | | shader: Rename maxwell/program.h to translate_program.hReinUsesLisp2021-07-235-11/+6
| * | | vulkan_device: Blacklist VK_EXT_vertex_input_dynamic_state on IntelReinUsesLisp2021-07-231-0/+4
| * | | glsl: Obey need_declared_frag_colors to declare and initialize all frag_colorameerj2021-07-232-1/+10
| * | | glsl: Address rest of feedbackameerj2021-07-2311-38/+86
| * | | glsl: Move gl_Position/generic attribute initialization to EmitProlgueameerj2021-07-232-14/+12
| * | | glsl: Conditionally use fine/coarse derivatives based on device supportameerj2021-07-234-4/+29
| * | | glsl: Cleanup/Address feedbackameerj2021-07-2310-28/+24
| * | | gl_shader_cache: Implement async shadersameerj2021-07-237-107/+154
| * | | glsl: Add Shader_GLSL loggingameerj2021-07-233-28/+32
| * | | glsl: Add LoopSafety instructionsameerj2021-07-232-0/+10
| * | | glsl: Conditionally add EXT_texture_shadow_lodameerj2021-07-233-4/+15
| * | | glsl: Add stubs for sparse queries and variable aoffi when not supportedameerj2021-07-237-13/+47
| * | | glsl: Implement legacy varyingsameerj2021-07-236-8/+81
| * | | gl_shader_cache: Remove const from pipeline source argumentsameerj2021-07-234-6/+6
| * | | gl_shader_cache: Move OGL shader compilation to the respective Pipeline constructorameerj2021-07-235-76/+79
| * | | glsl: Minor cleanupameerj2021-07-232-19/+15
| * | | glsl: Fix Cbuf getters for F32 typeameerj2021-07-231-12/+15
| * | | glsl: Add immediate index oob checking for Cbuf gettersameerj2021-07-231-0/+16
| * | | glsl: Refactor GetCbuf functions to reduce code duplicationameerj2021-07-231-104/+66
| * | | glsl: Address more feedback. Implement indexed texture readsameerj2021-07-236-114/+112
| * | | glsl: Remove Signed Integer variablesameerj2021-07-238-43/+13
| * | | glsl: Address Rodrigo's feedbackameerj2021-07-2313-75/+87
| * | | glsl: Reorganize backend code, remove unneeded [[maybe_unused]]ameerj2021-07-2312-315/+251
| * | | glsl: Implement SampleId and SetSampleMaskameerj2021-07-233-30/+35
| * | | glsl: Add gl_PerVertex in for GSameerj2021-07-231-1/+2
| * | | glsl: Use existing tracking for enabling EXT_shader_image_load_formattedameerj2021-07-231-15/+1
| * | | glsl: Enable early fragment testsameerj2021-07-232-4/+7
| * | | gl_rasterizer: Add texture fetch barrier for fragmentsameerj2021-07-231-1/+1
| * | | glsl: Implement more attribute getters and settersameerj2021-07-232-12/+60
| * | | glsl: Implement fswzaddameerj2021-07-235-5/+45
| * | | glsl: Implement indexed attribute loadsameerj2021-07-235-29/+64
| * | | glsl: Conditionally add GL_ARB_sparse_texture2ameerj2021-07-231-2/+3
| * | | glsl: Rebase fixesameerj2021-07-232-3/+5
| * | | glsl: Conditionally use GL_EXT_shader_image_load_formattedameerj2021-07-231-2/+18
| * | | glsl: Remove output generic indexing for geometry stageameerj2021-07-231-5/+3
| * | | glsl: Allow dynamic tracking of variable allocationameerj2021-07-233-21/+35
| * | | glsl: Implement barriersameerj2021-07-233-13/+21
| * | | glsl: Implement image atomics and set layerameerj2021-07-235-153/+202
| * | | glsl: Fix image gather logicameerj2021-07-231-0/+4
| * | | glsl: Add cbuf access workaround for devices with component indexing bugameerj2021-07-232-51/+112
| * | | glsl: Use textureGrad fallback when EXT_texture_shadow_lod is unsupportedameerj2021-07-234-8/+42
| * | | emit_glsl_image: Use immediate offsets when possibleameerj2021-07-231-12/+33
| * | | glsl: Fix <32-bit SSBO writesameerj2021-07-234-50/+43
| * | | glsl: Cleanup and address feedbackameerj2021-07-2310-86/+69
| * | | glsl: Refactor Global memory functionsameerj2021-07-232-71/+73
| * | | glsl: Increase NUM_VARS that can be allocatedameerj2021-07-231-1/+1
| * | | glsl: Implement Load/WriteGlobalameerj2021-07-239-98/+185
| * | | glsl: Implement Imagesameerj2021-07-232-9/+74
| * | | glsl: skip gl_ViewportIndex write if device does not support itameerj2021-07-235-8/+18
| * | | glsl: Implement transform feedbackameerj2021-07-234-18/+76
| * | | glsl: Yet another gl_ViewportIndex fix attemptameerj2021-07-231-3/+19
| * | | glsl: Add gl_ViewportIndex out attributeameerj2021-07-231-1/+3
| * | | emit_glsl_context_get_set: Remove unused functionlat9nq2021-07-231-4/+0
| * | | glsl: Fix precise variable declarationameerj2021-07-233-24/+25
| * | | glsl: Implement tessellation shadersameerj2021-07-235-27/+146
| * | | glsl: Implement ImageGradient and other texture function variantsameerj2021-07-232-32/+73
| * | | glsl: Fix atomic SSBO offsetsameerj2021-07-234-67/+74
| * | | glsl: Implement geometry shadersameerj2021-07-234-9/+62
| * | | glsl: Use NotImplemented macro with function name outputameerj2021-07-2310-104/+103
| * | | glsl: Implement gl_ViewportIndexameerj2021-07-233-5/+14
| * | | glsl: SHFL fix and prefer shift operations over divide in glsl shaderameerj2021-07-235-63/+64
| * | | glsl: Implement precise fp variable allocationameerj2021-07-234-8/+67
| * | | HACK glsl: Write defaults to unused generic attributesameerj2021-07-232-2/+11
| * | | glsl: Fix ssbo indexing and name shadowing between shader stagesameerj2021-07-233-77/+101
| * | | glsl: implement set clip distanceameerj2021-07-232-0/+15
| * | | glsl: Rework var alloc to not assign unused resultsameerj2021-07-239-49/+91
| * | | glsl: Rework variable allocator to allow for variable reuseameerj2021-07-2314-353/+482
| * | | glsl: Fix ATOM and implement ATOMSameerj2021-07-235-114/+136
| * | | glsl: Use gl_SubGroupInvocationARBameerj2021-07-232-8/+7
| * | | glsl: Implement VOTE for subgroup size potentially largerameerj2021-07-235-20/+43
| * | | glsl: Implement VOTEameerj2021-07-234-50/+64
| * | | glsl: Implement ST{LS}ameerj2021-07-236-69/+106
| * | | glsl: Implement more instructions used by SMOameerj2021-07-231-3/+3
| * | | glsl: Implement more instructions used by SMOameerj2021-07-235-10/+16
| * | | glsl: Fix GetAttribute return valuesameerj2021-07-232-7/+9
| * | | glsl: minor cleanupameerj2021-07-234-20/+19
| * | | glsl: Fix and implement rest of cbuf accessameerj2021-07-231-7/+43
| * | | glsl: Implement TXQ and other misc changesameerj2021-07-235-6/+36
| * | | glsl: TLD4 implementationameerj2021-07-231-2/+89
| * | | glsl: Implement TLD instructionameerj2021-07-231-1/+55
| * | | glsl: Implement TEXSameerj2021-07-231-1/+29
| * | | glsl: Cleanup texture functionsameerj2021-07-231-13/+11
| * | | shader_recompiler: GCC fixeslat9nq2021-07-2314-3/+13
| * | | glsl: Implement TEX depth functionsameerj2021-07-232-4/+46
| * | | glsl: Implement TEX ImageSample functionsameerj2021-07-233-11/+71
| * | | glsl: Rework Shuffle emit instructions to align with SPIR-Vameerj2021-07-231-19/+40
| * | | glsl: Better Storage access and wip warpsameerj2021-07-238-62/+133
| * | | glsl: Fix integer conversions, implement clamp CCameerj2021-07-232-27/+36
| * | | glsl: Implement IADD CCameerj2021-07-232-2/+17
| * | | glsl: SSBO access fixes and wip SampleExplicitLod implementation.ameerj2021-07-232-4/+19
| * | | glsl: WIP var forward declarationameerj2021-07-236-49/+60
| * | | glsl: Fix bindings, add some CC opsameerj2021-07-238-57/+91
| * | | glsl: remove unused headersameerj2021-07-2314-34/+10
| * | | glsl: Implement derivatives and YDirectionameerj2021-07-238-81/+87
| * | | glsl: Fix non-immediate buffer accessameerj2021-07-2312-72/+133
| * | | glsl: textures wipameerj2021-07-239-75/+139
| * | | glsl: Implement some attribute getters and settersameerj2021-07-2310-192/+337
| * | | glsl: Track S32 atomicsameerj2021-07-233-6/+16
| * | | glsl: Update phi node managementameerj2021-07-234-21/+53
| * | | glsl: Fix floating point compare opsameerj2021-07-231-28/+28
| * | | glsl: Query GL Device for FP16 extension supportameerj2021-07-235-2/+23
| * | | glsl: Simply FP storage atomicsameerj2021-07-232-48/+28
| * | | glsl: F16x2 storage atomicsameerj2021-07-237-58/+64
| * | | glsl: Revert ssbo aliasing. Storage Atomics implameerj2021-07-235-75/+134
| * | | glsl: implement phi nodesameerj2021-07-234-20/+54
| * | | glsl: Wip storage atomic opsameerj2021-07-2310-327/+414
| * | | glsl: Implement FCMPameerj2021-07-233-242/+185
| * | | glsl: Add a more robust fp formatterameerj2021-07-234-9/+14
| * | | glsl: More FP fixesameerj2021-07-232-9/+16
| * | | glsl: FP function fixesameerj2021-07-237-17/+25
| * | | glsl: More FP instructions/fixesameerj2021-07-235-28/+41
| * | | glsl: Add many FP32/64 instructionsameerj2021-07-2312-765/+1011
| * | | glsl: Fixup build issuesReinUsesLisp2021-07-231-1/+1
| * | | glsl: Implement more Integer opsameerj2021-07-233-119/+72
| * | | glsl: Implement BF*ameerj2021-07-233-9/+10
| * | | glsl: Implement a few Integer instructionsameerj2021-07-2310-260/+398
| * | | glsl: Use std::string_view for Emit function args.ameerj2021-07-236-760/+838
| * | | glsl: Pass IR::Inst& to Emit functionsameerj2021-07-236-171/+169
| * | | glsl: INeg and IAdd negate testsameerj2021-07-233-94/+106
| * | | glsl: Reusable typed variables. IADD32ameerj2021-07-236-203/+311
| * | | glsl: Fix program linking and cbufameerj2021-07-232-3/+5
| * | | glsl: Fix "reg" allocingameerj2021-07-2310-898/+938
| * | | glsl: Initial backendameerj2021-07-2328-2/+3297
| * | | spirv: Reduce log severity of mismatching denorm rulesReinUsesLisp2021-07-231-2/+2
| * | | shader: Fix loop safety to SSA passReinUsesLisp2021-07-232-2/+4
| * | | vk_rasterizer: Exit render passes on fragment barriersReinUsesLisp2021-07-231-0/+1
| * | | vk_graphics_pipeline: Fix path with no VK_EXT_extended_dynamic_stateRodrigo Locatti2021-07-231-1/+1
| * | | buffer_cache: Invalidate fast buffers on computeReinUsesLisp2021-07-231-0/+1
| * | | shader: Add loggingReinUsesLisp2021-07-2315-28/+38
| * | | shader: Add shader loop safety check settingslat9nq2021-07-2316-35/+183
| * | | shader: Comment why the array component is not read in TMMLReinUsesLisp2021-07-231-0/+2
| * | | vulkan_device: Enable VK_EXT_vertex_input_dynamic_stateReinUsesLisp2021-07-231-0/+28
| * | | vk_pipeline_cache: Skip cached pipelines with different dynamic stateReinUsesLisp2021-07-231-0/+6
| * | | main: Fix Open Transferable Shader Cache context itemameerj2021-07-231-25/+5
| * | | tmml: Remove index component from coords vecameerj2021-07-231-4/+3
| * | | vulkan: Add VK_EXT_vertex_input_dynamic_state supportReinUsesLisp2021-07-2311-116/+291
| * | | shader: Reorder shader cache directoriesReinUsesLisp2021-07-232-18/+12
| * | | vk_rasterizer: Implement first indexReinUsesLisp2021-07-231-2/+5
| * | | vulkan: Use VK_EXT_provoking_vertex when availableReinUsesLisp2021-07-236-4/+52
| * | | spirv/convert: Catch more signed operations oversightsameerj2021-07-231-5/+5
| * | | spirv/convert: Catch more broken signed operations on Nvidia OpenGLReinUsesLisp2021-07-231-0/+6
| * | | gl_buffer_cache: Use unorm internal formats for snorm texture buffer viewsameerj2021-07-231-1/+24
| * | | shader_environment: Fix local memory size calculationsReinUsesLisp2021-07-231-3/+3
| * | | buffer_cache: Fix copy based uniform bindings trackingReinUsesLisp2021-07-232-9/+22
| * | | shader_environment: Add shader_local_memory_crs_size to local memory sizeameerj2021-07-232-3/+3
| * | | gl_texture_cache: Create image storage viewsReinUsesLisp2021-07-234-38/+126
| * | | gl_shader_util: Move shader utility code to a separate fileReinUsesLisp2021-07-237-245/+106
| * | | gl_shader_cache: Store workers in shader cache objectReinUsesLisp2021-07-232-58/+78
| * | | vk_pipeline_cache,shader_notify: Add shader notificationsReinUsesLisp2021-07-2310-96/+127
| * | | vk_pipeline_cache: Add asynchronous shadersReinUsesLisp2021-07-233-3/+33
| * | | vk_rasterizer: Flush work on clear and dispatchesReinUsesLisp2021-07-231-0/+3
| * | | DMA: Restrict optimised path for BlockToLinear further.FernandoS272021-07-231-1/+2
| * | | vk_swapchain: Handle outdated swapchainsReinUsesLisp2021-07-233-17/+34
| * | | shader: Fix VertexA Shaders.FernandoS272021-07-234-19/+51
| * | | shader: Add 2D and 3D variants to SUATOM and SUREDReinUsesLisp2021-07-231-0/+4
| * | | vk_buffer_cache: Handle null texture buffersReinUsesLisp2021-07-231-0/+4
| * | | nsight_aftermath_tracker: Fix SPIR-V module writesReinUsesLisp2021-07-231-1/+1
| * | | vk_pipeline_cache: Set support_derivative_control to trueReinUsesLisp2021-07-231-0/+1
| * | | shader: Avoid CPU side undefined behavior on I2FReinUsesLisp2021-07-231-0/+2
| * | | glasm: Use ARB_derivative_control conditionallyReinUsesLisp2021-07-236-7/+37
| * | | buffer_cache: Reduce uniform buffer size from shader usageReinUsesLisp2021-07-2311-38/+78
| * | | transform_feedback: Read buffer stride from index instead of layoutReinUsesLisp2021-07-231-1/+2
| * | | fixed_pipeline_state: Use regular for loop instead of ranges for perfReinUsesLisp2021-07-231-2/+3
| * | | vk_swapchain: Avoid recreating the swapchain on each frameReinUsesLisp2021-07-232-15/+9
| * | | emit_glasm_context_get_set: Remove unused variablelat9nq2021-07-231-1/+0
| * | | shader,glasm: Implement legacy texcoord loadsReinUsesLisp2021-07-233-54/+29
| * | | glasm: Implement legacy varyingsReinUsesLisp2021-07-231-17/+56
| * | | shader: Track legacy varyingsReinUsesLisp2021-07-232-17/+105
| * | | shader: Add support for "negative" and unaligned offsetsReinUsesLisp2021-07-233-8/+13
| * | | shader: Implement ISCADD32IReinUsesLisp2021-07-231-17/+31
| * | | spirv: Fix output generics with componentsReinUsesLisp2021-07-231-1/+1
| * | | vulkan: Conditionally use shaderInt16ReinUsesLisp2021-07-233-2/+9
| * | | vulkan: Enable depth bounds and use it conditionallyReinUsesLisp2021-07-234-2/+17
| * | | vk_buffer_cache: Add transform feedback usage to buffersReinUsesLisp2021-07-231-15/+22
| * | | opengl: Declare fragment outputs even if they are not usedReinUsesLisp2021-07-236-10/+18
| * | | buffer_cache: Mark uniform buffers as dirty if any enable bit changesReinUsesLisp2021-07-235-7/+17
| * | | shader: Always initialize up reference in structure control flowReinUsesLisp2021-07-231-31/+36
| * | | vulkan_device: Enable float64 and int64 conditionallyReinUsesLisp2021-07-232-2/+6
| * | | shader: Fix ImageWrite indexingReinUsesLisp2021-07-231-1/+1
| * | | spirv: Fix image and image buffer descriptor index usageReinUsesLisp2021-07-231-5/+7
| * | | glasm: Fix immediate texture coordinateReinUsesLisp2021-07-231-0/+1
| * | | shader: Clang-format secondary texturesReinUsesLisp2021-07-231-2/+2
| * | | shader: Fix secondary texturesReinUsesLisp2021-07-231-2/+2
| * | | shader: Adhere to disk shader cache settingameerj2021-07-232-9/+12
| * | | shader: Fix TMML queriesReinUsesLisp2021-07-231-5/+9
| * | | shader: Fix FSwizzleAdd folding when going through phi nodesReinUsesLisp2021-07-231-2/+2
| * | | shader/exception: Fix compilation errors on gccReinUsesLisp2021-07-231-6/+6
| * | | glasm: Reduce reg allocation leaks from an exception to a logReinUsesLisp2021-07-231-1/+1
| * | | texture_cache: Reduce invalid image/sampler error severityReinUsesLisp2021-07-231-7/+7
| * | | shader: Handle host exceptionsReinUsesLisp2021-07-238-45/+98
| * | | glasm: Use integer lod for TXQReinUsesLisp2021-07-232-2/+2
| * | | glasm: Prepare XFB from state instead of global registersReinUsesLisp2021-07-231-4/+2
| * | | glasm: Fix global memory fallbacksReinUsesLisp2021-07-231-9/+10
| * | | Revert "glasm: Skip phi moves on undefined instructions"ReinUsesLisp2021-07-232-16/+1
| * | | glasm: Remove unintentional '\n' on Undef32ReinUsesLisp2021-07-231-1/+1
| * | | glasm: Use storage buffers instead of global memory when possibleReinUsesLisp2021-07-2317-437/+503
| * | | glasm: Implement Y directionReinUsesLisp2021-07-234-3/+9
| * | | glasm: Skip phi moves on undefined instructionsReinUsesLisp2021-07-232-1/+16
| * | | glasm: Implement undef instructionsReinUsesLisp2021-07-232-15/+15
| * | | glasm: Fix global memory callbacksReinUsesLisp2021-07-231-5/+6
| * | | gl_shader_cache: Add disk shader cacheReinUsesLisp2021-07-233-11/+116
| * | | video_core,shader: Clang-format fixesReinUsesLisp2021-07-234-7/+12
| * | | gl_shader_cache: Rename Program abstractions into PipelineReinUsesLisp2021-07-2310-104/+104
| * | | glasm: Release phi node registers after they are no longer neededReinUsesLisp2021-07-232-38/+54
| * | | glasm: Remove unintentionally committed fmt::printsReinUsesLisp2021-07-231-2/+0
| * | | glasm: Fix INeg32 on negative immediatesReinUsesLisp2021-07-231-1/+5
| * | | glasm: Remove unnecessary value typesReinUsesLisp2021-07-233-47/+6
| * | | glasm: Throw when there are register leaksReinUsesLisp2021-07-232-0/+7
| * | | glasm: Catch more register leaksReinUsesLisp2021-07-238-41/+114
| * | | glasm: Fix usage counting on phi nodesReinUsesLisp2021-07-233-8/+22
| * | | gl_shader_cache: Do not flip tessellation on OpenGLReinUsesLisp2021-07-231-2/+1
| * | | gl_graphics_program: Fix texture buffer bindingsReinUsesLisp2021-07-231-24/+35
| * | | glasm: Implement global memory fallbacksReinUsesLisp2021-07-232-50/+89
| * | | glasm: Implement int64 add and subtractReinUsesLisp2021-07-232-8/+6
| * | | emit_glasm_context_get_set: Remove unused variablelat9nq2021-07-231-1/+0
| * | | glasm: Implement indirect attribute loadsReinUsesLisp2021-07-234-6/+65
| * | | glasm: Implement image atomicsReinUsesLisp2021-07-233-166/+153
| * | | glasm: Reorder unreachable image atomic instsReinUsesLisp2021-07-231-66/+66
| * | | glasm: Implement gl_Layer storesReinUsesLisp2021-07-231-0/+7
| * | | glasm: Implement SampleIdReinUsesLisp2021-07-232-3/+3
| * | | glasm: Implement IsHelperInvocationReinUsesLisp2021-07-232-3/+3
| * | | glasm: Fix EmitVertex's optimizationReinUsesLisp2021-07-231-1/+1
| * | | gl_shader_cache: Conditionally use viewport maskReinUsesLisp2021-07-231-1/+1
| * | | gl_shader_cache,glasm: Conditionally use typeless image reads extensionReinUsesLisp2021-07-233-39/+43
| * | | gl_shader_cache: Improve GLASM error print logicReinUsesLisp2021-07-231-7/+10
| * | | glasm: Implement forced early ZReinUsesLisp2021-07-232-4/+8
| * | | glasm: Set transform feedback stateReinUsesLisp2021-07-235-113/+132
| * | | video_core: Abstract transform feedback translation utilityReinUsesLisp2021-07-236-111/+145
| * | | glasm: Simplify patch readsReinUsesLisp2021-07-231-5/+2
| * | | glasm: Fix output patch readsReinUsesLisp2021-07-232-13/+22
| * | | gl_shader_cache: Pass shader runtime informationReinUsesLisp2021-07-231-2/+74
| * | | shader: Split profile and runtime information in separate structsReinUsesLisp2021-07-2314-308/+300
| * | | emit_glasm_context_get_and_set.cpp: Add missing semicolonsameerj2021-07-231-2/+2
| * | | glasm: Fix patch attribute declarationsReinUsesLisp2021-07-231-1/+1
| * | | glasm: Implement FSWZADDameerj2021-07-233-4/+28
| * | | glasm: Implement PrimitiveId attribute readReinUsesLisp2021-07-231-0/+3
| * | | glasm: Implement clip distance storesReinUsesLisp2021-07-232-0/+15
| * | | glasm: Fix tessellation input attributesReinUsesLisp2021-07-231-2/+5
| * | | glasm: Add missing semicolon on tesscoord readingReinUsesLisp2021-07-231-1/+1
| * | | glasm: Fix tessellation headersReinUsesLisp2021-07-231-2/+2
| * | | glasm: Add tessellation shader declarationsReinUsesLisp2021-07-231-0/+35
| * | | glasm: Implement TessellationEvaluationPointReinUsesLisp2021-07-231-0/+4
| * | | gl_shader_manager: Zero initialize current assembly programsReinUsesLisp2021-07-231-1/+1
| * | | gl_shader_manager: Remove unintentionally committed #pragmaReinUsesLisp2021-07-231-2/+0
| * | | glasm: Implement patch memoryReinUsesLisp2021-07-233-6/+51
| * | | glasm: Fix InvocationId declarationReinUsesLisp2021-07-231-1/+1
| * | | glasm: Implement InvocationIdReinUsesLisp2021-07-232-2/+5
| * | | glasm: Optimize EmitVertex into EMITReinUsesLisp2021-07-231-1/+5
| * | | glasm: Implement geometry shader attribute readsReinUsesLisp2021-07-232-4/+18
| * | | glasm: Properly declare attributes on geometry programsReinUsesLisp2021-07-233-6/+14
| * | | glasm: Declare geometry program headersReinUsesLisp2021-07-231-0/+35
| * | | renderer_opengl: State track compute assembly programsReinUsesLisp2021-07-233-4/+21
| * | | renderer_opengl: State track assembly programsReinUsesLisp2021-07-233-23/+56
| * | | glasm: Fix potential aliasing bug on cube array samplesReinUsesLisp2021-07-232-35/+44
| * | | glasm: Implement ImageWriteReinUsesLisp2021-07-231-4/+7
| * | | glasm: Implement ImageReadReinUsesLisp2021-07-234-4/+56
| * | | glasm: Implement EmitVertex and EndPrimitiveReinUsesLisp2021-07-232-4/+8
| * | | glasm: Implement ImageGradientReinUsesLisp2021-07-232-7/+65
| * | | glasm: Implement 64-bit shiftsReinUsesLisp2021-07-232-12/+14
| * | | glasm: Implement barriersReinUsesLisp2021-07-231-3/+3
| * | | glasm: Fix compute stage nameReinUsesLisp2021-07-231-1/+1
| * | | glasm: Fix phi instruction typesReinUsesLisp2021-07-231-1/+1
| * | | glasm: Implement PREC on relevant instructionsReinUsesLisp2021-07-231-6/+12
| * | | glasm: Implement stores to gl_ViewportIndexReinUsesLisp2021-07-234-7/+29
| * | | glasm: Implement gl_PointSize storesReinUsesLisp2021-07-231-0/+3
| * | | glasm: Implement gl_PointCoordReinUsesLisp2021-07-231-0/+4
| * | | glasm: Implement ImageQueryLodReinUsesLisp2021-07-231-3/+5
| * | | glasm: Implement ImageFetchReinUsesLisp2021-07-234-13/+38
| * | | glasm: Implement IADD.CCameerj2021-07-231-1/+26
| * | | glasm: Implement BFE.CCReinUsesLisp2021-07-231-0/+8
| * | | glasm: Implement SelectU1ReinUsesLisp2021-07-232-4/+5
| * | | HACK: Bind stages before and after bindingsReinUsesLisp2021-07-231-0/+11
| * | | glasm: Implement gl_WorkGroupIDReinUsesLisp2021-07-232-3/+3
| * | | glasm: Implement TXQ and improve texture info readsReinUsesLisp2021-07-232-50/+51
| * | | glasm: Implement gl_FrongFacing attributeReinUsesLisp2021-07-231-0/+3
| * | | glasm: Support textures used in more than one stageReinUsesLisp2021-07-234-5/+25
| * | | glasm: Implement textureGather instructionsReinUsesLisp2021-07-232-15/+97
| * | | glasm: Implement gl_FragDepth and gl_SampleMask storesReinUsesLisp2021-07-232-5/+5
| * | | glasm: Do not alias ConditionRef for nowReinUsesLisp2021-07-232-3/+2
| * | | shader: Read branch conditions from an instructionReinUsesLisp2021-07-2312-16/+36
| * | | glasm: Implement InstanceId and VertexIdReinUsesLisp2021-07-231-0/+6
| * | | glasm: Add missing return value on move assignmentReinUsesLisp2021-07-231-0/+1
| * | | glasm: Fix aliased bitcasts ref countingReinUsesLisp2021-07-233-13/+42
| * | | glasm: Remove unintentional comma on vector insertReinUsesLisp2021-07-231-1/+1
| * | | glasm: Implement TEX and TEXS instructionsReinUsesLisp2021-07-2310-69/+275
| * | | glasm: Add support for non-2D texture samplesReinUsesLisp2021-07-231-4/+26
| * | | glasm: Reorder unreachable image instructions to the bottomReinUsesLisp2021-07-231-97/+97
| * | | glasm: Add support for texture offsetsReinUsesLisp2021-07-231-11/+15
| * | | glasm: Improve texture sampling instructionsReinUsesLisp2021-07-232-50/+70
| * | | emit_glasm: Enable ARB_draw_buffers when neededReinUsesLisp2021-07-232-1/+5
| * | | emit_glasm: Add support for reading position attributesReinUsesLisp2021-07-231-3/+13
| * | | shader_recompiler: GCC fixeslat9nq2021-07-237-58/+55
| * | | glasm: Implement rest of shared memameerj2021-07-232-35/+29
| * | | opengl: Initial (broken) support to GLASM shadersReinUsesLisp2021-07-233-14/+53
| * | | shader: Use a non-trivial dummy to construct ASL node unionReinUsesLisp2021-07-231-1/+6
| * | | emit_spirv: Jump to loop body with local variableReinUsesLisp2021-07-231-1/+1
| * | | glasm: Implement derivative instructions on GLASMReinUsesLisp2021-07-232-12/+12
| * | | glasm: Initial (broken) implementation of TEX on GLASMReinUsesLisp2021-07-233-299/+386
| * | | glasm: Implement some graphics instructions on GLASMReinUsesLisp2021-07-232-6/+5
| * | | glasm: Add Void type to GLASM valuesReinUsesLisp2021-07-233-0/+15
| * | | glasm: Add graphics specific shader declarations to GLASMReinUsesLisp2021-07-232-6/+63
| * | | glasm: Implement local memory for glasmameerj2021-07-234-9/+12
| * | | emit_spirv: Add missing block in caseReinUsesLisp2021-07-231-1/+2
| * | | glasm: Initial implementation of phi nodes on GLASMReinUsesLisp2021-07-2312-25/+117
| * | | glasm: Write result to scalar on integer comparison instructionsReinUsesLisp2021-07-231-10/+10
| * | | glasm: Declare NV_shader_thread_group when neededReinUsesLisp2021-07-231-3/+4
| * | | vk_update_descriptor: Properly initialize payload on the update descriptor queueReinUsesLisp2021-07-231-1/+3
| * | | glasm: Rework control flow introducing a syntax listReinUsesLisp2021-07-2333-505/+437
| * | | glasm: Implement Storage atomicsameerj2021-07-235-109/+156
| * | | glasm: Ensure reg alloc order across compilers on GLASMReinUsesLisp2021-07-231-11/+14
| * | | glasm: Enable unintentionally disabled register aliasing on GLASMReinUsesLisp2021-07-231-16/+11
| * | | glasm: Review all GLASM insts to be aware of register aliasingReinUsesLisp2021-07-234-20/+51
| * | | glasm: Implement shuffle and vote instructions on GLASMReinUsesLisp2021-07-2310-100/+166
| * | | glasm: Add MUFU instructions to GLASMReinUsesLisp2021-07-232-21/+22
| * | | glasm: Implement IAbs64 and INeg64 on GLASMReinUsesLisp2021-07-232-6/+6
| * | | shader: Add floating-point rounding to I2FReinUsesLisp2021-07-233-35/+42
| * | | glasm: Properly clamp Fp64 on GLASMReinUsesLisp2021-07-231-6/+6
| * | | glasm: Fix register allocation when moving immediate on GLASMReinUsesLisp2021-07-233-42/+89
| * | | glasm: Implement SelectU64 on GLASMReinUsesLisp2021-07-232-4/+20
| * | | glasm: Fix clamps so the min value has priority on NAN on GLASMReinUsesLisp2021-07-231-12/+15
| * | | glasm: Fix moving U64 immediates to registers in GLASMReinUsesLisp2021-07-232-3/+4
| * | | glasm: Implement storage atomic opsameerj2021-07-234-305/+358
| * | | glasm: Add conversion instructions to GLASMReinUsesLisp2021-07-239-282/+351
| * | | glasm: Add fp min/max insts and fix store for fp64 on GLASMReinUsesLisp2021-07-232-10/+8
| * | | glasm: Add logical instructions on GLASMReinUsesLisp2021-07-232-12/+12
| * | | glasm: Remove duplicated Fp64 pack instructions on GLASMReinUsesLisp2021-07-231-8/+0
| * | | glasm: Remove unnecesary new white space on Clamp GLASMReinUsesLisp2021-07-231-4/+4
| * | | glasm: Add floating-point comparisons on GLASMReinUsesLisp2021-07-233-120/+116
| * | | emit_glasm: Implement more integer alu opsameerj2021-07-232-47/+41
| * | | glasm: Reimplement bitwise ops and BFI/BFEameerj2021-07-234-88/+108
| * | | glasm: Initial GLASM fp64 supportReinUsesLisp2021-07-239-55/+152
| * | | glasm: Implement GLASM fp16 packing and move bitwise insnsReinUsesLisp2021-07-234-66/+77
| * | | glasm: Remove unused functions left from rebaseReinUsesLisp2021-07-231-12/+0
| * | | glasm: Specify namespace when using FormatToReinUsesLisp2021-07-231-6/+6
| * | | glasm: Implement more GLASM composite instructionsReinUsesLisp2021-07-232-54/+63
| * | | vk_pipeline_cache: Enable int8 and int16 types on VulkanReinUsesLisp2021-07-231-0/+2
| * | | glasm: Make GLASM aware of typesReinUsesLisp2021-07-2312-1244/+1380
| * | | glasm: Use CMP.S for Select32ameerj2021-07-233-12/+8
| * | | glasm: Implement more logical opsameerj2021-07-232-5/+5
| * | | glasm: Implement BFI, BFEameerj2021-07-234-138/+164
| * | | glasm: Use BitField instead of C bitfieldsReinUsesLisp2021-07-232-8/+12
| * | | glasm: Remove unused argument in identity instructions on GLASMReinUsesLisp2021-07-231-7/+7
| * | | gl_rasterizer: Flush L2 caches before glFlush on GLASMReinUsesLisp2021-07-231-0/+8
| * | | glasm: Initial GLASM compute implementation for testingReinUsesLisp2021-07-233-14/+47
| * | | glasm: Implement basic GLASM instructionsReinUsesLisp2021-07-2310-840/+1173
| * | | glasm: Changes to GLASM register allocator and emit contextReinUsesLisp2021-07-234-26/+64
| * | | vk_scheduler: Use locks instead of SPSC a queueReinUsesLisp2021-07-232-32/+42
| * | | vk_query_cache: Wait before reading queriesReinUsesLisp2021-07-231-9/+2
| * | | vk_master_semaphore: Use fetch_add to increase master semaphore tickReinUsesLisp2021-07-232-6/+4
| * | | glasm: Add GLASM backend infrastructureReinUsesLisp2021-07-2328-4/+3115
| * | | shader: ISET.X implementationameerj2021-07-231-8/+58
| * | | gl_shader_cache: Remove code unintentionally committedReinUsesLisp2021-07-231-3/+0
| * | | shader: Fixup SPIR-V emit header namespacesReinUsesLisp2021-07-231-2/+2
| * | | Move SPIR-V emission functions to their own headerReinUsesLisp2021-07-2326-579/+637
| * | | shader: Optimize NVN FallthroughFernandoS272021-07-234-9/+83
| * | | shader: Stub SR_AFFINITYFernandoS272021-07-231-0/+3
| * | | shader: Implement Int32 SUATOM/SUREDameerj2021-07-2317-6/+733
| * | | shader: Initial OpenGL implementationReinUsesLisp2021-07-2338-705/+1427
| * | | spirv: Be aware of NAN unaware driversReinUsesLisp2021-07-231-18/+40
| * | | spirv: Add SSBO read fallbacks when no aliasing is availableReinUsesLisp2021-07-231-37/+99
| * | | spirv: Add OpKill fallback to demoteReinUsesLisp2021-07-231-2/+6
| * | | spirv: Do not enable ShaderLayerReinUsesLisp2021-07-231-3/+0
| * | | spirv: Enable DemoteToHelperInvocationEXT only when supportedReinUsesLisp2021-07-231-1/+1
| * | | spirv: Use OriginLowerLeft when requestedReinUsesLisp2021-07-231-1/+5
| * | | spirv: Only add image operands mask when neededReinUsesLisp2021-07-231-5/+9
| * | | spirv: Workaround image unsigned offset bugReinUsesLisp2021-07-232-9/+26
| * | | spirv: Add int8 and int16 capabilities only when supportedReinUsesLisp2021-07-231-2/+2
| * | | spirv: Add integer clamping workaroundsReinUsesLisp2021-07-231-4/+34
| * | | spirv: Implement int8 and int16 conversion fallbacksReinUsesLisp2021-07-231-19/+80
| * | | spirv: Support OpenGL uniform buffers and change bindingsReinUsesLisp2021-07-236-58/+168
| * | | spirv: Desambiguate descriptor namesReinUsesLisp2021-07-231-9/+37
| * | | shader: Add OpenGL shader profile optionsReinUsesLisp2021-07-231-0/+11
| * | | shader: Remove shader utilReinUsesLisp2021-07-234-176/+0
| * | | shader: Address feedbackFernandoS272021-07-235-44/+42
| * | | shader: Implement VertexA stageFernandoS272021-07-2312-3/+180
| * | | shader: Implement delegation of Exit to dispatcher on CFGFernandoS272021-07-232-3/+47
| * | | vk_graphics_pipeline: Fix texture buffer descriptorsReinUsesLisp2021-07-231-7/+8
| * | | shader: Fix IADD3.CCameerj2021-07-231-12/+5
| * | | vk_scheduler: Allow command submission on worker threadReinUsesLisp2021-07-238-182/+200
| * | | vk_compute_pass: Fix -Wshadow warningReinUsesLisp2021-07-231-3/+3
| * | | shader: Move pipeline cache logic to separate filesReinUsesLisp2021-07-2312-824/+1095
| * | | vulkan: Defer descriptor set work to the Vulkan threadReinUsesLisp2021-07-238-79/+69
| * | | vulkan: Rework descriptor allocation algorithmReinUsesLisp2021-07-2315-197/+314
| * | | vk_graphics_pipeline: Generate specialized pipeline config functions and improve codeReinUsesLisp2021-07-232-31/+230
| * | | shader: Accelerate pipeline transitions and use dirty flags for shadersReinUsesLisp2021-07-239-64/+114
| * | | shader: Fix BFE s32 undefined checkameerj2021-07-231-1/+1
| * | | vk_compute_pipeline: Fix index comparison oversight on compute texture buffersReinUsesLisp2021-07-231-1/+1
| * | | shader: Fix error checking in bitfieldExtract and implement bitfieldInsert foldingReinUsesLisp2021-07-231-5/+14
| * | | vulkan_device: Require shaderClipDistance and shaderCullDistance featuresReinUsesLisp2021-07-231-2/+4
| * | | vk_graphics_pipeline: Guard against non-tessellation pipelines using patchesReinUsesLisp2021-07-231-2/+8
| * | | shader: Fix storage type when reading patches on tess controlReinUsesLisp2021-07-231-1/+2
| * | | shader: Fix VMNMX selector BReinUsesLisp2021-07-231-1/+2
| * | | shader: Fix bugs and build issues on GCCRodrigo Locatti2021-07-233-4/+4
| * | | shader: Fix render targets with null attachmentsReinUsesLisp2021-07-232-26/+34
| * | | shader: Increase the maximum number of storage buffersReinUsesLisp2021-07-231-1/+1
| * | | shader: Remove identity removal pass for better build timesReinUsesLisp2021-07-231-1/+0
| * | | shader: Add more strict validation the passReinUsesLisp2021-07-231-0/+42
| * | | shader: Fix forward referencing identity instructions when inserting phiReinUsesLisp2021-07-231-11/+13
| * | | shader: Remove invalidated blocks in dead code elimination passReinUsesLisp2021-07-231-3/+6
| * | | shader: Add missing UndoUse case for GetSparseFromOpReinUsesLisp2021-07-231-0/+4
| * | | shader: Require dual source blendingReinUsesLisp2021-07-231-1/+2
| * | | shader: Simplify code in opcodes.h to fix IntellisenseReinUsesLisp2021-07-231-8/+6
| * | | shader: Implement indexed texturesReinUsesLisp2021-07-2310-157/+284
| * | | shader: Refactor atomic_operations_global_memoryameerj2021-07-231-44/+36
| * | | shader: add missing include guard in half_floating_point_helper.hameerj2021-07-231-0/+2
| * | | shader: Fix gcc warningsReinUsesLisp2021-07-232-2/+2
| * | | shader: Inline common Value gettersReinUsesLisp2021-07-232-109/+102
| * | | shader: Intrusively store in a block if it's sealed or notReinUsesLisp2021-07-232-3/+11
| * | | cmake: Link to common in shader_recompilerReinUsesLisp2021-07-231-1/+1
| * | | shader: Improve goto removal algorithm complexityReinUsesLisp2021-07-231-49/+28
| * | | shader: Use memset to reset instruction argumentsReinUsesLisp2021-07-232-4/+7
| * | | shader: Inline common Value functions into the headerReinUsesLisp2021-07-232-19/+23
| * | | shader: Move microinstruction header to the value headerReinUsesLisp2021-07-2320-181/+162
| * | | shader: Move siblings check to a separate function and comment them outReinUsesLisp2021-07-231-16/+21
| * | | shader: Intrusively store register values in block for SSA passReinUsesLisp2021-07-232-21/+53
| * | | shader: Inline common Opcode and Inst functionsReinUsesLisp2021-07-234-112/+83
| * | | shader: Inline common IR::Block methodsReinUsesLisp2021-07-232-17/+12
| * | | shader: Use a small_vector for phi blocksReinUsesLisp2021-07-231-1/+2
| * | | shader: Calculate number of arguments in an opcode at compile timeReinUsesLisp2021-07-231-3/+12
| * | | shader: Implement D3D samplersReinUsesLisp2021-07-236-49/+127
| * | | shader: Add constant propagation for arithmetic right shiftsReinUsesLisp2021-07-231-0/+3
| * | | shader: Simplify code for local memoryReinUsesLisp2021-07-231-6/+11
| * | | shader: Add NVN storage buffer fallbacksReinUsesLisp2021-07-239-62/+214
| * | | spirv: Fix ViewportMaskReinUsesLisp2021-07-231-1/+2
| * | | spirv: Replace Constant/ConstantComposite with Const helperameerj2021-07-2312-112/+101
| * | | shader: Address feedbackFernandoS272021-07-232-7/+10
| * | | shader: Implement F2F (Imm)FernandoS272021-07-231-2/+28
| * | | shader: Implement IADD3.CC/.XFernandoS272021-07-231-7/+22
| * | | shader: Address feedbackFernandoS272021-07-234-7/+4
| * | | shader: Add coarse derivativesFernandoS272021-07-237-8/+28
| * | | shader: Implement fine derivates constant propagationFernandoS272021-07-239-0/+101
| * | | shader: Implement SR_Y_DIRECTIONFernandoS272021-07-2310-0/+22
| * | | shader: Fix Phi node typesReinUsesLisp2021-07-232-4/+4
| * | | shader: Fix memory barriersReinUsesLisp2021-07-238-62/+30
| * | | spirv: Fix implicit lod typeReinUsesLisp2021-07-232-1/+5
| * | | spirv: Use explicit lods outside of fragment shadersReinUsesLisp2021-07-231-5/+16
| * | | spirv: Use ConstOffset instead of Offset when possibleReinUsesLisp2021-07-233-21/+67
| * | | shader: Implement BFE and BFI CCameerj2021-07-233-14/+17
| * | | shader: Implement SampleMaskReinUsesLisp2021-07-2311-2/+22
| * | | shader: Implement PIXLD.MY_INDEXReinUsesLisp2021-07-2314-5/+71
| * | | spirv: Bitcast non-F32 output attributes to their type before storeReinUsesLisp2021-07-231-13/+28
| * | | spirv: Implement ViewportMask with NV_viewport_array2ReinUsesLisp2021-07-2310-0/+32
| * | | spirv: Bitcast non-F32 attributes to F32ReinUsesLisp2021-07-231-7/+9
| * | | shader: Implement PrimitiveIdReinUsesLisp2021-07-235-0/+10
| * | | shader: Implement tessellation shaders, polygon mode and invocation idReinUsesLisp2021-07-2328-91/+605
| * | | shader: Mark atomic instructions as writesReinUsesLisp2021-07-231-0/+27
| * | | vk_pipeline_cache: Silence GCC warningslat9nq2021-07-231-0/+2
| * | | spirv: Implement image buffersReinUsesLisp2021-07-239-49/+142
| * | | spirv: Implement Layer storesReinUsesLisp2021-07-236-9/+30
| * | | spirv: Fix alpha testFernandoS272021-07-231-0/+5
| * | | spirv: Fix non-atomic 64-bit storeameerj2021-07-231-1/+1
| * | | spirv: Implement alpha testameerj2021-07-233-1/+95
| * | | shader: Implement transform feedbacks and define file formatReinUsesLisp2021-07-2311-23/+272
| * | | shader: Implement early Z testsReinUsesLisp2021-07-233-0/+5
| * | | shader: Document and relax cache control on surface instructionsReinUsesLisp2021-07-231-10/+11
| * | | spirv: Rework storage buffers and shader memoryReinUsesLisp2021-07-239-500/+581
| * | | shader: Fix fixed pipeline point size on geometry shadersReinUsesLisp2021-07-231-10/+18
| * | | shader: Add constant propagation for *&^| binary operationsReinUsesLisp2021-07-231-0/+12
| * | | shader: Implement geometry shadersReinUsesLisp2021-07-2314-91/+277
| * | | shader: Implement OUTReinUsesLisp2021-07-2310-17/+73
| * | | internal_stage_buffer_entry_read: Remove pragma optimize offlat9nq2021-07-231-2/+0
| * | | shader: Stub SR_INVOCATION_INFOReinUsesLisp2021-07-231-2/+5
| * | | shader: Stub ISBERDReinUsesLisp2021-07-233-4/+56
| * | | shader: Fix CC in I2IReinUsesLisp2021-07-231-0/+2
| * | | spirv: Define StorageImageWriteWithoutFormat capability when usedReinUsesLisp2021-07-233-0/+9
| * | | pipeline_helper: Simplify descriptor objects initializationReinUsesLisp2021-07-231-33/+25
| * | | shader: Simplify FLO and throw on CCReinUsesLisp2021-07-231-12/+13
| * | | shader: Mark blocks with no end branch as unreachableReinUsesLisp2021-07-231-2/+7
| * | | shader: Implement LOP CCReinUsesLisp2021-07-233-12/+29
| * | | shader: Implement SR_THREAD_KILLReinUsesLisp2021-07-2310-0/+22
| * | | shader: Apply sign bit in FCMP (imm)ReinUsesLisp2021-07-231-1/+1
| * | | shader: Implement ATOM/S and REDameerj2021-07-2321-19/+1745
| * | | nsight_aftermath_tracker: Report used shaders to Nsight AftermathReinUsesLisp2021-07-236-16/+20
| * | | spirv: Move phi node patching to a separate functionReinUsesLisp2021-07-231-13/+16
| * | | spirv: Guard against typeless image reads on unsupported devicesReinUsesLisp2021-07-236-1/+17
| * | | shader: Move LaneId to the warp emission file and fix AMDReinUsesLisp2021-07-235-7/+11
| * | | vk_rasterizer: Request outside render pass execution context for computeReinUsesLisp2021-07-231-0/+1
| * | | pipeline_helper: Add missing [[maybe_unused]]ReinUsesLisp2021-07-231-1/+1
| * | | spirv: Fix forward declarations on phi nodesReinUsesLisp2021-07-231-47/+25
| * | | shader: Mark ImageWrite with side effectsReinUsesLisp2021-07-231-0/+3
| * | | shader: Implement CC for ISET, FSET, PSET, CSET, and DSETFernandoS272021-07-2318-13/+136
| * | | shader: Remove outdated comment in F2IReinUsesLisp2021-07-231-4/+0
| * | | shader: Implement SULD and SUSTReinUsesLisp2021-07-2331-202/+732
| * | | shader: Fix Windows build issuesReinUsesLisp2021-07-231-1/+1
| * | | shader: Address feedback + clang formatlat9nq2021-07-2312-24/+22
| * | | shader_recompiler,video_core: Cleanup some GCC and Clang errorslat9nq2021-07-2366-313/+308
| * | | shader: Fix FCMP immediate variantReinUsesLisp2021-07-231-1/+9
| * | | shader: Fix dangling labelsReinUsesLisp2021-07-231-0/+5
| * | | shader: Interact texture buffers with buffer cacheReinUsesLisp2021-07-2317-148/+333
| * | | shader: Fix F2IReinUsesLisp2021-07-231-1/+1
| * | | shader: Fix TextureGradReinUsesLisp2021-07-231-1/+1
| * | | shader: Implement texture buffersReinUsesLisp2021-07-2310-35/+154
| * | | shader: Address feedbackFernandoS272021-07-235-53/+54
| * | | shader: Implement indexed Position and ClipDistancesFernandoS272021-07-233-11/+100
| * | | shader: Implement indexed attributesFernandoS272021-07-2312-35/+279
| * | | shader: Implement AL2PFernandoS272021-07-233-4/+36
| * | | shader: Fix BRX trackingFernandoS272021-07-232-3/+4
| * | | vk_pipeline_cache: Fix num of pipeline workers on weird platformsReinUsesLisp2021-07-231-1/+1
| * | | shader: Move recursive SSA rewrite to the heapReinUsesLisp2021-07-231-29/+89
| * | | shader: Fix ShadowCube declaration type, set number of pipeline threads based on hardwareFernandoS272021-07-232-2/+4
| * | | shader: Fix splits on blocks using indirect branchesReinUsesLisp2021-07-233-17/+38
| * | | shader: Eliminate orphan blocks more efficientlyReinUsesLisp2021-07-231-7/+8
| * | | shader: Add subgroup masksReinUsesLisp2021-07-2310-45/+169
| * | | shader: Implement BAR and fix memory barriersReinUsesLisp2021-07-237-5/+79
| * | | shader: Abstract breadth searches and use the abstractionReinUsesLisp2021-07-234-104/+106
| * | | shader: Reimplement GetCbufU64 as GetCbufU32x2ReinUsesLisp2021-07-239-22/+21
| * | | vk_compute_pass: Fix compute passesReinUsesLisp2021-07-233-23/+19
| * | | shader: Remove atomic flags and use mutex + cond variable for pipelinesReinUsesLisp2021-07-234-11/+32
| * | | shader: Remove unused header in VOTEReinUsesLisp2021-07-231-2/+0
| * | | vk_pipeline_cache: Remove unnecesary scope in pipeline cache lockingReinUsesLisp2021-07-231-15/+12
| * | | shader: Rework global memory tracking to use breadth-first searchReinUsesLisp2021-07-231-69/+80
| * | | shader: Fix fp16 merge when using native fp16ReinUsesLisp2021-07-231-3/+3
| * | | shader: Fix FADD32IReinUsesLisp2021-07-231-6/+4
| * | | shader: Fix undetected bug from reviewFernandoS272021-07-231-0/+3
| * | | shader: Address feedbackFernandoS272021-07-233-13/+16
| * | | shader: "Implement" NOPFernandoS272021-07-231-1/+1
| * | | vk_pipeline_cache: Small fixes to the pipeline cacheFernandoS272021-07-231-10/+14
| * | | shader: Address FeedbackFernandoS272021-07-2316-211/+60
| * | | shader: Implement SR_LaneIdFernandoS272021-07-237-0/+15
| * | | shader: Fix shared memory on cool driversFernandoS272021-07-231-0/+1
| * | | shader: Implement MEMBARFernandoS272021-07-239-11/+121
| * | | shader: Improve VOTE.VTG stubFernandoS272021-07-237-4/+147
| * | | shader: Mark SSBOs as written when they areFernandoS272021-07-234-4/+32
| * | | shader: Implement ViewportIndexFernandoS272021-07-238-2/+33
| * | | shader: Stub TLD4's PTP when it isn't constantFernandoS272021-07-231-1/+2
| * | | shader: Stub VOTE.VTGFernandoS272021-07-234-4/+15
| * | | shader: Fold composite extractFernandoS272021-07-231-0/+62
| * | | shader: Fold comparisons and Pack/Unpack16FernandoS272021-07-231-1/+41
| * | | shader: Fix branches to visited virtual blocksReinUsesLisp2021-07-232-0/+12
| * | | vulkan: Serialize pipelines on a separate threadReinUsesLisp2021-07-232-67/+64
| * | | vulkan: Create pipeline layouts in separate threadsReinUsesLisp2021-07-237-63/+65
| * | | vulkan: Build pipelines in parallel at runtimeReinUsesLisp2021-07-239-165/+197
| * | | shader: Fix dependency on identity removal passReinUsesLisp2021-07-232-3/+8
| * | | shader: Fix constant propagation to use reverse post orderReinUsesLisp2021-07-231-1/+2
| * | | shader: Implement LDG .U.128 as .128ReinUsesLisp2021-07-231-3/+2
| * | | shader: Unroll "using enum" for opcode declarationsReinUsesLisp2021-07-231-1/+27
| * | | vk_pipeline_cache: Name SPIR-V modulesReinUsesLisp2021-07-231-1/+11
| * | | spirv: Remove unnecesary variable for clip distancesReinUsesLisp2021-07-232-6/+2
| * | | shader: Implement ClipDistanceFernandoS272021-07-235-0/+36
| * | | shader: Fix TXDFernandoS272021-07-232-2/+2
| * | | shader: Address feedbackFernandoS272021-07-235-53/+49
| * | | shader: Always pass a lod for TexelFetchReinUsesLisp2021-07-233-25/+17
| * | | shader: Implement TXDFernandoS272021-07-234-10/+183
| * | | shader: Implement ImageGradientFernandoS272021-07-238-2/+84
| * | | shader: Implement TMML partiallyFernandoS272021-07-236-13/+137
| * | | shader,spirv: Implement ImageQueryLod.FernandoS272021-07-239-1/+38
| * | | shader: Implement TLDSFernandoS272021-07-233-4/+253
| * | | shader: Implement TLDFernandoS272021-07-238-16/+174
| * | | spirv: Add fixed pipeline point sizeReinUsesLisp2021-07-234-1/+11
| * | | shader: Add PointCoord attributeFernandoS272021-07-235-0/+16
| * | | shader: Add PointSize attributeameerj2021-07-235-0/+13
| * | | shader: Store type of phi nodes in flagsReinUsesLisp2021-07-233-2/+11
| * | | shader: Fix indirect branches to scheduler instructionsReinUsesLisp2021-07-233-7/+17
| * | | spirv: Fix default output attribute initializationReinUsesLisp2021-07-231-3/+3
| * | | shader: Add missing new linesReinUsesLisp2021-07-231-0/+2
| * | | shader: Implement FSWZADDameerj2021-07-2314-4/+87
| * | | shader: Implement BRXFernandoS272021-07-2321-48/+437
| * | | shader: Fix alignment checks on RZReinUsesLisp2021-07-231-1/+1
| * | | shader: Implement I2I CCameerj2021-07-233-24/+45
| * | | shader: Implement I2I SATameerj2021-07-236-10/+52
| * | | vk_pipeline_cache: Fix size hashing of shadersReinUsesLisp2021-07-231-8/+7
| * | | shader: Fix ISCADD logic for PO/CCameerj2021-07-231-7/+8
| * | | shader: Implement LDS, STS, LDL, and STS and use SPIR-V 1.4 when availableReinUsesLisp2021-07-2320-36/+730
| * | | shader: Implement ISCADD CCameerj2021-07-231-1/+4
| * | | shader: Implement VMAD, VMNMX, VSETPameerj2021-07-239-23/+319
| * | | shader: Add missing I2I exception when CC is usedReinUsesLisp2021-07-231-0/+4
| * | | shader: Better interpolation and disabled attributes supportReinUsesLisp2021-07-239-25/+101
| * | | spirv: Remove dependencies on Environment when generating SPIR-VReinUsesLisp2021-07-235-16/+15
| * | | vk_pipeline_cache: Fix pipeline and shader cachesReinUsesLisp2021-07-232-6/+21
| * | | shader: Implement front faceReinUsesLisp2021-07-235-0/+12
| * | | shader: Fix structured control flow on KIL instructionsReinUsesLisp2021-07-232-3/+7
| * | | shader: Fix TXQFernandoS272021-07-231-1/+1
| * | | shader: Fix rasterizer integration order issuesReinUsesLisp2021-07-233-7/+6
| * | | shader: Implement TXQ and fix FragDepthReinUsesLisp2021-07-2315-21/+264
| * | | shader: Refactor PTP and other minor changesReinUsesLisp2021-07-2314-123/+67
| * | | shader: Add IR opcode for ImageFetchFernandoS272021-07-237-5/+55
| * | | shader: Implement TLD4.PTPFernandoS272021-07-2315-28/+111
| * | | shader: Fix Array Indices in TEX/TLD4FernandoS272021-07-232-6/+6
| * | | shader: Implement FragDepthFernandoS272021-07-232-1/+7
| * | | shader: Implement TLD4S.FernandoS272021-07-233-4/+134
| * | | shader: Implement TLD4 and TLD4_BFernandoS272021-07-2313-11/+315
| * | | shader: Implement SHFLameerj2021-07-2316-69/+284
| * | | shader: Track first bindless argument instead of the instruction itselfReinUsesLisp2021-07-231-1/+1
| * | | shader: Properly insert Prologue instructionReinUsesLisp2021-07-231-1/+2
| * | | shader: Minor style nitsReinUsesLisp2021-07-231-2/+4
| * | | shader: Fix F2IFernandoS272021-07-2310-9/+147
| * | | shader: Implement NDC [-1, 1], attribute types and default varying initializationReinUsesLisp2021-07-2315-43/+186
| * | | shader: Fix use-after-free bug in object_poolReinUsesLisp2021-07-231-3/+3
| * | | shader: Implement VOTEameerj2021-07-2318-6/+182
| * | | vk_pipeline_cache: Fix ReleaseContents orderReinUsesLisp2021-07-231-2/+2
| * | | shader: Fix TEX maskReinUsesLisp2021-07-231-1/+3
| * | | vk_pipeline_cache: Add pipeline cacheReinUsesLisp2021-07-232-0/+7
| * | | vk_pipeline_cache: Add pipeline cacheReinUsesLisp2021-07-238-106/+347
| * | | shader: Fold interpolation multiplicationsReinUsesLisp2021-07-231-0/+34
| * | | shader: Better but still partial interpolation supportReinUsesLisp2021-07-231-5/+7
| * | | shader: Implement DMNMX, DSET, DSETPameerj2021-07-2316-59/+210
| * | | shader: Implement FADD32IFernandoS272021-07-231-2/+15
| * | | shader: Implement F2FFernandoS272021-07-236-20/+192
| * | | shader: Add missing fp64 usage flagsReinUsesLisp2021-07-231-0/+34
| * | | shader: Implement DMUL and DFMAameerj2021-07-238-30/+111
| * | | shader: Add FP64 register load/store helpersameerj2021-07-233-21/+24
| * | | shader: Add support for fp16 comparisons and misc fixesReinUsesLisp2021-07-2311-14/+56
| * | | shader: Fix floating point comparison for FP16FernandoS272021-07-235-32/+56
| * | | shader: Implement HSETP2FernandoS272021-07-233-12/+117
| * | | shader: Implement HSET2FernandoS272021-07-235-14/+119
| * | | shader: Implement HMUL2FernandoS272021-07-233-16/+144
| * | | shader: Implement HFMA2FernandoS272021-07-235-20/+192
| * | | spirv: Implement VertexId and InstanceId, refactor codeReinUsesLisp2021-07-2310-144/+244
| * | | shader: Refactor half floating instructionsFernandoS272021-07-234-58/+84
| * | | shader: Implement I2FReinUsesLisp2021-07-2317-70/+429
| * | | shader: Implement ISCADD (imm)ReinUsesLisp2021-07-231-2/+2
| * | | shader: Implement LOP32IReinUsesLisp2021-07-232-18/+45
| * | | shader: Add partial rasterizer integrationReinUsesLisp2021-07-2354-566/+1927
| * | | shader: Implement DADDameerj2021-07-238-14/+132
| * | | shader: Implement CSET and CSETPameerj2021-07-236-15/+114
| * | | shader: Reorder phi nodes when redefined as undefined opcodesReinUsesLisp2021-07-231-1/+9
| * | | shader: Fix instruction transitions in and out of PhiReinUsesLisp2021-07-231-9/+11
| * | | shader: Implement FSET and FSETPameerj2021-07-239-94/+204
| * | | shader: Implement TEXSReinUsesLisp2021-07-238-7/+287
| * | | shader: Implement CAL inlining function callsReinUsesLisp2021-07-2324-330/+286
| * | | spirv: Add SignedZeroInfNanPreserve logicameerj2021-07-233-0/+12
| * | | shader: Implement FMNMXameerj2021-07-238-25/+101
| * | | shader: Fix rebase issueReinUsesLisp2021-07-231-1/+0
| * | | shader: Implement FCMPameerj2021-07-239-50/+203
| * | | shader: Partial implementation of LDCReinUsesLisp2021-07-2316-50/+405
| * | | shader: Initial support for textures and TEXReinUsesLisp2021-07-2333-342/+1489
| * | | shader: Implement R2Pameerj2021-07-238-15/+88
| * | | shader: Implement SHFameerj2021-07-238-31/+119
| * | | shader: Implement LEAameerj2021-07-239-29/+136
| * | | shader: Deduplicate HADD2 codeReinUsesLisp2021-07-231-19/+16
| * | | shader: Implement I2Iameerj2021-07-233-12/+100
| * | | shader: Implement HADD2ReinUsesLisp2021-07-2312-42/+400
| * | | shader: Implement LOP and LOP3ameerj2021-07-238-31/+227
| * | | shader: Implement IADD3ameerj2021-07-233-12/+104
| * | | shader: Implement PSETPameerj2021-07-234-5/+40
| * | | Implement PSET, refactor common comparison funcsameerj2021-07-239-101/+88
| * | | shader: Implement FLOameerj2021-07-238-18/+75
| * | | shader: Implement ISET, add common_funcsameerj2021-07-238-50/+150
| * | | shader: Make IMNMX, SHR, SEL stylistically more consistentameerj2021-07-233-5/+5
| * | | shader: Implement ICMPameerj2021-07-233-16/+84
| * | | shader: Implement IMNMXameerj2021-07-238-12/+105
| * | | shader: Implement BFIameerj2021-07-233-16/+57
| * | | shader: Implement BFEameerj2021-07-233-12/+67
| * | | shader: Implement POPCameerj2021-07-238-12/+59
| * | | shader: Implement SHRameerj2021-07-238-18/+80
| * | | shader: Implement SELameerj2021-07-234-16/+53
| * | | spirv: Move phi arguments emit to a separate functionReinUsesLisp2021-07-231-27/+27
| * | | shader: Avoid infinite recursion when tracking global memoryReinUsesLisp2021-07-231-5/+26
| * | | shader: Fix conditional execution of exit instructionsReinUsesLisp2021-07-232-5/+6
| * | | spirv: Add support for self-referencing phi nodesReinUsesLisp2021-07-231-3/+10
| * | | shader: Fix control flowReinUsesLisp2021-07-238-20/+39
| * | | shader: Implement more of XMAD and FFMA32I and fix XMAD.CBCCReinUsesLisp2021-07-235-28/+76
| * | | shader: FMUL, select, RRO, and MUFU fixesReinUsesLisp2021-07-2318-119/+507
| * | | shader: Fix MOV(reg), add SHL variants and emit neg and abs instructionsReinUsesLisp2021-07-234-11/+11
| * | | spirv: Fixes and Intel specific workaroundsReinUsesLisp2021-07-2311-32/+44
| * | | shader: Rename, implement FADD.SAT and P2R (imm)ReinUsesLisp2021-07-2318-127/+213
| * | | shader: Add denorm flush supportReinUsesLisp2021-07-2320-93/+260
| * | | spirv: Add lower fp16 to fp32 passReinUsesLisp2021-07-2332-285/+479
| * | | shader: Primitive Vulkan integrationReinUsesLisp2021-07-2343-3036/+1003
| * | | shader: Remove old shader managementReinUsesLisp2021-07-2380-19568/+54
| * | | shader: Add XMAD multiplication folding optimizationReinUsesLisp2021-07-231-5/+77
| * | | shader: Simplify ISCADDReinUsesLisp2021-07-231-6/+1
| * | | shader: Add utility to resolve identities on a valueReinUsesLisp2021-07-232-0/+8
| * | | spirv: Implement EmitIdentityReinUsesLisp2021-07-232-3/+3
| * | | spirv: Initial bindings supportReinUsesLisp2021-07-2322-292/+671
| * | | shader: Improve object poolReinUsesLisp2021-07-233-50/+66
| * | | shader: Fix trackingReinUsesLisp2021-07-231-50/+72
| * | | shader: Add support for forward declarationsReinUsesLisp2021-07-2310-68/+79
| * | | shader: Support SSA loops on IRReinUsesLisp2021-07-2312-46/+150
| * | | shader: Misc fixesReinUsesLisp2021-07-2310-89/+104
| * | | shader: Initial implementation of an ASTReinUsesLisp2021-07-2332-589/+1345
| * | | spirv: Initial SPIR-V supportReinUsesLisp2021-07-2320-3299/+1400
| * | | shader: Better constant foldingReinUsesLisp2021-07-232-13/+48
| * | | shader: Properly store phi on InstReinUsesLisp2021-07-236-75/+132
| * | | shader: Add pools and rename filesReinUsesLisp2021-07-2330-108/+255
| * | | shader: Make typed IRReinUsesLisp2021-07-2319-269/+495
| * | | shader: Remove illegal character in SSA passReinUsesLisp2021-07-231-1/+1
| * | | shader: Constant propagation and global memory to storage bufferReinUsesLisp2021-07-2317-63/+652
| * | | shader: Initial instruction supportReinUsesLisp2021-07-2328-334/+1450
| * | | shader: SSA and dominanceReinUsesLisp2021-07-2324-77/+570
| * | | shader: Initial recompiler workReinUsesLisp2021-07-2357-0/+7061
| * | | thread_worker: Fix compile time errorameerj2021-07-231-1/+1
| | |/ | |/|
* | | Merge pull request #6699 from lat9nq/common-threadsbunnei2021-07-251-1/+1
|\ \ \
| * | | common: Publically link to pthreadslat9nq2021-07-231-1/+1
| |/ /
* | | Merge pull request #6690 from ReinUsesLisp/dma-clear-fixupsbunnei2021-07-242-7/+3
|\ \ \
| * | | gl_buffer_cache: Use glClearNamedBufferSubData:GL_RED instead of GL_RGBAReinUsesLisp2021-07-201-1/+1
| * | | buffer_cache: Simplify clear logicReinUsesLisp2021-07-201-6/+2
* | | | Merge pull request #6551 from bunnei/improve-kernel-objbunnei2021-07-2421-88/+327
|\ \ \ \ | |_|/ / |/| | |
| * | | hle: service: kernel_helpers: Remove unnecessary pragma once.bunnei2021-07-211-2/+0
| * | | hle: kernel: svc: Remove part of ExitProcess.bunnei2021-07-211-5/+0
| * | | hle: service: nvdrv: Remove unused kernel reference.bunnei2021-07-211-1/+0
| * | | hle: service: hid: npad: Remove unused kernel reference.bunnei2021-07-211-1/+0
| * | | hle: kernel: Track and release server sessions, and protect methods with locks.bunnei2021-07-214-13/+82
| * | | hle: kernel: KProcess: Change process termination assert to a warning.bunnei2021-07-211-1/+1
| * | | hle: kernel: Ensure current running process is closed.bunnei2021-07-211-5/+6
| * | | hle: kernel: Ensure global handle table is finalized before closing.bunnei2021-07-211-0/+1
| * | | kernel: svc: ConnectToNamedPort: Close extra reference to port.bunnei2021-07-211-0/+1
| * | | hle: service: sm: Refactor to better manage ports.bunnei2021-07-214-45/+47
| * | | hle: kernel: k_process: Close the handle table on shutdown.bunnei2021-07-211-0/+3
| * | | hle: kernel: k_process: Close main thread reference after it is inserted into handle table.bunnei2021-07-211-0/+3
| * | | hle: kernel: Ensure global handle table is initialized.bunnei2021-07-211-0/+1
| * | | hle: service: Add a helper module for managing kernel objects.bunnei2021-07-2110-20/+146
| * | | hle: kernel: Provide methods for tracking dangling kernel objects.bunnei2021-07-214-2/+43
* | | | Merge pull request #6686 from ReinUsesLisp/vk-optimal-copybunnei2021-07-221-21/+35
|\ \ \ \
| * | | | vk_texture_cache: Use VK_IMAGE_LAYOUT_TRANSFER_SRC_OPTIMAL when possibleReinUsesLisp2021-07-201-21/+35
* | | | | Merge pull request #6693 from lat9nq/cmd-fullscreen-mode-2Morph2021-07-223-15/+34
|\ \ \ \ \
| * | | | | yuzu_cmd: Make use of fullscreen_mode settinglat9nq2021-07-223-15/+34
* | | | | | Merge pull request #6654 from german77/custom_thresholdbunnei2021-07-223-3/+91
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | configure/ui: Add sliders for trigger buttonsgerman772021-07-172-0/+78
| * | | | | input_common: Make button threshold customizablegerman772021-07-162-3/+13
* | | | | | yuzu-cmd: Fullscreen Improvements (#6656)san2021-07-214-9/+13
* | | | | | Merge pull request #6660 from Morph1984/controller_applet_rev8bunnei2021-07-212-3/+33
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | applet_controller: Add preliminary support for version 8Morph2021-07-202-3/+33
* | | | | | Merge pull request #6649 from german77/toggle_sdlbunnei2021-07-212-5/+53
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | input_common: Support SDL toggle buttonsgerman772021-07-152-5/+53
* | | | | | Merge pull request #6629 from FernandoS27/accel-dma-2bunnei2021-07-2011-12/+136
|\ \ \ \ \ \
| * | | | | | Buffer cache: Fixes, Clang and Feedback.Fernando Sahmkow2021-07-153-11/+10
| * | | | | | GPUMemoryManager: Force inmediate invalidation when writting block.Fernando Sahmkow2021-07-141-1/+1
| * | | | | | Buffer Cache: Fixes to DMA Copy.Fernando Sahmkow2021-07-141-6/+7
| * | | | | | DMAEngine: Revert flushing from Pitch to BlpockLinear.Fernando Sahmkow2021-07-141-2/+7
| * | | | | | BufferCache: fix clearing on forced download.Fernando Sahmkow2021-07-141-10/+20
| * | | | | | DMAEngine: Accelerate BufferClearFernando Sahmkow2021-07-1311-6/+115
* | | | | | | Merge pull request #6658 from Morph1984/render-window-fixbunnei2021-07-201-0/+6
|\ \ \ \ \ \ \
| * | | | | | | bootmanager: Create a dummy render widgetMorph2021-07-201-0/+6
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #6685 from ReinUsesLisp/radeonsi-clientFernando S2021-07-201-1/+1
|\ \ \ \ \ \ \
| * | | | | | | gl_texture_cache: Workaround slow PBO downloads on radeonsiReinUsesLisp2021-07-201-1/+1
* | | | | | | | uuid: Directly compare UUID instead of checking per elementChloe Marcec2021-07-201-3/+2
| |_|_|_|_|/ / |/| | | | | |
* | | | | | | vk_buffer_cache: Fix quad index array with 0 vertices (#6627)Fernando S2021-07-201-0/+7
* | | | | | | input/sdl_impl: fix rumble support on DualSense. (#6683)Nicolas Jallamion2021-07-201-2/+2
| |/ / / / / |/| | | | |
* | | | | | file_sys: Support load game collection (#6582)Feng Chen2021-07-2017-108/+171
|/ / / / /
* | | | | Merge pull request #6580 from ReinUsesLisp/xfb-radvRodrigo Locatti2021-07-202-11/+19
|\ \ \ \ \
| * | | | | vk_buffer_cache: Use emulated null buffers for transform feedbackReinUsesLisp2021-07-092-11/+19
* | | | | | Merge pull request #6652 from lat9nq/cmd-vulkan-fixesbunnei2021-07-205-32/+25
|\ \ \ \ \ \
| * | | | | | sdl_impl, emu_window: Remove clang ignorelat9nq2021-07-164-33/+0
| * | | | | | emu_window_sdl2_vk: Specify the window manager if it should be supportedlat9nq2021-07-161-0/+15
| * | | | | | emu_window_sdl2_vk: Use the generated SDL configlat9nq2021-07-162-0/+11
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #6651 from lat9nq/update-settingsbunnei2021-07-192-59/+107
|\ \ \ \ \ \
| * | | | | | yuzu_cmd: Add missing or update current settingslat9nq2021-07-162-4/+112
| * | | | | | default_ini: Remove deprecated settingslat9nq2021-07-161-61/+1
| |/ / / / /
* | | | | | Merge pull request #6679 from yzct12345/fix-lets-goFernando S2021-07-191-1/+4
|\ \ \ \ \ \
| * | | | | | Update src/video_core/renderer_vulkan/vk_texture_cache.cppyzct123452021-07-191-1/+1
| * | | | | | Update src/video_core/renderer_vulkan/vk_texture_cache.cppyzct123452021-07-191-1/+1
| * | | | | | Ignore wrong blit formatyzct123452021-07-181-1/+4
* | | | | | | Merge pull request #6670 from ReinUsesLisp/prepare-rtFernando S2021-07-191-0/+6
|\ \ \ \ \ \ \
| * | | | | | | texture_cache: Always prepare image views on render targetsReinUsesLisp2021-07-181-0/+6
| |/ / / / / /
* | | | | | | Merge pull request #6669 from ReinUsesLisp/fix-samples-sizesFernando S2021-07-191-53/+33
|\ \ \ \ \ \ \
| * | | | | | | texture_cache/util: Fix size calculations of multisampled imagesReinUsesLisp2021-07-181-53/+33
| |/ / / / / /
* | | | | | | vk_texture_cache: Finalize renderpass when downloading imagesReinUsesLisp2021-07-181-0/+1
* | | | | | | vk_compute_pass: Fix pipeline barriers on non-initialized ASTC imagesReinUsesLisp2021-07-181-2/+3
* | | | | | | vk_compute_pass: Fix ASTC buffer setup synchronizationReinUsesLisp2021-07-181-14/+14
|/ / / / / /
* | | | | | Merge pull request #6659 from german77/mouse_panningAmeer J2021-07-173-5/+8
|\ \ \ \ \ \
| * | | | | | input_common: Fix mouse panning behaivourgerman772021-07-173-5/+8
| |/ / / / /
* / / / / / configure_audio: Fix volume clamping to 0Morph2021-07-161-6/+6
|/ / / / /
* | | | | Merge pull request #6579 from ameerj/float-settingsbunnei2021-07-1611-69/+39
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | configure_input: Use u8 for mouse sensitivityameerj2021-07-093-11/+8
| * | | | config: Remove float {Read,Write}Setting variantsameerj2021-07-092-29/+2
| * | | | configure_graphics: Use u8 for bg_color valuesameerj2021-07-095-19/+20
| * | | | configure_audio: Use u8 for volume valueameerj2021-07-094-10/+9
| | |_|/ | |/| |
* | | | Merge pull request #6635 from ameerj/intel-vk-sm3dwFernando S2021-07-151-2/+4
|\ \ \ \
| * | | | vk_rasterizer: Only clear valid color attachmentsameerj2021-07-131-2/+4
* | | | | Merge pull request #6525 from ameerj/nvdec-fixesFernando S2021-07-152-56/+50
|\ \ \ \ \
| * | | | | vic: Fix dimension compuation of YUV framesameerj2021-07-151-11/+10
| * | | | | nvhost_nvdec_common: Read Submit ioctl data from object addrameerj2021-07-151-8/+2
| * | | | | nvhost_nvdec_common: Fix {Slice/Write}Vectors returnameerj2021-07-151-37/+38
* | | | | | applets/web: Resolve Nintendo CDN URLsMorph2021-07-151-0/+13
* | | | | | service: Append service name prefix to common filenamesMorph2021-07-1441-56/+56
* | | | | | applets: Append applet_ prefix to backend appletsMorph2021-07-1419-33/+33
* | | | | | applets: Append qt_ prefix to Qt frontend appletsMorph2021-07-1415-25/+26
* | | | | | Merge pull request #6599 from german77/disable_rumbleAmeer J2021-07-131-0/+5
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | npad: Disable vibration check if disabledgerman772021-07-111-0/+5
* | | | | | Merge pull request #6574 from lioncash/i18nbunnei2021-07-131-2/+4
|\ \ \ \ \ \
| * | | | | | qt/main: Make title string more i18n-friendlyLioncash2021-07-081-2/+4
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #6593 from german77/no_sdlbunnei2021-07-131-2/+2
|\ \ \ \ \ \
| * | | | | | input_common: Fix build with sdl disabledgerman772021-07-111-2/+2
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #6615 from ReinUsesLisp/httplib-debug-warningsbunnei2021-07-132-0/+13
|\ \ \ \ \ \
| * | | | | | web_service: Silence -Wmaybe-uninitialized on httplib.hReinUsesLisp2021-07-121-0/+10
| * | | | | | boxcat: Silence -Wmaybe-uninitialized in httplib.hReinUsesLisp2021-07-121-0/+3
* | | | | | | Merge pull request #6618 from ReinUsesLisp/bad-rangesbunnei2021-07-131-1/+0
|\ \ \ \ \ \ \
| * | | | | | | content_archive: Remove unnecessary include to <ranges>ReinUsesLisp2021-07-121-1/+0
| |/ / / / / /
* | | | | | | Merge pull request #6571 from Kelebek1/Mixbunnei2021-07-131-0/+9
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | Replace NaN mix volume samples with silence.Kelebek12021-07-081-0/+9
* | | | | | | Merge pull request #6597 from FernandoS27/accelerate-dmaAmeer J2021-07-129-62/+199
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | accelerateDMA: Fixes and feedback.Fernando Sahmkow2021-07-123-88/+62
| * | | | | | accelerateDMA: Accelerate Buffer Copies.Fernando Sahmkow2021-07-119-13/+176
* | | | | | | Merge pull request #6576 from ameerj/unlock-fps-settingMorph2021-07-116-29/+10
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | settings: Disable FPS unlimit setting between title launchesameerj2021-07-106-29/+10
| | |_|/ / / | |/| | | |
* | | | | | Buffer Cache: Address Feedback.Fernando Sahmkow2021-07-103-5/+10
* | | | | | Buffer Cache: Fix GCC copmpile errorFernando Sahmkow2021-07-091-1/+0
* | | | | | Fence Manager: remove reference fencing.Fernando Sahmkow2021-07-093-31/+6
* | | | | | BufferCache: Additional download fixes.Fernando Sahmkow2021-07-092-23/+107
* | | | | | Buffer Cache: Revert unnecessary range reduction.Fernando Sahmkow2021-07-091-29/+13
* | | | | | Fence Manager: Force ordering on WFI.Fernando Sahmkow2021-07-094-38/+71
* | | | | | Buffer Cache: Eliminate the AC Hack as the base game is fixed in Hades.Fernando Sahmkow2021-07-091-14/+4
* | | | | | Fence Manager: Add fences on Reference Count.Fernando Sahmkow2021-07-098-6/+57
* | | | | | Videocore: Address Feedback & CLANG Format.Fernando Sahmkow2021-07-092-78/+75
* | | | | | Buffer Cache: Fix High Downloads and don't predownload on Extreme.Fernando Sahmkow2021-07-094-92/+123
| |_|/ / / |/| | | |
* | | | | Merge pull request #6573 from lat9nq/cpu-settings-cleanup-2Fernando S2021-07-0918-146/+289
|\ \ \ \ \
| * | | | | settings, arm_dynarmic, yuzu qt: Move CPU debugging optionlat9nq2021-07-0818-132/+244
| * | | | | arm_dynarmic_64: Re-add fastmem_address_space_bits to Auto settinglat9nq2021-07-081-0/+1
| * | | | | settings, yuzu qt: Add migration code for CPU accuracylat9nq2021-07-082-1/+10
| * | | | | arm_dynarmic{32,64}: Fixes from test buildlat9nq2021-07-082-18/+5
| * | | | | core,common,yuzu qt: Add CPU accuracy option 'Auto'lat9nq2021-07-084-16/+50
| |/ / / /
* | | | / yuzu qt: config: Only save renderer_debug as a global settinglat9nq2021-07-091-2/+8
| |_|_|/ |/| | |
* | | | common/thread_worker: Stop workers on stop_token when waitingReinUsesLisp2021-07-091-18/+20
* | | | common/thread_worker: Add support for stateful threadsReinUsesLisp2021-07-093-78/+86
* | | | common/thread_worker: Simplify logicFernandoS272021-07-091-8/+1
* | | | common/thread_worker: Fix data raceFernandoS272021-07-092-1/+18
* | | | common/thread_worker: Use unique functionReinUsesLisp2021-07-092-28/+24
* | | | common: Add unique functionReinUsesLisp2021-07-094-0/+172
* | | | common/thread_worker: Add wait for requests methodReinUsesLisp2021-07-092-0/+11
|/ / /
* | | Merge pull request #6539 from lat9nq/default-settingAmeer J2021-07-0839-790/+940
|\ \ \
| * | | general: Code formatting improvementslat9nq2021-07-084-22/+25
| * | | config: Read UISettings as basic settingslat9nq2021-07-021-30/+19
| * | | settings: Set resolution_factor default to 1lat9nq2021-07-011-1/+1
| * | | yuzu_cmd: config: Pass a reference inlat9nq2021-07-012-5/+11
| * | | core, input_common: Miscellaneous fixeslat9nq2021-06-293-5/+8
| * | | yuzu qt: Make most UISettings a BasicSettinglat9nq2021-06-2912-91/+107
| * | | general: Make most settings a BasicSettinglat9nq2021-06-2832-660/+807
| * | | configuration: Defer to common/settings for per-game settings defaultslat9nq2021-06-262-127/+100
| * | | common: Force defaults for Settings::Setting'slat9nq2021-06-261-44/+57
* | | | Out of bound blit (#6531)Feng Chen2021-07-082-58/+35
* | | | Merge pull request #6564 from Kelebek1/AudioMorph2021-07-082-18/+51
|\ \ \ \ | |_|/ / |/| | |
| * | | Support more PCM formats. Fixes Ys IX audio.Kelebek12021-07-062-18/+51
* | | | Merge pull request #6569 from Kelebek1/VolMorph2021-07-085-75/+81
|\ \ \ \
| * | | | audio_core: Preserve front channel volume after 6 to 2 downmixKelebek12021-07-085-75/+81
* | | | | Merge pull request #6567 from Kelebek1/Audio2bunnei2021-07-071-1/+1
|\ \ \ \ \
| * | | | | Report 2 channels active. Fixes Tales of Vesperia's mono channel audio.Kelebek12021-07-061-1/+1
| | |/ / / | |/| | |
* | | | | util_shaders: Fix BindImageTexturelat9nq2021-07-071-2/+2
| |/ / / |/| | |
* | | | Merge pull request #6562 from Morph1984/flush-behaviorbunnei2021-07-073-11/+48
|\ \ \ \
| * | | | common: logging: backend: Close the file after exceeding the write limitMorph2021-07-061-8/+11
| * | | | common: fs: file: Revert Flush to its previous behavior and add CommitMorph2021-07-062-3/+34
| * | | | common: fs: file: Flush the file in GetSizeMorph2021-07-061-0/+3
| |/ / /
* | | | Merge pull request #6497 from FernandoS27/scotty-doesnt-knowbunnei2021-07-0713-59/+581
|\ \ \ \
| * | | | Texture Cache: Fix collision with multiple overlaps of the same sparse texture.Fernando Sahmkow2021-07-041-1/+6
| * | | | Texture Cache: Fix GCC & Clang.Fernando Sahmkow2021-07-042-11/+11
| * | | | Texture Cache: Address feedback.Fernando Sahmkow2021-07-045-18/+37
| * | | | Texture Cache: Improve accuracy of sparse texture detection.Fernando Sahmkow2021-07-046-131/+342
| * | | | Texture Cache: Initial Implementation of Sparse Textures.Fernando Sahmkow2021-07-0412-23/+310
* | | | | CMakeLists: Treat -Wsign-compare as an error on GCC/ClangMorph2021-07-064-8/+1
| |/ / / |/| | |
* | | | Merge pull request #6537 from Morph1984/warningsbunnei2021-07-0612-58/+27
|\ \ \ \
| * | | | CMakeLists: Disable all warnings for external headersMorph2021-06-281-0/+5
| * | | | video_core: Remove #pragma warning directives for external headersMorph2021-06-282-15/+0
| * | | | input_common: Remove #pragma warning directives for external headersMorph2021-06-282-14/+0
| * | | | CMakeLists: Enforce C4018, C4267, C4305, C4389Morph2021-06-281-3/+7
| * | | | core: Enforce C4242Morph2021-06-281-6/+3
| * | | | input_common: Enforce C4242Morph2021-06-281-12/+4
| * | | | video_core: Enforce C4242Morph2021-06-281-3/+2
| * | | | video_core: Silence signed/unsigned mismatch warningsMorph2021-06-284-5/+6
* | | | | Merge pull request #6556 from Morph1984/default-miibunnei2021-07-051-2/+3
|\ \ \ \ \
| * | | | | service: mii: Retrieve the correct default miis.Morph2021-07-041-2/+3
* | | | | | Merge pull request #6540 from Kelebek1/nvdecAmeer J2021-07-0510-356/+522
|\ \ \ \ \ \
| * | | | | | Slightly refactor NVDEC and codecs for readability and safetyKelebek12021-07-0110-356/+522
* | | | | | | Merge pull request #6561 from german77/analog_fixMorph2021-07-051-0/+1
|\ \ \ \ \ \ \
| * | | | | | | input_common: Add missing modifier callback to analog from buttongerman772021-07-051-0/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | profiler: Fix deprecated functionsgerman772021-07-051-4/+5
* | | | | | | Merge pull request #6552 from Morph1984/c4189-msvcMai M2021-07-051-0/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | CMakeLists: Enforce C4189Morph2021-07-031-0/+1
* | | | | | | TextureCacheOGL: Implement Image Copies for 1D and 1D Array.Fernando Sahmkow2021-07-031-0/+26
* | | | | | | TextureCache: Fix 1D to 2D overlapps.Fernando Sahmkow2021-07-031-3/+0
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #6498 from Kelebek1/Audiobunnei2021-07-038-88/+180
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Fix XC2/VOEZ crashing, add audio looping and a few misc fixesKelebek12021-07-017-132/+188
| * | | | | Decouple audio processing and run at variable rateKelebek12021-06-273-79/+115
* | | | | | Merge pull request #6459 from lat9nq/ubuntu-fixesAmeer J2021-07-011-1/+4
|\ \ \ \ \ \
| * | | | | | cmake: Fix find_program usage for 3.15lat9nq2021-06-131-1/+4
* | | | | | | Merge pull request #6471 from lat9nq/dump-as-modMorph2021-06-2910-31/+91
|\ \ \ \ \ \ \
| * | | | | | | patch_manager: Do not apply LayeredFS mods when dumpingMorph2021-06-283-4/+8
| * | | | | | | filesystem: Open a read-only directory for SDMC modsMorph2021-06-283-19/+25
| * | | | | | | core: Simplify SDMC mod loadinglat9nq2021-06-283-21/+10
| * | | | | | | core: Support LayeredFS mod from SDMC directorylat9nq2021-06-285-2/+47
| * | | | | | | yuzu qt: Add option to dump to SDMC directorylat9nq2021-06-284-7/+23
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #6502 from ameerj/vendor-titleMorph2021-06-289-10/+100
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_device: Expand on Mesa driver nameslat9nq2021-06-211-3/+28
| * | | | | | video_core: Add GPU vendor name to window title barameerj2021-06-219-10/+75
* | | | | | | main: Display the instruction set of the running title in the window nameameerj2021-06-281-0/+3
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #6529 from ReinUsesLisp/reaper-fixupsMorph2021-06-276-14/+42
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | buffer_cache: Only flush downloaded sizeReinUsesLisp2021-06-261-2/+3
| * | | | | video_core: Enforce C4244ReinUsesLisp2021-06-261-0/+1
| * | | | | codec,vic: Disable warnings in ffmpeg headersReinUsesLisp2021-06-262-4/+29
| * | | | | vk_buffer_cache: Silence implicit cast warningsReinUsesLisp2021-06-261-2/+3
| * | | | | buffer_cache/texture_cache: Make GC functions privateReinUsesLisp2021-06-262-5/+5
| * | | | | buffer_cache: Silence implicit cast warningReinUsesLisp2021-06-261-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #6526 from bunnei/doom-updatebunnei2021-06-266-9/+61
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | hle: service: hwopus: OpenHardwareOpusDecoderEx: Remove unused buffer size.bunnei2021-06-261-1/+30
| * | | | hle: hle_helpers: Skip data payload offset checks on TIPC requests.bunnei2021-06-251-2/+6
| * | | | hle: service: hwopus: Implement GetWorkBufferSizeEx and OpenHardwareOpusDecoderEx.bunnei2021-06-252-5/+15
| * | | | hle: service: aoc: Stub GetAddOnContentListChangedEventWithProcessId.bunnei2021-06-252-1/+10
| * | | | audio_core: common: Bump audio revision to 9.bunnei2021-06-251-1/+1
* | | | | vulkan_device: Make device memory match the rest of the fileReinUsesLisp2021-06-252-19/+18
| |_|_|/ |/| | |
* | | | Merge pull request #6496 from ameerj/astc-fixesbunnei2021-06-255-155/+50
|\ \ \ \
| * | | | util_shaders: Specify ASTC decoder memory barrier bitsameerj2021-06-191-1/+6
| * | | | astc_decoder.comp: Remove unnecessary LUT SSBOsameerj2021-06-195-113/+34
| * | | | astc: Various robustness enhancements for the gpu decoderameerj2021-06-195-47/+16
* | | | | Merge pull request #6519 from Wunkolo/mem-size-literalbunnei2021-06-2519-126/+152
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | common: Replace common_sizes into user-literalsWunkolo2021-06-2419-126/+152
* | | | | Merge pull request #6522 from Morph1984/pragmabunnei2021-06-244-0/+8
|\ \ \ \ \
| * | | | | general: Add missing #pragma once directivesMorph2021-06-244-0/+8
* | | | | | Add missing includes (#6521)Chloe2021-06-244-0/+7
|/ / / / /
* | | | | Merge pull request #6517 from lioncash/fmtlibbunnei2021-06-249-15/+23
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | General: Resolve fmt specifiers to adhere to 8.0.0 API where applicableLioncash2021-06-239-15/+23
* | | | | Merge pull request #6504 from Kelebek1/samples-playedbunnei2021-06-233-3/+20
|\ \ \ \ \
| * | | | | Implement audout GetAudioOutPlayedSampleCountKelebek12021-06-223-3/+20
* | | | | | Merge pull request #6518 from lioncash/funcbunnei2021-06-231-0/+1
|\ \ \ \ \ \
| * | | | | | maxwell3d: Add missing return in default SizeInBytes() caseLioncash2021-06-231-0/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #6465 from FernandoS27/sex-on-the-beachMai M2021-06-2325-63/+493
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Reaper: Set minimum cleaning limit on OGL.Fernando Sahmkow2021-06-221-1/+4
| * | | | | Reaper: Guarantee correct deletion.Fernando Sahmkow2021-06-205-2/+23
| * | | | | Reaper: Upgrade label from unsafe to experimental as no regressions are known now.Fernando Sahmkow2021-06-201-1/+1
| * | | | | Reaper: Correct size calculation on Vulkan.Fernando Sahmkow2021-06-171-5/+3
| * | | | | Reaper: Change memory restrictions on TC depending on host memory on VK.Fernando Sahmkow2021-06-1710-41/+90
| * | | | | Reaper: Address Feedback.Fernando Sahmkow2021-06-166-20/+43
| * | | | | Reaper: Setup settings and final tuning.Fernando Sahmkow2021-06-1610-32/+64
| * | | | | Reaper: Tune it up to be an smart GC.Fernando Sahmkow2021-06-165-13/+130
| * | | | | Initial Reaper SetupReinUsesLisp2021-06-166-56/+226
| * | | | | vulkan_memory_allocator: Release allocations with no commitsReinUsesLisp2021-06-162-5/+22
* | | | | | Merge pull request #6508 from ReinUsesLisp/bootmanager-stop-tokenMai M2021-06-238-18/+18
|\ \ \ \ \ \
| * | | | | | bootmanager: Use std::stop_source for stopping emulationReinUsesLisp2021-06-228-18/+18
* | | | | | | Merge pull request #6514 from OZtistic/masterMorph2021-06-232-1/+8
|\ \ \ \ \ \ \
| * | | | | | | Simple resizing of the Per-Game configuration window and removal of useless Help question mark button in the title barOZtistic2021-06-232-1/+8
* | | | | | | | Merge pull request #6512 from ReinUsesLisp/wait-detached-stasksMai M2021-06-231-0/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | common/detached_tasks: Wait for tasks before shutting downRodrigo Locatti2021-06-221-0/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #6509 from ReinUsesLisp/mouse-dataraceMai M2021-06-232-12/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | input_common/mouse_input: Fix data raceRodrigo Locatti2021-06-222-12/+10
| |/ / / / / / /
* | | | | | | | Merge pull request #6510 from ReinUsesLisp/npad-data-raceMai M2021-06-232-0/+8
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | npad: Fix data race when updating devicesRodrigo Locatti2021-06-222-0/+8
| |/ / / / / /
* | | | | | | Merge pull request #6493 from Morph1984/fs-nodiscardbunnei2021-06-2310-48/+48
|\ \ \ \ \ \ \
| * | | | | | | common: fs: Add a description of a regular file in IsFileMorph2021-06-221-4/+6
| * | | | | | | vfs_real: Fix Mode to FileAccessMode conversionMorph2021-06-221-6/+1
| * | | | | | | common: fs: Amend IsFile check in FileOpen / (Write/Append)StringToFileMorph2021-06-224-9/+12
| * | | | | | | common: fs: file: Remove [[nodiscard]] attribute from FlushMorph2021-06-222-3/+3
| * | | | | | | common: fs: Remove [[nodiscard]] attribute on Remove* functionsMorph2021-06-226-26/+26
* | | | | | | | Merge pull request #6472 from Morph1984/splbunnei2021-06-239-78/+493
|\ \ \ \ \ \ \ \
| * | | | | | | | spl: Mark the other functions as unimplementedMorph2021-06-161-5/+30
| * | | | | | | | spl: Implement spl::GetConfigMorph2021-06-162-1/+90
| * | | | | | | | hle: api_version: Add HLE API version constantsMorph2021-06-163-33/+54
| * | | | | | | | spl: Add the general SPL interfaceMorph2021-06-164-45/+64
| * | | | | | | | spl: Add SPL typesMorph2021-06-162-0/+231
| * | | | | | | | spl: Add SPL result codesMorph2021-06-162-0/+30
* | | | | | | | | Merge pull request #6483 from Morph1984/get-tz-filebunnei2021-06-221-1/+1
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | service: time: Use GetFileRelative to get files within subdirectoriesMorph2021-06-181-1/+1
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #6506 from ReinUsesLisp/master-semaphore-jthreadbunnei2021-06-222-19/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | vk_master_semaphore: Use jthread for debug threadReinUsesLisp2021-06-222-19/+8
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #6511 from ReinUsesLisp/core-is-powered-data-raceMai M2021-06-221-2/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Make is_powered_on atomicRodrigo Locatti2021-06-221-2/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #6481 from Morph1984/missing-peak-setbunnei2021-06-221-0/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel: Fix missing peak set in KResourceLimit::SetLimitValueMorph2021-06-181-0/+1
* | | | | | | | Merge pull request #6499 from FernandoS27/we-were-on-a-breakbunnei2021-06-217-0/+31
|\ \ \ \ \ \ \ \
| * | | | | | | | Update dynarmic and add new unsafe CPU option.Fernando Sahmkow2021-06-207-0/+31
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #6475 from ameerj/unlimit-fpsbunnei2021-06-2110-3/+46
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | config: Add frame limiter toggle hotkeyameerj2021-06-173-3/+8
| * | | | | | | nvflinger: Add toggle to disable buffer swap interval limitsameerj2021-06-178-0/+38
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #6486 from CaptV0rt3x/httplibMai M2021-06-211-1/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | externals: httplib: replace custom httplib header with upstream as submodule.Vortex2021-06-181-1/+2
| | |/ / / / | |/| | | |
* / | | | | host_memory: Correct MEM_RESERVE_PLACEHOLDERlat9nq2021-06-191-1/+1
|/ / / / /
* / / / / vulkan_debug_callback: Skip logging known false-positive validation errorsameerj2021-06-181-0/+8
|/ / / /
* | | | Merge pull request #6418 from clementgallet/sdl-audio-backendbunnei2021-06-175-1/+211
|\ \ \ \
| * | | | Various suggestions by v1993 and lioncashClément Gallet2021-06-072-11/+9
| * | | | Add sdl2 audio description in the yuzu-cmd config fileClément Gallet2021-06-061-1/+2
| * | | | Add SDL2 audio backendClément Gallet2021-06-064-0/+211
* | | | | Merge pull request #6469 from ReinUsesLisp/blit-view-compatAmeer J2021-06-171-1/+9
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | texture_cache/util: Avoid relaxed image views on different bytes per pixelReinUsesLisp2021-06-151-1/+9
| | |_|/ | |/| |
* | | | Merge pull request #6464 from ameerj/disable-astcbunnei2021-06-1616-7/+1637
|\ \ \ \
| * | | | astc_decoder: Fix LDR CEM1 endpoint calculationameerj2021-06-162-2/+2
| * | | | yuzu_cmd/config: Add Accelerate ASTC and missing NVDEC emulation settingsameerj2021-06-162-2/+12
| * | | | configure_graphics: Add Accelerate ASTC decoding settingameerj2021-06-169-2/+32
| * | | | textures: Reintroduce CPU ASTC decoderameerj2021-06-164-2/+1592
* | | | | Merge pull request #6460 from Morph1984/fs-access-log-fixMorph2021-06-1612-44/+64
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | common: fs: file: Remove redundant call to WriteStringToFileMorph2021-06-162-6/+1
| * | | | fsp_srv: Fix filesystem access loggingMorph2021-06-1610-38/+63
| |/ / /
* | | | Merge pull request #6462 from Morph1984/proper-flushbunnei2021-06-161-1/+5
|\ \ \ \ | |/ / / |/| | |
| * | | common: fs: file: Flush the file to the disk when Flush() is calledMorph2021-06-131-1/+5
* | | | lm: Demote guest logs to LOG_DEBUGameerj2021-06-151-27/+20
* | | | Merge pull request #6456 from Morph1984/very-important-changesbunnei2021-06-151-1/+1
|\ \ \ \
| * | | | configure_cpu_debug: Clarify settings behaviorMorph2021-06-131-1/+1
| | |/ / | |/| |
* | | | Merge pull request #6448 from Morph1984/recursive-dir-iteratorFernando Sahmkow2021-06-141-2/+16
|\ \ \ \
| * | | | common: fs: Use the normal directory iterator in *Recursively functionsMorph2021-06-121-2/+16
| |/ / /
* | | | general: Remove extraneous includesMorph2021-06-133-3/+0
* | | | common: logging: Restructure backend codeMorph2021-06-138-278/+288
* | | | common: logging: backend: Wrap IOFile in a unique_ptrMorph2021-06-132-6/+27
| |/ / |/| |
* | | Merge pull request #6452 from german77/sixaxis_firmware_stubMorph2021-06-132-1/+23
|\ \ \ | |/ / |/| |
| * | hid: Stub IsFirmwareUpdateAvailableForSixAxisSensorgerman772021-06-112-1/+23
* | | Merge pull request #6451 from Morph1984/check-disk-space-dumpbunnei2021-06-111-0/+12
|\ \ \
| * | | yuzu: main: Ensure enough space is available for RomFS dumpingMorph2021-06-111-0/+12
* | | | Merge pull request #6422 from FernandoS27/i-am-the-senateMai M2021-06-1122-43/+950
|\ \ \ \ | |_|/ / |/| | |
| * | | common/host_memory: Implement a fallback if fastmem fails.Markus Wick2021-06-112-14/+49
| * | | common/host_shader: Load Windows 10 functions dynamicallyReinUsesLisp2021-06-111-29/+88
| * | | GPUTHread: Remove async reads from Normal Accuracy.Fernando Sahmkow2021-06-111-18/+6
| * | | rasterizer: Update pages in batchesReinUsesLisp2021-06-111-15/+41
| * | | host_memory: Support staged VirtualProtect callsReinUsesLisp2021-06-111-3/+12
| * | | General: Add settings for fastmem and disabling adress space check.FernandoS272021-06-1112-6/+83
| * | | common/host_memory: Optimize for huge tables.Markus Wick2021-06-112-11/+24
| * | | core: Make use of fastmemMarkus Wick2021-06-116-8/+30
| * | | tests: Add tests for host memoryReinUsesLisp2021-06-112-0/+184
| * | | common/host_memory: Add Linux implementationMarkus Wick2021-06-111-10/+120
| * | | common/host_memory: Add interface and Windows implementationReinUsesLisp2021-06-113-0/+384
| |/ /
* | | Merge pull request #6443 from Morph1984/k-light-condition-variablebunnei2021-06-114-37/+43
|\ \ \ | |/ / |/| |
| * | kernel: Unconditionally set thread state when appropriateMorph2021-06-112-23/+12
| * | kernel: KLightConditionVariable: Update implementation to 12.xMorph2021-06-112-14/+31
* | | Merge pull request #6407 from lat9nq/fix-libusb-2bunnei2021-06-111-2/+1
|\ \ \
| * | | cmake: General improvements to libusb linkinglat9nq2021-06-031-2/+1
* | | | Merge pull request #6445 from degasus/fix_ubsnbunnei2021-06-113-1/+9
|\ \ \ \ | |_|/ / |/| | |
| * | | Fix GCC undefined behavior sanitizer.Markus Wick2021-06-103-1/+9
* | | | hle: service: sm: Remove redundant session reservation, etc.bunnei2021-06-102-18/+13
|/ / /
* | | hle: service: Increase arbitrary max sessions limit.bunnei2021-06-101-4/+1
* | | hle: kernel: KClientPort: Add an assert for session count.bunnei2021-06-101-0/+3
* | | hle: service: sm: Fix GetService setup of session & port.bunnei2021-06-102-5/+5
* | | hle: service: Use correct size for ServerSessionCountMax.bunnei2021-06-101-4/+6
* | | hle: kernel: KServerSession: Fix client disconnected.bunnei2021-06-103-9/+8
* | | kernel: svc: Add missing error check to CancelSynchronization.bunnei2021-06-101-2/+2
* | | Merge pull request #6436 from liushuyu/masterMai M2021-06-091-8/+9
|\ \ \
| * | | src/common/CMakeLists.txt: fix variable escapingliushuyu2021-06-091-8/+9
* | | | hle: service: Increase arbitrary max sessions limit.bunnei2021-06-091-1/+1
* | | | Merge pull request #6413 from Kewlan/limitable_input_dialog_limitbunnei2021-06-093-5/+48
|\ \ \ \ | |/ / / |/| | |
| * | | limitable_input_dialog: Implement character limiterKewlan2021-06-063-5/+48
* | | | Merge pull request #6435 from lioncash/nodisc2Morph2021-06-091-1/+1
|\ \ \ \
| * | | | common/fs/path_util: Remove [[nodiscard]] from function with void returnLioncash2021-06-091-1/+1
* | | | | Merge pull request #6434 from lioncash/tcontextbunnei2021-06-091-13/+27
|\ \ \ \ \
| * | | | | configure_ui: Add translation context for file-scope stringsLioncash2021-06-091-13/+27
| |/ / / /
* | | | | Merge pull request #6428 from bunnei/service-thread-crash-fixbunnei2021-06-094-28/+56
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | hle: kernel: KServerSession: Work-around scenario where session is closed too early.bunnei2021-06-081-7/+24
| * | | | hle: kernel: hle_ipc: Ensure SessionRequestHandler is valid.bunnei2021-06-083-5/+26
| * | | | hle: kernel: Remove service thread manager and use weak_ptr.bunnei2021-06-083-18/+8
* | | | | Merge pull request #6426 from lat9nq/context-menu-startMai M2021-06-084-3/+23
|\ \ \ \ \
| * | | | | yuzu qt: Start games from context menulat9nq2021-06-084-3/+23
| |/ / / /
* | | | | Merge pull request #6412 from clementgallet/yuzu-cmd-window-glbunnei2021-06-082-12/+6
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Avoid -Wshadow warningClément Gallet2021-06-051-1/+1
| * | | | yuzu-cmd: Fix OpenGL renderingClément Gallet2021-06-042-12/+6
| | |_|/ | |/| |
* | | | Merge pull request #6410 from lat9nq/avoid-oobbunnei2021-06-071-0/+8
|\ \ \ \
| * | | | decoders: Break instead of continuelat9nq2021-06-041-2/+2
| * | | | decoders: Avoid out-of-bounds accesslat9nq2021-06-041-0/+8
* | | | | Merge pull request #6414 from bunnei/fix-service-threadsbunnei2021-06-0721-87/+101
|\ \ \ \ \
| * | | | | hle: kernel: KServerSession: Use ASSERT_MSG where appropriate.bunnei2021-06-071-1/+1
| * | | | | hle: kernel: k_server_session: Return service thread by strong pointer.bunnei2021-06-072-4/+4
| * | | | | hle: kernel: k_server_session: Ensure service thread is valid before dereference.bunnei2021-06-071-1/+3
| * | | | | hle: kernel: hle_ipc: Use default destructor for SessionRequestManager.bunnei2021-06-071-1/+1
| * | | | | hle: kernel: KAutoObjectWithListContainer: Use boost::instrusive::rbtree.bunnei2021-06-0711-22/+26
| * | | | | hle: kernel: Refactor to allocate a ServiceThread per service handler.bunnei2021-06-0513-67/+75
* | | | | | Merge pull request #6400 from ameerj/disable-uniform-simplifybunnei2021-06-078-6/+29
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | buffer_cache: Simplify uniform disabling logicameerj2021-06-018-6/+29
* | | | | | result: Add [[nodiscard]] specifiers where applicableLioncash2021-06-051-20/+20
* | | | | | Merge pull request #6362 from lat9nq/reset-to-defaultsbunnei2021-06-056-3/+122
|\ \ \ \ \ \
| * | | | | | yuzu qt: Use lambda and std::function for reset callbacklat9nq2021-06-014-19/+17
| * | | | | | yuzu: Add settings reset button to general configurationlat9nq2021-06-018-23/+111
| * | | | | | configuration: Initial work to reset all settingsfearlessTobi2021-06-016-0/+33
| |/ / / / /
* | | | | | Merge pull request #6411 from clementgallet/yuzu-cmd-touch-buttonMai M2021-06-052-1/+50
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | yuzu-cmd: Add touch_from_button in config fileClément Gallet2021-06-042-1/+50
| | |_|/ / | |/| | |
* | | | | Merge pull request #6392 from german77/controller-widgetbunnei2021-06-043-2/+25
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | settings: Disable controller preview if controller is not activegerman772021-05-303-2/+25
* | | | | Merge pull request #6389 from german77/Analog_button_fixbunnei2021-06-043-73/+138
|\ \ \ \ \
| * | | | | input_common: Analog button, use time based position instead of frequent updatesgerman772021-05-303-73/+138
| |/ / / /
* | / / / [game_list] Correct light theme loading (#6408)Maide2021-06-041-5/+1
| |/ / / |/| | |
* | | | Merge pull request #6402 from Kelebek1/UIbunnei2021-06-032-34/+17
|\ \ \ \
| * | | | Stop the columns resizing on NAND installKelebek12021-06-022-34/+17
* | | | | Merge pull request #6404 from lat9nq/revert_viewsbunnei2021-06-037-18/+27
|\ \ \ \ \ | | |_|_|/ | |/| | |
| * | | | yuzu qt: Revert some usages of string_viewlat9nq2021-06-037-18/+27
* | | | | fsp-srv: Replace one last instance of RESULT_SUCCESSMorph2021-06-031-1/+1
* | | | | fspsrv: Implement DisableAutoSaveDataCreation (#6355)Chloe2021-06-036-2/+25
* | | | | Merge pull request #6308 from Morph1984/resultbunnei2021-06-03116-978/+975
|\ \ \ \ \
| * | | | | general: Replace RESULT_UNKNOWN with ResultUnknownMorph2021-06-0213-45/+45
| * | | | | general: Replace RESULT_SUCCESS with ResultSuccessMorph2021-06-02113-933/+930
| |/ / / /
* | | | | Merge pull request #6403 from Kewlan/game-list-for-loop-optimizationbunnei2021-06-031-9/+6
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | game_list: Minor for loop optimizationsKewlan2021-06-021-9/+6
| | |_|/ | |/| |
* | | | Merge pull request #6395 from lioncash/result-moveMorph2021-06-022-25/+25
|\ \ \ \
| * | | | common_funcs: Move R_ macros to result.hLioncash2021-05-312-25/+25
* | | | | common: fs: fs_util: Move PathToUTF8String to fs_utilMorph2021-06-024-15/+14
* | | | | common: fs: fs_util: Add more string conversion functionsMorph2021-06-022-0/+33
| |_|/ / |/| | |
* | | | Merge pull request #6361 from lat9nq/per-hb-cfgbunnei2021-06-028-22/+35
|\ \ \ \ | |_|/ / |/| | |
| * | | yuzu qt: Restore const qualifierslat9nq2021-05-262-23/+12
| * | | yuzu qt: Handle per-game configs for title id 0lat9nq2021-05-268-22/+46
* | | | Merge pull request #6318 from german77/dualJoyconbunnei2021-06-012-60/+258
|\ \ \ \
| * | | | input_common: Add dual joycon supportgerman772021-05-232-60/+258
* | | | | Merge pull request #6367 from ReinUsesLisp/vma-hostbunnei2021-06-012-31/+43
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | vulkan_memory_allocator: Allow textures to be allocated in host memoryReinUsesLisp2021-05-272-31/+43
* | | | | Merge pull request #6385 from degasus/save_memory_accessbunnei2021-05-315-33/+77
|\ \ \ \ \
| * | | | | core/memory: Check our memory fallbacks for out-of-bound behavior.Markus Wick2021-05-293-4/+46
| * | | | | core/arm_interface: Improve the performance of memory fallbacks.Markus Wick2021-05-292-29/+31
* | | | | | Merge pull request #6377 from lioncash/pointbunnei2021-05-305-39/+75
|\ \ \ \ \ \
| * | | | | | touchscreen: Make use of common point structLioncash2021-05-282-10/+10
| * | | | | | common: Extract point into a common structLioncash2021-05-283-29/+65
* | | | | | | Merge pull request #6387 from lioncash/class-tokenbunnei2021-05-301-43/+36
|\ \ \ \ \ \ \
| * | | | | | | k_class_token: Use variable templates where applicableLioncash2021-05-291-43/+36
| |/ / / / / /
* | | | | | | Merge pull request #6386 from bunnei/shutdown-fixbunnei2021-05-302-1/+13
|\ \ \ \ \ \ \
| * | | | | | | video_core: gpu: WaitFence: Do not block threads during shutdown.bunnei2021-05-292-1/+13
* | | | | | | | Merge pull request #6374 from Morph1984/swkbd-textcheck-encodingMai M2021-05-302-24/+26
|\ \ \ \ \ \ \ \
| * | | | | | | | applets/swkbd: Make use of std::move where applicableMorph2021-05-282-22/+19
| * | | | | | | | applets/swkbd: Only read the text check message on Failure/ConfirmMorph2021-05-281-2/+7
* | | | | | | | | Merge pull request #6364 from german77/stub-lp2pMai M2021-05-301-0/+141
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | |
| * | | | | | | | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkServicegerman772021-05-261-0/+141
* | | | | | | | | Merge pull request #6379 from degasus/update_dynarmicbunnei2021-05-296-11/+11
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | externals: Update dynarmic.Markus Wick2021-05-296-11/+11
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6384 from lioncash/virtualbunnei2021-05-2915-53/+48
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel: Add missing override specifiersLioncash2021-05-2915-53/+48
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6382 from lioncash/nullbunnei2021-05-291-5/+5
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | k_thread: Move dereference after null check in Initialize()Lioncash2021-05-291-5/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #6373 from bunnei/use-slabheap-tlsbunnei2021-05-292-11/+191
|\ \ \ \ \ \ \ \
| * | | | | | | | hle: kernel: KSlabHeap: Allow host or guest allocations.bunnei2021-05-292-11/+191
* | | | | | | | | Fix two GCC 11 warnings: Unneeded copies.Markus Wick2021-05-292-3/+3
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #6371 from degasus/drop_ExceptionalExitbunnei2021-05-296-18/+42
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | core/arm_interface: Call SVC after end of dynarmic block.Markus Wick2021-05-276-18/+42
* | | | | | | | Merge pull request #6356 from ogniK5377/ApplyNpadSystemCommonPolicybunnei2021-05-281-1/+10
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | hid: ApplyNpadSystemCommonPolicyChloe Marcec2021-05-241-1/+10
* | | | | | | | common/fs/file: Explicitly delete copy constructorsLioncash2021-05-281-1/+4
* | | | | | | | common/fs/file: Devirtualize destructorLioncash2021-05-281-1/+1
* | | | | | | | common/fs/file: Default initialize IOFile membersLioncash2021-05-281-2/+2
| |_|_|/ / / / |/| | | | | |
* | | | | | | video_core: rasterizer_cache: Use u16 for cached page count.bunnei2021-05-272-9/+9
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #6346 from lat9nq/apply-config-pgcAmeer J2021-05-276-18/+57
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | yuzu qt: Add an Apply button to configuration dialogslat9nq2021-05-256-18/+57
* | | | | | Merge pull request #6366 from lat9nq/bundled-qt-linuxMai M2021-05-271-2/+11
|\ \ \ \ \ \
| * | | | | | cmake: Download Qt binaries on Linux if neededlat9nq2021-05-261-2/+11
* | | | | | | core/arm: Drop ChangeProcessorID.Markus Wick2021-05-265-12/+0
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #6331 from lioncash/gestureMorph2021-05-262-67/+79
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | hid/gesture: Factor out last gesture retrieval into its own functionLioncash2021-05-182-14/+23
| * | | | | hid/gesture: Ensure all ID arrays are initializedLioncash2021-05-181-4/+4
| * | | | | hid/gesture: Make Point a templateLioncash2021-05-182-38/+46
| * | | | | hid/gesture: Replace x,y members of GestureState with a PointLioncash2021-05-182-6/+4
| * | | | | hid/gesture: Add default comparators to PointLioncash2021-05-182-10/+7
| * | | | | hid/gesture: Rename Points to PointLioncash2021-05-181-5/+5
* | | | | | Merge pull request #6339 from Morph1984/swkbd-queuedconnectionbunnei2021-05-261-15/+3
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | applets/swkbd: Make use of QueuedConnection in returnPressed signalMorph2021-05-221-15/+3
| | |_|_|/ | |/| | |
* | | | | common: fs: Rework the Common Filesystem interface to make use of std::filesystem (#6270)Morph2021-05-2674-2173/+3789
* | | | | Merge pull request #6349 from german77/suppress_config_warningbunnei2021-05-261-3/+3
|\ \ \ \ \
| * | | | | settings: Suppress duplicate label name warninggerman772021-05-231-3/+3
| |/ / / /
* | | | | Merge pull request #6353 from german77/handheld_dockedbunnei2021-05-253-4/+24
|\ \ \ \ \
| * | | | | settings: Forbid docked mode on handheldgerman772021-05-243-4/+24
| |/ / / /
* | | | | kernel: process_capability: Add MapRegion capabilityMorph2021-05-252-0/+12
* | | | | Merge pull request #6357 from lioncash/compressionbunnei2021-05-254-7/+8
|\ \ \ \ \
| * | | | | zstd_compression: Make use of std::spanLioncash2021-05-242-3/+4
| * | | | | lz4_compression: Make use of std::spanLioncash2021-05-242-4/+4
| |/ / / /
* | | | | Merge pull request #6312 from german77/analogMappingbunnei2021-05-241-26/+28
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | input_common: Fix crash when controller disconnectsgerman772021-05-151-1/+3
| * | | | input_common: Rewrite sdl analog mappinggerman772021-05-151-25/+25
* | | | | Merge pull request #6347 from bunnei/ipc-improvements-next-2bunnei2021-05-2422-356/+249
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | hle: kernel: service_thread: Take reference to KServerSession on service request.bunnei2021-05-211-9/+5
| * | | | hle: kernel: k_port: Use AcceptSession to ensure SessionList state is correct.bunnei2021-05-211-1/+1
| * | | | hle: kernel: Use host memory allocations for KSlabMemory.bunnei2021-05-214-174/+20
| * | | | Revert "WORKAROUND: Do not use slab heap while we track down issues with resource management."bunnei2021-05-211-2/+2
| * | | | hle: kernel: hle_ipc: Simplify incoming/outgoing move/copy/domain objects.bunnei2021-05-213-62/+17
| * | | | common: tree: Avoid a crash on nullptr dereference.bunnei2021-05-211-0/+11
| * | | | hle: kernel: Implement CloneCurrentObject and improve session management.bunnei2021-05-2113-99/+184
| * | | | Revert "WORKAROUND: temp. disable session resource limits while we work out issues"bunnei2021-05-214-11/+11
* | | | | Merge pull request #6248 from A-w-x/intelmesabunnei2021-05-211-1/+1
|\ \ \ \ \
| * | | | | gl_device: Intel: Disable texture view formats workaround on mesaA-w-x2021-04-261-1/+1
* | | | | | Merge pull request #6333 from Morph1984/swkbd-confirm-textbunnei2021-05-211-8/+8
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | applets/swkbd: Send the correct text string on TextCheck::ConfirmMorph2021-05-191-8/+8
* | | | | | Merge pull request #6320 from Morph1984/get-pidbunnei2021-05-212-9/+14
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | hle_ipc: unsigned -> u32Morph2021-05-161-7/+7
| * | | | | hle_ipc: Add a getter for PIDMorph2021-05-162-2/+7
* | | | | | Merge pull request #6321 from lat9nq/per-game-cpubunnei2021-05-2120-302/+290
|\ \ \ \ \ \
| * | | | | | configure_cpu: Simplify UpdateGrouplat9nq2021-05-201-7/+4
| * | | | | | configuration_shared: Drop unused function and template anotherlat9nq2021-05-192-52/+7
| * | | | | | general: Demote custom_rtc to regular settinglat9nq2021-05-176-58/+30
| * | | | | | configuration: Add CPU tab to game propertieslat9nq2021-05-1613-88/+181
| * | | | | | configuration: Simplify applying per-game settingslat9nq2021-05-166-112/+69
| * | | | | | configuration_shared: Add some commentslat9nq2021-05-161-6/+14
| * | | | | | general: Make CPU accuracy and related a Settings::Settinglat9nq2021-05-167-41/+47
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #6297 from lioncash/common-convbunnei2021-05-201-1/+2
|\ \ \ \ \ \
| * | | | | | parent_of_member: Make sign conversion explicit in OffsetOfImpl()Lioncash2021-05-101-1/+2
* | | | | | | Merge pull request #6310 from german77/nanMotionbunnei2021-05-201-0/+23
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | input_common: Sanitize motion datagerman772021-05-131-0/+23
* | | | | | | Merge pull request #6317 from ameerj/fps-fixbunnei2021-05-1910-14/+26
|\ \ \ \ \ \ \
| * | | | | | | perf_stats: Rework FPS counter to be more accurateameerj2021-05-1610-14/+26
| | |_|/ / / / | |/| | | | |
* | | | | | | KTransferMemory: Return size instead of size * PageSize in GetSize()Morph2021-05-181-1/+1
* | | | | | | Merge pull request #6322 from ameerj/fast-null-bufferbunnei2021-05-181-1/+4
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | buffer_cache: Ensure null buffers cannot take the fast uniform bind pathameerj2021-05-161-1/+4
| |/ / / / /
* | | | | | Merge pull request #6328 from Morph1984/enforce-c4715Mat M2021-05-171-0/+1
|\ \ \ \ \ \
| * | | | | | CMakeLists: Enforce C4715 on MSVCMorph2021-05-171-0/+1
* | | | | | | configure_debug: FIx duplicate labelsMorph2021-05-171-5/+5
|/ / / / / /
* | | | | | yuzu/main: Fix version info in logging and about dialogMorph2021-05-173-14/+17
* | | | | | Merge pull request #6319 from Morph1984/no-install-basebunnei2021-05-174-3/+28
|\ \ \ \ \ \
| * | | | | | main: Prevent installing base titles into NANDMorph2021-05-164-3/+28
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #6284 from ameerj/shantae-fixbunnei2021-05-162-5/+35
|\ \ \ \ \ \
| * | | | | | nvflinger: Create layers when they are queried but not foundameerj2021-05-062-5/+35
* | | | | | | Merge pull request #6296 from lioncash/shadow-errorbunnei2021-05-1699-279/+304
|\ \ \ \ \ \ \
| * | | | | | | core: Make variable shadowing a compile-time errorLioncash2021-05-1699-279/+304
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #6307 from Morph1984/fix-response-push-sizebunnei2021-05-162-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | nifm, ssl: Fix incorrect response sizesMorph2021-05-162-2/+2
* | | | | | | Merge pull request #6316 from ameerj/title-fixbunnei2021-05-161-11/+6
|\ \ \ \ \ \ \
| * | | | | | | main: Add title's version to window name on EA/mainlineameerj2021-05-151-11/+6
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #6299 from bunnei/ipc-improvementsbunnei2021-05-1619-220/+354
|\ \ \ \ \ \ \
| * | | | | | | common: tree: Avoid a nullptr dereference.bunnei2021-05-121-1/+1
| * | | | | | | hle: kernel: hle_ipc: Fix outgoing IPC response size calculation.bunnei2021-05-113-1/+15
| * | | | | | | WORKAROUND: temp. disable session resource limits while we work out issuesbunnei2021-05-114-11/+11
| * | | | | | | WORKAROUND: Do not use slab heap while we track down issues with resource management.bunnei2021-05-111-2/+2
| * | | | | | | audrenbunnei2021-05-112-25/+16
| * | | | | | | core: hle: ipc_helpers: Fix cast on raw_data_size calculation.bunnei2021-05-111-1/+1
| * | | | | | | hle: service: sm: Add TIPC support.bunnei2021-05-112-41/+66
| * | | | | | | hle: kernel: hle_ipc: Improve IPC code and add initial support for TIPC.bunnei2021-05-112-81/+57
| * | | | | | | hle: service: sm: GetService: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+7
| * | | | | | | hle: service: Add support for dispatching TIPC requests.bunnei2021-05-112-1/+52
| * | | | | | | hle: service: Implement IPC::CommandType::Close.bunnei2021-05-113-11/+15
| * | | | | | | hle: service: sm: Use RegisterNamedService to register the service.bunnei2021-05-111-1/+1
| * | | | | | | hle: service: sm: Improve Initialize implementation.bunnei2021-05-112-0/+3
| * | | | | | | hle: kernel: svc: Update ConnectToNamedPort to use new CreateNamedServicePort interface.bunnei2021-05-111-4/+3
| * | | | | | | hle: kernel: Implement named service ports using service interface factory.bunnei2021-05-114-22/+30
| * | | | | | | hle: kernel: KSession: Improve implementation of CloneCurrentObject.bunnei2021-05-111-2/+10
| * | | | | | | hle: service: sm: Increase point buffer size.bunnei2021-05-111-1/+1
| * | | | | | | hle: ipc_helpers: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+5
| * | | | | | | hle: kernel: KClientPort: Cleanup comment format.bunnei2021-05-111-1/+1
| * | | | | | | hle: ipc: Add declarations for TIPC.bunnei2021-05-111-1/+16
| * | | | | | | hle: kernel: Further cleanup and add TIPC helpers.bunnei2021-05-112-4/+12
| * | | | | | | hle: ipc_helpers: Update IPC response generation for TIPC.bunnei2021-05-112-19/+39
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #6289 from ameerj/oob-blitbunnei2021-05-168-61/+99
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | texture_cache: Handle out of bound texture blitsameerj2021-05-088-61/+99
| | |_|/ / / | |/| | | |
* | | | | | input_common: Implement SDL motiongerman772021-05-155-3/+167
| |_|/ / / |/| | | |
* | | | | Merge pull request #6301 from Morph1984/ssl-ImportClientPkibunnei2021-05-131-2/+40
|\ \ \ \ \
| * | | | | ssl: Stub Import(Client/Server)PkiMorph2021-05-131-2/+40
* | | | | | Merge pull request #6298 from Kewlan/toggled-show-add-on-refreshMorph2021-05-131-0/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | configure_ui: Call RequestGameListUpdate when toggling "Show Add-Ons Column"Kewlan2021-05-101-0/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #6267 from german77/gestureRewriteMorph2021-05-122-76/+340
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | hid: Improve hardware accuracy of gesturesgerman772021-05-052-76/+340
* | | | | Merge pull request #6291 from lioncash/kern-shadowbunnei2021-05-1040-140/+138
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | kernel: Eliminate variable shadowingLioncash2021-05-0840-140/+138
* | | | | kernel: Delete unused filesgerman772021-05-092-151/+0
|/ / / /
* | | | Merge pull request #6266 from bunnei/kautoobject-refactorbunnei2021-05-08181-2834/+4815
|\ \ \ \
| * | | | hle: kernel: KPageTable: CanContain should not be constexpr.bunnei2021-05-062-2/+2
| * | | | hle: kernel: Move slab resource counts to Kernel.bunnei2021-05-064-33/+52
| * | | | fixup! hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-061-2/+2
| * | | | fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-1/+1
| * | | | fixup! common: bit_util: Add BIT macro.bunnei2021-05-061-2/+0
| * | | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| * | | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| * | | | kernel: svc: Remove unused RetrieveResourceLimitValue function.bunnei2021-05-061-32/+0
| * | | | hle: kernel: Fix un/sign mismatch errors with NUM_CPU_CORES.bunnei2021-05-061-3/+3
| * | | | fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-6/+2
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-0/+3
| * | | | fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-7/+0
| * | | | common: parent_of_member: Fix build for OffsetOf().bunnei2021-05-061-4/+4
| * | | | fixup! common: intrusive_red_black_tree: Disable static_assert that will not evaluate as constant on MSVC.bunnei2021-05-061-5/+0
| * | | | fixup! hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-062-2/+2
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * | | | fixup! hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-061-12/+12
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * | | | fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| * | | | fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-063-22/+28
| * | | | fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-061-1/+1
| * | | | fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-60/+58
| * | | | fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-11/+9
| * | | | fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-9/+2
| * | | | fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-46/+46
| * | | | fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-1/+1
| * | | | fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-8/+8
| * | | | common: Rename NON_COPYABLE/NON_MOVABLE with YUZU_ prefix.bunnei2021-05-065-11/+11
| * | | | fixup! hle: kernel: Rename Process to KProcess.bunnei2021-05-061-1/+1
| * | | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * | | | fixup! hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-061-3/+3
| * | | | hle: kernel: svc: ConnectToNamedPort: Use KHandleTable::Reserve.bunnei2021-05-061-3/+8
| * | | | hle: kernel: Migrate to KHandleTable.bunnei2021-05-0622-381/+503
| * | | | hle: kernel: KClassToken: Ensure class tokens are correct.bunnei2021-05-061-1/+127
| * | | | hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-0610-95/+210
| * | | | hle: kernel: Rename Process to KProcess.bunnei2021-05-0683-247/+249
| * | | | hle: kernel: Remove deprecated Object class.bunnei2021-05-0639-423/+34
| * | | | hle: kernel: Do not shutdown twice on emulator close.bunnei2021-05-061-3/+1
| * | | | hle: kernel: Cleanup shutdown of persistent kernel objects.bunnei2021-05-061-14/+12
| * | | | hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-0622-166/+444
| * | | | hle: kernel: Migrate KServerPort to KAutoObject.bunnei2021-05-068-52/+67
| * | | | hle: kernel: Migrate KClientPort to KAutoObject.bunnei2021-05-0618-63/+92
| * | | | hle: kernel: HandleTable: Remove deprecated APIs.bunnei2021-05-067-111/+28
| * | | | hle: kernel: Migrate KResourceLimit to KAutoObject.bunnei2021-05-0613-122/+197
| * | | | hle: kernel: svc: Migrate WaitSynchronization.bunnei2021-05-062-47/+78
| * | | | hle: kernel: svc: Use new handle table API for Process.bunnei2021-05-062-16/+17
| * | | | hle: kernel: Migrate KTransferMemory to KAutoObject.bunnei2021-05-0612-68/+209
| * | | | hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-0631-356/+412
| * | | | hle: kernel: svc: Migrate GetThreadContext, GetThreadCoreMask.bunnei2021-05-061-2/+59
| * | | | hle: kernel: svc: Migrate GetProcessId, CancelSynchronization, SetThreadActivity.bunnei2021-05-061-13/+67
| * | | | hle: kernel: KThread: Remove incorrect resource release.bunnei2021-05-061-2/+1
| * | | | hle: kernel: svc_results: Update naming..bunnei2021-05-068-42/+43
| * | | | hle: kernel: KThread: Add missing resource hint release.bunnei2021-05-061-1/+1
| * | | | hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-0635-200/+215
| * | | | hle: ipc_helpers: Add methods for copy/move references.bunnei2021-05-061-2/+24
| * | | | hle: kernel: Move slab heaps to their own container.bunnei2021-05-062-10/+16
| * | | | hle: kernel: Refactor several threads/events/sharedmemory to use slab heaps.bunnei2021-05-0611-59/+53
| * | | | hle: kernel: Move slab heap management to KernelCore.bunnei2021-05-067-64/+106
| * | | | hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-0620-0/+55
| * | | | hle: kernel: Use unique_ptr for suspend and dummy threads.bunnei2021-05-061-8/+8
| * | | | hle: kernel: Migrate KEvent to KAutoObject.bunnei2021-05-0637-266/+269
| * | | | hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-0616-114/+128
| * | | | hle: kernel: Migrate KProcess to KAutoObject.bunnei2021-05-0614-58/+80
| * | | | hle: kernel: Refactor IPC interfaces to not use std::shared_ptr.bunnei2021-05-0628-59/+65
| * | | | hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-0618-294/+451
| * | | | hle: kernel: svc: Migrate GetThreadPriority, StartThread, and ExitThread.bunnei2021-05-061-21/+12
| * | | | hle: kernel: svc: Migrate CreateThread.bunnei2021-05-061-14/+21
| * | | | hle: kernel: Migrate idle threads.bunnei2021-05-062-13/+9
| * | | | hle: kernel: Migrate KThread to KAutoObject.bunnei2021-05-062-109/+91
| * | | | hle: kernel: Add initial impl. of slab setup.bunnei2021-05-063-0/+227
| * | | | hle: kernel: Refactor out various KThread std::shared_ptr usage.bunnei2021-05-0610-58/+30
| * | | | core: Defer CoreTiming initialization.bunnei2021-05-061-1/+1
| * | | | core: memory: Add a work-around to allocate and access kernel memory regions by vaddr.bunnei2021-05-063-1/+46
| * | | | common: common_funcs: Add Size helper function.bunnei2021-05-061-0/+15
| * | | | hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-062-0/+234
| * | | | common: bit_util: Add BIT macro.bunnei2021-05-061-0/+2
| * | | | hle: kernel: Add initial impl. of KSlabAllocated.bunnei2021-05-062-0/+153
| * | | | hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-063-0/+109
| * | | | hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-063-0/+306
| * | | | common: intrusive_red_black_tree: Disable static_assert that will not evaluate as constant on MSVC.bunnei2021-05-061-0/+4
| * | | | common: common_funcs: Add helper macros for non-copyable and non-moveable.bunnei2021-05-061-0/+8
| | |/ / | |/| |
* | | | Merge pull request #6287 from lioncash/ldr-copybunnei2021-05-071-5/+3
|\ \ \ \ | |/ / / |/| | |
| * | | ldr: Simplify memory copy within LoadNro()Lioncash2021-05-071-5/+3
* | | | Merge pull request #6279 from ogniK5377/nvhost-profbunnei2021-05-061-3/+14
|\ \ \ \ | |/ / / |/| | |
| * | | Update src/core/hle/service/nvdrv/interface.cppbunnei2021-05-061-1/+1
| * | | nvdrv: /dev/nvhost-prof-gpu for productionChloe Marcec2021-05-031-3/+14
* | | | service: Remove unused class variablesLioncash2021-05-053-7/+4
| |/ / |/| |
* | | service: Resolve cases of member field shadowingLioncash2021-05-0460-117/+119
* | | Merge pull request #6278 from lioncash/misc-shadowbunnei2021-05-0410-25/+27
|\ \ \
| * | | core: Resolve misc cases of variable shadowingLioncash2021-05-0310-25/+27
* | | | Merge pull request #6275 from german77/mousefocusbunnei2021-05-033-1/+18
|\ \ \ \ | |_|/ / |/| | |
| * | | input_common: Release mouse buttons on out of focusgerman772021-05-033-1/+18
| |/ /
* / / hid: Fix touch not initializing properly if disabledgerman772021-05-032-2/+10
|/ /
* | Merge pull request #6269 from lioncash/file-shadowbunnei2021-05-0321-114/+132
|\ \
| * | file_sys: Resolve cases of variable shadowingLioncash2021-05-0221-114/+132
* | | Merge pull request #6263 from Kewlan/folder-swap-expand-stateMorph2021-05-021-2/+4
|\ \ \
| * | | game_list: Fix dir move up/down expand stateKewlan2021-04-301-2/+4
* | | | Merge pull request #6265 from Morph1984/snap-save-fixbunnei2021-05-022-2/+8
|\ \ \ \ | |_|/ / |/| | |
| * | | service: filesystem: Return proper error codes for CreateFileMorph2021-05-012-2/+8
* | | | Merge pull request #6261 from Kewlan/game-list-filter-fixbunnei2021-05-012-5/+6
|\ \ \ \
| * | | | game_list: Update filter results when removing directoriesKewlan2021-04-302-5/+6
* | | | | Disable touch if setting is not enabledgerman772021-05-012-2/+2
| |/ / / |/| | |
* | | | Merge pull request #6257 from Morph1984/fix-use-after-free-webappletbunnei2021-04-306-25/+28
|\ \ \ \
| * | | | applets/web: Fix a use-after-free when passing in the URL stringMorph2021-04-286-25/+28
* | | | | Merge pull request #6243 from german77/GCresetOriginbunnei2021-04-302-2/+7
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | input_common: Reset GC sticks center by measuring multiple packetsgerman772021-04-272-2/+7
* | | | | Merge pull request #6226 from german77/sevensixbunnei2021-04-3010-17/+220
|\ \ \ \ \
| * | | | | address commentsgerman772021-04-272-5/+5
| * | | | | hid: Implement SevenSixAxis and ConsoleSixAxisSensorgerman772021-04-2410-17/+220
* | | | | | yuzu: config: Silence narrowing conversion warning on MSVCMorph2021-04-291-2/+1
| |_|_|/ / |/| | | |
* | | | | yuzu: main: Silence type conversion warning on MSVCMorph2021-04-281-1/+1
| |_|/ / |/| | |
* | | | loader: Resolve instances of variable shadowingLioncash2021-04-2719-169/+257
| |/ / |/| |
* | | Merge pull request #6246 from lioncash/shadowbunnei2021-04-2715-76/+81
|\ \ \
| * | | service: Eliminate cases of member shadowingLioncash2021-04-2615-76/+81
| | |/ | |/|
* | | Merge pull request #6236 from Morph1984/swkbd-button-hint-scalingbunnei2021-04-261-12/+6
|\ \ \ | |/ / |/| |
| * | applets/swkbd: Fix software keyboard button hint scalingIts-Rei2021-04-241-12/+6
* | | Merge pull request #6198 from Kewlan/favorite-gamesbunnei2021-04-265-5/+144
|\ \ \
| * | | game_list: Mark games as favorite to make them appear at the top.Kewlan2021-04-155-5/+144
* | | | Merge pull request #6237 from ameerj/nvdec-end-fixbunnei2021-04-264-15/+11
|\ \ \ \
| * | | | nvhost_vic: Fix device closureameerj2021-04-254-15/+11
* | | | | config: Add new keyboard bindingsMorph2021-04-251-9/+10
* | | | | vk_texture_cache: Swap R and B channels of color flipped formatameerj2021-04-251-1/+24
|/ / / /
* | | | Merge pull request #6234 from Morph1984/stub-amMat M2021-04-242-1/+10
|\ \ \ \
| * | | | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabledMorph2021-04-242-1/+10
* | | | | Merge pull request #6235 from german77/ectx_awMat M2021-04-244-0/+49
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | glue: Add ectx:aw placeholdergerman772021-04-244-0/+49
| | |_|/ | |/| |
* | | | Merge pull request #6230 from Morph1984/default-resource-sizebunnei2021-04-243-4/+8
|\ \ \ \
| * | | | program_metadata: Set a default resource size when a NPDM is not presentMorph2021-04-233-4/+8
* | | | | Merge pull request #6227 from lioncash/metabunnei2021-04-241-0/+6
|\ \ \ \ \
| * | | | | program_metadata: Explicitly specify copy/move functionsLioncash2021-04-231-0/+6
* | | | | | Merge pull request #6228 from lioncash/semibunnei2021-04-241-6/+7
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | lm: Make use of insert_or_assign() in Log()Lioncash2021-04-231-1/+1
| * | | | | lm: Prevent redundant map lookups in Log()Lioncash2021-04-231-4/+5
| * | | | | lm: Resolve -Wextra-semi warningLioncash2021-04-231-1/+1
| |/ / / /
* | | | | Merge pull request #6229 from lioncash/unused-varbunnei2021-04-242-6/+0
|\ \ \ \ \
| * | | | | acc/lbl: Remove unused variablesLioncash2021-04-232-6/+0
| |/ / / /
* | | | | Merge pull request #6231 from lioncash/aesbunnei2021-04-232-9/+5
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | aes_util: Make use of std::spanLioncash2021-04-232-9/+5
| |/ / /
* | | | Merge pull request #6232 from lioncash/alias2bunnei2021-04-234-26/+29
|\ \ \ \
| * | | | emu_window: Return pair from ClipToTouchScreen() instead of tupleLioncash2021-04-232-5/+8
| * | | | emu_window: unsigned -> u32Lioncash2021-04-234-23/+23
| |/ / /
* | / / yuzu_cmd: Remove unused resource.hameerj2021-04-232-17/+0
| |/ / |/| |
* | | service: hid: Get transfer memory for InitializeSevenSixAxisSensorMorph2021-04-221-1/+38
|/ /
* | Merge pull request #6214 from Morph1984/time-fix-kirby-clashbunnei2021-04-211-3/+5
|\ \
| * | time: Write buffer before pushing RESULT_SUCCESS in GetClockSnapshotMorph2021-04-191-1/+2
| * | time: Fix GetClockSnapshotFromSystemClockContextMorph2021-04-191-2/+3
* | | Merge pull request #6219 from lioncash/log-erasebunnei2021-04-212-10/+12
|\ \ \
| * | | log/backend: Use in-class initializer for FileBackendLioncash2021-04-202-6/+8
| * | | log/backend: Make use of erase_ifLioncash2021-04-201-4/+4
| |/ /
* | | Merge pull request #6218 from lioncash/tcachebunnei2021-04-201-1/+1
|\ \ \
| * | | texture_cache/util: Fix src being used instead of dst within DeduceBlitImagesLioncash2021-04-191-1/+1
| |/ /
* | | Merge pull request #6207 from lat9nq/sdl-2.0.14bunnei2021-04-206-1/+48
|\ \ \
| * | | general: Ignore implicit-fallthrough for SDL.hlat9nq2021-04-185-0/+47
| * | | cmake: Use SDL 2.0.14 and fix CMake scope issuelat9nq2021-04-181-1/+1
| |/ /
* | | Merge pull request #6217 from Morph1984/consistent-writebuffersbunnei2021-04-203-5/+12
|\ \ \
| * | | general: Write buffers before pushing raw argumentsMorph2021-04-193-5/+12
| |/ /
* | | Merge pull request #6215 from lioncash/duplicatebunnei2021-04-202-2/+1
|\ \ \
| * | | npad: Remove duplicated class member variableLioncash2021-04-192-2/+1
| |/ /
* | | arp: Use type alias for issue functionLioncash2021-04-191-4/+4
* | | arp: Prevent uninitialized read of launch member variableLioncash2021-04-191-1/+1
|/ /
* | applets: Send focus state change message on applet state changeMorph2021-04-1710-22/+56
* | applets: Make the applet mode a protected property of AppletMorph2021-04-1714-22/+20
* | Merge pull request #6125 from ogniK5377/nvdec-close-devbunnei2021-04-173-11/+14
|\ \
| * | Address issuesChloe Marcec2021-04-161-3/+2
| * | nvdrv: Cleanup CDMA Processor on device closureChloe Marcec2021-03-303-11/+15
* | | Merge pull request #6133 from Morph1984/project-eleuthiabunnei2021-04-1735-468/+8141
|\ \ \
| * | | applets/swkbd: Implement the Qt Software Keyboard frontendMorph2021-04-156-14/+5518
| * | | error: Make the error code as the title text of the OverlayDialogMorph2021-04-154-15/+17
| * | | overlay_dialog: Add an overlay text dialog that accepts controller inputMorph2021-04-155-1/+768
| * | | main: Move meta type registration into its own functionMorph2021-04-152-9/+65
| * | | input_interpreter: Fix button hold being interpreted incorrectly on initMorph2021-04-152-1/+17
| * | | applets/swkbd: Implement the Default Software Keyboard frontendMorph2021-04-152-2/+236
| * | | applets/swkbd: Implement the Normal and Inline Software Keyboard AppletMorph2021-04-154-13/+1488
| * | | ILibraryAppletCreator: Implement CreateHandleStorageMorph2021-04-152-6/+64
| * | | hle_ipc: Add helper functions to get copy/move handlesMorph2021-04-152-2/+16
| * | | ILibraryAppletAccessor: Demote from ERROR to DEBUG for null storage logsMorph2021-04-151-2/+2
| * | | applets: Pass in the LibraryAppletMode each applet's constructorMorph2021-04-1513-33/+58
| * | | applets: Remove the previous software keyboard applet implementationMorph2021-04-158-492/+14
* | | | Merge pull request #6119 from german77/SDLMappingbunnei2021-04-162-6/+24
|\ \ \ \ | |/ / / |/| | |
| * | | InputCommon: Name properly xbox 360 and one controllers, Fix mappings for Nintendo Pro controllersgerman772021-03-312-6/+24
* | | | Merge pull request #6199 from lioncash/log-nsbunnei2021-04-1511-45/+58
|\ \ \ \
| * | | | log/backend: Correct order of const in copy constructorLioncash2021-04-151-2/+5
| * | | | common/log: Move Log namespace into the Common namespaceLioncash2021-04-1511-43/+53
* | | | | Merge pull request #6196 from bunnei/asserts-settingbunnei2021-04-15118-147/+171
|\ \ \ \ \
| * | | | | common: Move settings to common from core.bunnei2021-04-15116-146/+144
| * | | | | core: settings: Add setting for debug assertions and disable by default.bunnei2021-04-157-2/+28
* | | | | | Merge pull request #6197 from ameerj/kreslimit-cleanupbunnei2021-04-144-21/+13
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | k_resource_limit: Minor cleanup of member variables/headersameerj2021-04-144-21/+13
* | | | | | Merge pull request #6195 from Morph1984/controller-applet-motionbunnei2021-04-142-0/+19
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | applets/controller: Hook up the "Motion" button functionalityMorph2021-04-132-0/+19
* | | | | | Merge pull request #6185 from ameerj/process-reslimitbunnei2021-04-142-38/+27
|\ \ \ \ \ \
| * | | | | | kernel/process: Replace process resource limit instance with the kernel's resource limitameerj2021-04-122-38/+27
* | | | | | | Merge pull request #6191 from lioncash/vdtorbunnei2021-04-144-4/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | engine_interface: Add missing virtual destructorLioncash2021-04-124-4/+5
* | | | | | | Merge pull request #6190 from lioncash/constfn2bunnei2021-04-141-2/+2
|\ \ \ \ \ \ \
| * | | | | | | vk_master_semaphore: Deduplicate atomic access within IsFree()Lioncash2021-04-121-1/+1
| * | | | | | | vk_master_semaphore: Add missing const qualifier for IsFree()Lioncash2021-04-121-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #6188 from lioncash/bitsbunnei2021-04-141-5/+6
|\ \ \ \ \ \ \
| * | | | | | | vk_texture_cache: Make use of Common::BitCast where applicableLioncash2021-04-121-5/+6
| |/ / / / / /
* | | | | | | Merge pull request #6187 from lioncash/sign-convbunnei2021-04-132-11/+15
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | texure_cache/util: Resolve implicit sign conversions with std::reduceLioncash2021-04-122-11/+15
| |/ / / / /
* | | | | | Merge pull request #6186 from lioncash/cache-erasebunnei2021-04-131-5/+4
|\ \ \ \ \ \
| * | | | | | query_cache: Make use of std::erase_ifLioncash2021-04-121-5/+4
| |/ / / / /
* | | / / / nvidia_flags: Add missing header guardLioncash2021-04-131-0/+2
| |_|/ / / |/| | | |
* | | | | k_thread: Remove [[nodiscard]] attribute from ClearWaitCancelled()Lioncash2021-04-121-1/+1
|/ / / /
* | | | Merge pull request #6135 from Morph1984/borderless-windowed-fullscreenbunnei2021-04-125-9/+120
|\ \ \ \ | |/ / / |/| | |
| * | | config: Default to exclusive fullscreen mode on platforms other than WindowsMorph2021-04-061-0/+12
| * | | configure_graphics: Add Borderless Windowed fullscreen modeMorph2021-04-065-9/+108
* | | | Merge pull request #6181 from Joshua-Ashton/robustness_featuresRodrigo Locatti2021-04-121-0/+9
|\ \ \ \
| * | | | vulkan_device: Enable EXT_robustness2 featuresJoshua Ashton2021-04-111-0/+9
* | | | | Merge pull request #6182 from Joshua-Ashton/null-offsetRodrigo Locatti2021-04-121-1/+1
|\ \ \ \ \
| * | | | | vk_buffer_cache: Fix offset for NULL vertex buffersJoshua Ashton2021-04-111-1/+1
* | | | | | Merge pull request #6170 from Morph1984/more-time-fixesbunnei2021-04-116-21/+38
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | service: time: Setup the network clock with the local clock contextMorph2021-04-086-21/+38
* | | | | | renderer_vulkan: Check return value of AcquireNextImageJoshua Ashton2021-04-113-5/+10
| |/ / / / |/| | | |
* | | | | Merge pull request #6167 from Morph1984/time-fixbunnei2021-04-111-3/+8
|\ \ \ \ \
| * | | | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUserMorph2021-04-081-3/+8
* | | | | | Merge pull request #6112 from ogniK5377/pctlbunnei2021-04-116-31/+254
|\ \ \ \ \ \
| * | | | | | Addressed issuesChloe Marcec2021-03-302-21/+22
| * | | | | | pctl: Rework how pctl works to be more accurateChloe Marcec2021-03-266-31/+253
* | | | | | | Merge pull request #6172 from degasus/cmake_opusbunnei2021-04-101-1/+1
|\ \ \ \ \ \ \
| * | | | | | | externals: Search for shared opus installation.Markus Wick2021-04-081-1/+1
* | | | | | | | Merge pull request #6099 from bunnei/derive-membunnei2021-04-1026-173/+2139
|\ \ \ \ \ \ \ \
| * | | | | | | | hle: kernel: Breakup InitializeMemoryLayout.bunnei2021-03-241-3/+7
| * | | | | | | | hle: kernel: k_memory_region_type: Minor code cleanup.bunnei2021-03-241-13/+12
| * | | | | | | | hle: kernel: k_memory_region: Minor code cleanup.bunnei2021-03-241-7/+5
| * | | | | | | | hle: kernel: k_memory_layout: Use pair instead of tuple.bunnei2021-03-241-2/+4
| * | | | | | | | hle: kernel: k_system_control: Remove unnecessary inline.bunnei2021-03-241-4/+4
| * | | | | | | | common: common_sizes: Move sizes to the Common namespace.bunnei2021-03-245-45/+50
| * | | | | | | | hle: kernel: Merge KMemoryRegionAttr and KMemoryRegionType.bunnei2021-03-212-11/+9
| * | | | | | | | hle: kernel: Remove unused variable.bunnei2021-03-211-1/+0
| * | | | | | | | hle: kernel: k_memory_region_type: Remove extra ".bunnei2021-03-211-1/+1
| * | | | | | | | hle: kernel: k_memory_layout: Move KMemoryRegionAllocator out of global.bunnei2021-03-213-35/+47
| * | | | | | | | hle: kernel: k_memory_layout: Derive memory regions based on board layout.bunnei2021-03-216-56/+1033
| * | | | | | | | common: common_sizes: Move Invalid to Size_* prefix and add missing values.bunnei2021-03-212-15/+21
| * | | | | | | | hle: kernel: k_memory_region: Refactor to simplify code.bunnei2021-03-212-83/+89
| * | | | | | | | hle: kernel: board: k_system_control: Extend to include memory region sizes.bunnei2021-03-213-1/+135
| * | | | | | | | hle: kernel: board: Add secure_monitor module.bunnei2021-03-212-0/+27
| * | | | | | | | common: Move common sizes to their own header for code reuse.bunnei2021-03-213-13/+25
| * | | | | | | | hle: kernel: k_address_space_info: Cleanup.bunnei2021-03-211-9/+9
| * | | | | | | | hle: kernel: Add k_trace module.bunnei2021-03-212-0/+13
| * | | | | | | | hle: kernel: KSystemControl: Update to reflect board-specific behavior.bunnei2021-03-214-10/+41
| * | | | | | | | hle: kernel: KMemoryManager: Add CalculateManagementOverheadSize.bunnei2021-03-212-0/+26
| * | | | | | | | hle: kernel: KMemoryManager: Add aliases.bunnei2021-03-211-0/+4
| * | | | | | | | hle: kernel: Add architecture and board specific memory regions.bunnei2021-03-212-0/+72
| * | | | | | | | hle: kernel: KMemoryRegion: Derive region values.bunnei2021-03-211-0/+327
| * | | | | | | | hle: kernel: Migrate some code from Common::SpinLock to KSpinLock.bunnei2021-03-215-25/+25
| * | | | | | | | hle: kernel: Add initial KMemoryRegionType module.bunnei2021-03-213-18/+41
| * | | | | | | | hle: kernel: Move KMemoryRegion to its own module and update.bunnei2021-03-214-31/+322
* | | | | | | | | Merge pull request #6171 from german77/servicesbunnei2021-04-1030-97/+137
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | wlan: Update to 12.xgerman772021-04-091-0/+7
| * | | | | | | | | usb: Use proper namesgerman772021-04-091-21/+21
| * | | | | | | | | ITimeZoneService: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | | spl: Update to 12.xgerman772021-04-091-0/+3
| * | | | | | | | | sfdnsres: Use proper namesgerman772021-04-091-2/+2
| * | | | | | | | | nsd: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | | ethc: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | | sm: Use proper names, update to 12.xgerman772021-04-091-4/+5
| * | | | | | | | | set_sys: Update to 12.xgerman772021-04-091-0/+6
| * | | | | | | | | pctl_module: Update to 12.xgerman772021-04-091-0/+3
| * | | | | | | | | pcie: Use proper namesgerman772021-04-091-1/+1
| * | | | | | | | | olsc: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | | pl_u: Update to 12.xgerman772021-04-091-0/+4
| * | | | | | | | | ldr: Use proper namesgerman772021-04-091-16/+16
| * | | | | | | | | arp: Use proper names, update to 12.xgerman772021-04-092-3/+10
| * | | | | | | | | caps_u: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | | caps_a: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | | bpc: Use proper namesgerman772021-04-091-2/+2
| * | | | | | | | | bcat_module: Update to 12.xgerman772021-04-091-0/+2
| * | | | | | | | | codecctl: Use proper namesgerman772021-04-091-13/+13
| * | | | | | | | | audren_u: Use proper namesgerman772021-04-092-4/+4
| * | | | | | | | | audren_a: Use proper namesgerman772021-04-091-6/+6
| * | | | | | | | | audrec_u: Use proper names, update to 12.xgerman772021-04-091-3/+4
| * | | | | | | | | audrec_a: Use proper namesgerman772021-04-091-2/+2
| * | | | | | | | | audout_u: Use proper namesgerman772021-04-091-3/+3
| * | | | | | | | | audout_a: Use proper namesgerman772021-04-091-6/+6
| * | | | | | | | | audin_u: Use proper namesgerman772021-04-091-7/+7
| * | | | | | | | | audin_a: Use proper namesgerman772021-04-091-4/+4
* | | | | | | | | | Merge pull request #6156 from lioncash/lock-discardbunnei2021-04-103-9/+12
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Amend bizarre clang-format suggestionsLioncash2021-04-073-5/+5
| * | | | | | | | | | k_scoped_scheduler_lock_and_sleep: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| * | | | | | | | | | k_scoped_lock: delete copy and move assignment operatorsLioncash2021-04-071-2/+5
| * | | | | | | | | | k_scoped_lock: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| * | | | | | | | | | k_scheduler: Mark KScopedSchedulerLock as [[nodiscard]]Lioncash2021-04-071-1/+1
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6113 from german77/playhistorybunnei2021-04-101-1/+13
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Friend: Stub GetPlayHistoryRegistrationKeygerman772021-03-271-1/+13
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6158 from german77/hidServiceTablesbunnei2021-04-102-0/+85
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | hid: Update service function tablesgerman772021-04-072-0/+85
* | | | | | | | | | | Merge pull request #6162 from degasus/no_spin_loopsbunnei2021-04-096-33/+64
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core: Use a CV for blocking commands.Markus Wick2021-04-072-23/+31
| * | | | | | | | | | | video_core/gpu_thread: Keep the write lock for allocating the fence.Markus Wick2021-04-072-1/+4
| * | | | | | | | | | | video_core/gpu_thread: Implement a ShutDown method.Markus Wick2021-04-075-15/+28
| * | | | | | | | | | | common/threadsafe_queue: Provide Wait() method.Markus Wick2021-04-072-3/+10
* | | | | | | | | | | | ns: Update to 12.xMorph2021-04-091-3/+38
* | | | | | | | | | | | aoc_u: Update to 12.xMorph2021-04-091-0/+2
* | | | | | | | | | | | nim: Update to 12.xMorph2021-04-091-44/+55
* | | | | | | | | | | | npns: Update to 12.xMorph2021-04-091-0/+3
* | | | | | | | | | | | bgtc: Update to 12.x and implement OpenTaskServiceMorph2021-04-094-1/+36
* | | | | | | | | | | | vi: Update to 12.xMorph2021-04-091-0/+8
* | | | | | | | | | | | erpt: Update to 12.xMorph2021-04-091-1/+6
* | | | | | | | | | | | btm: Update to 12.xMorph2021-04-091-0/+1
* | | | | | | | | | | | btdrv: Update to 12.xMorph2021-04-091-0/+19
* | | | | | | | | | | | Merge pull request #6168 from Morph1984/stub-SetNpadAnalogStickUseCenterClampbunnei2021-04-094-1/+29
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service: hid: Stub SetAnalogStickUseCenterClampMorph2021-04-084-1/+29
| | |_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #6155 from ameerj/kernel-12-rescntbunnei2021-04-091-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | kernel: Increase event and session countsameerj2021-04-071-2/+2
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6157 from Morph1984/am-update-12.xbunnei2021-04-091-0/+22
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | ISelfController: Update to 11.xMorph2021-04-071-0/+1
| * | | | | | | | | | | IApplicationFunctions: Update to 11.xMorph2021-04-071-0/+6
| * | | | | | | | | | | IDebugFunctions: Update to 12.xMorph2021-04-071-0/+2
| * | | | | | | | | | | ICommonStateGetter: Update to 12.xMorph2021-04-071-0/+9
| * | | | | | | | | | | IGlobalStateController: Update to 12.xMorph2021-04-071-0/+1
| * | | | | | | | | | | IHomeMenuFunctions: Update to 12.xMorph2021-04-071-0/+3
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6062 from ameerj/auto-stubbunnei2021-04-095-0/+32
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | configuration: Add auto stub toggle that resets on bootameerj2021-03-305-4/+32
| * | | | | | | | | | service: Auto stub fallbackameerj2021-03-301-0/+4
* | | | | | | | | | | Merge pull request #6145 from lat9nq/nvhost_empty_memcpybunnei2021-04-081-6/+11
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | nvhost_nvdec_common: Avoid memcpy with null pointerslat9nq2021-04-051-6/+11
* | | | | | | | | | | | Merge pull request #6154 from lioncash/svcrange2bunnei2021-04-081-0/+132
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | svc: Expand SVC tablesLioncash2021-04-071-0/+132
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #6160 from Morph1984/fs-update-12.xbunnei2021-04-082-6/+15
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / |/| | | | | | | | | |
| * | | | | | | | | | IFile: Update to 12.xMorph2021-04-071-3/+7
| * | | | | | | | | | fsp-srv: Update to 12.xMorph2021-04-072-3/+8
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6143 from lat9nq/nvhost_null_memcpybunnei2021-04-081-1/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpylat9nq2021-04-051-1/+7
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6159 from Morph1984/acc-update-12.xbunnei2021-04-073-36/+45
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | dauth_o: Update to 11.xMorph2021-04-071-6/+11
| * | | | | | | | | acc_u1: Update to 12.xMorph2021-04-071-13/+15
| * | | | | | | | | acc_su: Update to 12.xMorph2021-04-071-17/+19
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6130 from degasus/better_assert_handlingbunnei2021-04-073-6/+20
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common: Move assert failure handling into a cpp file.Markus Wick2021-04-043-6/+20
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6153 from lioncash/svcrangebunnei2021-04-072-6/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | process_capability: Handle extended SVC rangeLioncash2021-04-072-6/+1
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | hwopus: Update to 12.xMorph2021-04-071-0/+4
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #6146 from lat9nq/vp9_empty_memcpybunnei2021-04-071-7/+9
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | vp9: Avoid memcpy with null pointerslat9nq2021-04-051-7/+9
| |/ / / / / /
* / / / / / / configure_graphics: Prevent stack-use-after-scopelat9nq2021-04-041-1/+1
|/ / / / / /
* | | | | | Merge pull request #6127 from german77/udpSingleConnectionbunnei2021-04-044-102/+101
|\ \ \ \ \ \
| * | | | | | Use a single connection for UDP server, make connection test longer and check all pads instead of only the first onegerman772021-03-314-102/+101
* | | | | | | Merge pull request #6132 from MerryMage/code_sizebunnei2021-04-032-0/+8
|\ \ \ \ \ \ \
| * | | | | | | arm_dynarmic: Increase size of code cacheMerryMage2021-04-022-0/+8
* | | | | | | | Merge pull request #6131 from german77/rightjoyconSLSRMorph2021-04-021-2/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | HID: Fix SL and SR buttons for right joycongerman772021-04-021-2/+6
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #6106 from MerryMage/nullptr-jitbunnei2021-04-014-53/+26
|\ \ \ \ \ \ \
| * | | | | | | arm_dynarmic: Always have a 'valid' jit instanceMerryMage2021-03-244-53/+26
* | | | | | | | Merge pull request #6126 from Morph1984/stub-SetAlbumImageTakenNotificationEnabledbunnei2021-03-312-1/+17
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | ISelfController: Stub SetAlbumImageTakenNotificationEnabledMorph2021-03-302-1/+17
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #5927 from ameerj/astc-computeRodrigo Locatti2021-03-3122-1770/+2027
|\ \ \ \ \ \ \
| * | | | | | | astc_decoder: Refactor for style and more efficient memory useameerj2021-03-259-2256/+502
| * | | | | | | astc_decoder: Reimplement LayersRodrigo Locatti2021-03-135-142/+161
| * | | | | | | astc_decoder: Fix out of bounds memory accessameerj2021-03-131-2/+10
| * | | | | | | renderer_vulkan: Accelerate ASTC decodingameerj2021-03-1311-57/+426
| * | | | | | | host_shaders: Modify shader cmake integration to allow for larger shadersameerj2021-03-134-8/+27
| * | | | | | | renderer_opengl: Accelerate ASTC texture decoding with a compute shaderameerj2021-03-136-2/+1598
* | | | | | | | Merge pull request #6116 from german77/userArgumentbunnei2021-03-311-0/+28
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | yuzu/main: Add user command line argumentgerman772021-03-271-0/+28
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #6124 from jbeich/vulkan+openglbunnei2021-03-302-5/+5
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | vulkan_common: enable OpenGL interop on other UnicesJan Beich2021-03-302-5/+5
* | | | | | | Merge pull request #6109 from german77/gestureIDbunnei2021-03-302-3/+13
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | HID: Initialize correctly the gesture finger_id and filter invalid resultsNarr the Reg2021-03-262-3/+13
| |/ / / / /
* | | | | | Merge pull request #6102 from ogniK5377/fd-passbunnei2021-03-2920-78/+161
|\ \ \ \ \ \
| * | | | | | nvdrv: Pass device fd and handle device create methods for device opening and closingChloe Marcec2021-03-2520-78/+161
| |/ / / / /
* | | | | | Merge pull request #6115 from bunnei/fix-kernel-initbunnei2021-03-281-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | hle: kernel: Initialize preemption task after schedulers.bunnei2021-03-271-1/+1
| |/ / / /
* / / / / service: friend: Change logging class from ACC to FriendMorph2021-03-271-11/+12
|/ / / /
* | | | Merge pull request #6101 from ogniK5377/alloc-as-exbunnei2021-03-252-27/+49
|\ \ \ \
| * | | | nvdrv: Change InitializeEx to AllocAsExChloe Marcec2021-03-222-27/+49
* | | | | gl_device: unblock async shaders on other Unix systemsJan Beich2021-03-241-1/+1
| |_|/ / |/| | |
* | | | Merge pull request #6100 from bunnei/arm-fixbunnei2021-03-242-0/+10
|\ \ \ \
| * | | | core: arm_dynarmic: Ensure JIT state is saved/restored on page table changes.bunnei2021-03-212-0/+10
| | |_|/ | |/| |
* | | | Merge pull request #6092 from ivan-boikov/cancel-dir-selectbunnei2021-03-231-1/+4
|\ \ \ \ | |_|/ / |/| | |
| * | | Fix cancelation of choose directory dialogivan-boikov2021-03-201-1/+4
| |/ /
* | | Merge pull request #6095 from lat9nq/async-shader-blockLC2021-03-221-1/+13
|\ \ \ | |/ / |/| |
| * | gl_device: Block async shaders on AMD and Intellat9nq2021-03-211-1/+13
* | | Merge pull request #6052 from Morph1984/vi-getindirectlayerimagemapbunnei2021-03-201-1/+27
|\ \ \
| * | | IApplicationDisplayService: Stub GetIndirectLayerImageMapMorph2021-03-171-1/+27
* | | | Merge pull request #6056 from zkitX/spl-updatesbunnei2021-03-183-9/+178
|\ \ \ \
| * | | | Fix casing on DeallocateAesKeySlotzkitx2021-03-111-3/+3
| * | | | Update SPL to fit N's service refactor (4.0.0+) which split into new services.zkitx2021-03-113-9/+178
* | | | | Merge pull request #6055 from MerryMage/exceed-the-limitbunnei2021-03-181-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | fiber: Double default stack sizeMerryMage2021-03-101-1/+1
| |/ / /
* | | | Merge pull request #6070 from Morph1984/sysver-11.0.1bunnei2021-03-171-5/+5
|\ \ \ \
| * | | | system_version: Update to 11.0.1Morph2021-03-141-5/+5
| | |/ / | |/| |
* | | | bsd: Avoid writing empty buffersMorph2021-03-161-2/+6
* | | | Merge pull request #6069 from Morph1984/ngWordbunnei2021-03-151-2/+2
|\ \ \ \ | |/ / / |/| | |
| * | | system_archive: Update NgWord archive versionMorph2021-03-141-2/+2
| | |/ | |/|
* | | Merge pull request #6054 from Morph1984/time-GetClockSnapshotbunnei2021-03-141-0/+2
|\ \ \ | |/ / |/| |
| * | time: Assign the current time point to the ClockSnapshotMorph2021-03-101-0/+2
| |/
* | Merge pull request #6053 from Morph1984/time-CalculateSpanBetweenbunnei2021-03-131-3/+9
|\ \
| * | time: Fix CalculateSpanBetween implementationMorph2021-03-101-3/+9
| |/
* | Merge pull request #6028 from bunnei/raster-cachebunnei2021-03-132-47/+40
|\ \
| * | video_core: rasterizer_accelerated: Fix un/signed mismatch.bunnei2021-03-131-1/+2
| * | video_core: rasterizer_accelerated: Fix delta check ordering.bunnei2021-03-031-3/+3
| * | video_core: rasterizer_accelerated: Improve error handling & fix implicit conversion.bunnei2021-03-031-4/+8
| * | video_core: rasterizer_accelerated: Use a flat array instead of interval_map for cached pages.bunnei2021-03-032-44/+32
* | | Merge pull request #5327 from AniLeo/masterbunnei2021-03-121-0/+9
|\ \ \
| * | | qt: Set DISPLAY env var when not presentAni2021-03-071-0/+9
* | | | Merge pull request #6040 from german77/toggleKeyboardbunnei2021-03-116-12/+109
|\ \ \ \ | |_|_|/ |/| | |
| * | | Enable mouse toggle buttonsgerman772021-03-065-11/+65
| * | | Add toggle button option for normal buttonsgerman2021-03-061-0/+5
| * | | Enable button toggle for keyboard in the modifier buttongerman2021-03-063-6/+44
* | | | Merge pull request #5891 from ameerj/bgra-oglRodrigo Locatti2021-03-0914-30/+212
|\ \ \ \
| * | | | texture_cache: Blacklist BGRA8 copies and views on OpenGLameerj2021-03-049-28/+80
| * | | | renderer_opengl: Swizzle BGR textures on copyameerj2021-03-045-2/+132
* | | | | Merge pull request #6021 from ReinUsesLisp/skip-cache-heuristicbunnei2021-03-092-11/+37
|\ \ \ \ \
| * | | | | buffer_cache: Heuristically decide to skip cache on uniform buffersReinUsesLisp2021-03-022-11/+37
* | | | | | Merge pull request #5990 from german77/mousePanningV2bunnei2021-03-089-25/+89
|\ \ \ \ \ \
| * | | | | | inputCommon: Mouse fixesgerman772021-02-289-25/+89
* | | | | | | common: Fiber: use a reference for YieldTo.bunnei2021-03-075-34/+27
* | | | | | | common: fiber: Use weak_ptr when yielding.bunnei2021-03-062-8/+13
* | | | | | | Merge pull request #6036 from bunnei/thread-leakbunnei2021-03-066-36/+65
|\ \ \ \ \ \ \
| * | | | | | | hle: kernel: KThread: Rework dummy threads & fix memory leak.bunnei2021-03-066-36/+65
* | | | | | | | Merge pull request #6029 from Morph1984/compile-utf8LC2021-03-061-0/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | CMakeLists: Add /utf-8 compile option for MSVCMorph2021-03-051-0/+2
* | | | | | | | Revert "core: Switch to unique_ptr for usage of Common::Fiber."bunnei2021-03-0610-58/+59
| |_|_|_|/ / / |/| | | | | |
* | | | | | | Merge pull request #6034 from Morph1984/mbedtlsbunnei2021-03-061-2/+0
|\ \ \ \ \ \ \
| * | | | | | | aes_util: Remove malformed mbedtls_cipher_finish function callMorph2021-03-051-2/+0
* | | | | | | | Merge pull request #6006 from bunnei/fiber-unique-ptrbunnei2021-03-0510-59/+58
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | core: Switch to unique_ptr for usage of Common::Fiber.bunnei2021-02-2710-59/+58
* | | | | | | | Merge pull request #5989 from ReinUsesLisp/cmdpoolbunnei2021-03-041-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | vk_command_pool: Reduce the command pool size from 4096 to 4ReinUsesLisp2021-02-231-1/+1
* | | | | | | | Merge pull request #6004 from german77/udprandombunnei2021-03-044-19/+23
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | inputCommon: Use an unique client id for each socket instancegerman2021-03-014-19/+23
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #5815 from comex/net-error-reformbunnei2021-03-036-111/+147
|\ \ \ \ \ \ \
| * | | | | | | [network] Error handling reformcomex2021-02-286-111/+147
* | | | | | | | core: Shutdown: Move kernel cleanup to later in shutdown.bunnei2021-03-021-12/+1
| |_|_|_|_|_|/ |/| | | | | |
* | | | | | | Fix default bcat_backend initKelebek12021-03-022-3/+3
| |/ / / / / |/| | | | |
* | | | | | gpu_thread: Remove Async NVDEC placeholdersameerj2021-03-013-26/+8
|/ / / / /
* | | | | Merge pull request #6007 from bunnei/ldn-errorbunnei2021-02-281-1/+1
|\ \ \ \ \
| * | | | | core: hle: ldn: Error out on call to Initialization.bunnei2021-02-271-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #5276 from german77/gesturesMorph2021-02-282-11/+240
|\ \ \ \ \
| * | | | | Implements touch, pan, pinch and rotation gesturesgerman2021-02-282-11/+240
* | | | | | Merge pull request #5984 from jbeich/gcc-freebsdbunnei2021-02-272-0/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | video_core: add missing header after 468bd9c1b0f9Jan Beich2021-02-231-0/+1
| * | | | | common: add missing header after f3805376f726Jan Beich2021-02-231-0/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #5953 from bunnei/memory-refactor-1bunnei2021-02-2756-1212/+1690
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | hle: kernel: Migrate PageHeap/PageTable to KPageHeap/KPageTable.bunnei2021-02-1924-147/+131
| * | | | hle: kernel: Migrate MemoryManager to KMemoryManager.bunnei2021-02-198-47/+48
| * | | | hle: kernel: Migrate PageLinkedList to KPageLinkedList.bunnei2021-02-198-38/+41
| * | | | hle: kernel: Migrate to KMemoryBlock, KMemoryBlockManager, and others.bunnei2021-02-1918-476/+479
| * | | | hle: kernel: Migrate SlabHeap to KSlabHeap.bunnei2021-02-194-22/+21
| * | | | hle: kernel: Migrate MemoryLayout to KMemoryLayout.bunnei2021-02-195-31/+30
| * | | | hle: kernel: Migrate AddressSpaceInfo to KAddressSpaceInfo.bunnei2021-02-194-59/+54
| * | | | hle: kernel: memory_manager: Rename AllocateContinuous to AllocateContinuous.bunnei2021-02-192-4/+28
| * | | | hle: kernel: KSystemControl does not belong in Memory namespace.bunnei2021-02-197-31/+38
| * | | | hle: kernel: memory: PageHeap: Migrate to KPageBitmap class.bunnei2021-02-194-197/+23
| * | | | hle: kernel: Add KPageBitmap class.bunnei2021-02-192-0/+280
| * | | | hle: kernel: system_control: Add function GenerateRandomU64.bunnei2021-02-192-3/+5
| * | | | common: Add implementation of TinyMT (Mersenne Twister RNG).bunnei2021-02-192-0/+251
| * | | | hle: kernel: Add KSpinLock implementation.bunnei2021-02-193-0/+89
| * | | | core: memory: Add templated GetPointer methods.bunnei2021-02-191-0/+10
| * | | | common: alignment: Add DivideUp utility method.bunnei2021-02-191-0/+5
| * | | | hle: kernel: Rename SharedMemory to KSharedMemory.bunnei2021-02-1913-54/+54
* | | | | Merge pull request #5944 from Morph1984/gc-vibrationsbunnei2021-02-272-3/+130
|\ \ \ \ \
| * | | | | hid: Implement GameCube Controller VibrationsMorph2021-02-212-3/+130
* | | | | | Merge pull request #5997 from Kelebek1/Depthbunnei2021-02-263-1/+12
|\ \ \ \ \ \
| * | | | | | Implement glDepthRangeIndexeddNVKelebek12021-02-243-1/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #5977 from Morph1984/stub-accbunnei2021-02-251-1/+17
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | acc: Stub GetNintendoAccountUserResourceCacheForApplicationMorph2021-02-211-1/+17
| |/ / / /
* | | | | Merge pull request #5936 from Kelebek1/Offsetsbunnei2021-02-223-9/+34
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Review 1Kelebek12021-02-152-3/+3
| * | | | Implement texture offset support for TexelFetch and TextureGather and add offsets for TldsKelebek12021-02-153-9/+34
* | | | | kernel: Fix resource release exception on exitameerj2021-02-214-2/+16
* | | | | gl_disk_shader_cache: Log total shader entries count on game loadMorph2021-02-201-0/+4
* | | | | common: wall_clock: Fix integer overflow with StandardWallClock.bunnei2021-02-202-7/+28
* | | | | Merge pull request #5924 from ReinUsesLisp/inline-bindingsbunnei2021-02-194-24/+24
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | vk_update_descriptor: Inline and improve code for binding buffersReinUsesLisp2021-02-134-24/+24
* | | | | Merge pull request #4973 from ameerj/nvdec-optbunnei2021-02-1911-149/+79
|\ \ \ \ \
| * | | | | rebase, fix name shadowing, more constameerj2021-02-134-11/+10
| * | | | | Address PR feedbackameerj2021-02-134-12/+7
| * | | | | streamline cdma_pusher/command_classesameerj2021-02-131-13/+5
| * | | | | streamline cdma_pusher/command_classesameerj2021-02-135-85/+34
| * | | | | nvdec cleanupameerj2021-02-138-43/+38
* | | | | | Revert "Port citra-emu/citra#5123: "SDL: Disable hidapi drivers due to compatibility problems with certain controllers""Morph2021-02-181-7/+0
* | | | | | common/cityhash: Use common typesReinUsesLisp2021-02-183-116/+100
* | | | | | tests: Add tests for CityHashReinUsesLisp2021-02-182-0/+23
* | | | | | Merge pull request #5121 from bunnei/optimize-core-timingbunnei2021-02-168-241/+141
|\ \ \ \ \ \
| * | | | | | core: core_timing_util: Optimize core timing math.bunnei2021-02-153-98/+48
| * | | | | | common: wall_clock: Optimize GetClockCycles/GetCPUCycles to use a single MUL instruction.bunnei2021-02-151-8/+9
| * | | | | | common: Merge uint128 to a single header file with inlines.bunnei2021-02-154-135/+84
* | | | | | | Merge pull request #5929 from german77/mousePanningMorph2021-02-161-5/+21
|\ \ \ \ \ \ \
| * | | | | | | Improve mouse panninggerman2021-02-141-5/+21
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #4298 from FearlessTobi/remove-cache-settingbunnei2021-02-165-57/+1
|\ \ \ \ \ \ \
| * | | | | | | yuzu/configure_filesystem: Remove "Select Cache Directory" optionFearlessTobi2021-01-045-57/+1
* | | | | | | | vk_rasterizer: Fix loading shader addresses twiceReinUsesLisp2021-02-161-1/+0
* | | | | | | | Merge pull request #3603 from FearlessTobi/port-5123bunnei2021-02-161-0/+7
|\ \ \ \ \ \ \ \
| * | | | | | | | sdl_joystick: disable the use of the hidapi drivers due to many problems caused by them.Vitor Kiguchi2020-08-301-0/+7
* | | | | | | | | Merge pull request #5923 from ReinUsesLisp/vk-dirty-pipelinebunnei2021-02-157-56/+103
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | fixed_pipeline_cache: Use dirty flags to lazily update keyReinUsesLisp2021-02-137-56/+103
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #5939 from Morph1984/web_typesLC2021-02-151-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | core/CMakeLists: Add web_types.hMorph2021-02-151-0/+1
* | | | | | | | | Merge pull request #4940 from german77/nativeGCbunnei2021-02-158-6/+209
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Use GC imagegerman2021-02-091-0/+3
| * | | | | | | | hid: Implement GC controllergerman2021-02-087-6/+206
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #5935 from lat9nq/controller_access_keysbunnei2021-02-151-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | debugger: controller: Add access keylat9nq2021-02-141-1/+1
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #5909 from ogniK5377/I3dl2Reverbbunnei2021-02-158-18/+572
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | revert to std::sin and std::cosChloe Marcec2021-02-133-6/+6
| * | | | | | | address issuesChloe Marcec2021-02-133-22/+25
| * | | | | | | audren: Implement I3dl2ReverbChloe Marcec2021-02-138-18/+569
* | | | | | | | Merge pull request #5920 from bunnei/am-ldn-fixbunnei2021-02-144-11/+52
|\ \ \ \ \ \ \ \
| * | | | | | | | hle: service: ldn: IUserLocalCommunicationService: Improve the stub.bunnei2021-02-141-5/+29
| * | | | | | | | hle: service: ldn: IUserLocalCommunicationService: Indicate that LDN is disabled.bunnei2021-02-143-3/+19
| * | | | | | | | hle: service: am: IStorageAccessor: Fix out of bounds error handling.bunnei2021-02-141-6/+7
* | | | | | | | | yuzu: Various frontend improvements to avoid crashes and improve experience on Linux.bunnei2021-02-1410-10/+52
|/ / / / / / / /
* | | / / / / / vk_resource_pool: Load GPU tick once and compare with itReinUsesLisp2021-02-132-8/+8
| |_|/ / / / / |/| | | | | |
* | | | | | | gl_texture_cache: Lazily create non-sRGB texture views for sRGB formatsameerj2021-02-133-7/+41
| |_|_|_|/ / |/| | | | |
* | | | | | Merge pull request #5919 from ReinUsesLisp/stream-buffer-tragicMorph2021-02-133-6/+12
|\ \ \ \ \ \
| * | | | | | vk_master_semaphore: Mark gpu_tick atomic operations with relaxed orderReinUsesLisp2021-02-131-4/+4
| * | | | | | vk_staging_buffer_pool: Inline tick testsReinUsesLisp2021-02-132-1/+7
| * | | | | | gl_stream_buffer/vk_staging_buffer_pool: Fix size checkReinUsesLisp2021-02-132-2/+2
* | | | | | | Merge pull request #5915 from lat9nq/screenshots-dir-fixLC2021-02-131-0/+5
|\ \ \ \ \ \ \
| * | | | | | | yuzu: Create screenshot path before capturelat9nq2021-02-121-0/+5
* | | | | | | | Merge pull request #5916 from ameerj/maxwell-gl-unusedLC2021-02-132-36/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | maxwell_to_gl: Remove unused codeameerj2021-02-132-36/+3
* | | | | | | | | vulkan_device: Require VK_EXT_robustness2ReinUsesLisp2021-02-132-37/+14
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | config: Make high GPU accuracy the defaultReinUsesLisp2021-02-132-3/+3
* | | | | | | | video_core: Fix clang build issuesReinUsesLisp2021-02-132-8/+5
* | | | | | | | vk_staging_buffer_pool: Fix softlock when stream buffer overflowsReinUsesLisp2021-02-132-19/+20
* | | | | | | | vk_buffer_cache: Add support for null index buffersReinUsesLisp2021-02-132-4/+40
* | | | | | | | buffer_cache: Add extra bytes to guest SSBOsReinUsesLisp2021-02-131-1/+7
* | | | | | | | Merge branch 'bytes-to-map-end' into new-bufcache-wipReinUsesLisp2021-02-131-0/+2
* | | | | | | | vk_staging_buffer_pool: Get a staging buffer instead of waitingReinUsesLisp2021-02-132-9/+18
* | | | | | | | yuzu/config: Disable assembly shaders by defaultReinUsesLisp2021-02-131-2/+2
* | | | | | | | renderer_opengl: Remove interopReinUsesLisp2021-02-138-122/+10
* | | | | | | | gl_buffer_cache: Drop interop based parameter buffer workaroundsReinUsesLisp2021-02-133-65/+45
* | | | | | | | buffer_cache: Heuristically detect stream buffersReinUsesLisp2021-02-132-6/+33
* | | | | | | | buffer_cache: Split CreateBuffer in separate functionsReinUsesLisp2021-02-131-29/+52
* | | | | | | | buffer_cache: Skip cache on small uploads on VulkanReinUsesLisp2021-02-133-9/+18
* | | | | | | | vk_staging_buffer_pool: Add stream buffer for small uploadsReinUsesLisp2021-02-1315-127/+298
* | | | | | | | vulkan_device: Enable robustBufferAccessReinUsesLisp2021-02-131-1/+2
* | | | | | | | video_core: Reimplement the buffer cacheReinUsesLisp2021-02-1367-2607/+2514
* | | | | | | | vulkan_common: Expose interop and headless devicesReinUsesLisp2021-02-134-21/+100
* | | | | | | | vulkan_common: Make interop extensions mandatoryReinUsesLisp2021-02-131-0/+6
* | | | | | | | vulkan_device: Enable robust buffersReinUsesLisp2021-02-131-2/+4
* | | | | | | | vulkan_device: Use designated initializers for featuresReinUsesLisp2021-02-131-60/+59
* | | | | | | | vulkan_wrapper: Add memory barrier pipeline barrier helperReinUsesLisp2021-02-131-0/+6
* | | | | | | | vulkan_device: Fix formatting of constantsReinUsesLisp2021-02-131-10/+6
* | | | | | | | vulkan_wrapper: Add interop functionsReinUsesLisp2021-02-132-1/+41
* | | | | | | | vulkan_instance: Initialize Vulkan instance in a separate threadReinUsesLisp2021-02-131-1/+5
* | | | | | | | vulkan_wrapper: Pull Windows symbolsReinUsesLisp2021-02-132-0/+14
* | | | | | | | gpu: Report renderer errors with exceptionsReinUsesLisp2021-02-1327-232/+176
* | | | | | | | tests/buffer_base: Add cached CPU writes testsReinUsesLisp2021-02-131-0/+76
* | | | | | | | buffer_base: Add support for cached CPU writesReinUsesLisp2021-02-131-61/+145
| |_|/ / / / / |/| | | | | |
* | | | | | | kernel: More accurately reserve and release resourcesameerj2021-02-136-14/+42
* | | | | | | kernel: KScopedReservation implementationameerj2021-02-136-26/+152
* | | | | | | kernel: Unify result codes (#5890)Chloe2021-02-1321-256/+223
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #5902 from lioncash/core-warnbunnei2021-02-123-4/+7
|\ \ \ \ \ \
| * | | | | | bsd: Remove usage of optional emplace() with no argumentsLioncash2021-02-091-2/+4
| * | | | | | am/controller: Remove [[fallthrough]] from unreachable pathLioncash2021-02-091-1/+2
| * | | | | | nfp: Correct uninitialized size being used within GetTagInfo()Lioncash2021-02-091-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #5869 from german77/mousePanningbunnei2021-02-1111-38/+149
|\ \ \ \ \ \
| * | | | | | Add mouse panninggerman2021-02-0811-38/+149
* | | | | | | software_keyboard: Implement Finalize request commandMorph2021-02-111-0/+4
* | | | | | | Merge pull request #5893 from lioncash/inputbunnei2021-02-102-113/+131
|\ \ \ \ \ \ \
| * | | | | | | configure_input_player_widget: Reduce duplication of array accessors where applicableLioncash2021-02-091-108/+125
| * | | | | | | configure_input_player_widget: Avoid nontrivial copies where applicableLioncash2021-02-092-5/+6
* | | | | | | | Merge pull request #5904 from lat9nq/common-sized-deallocLC2021-02-101-0/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | common: Add -fsized-deallocation as a Clang flaglat9nq2021-02-101-0/+2
* | | | | | | | | Merge pull request #5905 from lat9nq/core-sized-deallocLC2021-02-101-0/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core: Add -fsized-dealloction as a Clang flaglat9nq2021-02-101-0/+2
| |/ / / / / / / /
* / / / / / / / / configure_input_player_widget: Silence unused variable warningslat9nq2021-02-101-7/+0
|/ / / / / / / /
* | | | | | | | Merge pull request #5901 from lioncash/input-warnAmeer J2021-02-103-2/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | udp: Silence unused member variable warningsLioncash2021-02-091-2/+2
| * | | | | | | | udp/client: Define ClientData constructor/destructor in cpp fileLioncash2021-02-092-0/+7
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #5900 from lioncash/unused-funcbunnei2021-02-102-37/+0
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | gl_rasterizer: Remove unused variablesLioncash2021-02-091-3/+0
| * | | | | | | texture_cache/util: Remove unused functionsLioncash2021-02-091-34/+0
| |/ / / / / /
* | | / / / / Settings: Add depth to Joysticks on Pro Controller preview (#5894)Jatoxo2021-02-092-6/+30
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #5880 from lat9nq/ffmpeg-externalAmeer J2021-02-091-6/+5
|\ \ \ \ \ \
| * | | | | | Address reviewer commentslat9nq2021-02-051-1/+1
| * | | | | | CMake: Port citra-emu/citra FindFFmpeg.cmakelat9nq2021-02-051-2/+2
| * | | | | | CMake: Implement YUZU_USE_BUNDLED_FFMPEGlat9nq2021-02-052-7/+6
* | | | | | | Merge pull request #5892 from german77/backupbunnei2021-02-091-1/+12
|\ \ \ \ \ \ \
| * | | | | | | olsc: Stub GetSaveDataBackupSettinggerman2021-02-081-1/+12
* | | | | | | | Merge pull request #5868 from german77/HandheldFixbunnei2021-02-082-1/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | Prevent over scheduling audio events and terminate properly the motion update eventgerman2021-02-022-1/+9
* | | | | | | | | string_util: Remove MSVC workaround for converting between UTF8/UTF16Morph2021-02-081-14/+0
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #5339 from german77/interactivebunnei2021-02-0815-75/+3143
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Add GC controller animationgerman2021-02-072-52/+429
| * | | | | | | Refresh debug controller settingsgerman2021-02-064-10/+18
| * | | | | | | Refresh controller only when necessarygerman2021-02-062-15/+37
| * | | | | | | Add SL SR vectors, change dual joycon view, add missing raw data from keyboard/mousegerman2021-02-064-178/+247
| * | | | | | | Add controller window and single joycon top viewgerman2021-02-067-29/+391
| * | | | | | | Replace text with vectorsgerman2021-02-062-77/+306
| * | | | | | | Make settings controller image change with controller inputgerman2021-02-069-75/+2076
* | | | | | | | Merge pull request #5872 from lioncash/svc-errorChloe2021-02-081-59/+188
|\ \ \ \ \ \ \ \
| * | | | | | | | svc: Provide more detailed error logs for svc functionsLioncash2021-02-061-59/+188
* | | | | | | | | Merge pull request #5888 from Morph1984/ogl-4.6Rodrigo Locatti2021-02-083-42/+17
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | renderer_opengl: Update OpenGL backend version requirement to 4.6Morph2021-02-073-42/+17
* | | | | | | | | | Merge pull request #5889 from ogniK5377/morton-removeLC2021-02-083-2/+0
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | video_core: Delete mortonChloe Marcec2021-02-083-2/+0
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5887 from ogniK5377/lm-fixbunnei2021-02-071-7/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | lm: Fix ReadLeb128Chloe Marcec2021-02-071-7/+9
| |/ / / / / / / /
* | | | | | | | | Merge pull request #5878 from aleasto/masterMorph2021-02-071-2/+7
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | pl_u: Fix read out of boundsAlessandro Astone2021-02-061-2/+7
* | | | | | | | | Merge pull request #5885 from MerryMage/ring_buffer-granularitybunnei2021-02-062-16/+15
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | ring_buffer: Remove granularity template argumentMerryMage2021-02-062-16/+15
* | | | | | | | | | Merge pull request #5871 from lioncash/address-arbbunnei2021-02-061-54/+30
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | k_address_arbiter: Unfold R_UNLESS macrosLioncash2021-02-061-5/+8
| * | | | | | | | | k_address_arbiter: Remove unnecessary usages of std::addressofLioncash2021-02-061-10/+10
| * | | | | | | | | k_address_arbiter: Remove dead codeLioncash2021-02-061-40/+13
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5326 from german77/hidUpdate1bunnei2021-02-0611-169/+407
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Add footer types and address commentsgerman2021-02-047-58/+106
| * | | | | | | | Fix npad struct to match switchbrewgerman2021-02-044-106/+135
| * | | | | | | | Adds missing controller types and propertiesgerman2021-02-049-30/+191
* | | | | | | | | Merge pull request #5862 from bunnei/keventbunnei2021-02-0663-568/+737
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle: kernel: Drop R_UNLESS_NOLOG in favor of expanded if-statement.bunnei2021-02-053-11/+11
| * | | | | | | | | hle: kernel: KAddressArbiter: Remove noisy error log.bunnei2021-02-051-1/+1
| * | | | | | | | | hle: kernel: svc: Cleanup KEvent/KReadableEvent/KWritableEvent SVCs.bunnei2021-02-055-69/+89
| * | | | | | | | | common: scope_exit: Add a cancellable ScopeExit macro.bunnei2021-02-051-0/+6
| * | | | | | | | | hle: kernel: Reimplement KReadableEvent and KWritableEvent.bunnei2021-02-0538-298/+341
| * | | | | | | | | hle: kernel: Implement KEvent.bunnei2021-02-053-0/+91
| * | | | | | | | | hle: kernel: KAddressArbiter: Use R_UNLESS_NOLOG where applicable.bunnei2021-02-051-1/+1
| * | | | | | | | | common: common_funcs: Add R_UNLESS_NOLOG for scenarios that should not log.bunnei2021-02-051-0/+8
| * | | | | | | | | hle: kernel: Rename WritableEvent to KWritableEvent.bunnei2021-02-0544-101/+101
| * | | | | | | | | hle: kernel: Rename ReadableEvent to KReadableEvent.bunnei2021-02-0542-81/+82
* | | | | | | | | | Merge pull request #5875 from lioncash/identifierbunnei2021-02-061-9/+9
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | k_priority_queue: Unfold several declval usagesLioncash2021-02-041-5/+5
| * | | | | | | | | k_priority_queue: Simplify affinity mask type aliasLioncash2021-02-041-2/+2
| * | | | | | | | | k_priority_queue: Resolved reserved identifierLioncash2021-02-041-2/+2
| |/ / / / / / / /
* | | | | | | | | Merge pull request #5867 from Morph1984/am-GetHealthWarningDisappearedSystemEventbunnei2021-02-052-1/+14
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEventMorph2021-02-022-1/+14
* | | | | | | | | Merge pull request #5865 from lat9nq/conditionally-quietbunnei2021-02-051-1/+19
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | video_core: host_shaders: Don't pass --quiet to glslangValidator if unavailablelat9nq2021-02-021-1/+19
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #5876 from lioncash/truncationbunnei2021-02-041-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | k_affinity_mask: Avoid implicit truncation to boolLioncash2021-02-041-1/+1
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | key_manager: Create the keys directory if it does not existMorph2021-02-041-0/+5
* | | | | | | | Merge pull request #5870 from german77/hanheldfix2bunnei2021-02-041-4/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Always update handheld configgerman2021-02-041-4/+2
* | | | | | | | Merge pull request #5863 from ogniK5377/disable-reverbbunnei2021-02-041-1/+4
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | audren: Disable reverb for the time beingChloe Marcec2021-02-011-1/+4
* | | | | | | | Merge pull request #5848 from ogniK5377/k-resourcelimitbunnei2021-02-0313-230/+343
|\ \ \ \ \ \ \ \
| * | | | | | | | Simplify limitableresource namesChloe Marcec2021-02-036-36/+29
| * | | | | | | | Compile errorChloe Marcec2021-02-021-1/+1
| * | | | | | | | Address issuesChloe Marcec2021-02-023-19/+15
| * | | | | | | | fix compile errorChloe Marcec2021-01-301-1/+1
| * | | | | | | | cleanup commentingChloe Marcec2021-01-301-2/+2
| * | | | | | | | Drop m_ from lockChloe Marcec2021-01-302-9/+9
| * | | | | | | | Move to GetGlobalTimeNs, fix GetTotalPhysicalMemoryAvailableChloe Marcec2021-01-303-9/+7
| * | | | | | | | kernel: Rewrite resource limit to be more accurateChloe Marcec2021-01-3013-231/+357
* | | | | | | | | Merge pull request #5842 from german77/userfixbunnei2021-02-031-2/+8
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fix user changing to 0 if validgerman2021-01-291-2/+8
* | | | | | | | | | Merge pull request #5841 from german77/usernamebunnei2021-02-031-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Avoid overwritting usernamegerman2021-01-281-1/+1
| |/ / / / / / / / /
* | | | | / / / / / settings: Log the cache, config, and mod load directoriesMorph2021-02-021-0/+3
| |_|_|_|/ / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #5861 from german77/HandheldFixbunnei2021-02-021-2/+11
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | / / / / | | |_|_|/ / / / | |/| | | | | |
| * | | | | | | Only update motion for npad and prevent over scheduling eventsgerman2021-02-011-2/+11
* | | | | | | | arm_dynarmic_32: Print out CPSR.T on exceptionMerryMage2021-02-012-2/+7
* | | | | | | | Merge pull request #5859 from Morph1984/nifmbunnei2021-02-011-2/+157
|\ \ \ \ \ \ \ \
| * | | | | | | | nifm: Stub GetCurrentIpConfigInfoMorph2021-01-311-1/+29
| * | | | | | | | nifm: Stub GetCurrentNetworkProfileMorph2021-01-311-1/+41
| * | | | | | | | nifm: Add several structsMorph2021-01-311-0/+87
* | | | | | | | | Merge pull request #5856 from Morph1984/nifm-fix-getappletinfo-stubAmeer J2021-02-011-1/+5
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | nifm: Fix GetAppletInfo stubMorph2021-01-311-1/+5
* | | | | | | | | Merge pull request #5858 from Morph1984/IsGamePlayRecordingSupported-stubbunnei2021-02-012-1/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupportedMorph2021-01-312-1/+12
* | | | | | | | | | Merge pull request #5860 from Morph1984/prepo-transmission-stubbunnei2021-01-311-2/+19
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | prepo: Stub GetTransmissionStatusMorph2021-01-311-1/+11
| * | | | | | | | | | prepo: Stub RequestImmediateTransmissionMorph2021-01-311-1/+8
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #5846 from ameerj/analog-joinMorph2021-01-311-5/+9
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | analog_from_button: Fix update_thread.join exceptionameerj2021-01-301-5/+9
* | | | | | | | | | bsd: Fix EventFd stubMorph2021-01-311-3/+3
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #5855 from Morph1984/bsd-fix-getsockopt-stubbunnei2021-01-311-1/+5
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | bsd: Fix GetSockOpt stubMorph2021-01-311-1/+5
* | | | | | | | | Merge pull request #5851 from ameerj/pop-inv-stubMorph2021-01-312-1/+10
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | am: Stub TryPopFromFriendInvitationStorageChannelameerj2021-01-312-1/+10
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | bsd: Stub EventFdameerj2021-01-312-1/+12
|/ / / / / / /
* | | | | | | Merge pull request #5779 from bunnei/kthread-rewritebunnei2021-01-3068-1953/+2979
|\ \ \ \ \ \ \
| * | | | | | | hle: kernel: KLightLock: Fix several bugs.bunnei2021-01-291-3/+3
| * | | | | | | common: common_funcs: Change R_UNLESS to LOG_ERROR.bunnei2021-01-291-1/+1
| * | | | | | | arm: dynarmic: Reintroduce JIT checks on SaveContext/LoadContext.bunnei2021-01-292-0/+12
| * | | | | | | hle: kernel: KThread: Release thread resource on thread exit.bunnei2021-01-291-0/+1
| * | | | | | | yuzu: debugger: Ignore HLE threads.bunnei2021-01-293-9/+21
| * | | | | | | hle: kernel: process: Add state lock.bunnei2021-01-293-6/+15
| * | | | | | | hle: kernel: threading: Fix bug with host thread naming.bunnei2021-01-291-3/+2
| * | | | | | | hle: kernel: k_scheduler_lock: Cleanup.bunnei2021-01-291-3/+3
| * | | | | | | core: arm: Remove unnecessary JIT checks.bunnei2021-01-292-24/+0
| * | | | | | | common: common_funcs: Log error on R_UNLESS.bunnei2021-01-291-0/+3
| * | | | | | | hle: kernel: Allocate a dummy KThread for each host thread, and use it for scheduling.bunnei2021-01-298-43/+45
| * | | | | | | hle: kernel: k_scheduler: Use atomics for current_thread, etc.bunnei2021-01-292-26/+28
| * | | | | | | hle: kernel: k_scheduler: Fix for single core mode.bunnei2021-01-291-1/+2
| * | | | | | | kernel: Fix build errors.bunnei2021-01-292-4/+9
| * | | | | | | core: cpu_manager: Remove unused variable.bunnei2021-01-291-1/+0
| * | | | | | | hle: kernel: KScheduler: Introduce thread context_guard.bunnei2021-01-292-3/+16
| * | | | | | | hle: kernel: Recode implementation of KThread to be more accurate.bunnei2021-01-2914-785/+1562
| * | | | | | | kernel: svc_types: Add ThreadActivity.bunnei2021-01-291-0/+5
| * | | | | | | kernel: KSchedulerPriorityQueue: Lowest priority should be LowestThreadPriority.bunnei2021-01-291-1/+1
| * | | | | | | kernel: k_light_lock: Simplify EmuThreadHandle implementation.bunnei2021-01-295-51/+33
| * | | | | | | hle: kernel: TimeManager: Simplify to not rely on previous EmuThreadHandle implementation.bunnei2021-01-296-69/+25
| * | | | | | | common: common_funcs: Add useful kernel macro R_SUCCEED_IF.bunnei2021-01-291-0/+3
| * | | | | | | core: hle: kernel: object: Implement Finalize() virtual method.bunnei2021-01-2915-6/+29
| * | | | | | | core: hle: kernel: svc_results: Populate with several missing error codes.bunnei2021-01-291-0/+3
| * | | | | | | core: hle: kernel: Implement KLightLock.bunnei2021-01-293-0/+173
| * | | | | | | core: hle: kernel: Implement KThreadQueue.bunnei2021-01-292-0/+82
| * | | | | | | common: common_funcs: Add a few more useful macros for kernel code.bunnei2021-01-291-0/+11
| * | | | | | | hle: kernel: KThread: Clean up thread priorities.bunnei2021-01-2910-83/+44
| * | | | | | | hle: kernel: KThread: Reorganize thread priority defaults.bunnei2021-01-299-31/+31
| * | | | | | | hle: kernel: KThread: Fix ThreadType definition.bunnei2021-01-295-11/+12
| * | | | | | | hle: kernel: Move single core "phantom mode" out of KThread.bunnei2021-01-294-16/+31
| * | | | | | | hle: kernel: KThread: Remove thread types that do not exist.bunnei2021-01-296-53/+30
| * | | | | | | arm: arm_dynarmic: Skip calls when JIT is invalid.bunnei2021-01-292-0/+24
| * | | | | | | core: hle: kernel: Rename Thread to KThread.bunnei2021-01-2945-272/+271
* | | | | | | | Merge pull request #5795 from ReinUsesLisp/bytes-to-map-endbunnei2021-01-302-2/+27
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core/memory_manager: Add BytesToMapEndReinUsesLisp2021-01-222-2/+27
* | | | | | | | | Merge pull request #5838 from german77/prepostubMorph2021-01-301-1/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Stub GetSystemSessionIdgerman2021-01-301-1/+10
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5805 from german77/HandheldFixbunnei2021-01-302-15/+37
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | / / / / | | |_|_|/ / / / | |/| | | | | |
| * | | | | | | Fix connect and disconnect controller eventsgerman2021-01-242-15/+37
* | | | | | | | Merge pull request #5809 from ogniK5377/FlushAudioOutBuffersbunnei2021-01-293-1/+20
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | audout: FlushAudioOutBuffersChloe Marcec2021-01-243-1/+20
* | | | | | | | Merge pull request #5837 from german77/socketstubbunnei2021-01-292-1/+17
|\ \ \ \ \ \ \ \
| * | | | | | | | Stub GetSockOptgerman2021-01-282-1/+17
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #5836 from ReinUsesLisp/unaligned-constr-schedLC2021-01-281-6/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | vk_scheduler: Fix unaligned placement new expressionsReinUsesLisp2021-01-281-6/+6
* | | | | | | | | Merge pull request #5840 from Morph1984/prepo-fixLC2021-01-283-24/+70
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | prepo: Fix BufferDescriptorX invalid buffer errors and add "New" variants of SaveReportMorph2021-01-281-24/+42
| * | | | | | | | | hle_ipc: Add Can(Read, Write)BufferMorph2021-01-282-0/+28
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5835 from Morph1984/cleanup-sixaxis-fusionLC2021-01-283-26/+28
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | hid: Add static_assert for Parameter sizeMorph2021-01-281-15/+19
| * | | | | | | | npad: Remove unused device handle parameterMorph2021-01-273-11/+9
* | | | | | | | | Merge pull request #5786 from ReinUsesLisp/glsl-cbufbunnei2021-01-281-1/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_decompiler: Fix constant buffer size calculationReinUsesLisp2021-01-211-1/+2
* | | | | | | | | | vulkan_device: Blacklist Intel from float16 math (#5798)Rodrigo Locatti2021-01-271-0/+5
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #5778 from ReinUsesLisp/shader-dirbunnei2021-01-278-5/+59
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | renderer_opengl: Avoid precompiled cache and force NV GL cache directoryReinUsesLisp2021-01-218-5/+59
| |/ / / / / / /
* | | | | | | | Merge pull request #5812 from german77/StubSixaxisFusionbunnei2021-01-274-3/+104
|\ \ \ \ \ \ \ \
| * | | | | | | | Stub Set/Get/Reset SixaxisSensorFusionParametersgerman2021-01-244-3/+104
* | | | | | | | | Merge pull request #5810 from ogniK5377/stereo-visionbunnei2021-01-273-7/+60
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle: Implement remaining services for Stereo VisionChloe Marcec2021-01-243-7/+60
| |/ / / / / / / /
* | | | | | | | | Merge pull request #5824 from ogniK5377/IPsmSessionbunnei2021-01-261-1/+112
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Omit system referenceChloe Marcec2021-01-251-2/+1
| * | | | | | | | | psm: IPsmSessionChloe Marcec2021-01-251-2/+114
* | | | | | | | | | Merge pull request #5774 from ogniK5377/mii-raw-randombunnei2021-01-264-2274/+1657
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | mii: Fix BuildRandomStoreData & Cleanup raw_dataChloe Marcec2021-01-204-2274/+1657
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #5771 from ogniK5377/lm-reworkbunnei2021-01-258-345/+288
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Print Process ID and Thread ID as hexChloe Marcec2021-01-241-2/+2
| * | | | | | | | | Clamp string reads to buffer sizeChloe Marcec2021-01-231-3/+5
| * | | | | | | | | Mark DestinationToString as staticChloe Marcec2021-01-201-1/+1
| * | | | | | | | | Mark LogPacketHeaderEntry hash as noexceptChloe Marcec2021-01-201-1/+1
| * | | | | | | | | lm: Recode LM serviceChloe Marcec2021-01-208-345/+286
| |/ / / / / / / /
* | | | | | | | | Merge pull request #5799 from ogniK5377/event-register-unregisterbunnei2021-01-251-1/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Simplify conditionChloe Marcec2021-01-231-2/+1
| * | | | | | | | | nvdrv: Unregister already registered eventsChloe Marcec2021-01-231-1/+8
* | | | | | | | | | Merge pull request #5785 from ReinUsesLisp/buffer-dmabunnei2021-01-252-8/+21
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core/memory_manager: Remove unused CopyBlockUnsafeReinUsesLisp2021-01-212-8/+0
| * | | | | | | | | | video_core/memory_manager: Flush destination buffer on CopyBlockReinUsesLisp2021-01-211-0/+4
| * | | | | | | | | | video_core/memory_manager: Add GPU address based flush methodReinUsesLisp2021-01-212-0/+17
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Revert "Start of Integer flags implementation"ReinUsesLisp2021-01-253-59/+3
* | | | | | | | | | vk_graphics_pipeline: Fix narrowing conversion on MSVCReinUsesLisp2021-01-251-2/+2
* | | | | | | | | | Merge pull request #5807 from ReinUsesLisp/vc-warningsLC2021-01-2410-62/+95
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | cmake: Enforce -Warray-bounds and -Wmissing-field-initializers globallyReinUsesLisp2021-01-242-2/+2
| * | | | | | | | | | video_core/cmake: Enforce -Warray-bounds and -Wmissing-field-initializersReinUsesLisp2021-01-241-0/+2
| * | | | | | | | | | video_core: Silence -Wmissing-field-initializers warningsReinUsesLisp2021-01-245-25/+56
| * | | | | | | | | | maxwell_3d: Silence array bounds warningsReinUsesLisp2021-01-242-35/+35
| * | | | | | | | | | maxwell_to_vk: Silence -Wextra warnings about using different enum typesReinUsesLisp2021-01-242-2/+2
* | | | | | | | | | | Merge pull request #5363 from ReinUsesLisp/vk-image-usageRodrigo Locatti2021-01-243-38/+72
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | vk_texture_cache: Support image store on sRGB images with VkImageViewUsageCreateInfoReinUsesLisp2021-01-243-38/+72
* | | | | | | | | | | | Merge pull request #5151 from comex/xx-vfsbunnei2021-01-241-4/+10
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | vfs_real: When moving files or directories, don't assume file opening will succeedcomex2021-01-231-4/+10
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | vulkan_device: Lift VK_EXT_extended_dynamic_state blacklist on RDNAReinUsesLisp2021-01-251-23/+0
* | | | | | | | | | | | Merge pull request #5796 from ReinUsesLisp/vertex-a-bypass-vkbunnei2021-01-241-9/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | vk_pipeline_cache: Properly bypass VertexA shadersReinUsesLisp2021-01-231-9/+3
* | | | | | | | | | | | Merge pull request #5808 from ReinUsesLisp/glslang-quietLC2021-01-241-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | host_shaders/cmake: Pass --quiet to glslang to keep it quietReinUsesLisp2021-01-241-1/+1
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #5806 from bunnei/am-stubbunnei2021-01-241-1/+8
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.bunnei2021-01-211-1/+8
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | shader_ir: Fix comment typoLevi Behunin2021-01-231-1/+1
* | | | | | | | | | sdl_impl: Set the maximum vibration duration to 1 secondMorph2021-01-231-2/+6
* | | | | | | | | | Merge pull request #5797 from ReinUsesLisp/nsight-aftermath-buildLC2021-01-233-18/+7
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | video_core/cmake: Properly generate fatal errors on AftermathReinUsesLisp2021-01-231-2/+2
| * | | | | | | | | nsight_aftermath_tracker: Fix build issues when enabledReinUsesLisp2021-01-232-16/+5
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5776 from ogniK5377/lblbunnei2021-01-231-22/+261
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | lbl: Implement most of lblChloe Marcec2021-01-201-22/+261
| |/ / / / / / /
* | | | | | | | Merge pull request #4713 from behunin/int-flagsbunnei2021-01-233-3/+59
|\ \ \ \ \ \ \ \
| * \ \ \ \ \ \ \ Merge remote-tracking branch 'upstream/master' into int-flagsLevi2021-01-11868-23050/+34921
| |\ \ \ \ \ \ \ \
| * | | | | | | | | More forgetting... duhLevi Behunin2020-09-251-2/+2
| * | | | | | | | | Forgot to apply suggestion here as wellLevi Behunin2020-09-251-1/+1
| * | | | | | | | | Address CommentsLevi Behunin2020-09-253-25/+34
| * | | | | | | | | Start of Integer flags implementationLevi Behunin2020-09-253-3/+50
* | | | | | | | | | Merge pull request #5765 from ogniK5377/StoreSaveDataThumbnail-stubbunnei2021-01-235-6/+66
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | |
| * | | | | | | | | acc: Stub StoreSaveDataThumbnailChloe Marcec2021-01-195-6/+66
* | | | | | | | | | common: Add missing include to bit_util.hbunnei2021-01-221-0/+1
* | | | | | | | | | Merge pull request #5781 from lioncash/bitsbunnei2021-01-211-35/+13
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | bit_util: Unify implementations of MostSignificantBit32/MostSignificantBit64Lioncash2021-01-211-35/+13
* | | | | | | | | | | Merge pull request #5270 from german77/multiTouchbunnei2021-01-2119-263/+365
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Always initialize keyboard inputgerman2021-01-155-25/+20
| * | | | | | | | | | | Add mutitouch support for touch screensgerman2021-01-1510-85/+137
| * | | | | | | | | | | Allow to return up to 16 touch inputs per enginegerman2021-01-1510-154/+202
| * | | | | | | | | | | Allow all touch inputs at the same time and remove config options that are not longer necesarygerman2021-01-158-99/+36
| * | | | | | | | | | | Add multitouch supportgerman2021-01-152-23/+93
* | | | | | | | | | | | Merge pull request #5361 from ReinUsesLisp/vk-shader-commentbunnei2021-01-211-1/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | vk_shader_decompiler: Show comments as OpUndef with a typeReinUsesLisp2021-01-161-1/+4
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #5743 from german77/HandheldFixbunnei2021-01-212-1/+12
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / |/| | | | | | | / / / / | | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
| * | | | | | | | | | Always update configuration for handheldgerman2021-01-181-0/+10
| * | | | | | | | | | Fix player 1 default connected valuegerman2021-01-171-1/+2
* | | | | | | | | | | Merge pull request #5755 from FearlessTobi/port-5344bunnei2021-01-192-28/+32
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | game_list: Fix folder reorderingFearlessTobi2021-01-182-28/+32
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #5746 from lioncash/sign-compareRodrigo Locatti2021-01-181-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | texture_cache/util: Resolve -Wsign-compare warningLioncash2021-01-171-1/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #5754 from lat9nq/fix-disable-boxcatLC2021-01-181-0/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | configure_service: Only compile FormatEventStatusString when YUZU_ENABLE_BOXCAT is enabledlat9nq2021-01-171-0/+2
| | |/ / / / / / / / | |/| | | | | | | |
* / | | | | | | | | npad: Add check for HANDHELD_INDEX in UpdateControllerAt()Morph2021-01-181-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #5360 from ReinUsesLisp/enforce-memclass-accessbunnei2021-01-1718-205/+216
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/cmake: Enforce Wclass-memaccessReinUsesLisp2021-01-151-0/+1
| * | | | | | | | | core: Silence Wclass-memaccess warningsReinUsesLisp2021-01-1517-205/+215
* | | | | | | | | | Merge pull request #5745 from lioncash/documentationRodrigo Locatti2021-01-172-4/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: Resolve -Wdocumentation warningsLioncash2021-01-172-4/+3
| | |/ / / / / / / / | |/| | | | | | | |
* / | | | | | | | | vulkan_debug_callback: Add missing header guardLioncash2021-01-171-0/+2
|/ / / / / / / / /
* | | | | | | | | Merge pull request #5740 from lioncash/const-fnRodrigo Locatti2021-01-171-4/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | input_interpreter: Mark two member functions as constLioncash2021-01-161-4/+4
* | | | | | | | | | Merge pull request #5262 from ReinUsesLisp/buffer-baseRodrigo Locatti2021-01-164-0/+970
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | tests: Add unit tests for the GPU range tracking buffer containerReinUsesLisp2021-01-132-0/+474
| * | | | | | | | | buffer_cache/buffer_base: Add a range tracking buffer containerReinUsesLisp2021-01-132-0/+496
* | | | | | | | | | input_interpreter: Add method to check for a button press stateMorph2021-01-162-0/+25
* | | | | | | | | | Merge pull request #5275 from FernandoS27/fast-native-clockbunnei2021-01-165-104/+174
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | X86/NativeClock: Reimplement RTDSC access to be lock free.Fernando Sahmkow2021-01-025-103/+107
| * | | | | | | | | | X86/NativeClock: Improve performance of clock calculations on hot path.Fernando Sahmkow2021-01-022-5/+71
* | | | | | | | | | | Merge pull request #5336 from lioncash/treebunnei2021-01-162-841/+668
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | common/tree: Convert defines over to templatesLioncash2021-01-122-592/+666
| * | | | | | | | | | | common/tree: Remove unused splay tree definesLioncash2021-01-121-249/+2
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #5297 from ReinUsesLisp/vulkan-allocator-commonRodrigo Locatti2021-01-1619-554/+609
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | vulkan_memory_allocator: Remove unnecesary 'device' memory from commitsReinUsesLisp2021-01-152-15/+15
| * | | | | | | | | | vk_texture_cache: Use Download memory types for texture flushesReinUsesLisp2021-01-152-5/+10
| * | | | | | | | | | vulkan_memory_allocator: Add allocation support for download typesReinUsesLisp2021-01-152-55/+91
| * | | | | | | | | | vulkan_memory_allocator: Add "download" memory usage hintReinUsesLisp2021-01-159-45/+86
| * | | | | | | | | | vulkan_common: Move allocator to the common directoryReinUsesLisp2021-01-1511-11/+11
| * | | | | | | | | | renderer_vulkan: Rename Vulkan memory manager to memory allocatorReinUsesLisp2021-01-1515-54/+52
| * | | | | | | | | | vk_memory_manager: Improve memory manager and its APIReinUsesLisp2021-01-1513-343/+318
* | | | | | | | | | | Merge pull request #5358 from ReinUsesLisp/rename-insert-paddingLC2021-01-1511-149/+149
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | / / / / / / / | | |_|/ / / / / / / | |/| | | | | | | |
| * | | | | | | | | common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINITReinUsesLisp2021-01-1511-149/+149
* | | | | | | | | | Merge pull request #5355 from lioncash/timerbunnei2021-01-153-202/+0
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | common/timer: RemoveLioncash2021-01-153-202/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #5357 from ReinUsesLisp/alignment-log2LC2021-01-154-28/+23
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/alignment: Upgrade to use constraints instead of static assertsReinUsesLisp2021-01-151-13/+9
| * | | | | | | | | common/alignment: Rename AlignBits to AlignUpLog2ReinUsesLisp2021-01-154-16/+15
* | | | | | | | | | common/bit_util: Replace CLZ/CTZ operations with standardized onesLioncash2021-01-1510-113/+17
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #5354 from ReinUsesLisp/remove-common-colorLC2021-01-152-272/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | common/color: RemoveReinUsesLisp2021-01-152-272/+0
* | | | | | | | | Merge pull request #5352 from ReinUsesLisp/remove-testerLC2021-01-1512-1057/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | cmake: Remove yuzu_testerReinUsesLisp2021-01-1512-1057/+0
* | | | | | | | | | core/cmake: Remove Werror flags already defined code-base wideReinUsesLisp2021-01-151-2/+0
* | | | | | | | | | video_core/cmake: Remove Werror flags already defined code-base wideReinUsesLisp2021-01-151-2/+0
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #5351 from ReinUsesLisp/vc-unused-functionsLC2021-01-152-4/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | cmake: Enforce -Wunused-function code-base wideReinUsesLisp2021-01-152-1/+1
| * | | | | | | | | video_core: Enforce -Wunused-functionReinUsesLisp2021-01-151-0/+1
| * | | | | | | | | vk_buffer_cache: Remove unused functionReinUsesLisp2021-01-151-4/+0
* | | | | | | | | | Merge pull request #5350 from ReinUsesLisp/vk-init-warnsRodrigo Locatti2021-01-152-145/+146
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vulkan_common: Silence missing initializer warningsReinUsesLisp2021-01-152-145/+146
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #5349 from ReinUsesLisp/anv-fixLC2021-01-152-18/+20
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | vulkan_device: Enable shaderStorageImageMultisample conditionallyReinUsesLisp2021-01-152-18/+20
| |/ / / / / / / /
* | | | | | | | | astc: Increase integer encoded vector sizeReinUsesLisp2021-01-151-1/+1
* | | | | | | | | astc: Return zero on out of bound bitsReinUsesLisp2021-01-151-17/+22
|/ / / / / / / /
* | | | | | | | yuzu: Remove unused variables in Qt codeLioncash2021-01-142-21/+2
* | | | | | | | Merge pull request #5343 from lioncash/qt6Morph2021-01-141-6/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | configure_motion_touch: Migrate off QRegExp to QRegularExpressionLioncash2021-01-141-6/+9
* | | | | | | | | configure_motion_touch: Prevent use after move in ApplyConfiguration()Lioncash2021-01-141-2/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #5330 from german77/regexerrorLC2021-01-141-2/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | Fix IP validator error where the last octet produced an error if the value was higher than 199german2021-01-131-2/+3
* | | | | | | | | Merge pull request #5342 from lioncash/qt6bunnei2021-01-132-3/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu: Migrate off of setMargin() to setContentsMargins()Lioncash2021-01-132-3/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | vulkan_device: Remove requirement on shaderStorageImageMultisampleReinUsesLisp2021-01-131-1/+0
* | | | | | | | | cmake: Enforce -Werror=switch and -Werror=unused-variableMorph2021-01-131-0/+2
* | | | | | | | | Merge pull request #5280 from FearlessTobi/port-5666bunnei2021-01-131-4/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Address review commentsFearlessTobi2021-01-041-5/+5
| * | | | | | | | | Delete the old log file before rotating (#5675)xperia642021-01-041-0/+3
| * | | | | | | | | Fix the old log file to work with the log parser.bunnei2021-01-031-1/+1
| * | | | | | | | | Rotate previous log file to '.old' if it existsxperia642021-01-031-4/+9
* | | | | | | | | | Merge pull request #5311 from ReinUsesLisp/fence-waitbunnei2021-01-133-54/+18
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | vk_fence_manager: Use timeline semaphores instead of spin waitsReinUsesLisp2021-01-083-54/+18
* | | | | | | | | | common/parent_of_member: Replace TYPED_STORAGE define with template aliasLioncash2021-01-122-8/+10
* | | | | | | | | | hle: kernel: thread: Preserve thread wait reason for debugging only.bunnei2021-01-118-4/+74
* | | | | | | | | | yuzu: debugger: wait_tree: Handle unknown ThreadState.bunnei2021-01-111-0/+3
* | | | | | | | | | hle: kernel: k_scheduler_lock: Fix shadowing errors.bunnei2021-01-111-1/+1
* | | | | | | | | | core: arm: arm_interface: Fix shadowing errors.bunnei2021-01-111-3/+4
* | | | | | | | | | core: hle: Add missing calls to MicroProfileOnThreadExit.bunnei2021-01-112-0/+5
* | | | | | | | | | core: hle: Integrate new KConditionVariable and KAddressArbiter implementations.bunnei2021-01-1115-1182/+508
* | | | | | | | | | core: hle: kernel: Update KAddressArbiter.bunnei2021-01-113-0/+437
* | | | | | | | | | core: hle: kernel: Update KConditionVariable.bunnei2021-01-114-0/+413
* | | | | | | | | | core: hle: kernel: Begin moving common SVC defintions to its own header.bunnei2021-01-112-0/+14
* | | | | | | | | | hle: kernel: Remove unnecessary AddressArbiter definition.bunnei2021-01-111-1/+0
* | | | | | | | | | common: common_funcs: Add R_UNLESS macro.bunnei2021-01-111-0/+8
* | | | | | | | | | hle: kernel: k_scheduler: Cleanup OnThreadPriorityChanged.bunnei2021-01-112-6/+3
* | | | | | | | | | hle: kernel: Rename thread "status" to "state".bunnei2021-01-111-2/+2
* | | | | | | | | | hle: kernel: thread: Replace ThreadStatus/ThreadSchedStatus with a single ThreadState.bunnei2021-01-1112-172/+111
* | | | | | | | | | core: hle: kernel: Add some useful functions for checking kernel addresses.bunnei2021-01-111-0/+19
* | | | | | | | | | core: hle: kernel: svc_types: Add type definitions for KAddressArbiter.bunnei2021-01-111-0/+12
* | | | | | | | | | common: Introduce useful tree structures.bunnei2021-01-114-0/+1641
* | | | | | | | | | core: hle: kernel: Update KSynchronizationObject.bunnei2021-01-1133-621/+397
* | | | | | | | | | core: hle: kernel: Begin moving common SVC results to its own header.bunnei2021-01-112-0/+21
* | | | | | | | | | hle: service: nfp: Remove incorrect signaling behavior in GetDeviceState.bunnei2021-01-111-6/+0
| |_|_|_|_|/ / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #5229 from Morph1984/fullscreen-optbunnei2021-01-111-3/+39
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu/main: Add basic command line argumentsMorph2020-12-251-3/+39
* | | | | | | | | | Merge pull request #5324 from Morph1984/docked-defaultLC2021-01-115-6/+6
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | config: Enable docked mode by defaultMorph2021-01-105-6/+6
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #5312 from german77/overclockenabledbunnei2021-01-102-1/+10
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Stub IsCpuOverclockEnabledgerman2021-01-082-1/+10
| | |/ / / / / / | |/| | | | | |
* | | | | | | | cmake: Enforce C4101Morph2021-01-101-0/+1
* | | | | | | | yuzu_cmd: Silence unreferenced local variable warningMorph2021-01-101-2/+0
* | | | | | | | Merge pull request #5320 from ReinUsesLisp/div-ceil-typeLC2021-01-091-5/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | common/div_ceil: Return numerator typeReinUsesLisp2021-01-091-5/+5
* | | | | | | | | general: Resolve C4062 warnings on MSVCMorph2021-01-092-0/+4
* | | | | | | | | cmake: Enforce C4062, C4265, C4388, and C5038ReinUsesLisp2021-01-091-0/+4
* | | | | | | | | file_sys/registered_cache: Silence virtual functions without override warningsReinUsesLisp2021-01-091-4/+4
* | | | | | | | | core: Silence unhandled enum in switch warningsReinUsesLisp2021-01-092-10/+5
* | | | | | | | | tests/ring_buffer: Silence signed/unsigned mismatch warningsReinUsesLisp2021-01-091-15/+15
|/ / / / / / / /
* | | | | | | | Merge pull request #5231 from ReinUsesLisp/dyn-bindingsbunnei2021-01-083-26/+12
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | renderer_vulkan/fixed_pipeline_state: Move enabled bindings to static stateReinUsesLisp2020-12-263-26/+12
| |/ / / / / /
* | | | | | | remove inaccurate referenceAmeer J2021-01-071-1/+1
* | | | | | | fix for nvdec disabled, cleanup host1xameerj2021-01-073-72/+23
* | | | | | | nvdec syncpt incorporationameerj2021-01-0711-37/+59
* | | | | | | vulkan_library: Common::DynamicLibrary::Open is [[nodiscard]]MerryMage2021-01-071-1/+1
* | | | | | | texture_cache: Replace PAGE_SHIFT with PAGE_BITSMerryMage2021-01-071-6/+6
* | | | | | | Merge pull request #5288 from ReinUsesLisp/workaround-garbageMorph2021-01-0612-120/+148
|\ \ \ \ \ \ \
| * | | | | | | gl_texture_cache: Avoid format views on Intel and AMDReinUsesLisp2021-01-0411-21/+48
| * | | | | | | gl_texture_cache: Create base images with sRGBReinUsesLisp2021-01-042-99/+100
* | | | | | | | Merge pull request #5293 from ReinUsesLisp/return-valuesbunnei2021-01-066-8/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Enforce C4715 (not all control paths return a value)ReinUsesLisp2021-01-051-0/+2
| * | | | | | | | core: Silence warnings when compiling without assertsReinUsesLisp2021-01-055-8/+11
* | | | | | | | | Merge pull request #5289 from ReinUsesLisp/vulkan-devicebunnei2021-01-0631-62/+55
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | vulkan_device: Allow creating a device without surfaceReinUsesLisp2021-01-041-3/+3
| * | | | | | | | renderer_vulkan/nsight_aftermath_tracker: Move to vulkan_commonReinUsesLisp2021-01-045-30/+21
| * | | | | | | | renderer_vulkan: Move device abstraction to vulkan_commonReinUsesLisp2021-01-0429-29/+31
* | | | | | | | | Merge pull request #5292 from ReinUsesLisp/empty-setLC2021-01-051-2/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_rasterizer: Skip binding empty descriptor sets on computeReinUsesLisp2021-01-041-2/+4
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #5261 from gal20/hide_mouse_patchbunnei2021-01-054-19/+24
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu/main: fix mouse not showing on move and port citra-emu/citra#5476gal202020-12-314-19/+24
* | | | | | | | | | buffer_queue: Protect queue_sequence list access with a mutexameerj2021-01-042-13/+21
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #5286 from ReinUsesLisp/rename-vk-deviceRodrigo Locatti2021-01-0452-169/+166
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | renderer_vulkan: Rename VKDevice to DeviceReinUsesLisp2021-01-0352-169/+166
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #5285 from lioncash/error-strRodrigo Locatti2021-01-033-2/+8
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | main: Resolve error string not displayingLioncash2021-01-033-2/+8
* | | | | | | | Merge pull request #5230 from ReinUsesLisp/vulkan-commonRodrigo Locatti2021-01-0360-486/+574
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | vulkan_instance: Allow different Vulkan versions and enforce 1.1ReinUsesLisp2020-12-317-41/+39
| * | | | | | | vk_device: Use an array to report lacking device limitsReinUsesLisp2020-12-311-13/+17
| * | | | | | | vk_device: Stop initialization when device is not suitableReinUsesLisp2020-12-312-61/+39
| * | | | | | | renderer_vulkan: Remove two step initialization on VKDeviceReinUsesLisp2020-12-316-31/+10
| * | | | | | | renderer_vulkan: Throw when enumerating devices failsReinUsesLisp2020-12-315-33/+21
| * | | | | | | renderer_vulkan: Initialize surface in separate fileReinUsesLisp2020-12-316-73/+109
| * | | | | | | renderer_vulkan: Catch and report exceptionsReinUsesLisp2020-12-311-2/+5
| * | | | | | | renderer_vulkan: Create debug callback on separate file and throwReinUsesLisp2020-12-318-79/+88
| * | | | | | | renderer_vulkan: Move instance initialization to a separate fileReinUsesLisp2020-12-314-111/+176
| * | | | | | | vulkan_common: Rename renderer_vulkan/wrapper.h to vulkan_common/vulkan_wrapper.hReinUsesLisp2020-12-3151-51/+51
| * | | | | | | vulkan_common: Move dynamic library load to a separate fileReinUsesLisp2020-12-314-31/+59
* | | | | | | | Merge pull request #5278 from MerryMage/cpuopt_unsafe_inaccurate_nanbunnei2021-01-036-0/+26
|\ \ \ \ \ \ \ \
| * | | | | | | | dynarmic: Add Unsafe_InaccurateNaN optimizationMerryMage2021-01-026-0/+26
* | | | | | | | | Merge pull request #5279 from bunnei/buffer-queue-connectbunnei2021-01-031-2/+0
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | hle: service: nvflinger: buffer_queue: Do not reset id/layer_id on Connect.bunnei2021-01-031-2/+0
* | | | | | | | | Merge pull request #5267 from lioncash/localizebunnei2021-01-031-10/+13
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | main: Make the loader error dialog fully translatableLioncash2020-12-311-8/+12
| * | | | | | | | main: Tidy up enum comparisonLioncash2020-12-311-2/+1
* | | | | | | | | general: Fix various spelling errorsMorph2021-01-0220-43/+43
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #5209 from Morph1984/refactor-controller-connectbunnei2021-01-014-12/+47
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | configure_input: Modify controller connection delayMorph2021-01-014-12/+47
* | | | | | | | memory: Remove MemoryHookMerryMage2021-01-019-382/+0
* | | | | | | | Merge pull request #5249 from ReinUsesLisp/lock-free-pagesbunnei2021-01-017-147/+132
|\ \ \ \ \ \ \ \
| * | | | | | | | core/memory: Read and write page table atomicallyReinUsesLisp2020-12-307-147/+132
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #5264 from 16-Bit-Dog/patch-1bunnei2020-12-311-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Make the coding conventions more consistant16-Bit-Dog2020-12-311-1/+1
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #5265 from german77/port5509bunnei2020-12-311-2/+45
|\ \ \ \ \ \ \ \
| * | | | | | | | Port citra-emu/citra#5509german2020-12-311-2/+45
* | | | | | | | | Merge pull request #5208 from bunnei/service-threadsbunnei2020-12-3167-1003/+772
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | hle: kernel: service_thread: Make thread naming more consistent.bunnei2020-12-301-1/+1
| * | | | | | | | hle: kernel: Manage service threads on another thread.bunnei2020-12-301-9/+20
| * | | | | | | | common: ThreadWorker: Add class to help do asynchronous work.bunnei2020-12-303-0/+90
| * | | | | | | | hle: kernel: Manage host thread IDs using TLS.bunnei2020-12-301-46/+31
| * | | | | | | | hle: kernel: Move ServiceThread ownership to KernelCore.bunnei2020-12-294-5/+48
| * | | | | | | | hle: kernel: service_thread: Add thread name and take weak_ptr of ServerSession.bunnei2020-12-293-11/+22
| * | | | | | | | hle: service: Acquire and release a lock on requests.bunnei2020-12-297-40/+41
| * | | | | | | | audio_core: stream: Ensure buffer is valid before release.bunnei2020-12-291-2/+10
| * | | | | | | | core: Do not reset device_memory on shutdown.bunnei2020-12-291-1/+0
| * | | | | | | | core: hle: kernel: Clear process list on boot.bunnei2020-12-291-2/+2
| * | | | | | | | gpu: gpu_thread: Ensure MicroProfile is shutdown on exit.bunnei2020-12-291-0/+3
| * | | | | | | | hle: service: vi: Refactor to grab buffer only once.bunnei2020-12-291-15/+4
| * | | | | | | | service: nvflinger: Improve synchronization for BufferQueue.bunnei2020-12-295-19/+72
| * | | | | | | | hle: service: Ensure system is powered on before writing IPC result.bunnei2020-12-291-1/+5
| * | | | | | | | core: kernel: Clear process list earlier.bunnei2020-12-291-2/+2
| * | | | | | | | video_core: gpu_thread: Do not wait when system is powered down.bunnei2020-12-291-1/+2
| * | | | | | | | core: settings: Untangle multicore from asynchronous GPU.bunnei2020-12-295-21/+4
| * | | | | | | | video_core: gpu: Implement synchronous mode using threaded GPU.bunnei2020-12-294-12/+34
| * | | | | | | | video_core: gpu: Refactor out synchronous/asynchronous GPU implementations.bunnei2020-12-2910-289/+130
| * | | | | | | | hle: kernel: hle_ipc: Remove SleepClientThread.bunnei2020-12-292-54/+0
| * | | | | | | | hle: service: bsd: Update to work with service threads, removing SleepClientThread.bunnei2020-12-294-250/+45
| * | | | | | | | hle: service: nvdrv: Revert #4981 to remove usage of SleepClientThread.bunnei2020-12-2923-211/+83
| * | | | | | | | hle: kernel: service_thread: Add parameter for thread pool size.bunnei2020-12-293-7/+7
| * | | | | | | | hle: service: nvflinger: Refactor locking and interfaces.bunnei2020-12-293-45/+31
| * | | | | | | | hle: service: vi: Remove usage of SleepClientThread.bunnei2020-12-291-34/+43
| * | | | | | | | core: hle: server_session: Use separate threads for each service connection.bunnei2020-12-296-23/+140
* | | | | | | | | half_set: Resolve -Wmaybe-uninitialized warningsLioncash2020-12-301-7/+7
| |_|_|_|/ / / / |/| | | | | | |
* | | | | | | | maxwell_to_vk: Initialize usage variable in SurfaceFormat()Lioncash2020-12-301-1/+1
| |_|_|/ / / / |/| | | | | |
* | | | | | | Merge pull request #5251 from ReinUsesLisp/wuninitializedLC2020-12-302-1/+2
|\ \ \ \ \ \ \
| * | | | | | | cmake: Enforce -WuninitializedReinUsesLisp2020-12-301-0/+1
| * | | | | | | service/pcie: Fix invalid initialization argumentReinUsesLisp2020-12-301-1/+1
* | | | | | | | video_core: Rewrite the texture cacheReinUsesLisp2020-12-30152-8101/+10359
* | | | | | | | video_core: Add a delayed destruction ring abstractionReinUsesLisp2020-12-302-0/+33
* | | | | | | | host_shaders: Add Vulkan assembler compute shadersReinUsesLisp2020-12-304-0/+96
* | | | | | | | host_shaders: Add helper to blit depth stencil fragment shaderReinUsesLisp2020-12-302-0/+17
* | | | | | | | host_shaders: Add texture color blit fragment shaderReinUsesLisp2020-12-302-0/+15
* | | | | | | | host_shaders: Add shaders to present to the swapchainReinUsesLisp2020-12-303-0/+36
* | | | | | | | host_shaders: Add shaders to convert between depth and color imagesReinUsesLisp2020-12-303-0/+28
* | | | | | | | host_shaders: Add compute shader to copy BC4 as RG32UI to RGBA8ReinUsesLisp2020-12-302-0/+71
* | | | | | | | host_shaders: Add shader to render a full screen triangleReinUsesLisp2020-12-302-0/+30
* | | | | | | | host_shaders: Add pitch linear upload compute shaderReinUsesLisp2020-12-302-0/+87
* | | | | | | | host_shaders: Add block linear upload compute shadersReinUsesLisp2020-12-303-0/+249
* | | | | | | | host_shaders: Add copyright headers to OpenGL present shadersReinUsesLisp2020-12-302-0/+8
* | | | | | | | video_core/host_shaders: Add support for prebuilt SPIR-V shadersReinUsesLisp2020-12-301-16/+37
|/ / / / / / /
* | | | | | | Merge pull request #5247 from comex/xx-conceptsbunnei2020-12-302-3/+9
|\ \ \ \ \ \ \
| * | | | | | | k_priority_queue: Fix concepts usecomex2020-12-292-3/+9
* | | | | | | | Merge pull request #5246 from comex/xx-includebunnei2020-12-301-0/+1
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Add missing include of "core/hle/kernel/kernel.h"comex2020-12-291-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #5245 from ameerj/sleepthread-logLC2020-12-291-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | svc: demote SleepThread log to LOG_TRACEameerj2020-12-291-1/+1
| |/ / / / /
* | | | | | Merge pull request #5236 from gal20/udp_client_patchbunnei2020-12-291-0/+5
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | udp client: process packets only for the correct padgal202020-12-271-0/+5
| | |/ / / | |/| | |
* / | | | Allow to invert analog axis with right clickgerman2020-12-274-65/+99
|/ / / /
* | | | Merge pull request #5226 from ReinUsesLisp/c4715-vcRodrigo Locatti2020-12-252-0/+2
|\ \ \ \
| * | | | video_core: Enforce C4715 (not all control paths return a value)ReinUsesLisp2020-12-251-0/+1
| * | | | vk_shader_decompiler: Silence warning when compiling without assertsReinUsesLisp2020-12-251-0/+1
* | | | | Merge pull request #5225 from ReinUsesLisp/always-vulkanRodrigo Locatti2020-12-258-133/+75
|\ \ \ \ \
| * | | | | cmake: Always enable VulkanReinUsesLisp2020-12-258-133/+75
| |/ / / /
* / / / / core: memory: Ensure thread safe access when pages are rasterizer cached (#5206)bunnei2020-12-251-12/+40
|/ / / /
* | | | Merge pull request #5217 from lat9nq/save-on-bootbunnei2020-12-232-16/+25
|\ \ \ \
| * | | | yuzu/main: Save settings when starting guestlat9nq2020-12-222-16/+25
* | | | | yuzu/main: Improve menubar access keyslat9nq2020-12-234-38/+38
* | | | | Add option to reset window size to 1080pgerman2020-12-233-6/+30
* | | | | Merge pull request #5042 from Morph1984/project-aetherbunnei2020-12-2227-861/+1788
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | applets/web: Implement the online web browser appletMorph2020-12-188-64/+167
| * | | | applets/web: Fix keyboard to emulated controller inputMorph2020-12-183-4/+30
| * | | | main: Add the ability to disable the web appletMorph2020-12-182-0/+27
| * | | | main, applets/web: Re-add progress dialog for RomFS extractionMorph2020-12-188-68/+125
| * | | | applets/web: Implement the Qt web browser applet frontendMorph2020-12-184-5/+600
| * | | | web_browser_scripts: Add injection scripts for the web browserMorph2020-12-181-0/+193
| * | | | pl_u, applets/web: Decrypt shared fonts to TTF filesMorph2020-12-183-18/+117
| * | | | ns_vm: Stub NeedsUpdateVulnerabilityMorph2020-12-181-1/+10
| * | | | frontend/input_interpreter: Add InputInterpreter APIMorph2020-12-183-0/+167
| * | | | controllers/npad: Make press_state atomicMorph2020-12-182-2/+3
| * | | | util: Add URL Request Interceptor for QWebEngineMorph2020-12-183-0/+64
| * | | | bootmanager: Add a check whether loading is completeMorph2020-12-182-0/+6
| * | | | applets/web: Implement the default web browser applet frontendMorph2020-12-183-1/+24
| * | | | applets/web: Implement the offline browser applet backendMorph2020-12-182-13/+143
| * | | | applets/web: Initial implementation of the web browser appletMorph2020-12-183-2/+428
| * | | | applets: Remove the previous web browser applet implementationMorph2020-12-1812-1039/+40
* | | | | Merge pull request #5131 from bunnei/scheduler-rewritebunnei2020-12-2141-1872/+2216
|\ \ \ \ \
| * | | | | hle: kernel: Process: Various style fixes based on code review feedback.bunnei2020-12-061-2/+2
| * | | | | core: cpu_manager: Fix a typo in PreemptSingleCore, which broke many games.bunnei2020-12-061-21/+26
| * | | | | hle: kernel: Thread: Various style fixes based on code review feedback.bunnei2020-12-061-22/+25
| * | | | | hle: kernel: KScopedSchedulerLockAndSleep: Various style fixes based on code review feedback.bunnei2020-12-061-6/+6
| * | | | | hle: kernel: KScopedLock: Various style fixes based on code review feedback.bunnei2020-12-061-6/+8
| * | | | | hle: kernel: KAbstractSchedulerLock: Various style fixes based on code review feedback.bunnei2020-12-061-9/+7
| * | | | | hle: kernel: KScheduler: Various style fixes based on code review feedback.bunnei2020-12-062-50/+41
| * | | | | hle: kernel: KPriorityQueue: Various style fixes based on code review feedback.bunnei2020-12-061-29/+36
| * | | | | hle: kernel: KAffinityMask: Various style fixes based on code review feedback.bunnei2020-12-061-17/+13
| * | | | | hle: kernel: GlobalSchedulerContext: Various style fixes based on code review feedback.bunnei2020-12-062-5/+10
| * | | | | common: BitSet: Various style fixes based on code review feedback.bunnei2020-12-061-23/+22
| * | | | | hle: kernel: Use C++ style comments in KScheduler, etc.bunnei2020-12-064-152/+136
| * | | | | kernel: KScopedSchedulerLockAndSleep: Remove unused ctor.bunnei2020-12-061-13/+7
| * | | | | kernel: time_manager: Add missing lock guards.bunnei2020-12-061-3/+10
| * | | | | hle: kernel: Migrate to KScopedSchedulerLock.bunnei2020-12-0615-48/+92
| * | | | | hle: kernel: Separate KScopedSchedulerLockAndSleep from k_scheduler.bunnei2020-12-0611-69/+72
| * | | | | hle: kernel: Separate KScheduler from GlobalSchedulerContext class.bunnei2020-12-069-520/+140
| * | | | | hle: kernel: Rewrite scheduler implementation based on Mesopshere.bunnei2020-12-0626-1223/+1215
| * | | | | hle: kernel: physical_core: Clear exclusive state after each run.bunnei2020-12-063-0/+7
| * | | | | hle: kernel: Port KAbstractSchedulerLock from Mesosphere.bunnei2020-12-062-0/+77
| * | | | | hle: kernel: svc: Remove reschedule on svcBreak.bunnei2020-12-061-5/+0
| * | | | | hle: kernel: process: Add schedule count tracking, to be used for yield impl.bunnei2020-12-061-0/+13
| * | | | | hle: kernel: svc: Remove unnecessary hack in svcSleep.bunnei2020-12-061-7/+0
| * | | | | common: Port KPriorityQueue from Mesosphere.bunnei2020-12-062-0/+444
| * | | | | common: Port BitSet from Mesosphere.bunnei2020-12-062-0/+101
| * | | | | hle: kernel: Port KAffinityMask from Mesosphere.bunnei2020-12-067-16/+80
* | | | | | Merge pull request #5201 from ameerj/bufferq-refactorbunnei2020-12-213-70/+63
|\ \ \ \ \ \
| * | | | | | buffer_queue: better use of std::arrayameerj2020-12-181-59/+46
| * | | | | | Overwrite slots instead of queuing them, add disconnect signalameerj2020-12-173-27/+33
* | | | | | | yuzu: Remove gdbstub configurationFearlessTobi2020-12-199-110/+7
| |_|/ / / / |/| | | | |
* | | | | | system_archive: Add + and - buttons to the Nintendo Extended OSS fontMorph2020-12-182-315/+343
* | | | | | system_archive: Update Nintendo Extended OSS fontMorph2020-12-172-182/+347
|/ / / / /
* | | | | Merge pull request #5190 from Morph1984/validate_device_handlebunnei2020-12-162-0/+45
|\ \ \ \ \
| * | | | | controllers/npad: Validate device handles before useMorph2020-12-122-0/+45
* | | | | | Merge pull request #5119 from Morph1984/fs-opendatastoragewithprogramindexbunnei2020-12-1511-14/+150
|\ \ \ \ \ \
| * | | | | | fsp_srv: Implement OpenDataStorageWithProgramIndexMorph2020-12-086-1/+83
| * | | | | | file_sys: Consolidate common Title ID operationsMorph2020-12-085-13/+67
* | | | | | | Merge pull request #5157 from lioncash/array-dirtybunnei2020-12-151-34/+33
|\ \ \ \ \ \ \
| * | | | | | | maxwell_3d: Move member variables to end of classLioncash2020-12-071-31/+32
| * | | | | | | maxwell_3d: Resolve -Wdocumentation warningLioncash2020-12-071-1/+1
| * | | | | | | maxwell_3d: Remove unused dirty_pointer arrayLioncash2020-12-071-2/+0
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #5168 from Morph1984/aoc-PurchaseEventManagerbunnei2020-12-152-2/+76
|\ \ \ \ \ \ \
| * | | | | | | IPurchaseEventManager: Implement GetPurchasedEventReadableHandleMorph2020-12-081-1/+14
| * | | | | | | IPurchaseEventManager: Stub Set(Default)DeliveryTargetMorph2020-12-081-2/+27
| * | | | | | | aoc_u: Stub Create(Permanent)EcPurchasedEventManagerMorph2020-12-082-2/+38
* | | | | | | | cmake: Fix generating CMake configs and linking with Boostlat9nq2020-12-131-1/+1
* | | | | | | | common: Update CMakeList to fix build issue with Boost.bunnei2020-12-121-2/+1
| |_|_|/ / / / |/| | | | | |
* | | | | | | Merge pull request #5183 from lioncash/alias2bunnei2020-12-1228-136/+142
|\ \ \ \ \ \ \
| * | | | | | | vfs: Use existing type aliases consistentlyLioncash2020-12-1028-136/+142
* | | | | | | | Merge pull request #5187 from Morph1984/revert-stdfsbunnei2020-12-123-136/+390
|\ \ \ \ \ \ \ \
| * | | | | | | | Revert "Merge pull request #5173 from lioncash/common-fs"Morph2020-12-122-112/+396
| * | | | | | | | Revert "Merge pull request #5174 from ReinUsesLisp/fs-fix"Morph2020-12-122-36/+4
| * | | | | | | | Revert "Merge pull request #5176 from Morph1984/fix-createfile"Morph2020-12-121-6/+2
| * | | | | | | | Revert "Merge pull request #5179 from ReinUsesLisp/fs-path"Morph2020-12-121-1/+1
| * | | | | | | | Revert "Merge pull request #5181 from Morph1984/5174-review"Morph2020-12-121-3/+9
* | | | | | | | | Merge pull request #5172 from lioncash/svc-widebunnei2020-12-121-35/+25
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | svc: Remove unnecessary castsLioncash2020-12-081-35/+25
* | | | | | | | | Merge pull request #5181 from Morph1984/5174-reviewbunnei2020-12-111-9/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/file_util: Simplify the behavior of CreateFullPathMorph2020-12-101-9/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5123 from Morph1984/nim-IsLargeResourceAvailablebunnei2020-12-101-1/+13
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | nim: Stub IsLargeResourceAvailableMorph2020-12-041-1/+13
* | | | | | | | | | Merge pull request #5162 from lioncash/copy-shaderbunnei2020-12-101-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | gl_shader_decompiler: Elide unnecessary copies within DeclareConstantBuffers()Lioncash2020-12-071-1/+1
* | | | | | | | | | common/file_util: Let std::filesystem cast from UTF16 to std::stringReinUsesLisp2020-12-091-1/+1
* | | | | | | | | | vfs_real: Fix CreateFile for files without a file extensionMorph2020-12-091-2/+6
* | | | | | | | | | common/file_util: Fix and deprecate CreateFullPath, add CreateDirsReinUsesLisp2020-12-092-4/+31
* | | | | | | | | | common/file_util: Succeed on CreateDir when the directory existsReinUsesLisp2020-12-091-0/+5
* | | | | | | | | | Merge pull request #5142 from comex/xx-poll-eventsRodrigo Locatti2020-12-096-71/+82
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`comex2020-12-076-71/+82
* | | | | | | | | | | Merge pull request #5173 from lioncash/common-fsRodrigo Locatti2020-12-092-396/+112
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | file_util: Migrate remaining file handling functions over to std::filesystemLioncash2020-12-092-340/+100
| * | | | | | | | | | | file_util: Migrate Exists() and IsDirectory() over to std::filesystemLioncash2020-12-092-57/+13
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #5166 from lioncash/log-castbunnei2020-12-0925-96/+90
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core: Remove unnecessary enum casts in log callsLioncash2020-12-0825-96/+90
* | | | | | | | | | | | Merge pull request #5135 from Morph1984/applets-shadowbunnei2020-12-0910-19/+19
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | applets: Resolve variable shadowingMorph2020-12-0510-19/+19
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #5167 from lioncash/doc-memorybunnei2020-12-081-2/+0
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | memory: Resolve -Wdocumentation warning for Write()Lioncash2020-12-081-2/+0
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #5156 from comex/xx-rawsbunnei2020-12-081-2/+2
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | |
| * | | | | | | | | configure_motion_touch: Fix unescaped backslash in regexcomex2020-12-071-2/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5165 from lioncash/copy-controllerMorph2020-12-081-12/+11
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | controller: Use std::move within ConvertToFrontendParameters()Lioncash2020-12-081-3/+3
| * | | | | | | | | controller: Avoid unnecessary copies in ConfigurationComplete()Lioncash2020-12-081-9/+8
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5020 from german77/AnalogfromButtonFixMorph2020-12-085-10/+52
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Disable analog joystick from buttons by defaultgerman2020-12-085-10/+52
* | | | | | | | | Merge pull request #5164 from lioncash/containsRodrigo Locatti2020-12-088-16/+13
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core: Make use of ordered container contains() where applicableLioncash2020-12-078-16/+13
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #5163 from lioncash/concatRodrigo Locatti2020-12-081-5/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | ast: Improve string concat readability in operator()Lioncash2020-12-071-5/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #5153 from comex/xx-unixbunnei2020-12-082-5/+5
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | CMakeLists,network: Create YUZU_UNIX macro to replace __unix__comex2020-12-072-5/+5
* | | | | | | | | Merge pull request #5149 from comex/xx-map-intervalbunnei2020-12-071-1/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | map_interval: Change field order to address uninitialized field warningcomex2020-12-071-1/+2
* | | | | | | | | | Merge pull request #5159 from lioncash/move-amendRodrigo Locatti2020-12-071-2/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | shader_ir: std::move node within DeclareAmend()Lioncash2020-12-071-2/+2
* | | | | | | | | | | buffer_block: Mark interface as nodiscard where applicableLioncash2020-12-071-7/+7
* | | | | | | | | | | buffer_block: Remove unnecessary includesLioncash2020-12-071-5/+0
* | | | | | | | | | | Merge pull request #5158 from lioncash/video-fmtRodrigo Locatti2020-12-0733-148/+125
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core: Remove unnecessary enum class casting in logging messagesLioncash2020-12-0733-148/+125
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #5148 from comex/xx-unused-fieldsbunnei2020-12-072-3/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core: Mark unused fields as [[maybe_unused]]comex2020-12-072-3/+3
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #5154 from comex/xx-ipcbunnei2020-12-072-34/+37
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cppcomex2020-12-072-34/+37
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #5147 from comex/xx-purevirtLC2020-12-071-33/+0
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclasscomex2020-12-071-33/+0
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #5150 from comex/xx-boxcatLC2020-12-071-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | boxcat: Avoid unnecessary object copycomex2020-12-071-1/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #5152 from comex/xx-overrideLC2020-12-071-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | renderer_vulkan: Add missing `override` specifiercomex2020-12-071-1/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #5136 from lioncash/video-shadow3LC2020-12-0749-292/+305
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | video_core: Resolve more variable shadowing scenarios pt.3Lioncash2020-12-0549-292/+305
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Fix "explicitly defaulted but implicitly deleted" warningcomex2020-12-071-1/+1
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | video_core: Adjust `NUM` macro to avoid Clang warningcomex2020-12-073-3/+3
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #5143 from comex/xx-users-sizeRodrigo Locatti2020-12-061-1/+0
|\ \ \ \ \ \ \
| * | | | | | | yuzu_cmd: Remove 'users_size'comex2020-12-051-1/+0
| |/ / / / / /
* | | | | | | Merge pull request #5141 from comex/xx-true-falseRodrigo Locatti2020-12-061-5/+7
|\ \ \ \ \ \ \
| * | | | | | | maxwell_dma: Rename RenderEnable::Mode::FALSE and TRUE to avoid name conflictcomex2020-12-051-5/+7
| |/ / / / / /
* | | | | | | Merge pull request #5140 from FearlessTobi/port-5577bunnei2020-12-061-0/+1
|\ \ \ \ \ \ \
| * | | | | | | Update cubeb and request a persistent stream sessionVitor Kiguchi2020-12-051-0/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #5132 from lioncash/xbyak-abibunnei2020-12-061-10/+10
|\ \ \ \ \ \ \
| * | | | | | | xbyak_abi: Shorten std::size_t to size_tLioncash2020-12-051-8/+8
| * | | | | | | xbyak_abi: Avoid implicit sign conversionsLioncash2020-12-051-2/+2
| | |_|_|/ / / | |/| | | | |
* | | | | | | game_list_p: Resolve deprecated usage of QVariant operator<Lioncash2020-12-051-1/+2
| |_|/ / / / |/| | | | |
* | | | | | video_core: Resolve more variable shadowing scenarios pt.2Lioncash2020-12-0539-296/+305
* | | | | | Merge pull request #5124 from lioncash/video-shadowbunnei2020-12-0542-206/+219
|\ \ \ \ \ \
| * | | | | | video_core: Resolve more variable shadowing scenariosLioncash2020-12-0442-206/+219
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #5127 from FearlessTobi/port-5617bunnei2020-12-051-3/+3
|\ \ \ \ \ \
| * | | | | | Fix telemetry-related exit crash from use-after-freeFearlessTobi2020-12-051-3/+3
| |/ / / / /
* | / / / / system_version: Update to 11.0.0Chloe Marcec2020-12-051-6/+6
| |/ / / / |/| | | |
* | | | | codec: Remove deprecated usage of AVCodecContext::refcounted_framesLioncash2020-12-041-1/+0
|/ / / /
* | | | Merge pull request #5064 from lioncash/node-shadowbunnei2020-12-041-75/+77
|\ \ \ \
| * | | | node: Mark member functions as [[nodiscard]] where applicableLioncash2020-12-031-29/+29
| * | | | node: Eliminate variable shadowingLioncash2020-12-031-47/+49
* | | | | Merge pull request #5061 from lioncash/pessimizingbunnei2020-12-042-11/+11
|\ \ \ \ \
| * | | | | vp9/vic: Resolve pessimizing movesLioncash2020-12-032-11/+11
| |/ / / /
* | | | | Merge pull request #4996 from bunnei/use-4jitsbunnei2020-12-0427-271/+214
|\ \ \ \ \
| * | | | | kernel: scheduler: Minor cleanup to remove duplicated code.bunnei2020-11-292-46/+14
| * | | | | kernel: time_manager: Protect access with a mutex.bunnei2020-11-292-1/+5
| * | | | | common: fiber: Use VirtualBuffer for stack memory.bunnei2020-11-291-2/+5
| * | | | | hle: kernel: thread: Remove unused "Running" state.bunnei2020-11-293-21/+9
| * | | | | core: arm: Implement InvalidateCacheRange for CPU cache invalidation.bunnei2020-11-2912-16/+56
| * | | | | hle: kernel: time_manager: Avoid a crash on process exit.bunnei2020-11-291-1/+4
| * | | | | hle: kernel: AddressArbiter: Remove unused code.bunnei2020-11-292-9/+0
| * | | | | hle: kernel: SynchronizationObject: Use atomic_bool for is_signaled.bunnei2020-11-291-1/+2
| * | | | | common: fiber: Use boost::context instead of native fibers on Windows.bunnei2020-11-293-116/+9
| * | | | | hle: kernel: multicore: Replace n-JITs impl. with 4 JITs.bunnei2020-11-2915-72/+124
* | | | | | mouse_poller: Remove unused includesLioncash2020-12-031-3/+1
* | | | | | mouse_input: Invert conditional in UpdateYuzuSettings()Lioncash2020-12-031-4/+6
* | | | | | mouse_input: Remove two casts and amend some formattingLioncash2020-12-031-11/+14
* | | | | | mouse_input: Resolve a -Wdocumentation warningLioncash2020-12-031-1/+1
* | | | | | mouse_input: Remove unused includesLioncash2020-12-032-7/+3
| |/ / / / |/| | | |
* | | | | Merge pull request #5000 from lioncash/audio-errorbunnei2020-12-0329-154/+163
|\ \ \ \ \
| * | | | | audio_core: Make shadowing and unused parameters errorsLioncash2020-12-0329-154/+163
* | | | | | Merge pull request #5002 from ameerj/nvdec-frameskipbunnei2020-12-0310-340/+234
|\ \ \ \ \ \
| * | | | | | Limit queue size to 10 framesameerj2020-11-261-0/+4
| * | | | | | Address PR feedbackameerj2020-11-264-32/+33
| * | | | | | Queue decoded frames, cleanup decodersameerj2020-11-2510-338/+227
* | | | | | | Merge pull request #4937 from german77/multiUDPbunnei2020-12-0110-267/+420
|\ \ \ \ \ \ \
| * | | | | | | Add multiple udp server supportgerman2020-11-2610-267/+420
* | | | | | | | Merge pull request #5047 from german77/MouseInputLC2020-12-011-6/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | Fix implicit conversion in mouse inputgerman2020-12-011-6/+8
* | | | | | | | | Merge pull request #5013 from ReinUsesLisp/vk-early-zbunnei2020-11-306-11/+19
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_shader_decompiler: Implement force early fragment testsReinUsesLisp2020-11-266-11/+19
* | | | | | | | | | Disable web applet and warning when compiling for Linux on CIlat9nq2020-11-301-0/+2
* | | | | | | | | | Merge pull request #4939 from german77/MouseInputbunnei2020-11-3014-277/+793
|\ \ \ \ \ \ \ \ \ \ | | |/ / / / / / / / | |/| | | | | | | |
| * | | | | | | | | Implement full mouse supportgerman2020-11-2614-277/+793
* | | | | | | | | | Merge pull request #5005 from ReinUsesLisp/div-ceilbunnei2020-11-292-0/+27
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | |
| * | | | | | | | | common: Add Common::DivCeil and Common::DivCeilLog2ReinUsesLisp2020-11-262-0/+27
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #4998 from Morph1984/bioshock-patchbunnei2020-11-291-2/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hid: Check if applet_resource exists in InitializeVibrationDeviceMorph2020-11-251-2/+4
* | | | | | | | | | Add missing types to NpadCommunicationModegerman2020-11-291-0/+2
* | | | | | | | | | Merge pull request #5021 from german77/StubCommunicationModebunnei2020-11-294-2/+50
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Stub set and get NpadCommunicationModegerman2020-11-274-2/+50
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | audio_core: Remove temp_mix_bufferChloe Marcec2020-11-282-3/+1
* | | | | | | | | | Merge pull request #5015 from comex/xx-sign-comparebunnei2020-11-281-2/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | tests: Fix warning about comparison between signed and unsignedcomex2020-11-271-2/+2
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #5011 from lioncash/file-str2bunnei2020-11-281-12/+22
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core: Reduce string copies in GetGameFileFromPath()Lioncash2020-11-261-12/+22
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #5014 from comex/xx-invalid-offsetofLC2020-11-271-0/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | CMakeLists: disable -Winvalid-offsetofcomex2020-11-271-0/+1
| |/ / / / / / / / /
* | | | | | | | | | core: Eliminate remaining usages of the global system instanceLioncash2020-11-2721-1593/+58
* | | | | | | | | | savedata_factory: Eliminate usage of the global system instanceLioncash2020-11-274-14/+22
* | | | | | | | | | Merge pull request #5018 from lioncash/service-globalRodrigo Locatti2020-11-27222-907/+1221
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | service: Eliminate usages of the global system instanceLioncash2020-11-27222-907/+1221
| |/ / / / / / / /
* / / / / / / / / codec: Fix `pragma GCC diagnostic pop` missing corresponding pushcomex2020-11-261-0/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #4975 from comex/invalid-syncpoint-idbunnei2020-11-262-13/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint IDcomex2020-11-242-13/+20
* | | | | | | | | Merge pull request #4981 from ogniK5377/ioctl-ctrlbunnei2020-11-2624-91/+214
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | nvservices: Reintroducee IoctlCtrlChloe Marcec2020-11-2424-91/+214
* | | | | | | | | | input_common: ignore some Clang warnings after 5c4774e8ce1dJan Beich2020-11-261-2/+2
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #4976 from comex/poll-eventsRodrigo Locatti2020-11-2610-73/+68
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | Overhaul EmuWindow::PollEvents to fix yuzu-cmd calling SDL_PollEvents off main threadcomex2020-11-2310-73/+68
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4946 from ameerj/alpha-testRodrigo Locatti2020-11-255-3/+65
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | cleanup unneeded comments and newlinesameerj2020-11-251-6/+0
| * | | | | | | Refactor MaxwellToSpirvComparison. Use Common::BitCastameerj2020-11-253-31/+34
| * | | | | | | Address PR feedback from Reinameerj2020-11-255-40/+31
| * | | | | | | vulkan_renderer: Alpha Test Culling Implementationameerj2020-11-255-2/+76
* | | | | | | | Merge pull request #4959 from Morph1984/emulated-controller-stylesetbunnei2020-11-254-99/+192
|\ \ \ \ \ \ \ \
| * | | | | | | | applets/controller: Use a pair of emulated controller index to controller typeMorph2020-11-212-44/+96
| * | | | | | | | configure_input_player: Use the npad style set to show the available controllersMorph2020-11-212-55/+96
* | | | | | | | | Merge pull request #4932 from ogniK5377/misc-audiobunnei2020-11-2513-103/+198
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | Addressed changesChloe Marcec2020-11-174-10/+13
| * | | | | | | | audren: Make use of nodiscard, rework downmixing, release all buffersChloe Marcec2020-11-1713-102/+194
* | | | | | | | | Merge pull request #4978 from bunnei/shutdown-crashbunnei2020-11-251-7/+17
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | core: cpu_manager: Fix shutdown crash when closing before emulation starts.bunnei2020-11-251-7/+17
* | | | | | | | | Merge pull request #4905 from german77/AnalogFromButtonbunnei2020-11-251-19/+103
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | fix minor clang errorgerman2020-11-101-1/+1
| * | | | | | | | | Allow to dial any angle with digital joystickgerman2020-11-081-19/+103
* | | | | | | | | | frontend: yuzu (qt): Register a callback for ExecuteProgram.bunnei2020-11-254-7/+38
* | | | | | | | | | service: am: Implement ExecuteProgram and required stubs.bunnei2020-11-252-3/+34
* | | | | | | | | | core: loader: Implement support for loading indexed programs.bunnei2020-11-2512-26/+74
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | hle: services: Fix a crash with improper NVFlinger lifetime management. (#4977)bunnei2020-11-2417-100/+104
* | | | | | | | | Merge pull request #3681 from lioncash/componentRodrigo Locatti2020-11-241-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | decode/image: Fix typo in assert in GetComponentSize()Lioncash2020-04-161-3/+3
| * | | | | | | | | decoder/image: Fix incorrect G24R8 component sizes in GetComponentSize()Lioncash2020-04-161-2/+2
* | | | | | | | | | Merge pull request #4942 from lioncash/systemRodrigo Locatti2020-11-244-100/+85
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core: Remove unused private Init function for the System classLioncash2020-11-182-16/+4
| * | | | | | | | | | core: Make use of [[nodiscard]] with the System classLioncash2020-11-184-85/+82
* | | | | | | | | | | Merge pull request #4972 from lioncash/unused4Rodrigo Locatti2020-11-241-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | svc: Remove unnecessary [[maybe_unused]] tagLioncash2020-11-231-1/+1
* | | | | | | | | | | | input_common: Fix typo in gc_poller.cpp with [[maybe_unused]].bunnei2020-11-241-2/+2
* | | | | | | | | | | | input_common: Add more missing [[maybe_unused]] from #4927.bunnei2020-11-243-4/+6
| |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
* | | | | | | | | | | Fix warnings in core/frontend/input.h with [[maybe_unused]]bunnei2020-11-241-1/+3
* | | | | | | | | | | Merge pull request #4927 from lioncash/input-errorbunnei2020-11-248-10/+23
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | input_common: Treat warnings as errorsLioncash2020-11-228-10/+23
* | | | | | | | | | | Merge pull request #4451 from slashiee/extended-loggingbunnei2020-11-235-11/+54
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | logging/settings: Increase maximum log size to 100 MB and add extended logging optionM&M2020-08-255-11/+54
* | | | | | | | | | | Merge pull request #4944 from lioncash/system-rembunnei2020-11-2226-157/+259
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | patch_manager: Remove usages of the global system instanceLioncash2020-11-1826-157/+259
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4954 from lioncash/compareMorph2020-11-221-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_rasterizer: Make floating-point literal a floatLioncash2020-11-201-1/+1
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4955 from lioncash/move3bunnei2020-11-211-19/+13
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | async_shaders: emplace threads into the worker thread vectorLioncash2020-11-201-2/+2
| * | | | | | | | | | | async_shaders: Simplify implementation of GetCompletedWork()Lioncash2020-11-201-2/+1
| * | | | | | | | | | | async_shaders: Simplify moving data into the pending queueLioncash2020-11-201-13/+8
| * | | | | | | | | | | async_shaders: std::move data within QueueVulkanShader()Lioncash2020-11-201-2/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4907 from ogniK5377/nvdrv-cleanupbunnei2020-11-2126-898/+1220
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | Addressed issuesChloe Marcec2020-11-1010-17/+86
| * | | | | | | | | | core: Make nvservices more standardizedChloe Marcec2020-11-1026-903/+1156
* | | | | | | | | | | Merge pull request #4957 from ReinUsesLisp/alpha-test-rtLC2020-11-211-4/+0
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_rasterizer: Remove warning of untested alpha testReinUsesLisp2020-11-211-4/+0
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4953 from lioncash/shader-shadowbunnei2020-11-211-88/+96
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | shader_bytecode: Make use of [[nodiscard]] where applicableLioncash2020-11-201-73/+79
| * | | | | | | | | | | shader_bytecode: Eliminate variable shadowingLioncash2020-11-201-15/+17
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4951 from bunnei/olsc-stubbunnei2020-11-206-0/+91
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | olsc: Move member initialization to after member functions.bunnei2020-11-201-2/+2
| * | | | | | | | | | | hle: service: Stub OLSC Initialize and SetSaveDataBackupSettingEnabled functions.bunnei2020-11-196-0/+91
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4941 from lioncash/configMorph2020-11-201-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | configure_input_player: Use static qualifier for IsProfileNameValid()Lioncash2020-11-181-1/+1
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4950 from german77/RumbleStrenghtLC2020-11-202-4/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Modify rumble amplificationgerman772020-11-192-4/+3
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4952 from ReinUsesLisp/bit-castLC2020-11-202-0/+23
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | common/bit_cast: Add function matching std::bit_cast without constexprReinUsesLisp2020-11-202-0/+23
* | | | | | | | | | | Merge pull request #4308 from ReinUsesLisp/maxwell-3d-funcsRodrigo Locatti2020-11-202-151/+122
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | maxwell_3d: Use insert instead of loop push_backReinUsesLisp2020-11-111-3/+1
| * | | | | | | | | | maxwell_3d: Move code to separate functionsReinUsesLisp2020-11-112-151/+124
* | | | | | | | | | | virtual_buffer: Do nothing on resize() calls with same sizesLioncash2020-11-191-1/+6
| |/ / / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #4936 from lioncash/pagebunnei2020-11-194-12/+37
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | virtual_buffer: Add compile-time type-safety guarantees with VirtualBufferLioncash2020-11-181-0/+6
| * | | | | | | | | page_table: Allow page tables to be movedLioncash2020-11-184-9/+30
| * | | | | | | | | page_table: Add missing doxygen parameters to Resize()Lioncash2020-11-181-0/+2
| * | | | | | | | | page_table: Remove unnecessary header inclusionsLioncash2020-11-181-4/+0
* | | | | | | | | | Merge pull request #4866 from Morph1984/mjolnir-p3-prodbunnei2020-11-1866-1431/+3265
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | sdl_impl: Pump SDL Events at 1000 HzMorph2020-11-161-1/+1
| * | | | | | | | | | configure_input: Accommodate for the mouse input device engineMorph2020-11-162-2/+18
| * | | | | | | | | | hid: Reimplement Begin/EndPermitVibrationSessionMorph2020-11-163-5/+17
| * | | | | | | | | | controllers/npad: Load input devices on initMorph2020-11-161-0/+2
| * | | | | | | | | | configure_input: Update the input profiles for other player tabsMorph2020-11-164-11/+38
| * | | | | | | | | | general: Fix compiler warnings on linux and miscellaneous changesMorph2020-11-1612-22/+31
| * | | | | | | | | | sdl_impl: Revert to the "old" method of mapping sticksMorph2020-11-163-33/+29
| * | | | | | | | | | applets/controller: Change the input button to create input profilesMorph2020-11-1610-100/+117
| * | | | | | | | | | controllers/npad: Remove the old vibration filterMorph2020-11-164-65/+64
| * | | | | | | | | | input: Disconnect a controller prior to connecting a new oneMorph2020-11-162-50/+73
| * | | | | | | | | | hid: Implement InitializeVibrationDevice and IsVibrationDeviceMountedMorph2020-11-163-12/+66
| * | | | | | | | | | input_common: Add VibrationDevice and VibrationDeviceFactoryMorph2020-11-1619-101/+327
| * | | | | | | | | | configure_input: Add per-player vibrationMorph2020-11-1616-28/+730
| * | | | | | | | | | settings: Remove global vibration strength modifierMorph2020-11-169-19/+1
| * | | | | | | | | | hid: Mark Begin/EndPermitVibrationSession as stubsMorph2020-11-163-18/+4
| * | | | | | | | | | controllers/npad: Send an empty vibration on destruction/deactivationMorph2020-11-163-22/+38
| * | | | | | | | | | hid: Stub IsVibrationDeviceMountedMorph2020-11-162-1/+23
| * | | | | | | | | | controllers/npad: Add heuristics to reduce rumble state changesMorph2020-11-163-35/+72
| * | | | | | | | | | configure_input: Hook up the vibration percentage spinboxMorph2020-11-1611-3/+26
| * | | | | | | | | | controllers/npad: Stop games from vibrating incorrect controllersMorph2020-11-161-0/+10
| * | | | | | | | | | hid: Fix controller rumble based on new researchMorph2020-11-163-43/+69
| * | | | | | | | | | hid: Pop a struct of parameters instead of popping individual parametersMorph2020-11-161-103/+237
| * | | | | | | | | | hid: Reorder all HID commandsMorph2020-11-165-217/+232
| * | | | | | | | | | hid: Implement GetVibrationDeviceInfoMorph2020-11-162-3/+39
| * | | | | | | | | | hid: Stub InitializeVibrationDeviceMorph2020-11-161-3/+11
| * | | | | | | | | | controllers/npad: Rename NPadType to NpadStyleSetMorph2020-11-163-9/+9
| * | | | | | | | | | controllers/npad: Add DeviceHandle structMorph2020-11-161-27/+50
| * | | | | | | | | | configure_input_player: Change "Defaults" button behaviorMorph2020-11-162-35/+30
| * | | | | | | | | | settings: Preparation for per-game input settingsMorph2020-11-1619-115/+167
| * | | | | | | | | | udp/client: Reduce testing period to 5 secondsMorph2020-11-161-1/+1
| * | | | | | | | | | config: Migrate config files into config/customMorph2020-11-164-21/+61
| * | | | | | | | | | controllers/npad: Connect a controller on init if none are connectedMorph2020-11-162-1/+15
| * | | | | | | | | | applets/controller: Auto accept a valid single player configurationMorph2020-11-163-14/+24
| * | | | | | | | | | bootmanager: Allow mouse clicks only if touch is disabledMorph2020-11-161-3/+13
| * | | | | | | | | | input_profiles: Implement input profilesMorph2020-11-1613-130/+509
| * | | | | | | | | | configure_input_player: Implement input exclusivity and persistenceMorph2020-11-164-138/+205
| * | | | | | | | | | ui/themes: Cleanup UIMorph2020-11-1613-397/+263
* | | | | | | | | | | rasterizer_interface: Make use of [[nodiscard]] where applicableLioncash2020-11-171-8/+9
* | | | | | | | | | | render_base: Make use of [[nodiscard]] where applicableLioncash2020-11-171-11/+11
* | | | | | | | | | | gpu: Make use of [[nodiscard]] where applicableLioncash2020-11-171-31/+35
| |/ / / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #4929 from lioncash/nodiscard-inputbunnei2020-11-171-11/+12
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | motion_input: Mark constructor as explicitLioncash2020-11-151-1/+1
| * | | | | | | | | motion_input: Mark member functions as [[nodiscard]] where applicableLioncash2020-11-151-10/+11
* | | | | | | | | | Merge pull request #4914 from lat9nq/gl-warningsLC2020-11-151-8/+28
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | |
| * | | | | | | | | bootmanager: Address review commentslat9nq2020-11-101-12/+16
| * | | | | | | | | bootmanager: Log and show GL_RENDERER string when GPU is insufficientlat9nq2020-11-101-3/+19
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #4895 from Morph1984/cave-story-plus-applet-fixbunnei2020-11-132-26/+80
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | applets: Rename LibraryAppletVersion to ControllerAppletVersionMorph2020-11-082-15/+15
| * | | | | | | | applets/controller: Pop normal data for StrapGuide and FirmwareUpdateMorph2020-11-082-6/+19
| * | | | | | | | applets/controller: Introduce additional checks for mode and callerMorph2020-11-082-5/+39
| * | | | | | | | applets/controller: Add ControllerUpdateFirmwareArg structMorph2020-11-081-0/+7
* | | | | | | | | Merge pull request #4901 from bunnei/caps-stubbunnei2020-11-102-9/+17
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.bunnei2020-11-072-9/+17
* | | | | | | | | Merge pull request #4909 from lioncash/interruptRodrigo Locatti2020-11-091-2/+2
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | cpu_interrupt_handler: Mark move contructor/assignment as deletedLioncash2020-11-081-2/+2
| | |/ / / / / / | |/| | | | | |
* / | | | | | | ipc_helpers: Remove usage of the global system instanceLioncash2020-11-0816-7/+23
|/ / / / / / /
* | | | | | | Merge pull request #4903 from bunnei/remove-gpu-integritybunnei2020-11-083-29/+1
|\ \ \ \ \ \ \
| * | | | | | | video_core: dma_pusher: Remove integrity check on command lists.bunnei2020-11-073-29/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #4906 from lat9nq/log-cpu-accuracyLC2020-11-071-0/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | settings: log value of CPU_Accuracylat9nq2020-11-071-0/+1
| |/ / / / /
* | | | | | Merge pull request #4888 from lioncash/unicorn-removebunnei2020-11-0711-418/+15
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | core: Remove usage of unicornLioncash2020-11-0411-418/+15
* | | | | | common/fiber: Move all member variables into impl classLioncash2020-11-072-89/+86
* | | | | | Merge pull request #4891 from lioncash/clang2bunnei2020-11-064-7/+14
|\ \ \ \ \ \
| * | | | | | General: Fix clang buildLioncash2020-11-054-7/+14
* | | | | | | Merge pull request #4894 from lioncash/fnbunnei2020-11-061-1/+1
|\ \ \ \ \ \ \
| * | | | | | | settings: Simplify initializer of resolution factorLioncash2020-11-061-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #4854 from ReinUsesLisp/cube-array-shadowbunnei2020-11-063-25/+37
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | shader: Partially implement texture cube array shadowReinUsesLisp2020-10-283-25/+37
* | | | | | | Merge pull request #4889 from lioncash/setting-globalbunnei2020-11-059-39/+50
|\ \ \ \ \ \ \
| * | | | | | | core/settings: Move configuring_global behind an APILioncash2020-11-049-39/+50
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #4858 from lioncash/initializerbunnei2020-11-045-4/+24
|\ \ \ \ \ \ \
| * | | | | | | General: Resolve a few missing initializer warningsLioncash2020-10-305-4/+24
* | | | | | | | Merge pull request #4869 from bunnei/improve-gpu-syncChloe2020-11-0415-117/+448
|\ \ \ \ \ \ \ \
| * | | | | | | | fixup! hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-012-3/+11
| * | | | | | | | core: Initialize GPU before services.bunnei2020-11-011-4/+6
| * | | | | | | | hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-013-46/+106
| * | | | | | | | video_core: dma_pusher: Add support for integrity checks.bunnei2020-11-012-0/+27
| * | | | | | | | video_core: dma_pusher: Add support for prefetched command lists.bunnei2020-11-012-25/+52
| * | | | | | | | service: hle: nvflinger: Fix potential shutdown crash when GPU is destroyed.bunnei2020-11-011-0/+4
| * | | | | | | | video_core: gpu: Implement WaitFence and IncrementSyncPoint.bunnei2020-11-013-28/+70
| * | | | | | | | hle service: nvdrv: nvhost_ctrl: Update to use SyncpointManager.bunnei2020-11-013-9/+31
| * | | | | | | | hle service: nvdrv: Update to instantiate SyncpointManager.bunnei2020-11-012-5/+18
| * | | | | | | | hle: service: nvdrv: Implement SyncpointManager, to manage syncpoints.bunnei2020-11-014-1/+127
* | | | | | | | | Merge pull request #4874 from lioncash/nodiscard2bunnei2020-11-047-16/+16
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | nvdec: Make use of [[nodiscard]] where applicableLioncash2020-11-027-16/+16
* | | | | | | | | Merge pull request #4873 from lioncash/common-errorbunnei2020-11-039-31/+49
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common: Enable warnings as errorsLioncash2020-11-029-31/+49
| |/ / / / / / / /
* | | | | | | | | Merge pull request #4878 from bunnei/unload-nrrbunnei2020-11-031-1/+15
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle: service: ldr: Implement UnloadNrr.bunnei2020-10-311-1/+15
* | | | | | | | | | Merge pull request #4865 from ameerj/async-threadcountbunnei2020-11-011-8/+9
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | async_shaders: Increase Async worker thread count for 8+ thread cpusameerj2020-10-291-8/+9
* | | | | | | | | | Rename to align with switchbrew and remove gpu function (#4714)Levi Behunin2020-11-012-16/+10
* | | | | | | | | | Merge pull request #4853 from ReinUsesLisp/fcmp-immbunnei2020-10-312-1/+4
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | shader/arithmetic: Implement FCMP immediate + register variantReinUsesLisp2020-10-282-1/+4
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #4872 from jbeich/clangLC2020-10-301-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | video_core: unbreak -Werror in NVDEC with ClangJan Beich2020-10-301-1/+1
* | | | | | | | | CMakeLists: Resolve MSVC build failuresLioncash2020-10-301-1/+0
|/ / / / / / / /
* | | | | | | | Merge pull request #4868 from lioncash/discard-errorbunnei2020-10-303-6/+21
|\ \ \ \ \ \ \ \
| * | | | | | | | General: Catch more expressions with no effect on MSVCLioncash2020-10-301-0/+4
| * | | | | | | | General: Make ignoring a discarded return value an errorLioncash2020-10-303-6/+17
* | | | | | | | | common/stream: Be explicit with copy and move operatorsLioncash2020-10-301-3/+9
* | | | | | | | | vp9: Be explicit with copy and move operatorsLioncash2020-10-301-0/+18
* | | | | | | | | vp9: Mark functions with [[nodiscard]] where applicableLioncash2020-10-302-13/+13
* | | | | | | | | vp9: Provide a default initializer for "hidden" memberLioncash2020-10-301-1/+1
* | | | | | | | | vp9: Make some member functions internally linkedLioncash2020-10-302-58/+54
|/ / / / / / / /
* | | | | | | | Merge pull request #4837 from lioncash/nvdec-2bunnei2020-10-2913-88/+81
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | h264: Make WriteUe take a u32Lioncash2020-10-272-7/+8
| * | | | | | | vp9: std::move buffer within ComposeFrameHeader()Lioncash2020-10-271-1/+1
| * | | | | | | vp9: Remove dead codeLioncash2020-10-271-6/+0
| * | | | | | | vp9: Join declarations with assignmentsLioncash2020-10-271-7/+8
| * | | | | | | vp9: Remove pessimizing movesLioncash2020-10-271-2/+2
| * | | | | | | vp9: Resolve variable shadowingLioncash2020-10-271-4/+4
| * | | | | | | nvdec: Tidy up header includesLioncash2020-10-2713-62/+59
* | | | | | | | Merge pull request #4781 from german77/GChotplugbunnei2020-10-293-303/+433
|\ \ \ \ \ \ \ \
| * | | | | | | | Add hotplug, rumble and fix 3rd party adapters for the GC adaptergerman2020-10-293-303/+433
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | kernel/process: Add missing <ctime> includeMorph2020-10-291-0/+1
* | | | | | | | Merge pull request #4857 from liushuyu/masterLC2020-10-291-5/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | web_service: follow-up fix to #4842 ...liushuyu2020-10-291-5/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #4835 from lat9nq/rng-default-timebunnei2020-10-291-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel: Use the current time as the default RNG seedlat9nq2020-10-271-1/+1
* | | | | | | | | Merge pull request #4838 from lioncash/syncmgrbunnei2020-10-292-9/+9
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | sync_manager: Amend parameter order of calls to SyncptIncr constructorLioncash2020-10-272-9/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | web_service: web_backend: Handle socket errors with GenericRequest.bunnei2020-10-291-0/+11
* | | | | | | | video_core: cdma_pusher: Add missing LOG_DEBUG field in ExecuteCommand.bunnei2020-10-291-1/+1
* | | | | | | | Merge pull request #4846 from lioncash/service-fnbunnei2020-10-285-1/+7
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | service: Update function tablesLioncash2020-10-285-1/+7
| |/ / / / / /
* | | | | | | Merge pull request #4851 from ReinUsesLisp/core-threads-raceLC2020-10-281-5/+0
|\ \ \ \ \ \ \
| * | | | | | | hle/kernel: Remove unused registered_core_threads to fix data racesReinUsesLisp2020-10-271-5/+0
* | | | | | | | Merge pull request #4850 from ReinUsesLisp/fiber-ptr-refLC2020-10-282-3/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | common/fiber: Take shared_ptr<Fiber> by copy in YieldToReinUsesLisp2020-10-282-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #4849 from ReinUsesLisp/fix-fiber-testLC2020-10-281-31/+40
|\ \ \ \ \ \ \ \
| * | | | | | | | tests: Fix data race in fibers testReinUsesLisp2020-10-281-31/+40
| |/ / / / / / /
* | | | | | | | Merge pull request #4848 from ReinUsesLisp/type-limitsLC2020-10-282-1/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: Enforce -Werror=type-limitsReinUsesLisp2020-10-282-1/+2
* | | | | | | | | video_core: Enforce -Wredundant-move and -Wpessimizing-moveReinUsesLisp2020-10-284-4/+5
|/ / / / / / / /
* / / / / / / / web_backend: fix a regression introduced in 39c8d18liushuyu2020-10-272-20/+2
|/ / / / / / /
* / / / / / / yuzu: settings: Enable multicore, asynch GPU, and assembly shaders by default.bunnei2020-10-273-11/+11
|/ / / / / /
* | | | | | Merge pull request #4729 from ameerj/nvdec-prodbunnei2020-10-2750-310/+3909
|\ \ \ \ \ \
| * | | | | | video_core: NVDEC Implementationameerj2020-10-2750-310/+3909
| |/ / / / /
* | | | | | Merge pull request #4832 from bunnei/cpu-manager-microprofile-fixbunnei2020-10-271-0/+2
|\ \ \ \ \ \
| * | | | | | core: cpu_manager: Add missing call to MicroProfileOnThreadExit().bunnei2020-10-271-0/+2
| |/ / / / /
* | | | | | Merge pull request #4833 from bunnei/timezonemanager-explicitbunnei2020-10-271-1/+1
|\ \ \ \ \ \
| * | | | | | hle: services: TimeZoneContentManager: This can be made explicit.bunnei2020-10-271-1/+1
| |/ / / / /
* | | | | | Merge pull request #4834 from lioncash/copy-fnbunnei2020-10-274-7/+9
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | controller: Pass ControllerParameters by reference in ReconfigureControllers()Lioncash2020-10-274-7/+9
* | | | | | Merge pull request #4827 from lioncash/truncRodrigo Locatti2020-10-251-9/+9
|\ \ \ \ \ \
| * | | | | | controller: Convert led_patterns integer literals to bool literalsLioncash2020-10-251-9/+9
* | | | | | | Merge pull request #4828 from lioncash/lockguardRodrigo Locatti2020-10-252-2/+2
|\ \ \ \ \ \ \ | | |/ / / / / | |/| | | | |
| * | | | | | general: Use template deduction guides for lock_guardLioncash2020-10-252-2/+2
| |/ / / / /
* | | | | | applets/profile_select: Resolve a warning in exec()Morph2020-10-251-1/+1
* | | | | | Merge pull request #4817 from Kewlan/open-single-save-locationbunnei2020-10-243-16/+20
|\ \ \ \ \ \
| * | | | | | Don't ask for profile when there's only one.Kewlan2020-10-223-16/+20
* | | | | | | Merge pull request #4816 from Morph1984/controller-disconnect-fixLC2020-10-231-85/+84
|\ \ \ \ \ \ \
| * | | | | | | sdl_impl: Fix controller reconnection issuesMorph2020-10-211-85/+84
| |/ / / / / /
* | | | | | | Merge pull request #4706 from ReinUsesLisp/cmake-host-shadersbunnei2020-10-232-12/+7
|\ \ \ \ \ \ \
| * | | | | | | video_core: Fix instances where msbuild always regenerated host shadersReinUsesLisp2020-09-242-12/+7
* | | | | | | | Merge pull request #4792 from bunnei/rtc-fixbunnei2020-10-239-198/+341
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | service: time: Update current time with changes to RTC setting.bunnei2020-10-139-198/+341
* | | | | | | | core: Fix clang build pt.3Lioncash2020-10-224-16/+6
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #4811 from lioncash/warn-videobunnei2020-10-211-2/+4
|\ \ \ \ \ \ \
| * | | | | | | video_core: Conditially activate relevant compiler warningsLioncash2020-10-211-2/+4
* | | | | | | | core: Fix clang build pt.2Lioncash2020-10-212-4/+10
* | | | | | | | Revert "core: Fix clang build"bunnei2020-10-21104-904/+665
|/ / / / / / /
* | | | | | | kernel: Fix build with recent compiler flag changesLioncash2020-10-211-4/+8
* | | | | | | Merge pull request #4807 from ReinUsesLisp/glasm-robust-ssboLC2020-10-213-33/+54
|\ \ \ \ \ \ \
| * | | | | | | gl_arb_decompiler: Implement robust buffer operationsReinUsesLisp2020-10-203-33/+54
* | | | | | | | Merge pull request #4796 from lioncash/clangLC2020-10-21104-665/+904
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Fix clang buildLioncash2020-10-18104-665/+904
* | | | | | | | | Merge pull request #4390 from ogniK5377/get-applet-inf-stubbunnei2020-10-211-1/+11
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Added remaining paramsDavid Marcec2020-10-201-1/+4
| * | | | | | | | | nifm: GetAppletInfo stubDavid Marcec2020-10-201-1/+8
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #4809 from Morph1984/mjolnir-p3LC2020-10-203-25/+23
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | configure_input_player: Fix modifier buttonsMorph2020-10-203-25/+23
* | | | | | | | | | Merge pull request #4627 from Morph1984/fix-dinput-controller-disconnectbunnei2020-10-201-15/+13
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | sdl_impl: Erase the SDLJoystick entry after removing a controllerMorph2020-10-161-15/+13
* | | | | | | | | | Merge pull request #4788 from ReinUsesLisp/lockfree-host-threadbunnei2020-10-201-28/+38
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel: Implement host thread register methods without lockingReinUsesLisp2020-10-131-28/+38
* | | | | | | | | | Merge pull request #4785 from Morph1984/fs-hadesbunnei2020-10-201-2/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | filesystem: Fix CreateDirectory and DeleteFileMorph2020-10-131-2/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4204 from ReinUsesLisp/vulkan-1.0bunnei2020-10-197-58/+92
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vk_device: Use Vulkan 1.0 properlyReinUsesLisp2020-08-205-52/+66
| * | | | | | | | | | renderer_vulkan: Create a Vulkan 1.0 instance when 1.1 is not availableReinUsesLisp2020-08-203-6/+26
* | | | | | | | | | | Merge pull request #4802 from lioncash/bcatbunnei2020-10-191-7/+7
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core: Add boxcat sources with target_sourcesLioncash2020-10-181-7/+7
* | | | | | | | | | | | Merge pull request #4783 from bunnei/nvdrv-freespacebunnei2020-10-182-0/+25
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.bunnei2020-10-132-0/+25
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4801 from lioncash/missing-boundbunnei2020-10-181-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | mii/manager: Make use of unused lower bound in GetRandomValue()Lioncash2020-10-171-1/+1
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4782 from ReinUsesLisp/remove-dyn-primitivebunnei2020-10-186-26/+7
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | vk_graphics_pipeline: Manage primitive topology as fixed stateReinUsesLisp2020-10-136-26/+7
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4797 from bunnei/bcat-errorsbunnei2020-10-171-0/+10
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service: bcat: Check client connection before interacting with socket.bunnei2020-10-171-0/+10
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | udp/client: Make use of designated initializers in TestCommunication()Lioncash2020-10-161-2/+5
* | | | | | | | | | | udp/client: Take std::function by const reference with TestCommunication()Lioncash2020-10-162-5/+5
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #4790 from lioncash/input-commonbunnei2020-10-1619-203/+306
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | input_common/CMakeLists: Make some warnings errorsLioncash2020-10-1619-203/+306
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4784 from bunnei/cancelbufferbunnei2020-10-163-14/+53
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | hle: service: vi: Implement BufferQueue::CancelBuffer.bunnei2020-10-143-14/+53
| |/ / / / / / / / /
* | | | | | | | | | service: acc: Stub IManagerForApplication::StoreOpenContext.bunnei2020-10-151-1/+7
* | | | | | | | | | Merge pull request #4772 from goldenx86/block-rdnabunnei2020-10-151-0/+24
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | vk_device: Block VK_EXT_extended_dynamic_state for RDNA devicesgoldenx862020-10-091-0/+24
* | | | | | | | | | audio_core/CMakeLists: Make warnings consistent with coreLioncash2020-10-136-8/+17
* | | | | | | | | | core/CMakeLists: Make some warnings errorsLioncash2020-10-1330-146/+144
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #3929 from FearlessTobi/ticket-keysbunnei2020-10-132-32/+30
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | file_sys/nsp: Make SetTicketKeys actually do somethingFearlessTobi2020-07-182-32/+30
* | | | | | | | | Merge pull request #4766 from ReinUsesLisp/tmml-cubebunnei2020-10-121-19/+22
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shader/texture: Implement CUBE texture type for TMML and fix arraysReinUsesLisp2020-10-081-19/+22
* | | | | | | | | | Merge pull request #4775 from ReinUsesLisp/enforce-class-memaccessbunnei2020-10-102-7/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: Enforce -Wclass-memaccessReinUsesLisp2020-10-092-7/+7
* | | | | | | | | | | Merge pull request #4757 from german77/BetterMotionbunnei2020-10-102-8/+102
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Address commentsgerman2020-10-052-40/+40
| * | | | | | | | | | Add compatibility with only accelerometer and auto calibrate for driftgerman2020-10-042-12/+106
* | | | | | | | | | | Merge pull request #4771 from ReinUsesLisp/warn-unused-varLC2020-10-093-4/+7
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | video_core: Enforce -Wunused-variable and -Wunused-but-set-variableReinUsesLisp2020-10-033-4/+7
* | | | | | | | | | | Merge pull request #4677 from german77/ShakeFromButtonbunnei2020-10-089-5/+295
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Add random motion input to keyboardgerman2020-09-264-0/+65
| * | | | | | | | | | | Add random motion input to SDLgerman2020-09-265-5/+230
* | | | | | | | | | | | Merge pull request #4765 from ReinUsesLisp/fix-sort-devicesRodrigo Locatti2020-10-081-13/+35
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | renderer_vulkan/wrapper: Fix physical device sortingReinUsesLisp2020-10-071-13/+35
* | | | | | | | | | | | Merge pull request #4731 from lat9nq/mingw-zstd-fixbunnei2020-10-081-1/+6
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | CMakeLists: use system zstd on Linuxlat9nq2020-09-291-1/+6
| * | | | | | | | | | | | CMakeLists: fix for finding zstd on linux-mingwlat9nq2020-09-291-1/+1
* | | | | | | | | | | | | Merge pull request #4736 from Morph1984/home-button-input-protection-stubbunnei2020-10-074-2/+50
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | hid: Stub HomeButtonInputProtection service commandsMorph2020-09-304-2/+50
* | | | | | | | | | | | | Merge pull request #4710 from Morph1984/fix-integrated-updatesbunnei2020-10-071-3/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | submission_package: Fix updates integrated into cartridge images.Morph2020-09-241-3/+22
| | |_|_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4737 from Morph1984/setshimlibraryversion-stubbunnei2020-10-075-4/+38
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | caps_c: Stub SetShimLibraryVersionMorph2020-09-302-1/+18
| * | | | | | | | | | | | | caps_u: Stub SetShimLibraryVersionMorph2020-09-302-2/+14
| * | | | | | | | | | | | | caps_su: Properly stub SetShimLibraryVersionMorph2020-09-301-1/+6
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4727 from FrogTheFrog/patch-1bunnei2020-10-071-2/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Reduce the "shake" requirements when configuring UDP.Lukas Senionis2020-09-301-2/+6
* | | | | | | | | | | | | | Merge pull request #4742 from german77/InputFilterbunnei2020-10-061-49/+58
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | Only use inputs corresponding to controller typegerman2020-10-021-49/+58
| | |_|_|_|_|/ / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4734 from german77/motionfusionbunnei2020-10-022-1/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | Stubbed EnableSixAxisSensorFusiongerman2020-09-302-1/+15
* | | | | | | | | | | | | Merge pull request #4291 from german77/ImplementControllerRumbleDavid2020-09-305-14/+63
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | First implementation of controller rumblegerman2020-09-295-14/+63
| | |_|_|_|/ / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4726 from lioncash/appletDavid2020-09-304-6/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | core: Mark GetInstance() as deprecatedLioncash2020-09-261-1/+1
| * | | | | | | | | | | | frontend/controller: Eliminate dependency on the global system instanceLioncash2020-09-263-5/+14
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4733 from ReinUsesLisp/game-list-leakLC2020-09-302-3/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | qt/game_list: Give GameListSearchField::KeyReleaseEater a parentReinUsesLisp2020-09-292-3/+4
* | | | | | | | | | | | | Merge pull request #4732 from ReinUsesLisp/wall-clock-destrLC2020-09-303-2/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | common/wall_clock: Add virtual destructorsReinUsesLisp2020-09-303-2/+4
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4735 from goldenx86/patch-1LC2020-09-301-8/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Remove ext_extended_dynamic_state blacklistMatías Locatti2020-09-301-8/+0
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4705 from german77/SplitMotionPollerbunnei2020-09-305-76/+157
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | Use different timing for motiongerman2020-09-245-76/+157
* | | | | | | | | | | | | Merge pull request #4728 from Morph1984/applets-on-topbunnei2020-09-301-6/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | main: Allow applets to display on top while fullscreenMorph2020-09-261-6/+8
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4721 from lioncash/genfnbunnei2020-09-303-5/+7
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | command_generator: Make lookup table static constexprLioncash2020-09-261-2/+3
| * | | | | | | | | | | | codec: Make lookup table static constexprLioncash2020-09-252-3/+4
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4722 from lioncash/castingbunnei2020-09-301-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | cubeb_sink: Use static_cast instead of reinterpret_cast in DataCallback()Lioncash2020-09-251-2/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1703 from DarkLordZach/nvdec-ioctlbunnei2020-09-304-3/+256
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | service: nvhost_vic: Ignore Submit commands.bunnei2020-06-052-1/+18
| * | | | | | | | | | | nvdrv: Stub nvdec/vic ioctls to bypass nvdec moviesZach Hilman2020-06-054-3/+239
* | | | | | | | | | | | Merge pull request #4719 from lioncash/audio-warnbunnei2020-09-278-38/+46
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | audio_core: Resolve sign conversion warningsLioncash2020-09-258-25/+34
| * | | | | | | | | | | | effect_context: Make use of explicit where applicableLioncash2020-09-251-13/+12
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4724 from lat9nq/fix-vulkan-nvidia-allocate-2Rodrigo Locatti2020-09-271-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | vk_stream_buffer: Fix initializing Vulkan with NVIDIA on Linuxlat9nq2020-09-251-1/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #4703 from lioncash/desig7bunnei2020-09-272-26/+26
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | shader/registry: Silence a -Wshadow warningLioncash2020-09-232-5/+5
| * | | | | | | | | | | shader/registry: Remove unnecessary namespace qualifiersLioncash2020-09-231-5/+3
| * | | | | | | | | | | shader/registry: Make use of designated initializers where applicableLioncash2020-09-231-17/+19
* | | | | | | | | | | | Merge pull request #4718 from lioncash/vkbunnei2020-09-262-5/+9
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | vk_command_pool: Move definition of Pool into the cpp fileLioncash2020-09-252-4/+6
| * | | | | | | | | | | | vk_command_pool: Make use of override on destructorLioncash2020-09-251-1/+1
| * | | | | | | | | | | | vk_command_pool: Add missing header guardLioncash2020-09-251-0/+2
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4720 from lioncash/headerbunnei2020-09-265-7/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | audio_core: Remove unnecessary inclusionsLioncash2020-09-255-7/+2
| |/ / / / / / / / / / /
* / / / / / / / / / / / behavior_info: Fix typo Renerer -> RendererLioncash2020-09-252-6/+6
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #4717 from lioncash/debugLC2020-09-251-0/+17
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service: Restore "unused" functionLioncash2020-09-251-0/+17
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4711 from lioncash/move5bunnei2020-09-251-16/+19
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | arithmetic_integer_immediate: Make use of std::move where applicableLioncash2020-09-241-16/+19
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4678 from Morph1984/LoadOpenContext-partial-implbunnei2020-09-243-1/+13
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | acc: Stub LoadOpenContextMorph2020-09-213-1/+13
* | | | | | | | | | | Merge pull request #4674 from ReinUsesLisp/timeline-semaphoresbunnei2020-09-2442-814/+647
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | vk_query_cache: Hack counter destructor to avoid reserving queriesReinUsesLisp2020-09-191-1/+10
| * | | | | | | | | | renderer_vulkan: Make unconditional use of VK_KHR_timeline_semaphoreReinUsesLisp2020-09-1942-814/+638
* | | | | | | | | | | Merge pull request #4618 from german77/GcAdapterAutoMapbunnei2020-09-243-1/+103
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Add automap feature for GC adaptergerman2020-09-183-1/+103
* | | | | | | | | | | Merge pull request #4702 from lioncash/doc-warnRodrigo Locatti2020-09-231-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | memory: Resolve a -Wdocumentation warningLioncash2020-09-231-1/+1
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4701 from lioncash/unused-protoRodrigo Locatti2020-09-231-3/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | install_dialog: Make use of [[nodiscard]] where applicableLioncash2020-09-231-2/+2
| * | | | | | | | | | | install_dialog: Remove unused function prototypeLioncash2020-09-231-1/+0
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4700 from lioncash/copiesRodrigo Locatti2020-09-233-52/+67
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | game_list: Make game list function naming consistentLioncash2020-09-233-36/+45
| * | | | | | | | | | | game_list: Eliminate redundant argument copiesLioncash2020-09-232-16/+22
| |/ / / / / / / / / /
* | | | | | | | | | | control_flow: emplace elements in place within TryQuery()Lioncash2020-09-231-6/+6
* | | | | | | | | | | control_flow: Make use of std::move in InsertBranch()Lioncash2020-09-231-7/+8
|/ / / / / / / / / /
* | | | | | | | | | General: Make use of std::nullopt where applicableLioncash2020-09-2217-59/+60
* | | | | | | | | | ips_layer: Eliminate a redundant copy in Parse()Lioncash2020-09-221-2/+4
* | | | | | | | | | Merge pull request #4675 from Morph1984/fix-boot-multicontentbunnei2020-09-221-5/+5
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | submission_package: Account for multi-content NSPsMorph2020-09-181-5/+5
* | | | | | | | | | Merge pull request #4692 from ReinUsesLisp/remove-vsyncRodrigo Locatti2020-09-2113-360/+35
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | renderer_opengl: Remove emulated mailbox presentationReinUsesLisp2020-09-2013-360/+35
* | | | | | | | | | | Merge pull request #4683 from Morph1984/NpadHandheldActivationMode-implbunnei2020-09-203-5/+28
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | hid: Implement Get/SetNpadHandheldActivationModeMorph2020-09-183-5/+28
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4643 from FearlessTobi/decrease-pad-update-intervalbunnei2020-09-191-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Test: Decrease pad_update_nsFearlessTobi2020-09-101-1/+1
* | | | | | | | | | fermi_2d: Make use of designated initializersLioncash2020-09-182-8/+8
* | | | | | | | | | configure_input_player: Fixes motion mapping using ConfigureButtonClickMorph2020-09-181-5/+8
* | | | | | | | | | Merge pull request #4647 from Morph1984/readd-context-menubunnei2020-09-182-31/+66
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | configure_input_player: Re-add "Clear" context menu optionMorph2020-09-182-31/+66
* | | | | | | | | | | am: Stub GetPreviousProgramIndexMorph2020-09-182-1/+11
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #4670 from lioncash/initializerRodrigo Locatti2020-09-171-2/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | arm_dynarmic_cp15: Initialize member variablesLioncash2020-09-171-2/+2
* | | | | | | | | | | Merge pull request #4665 from lioncash/sm-kernelRodrigo Locatti2020-09-173-9/+11
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service/sm: Slightly more efficient string name validationLioncash2020-09-171-2/+2
| * | | | | | | | | | | service/sm: Eliminate dependency on the global system instanceLioncash2020-09-173-7/+9
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4666 from lioncash/unused-funcRodrigo Locatti2020-09-171-22/+0
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service: Remove unused funcationLioncash2020-09-171-22/+0
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4671 from lioncash/nfp-copyRodrigo Locatti2020-09-172-21/+25
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | audio_core/command_generator: Use const references where applicableLioncash2020-09-171-10/+11
| * | | | | | | | | | | audio_core/command_generator: Avoid an unnecessary copy in GenerateFinalMixCommand()Lioncash2020-09-171-1/+1
| * | | | | | | | | | | nfp: Eliminate two unnecessary copiesLioncash2020-09-171-10/+13
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4672 from lioncash/narrowingRodrigo Locatti2020-09-171-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | decoder/texture: Eliminate narrowing conversion in GetTldCode()Lioncash2020-09-171-1/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4673 from lioncash/fallthroughRodrigo Locatti2020-09-171-0/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | decode/image: Eliminate switch fallthrough in DecodeImage()Lioncash2020-09-171-0/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4594 from german77/MotionHIDbunnei2020-09-1723-159/+943
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | configure_input: Hook up the motion button and checkboxMorph2020-09-057-7/+19
| * | | | | | | | | | | Minor cleanupgerman2020-09-051-19/+16
| * | | | | | | | | | | Add cemu hook changes related to PR #4609german2020-09-058-139/+449
| * | | | | | | | | | | Remove RealMotionDevicegerman2020-09-057-35/+41
| * | | | | | | | | | | configure_input_player: Show/hide motion buttons based on the controllerMorph2020-09-053-103/+141
| * | | | | | | | | | | controllers/npad: Simplify motion entry assignmentMorph2020-09-051-29/+18
| * | | | | | | | | | | Include HID and configuration changes related to motiongerman2020-09-0513-16/+448
* | | | | | | | | | | | control_metadata: Resolve typo in Portuguese language nameLioncash2020-09-171-1/+1
| |/ / / / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #4653 from ReinUsesLisp/gc-warnsbunnei2020-09-171-0/+9
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | gc_adapter: Disable MSVC nonstandard extension warning on libusb.hReinUsesLisp2020-09-151-0/+9
* | | | | | | | | | | Merge pull request #4663 from ReinUsesLisp/wswitchbunnei2020-09-177-10/+59
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core: Enforce -Werror=switchReinUsesLisp2020-09-167-10/+59
* | | | | | | | | | | | file_sys/romfs_factory: Eliminate usage of the global system accessorLioncash2020-09-175-34/+49
* | | | | | | | | | | | file_sys/bis_factory: Eliminate usage of the global system accessorLioncash2020-09-175-11/+11
* | | | | | | | | | | | loader/nso: Remove unnecessary [[maybe_unused]]Lioncash2020-09-171-2/+1
|/ / / / / / / / / / /
* | | | | | | | | | | core/loader: Remove dependencies on the global system instanceLioncash2020-09-1620-45/+85
* | | | | | | | | | | Merge pull request #4658 from lioncash/copy3Rodrigo Locatti2020-09-162-44/+43
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | nca_patch: Significantly reduce the stack usage size within SearchBucketEntry()Lioncash2020-09-151-4/+4
| * | | | | | | | | | | nca_patch: Make SearchBucketEntry() internally linkedLioncash2020-09-152-44/+43
* | | | | | | | | | | | cheat_engine: Convert ExtractName into a non-template functionLioncash2020-09-151-19/+17
* | | | | | | | | | | | cheat_engine: Remove unnecessary system argument to CheatParser's Parse functionLioncash2020-09-153-15/+9
|/ / / / / / / / / / /
* | | | | | | | | | | patch_manager: Resolve implicit truncations in FormatTitleVersion()Lioncash2020-09-151-3/+4
* | | | | | | | | | | patch_manager: Make use of type aliasesLioncash2020-09-152-69/+79
* | | | | | | | | | | patch_manager: Make a few functions internally linkedLioncash2020-09-152-15/+12
|/ / / / / / / / / /
* | | | | | | | | | crypto/key_manager: Remove dependency on the global system accessorLioncash2020-09-143-7/+12
* | | | | | | | | | kernel: Remove all dependencies on the global system instanceLioncash2020-09-145-11/+20
* | | | | | | | | | Merge pull request #4636 from lioncash/kernel-hlebunnei2020-09-143-7/+5
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | service: Remove two usages of the global system accessorLioncash2020-09-073-7/+5
* | | | | | | | | | Merge pull request #4323 from ReinUsesLisp/no-spinbunnei2020-09-121-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/scheduler: Use std::mutex instead of spin lockReinUsesLisp2020-07-131-1/+1
* | | | | | | | | | | Merge pull request #4634 from lioncash/blockingbunnei2020-09-123-19/+19
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | bsd: Resolve unused value within SendToImplLioncash2020-09-071-0/+1
| * | | | | | | | | | | bsd: Resolve sign comparison warningsLioncash2020-09-071-3/+3
| * | | | | | | | | | | sockets_translate: Make use of designated initializersLioncash2020-09-071-12/+12
| * | | | | | | | | | | blocking_worker: Make use of templated lambdaLioncash2020-09-071-3/+2
| * | | | | | | | | | | blocking_worker: Resolve -Wdocumentation warningLioncash2020-09-071-1/+1
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4310 from ogniK5377/apollo-1-prodbunnei2020-09-1127-719/+5048
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Preliminary effectsDavid Marcec2020-08-1610-35/+731
| * | | | | | | | | | | Disable biquad filterDavid Marcec2020-08-141-8/+9
| * | | | | | | | | | | Reworked ADPCM decoder to allow better streamingDavid Marcec2020-08-142-33/+95
| * | | | | | | | | | | mix buffer depoppingDavid Marcec2020-08-012-30/+101
| * | | | | | | | | | | adpcm streamingDavid Marcec2020-07-304-27/+32
| * | | | | | | | | | | Fix perf regressionDavid Marcec2020-07-251-1/+2
| * | | | | | | | | | | Fix stream channel count when outputting to stereoDavid Marcec2020-07-251-1/+1
| * | | | | | | | | | | Address issuesDavid Marcec2020-07-258-101/+104
| * | | | | | | | | | | Queue extra mix bufferDavid Marcec2020-07-251-0/+1
| * | | | | | | | | | | Disable time stretcher for time beingDavid Marcec2020-07-252-6/+4
| * | | | | | | | | | | audio_core: Apollo Part 1, AudioRenderer refactorDavid Marcec2020-07-2526-713/+4204
* | | | | | | | | | | | Merge pull request #4597 from Morph1984/mjolnir-p2bunnei2020-09-1120-148/+4150
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | applets/controller: Resolve several compiler warningsMorph2020-09-042-7/+8
| * | | | | | | | | | | | Address feedbackMorph2020-09-044-2/+12
| * | | | | | | | | | | | clang-formatMorph2020-09-042-2/+4
| * | | | | | | | | | | | applets/controller: Set min_players to have a minimum value of 1.Morph2020-09-041-1/+1
| * | | | | | | | | | | | applets/controller: Modify heuristic to account for certain gamesMorph2020-09-041-7/+12
| * | | | | | | | | | | | main: Apply settings after applet configuration is complete.Morph2020-09-041-0/+4
| * | | | | | | | | | | | applets/controller: Implement fallback applet for the SDL frontendMorph2020-09-043-90/+34
| * | | | | | | | | | | | applets/controller: Load configuration prior to setting up connectionsMorph2020-09-042-23/+29
| * | | | | | | | | | | | applets/controller: Make 8 a static constexpr value of NUM_PLAYERSMorph2020-09-042-15/+22
| * | | | | | | | | | | | applets/controller: Implement "Explain Text"Morph2020-09-046-25/+304
| * | | | | | | | | | | | Project Mjölnir: Part 2 - Controller AppletMorph2020-09-0420-59/+3803
* | | | | | | | | | | | | Merge pull request #4608 from lioncash/sign3bunnei2020-09-101-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | configure_input_player: Resolve sign conversion warnings in UpdateMappingWithDefaults()Lioncash2020-08-291-2/+2
* | | | | | | | | | | | | Merge pull request #4633 from ReinUsesLisp/gpu-initRodrigo Locatti2020-09-1053-633/+573
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | video_core: Remove all Core::System references in rendererReinUsesLisp2020-09-0653-633/+573
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | gc_adapter: Make DeviceConnected() a const member functionLioncash2020-09-073-9/+9
| |_|_|/ / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4606 from lioncash/constexprbunnei2020-09-071-14/+18
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | game_list_p: Avoid string churn in GameListItemPath data()Lioncash2020-08-291-4/+8
| * | | | | | | | | | | | game_list_p: Mark some constants as constexprLioncash2020-08-291-10/+10
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4397 from ReinUsesLisp/bsdbunnei2020-09-0610-56/+1387
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | service/bsd: Handle Poll with no entries accuratelyReinUsesLisp2020-07-281-0/+5
| * | | | | | | | | | | services/bsd: Implement most of bsd:sReinUsesLisp2020-07-285-55/+911
| * | | | | | | | | | | service/sockets: Add worker pool abstractionReinUsesLisp2020-07-281-0/+30
| * | | | | | | | | | | service/sockets: Add worker abstraction to execute blocking calls asynchronouslyReinUsesLisp2020-07-282-0/+133
| * | | | | | | | | | | service/sockets: Add translate functionsReinUsesLisp2020-07-283-0/+215
| * | | | | | | | | | | service/sockets: Add enumerations and structuresReinUsesLisp2020-07-282-0/+81
| * | | | | | | | | | | services/nifm: Implement GetCurrentIpAddressReinUsesLisp2020-07-281-1/+12
* | | | | | | | | | | | hid: Implement MergeSingleJoyasDualJoyMorph2020-09-043-5/+24
| |_|/ / / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #4611 from lioncash/xbyak2bunnei2020-09-042-21/+21
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | externals: Update Xbyak to 5.96Lioncash2020-08-302-21/+21
* | | | | | | | | | | | Merge pull request #4583 from lioncash/truncbunnei2020-09-041-3/+5
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gc_poller: Resolve compilation warnings on MSVCLioncash2020-08-261-3/+5
* | | | | | | | | | | | | Merge pull request #4578 from lioncash/xorbunnei2020-09-031-4/+10
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | common_funcs: Add missing XOR operators to DECLARE_ENUM_FLAG_OPERATORSLioncash2020-08-241-4/+10
* | | | | | | | | | | | | | Merge pull request #4590 from ReinUsesLisp/tsan-schedbunnei2020-09-031-2/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | hle/scheduler: Fix data race in is_context_switch_pendingReinUsesLisp2020-08-261-2/+6
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4575 from lioncash/asyncbunnei2020-09-032-17/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | async_shaders: Mark getters as const member functionsLioncash2020-08-242-17/+15
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | file_sys/patch_manager: Add missing includeReinUsesLisp2020-09-031-0/+1
* | | | | | | | | | | | | | Merge pull request #4568 from lioncash/fspbunnei2020-09-031-3/+13
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | fsp_srv: Resolve -Wunused-but-set-variable warningLioncash2020-08-231-1/+8
| * | | | | | | | | | | | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()Lioncash2020-08-231-2/+5
| | |_|_|_|_|_|_|_|_|/ / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4564 from lioncash/file-includebunnei2020-09-0327-37/+66
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | file_sys: Replace inclusions with forward declarations where applicableLioncash2020-08-2327-37/+66
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | main: Use three dots to complete the ellipsislat9nq2020-09-021-1/+1
* | | | | | | | | | | | | | input_common/motion_input: Make use of Common::PI constantMorph2020-09-023-5/+10
* | | | | | | | | | | | | | Merge pull request #4570 from german77/motionInputbunnei2020-09-024-0/+276
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | Fix orientation errors and improve drift correctiongerman2020-08-282-14/+31
| * | | | | | | | | | | | | | Address commentsgerman2020-08-282-85/+65
| * | | | | | | | | | | | | | Implement a basic class for motion devicesgerman2020-08-284-0/+279
* | | | | | | | | | | | | | | Merge pull request #4382 from FearlessTobi/port-udp-configbunnei2020-09-0122-13/+1959
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | Address second batch of reviewsFearlessTobi2020-08-309-30/+27
| * | | | | | | | | | | | | | | Reolve reorder warningFearlessTobi2020-08-292-3/+3
| * | | | | | | | | | | | | | | Address review comments and fix code compilationFearlessTobi2020-08-2913-155/+218
| * | | | | | | | | | | | | | | yuzu: Add motion and touch configurationFearlessTobi2020-08-2918-3/+1889
| | |_|_|_|_|_|_|_|_|_|_|_|_|/ | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #4588 from ReinUsesLisp/tsan-eventbunnei2020-09-011-4/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | common/thread: Fix data race in is_setReinUsesLisp2020-08-261-4/+5
| | |_|_|_|/ / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #4589 from ReinUsesLisp/tsan-hostbunnei2020-09-011-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | hle/kernel: Fix data race in GetCurrentHostThreadIDReinUsesLisp2020-08-261-1/+2
| |/ / / / / / / / / / / / / /
* | | | | | | | | | | | | | | Merge pull request #4461 from comex/thread-namesLC2020-08-312-1/+13
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | Fix thread naming on Linux, which limits names to 15 bytes.comex2020-08-062-1/+13
* | | | | | | | | | | | | | | | vk_device: Fix driver id check on AMD for VK_EXT_extended_dynamic_stateReinUsesLisp2020-08-311-6/+9
| |_|_|_|_|_|/ / / / / / / / / |/| | | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #4601 from lioncash/const3bunnei2020-08-301-52/+62
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | sdl_impl: Reduce allocations in GetButtonMappingForDevice()Lioncash2020-08-291-31/+37
| * | | | | | | | | | | | | | | sdl_impl: Make use of std::move on std::string where applicableLioncash2020-08-291-3/+3
| * | | | | | | | | | | | | | | sdl_impl: Make use of insert_or_assign() where applicableLioncash2020-08-291-14/+18
| * | | | | | | | | | | | | | | sdl_impl: Prevent type truncation in BuildAnalogParamPackageForButton() default argumentsLioncash2020-08-291-1/+1
| * | | | | | | | | | | | | | | sdl_impl: Simplify make_tuple callLioncash2020-08-291-1/+1
| * | | | | | | | | | | | | | | sdl_impl: Mark FromEvent() as a const member functionLioncash2020-08-291-2/+2
| | |_|_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #4605 from lioncash/copy3bunnei2020-08-301-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | bootmanager: Prevent unnecessary copies in TouchUpdateEvent()Lioncash2020-08-291-1/+1
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #4604 from lioncash/lifetimeLC2020-08-294-7/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | yuzu/main: Amend lifetime issues with InputSubsystemLioncash2020-08-294-7/+8
| |/ / / / / / / / / / / / /
* / / / / / / / / / / / / / yuzu/configuration: Fix index out of bounds for default_analogsMorph2020-08-293-12/+13
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4600 from lioncash/prototypeLC2020-08-293-8/+11
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | input_common/main: Remove unnecessary headersLioncash2020-08-293-5/+11
| * | | | | | | | | | | | | input_common/main: Remove unimplemented prototypeLioncash2020-08-291-3/+0
* | | | | | | | | | | | | | vk_device: Blacklist AMD proprietary from VK_EXT_extended_dynamic_stateReinUsesLisp2020-08-291-1/+6
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4544 from lioncash/input-subbunnei2020-08-2825-242/+396
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | input_common: Eliminate most global stateLioncash2020-08-2725-242/+396
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4586 from yuzu-emu/tsan-cpu-interruptbunnei2020-08-282-5/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | cpu_interrupt_handler: Misc style changesReinUsesLisp2020-08-262-5/+3
| * | | | | | | | | | | | cpu_interrupt_handler: Make is_interrupted an atomicReinUsesLisp2020-08-262-2/+3
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4530 from Morph1984/mjolnir-p1bunnei2020-08-2744-3191/+8385
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | input_common/main: Add "/Mouse" to the display nameMorph2020-08-271-1/+1
| * | | | | | | | | | | | configure_input_player: Fix modifier scale button mappingMorph2020-08-262-20/+19
| * | | | | | | | | | | | configuration/input: Add support for mouse button clicksMorph2020-08-265-11/+82
| * | | | | | | | | | | | controllers/npad: Fix inconsistencies with controller connection statusesMorph2020-08-261-1/+7
| * | | | | | | | | | | | controllers/npad: Fix LibNX controller connection statusesMorph2020-08-261-1/+9
| * | | | | | | | | | | | controllers/npad: Fix LedPattern for P1-4Morph2020-08-261-3/+3
| * | | | | | | | | | | | input_common: Fix directional deadzone valuesMorph2020-08-262-2/+2
| * | | | | | | | | | | | Address feedbackMorph2020-08-2613-96/+77
| * | | | | | | | | | | | Project Mjölnir: Part 1Morph2020-08-2643-3177/+8306
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #4577 from lioncash/assertsbunnei2020-08-271-3/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | common/assert: Make use of C++ attribute syntaxLioncash2020-08-241-3/+4
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4524 from lioncash/memory-logbunnei2020-08-271-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | shader/memory: Amend UNIMPLEMENTED_IF_MSG without a messageLioncash2020-08-141-1/+2
* | | | | | | | | | | | | Merge pull request #4569 from ReinUsesLisp/glsl-cmakebunnei2020-08-2712-51/+127
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | video_core/host_shaders: Add CMake integration for string shadersReinUsesLisp2020-08-247-42/+106
| * | | | | | | | | | | | | gl_shader_util: Use std::string_view instead of star pointerReinUsesLisp2020-08-245-9/+21
* | | | | | | | | | | | | | Merge pull request #4555 from ReinUsesLisp/fix-primitive-topologybunnei2020-08-273-13/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | vk_state_tracker: Fix primitive topologyReinUsesLisp2020-08-213-13/+14
| | |_|_|_|_|/ / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | memory_manager: Make use of [[nodiscard]] in the interfaceLioncash2020-08-271-17/+17
* | | | | | | | | | | | | | memory_manager: Make operator+ const qualifiedLioncash2020-08-271-1/+1
| |_|_|_|/ / / / / / / / / |/| | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4574 from lioncash/const-fnbunnei2020-08-252-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | memory_manager: Mark IsGranularRange() as a const member functionLioncash2020-08-242-3/+3
* | | | | | | | | | | | | | Merge pull request #4563 from lioncash/rcachebunnei2020-08-251-17/+16
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | registered_cache: Make use of ends_with for string suffix checkingLioncash2020-08-231-2/+1
| * | | | | | | | | | | | | | registered_cache: Make use of designated initializersLioncash2020-08-231-15/+15
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4548 from lioncash/colorbunnei2020-08-251-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | common/color: Migrate code over to the Common namespaceLioncash2020-08-181-2/+2
* | | | | | | | | | | | | | Merge pull request #4542 from ReinUsesLisp/gpu-init-basebunnei2020-08-2522-119/+172
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | video_core: Initialize renderer with a GPUReinUsesLisp2020-08-2222-119/+172
* | | | | | | | | | | | | | | Merge pull request #4562 from lioncash/loopbunnei2020-08-241-16/+13
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | cpu_manager: Make use of ranged for where applicableLioncash2020-08-231-16/+13
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | gl_texture_cache: Take std::string by reference in DecorateViewName()Lioncash2020-08-242-2/+2
| |_|_|/ / / / / / / / / / |/| | | | | | | | | | | |
* | | | | | | | | | | | | video_core/fence_manager: Remove unnecessary includesLioncash2020-08-243-9/+4
* | | | | | | | | | | | | Merge pull request #4561 from lioncash/key-constexprbunnei2020-08-242-75/+82
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | key_manager: Make data arrays constexprLioncash2020-08-232-75/+82
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4549 from lioncash/filesbunnei2020-08-241-32/+48
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | vfs_real: Resolve sign conversion warningsLioncash2020-08-181-2/+2
| * | | | | | | | | | | | vfs_real: Avoid redundant map lookupsLioncash2020-08-181-30/+46
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4559 from lioncash/webresultbunnei2020-08-237-47/+41
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | web_service: Move web_result.h into web_serviceLioncash2020-08-237-47/+41
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4560 from lioncash/convertbunnei2020-08-233-8/+6
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | core_timing: Remove unused headerLioncash2020-08-233-2/+2
| * | | | | | | | | | | | core_timing: Move clock initializer into constructor initializer listLioncash2020-08-231-4/+2
| * | | | | | | | | | | | core_timing: Resolve sign conversion warningLioncash2020-08-231-2/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #4521 from lioncash/optionalcachebunnei2020-08-221-11/+12
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_shader_disk_cache: Make use of std::nullopt where applicableLioncash2020-08-141-11/+12
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4541 from MerryMage/yolobunnei2020-08-227-4/+108
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | dynarmic: Add unsafe optimizationsMerryMage2020-08-167-4/+108
* | | | | | | | | | | | | Merge pull request #4523 from lioncash/self-assignbunnei2020-08-221-1/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | macro-interpreter: Resolve -Wself-assign-field warningLioncash2020-08-141-1/+0
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4546 from lioncash/telemetrybunnei2020-08-2013-35/+43
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | common/telemetry: Migrate namespace into the Common namespaceLioncash2020-08-1813-35/+43
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4547 from lioncash/header-conceptbunnei2020-08-201-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | common/concepts: Move <type_traits> include out of the Common namespaceLioncash2020-08-181-2/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | Revert "common/time_zone: Simplify GetOsTimeZoneOffset()"bunnei2020-08-201-5/+9
* | | | | | | | | | | | Merge pull request #4539 from lioncash/discbunnei2020-08-192-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | common: Silence two discarded result warningsLioncash2020-08-162-3/+3
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4522 from lioncash/vulk-copybunnei2020-08-191-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | vulkan/wrapper: Avoid unnecessary copy in EnumerateInstanceExtensionProperties()Lioncash2020-08-141-1/+1
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4381 from Morph1984/fix-open-folder-installed-titlebunnei2020-08-184-13/+24
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | main: Fallback to loader if no control nca is found with patch managerMorph2020-08-051-6/+17
| * | | | | | | | | | | main: Fix Open Save/Mod Locations for installed titlesMorph2020-08-054-12/+12
* | | | | | | | | | | | Merge pull request #4532 from lioncash/object-namebunnei2020-08-187-90/+74
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | configuration_shared: Simplify name lookup in highlighting functionsLioncash2020-08-147-90/+74
* | | | | | | | | | | | | Merge pull request #4535 from lioncash/fileutilbunnei2020-08-1840-547/+639
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | common/fileutil: Convert namespace to Common::FSLioncash2020-08-1640-547/+639
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4537 from lioncash/tzbunnei2020-08-171-9/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | common/time_zone: Simplify GetOsTimeZoneOffset()Lioncash2020-08-161-9/+5
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4540 from lioncash/tr3bunnei2020-08-171-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | configure_hotkeys: Don't translate empty stringsLioncash2020-08-161-2/+2
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4494 from lioncash/transcodebunnei2020-08-172-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | partition_data_manager: Eliminate magic valueLioncash2020-08-061-2/+2
| * | | | | | | | | | | | | aes_util: Make use of non-template variant of TranscodeLioncash2020-08-061-1/+1
| | |_|_|_|_|/ / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4531 from lioncash/overloadRodrigo Locatti2020-08-171-2/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | yuzu: Make use of qOverload where applicableLioncash2020-08-141-2/+1
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4443 from ameerj/vk-async-shadersDavid2020-08-1715-88/+210
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Remove unneeded newlines, optional Registry in shader paramsameerj2020-08-165-14/+9
| * | | | | | | | | | | | | Morph: Update worker allocation commentAmeer J2020-08-161-1/+1
| * | | | | | | | | | | | | move thread 1/4 count computation into allocate workers methodameerj2020-08-164-23/+14
| * | | | | | | | | | | | | Address feedback, add shader compile notifier, update setting textameerj2020-08-169-162/+117
| * | | | | | | | | | | | | Vk Async Worker directly emplace in cacheameerj2020-08-163-58/+41
| * | | | | | | | | | | | | Address feedback. Bruteforce delete duplicatesameerj2020-08-167-80/+116
| * | | | | | | | | | | | | Vk Async pipeline compilationameerj2020-08-1613-20/+182
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4515 from lat9nq/pgs-menubar-configbunnei2020-08-173-20/+46
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | main: Add an option to modify the currrent game's configurationlat9nq2020-08-163-20/+46
* | | | | | | | | | | | | | Merge pull request #4520 from lioncash/pessimizeDavid2020-08-171-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | async_shaders: Resolve -Wpessimizing-move warningLioncash2020-08-141-2/+2
| | |_|_|_|_|/ / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | yuzu: Resolve -Wextra-semi warningsLioncash2020-08-163-6/+6
| |_|/ / / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4528 from lioncash/discardbunnei2020-08-1637-391/+383
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | common/compression: Roll back std::span changesLioncash2020-08-155-38/+45
| * | | | | | | | | | | | common: Make use of [[nodiscard]] where applicableLioncash2020-08-1534-358/+343
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4519 from lioncash/semibunnei2020-08-161-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | maxwell_3d: Resolve -Wextra-semi warningLioncash2020-08-141-1/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4526 from lioncash/core-semibunnei2020-08-153-7/+12
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core: Resolve several -Wextra-semi warningsLioncash2020-08-143-7/+12
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4527 from lioncash/pessimizing2bunnei2020-08-151-2/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | software_keyboard: Resolve a pessimizing move warningLioncash2020-08-141-2/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4492 from lioncash/linkagebunnei2020-08-152-15/+11
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | system_control: Make functions internally linked where applicableLioncash2020-08-052-15/+11
* | | | | | | | | | | | Merge pull request #4463 from lioncash/lockdiscardbunnei2020-08-152-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | emu_window: Mark Scoped constructor and Acquire() as nodiscardLioncash2020-08-141-2/+2
| * | | | | | | | | | | | kernel/scheduler: Mark SchedulerLock constructor as nodiscardLioncash2020-08-141-1/+1
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4416 from lioncash/spanbunnei2020-08-155-30/+24
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | lz4_compression: Make use of std::span in interfacesLioncash2020-07-252-17/+14
| * | | | | | | | | | | | zstd_compression: Make use of std::span in interfacesLioncash2020-07-253-13/+10
* | | | | | | | | | | | | Merge pull request #4453 from ReinUsesLisp/block-to-linearbunnei2020-08-153-34/+34
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | textures/decoders: Fix block linear to pitch copiesReinUsesLisp2020-08-113-34/+34
* | | | | | | | | | | | | time_zone_content_manager: Collapse auto and default caseLioncash2020-08-141-3/+1
| |_|/ / / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4495 from lioncash/convRodrigo Locatti2020-08-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | cheat_engine: Resolve implicit bool->u64 conversionLioncash2020-08-061-1/+1
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4514 from Morph1984/worker-allocbunnei2020-08-131-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_shader_cache: Use std::max() for determining num_workersMorph2020-08-121-1/+1
* | | | | | | | | | | | | Merge pull request #4511 from lioncash/build2LC2020-08-1317-117/+129
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | General: Tidy up clang-format warnings part 2Lioncash2020-08-1317-117/+129
* | | | | | | | | | | | | Merge pull request #4497 from lioncash/freezer-algbunnei2020-08-122-16/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | freezer: Move entry finding to its own functionLioncash2020-08-062-12/+21
| * | | | | | | | | | | | | freezer: Take address values by valueLioncash2020-08-061-3/+3
| * | | | | | | | | | | | | freezer: Make use of std::erase_ifLioncash2020-08-061-4/+1
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4493 from jbeich/dragonflybunnei2020-08-111-9/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | common/virtual_buffer: drop unused includesJan Beich2020-08-051-9/+0
* | | | | | | | | | | | | Merge pull request #4502 from lioncash/buildbunnei2020-08-111-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | General: Tidy up clang-format warningsLioncash2020-08-091-1/+1
* | | | | | | | | | | | | Merge pull request #4496 from lioncash/ce-desigbunnei2020-08-101-6/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | cheat_engine: Make use of designated initializersLioncash2020-08-061-6/+18
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Remove UI changesameerj2020-08-105-86/+5
* | | | | | | | | | | | | Add range slider functionality for gc adapterameerj2020-08-101-7/+7
* | | | | | | | | | | | | undo unnecessary newlines, slider range 50-150Ameer2020-08-103-6/+5
* | | | | | | | | | | | | Address c++20 warning, fix inaccurate range text display when slide == 0Ameer2020-08-101-2/+2
* | | | | | | | | | | | | Add range slider for analog sticksAmeer2020-08-104-14/+99
* | | | | | | | | | | | | Merge pull request #4491 from lioncash/unused-varsbunnei2020-08-102-18/+11
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel: Remove unused variablesLioncash2020-08-052-18/+11
| | |_|_|_|/ / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4488 from lioncash/filebunnei2020-08-094-41/+41
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | vfs_vector: Make creation of array vfs files less verboseLioncash2020-08-054-41/+41
| | |_|_|_|_|/ / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4448 from Morph1984/fix-entriesbunnei2020-08-071-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | game_list_worker: Do not clear entries when > 1 gamedir is presentMorph2020-08-051-1/+1
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4457 from ogniK5377/SetScreenShotPermissionbunnei2020-08-072-1/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | am: Unstub SetScreenShotPermissionDavid Marcec2020-07-312-1/+12
* | | | | | | | | | | | | | Merge pull request #4389 from ogniK5377/redundant-format-typebunnei2020-08-071-1/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | video_core: Remove redundant pixel format typeDavid Marcec2020-07-211-1/+0
* | | | | | | | | | | | | | common/concepts: Rename IsBaseOf to DerivedFromLioncash2020-08-073-6/+8
* | | | | | | | | | | | | | Merge pull request #4483 from lioncash/constexpr-hexbunnei2020-08-074-138/+141
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | partition_data_manager: Update master key hashesLioncash2020-08-061-5/+5
| * | | | | | | | | | | | | | partition_data_manager: Make data arrays constexprLioncash2020-08-064-138/+141
* | | | | | | | | | | | | | | Merge pull request #4490 from lioncash/arbiterbunnei2020-08-072-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | scheduler: Resolve sign conversion warningLioncash2020-08-051-1/+2
| * | | | | | | | | | | | | | address_arbiter: Resolve sign conversion warningLioncash2020-08-051-1/+1
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4489 from lioncash/typesafebunnei2020-08-061-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | ipc_helpers: Only allow trivially copyable objects with PushRaw() and PopRaw()Lioncash2020-08-051-0/+4
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #4484 from lioncash/aesutilbunnei2020-08-067-27/+36
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | aes_util: Allow SetIV to be non-allocatingLioncash2020-08-037-27/+36
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4477 from lioncash/log-desigbunnei2020-08-062-21/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | logging/backend: Make use of designated initializersLioncash2020-08-032-21/+15
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4475 from lioncash/bqueuebunnei2020-08-051-10/+11
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | buffer_queue: Make use of std::nulloptLioncash2020-08-031-5/+6
| * | | | | | | | | | | | | buffer_queue: Make use of designated initializersLioncash2020-08-031-5/+5
| | |_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4479 from lioncash/conceptsbunnei2020-08-051-1/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | CMakeLists: Resolve #4478Lioncash2020-08-031-1/+6
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4444 from lioncash/volatilebunnei2020-08-053-27/+30
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | common/atomic_ops: Don't cast away volatile from pointersLioncash2020-07-283-27/+30
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4466 from ogniK5377/loader-type-safebunnei2020-08-051-18/+34
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | Place in anonymous namespaceDavid Marcec2020-08-031-0/+4
| * | | | | | | | | | | loader: Make IdentifyFile typesafeDavid Marcec2020-08-031-20/+32
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4476 from lioncash/tzbunnei2020-08-051-17/+25
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | time_zone_binary: Make use of designated initializersLioncash2020-08-031-17/+25
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4401 from ogniK5377/GetIndirectLayerImageRequiredMemoryInfobunnei2020-08-051-1/+19
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfoDavid Marcec2020-07-211-1/+19
* | | | | | | | | | | | Merge pull request #4430 from bunnei/new-gpu-vmmbunnei2020-08-056-593/+431
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Update src/core/hle/service/nvdrv/devices/nvmap.cppbunnei2020-07-281-1/+1
| * | | | | | | | | | | | hle: nvdrv: Rewrite of GPU memory management.bunnei2020-07-266-593/+431
* | | | | | | | | | | | | Merge pull request #4445 from Morph1984/async-threadsbunnei2020-08-051-9/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | renderer_opengl: Use 1/4 of all threads for async shader compilationMorph2020-07-281-9/+4
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4450 from Morph1984/fix-gamelist-scanningbunnei2020-08-051-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | game_list_worker: Fix game list subdirectory scanningMorph2020-07-291-2/+2
* | | | | | | | | | | | | | Merge pull request #4472 from lioncash/const-getbunnei2020-08-042-15/+16
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | perf_stats: Make use of designated initializersLioncash2020-08-031-6/+7
| * | | | | | | | | | | | | | perf_stats: Mark GetMeanFrametime() as constLioncash2020-08-032-9/+9
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4469 from lioncash/missingbunnei2020-08-046-3/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | vulkan: Silence more -Wmissing-field-initializer warningsLioncash2020-08-036-3/+18
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #4470 from lioncash/qualifierDavid2020-08-041-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | patch_manager: Resolve -Wignored-qualifier warningsLioncash2020-08-031-2/+2
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #4481 from lioncash/cpp-depDavid2020-08-049-81/+88
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | yuzu: Resolve C++20 deprecation warnings related to lambda capturesLioncash2020-08-039-81/+88
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4474 from lioncash/hle-profileDavid2020-08-041-17/+26
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | profile_manager: Make use of std::nulloptLioncash2020-08-031-4/+4
| * | | | | | | | | | | | | | profile_manager: Make use of designated initializersLioncash2020-08-031-13/+22
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4473 from lioncash/cheat-desigbunnei2020-08-041-105/+121
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | dmnt_cheat_vm: Make use of designated initializersLioncash2020-08-031-105/+121
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #4456 from Morph1984/stub-really-long-fs-funcbunnei2020-08-047-63/+120
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | minor nitsMorph2020-07-311-1/+3
| * | | | | | | | | | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttributeMorph2020-07-302-23/+56
| * | | | | | | | | | | | | | fs: Rename SaveDataDescriptor to SaveDataAttributeMorph2020-07-305-41/+63
| | |_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4480 from lioncash/optimizebunnei2020-08-031-9/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | tests/core_timing: Remove pragma optimize(off)Lioncash2020-08-031-9/+5
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4482 from lioncash/ldr-signbunnei2020-08-031-3/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | service/ldr: Resolve sign mismatch warningsLioncash2020-08-031-3/+2
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #4468 from lioncash/regcachebunnei2020-08-031-10/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | registered_cache: Resolve -Wmaybe_uninitialized warningsLioncash2020-08-031-10/+15
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4471 from ogniK5377/sm-getservice-conceptbunnei2020-08-031-3/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | sm: Make use of IsBaseOf for GetServiceDavid Marcec2020-08-031-3/+2
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4467 from lioncash/modebunnei2020-08-032-18/+21
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | file_sys/mode: Make use of DECLARE_ENUM_FLAG_OPERATORS with ModeLioncash2020-08-032-18/+21
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer (#4465)David2020-08-0312-30/+64
* | | | | | | | | | | | | Merge pull request #4263 from lat9nq/fix-screencaps-2David2020-08-039-14/+120
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | config: Make the save-as identifier more consistentlat9nq2020-07-261-2/+2
| * | | | | | | | | | | | | configure_ui: Ensure a separator follows the returned pathlat9nq2020-07-211-3/+5
| * | | | | | | | | | | | | configure_ui: don't use an empty stringlat9nq2020-07-211-1/+3
| * | | | | | | | | | | | | main: Don't use as many string copieslat9nq2020-07-211-6/+8
| * | | | | | | | | | | | | main: rewrite (save as) screenshot savinglat9nq2020-07-211-9/+18
| * | | | | | | | | | | | | configuration: Setup UI to config screenshot path and savinglat9nq2020-07-215-5/+93
| * | | | | | | | | | | | | common: Add a screenshots directorylat9nq2020-07-213-0/+3
| | |_|_|_|_|/ / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4439 from lioncash/cpuDavid2020-08-031-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | cpu_manager: Remove redundant std::function declarationsLioncash2020-07-281-3/+3
* | | | | | | | | | | | | | Merge pull request #4438 from lioncash/localizingDavid2020-08-031-6/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | yuzu/main: Remove redundant usages of QStringLiteral("")Lioncash2020-07-281-6/+5
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4392 from lioncash/guardDavid2020-07-301-0/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | compatible_formats: Add missing header guardLioncash2020-07-211-0/+2
* | | | | | | | | | | | | | Merge pull request #4396 from lioncash/commabunnei2020-07-301-45/+52
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | surface_params: Make use of designated initializers where applicableLioncash2020-07-211-38/+46
| * | | | | | | | | | | | | | surface_params: Remove redundant assignmentLioncash2020-07-211-1/+0
| * | | | | | | | | | | | | | surface_params: Replace questionable usages of the comma operator with semicolonsLioncash2020-07-211-9/+9
* | | | | | | | | | | | | | | main: Add support for removing SDMC installed titlesMorph2020-07-291-14/+13
* | | | | | | | | | | | | | | xts_archive: Check if the file is nullptr prior to parsingMorph2020-07-291-5/+9
* | | | | | | | | | | | | | | registered_cache: Add support for removing folder ncasMorph2020-07-292-53/+54
* | | | | | | | | | | | | | | game_list: Limit context menu options for homebrewMorph2020-07-291-1/+7
* | | | | | | | | | | | | | | main: Remove assert for opening savedata when program_id = 0Morph2020-07-291-1/+0
* | | | | | | | | | | | | | | main: Silence [[fallthrough]] warningMorph2020-07-291-3/+2
* | | | | | | | | | | | | | | main: Split removal cases into their individual functions and address feedbackMorph2020-07-292-113/+131
* | | | | | | | | | | | | | | main: Connect game list remove signals to removal functionsMorph2020-07-292-5/+167
* | | | | | | | | | | | | | | game_list: Add "Remove" context menuMorph2020-07-292-4/+37
| |_|_|_|_|/ / / / / / / / / |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4442 from lioncash/devicemembunnei2020-07-283-11/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | device_memory: Remove unused system memberLioncash2020-07-283-11/+4
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | configure_graphics: Remove Force 30 FPS modeMorph2020-07-286-25/+0
| |_|_|_|/ / / / / / / / / |/| | | | | | | | | | | |
* | | | | | | | | | | | | core_timing: Make use of uintptr_t to represent user_dataLioncash2020-07-2815-43/+52
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #4419 from lioncash/initializerbunnei2020-07-282-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | vulkan: Resolve -Wmissing-field-initializer warningsLioncash2020-07-252-0/+4
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4434 from CrazyMax/lang_unused_varbunnei2020-07-271-1/+0
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | remove unused variable;CrazyMax2020-07-271-1/+0
* | | | | | | | | | | | | Merge pull request #4432 from bylaws/patch-1Rodrigo Locatti2020-07-271-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | video_core/gpu: Correct the size of the puller registersBilly Laws2020-07-261-2/+2
* | | | | | | | | | | | | Merge pull request #4431 from kelnos/fix-exit-crashbunnei2020-07-271-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | GCAdapter: only join worker thread if running & joinableBrian J. Tarricone2020-07-261-1/+3
* | | | | | | | | | | | | Merge pull request #4426 from lioncash/lockbunnei2020-07-263-19/+17
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | nvflinger: Mark interface functions with return values as [[nodiscard]]Lioncash2020-07-261-16/+14
| * | | | | | | | | | | | nvflinger: Use return value of Lock()Lioncash2020-07-263-4/+4
* | | | | | | | | | | | | Merge pull request #4418 from lioncash/udp-warnbunnei2020-07-261-1/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | udp/client: Remove unused boost includeLioncash2020-07-251-1/+0
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4415 from lioncash/maybebunnei2020-07-261-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | virtual_buffer: Mark size parameter of FreeMemoryPages() as [[maybe_unused]]Lioncash2020-07-251-1/+1
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #4417 from lioncash/pollbunnei2020-07-262-4/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gc_adapter: Resolve C++20 deprecation warningLioncash2020-07-251-1/+1
| * | | | | | | | | | | | gc_poller: Resolve -Wsign-compare warningLioncash2020-07-251-1/+2
| * | | | | | | | | | | | gc_poller: Resolve -Wredundant-move warningLioncash2020-07-251-2/+1
| |/ / / / / / / / / / /
* | / / / / / / / / / / yuzu/configure_debug: Remove duplicated checkboxesFearlessTobi2020-07-261-22/+0
| |/ / / / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #4350 from ogniK5377/hid-update-connectedbunnei2020-07-252-33/+37
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | hid: Only update keyboard & debug pad inputs if enabledDavid Marcec2020-07-162-33/+37
* | | | | | | | | | | | common/string_util: Remove unimplemented function prototype (#4414)LC2020-07-251-12/+0
* | | | | | | | | | | | Merge pull request #4380 from ogniK5377/swkbd-inline-1bunnei2020-07-252-13/+49
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | Address issuesDavid Marcec2020-07-201-2/+2
| * | | | | | | | | | | swkbd: Return result for Calc request for inlined swkbdDavid Marcec2020-07-192-13/+49
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4393 from lioncash/unused5bunnei2020-07-251-4/+0
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | vk_rasterizer: Remove unused variable in Clear()Lioncash2020-07-211-4/+0
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4377 from Morph1984/dark-themesbunnei2020-07-253-2/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | wait_tree: Include Midnight Blue dark themesMorph2020-07-201-1/+4
| * | | | | | | | | | qt-themes: Add Midnight Blue qdarkstyle theme (2.8.1)James Rowe2020-07-202-1/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4334 from lat9nq/clear-per-game-settingsbunnei2020-07-2516-869/+1116
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | configure_graphics_advnaced: clang-format mk iilat9nq2020-07-191-3/+3
| * | | | | | | | | | configure_graphics_advanced: Fix oversight from rebaselat9nq2020-07-191-1/+1
| * | | | | | | | | | configuration_shared: Remove unused functionslat9nq2020-07-192-18/+0
| * | | | | | | | | | configuration: Use forward declares and remove extraneous structslat9nq2020-07-1910-63/+59
| * | | | | | | | | | configuration_shared: Make CheckState strongly typedlat9nq2020-07-192-24/+23
| * | | | | | | | | | clang-formatlat9nq2020-07-195-38/+32
| * | | | | | | | | | configuration_shared: Break up tracker structs to respective classeslat9nq2020-07-1912-49/+58
| * | | | | | | | | | configure_system: break instead of semicolonlat9nq2020-07-191-2/+4
| * | | | | | | | | | clang-formatlat9nq2020-07-193-8/+11
| * | | | | | | | | | configure_system: Highlight labels on startuplat9nq2020-07-191-0/+5
| * | | | | | | | | | configure_graphics: Fix layout in global configlat9nq2020-07-191-1/+1
| * | | | | | | | | | configure_per_game: Improve style consistencylat9nq2020-07-193-54/+43
| * | | | | | | | | | configure_system: Implement highlighted overrideslat9nq2020-07-193-539/+544
| * | | | | | | | | | configuration_shared: Add default combobox setup functionlat9nq2020-07-193-21/+52
| * | | | | | | | | | configuration_shared: Use an int instead of a QStringlat9nq2020-07-194-22/+28
| * | | | | | | | | | configure_graphics_advanced: Implement highlighted overrideslat9nq2020-07-193-96/+146
| * | | | | | | | | | configuration_shared: Switch back to background colorslat9nq2020-07-191-2/+2
| * | | | | | | | | | configuration_shared: Better use global textlat9nq2020-07-192-0/+15
| * | | | | | | | | | configure_audio: fix UI marginslat9nq2020-07-191-1/+10
| * | | | | | | | | | configure_graphics: Implement highlighted overrideslat9nq2020-07-192-134/+200
| * | | | | | | | | | configure_audio: Implement highlighted overrideslat9nq2020-07-192-80/+87
| * | | | | | | | | | configuration_shared: Require name of the widget for highlightinglat9nq2020-07-193-16/+27
| * | | | | | | | | | configuration_shared: Use a highlight instead of background colorlat9nq2020-07-192-6/+6
| * | | | | | | | | | configure_general: Implement manual tristate buttonslat9nq2020-07-192-17/+27
| * | | | | | | | | | configuration_shared: Initial functions and data for manual tristatelat9nq2020-07-192-0/+58
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4388 from lioncash/writtenbunnei2020-07-241-6/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | buffer_cache: Eliminate redundant map lookup in MarkRegionAsWritten()Lioncash2020-07-201-6/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4391 from lioncash/nrvobunnei2020-07-247-26/+26
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: Allow copy elision to take place where applicableLioncash2020-07-217-26/+26
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4394 from lioncash/unused6bunnei2020-07-248-33/+5
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: Remove unused variablesLioncash2020-07-218-33/+5
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4353 from ameerj/gc-refactorbunnei2020-07-242-183/+46
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fix axis thresholding while pollingameerj2020-07-191-5/+2
| * | | | | | | | | | std::size_t where appropriate, make error message more clear if can't readameerj2020-07-171-3/+4
| * | | | | | | | | | Refactor adapter codeAmeer2020-07-162-179/+44
* | | | | | | | | | | network: add missing include for BSDsJan Beich2020-07-231-0/+2
| |_|_|_|_|/ / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #4359 from ReinUsesLisp/clamp-sharedRodrigo Locatti2020-07-216-9/+42
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | renderer_{opengl,vulkan}: Clamp shared memory to host's limitReinUsesLisp2020-07-166-9/+42
* | | | | | | | | | | Merge pull request #4360 from ReinUsesLisp/glasm-barRodrigo Locatti2020-07-211-4/+0
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_arb_decompiler: Execute BAR even when inside control flowReinUsesLisp2020-07-161-4/+0
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #4361 from ReinUsesLisp/lane-idRodrigo Locatti2020-07-211-2/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | decode/other: Implement S2R.LaneIdReinUsesLisp2020-07-161-2/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4306 from ReinUsesLisp/bsd-networkDavid2020-07-215-0/+840
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core/network: Add network abstractionReinUsesLisp2020-07-195-0/+840
* | | | | | | | | | | Merge pull request #4324 from ReinUsesLisp/formatsbunnei2020-07-2120-1100/+1111
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | video_core: Rearrange pixel format namesReinUsesLisp2020-07-1319-1179/+1077
| * | | | | | | | | | video_core: Fix DXT4 and RGB565ReinUsesLisp2020-07-137-37/+31
| * | | | | | | | | | video_core/format_lookup_table: Add formats with existing PixelFormatReinUsesLisp2020-07-131-1/+9
| * | | | | | | | | | video_core: Fix B5G6R5_UNORM render target formatReinUsesLisp2020-07-135-1/+10
| * | | | | | | | | | video_core: Fix B5G6R5UReinUsesLisp2020-07-132-2/+2
| * | | | | | | | | | video_core: Implement RGBA32_SINT render targetReinUsesLisp2020-07-137-58/+71
| * | | | | | | | | | video_core: Implement RGBA32_SINT render targetReinUsesLisp2020-07-137-0/+13
| * | | | | | | | | | video_core: Implement RGBA16_SINT render targetReinUsesLisp2020-07-137-0/+13
| * | | | | | | | | | video_core: Implement RGBA8_SINT render targetReinUsesLisp2020-07-137-0/+13
| * | | | | | | | | | video_core: Implement RG32_SINT render targetReinUsesLisp2020-07-137-0/+13
| * | | | | | | | | | video_core: Implement RG8_SINT render target and fix RG8_UINTReinUsesLisp2020-07-137-1/+14
| * | | | | | | | | | video_core: Implement R8_SINT render targetReinUsesLisp2020-07-137-0/+13
| * | | | | | | | | | video_core: Implement R8_SNORM render targetReinUsesLisp2020-07-137-0/+13
| * | | | | | | | | | video_core/surface: Remove explicit values on PixelFormat's definitionReinUsesLisp2020-07-131-80/+80
| * | | | | | | | | | video_core/surface: Reorder render target to pixel format switchReinUsesLisp2020-07-131-53/+51
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4168 from ReinUsesLisp/global-memorybunnei2020-07-217-110/+173
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | gl_arb_decompiler: Use NV_shader_buffer_{load,store} on assembly shadersReinUsesLisp2020-07-187-110/+173
* | | | | | | | | | Merge pull request #4376 from ogniK5377/dark-wait-treeRodrigo Locatti2020-07-191-11/+41
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Address issuesDavid Marcec2020-07-181-6/+3
| * | | | | | | | | | frontend: Improve wait tree readability for dark themesDavid Marcec2020-07-181-11/+44
* | | | | | | | | | | alignment: explicitly include <new> after 723edb4c0659Jan Beich2020-07-191-0/+1
* | | | | | | | | | | Address trivial review comments.FearlessTobi2020-07-181-1/+1
* | | | | | | | | | | configure_ui: Address some review comments from the previous PRFearlessTobi2020-07-182-16/+21
* | | | | | | | | | | yuzu: Port translation support from CitraFearlessTobi2020-07-1810-84/+235
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #4348 from lioncash/nanobunnei2020-07-1816-100/+111
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core_timing: Remove unused data memberLioncash2020-07-161-2/+0
| * | | | | | | | | | core_timing: Make TimedCallback take std::chrono::nanosecondsLioncash2020-07-1616-58/+62
| * | | | | | | | | | core_timing: Make use of std::chrono with ScheduleEventLioncash2020-07-1613-49/+58
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4373 from lioncash/allocatorbunnei2020-07-181-43/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | alignment: Simplify AlignmentAllocator implementationLioncash2020-07-171-43/+4
* | | | | | | | | | | Merge pull request #4345 from Morph1984/fix-createfilebunnei2020-07-181-0/+4
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Add comment to clarify the nullptr checkMorph2020-07-161-0/+1
| * | | | | | | | | | filesystem: Create subdirectories prior to creating a fileMorph2020-07-161-0/+3
* | | | | | | | | | | Merge pull request #4273 from ogniK5377/async-shaders-prodbunnei2020-07-1824-64/+660
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Fix style issuesDavid Marcec2020-07-182-7/+13
| * | | | | | | | | | | Drop settings namespaceDavid Marcec2020-07-171-2/+1
| * | | | | | | | | | | Remove duplicate configDavid Marcec2020-07-172-2/+1
| * | | | | | | | | | | Use conditional varDavid Marcec2020-07-172-9/+15
| * | | | | | | | | | | Drop max workers from 8->2 for testingDavid Marcec2020-07-171-1/+1
| * | | | | | | | | | | Rebase for per game settingsDavid Marcec2020-07-179-1/+53
| * | | | | | | | | | | async shadersDavid Marcec2020-07-1716-64/+598
* | | | | | | | | | | | Merge pull request #4364 from lioncash/desig5bunnei2020-07-1819-664/+763
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | wrapper: Make use of designated initializers where applicableLioncash2020-07-171-56/+64
| * | | | | | | | | | | | vk_texture_cache: Make use of designated initializers where applicableLioncash2020-07-171-96/+135
| * | | | | | | | | | | | vk_swapchain: Make use of designated initializers where applicableLioncash2020-07-171-43/+51
| * | | | | | | | | | | | vk_stream_buffer: Make use of designated initializers where applicableLioncash2020-07-171-19/+16
| * | | | | | | | | | | | vk_staging_buffer_pool: Make use of designated initializers where applicableLioncash2020-07-171-13/+12
| * | | | | | | | | | | | vk_shader_util: Make use of designated initializers where applicableLioncash2020-07-171-7/+7
| * | | | | | | | | | | | vk_scheduler: Make use of designated initializers where applicableLioncash2020-07-171-27/+30
| * | | | | | | | | | | | vk_sampler_cache: Make use of designated initializers where applicableLioncash2020-07-171-24/+27
| * | | | | | | | | | | | vk_resource_manager: Make use of designated initializers where applicableLioncash2020-07-171-15/+14
| * | | | | | | | | | | | vk_renderpass_cache: Make use of designated initializers where applicableLioncash2020-07-171-59/+70
| * | | | | | | | | | | | vk_rasterizer: Make use of designated initializers where applicableLioncash2020-07-171-41/+47
| * | | | | | | | | | | | vk_query_cache: Make use of designated initializers where applicableLioncash2020-07-171-8/+8
| * | | | | | | | | | | | vk_pipeline_cache: Make use of designated initializers where applicableLioncash2020-07-171-31/+35
| * | | | | | | | | | | | vk_memory_manager: Make use of designated initializers where applicableLioncash2020-07-171-7/+6
| * | | | | | | | | | | | vk_image: Make use of designated initializers where applicableLioncash2020-07-171-15/+23
| * | | | | | | | | | | | vk_descriptor_pool: Make use of designated initializers where applicableLioncash2020-07-171-15/+18
| * | | | | | | | | | | | vk_compute_pipeline: Make use of designated initializers where applicableLioncash2020-07-161-63/+68
| * | | | | | | | | | | | vk_compute_pass: Make use of designated initializers where applicableLioncash2020-07-161-95/+99
| * | | | | | | | | | | | vk_buffer_cache: Make use of designated initializers where applicableLioncash2020-07-161-30/+33
* | | | | | | | | | | | | Merge pull request #4365 from lioncash/miibunnei2020-07-181-53/+54
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | mii/manager: Make use of designated initializersLioncash2020-07-171-53/+54
* | | | | | | | | | | | | | Merge pull request #4374 from ReinUsesLisp/fix-errbunnei2020-07-181-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | vk_device: Fix build error on old MSVC versionsReinUsesLisp2020-07-181-3/+3
| | |_|_|_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4366 from lioncash/mii-signbunnei2020-07-181-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | mii/manager: Resolve sign mismatch warningsLioncash2020-07-171-3/+3
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4344 from VolcaEM/c3bunnei2020-07-172-1/+42
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | clang-formatVolcaEM2020-07-151-1/+2
| * | | | | | | | | | | | | dmnt_cheat_vm: Implement opcode 0xC3 (ReadWriteStaticRegister)VolcaEM2020-07-152-1/+41
* | | | | | | | | | | | | | Merge pull request #4309 from Morph1984/fix-romfs-bugbunnei2020-07-174-10/+10
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | fs: Fix RomFS building when zero byte files are presentMorph2020-07-124-10/+10
* | | | | | | | | | | | | | Merge pull request #4322 from ReinUsesLisp/fix-dynstatebunnei2020-07-171-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | vk_state_tracker: Fix dirty flags for stencil_enable on VK_EXT_extended_dynamic_stateReinUsesLisp2020-07-131-0/+1
| | |_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4369 from lioncash/hle-macroLC2020-07-171-10/+7
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | macro_hle: Remove unnecessary static keywordsLioncash2020-07-171-7/+4
| * | | | | | | | | | | | | macro_hle: Remove unnecessary std::make_pair callsLioncash2020-07-171-3/+3
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4340 from lioncash/removeLC2020-07-171-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | shader_cache: Make use of std::erase_ifLioncash2020-07-141-2/+2
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4347 from lioncash/loggingDavid2020-07-171-38/+39
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | settings: Resolve a sign conversion warning within GetTimeZoneString()Lioncash2020-07-151-5/+5
| * | | | | | | | | | | | settings: Make use of std::string_view over std::string for loggingLioncash2020-07-151-33/+34
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4371 from lioncash/cmake2David2020-07-171-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | core/CMakeLists: Add missing physical_memory.h header fileLioncash2020-07-171-0/+1
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4357 from lioncash/unused4David2020-07-173-7/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | kernel: Remove unused variablesLioncash2020-07-163-7/+2
* | | | | | | | | | | | | Merge pull request #4358 from lioncash/unused5David2020-07-171-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | kernel/thread: Remove unimplemented function prototypeLioncash2020-07-161-2/+0
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4367 from lioncash/inc2David2020-07-171-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | constants: Add missing <array> includeLioncash2020-07-171-0/+1
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4368 from lioncash/macroDavid2020-07-171-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | macro: Resolve missing parameter in doxygen commentLioncash2020-07-171-1/+2
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4370 from lioncash/simplifyDavid2020-07-171-2/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | macro_hle: Simplify shift expression in HLE_771BB18C62444DA0()Lioncash2020-07-171-2/+1
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #4363 from lioncash/mismatchRodrigo Locatti2020-07-171-6/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | vk_texture_cache: Amend mismatched access masks and indices in UploadBufferLioncash2020-07-171-6/+4
* | | | | | | | | | | | | Merge pull request #4292 from bunnei/mii-rewritebunnei2020-07-179-914/+3270
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | hle: service: mii: Rewrite service to properly support creation of random and default miis.bunnei2020-07-129-914/+3270
* | | | | | | | | | | | | vk_graphics_pipeline: Resolve narrowing warningsLioncash2020-07-171-2/+4
| |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4327 from lioncash/desig2Rodrigo Locatti2020-07-162-58/+38
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | address_space_info: Use type alias to simplify codeLioncash2020-07-131-14/+13
| * | | | | | | | | | | | address_space_info: Make use of designated initializersLioncash2020-07-132-46/+27
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #4333 from lioncash/desig3Rodrigo Locatti2020-07-161-198/+223
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | vk_graphics_pipeline: Make use of designated initializers where applicableLioncash2020-07-141-198/+223
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #4332 from lioncash/vkdevRodrigo Locatti2020-07-161-124/+152
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | vk_device: Make use of designated initializers where applicableLioncash2020-07-141-124/+152
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #4321 from lioncash/desigbunnei2020-07-161-334/+384
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | vk_blit_screen: Make use of designated initializers where applicableLioncash2020-07-131-334/+384
| |/ / / / / / / / / /
* | | | | | | | | | | kernel: Add missing includeLioncash2020-07-161-0/+1
* | | | | | | | | | | cpu_manager: Mark function getters as staticLioncash2020-07-164-10/+11
* | | | | | | | | | | cpu_manager: Remove unused preemption_count variableLioncash2020-07-161-1/+0
* | | | | | | | | | | cpu_manager: Add missing includesLioncash2020-07-161-0/+3
| |_|_|_|_|_|/ / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #4261 from ameerj/gc-calibrationbunnei2020-07-163-36/+67
|\ \ \ \ \ \ \ \ \ \
| * \ \ \ \ \ \ \ \ \ Rebase to masterAmeer2020-07-14118-1479/+3408
| |\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Break out of scan loop if can't find adapter on first runAmeer2020-07-101-0/+3
| * | | | | | | | | | | Rebase to master, fix merge conflictsAmeer2020-07-0921-302/+722
| |\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Address PR feedback, fix axis button thresholdingAmeer2020-07-073-58/+22
| * | | | | | | | | | | | Brace the code! Fix compile error due to class member construction orderAmeer2020-07-072-15/+31
| * | | | | | | | | | | | Recalibrate reconnected controllersAmeer2020-07-071-0/+5
| * | | | | | | | | | | | Save origin state of GC controller analog features, compare against origin for input detectionAmeer2020-07-073-28/+72
* | | | | | | | | | | | | Merge pull request #4337 from lat9nq/fix-per-game-asyncbunnei2020-07-163-0/+10
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | clang-formatlat9nq2020-07-141-2/+1
| * | | | | | | | | | | | | settings: Move settings sanitization to its own functionlat9nq2020-07-144-4/+11
| * | | | | | | | | | | | | main: Set async gpu properly after loading per-game settinglat9nq2020-07-141-0/+4
* | | | | | | | | | | | | | Merge pull request #4297 from FearlessTobi/skip-profile-selectbunnei2020-07-161-9/+13
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | main/profile_select: Don't prompt for profile selection when only one is availableFearlessTobi2020-07-111-9/+13
| | |_|_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #4346 from lioncash/threadDavid2020-07-167-35/+26
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | kernel/process: Move name and system context to the bottom of the member listLioncash2020-07-151-6/+6
| * | | | | | | | | | | | | kernel/handle_table: Remove usages of the global system instanceLioncash2020-07-154-8/+15
| * | | | | | | | | | | | | kernel/thread: Remove global GetCurrentThread()Lioncash2020-07-153-23/+7
| | |_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #4249 from Morph1984/delete-update-aoc-on-overwriteDavid2020-07-163-12/+94
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | Check for empty section0 and CNMT prior to installMorph2020-07-161-3/+19
| * | | | | | | | | | | | clang formatMorph2020-07-151-3/+3
| * | | | | | | | | | | | Use proper install result when overwriting filesMorph2020-07-152-3/+3
| * | | | | | | | | | | | Remove global system instance and address feedbackMorph2020-07-152-14/+10
| * | | | | | | | | | | | registered_cache: Remove previous update/dlc if it exists on installMorph2020-07-152-13/+83
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #4328 from lioncash/unused-var3bunnei2020-07-161-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | memory_layout: Remove unused data memberLioncash2020-07-131-2/+0
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #4342 from lioncash/endianRodrigo Locatti2020-07-141-42/+4
|\ \ \ \ \ \ \ \ \ \ \