summaryrefslogtreecommitdiffstats
Commit message (Collapse)AuthorAgeFilesLines
* ci: Fix unset environment variable bugZach Hilman2019-10-021-3/+1
|
* Merge pull request #2904 from ogniK5377/better-signal-hidbunnei2019-10-011-8/+2
|\ | | | | Signal styleset changes at a better time
| * Signal styleset changes at a better timeDavid Marcec2019-09-241-8/+2
| | | | | | | | We should signal when a net controller is added and our event should be manual, not automatic.
* | Merge pull request #2924 from MysticExile/readme-2bunnei2019-10-011-1/+0
|\ \ | | | | | | Remove AppVeyor status from the readme.md
| * | Remove AppVeyor statusEthan2019-09-291-1/+0
| | |
* | | Merge pull request #2929 from DarkLordZach/azure-patreon-merge-extrabunnei2019-10-013-6/+13
|\ \ \ | | | | | | | | ci: Merge patreon tagged PRs from public repository during merge step.
| * | | ci: Correct arguments for mergebot scriptZach Hilman2019-09-301-2/+2
| | | |
| * | | ci: Populate patreon PRs on public repositoryZach Hilman2019-09-303-6/+13
|/ / /
* | | Merge pull request #2923 from yuzu-emu/revert-2574-dynarmic-jit-nullptrbunnei2019-09-301-3/+0
|\ \ \ | | | | | | | | Revert "arm_dynarmic: Check if jit is nullptr when preparing reschedule"
| * | | Revert "arm_dynarmic: Check if jit is nullptr when preparing reschedule"bunnei2019-09-301-3/+0
|/ / /
* | | Merge pull request #2574 from DarkLordZach/dynarmic-jit-nullptrbunnei2019-09-301-0/+3
|\ \ \ | |/ / |/| | arm_dynarmic: Check if jit is nullptr when preparing reschedule
| * | arm_dynarmic: Check if jit is nullptr when preparing rescheduleZach Hilman2019-06-101-0/+3
| | | | | | | | | | | | Prevents crash with multiprocess loading.
* | | Merge pull request #2909 from MysticExile/fmt-2Rodrigo Locatti2019-09-271-0/+0
|\ \ \ | | | | | | | | externals: Update fmt to master
| * | | externals: Update fmt to masterEthan2019-09-261-0/+0
| | | |
* | | | Merge pull request #2911 from DarkLordZach/azure-patreonRodrigo Locatti2019-09-277-21/+151
|\ \ \ \ | |/ / / |/| | | ci: Add azure patreon pipeline
| * | | ci: Add two step patreon build pipelineZach Hilman2019-09-263-19/+36
| | | |
| * | | ci: Add private mergebot CI templatesZach Hilman2019-09-262-0/+70
| | | |
| * | | ci: Optionally prepend commit messages with environment variableZach Hilman2019-09-261-2/+4
| | | |
| * | | ci: Add private mergebot scriptZach Hilman2019-09-261-0/+41
| | |/ | |/| | | | Uses Azure instead of GitHub
* | | Merge pull request #2864 from ReinUsesLisp/fix-clang-decompilerbunnei2019-09-251-26/+25
|\ \ \ | |/ / |/| | gl_shader_decompiler: Fix clang build issues
| * | gl_shader_decompiler: Add tailing return for HUnpack2ReinUsesLisp2019-09-241-0/+2
| | |
| * | gl_shader_decompiler: Fix clang build issuesReinUsesLisp2019-09-241-26/+23
|/ /
* | Merge pull request #2869 from ReinUsesLisp/suldbunnei2019-09-2411-229/+199
|\ \ | | | | | | shader/image: Implement SULD and fix SUATOM
| * | gl_shader_decompiler: Use uint for images and fix SUATOMReinUsesLisp2019-09-217-188/+93
| | | | | | | | | | | | | | | | | | In the process remove implementation of SUATOM.MIN and SUATOM.MAX as these require a distinction between U32 and S32. These have to be implemented with imageCompSwap loop.
| * | shader/image: Implement SULD and remove irrelevant codeReinUsesLisp2019-09-2110-47/+110
| | | | | | | | | | | | | | | * Implement SULD as float. * Remove conditional declaration of GL_ARB_shader_viewport_layer_array.
| * | shader_bytecode: Add SULD encodingReinUsesLisp2019-09-211-0/+2
| | |
* | | Merge pull request #2901 from DarkLordZach/mainline-title-barJames Rowe2019-09-232-0/+5
|\ \ \ | | | | | | | | ci: Properly parse Azure CI details in title bar
| * | | ci: Correct GitHub Release nameZach Hilman2019-09-231-1/+1
| | | |
| * | | ci: Determine build date via bashZach Hilman2019-09-231-1/+2
| | | |
| * | | ci: Update to use date as build numberZach Hilman2019-09-222-1/+2
| | | |
| * | | cmake: Add SCM detection for AzureZach Hilman2019-09-221-0/+3
|/ / /
* | | ci: Split mainline pipeline and add support for GitHub releases (#2900)Zach Hilman2019-09-227-13/+62
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * ci: Add mock build alternative for fast testing * ci: Always cache build * ci: Extract steps to download build stage artifacts * ci: Add template to release to GitHub * ci: Add template to release to Azure Universal Artifacts * ci: Split mainline to two pipelines
* | | Merge pull request #2683 from DarkLordZach/lock-exitDavid2019-09-228-8/+92
|\ \ \ | | | | | | | | am: Implement exit locking and self exit commands
| * | | main: Use const on all variable initializationsZach Hilman2019-09-221-2/+2
| | | |
| * | | qt: Prompt user for confirmation if exit lock is activeZach Hilman2019-09-223-1/+44
| | | |
| * | | am: Implement ISelfController ExitLock commandsZach Hilman2019-09-221-2/+6
| | | |
| * | | am: Implement ISelfController ExitZach Hilman2019-09-224-4/+20
| | | | | | | | | | | | | | | | Closes the current application.
| * | | am: Add RequestExit event to AppletMessageQueueZach Hilman2019-09-222-0/+6
| | | | | | | | | | | | | | | | Tested against libnx, signals to games to begin cleanup.
| * | | core: Track system exit lock statusZach Hilman2019-09-222-0/+15
| | | | | | | | | | | | | | | | Used to determine if yuzu should confirm before pausing or stopping a game.
* | | | Merge pull request #2889 from FearlessTobi/adwsawdawdDavid2019-09-221-0/+1
|\ \ \ \ | | | | | | | | | | Add missing include
| * | | | Add missing includeFearlessTobi2019-09-221-0/+1
| | | | |
* | | | | Merge pull request #2876 from ogniK5377/AcquireNpadStyleSetUpdateEventHandle-fixZach Hilman2019-09-223-11/+18
|\ \ \ \ \ | | | | | | | | | | | | AcquireNpadStyleSetUpdateEventHandle should have a separate event for each controller type
| * | | | | removed commentDavid Marcec2019-09-221-1/+0
| | | | | |
| * | | | | RebasedDavid Marcec2019-09-223-11/+19
| |/ / / /
* | | | | Merge pull request #2877 from ogniK5377/framecount-rev7Zach Hilman2019-09-222-11/+24
|\ \ \ \ \ | | | | | | | | | | | | Added frame_count for REV5 audio renderer
| * | | | | Used revision 5 instead of 7, marked constexpr as staticDavid Marcec2019-09-211-2/+2
| | | | | |
| * | | | | Added frame_count for REV7 audio rendererDavid Marcec2019-09-202-11/+24
| | | | | | | | | | | | | | | | | | | | | | | | Added framecount
* | | | | | Merge pull request #2895 from FearlessTobi/debug-logsDavid2019-09-221-7/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/acc: Lower log severity from INFO to DEBUG
| * | | | | | service/acc: Lower log severity from INFO to DEBUGFearlessTobi2019-09-221-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | According to ogniK, this should have always been Debug and not Info.
* | | | | | | Merge pull request #2873 from ogniK5377/new-ioctlsFernando Sahmkow2019-09-2224-73/+153
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Initial implementation of Ioctl2 & Ioctl3
| * | | | | | server side clang format fix2David Marcec2019-09-221-18/+18
| | | | | | |
| * | | | | | Use clang-format provided by build serverDavid Marcec2019-09-221-20/+18
| | | | | | |
| * | | | | | disable clang-format tempDavid Marcec2019-09-201-0/+2
| | | | | | |
| * | | | | | Initial implementation of Ioctl2 & Ioctl3David Marcec2019-09-1924-63/+143
| | |/ / / / | |/| | | | | | | | | | | | | | | | Purpose of Ioctl2 and Ioctl3 is to prevent the passing of raw pointers through ioctls
* | | | | | Merge pull request #2884 from ogniK5377/deglobal-sys-servicesFernando Sahmkow2019-09-2264-212/+291
|\ \ \ \ \ \ | | | | | | | | | | | | | | Remove usage of System::CurrentInterface() from most services
| * | | | | | removed unneeded semicolonDavid Marcec2019-09-221-1/+1
| | | | | | |
| * | | | | | Removed reference to core timing to nvflinger and used system insteadDavid Marcec2019-09-221-1/+1
| | | | | | |
| * | | | | | marked controller constructors as explicitDavid Marcec2019-09-228-8/+8
| | | | | | |
| * | | | | | RebaseDavid Marcec2019-09-2225-62/+75
| | | | | | |
| * | | | | | RebaseDavid Marcec2019-09-225-20/+21
| | | | | | |
| * | | | | | Deglobalize System: ViDavid Marcec2019-09-223-8/+8
| | | | | | |
| * | | | | | Deglobalize System: TimeDavid Marcec2019-09-224-14/+21
| | | | | | |
| * | | | | | RebaseDavid Marcec2019-09-222-8/+12
| | | | | | |
| * | | | | | Deglobalize System: NvFlingerDavid Marcec2019-09-222-6/+7
| | | | | | |
| * | | | | | RebaseDavid Marcec2019-09-224-8/+12
| | | | | | |
| * | | | | | Deglobalize System: NimDavid Marcec2019-09-222-7/+12
| | | | | | |
| * | | | | | Deglobalize System: NifmDavid Marcec2019-09-222-13/+23
| | | | | | |
| * | | | | | Deglobalize System: NFPDavid Marcec2019-09-224-14/+16
| | | | | | |
| * | | | | | Deglobalize System: LDRDavid Marcec2019-09-222-6/+7
| | | | | | |
| * | | | | | Deglobalize System: IRSDavid Marcec2019-09-223-5/+6
| | | | | | |
| * | | | | | Deglobalize System: HidDavid Marcec2019-09-2220-37/+44
| | | | | | |
| * | | | | | Deglobalize System: FriendDavid Marcec2019-09-224-22/+24
| | | | | | |
| * | | | | | Deglobalize System: FatalDavid Marcec2019-09-226-20/+29
| | | | | | |
| * | | | | | Deglobalize System: BtmDavid Marcec2019-09-222-7/+13
| | | | | | |
| * | | | | | Deglobalize System: BtdrvDavid Marcec2019-09-222-5/+9
| | | | | | |
| * | | | | | Deglobalize System: AocDavid Marcec2019-09-222-11/+13
| | | | | | |
| * | | | | | Deglobalize System: AmDavid Marcec2019-09-221-1/+1
| | | | | | |
* | | | | | | Merge pull request #2870 from FernandoS27/multi-drawDavid2019-09-229-91/+273
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement a MME Draw commands Inliner and correct host instance drawing
| * | | | | | | Maxwell3D: Corrections and refactors to MME instance refactorFernando Sahmkow2019-09-224-44/+46
| | | | | | | |
| * | | | | | | Rasterizer: Correct introduced bug where a conditional render wouldn't stop a draw call from executingFernando Sahmkow2019-09-201-10/+16
| | | | | | | |
| * | | | | | | Rasterizer: Refactor and simplify DrawBatch Interface.Fernando Sahmkow2019-09-194-35/+16
| | | | | | | |
| * | | | | | | Rasterizer: Address Feedback and conscerns.Fernando Sahmkow2019-09-191-11/+11
| | | | | | | |
| * | | | | | | Rasterizer: Refactor draw calls, remove deadcode and clean up.Fernando Sahmkow2019-09-193-106/+68
| | | | | | | |
| * | | | | | | VideoCore: Corrections to the MME Inliner and removal of hacky instance management.Fernando Sahmkow2019-09-196-31/+81
| | | | | | | |
| * | | | | | | Video Core: initial Implementation of InstanceDraw PackagingFernando Sahmkow2019-09-197-11/+192
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2891 from FearlessTobi/rod-texFernando Sahmkow2019-09-228-24/+39
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Implement RGBX16F and lower Surface Copy log severity
| * | | | | | | Fix clang-formatFearlessTobi2019-09-222-2/+2
| | | | | | | |
| * | | | | | | fermi_2d: Lower surface copy log severity to DEBUGFearlessTobi2019-09-221-1/+1
| | | | | | | |
| * | | | | | | video_core: Implement RGBX16F PixelFormatFearlessTobi2019-09-227-22/+37
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2867 from ReinUsesLisp/configure-framebuffers-cleanDavid2019-09-224-121/+33
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer: Remove unused code paths from ConfigureFramebuffers
| * | | | | | | gl_rasterizer: Remove unused code paths from ConfigureFramebuffersReinUsesLisp2019-09-174-121/+33
| | | | | | | |
* | | | | | | | Merge pull request #2893 from ogniK5377/revert-dlzDavid2019-09-2233-73477/+111852
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"
| * | | | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"David Marcec2019-09-2233-73477/+111852
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit fa1c60c33ef88c6cd0b72da46842dc9098db712d, reversing changes made to e34899067b60a69bca02761bd1290c6824bb559a.
* | | | | | | Merge pull request #2535 from DarkLordZach/cheat-v2David2019-09-2215-760/+1962
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cheat_engine: Use Atmosphere's Cheat VM and fix cheat crash
| * | | | | | | dmnt_cheat_vm: Default initialize structure valuesZach Hilman2019-09-223-89/+88
| | | | | | | |
| * | | | | | | dmnt_cheat_vm: Make Cheat VM compliant to code styleZach Hilman2019-09-224-870/+862
| | | | | | | |
| * | | | | | | core: Initialize cheats after load to avoid VMManager crashZach Hilman2019-09-221-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | This used to occur due to the VMManager being nullptr at the time cheats were registered (during load, but before it was done). This is bypassed by not accessing the VMManager for offset data until load is complete,
| * | | | | | | core: Update RegisterCheatList for new VMZach Hilman2019-09-222-11/+16
| | | | | | | |
| * | | | | | | patch_manager: Update cheat parsing for new VMZach Hilman2019-09-222-15/+20
| | | | | | | |
| * | | | | | | nso: Pass build ID directlyZach Hilman2019-09-221-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | As opposed to converting to string and then back to hex array
| * | | | | | | cheat_engine: Move to memory and strip VMZach Hilman2019-09-225-728/+325
| | | | | | | | | | | | | | | | | | | | | | | | This is to go with the Atmosphere VM port, now it just contains the callbacks needed for the interface between DmntCheatVm and yuzu, along with the cheat parsers.
| * | | | | | | memory: Port Atmosphere's DmntCheatVmZach Hilman2019-09-223-0/+1598
| | | | | | | | | | | | | | | | | | | | | | | | This was done because the current VM contained many inaccuracies and this also allows cheats to have identical behavior between hardware and yuzu.
| * | | | | | | log: Add logging class for Cheat EngineZach Hilman2019-09-222-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | This is better than just using something like Common.Filesystem or Common.Memory
* | | | | | | | Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1David2019-09-2233-111852/+73477
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | system_archive: Move shared font data to system_archive and fix extended font data
| * | | | | | | | pl_u: Use kernel physical memoryZach Hilman2019-09-222-4/+8
| | | | | | | | |
| * | | | | | | | pl_u: Remove excess static qualifierZach Hilman2019-09-221-1/+1
| | | | | | | | |
| * | | | | | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-09-223-111/+42
| | | | | | | | |
| * | | | | | | | system_archive: Synthesize shared fonts system archivesZach Hilman2019-09-223-5/+101
| | | | | | | | |
| * | | | | | | | pl_u: Expose method to encrypt TTF to BFTTFZach Hilman2019-09-222-14/+14
| | | | | | | | |
| * | | | | | | | externals: Move OSS font data to file_sys in coreZach Hilman2019-09-2228-111730/+73324
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2886 from MysticExile/dynarmicDavid2019-09-221-0/+0
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | externals: Update dynarmic to master
| * | | | | | | externals: Update dynarmic to masterEthan2019-09-211-0/+0
| | | | | | | |
* | | | | | | | Merge pull request #2612 from DarkLordZach/prepo-newDavid2019-09-225-30/+99
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | prepo: Implement New, System, and Non-User variants of SaveReport
| * | | | | | | prepo: Remove system global accessorsZach Hilman2019-09-223-15/+18
| | | | | | | |
| * | | | | | | prepo: Implement SaveReport New and System variantsZach Hilman2019-09-221-15/+71
| | | | | | | |
| * | | | | | | reporter: Differentiate between Old, New, and System play reportsZach Hilman2019-09-222-5/+15
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2430 from DarkLordZach/fs-controllerDavid2019-09-2255-265/+1885
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Implement FileSystemController to deglobalize FS services
| * | | | | | | configure_debug: Move reporting option to loggingZach Hilman2019-09-2215-63/+64
| | | | | | | |
| * | | | | | | config: Remove Dump options from configure_debugZach Hilman2019-09-214-47/+39
| | | | | | | |
| * | | | | | | filesystem: Add const qualification to various accessorsZach Hilman2019-09-2110-83/+94
| | | | | | | |
| * | | | | | | yuzu: Add UI to manage filesystem paths and sizesZach Hilman2019-09-216-1/+627
| | | | | | | |
| * | | | | | | core: Store FileSystemController in coreZach Hilman2019-09-212-0/+32
| | | | | | | |
| * | | | | | | settings: Add options for managing gamecard emulationZach Hilman2019-09-214-2/+67
| | | | | | | |
| * | | | | | | settings: Add options for setting storage sizesZach Hilman2019-09-213-1/+57
| | | | | | | |
| * | | | | | | yuzu: Port old usages of Filesystem namespace to FilesystemControllerZach Hilman2019-09-2114-46/+106
| | | | | | | |
| * | | | | | | settings: Update LogSettings to show NAND/SDMC paths from FileUtilZach Hilman2019-09-211-2/+3
| | | | | | | |
| * | | | | | | card_image: Add accessors for gamecard certificateZach Hilman2019-09-212-0/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by fsp-srv/IDeviceOperator
| * | | | | | | card_image: Add functions to query gamecard update partitionZach Hilman2019-09-212-0/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes version and meta title ID, used by fsp-srv/IDeviceOperator
| * | | | | | | content_archive: Add accessors for Rights ID and SDK VersionZach Hilman2019-09-212-0/+10
| | | | | | | |
| * | | | | | | partition_data_manager: Add accessor for decrypted PRODINFO partitionZach Hilman2019-09-212-0/+5
| | | | | | | |
| * | | | | | | services: Pass FileSystemController as reference to services that need itZach Hilman2019-09-2111-20/+47
| | | | | | | |
| * | | | | | | am: Unstub IApplicationFunctions EnsureSaveData (20)Zach Hilman2019-09-211-8/+14
| | | | | | | | | | | | | | | | | | | | | | | | Creates a default save data for the application given a user ID.
| * | | | | | | filesystem: Pass Size Getter functions to IFileSystem for sizesZach Hilman2019-09-213-20/+31
| | | | | | | |
| * | | | | | | sdmc_factory: Add SD Card size gettersZach Hilman2019-09-212-0/+12
| | | | | | | |
| * | | | | | | bis_factory: Add getters for NAND partition sizesZach Hilman2019-09-212-0/+38
| | | | | | | |
| * | | | | | | filesystem: Add FileSystemController to deglobalize FS servicesZach Hilman2019-09-212-58/+359
| | | | | | | |
| * | | | | | | submisson_package: Fix edge case with improperly sized filenamesZach Hilman2019-09-211-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | Prevents a crash if the filename is less than 9 characters long.
| * | | | | | | sdmc_factory: Add accessor for SDMC Album directoryZach Hilman2019-09-212-0/+6
| | | | | | | |
| * | | | | | | sdmc_factory: Add accessor for SDMC PlaceholderCacheZach Hilman2019-09-212-1/+10
| | | | | | | |
| * | | | | | | sdmc_factory: Add accessor for content directoryZach Hilman2019-09-212-0/+7
| | | | | | | |
| * | | | | | | savedata_factory: Implement savedata creation and don't create dir on openZach Hilman2019-09-212-26/+40
| | | | | | | | | | | | | | | | | | | | | | | | Matches hardware behavior and eliminates some nasty behavior we were doing that wasn't hw-accurate at all.
| * | | | | | | patch_manager: Add short-circuit edge-case to GetPatchVersionNamesZach Hilman2019-09-211-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | If title ID is 0, there are no add ons, prevents wasting time looking for them.
| * | | | | | | patch_manager: Add error checking to load dir to prevent crashesZach Hilman2019-09-211-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | Prevents a crash if the load dir would be nullptr, instead logs an error and returns appropriately.
| * | | | | | | registered_cache: Process *.cnmt.nca filesZach Hilman2019-09-211-16/+23
| | | | | | | | | | | | | | | | | | | | | | | | Needed to use the RegisteredCache/PlaceholderCache on gamecards.
| * | | | | | | registered_cache: Implement PlaceholderCache to manage placeholder and installing contentZach Hilman2019-09-212-0/+175
| | | | | | | |
| * | | | | | | bis_factory: Fix mod loader edge-case with homebrew title IDsZach Hilman2019-09-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Fixes a bug where homebrew that has a title ID with the update bit set can cause issues with the PatchManager
| * | | | | | | bis_factory: Add accessors for BIS placeholder cachesZach Hilman2019-09-212-1/+20
| | | | | | | |
| * | | | | | | bis_factory: Add accessor for NAND Image DirectoryZach Hilman2019-09-212-0/+6
| | | | | | | |
| * | | | | | | bis_factory: Add accessors for BIS content directoriesZach Hilman2019-09-212-0/+11
| | | | | | | |
| * | | | | | | bis_factory: Add accessors for BIS partitionsZach Hilman2019-09-212-0/+61
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2883 from ogniK5377/log-gameZach Hilman2019-09-221-3/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Log the current title id and game name which is booting
| * | | | | | Swapped TID and Game name to make it easier to parseDavid Marcec2019-09-211-1/+1
| | | | | | |
| * | | | | | Log the current title id and game name which is bootingDavid Marcec2019-09-211-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Spit out a LOG_INFO of the current game name and it's title id in the log. This helps to read log files and figure out which games have which issues
* | | | | | | Update README.md (#2871)MysticExile2019-09-211-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Update README.md * Adress feedback * Add link to our compatability page * Address feedback Co-Authored-By: Morph <39850852+Morph1984@users.noreply.github.com> * Fix spelling Co-Authored-By: Morph <39850852+Morph1984@users.noreply.github.com> * Small fix * Removed the mention of a specific game * fix
* | | | | | | Merge pull request #2878 from FernandoS27/icmpRodrigo Locatti2019-09-212-0/+42
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | shader_ir: Implement ICMP
| * | | | | | Shader_IR: ICMP corrections and fixesFernando Sahmkow2019-09-212-6/+11
| | | | | | |
| * | | | | | Shader_IR: Implement ICMP.Fernando Sahmkow2019-09-202-0/+37
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2885 from Hexagon12/port-4944David2019-09-211-0/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port citra-emu/citra#4944: "Added Host CPU and OS to log"
| * | | | | | Added Host CPU and OS to logpbarilla2019-09-211-0/+8
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2806 from FearlessTobi/port-4882David2019-09-217-10/+93
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port citra-emu/citra#4882: "Add frametime logging for tracking performance over time"
| * | | | | | Address review commentsFearlessTobi2019-09-102-6/+9
| | | | | | |
| * | | | | | Add frametime logging for tracking performance over timefearlessTobi2019-09-107-10/+90
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: jroweboy <jroweboy@gmail.com>
* | | | | | | Merge pull request #2872 from FernandoS27/mem-gpu-optDavid2019-09-211-2/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Core/Memory: Only FlushAndInvalidate GPU if the page is marked as RasterizerCachedMemory
| * | | | | | | Core/Memory: Only FlushAndInvalidate GPU if the page is marked as RasterizerCachedMemoryFernando Sahmkow2019-09-191-2/+7
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This commit avoids Invalidating and Flushing the GPU if the page is not marked as a RasterizerCache Page.
* | | | | | | Merge pull request #2576 from DarkLordZach/nsp-fix-1David2019-09-212-14/+39
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nsp: Fix various errors with loading and processing of extracted NSPs
| * | | | | | | nsp: Correct status codes for extracted NSPsZach Hilman2019-06-102-13/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids all extracted NSPs being marked as error file type because they don't have program NCAs.
| * | | | | | | nsp: Use title ID from NPDM metadata for extracted type NSPsZach Hilman2019-06-102-1/+22
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | Avoids 0 being used as title ID for all extracted NSPs.
* | | | | | | Merge pull request #2866 from Morph1984/checkbox_fixDavid2019-09-211-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | configure_input: Uncheck "Joycons Docked" when "Use Docked Mode" is checked
| * | | | | | | When docked mode is checked, uncheck "joycons docked"Morph2019-09-171-0/+2
| | | | | | | |
* | | | | | | | Merge pull request #2868 from ReinUsesLisp/fix-mipmapsDavid2019-09-211-2/+2
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | maxwell_to_gl: Fix mipmap filtering
| * | | | | | | maxwell_to_gl: Fix mipmap filteringReinUsesLisp2019-09-171-2/+2
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | OpenGL texture filters follow GL_<texture_filter>_MIPMAP_<mipmap_filter> but we were using them in the opposite way.
* | | | | | | Merge pull request #2879 from ogniK5377/trace-submitgpfifoDavid2019-09-211-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Mark KickOffPb & SubmitGPFIFO as trace
| * | | | | | | Mark KickOffPb & SubmitGPFIFO as traceDavid Marcec2019-09-211-4/+4
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | These functions are not stubbed and are called fairly often. Due to the nature of how often they're called, we should keep them marked as LOG_TRACE instead of LOG_DEBUG or LOG_WARNING
* | | | | | | Merge pull request #2880 from ogniK5377/drawarrays-traceDavid2019-09-211-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Mark DrawArrays as LOG_TRACE
| * | | | | | Mark DrawArrays as LOG_TRACEDavid Marcec2019-09-211-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | There's no reason to clog logs with DrawArray.
* | | | | | Merge pull request #2846 from ReinUsesLisp/fixup-viewport-indexbunnei2019-09-201-10/+14
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Avoid writing output attribute when unimplemented
| * | | | | | gl_shader_decompiler: Avoid writing output attribute when unimplementedReinUsesLisp2019-09-061-10/+14
| | | | | | |
* | | | | | | Merge pull request #2855 from ReinUsesLisp/shflbunnei2019-09-206-9/+182
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | shader_ir/warp: Implement SHFL for Nvidia devices
| * | | | | | shader_ir/warp: Implement SHFLReinUsesLisp2019-09-176-9/+182
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2784 from ReinUsesLisp/smembunnei2019-09-185-21/+81
|\ \ \ \ \ \ | |/ / / / / |/| | | | | shader_ir: Implement shared memory
| * | | | | gl_shader_decompiler: Implement shared memoryReinUsesLisp2019-09-051-0/+23
| | | | | |
| * | | | | shader_ir: Implement LD_SReinUsesLisp2019-09-051-10/+13
| | | | | | | | | | | | | | | | | | | | | | | | Loads from shared memory.
| * | | | | shader_ir: Implement ST_SReinUsesLisp2019-09-054-11/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This instruction writes to a memory buffer shared with threads within the same work group. It is known as "shared" memory in GLSL.
* | | | | | Merge pull request #2851 from ReinUsesLisp/srgbFernando Sahmkow2019-09-156-30/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_opengl: Fix sRGB blits
| * | | | | | renderer_opengl: Fix rebase mistakeReinUsesLisp2019-09-111-1/+1
| | | | | | |
| * | | | | | gl_rasterizer: Correct sRGB Fix regressionFernando Sahmkow2019-09-111-0/+12
| | | | | | |
| * | | | | | renderer_opengl: Fix sRGB blitsReinUsesLisp2019-09-116-43/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the sRGB hack of tracking if a frame used an sRGB rendertarget to apply at least once to blit the final texture as sRGB. Instead of doing this apply sRGB if the presented image has sRGB. Also enable sRGB by default on Maxwell3D registers as some games seem to assume this.
* | | | | | | Merge pull request #2824 from ReinUsesLisp/mmeFernando Sahmkow2019-09-153-4/+20
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | Revert "Revert #2466" and stub FirmwareCall 4
| * | | | | | maxwell_3d: Update firmware 4 call stub commentaryRodrigo Locatti2019-09-151-1/+2
| | | | | | |
| * | | | | | Revert "Revert #2466" and stub FirmwareCall 4ReinUsesLisp2019-09-043-4/+19
| | | | | | |
* | | | | | | Merge pull request #2857 from ReinUsesLisp/surface-srgbFernando Sahmkow2019-09-142-0/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core/surface: Add function to detect sRGB surfaces
| * | | | | | | video_core/surface: Add function to detect sRGB surfacesReinUsesLisp2019-09-132-0/+22
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This is required for proper conversion to RGBA8_UNORM or RGBA8_SRGB surfaces when a backend can target both native and converted ASTC.
* | | | | | | Merge pull request #2858 from ReinUsesLisp/vk-deviceFernando Sahmkow2019-09-144-111/+258
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vk_device: Add miscellaneous features and minor style changes
| * | | | | | | vk_device: Add miscellaneous features and minor style changesReinUsesLisp2019-09-133-111/+258
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Increase minimum Vulkan requirements * Require VK_EXT_vertex_attribute_divisor * Require depthClamp, samplerAnisotropy and largePoints features * Search and expose VK_KHR_uniform_buffer_standard_layout * Search and expose VK_EXT_index_type_uint8 * Search and expose native float16 arithmetics * Track current driver with VK_KHR_driver_properties * Query and expose SSBO alignment * Query more image formats * Improve logging overall * Minor style changes * Minor rephrasing of commentaries
| * | | | | | | externals: Update Vulkan headersReinUsesLisp2019-09-131-0/+0
| |/ / / / / /
* | | | | | | Merge pull request #2667 from DarkLordZach/profile-editorbunnei2019-09-145-10/+130
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | acc: Implement IProfileEditor interface and 'Store'/'StoreWithImage' commands
| * | | | | | | acc_su: Implement GetProfileEditor (205)Zach Hilman2019-07-033-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Takes a UUID of a user and provides and interface that allows RW access to user data/settings.
| * | | | | | | acc: Implement IProfileEditor-specific commands 'Store' and 'StoreWithImage'Zach Hilman2019-07-031-1/+73
| | | | | | | | | | | | | | | | | | | | | | | | Verified with IDA
| * | | | | | | profile_manager: Add setter for ProfileBase and ProfileDataZach Hilman2019-07-032-0/+13
| | | | | | | | | | | | | | | | | | | | | | | | Needed by IProfileEditor 'Store' and 'StoreWithImage'
| * | | | | | | acc: Add IProfileCommon for IProfile and IProfileEditorZach Hilman2019-07-031-8/+31
| | | | | | | | | | | | | | | | | | | | | | | | Since 2/3 of the commands are shared, this is likely how its done on HW.
* | | | | | | | Merge pull request #2757 from ReinUsesLisp/suatombunnei2019-09-147-69/+329
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | shader/image: Implement SUATOM and fix SUST
| * | | | | | | shader/image: Implement SUATOM and fix SUSTReinUsesLisp2019-09-117-69/+329
|/ / / / / / /
* | | | | | | Merge pull request #2823 from ReinUsesLisp/shr-clampbunnei2019-09-102-6/+17
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader/shift: Implement SHR wrapped and clamped variants
| * | | | | | | shader/shift: Implement SHR wrapped and clamped variantsReinUsesLisp2019-09-042-6/+17
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nvidia defaults to wrapped shifts, but this is undefined behaviour on OpenGL's spec. Explicitly mask/clamp according to what the guest shader requires.
* | | | | | | Merge pull request #2810 from ReinUsesLisp/mme-optbunnei2019-09-104-12/+24
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_3d: Avoid moving macro_params
| * | | | | | | maxwell_3d: Avoid moving macro_paramsReinUsesLisp2019-09-044-12/+24
| |/ / / / / /
* | | | | | | Merge pull request #2759 from ReinUsesLisp/compute-imagesFernando Sahmkow2019-09-1020-229/+457
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | gl_rasterizer: Bind images and samplers to compute
| * | | | | | gl_shader_decompiler: Keep track of written images and mark them as modifiedReinUsesLisp2019-09-067-62/+92
| | | | | | |
| * | | | | | texture_cache: Minor changesReinUsesLisp2019-09-064-19/+17
| | | | | | |
| * | | | | | gl_rasterizer: Apply textures and images stateReinUsesLisp2019-09-061-0/+2
| | | | | | |
| * | | | | | gl_rasterizer: Add samplers to compute dispatchesReinUsesLisp2019-09-062-3/+36
| | | | | | |
| * | | | | | gl_rasterizer: Minor code changesReinUsesLisp2019-09-062-20/+31
| | | | | | |
| * | | | | | gl_state: Split textures and samplers into two arraysReinUsesLisp2019-09-064-91/+39
| | | | | | |
| * | | | | | gl_rasterizer: Implement image bindingsReinUsesLisp2019-09-065-32/+106
| | | | | | |
| * | | | | | gl_state: Add support for glBindImageTexturesReinUsesLisp2019-09-062-0/+24
| | | | | | |
| * | | | | | texture_cache: Pass TIC to texture cacheReinUsesLisp2019-09-064-27/+25
| | | | | | |
| * | | | | | kepler_compute: Implement texture queriesReinUsesLisp2019-09-065-5/+99
| | | | | | |
| * | | | | | gl_rasterizer: Split SetupTexturesReinUsesLisp2019-09-062-22/+38
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2847 from VelocityRa/nro-nacp-fixDavid2019-09-092-0/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | nro/ui: Show "Developer" field in Properties
| * | | | | | nro: Implement ReadControlDataNick Renieris2019-09-072-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With this, the "Developer" field in the Properties for homebrew is now populated. Signed-off-by: Nick Renieris <velocityra@gmail.com>
* | | | | | | Merge pull request #2716 from lioncash/hle-globalDavid2019-09-0917-97/+143
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/am: Remove usages of global system accessors
| * | | | | | | service/am: Remove usages of global system accessorsLioncash2019-09-0517-97/+143
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the use of global accessors, removing the reliance on global state. This also makes dependencies explicit in the interface, as opposed to being hidden
* | | | | | | | Merge pull request #2763 from lioncash/map-physDavid2019-09-092-39/+41
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | kernel/vm_manager: Minor cleanup
| * | | | | | | kernel/vm_manager: Correct doxygen comment parameter tags for MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects the parameter names within the doxygen comments so that they resolve properly.
| * | | | | | | kernel/vm_manager: Move variables closer to usage spots in MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-16/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Narrows the scope of variables down to where they're only necessary.
| * | | | | | | kernel/vm_manager: Correct behavior in failure case of UnmapPhysicalMemory()Lioncash2019-08-301-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If an unmapping operation fails, we shouldn't be decrementing the amount of memory mapped and returning that the operation was successful. We should actually be returning the error code in this case.
| * | | | | | | kernel/vm_manager: Reserve memory ahead of time for slow path in MergeAdjacentVMALioncash2019-08-301-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially expensive (depending on the size of the memory block) allocations by reserving the necessary memory before performing both insertions. This avoids scenarios where the second insert may cause a reallocation to occur.
| * | | | | | | kernel/vm_manager: std::move shared_ptr instance in MergeAdjacentVMALioncash2019-08-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids an unnecessary atomic reference count increment and decrement.
| * | | | | | | kernel/vm_manager: Deduplicate iterator creation in MergeAdjacentVMALioncash2019-08-301-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids needing to read the same long sequence of code in both code paths. Also makes it slightly nicer to read and debug, as the locals will be able to be shown in the debugger.
| * | | | | | | kernel/vm_manager: Simplify some std::vector constructor callsLioncash2019-08-301-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, one less magic constant to read.
| * | | | | | | kernel/vm_manager: Simplify some assertion messagesLioncash2019-08-301-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Assertions already log out the function name, so there's no need to manually include the function name in the assertion strings.
* | | | | | | | Merge pull request #2804 from ReinUsesLisp/remove-gs-specialFernando Sahmkow2019-09-052-80/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_cache: Remove special casing for geometry shaders
| * | | | | | | | gl_shader_cache: Remove special casing for geometry shadersReinUsesLisp2019-09-042-80/+9
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that ProgramVariants holds the primitive topology we no longer need to keep track of individual geometry shaders topologies.
* | | | | | | | Merge pull request #2833 from ReinUsesLisp/fix-stencilbunnei2019-09-051-11/+11
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | gl_rasterizer: Fix stencil testing
| * | | | | | | gl_rasterizer: Fix stencil testingReinUsesLisp2019-09-041-11/+11
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fix stencil dirty flags tracking when stencil is disabled * Attach stencil on clears (previously it only attached depth) * Attach stencil on drawing regardless of stencil testing being enabled
* | | | | | | Merge pull request #2797 from FearlessTobi/port-4877David2019-09-051-0/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port citra-emu/citra#4877: "citra_qt: on osx chdir to bundle dir to allow detection of user folder"
| * | | | | | | Address review commentsFearlessTobi2019-09-051-1/+4
| | | | | | | |
| * | | | | | | Guard unistd.h with MacOS only macroWeiyi Wang2019-08-221-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix compile error on Windows caused by #4877 Weird, I thought I saw this guard during the code review...
| * | | | | | | citra_qt: on osx chdir to bundle dir to allow detection of user folderB3n302019-08-221-0/+6
| | | | | | | |
* | | | | | | | Merge pull request #2802 from ReinUsesLisp/hsetp2-predDavid2019-09-051-10/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | half_set_predicate: Fix HSETP2 predicate assignments
| * | | | | | | | half_set_predicate: Fix predicate assignmentsReinUsesLisp2019-09-041-10/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2418 from DarkLordZach/srv-esDavid2019-09-053-51/+536
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | es: Implement various ticket accessor commands from IEticketService
| * | | | | | | | key_manager: Convert Ticket union to std::variantZach Hilman2019-07-083-57/+88
| | | | | | | | |
| * | | | | | | | es: Populate/synthesize tickets on constructionZach Hilman2019-07-083-15/+17
| | | | | | | | |
| * | | | | | | | key_manager: Add structure for Ticket parsingZach Hilman2019-07-083-44/+194
| | | | | | | | |
| * | | | | | | | es: Implement ETicket GetPersonalizedTicketData (17)Zach Hilman2019-07-081-1/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | Copies the raw personal ticket data into the buffer provided.
| * | | | | | | | es: Implement ETicket GetCommonTicketData (16)Zach Hilman2019-07-081-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | Copies the raw common ticket data for the specified rights ID into the buffer provided.
| * | | | | | | | es: Implement ETicket GetPersonalizedTicketSize (15)Zach Hilman2019-07-081-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the size of the buffer needed to hold the personal ticket associated with the rights ID.
| * | | | | | | | es: Implement ETicket GetCommonTicketSize (14)Zach Hilman2019-07-081-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the size of the buffer needed to hold the common ticket associated with the rights ID.
| * | | | | | | | es: Implement ETicket ListPersonalizedTicket (12)Zach Hilman2019-07-081-1/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | Returns an application-specific number of entries of personal tickets, starting at offset 0.
| * | | | | | | | es: Implement ETicket ListCommonTicket (11)Zach Hilman2019-07-081-1/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | Returns an application specified count of entries of common tickets, starting at offset 0.
| * | | | | | | | es: Implement ETicket CountPersonalizedTicket (10)Zach Hilman2019-07-081-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the number of personalized (console/user-unique) tickets in the KeyManager.
| * | | | | | | | es: Implement ETicket CountCommonTicket (9)Zach Hilman2019-07-081-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the number of common (non-console-unique) tickets in the KeyManager.
| * | | | | | | | es: Implement ETicket GetTitleKey (8)Zach Hilman2019-07-081-1/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | Takes a rights ID as input and returns the associated title key, if it exists.
| * | | | | | | | es: Implement ETicket ImportTicket (1)Zach Hilman2019-07-081-1/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | Takes a ticket and certificate and installs it to the KeyManager.
| * | | | | | | | key_manager: Add accessors/helpers for ticket managementZach Hilman2019-07-082-14/+100
| | | | | | | | |
| * | | | | | | | key_manager: Add equality operator for RSAKeyPairZach Hilman2019-07-081-0/+7
| | | | | | | | |
* | | | | | | | | Merge pull request #2808 from FearlessTobi/port-4866David2019-09-051-20/+24
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4866: "configure_dialog: reverse tab map to avoid logic based on user-facing/translatable text"
| * | | | | | | | | configure_dialog: reverse tab map to avoid logic based on user-facing/translatable textfearlessTobi2019-09-041-20/+24
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Weiyi Wang <wwylele@gmail.com>
* | | | | | | | | Merge pull request #2707 from DarkLordZach/oss-miimodelDavid2019-09-054-1/+63
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | system_archive: Add open-source reimplementation of MiiModel data
| * | | | | | | | | system_archive: Add open-source reimplementation of MiiModel dataZach Hilman2019-07-104-1/+63
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2807 from FearlessTobi/port-4864David2019-09-054-33/+36
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | Port citra-emu/citra#4864: "yuzu/configure: move speed limiter to general"
| * | | | | | | | | yuzu/configure: move speed limiter to generalFearlessTobi2019-09-054-33/+36
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The speed limiter being a frame limiter is an implmentation detail and can be changed in the future. What user care about is that it limit the emulation speed in genenral (not just graphics but also audio+input) Co-Authored-By: Weiyi Wang <wwylele@gmail.com>
* | | | | | | | | Merge pull request #2830 from FearlessTobi/port-4911David2019-09-051-7/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4911: "Add cancel option to analog stick configuration"
| * | | | | | | | | Add cancel option to analog stick configurationfearlessTobi2019-09-031-7/+10
| | |_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Vitor K <vitor-k@users.noreply.github.com>
* | | | | | | | | Merge pull request #2834 from Morph1984/audrenu_QueryAudioDeviceInputEventDavid2019-09-051-1/+15
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEvent
| * | | | | | | | | Add Kernel::EventPair audio_input_device_switch_event;Morph19842019-09-041-0/+1
| | | | | | | | | |
| * | | | | | | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEventMorph19842019-09-041-1/+14
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2836 from Morph1984/hid_vibrationDavid2019-09-054-2/+32
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hid: Implement PermitVibration and IsVibrationPermitted
| * | | | | | | | | dittoMorph19842019-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: David <25727384+ogniK5377@users.noreply.github.com>
| * | | | | | | | | IsVibrationEnabled() as a const member funcMorph19842019-09-041-1/+1
| | | | | | | | | |
| * | | | | | | | | clang-formatMorph19842019-09-041-2/+2
| | | | | | | | | |
| * | | | | | | | | Update npad.hMorph19842019-09-041-0/+1
| | | | | | | | | |
| * | | | | | | | | Update npad.cppMorph19842019-09-041-0/+6
| | | | | | | | | |
| * | | | | | | | | Update hid.hMorph19842019-09-041-0/+2
| | | | | | | | | |
| * | | | | | | | | Update hid.cppMorph19842019-09-041-2/+23
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2818 from MysticExile/fmtDavid2019-09-053-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | externals: update fmt to 6.0.0
| * | | | | | | | | Fix clang-formatEthan2019-09-041-1/+1
| | | | | | | | | |
| * | | | | | | | | accommodate for fmt updateEthan2019-08-292-2/+2
| | | | | | | | | |
| * | | | | | | | | externals: update fmt to 6.0.0Ethan2019-08-291-0/+0
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2801 from ReinUsesLisp/typed-decompilerbunnei2019-09-043-431/+548
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Rework GLSL decompiler type system
| * | | | | | | | | | gl_shader_decompiler: Fixup slow pathReinUsesLisp2019-09-041-1/+1
| | | | | | | | | | |
| * | | | | | | | | | gl_device: Disable precise in fragment shaders on bugged driversReinUsesLisp2019-09-043-15/+43
| | | | | | | | | | |
| * | | | | | | | | | gl_shader_decompiler: Fixup AMD's slow path typeReinUsesLisp2019-09-041-1/+1
| | | | | | | | | | |
| * | | | | | | | | | gl_shader_decompiler: Rework GLSL decompiler type systemReinUsesLisp2019-09-041-416/+505
| | |_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GLSL decompiler type system was broken. We converted all return values to float except for some cases where returning we couldn't and implicitly broke the rule of returning floats (e.g. for bools or bool pairs). Instead of doing this introduce class Expression that knows what type a return value has and when a consumer wants to use the string it asks for it with a required type, emitting a runtime error if types are incompatible. This has the disadvantage that there's more C++ code, but we can emit better GLSL code that's easier to read.
* | | | | | | | | | AM: Stub IApplicationFunctions::GetGpuErrorDetectedSystemEvent (#2827)mailwl2019-09-042-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * AM: Implement IApplicationFunctions::GetGpuErrorDetectedSystemEvent * Remove unneeded event clear * Fix event name
* | | | | | | | | | Merge pull request #2829 from Morph1984/audiobunnei2019-09-041-2/+15
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolume
| * | | | | | | | | | remove <f32>Morph19842019-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can remove this since its already a f32 value
| * | | | | | | | | | explicitly represent 1 as a float (1.0f instead of 1)Morph19842019-09-041-1/+1
| | | | | | | | | | |
| * | | | | | | | | | Change u32 -> f32Morph19842019-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Volume is a f32 value. (SwIPC describes it as a u32, but it is actually f32 as corroborated by switchbrew docs and SetAudioDeviceOutputVolume) ```cpp const f32 volume = rp.Pop<f32>(); ```
| * | | | | | | | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolumeMorph19842019-09-031-2/+15
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2444 from FearlessTobi/port-3617-newbunnei2019-09-0445-199/+870
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | Port citra-emu/citra#3617: "QT: Add support for multiple game directories"
| * | | | | | | | | Fix uisettings includefearlessTobi2019-09-041-1/+1
| | | | | | | | | |
| * | | | | | | | | Limit the size of directory icons, fix text when icon size is nonefearlessTobi2019-09-042-4/+3
| | | | | | | | | |
| * | | | | | | | | Change QList to QVectorfearlessTobi2019-09-045-16/+19
| | | | | | | | | |
| * | | | | | | | | Separate UserNand and Sdmc directoriesfearlessTobi2019-09-045-32/+59
| | | | | | | | | |
| * | | | | | | | | Address more trivial review commentsfearlessTobi2019-09-044-25/+18
| | | | | | | | | |
| * | | | | | | | | Address trivial review commentsfearlessTobi2019-09-047-53/+59
| | | | | | | | | |
| * | | | | | | | | yuzu: Add support for multiple game directoriesfearlessTobi2019-09-0412-195/+666
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ported from https://github.com/citra-emu/citra/pull/3617.
| * | | | | | | | | Add assets and licensesfearlessTobi2019-09-0433-3/+175
|/ / / / / / / / /
* | | | | | | | | Merge pull request #2835 from chris062689/masterDavid2019-09-041-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | CI Fix (Azure/Testing) - apt update before upgrade. Use apt-get.
| * | | | | | | | | Changed apt-get upgrade for specific package.Flame Sage2019-09-041-1/+1
| | | | | | | | | |
| * | | | | | | | | apt update before upgrade. Use apt-get.Flame Sage2019-09-041-1/+1
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Identified a bug in the script which uses the azure image when attempting to upgrade python3-pip. Package index was out of date because apt-get update was not ran before attempting the upgrade.
* | | | | | | | | Merge pull request #2708 from DarkLordZach/mii-db-source-crashDavid2019-09-041-0/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | mii: Handle logging of unknown database source
| * | | | | | | | | mii: Handle logging of unknown database sourceZach Hilman2019-07-101-0/+4
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2793 from ReinUsesLisp/bgr565bunnei2019-09-0415-204/+71
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | renderer_opengl: Implement RGB565 framebuffer format
| * | | | | | | | | renderer_opengl: Implement RGB565 framebuffer formatReinUsesLisp2019-08-213-3/+9
| | | | | | | | | |
| * | | | | | | | | renderer_opengl: Use block linear swizzling for CPU framebuffersReinUsesLisp2019-08-213-150/+33
| | | | | | | | | |
| * | | | | | | | | renderer_opengl: Use VideoCore pixel formatReinUsesLisp2019-08-213-23/+11
| | | | | | | | | |
| * | | | | | | | | gpu: Change optional<reference_wrapper<T>> to T* for FramebufferConfigReinUsesLisp2019-08-2111-32/+22
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2812 from ReinUsesLisp/f2i-selectorbunnei2019-09-042-7/+23
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | shader_ir/conversion: Implement F2I and F2F F16 selector
| * | | | | | | | | | shader_ir/conversion: Split int and float selector and implement F2F H1ReinUsesLisp2019-08-282-19/+24
| | | | | | | | | | |
| * | | | | | | | | | shader_ir/conversion: Implement F2I F16 Ra.H1ReinUsesLisp2019-08-282-6/+17
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2811 from ReinUsesLisp/fsetp-fixbunnei2019-09-042-4/+6
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | float_set_predicate: Add missing negation bit for the second operand
| * | | | | | | | | | float_set_predicate: Add missing negation bit for the second operandReinUsesLisp2019-08-282-4/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2826 from ReinUsesLisp/macro-bindingbunnei2019-09-042-10/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | maxwell_3d: Fix macro binding cursor
| * | | | | | | | | | maxwell_3d: Fix macro binding cursorReinUsesLisp2019-09-012-10/+4
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #2831 from FearlessTobi/port-4914bunnei2019-09-042-0/+22
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4914: "Fix to Windows sleep issues"
| * | | | | | | | | | | Fix to Windows sleep issuesfearlessTobi2019-09-032-0/+22
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Vitor K <vitor-k@users.noreply.github.com>
* | | | | | | | | | | Merge pull request #2832 from FearlessTobi/im-an-idiotbunnei2019-09-041-0/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | configuration/config: Add missing screenshot path read
| * | | | | | | | | | configuration/config: Add missing screenshot path readfearlessTobi2019-09-041-0/+1
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I missed this in my original PR (https://github.com/yuzu-emu/yuzu/pull/1886).
* | | | | | | | | | Merge pull request #2765 from FernandoS27/dma-fixbunnei2019-09-013-23/+36
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | MaxwellDMA: Fixes, corrections and relaxations.
| * | | | | | | | | MaxwellDMA: Fixes, corrections and relaxations.Fernando Sahmkow2019-07-263-23/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit fixes offsets on Linear -> Tiled copies, corrects z pos fortiled->linear copies, corrects bytes_per_pixel calculation in tiled -> linear copies and relaxes some limitations set by latest dma fixes refactors.
* | | | | | | | | | video_core: Silent miscellaneous warnings (#2820)Rodrigo Locatti2019-08-3023-48/+22
| |_|_|_|_|_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * texture_cache/surface_params: Remove unused local variable * rasterizer_interface: Add missing documentation commentary * maxwell_dma: Remove unused rasterizer reference * video_core/gpu: Sort member declaration order to silent -Wreorder warning * fermi_2d: Remove unused MemoryManager reference * video_core: Silent unused variable warnings * buffer_cache: Silent -Wreorder warnings * kepler_memory: Remove unused MemoryManager reference * gl_texture_cache: Add missing override * buffer_cache: Add missing include * shader/decode: Remove unused variables
* | | | | | | | | Merge pull request #2819 from ReinUsesLisp/fixup-clangFernando Sahmkow2019-08-301-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_buffer_cache: Add missing include
| * | | | | | | | | gl_buffer_cache: Add missing includeReinUsesLisp2019-08-301-0/+1
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | RasterizerInterface was considered an incomplete object by clang.
* | | | | | | | | Merge pull request #2742 from ReinUsesLisp/fix-texture-buffersbunnei2019-08-294-4/+12
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | gl_texture_cache: Miscellaneous texture buffer fixes
| * | | | | | | | gl_shader_decompiler: Rename bufferImage to imageBufferReinUsesLisp2019-07-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The online OpenGL documentation is wrong. The type definition is imageBuffer.
| * | | | | | | | gl_shader_cache: Fix newline on buffer preprocessor definitionsReinUsesLisp2019-07-181-2/+6
| | | | | | | | |
| * | | | | | | | textures: Fix texture buffer size calculationReinUsesLisp2019-07-181-1/+1
| | | | | | | | |
| * | | | | | | | gl_texture_cache: Do not set texture parameters to buffersReinUsesLisp2019-07-181-0/+3
| | | | | | | | |
| * | | | | | | | gl_texture_cache: Add missing break in CreateTextureReinUsesLisp2019-07-181-0/+1
| | | | | | | | |
* | | | | | | | | Revert "externals: Update FMT to 6.0.0"James Rowe2019-08-291-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit ca4ca8a6dc41207de99f67de1931579ceb4d9660.
* | | | | | | | | externals: Update FMT to 6.0.0Ethan2019-08-291-0/+0
| | | | | | | | |
* | | | | | | | | Merge pull request #2783 from FernandoS27/new-buffer-cachebunnei2019-08-299-330/+684
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Implement a New LLE Buffer Cache
| * | | | | | | | | Buffer Cache: Adress Feedback.Fernando Sahmkow2019-08-212-7/+6
| | | | | | | | | |
| * | | | | | | | | Buffer_Cache: Implement flushing.Fernando Sahmkow2019-08-212-1/+30
| | | | | | | | | |
| * | | | | | | | | Buffer_Cache: Implement barriers.Fernando Sahmkow2019-08-211-0/+4
| | | | | | | | | |
| * | | | | | | | | Buffer_Cache: Optimize and track written areas.Fernando Sahmkow2019-08-212-12/+104
| | | | | | | | | |
| * | | | | | | | | BufferCache: Rework mapping caching.Fernando Sahmkow2019-08-212-49/+76
| | | | | | | | | |
| * | | | | | | | | Buffer_Cache: Fixes and optimizations.Fernando Sahmkow2019-08-212-68/+38
| | | | | | | | | |
| * | | | | | | | | Video_Core: Implement a new Buffer CacheFernando Sahmkow2019-08-219-327/+560
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2758 from ReinUsesLisp/packed-tidbunnei2019-08-293-0/+15
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | shader/decode: Implement S2R Tic
| * | | | | | | | | shader/decode: Implement S2R TicReinUsesLisp2019-07-223-0/+15
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2786 from ReinUsesLisp/votebunnei2019-08-2913-1/+164
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | shader_ir: Implement VOTE on Nvidia drivers
| * | | | | | | | | shader_ir: Implement VOTEReinUsesLisp2019-08-2113-1/+164
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implement VOTE using Nvidia's intrinsics. Documentation about these can be found here https://developer.nvidia.com/reading-between-threads-shader-intrinsics Instead of using portable ARB instructions I opted to use Nvidia intrinsics because these are the closest we have to how Tegra X1 hardware renders. To stub VOTE on non-Nvidia drivers (including nouveau) this commit simulates a GPU with a warp size of one, returning what is meaningful for the instruction being emulated: * anyThreadNV(value) -> value * allThreadsNV(value) -> value * allThreadsEqualNV(value) -> true ballotARB, also known as "uint64_t(activeThreadsNV())", emits VOTE.ANY Rd, PT, PT; on nouveau's compiler. This doesn't match exactly to Nvidia's code VOTE.ALL Rd, PT, PT; Which is emulated with activeThreadsNV() by this commit. In theory this shouldn't really matter since .ANY, .ALL and .EQ affect the predicates (set to PT on those cases) and not the registers.
* | | | | | | | | Merge pull request #2748 from FernandoS27/align-memorybunnei2019-08-2115-37/+119
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | VM_Manager: Align allocated host physical memory to 256bytes
| * | | | | | | | | Common/Alignment: Add noexcept where required.Fernando Sahmkow2019-07-201-5/+5
| | | | | | | | | |
| * | | | | | | | | Kernel: Address FeedbackFernando Sahmkow2019-07-193-6/+11
| | | | | | | | | |
| * | | | | | | | | Common: Correct alignment allocator to work on C++14 or higher.Fernando Sahmkow2019-07-191-37/+19
| | | | | | | | | |
| * | | | | | | | | VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-1915-36/+131
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit ensures that all backing memory allocated for the Guest CPU is aligned to 256 bytes. This due to how gpu memory works and the heavy constraints it has in the alignment of physical memory.
* | | | | | | | | | Merge pull request #2769 from FernandoS27/commands-flushbunnei2019-08-216-0/+15
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | GPU: Flush commands on every dma pusher step.
| * | | | | | | | | | GPU: Flush commands on every dma pusher step.Fernando Sahmkow2019-07-266-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit ensures that the host gpu is constantly fed with commands to work with, while the guest gpu keeps producing the rest of the commands. This reduces syncing time between host and guest gpu.
* | | | | | | | | | | Merge pull request #2777 from ReinUsesLisp/hsetp2-fe3h-fixbunnei2019-08-211-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | half_set_predicate: Fix HSETP2_C constant buffer offset
| * | | | | | | | | | | half_set_predicate: Fix HSETP2_C constant buffer offsetReinUsesLisp2019-08-041-1/+1
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2753 from FernandoS27/float-convertbunnei2019-08-215-18/+75
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Shader_Ir: Implement F16 Variants of F2F, F2I, I2F.
| * | | | | | | | | | | | Shader_Ir: Implement F16 Variants of F2F, F2I, I2F.Fernando Sahmkow2019-07-205-18/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit takes care of implementing the F16 Variants of the conversion instructions and makes sure conversions are done.
* | | | | | | | | | | | | Merge pull request #2773 from lioncash/test-unusedbunnei2019-08-211-2/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | | yuzu-tester/yuzu: Remove unused variable
| * | | | | | | | | | | | yuzu-tester/yuzu: Correct format stringLioncash2019-07-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents an invalid formatting exception from being thrown.
| * | | | | | | | | | | | yuzu-tester/yuzu: Remove unused variableLioncash2019-07-301-1/+0
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of a compilation warning.
* | | | | | | | | | | | Merge pull request #2747 from lioncash/audiobunnei2019-08-187-108/+179
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service/audren_u: Unstub ListAudioDeviceName
| * | | | | | | | | | | | service/audren_u: Handle audio USB output revision queries in ListAudioDeviceName()Lioncash2019-07-192-16/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Audio devices use the supplied revision information in order to determine if USB audio output is able to be supported. In this case, we can only really handle using this revision information in ListAudioDeviceName(), where it checks if USB audio output is supported before supplying it as a device name. A few other scenarios exist where the revision info is checked, such as: - Early exiting from SetAudioDeviceOutputVolume if USB audio is attempted to be set when that device is unsupported. - Early exiting and returning 0.0f in GetAudioDeviceOutputVolume when USB output volume is queried and it's an unsupported device. - Falling back to AHUB headphones in GetActiveAudioDeviceName when the device type is USB output, but is unsupported based off the revision info. In order for these changes to also be implemented, a few other changes to the interface need to be made. Given we now properly handle everything about ListAudioDeviceName(), we no longer need to describe it as a stubbed function.
| * | | | | | | | | | | | service/audren_u: Move revision testing code out of AudRenULioncash2019-07-192-63/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The revision querying facilities are used by more than just audren. e.g. audio devices can use this to test whether or not USB audio output is supported. This will be used within the following change.
| * | | | | | | | | | | | service/audio: Remove global system accessorsLioncash2019-07-197-34/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Trims out the lingering reliance on global state out of the audio code.
| * | | | | | | | | | | | service/audren_u: Remove unnecessary return value from GetActiveAudioDeviceName()Lioncash2019-07-191-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function only ever returns a result and nothing more.
| * | | | | | | | | | | | service/audren_u: Report proper device namesLioncash2019-07-191-6/+29
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AudioDevice and AudioInterface aren't valid device names on the Switch. We should also be returning consistent names in GetActiveAudioDeviceName(). While we're at it, we can also handle proper name output in ListAudioDeviceName, by returning all the available devices on the Switch.
* | | | | | | | | | | | Merge pull request #2778 from ReinUsesLisp/nopbunnei2019-08-182-0/+13
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | shader_ir: Implement NOP
| * | | | | | | | | | | | shader_ir: Implement NOPReinUsesLisp2019-08-042-0/+13
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2768 from ReinUsesLisp/hsetp2-fixbunnei2019-08-181-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | decode/half_set_predicate: Fix predicates
| * | | | | | | | | | | | decode/half_set_predicate: Fix predicatesReinUsesLisp2019-07-261-3/+3
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2789 from jroweboy/quickfixJames Rowe2019-08-171-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixup! #2772 missed this one file
| * | | | | | | | | | | | | Fixup! #2772 missed this one fileJames Rowe2019-08-171-1/+1
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2766 from FearlessTobi/port-4849James Rowe2019-08-177-21/+21
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4849: "Qt: Fixed behaviour of buttons by connecting functors to correct signals"
| * | | | | | | | | | | | | Qt: Fixed behaviour of buttons by connecting functors to correct signalsSilent2019-08-027-21/+21
| | |_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Following screens got fixes: - Configure/Debug - Configure/Input
* | | | | | | | | | | | | Merge pull request #2772 from lioncash/uiJames Rowe2019-08-1716-44/+39
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | | yuzu/CMakeLists: Remove qt5_wrap_ui macro usage
| * | | | | | | | | | | | yuzu/CMakeLists: Remove qt5_wrap_ui macro usageLioncash2019-08-0916-44/+39
| | |_|_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can simply enable CMAKE_AUTOUIC and let CMake take care of handling the UI code generation for targets. As part of letting CMake automatically handle the header file parsing, we must not name includes with "ui_*" unless they're related to the output of the Qt UIC compiler. Because of this, we need to rename ui_settings, given it would conflict with this restriction.
* | | | | | | | | | | | Merge pull request #2770 from DarkLordZach/azure-pr-fixFlame Sage2019-08-025-9/+17
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | ci: Fix Azure PR Builds
| * | | | | | | | | | | Correct apt permissionsZach Hilman2019-08-021-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | Upgrade PIP version with APTZach Hilman2019-08-021-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | Upgrade pip versionZach Hilman2019-08-021-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | Add missing dotZach Hilman2019-08-021-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | ci: Fix Azure PR BuildsZach Hilman2019-07-285-8/+16
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2592 from FernandoS27/sync1bunnei2019-07-2644-229/+732
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | Implement GPU Synchronization Mechanisms & Correct NVFlinger
| * | | | | | | | | | NVServices: Correct delayed responses.Fernando Sahmkow2019-07-051-24/+19
| | | | | | | | | | |
| * | | | | | | | | | Nv_Host_Ctrl: Correct difference calculationFernando Sahmkow2019-07-051-5/+7
| | | | | | | | | | |
| * | | | | | | | | | NVServices: Address FeedbackFernando Sahmkow2019-07-058-21/+38
| | | | | | | | | | |
| * | | | | | | | | | NVServices: Styling, define constructors as explicit and correctionsFernando Sahmkow2019-07-0524-65/+73
| | | | | | | | | | |
| * | | | | | | | | | NVFlinger: Correct GCC compile errorFernando Sahmkow2019-07-058-23/+22
| | | | | | | | | | |
| * | | | | | | | | | NVServices: Make NVEvents Automatic according to documentation.Fernando Sahmkow2019-07-054-7/+13
| | | | | | | | | | |
| * | | | | | | | | | NVServices: Correct CtrlEventWaitSync to block the ipc until timeout.Fernando Sahmkow2019-07-0523-31/+104
| | | | | | | | | | |
| * | | | | | | | | | GPU: Correct Interrupts to interrupt on syncpt/value instead of event, mirroring hardwareFernando Sahmkow2019-07-0512-48/+45
| | | | | | | | | | |
| * | | | | | | | | | nvflinger: Make the force 30 fps still force 30 fpsFernando Sahmkow2019-07-051-1/+1
| | | | | | | | | | |
| * | | | | | | | | | nv_services: Fixes to event liberation.Fernando Sahmkow2019-07-051-6/+14
| | | | | | | | | | |
| * | | | | | | | | | nvflinger: Acquire buffers in the same order as they were queued.Fernando Sahmkow2019-07-052-3/+11
| | | | | | | | | | |
| * | | | | | | | | | nv_services: Deglobalize NvServicesFernando Sahmkow2019-07-0523-51/+65
| | | | | | | | | | |
| * | | | | | | | | | gpu_asynch: Simplify synchronization to a simpler consumer->producer scheme.Fernando Sahmkow2019-07-052-47/+3
| | | | | | | | | | |
| * | | | | | | | | | nv_host_ctrl: Make Sync GPU variant always return synced result.Fernando Sahmkow2019-07-055-5/+16
| | | | | | | | | | |
| * | | | | | | | | | Async GPU: do invalidate as synced operationFernando Sahmkow2019-07-051-6/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Async GPU: Always invalidate synced.
| * | | | | | | | | | Gpu: use an std mutex instead of a spin_lock to guard syncpointsFernando Sahmkow2019-07-052-6/+6
| | | | | | | | | | |
| * | | | | | | | | | nvhost_ctrl: Corrections to event handlingFernando Sahmkow2019-07-052-8/+12
| | | | | | | | | | |
| * | | | | | | | | | Gpu: Mark areas as protected.Fernando Sahmkow2019-07-053-0/+19
| | | | | | | | | | |
| * | | | | | | | | | nv_services: Stub CtrlEventSignalFernando Sahmkow2019-07-054-13/+48
| | | | | | | | | | |
| * | | | | | | | | | Gpu: Implement Hardware Interrupt Manager and manage GPU interruptsFernando Sahmkow2019-07-0513-13/+90
| | | | | | | | | | |
| * | | | | | | | | | nv_services: Implement NvQueryEvent, NvCtrlEventWait, NvEventRegister, NvEventUnregisterFernando Sahmkow2019-07-057-17/+192
| | | | | | | | | | |
| * | | | | | | | | | nv_services: Create GPU channels correctlyFernando Sahmkow2019-07-052-2/+5
| | | | | | | | | | |
| * | | | | | | | | | video_core: Implement GPU side SyncpointsFernando Sahmkow2019-07-056-9/+84
| | | | | | | | | | |
| * | | | | | | | | | nv_services: Correct buffer queue fencing and GPFifo fencingFernando Sahmkow2019-07-058-57/+70
| | | | | | | | | | |
| * | | | | | | | | | nvflinger: Implement swap intervalsFernando Sahmkow2019-07-055-8/+21
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #2739 from lioncash/cflowbunnei2019-07-254-33/+53
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | video_core/control_flow: Minor changes/warning cleanup
| * | | | | | | | | | | video_core/control_flow: Provide operator!= for types with operator==Lioncash2019-07-191-4/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides operational symmetry for the respective structures.
| * | | | | | | | | | | video_core/control_flow: Prevent sign conversion in TryGetBlock()Lioncash2019-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The return value is a u32, not an s32, so this would result in an implicit signedness conversion.
| * | | | | | | | | | | video_core/control_flow: Remove unnecessary BlockStack copy constructorLioncash2019-07-191-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the default behavior of the copy constructor, so it doesn't need to be specified. While we're at it we can make the other non-default constructor explicit.
| * | | | | | | | | | | video_core/control_flow: Use std::move where applicableLioncash2019-07-191-10/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Results in less work being done where avoidable.
| * | | | | | | | | | | video_core/control_flow: Use the prefix variant of operator++ for iteratorsLioncash2019-07-191-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same thing, but potentially allows a standard library implementation to pick a more efficient codepath.
| * | | | | | | | | | | video_core/control_flow: Use empty() member function for checking emptinessLioncash2019-07-191-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's what it's there for.
| * | | | | | | | | | | video_core: Resolve -Wreorder warningsLioncash2019-07-192-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that the constructor members are always initialized in the order that they're declared in.
| * | | | | | | | | | | video_core/control_flow: Make program_size for ScanFlow() a std::size_tLioncash2019-07-192-5/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents a truncation warning from occurring with MSVC. Also the internal data structures already treat it as a size_t, so this is just a discrepancy in the interface.
| * | | | | | | | | | | video_core/control_flow: Place all internally linked types/functions within an anonymous namespaceLioncash2019-07-191-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, quite a few functions were being linked with external linkage.
| * | | | | | | | | | | video_core/shader/decode: Prevent sign-conversion warningsLioncash2019-07-191-2/+2
| | |_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it explicit that the conversions here are intentional.
* | | | | | | | | | | Merge pull request #2737 from FernandoS27/track-fixbunnei2019-07-251-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Shader_Ir: Correct tracking to track from right to left
| * | | | | | | | | | | Shader_Ir: Correct tracking to track from right to leftFernando Sahmkow2019-07-161-2/+2
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2689 from lioncash/tlbunnei2019-07-251-7/+8
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu/main: Make error messages within OnCoreError more localization-friendly
| * | | | | | | | | | | | yuzu/main: Make error messages within OnCoreError more localization-friendlyLioncash2019-07-071-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, a translated string was being appended onto another string in a manner that doesn't allow the translator to control where the appended text is placed. This can be a nuisance for languages where grammar and text ordering differs from English. We now append the strings via the format strings themselves, which allows translators to reorder where the text will be placed.
* | | | | | | | | | | | | Merge pull request #2743 from FernandoS27/surpress-assertbunnei2019-07-259-29/+36
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | | Downgrade and suppress a series of GPU asserts and debug messages.
| * | | | | | | | | | | | Shader_Ir: Change Debug Asserts for Log WarningsFernando Sahmkow2019-07-203-10/+17
| | | | | | | | | | | | |
| * | | | | | | | | | | | Shader_Ir: correct clang formatFernando Sahmkow2019-07-181-2/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | GPU: Add missing puller methods.Fernando Sahmkow2019-07-182-14/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds some missing puller methods. We don't assert them as these are nop operations for us.
| * | | | | | | | | | | | MaxwellDMA/KeplerCopy: Downgrade DMA log message to Trace.Fernando Sahmkow2019-07-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This log was just to know which games used DMA. It's no longer important.
| * | | | | | | | | | | | Gl_Texture_Cache: Remove assert on component type in GetFormatTupleFernando Sahmkow2019-07-181-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Textures can have different components types in different orders. This assert was completely inprecise and the effectiveness of such is better handled by case and within the texture cache.
| * | | | | | | | | | | | Shader_Ir: Downgrade precision and rounding asserts to debug asserts.Fernando Sahmkow2019-07-185-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit reduces the sevirity of asserts for FP precision and rounding as this are well known and have little to no consequences in gpu's accuracy.
* | | | | | | | | | | | | Merge pull request #2704 from FernandoS27/conditionalbunnei2019-07-243-2/+100
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | maxwell3d: Implement Conditional Rendering
| * | | | | | | | | | | | | maxwell3d: Implement Conditional RenderingFernando Sahmkow2019-07-173-2/+100
| | |_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Conditional Rendering takes care of conditionaly clearing or drawing depending on a set of queries. This PR implements the query checks to stablish if things can be rendered or not.
* | | | | | | | | | | | | Fix README change mistake (#2754)Zach Hilman2019-07-243-5/+7
| |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | Fix README change mistake
* | | | | | | | | | | | Merge pull request #2734 from ReinUsesLisp/compute-shadersbunnei2019-07-2215-140/+357
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Implement compute shaders
| * | | | | | | | | | | | gl_shader_cache: Fix clang-format issuesReinUsesLisp2019-07-162-4/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | gl_shader_decompiler: Stub local memory sizeReinUsesLisp2019-07-151-8/+14
| | | | | | | | | | | | |
| * | | | | | | | | | | | gl_shader_cache: Address review commentariesReinUsesLisp2019-07-154-13/+12
| | | | | | | | | | | | |
| * | | | | | | | | | | | gl_shader_cache: Address CI issuesReinUsesLisp2019-07-152-3/+3
| | | | | | | | | | | | |
| * | | | | | | | | | | | gl_rasterizer: Implement compute shadersReinUsesLisp2019-07-1515-136/+350
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2735 from FernandoS27/pipeline-reworkbunnei2019-07-2114-116/+528
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rework Dirty Flags in GPU Pipeline, Optimize CBData and Redo Clearing mechanism
| * | | | | | | | | | | | | Maxwell3D: Reorganize and address feedbackFernando Sahmkow2019-07-203-20/+33
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | GL_State: Feedback and fixesFernando Sahmkow2019-07-174-14/+27
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Maxwell3D: Address FeedbackFernando Sahmkow2019-07-175-17/+13
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Texture_Cache: Rebase FixesFernando Sahmkow2019-07-171-6/+0
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | GL_Rasterizer: Corrections to Clearing.Fernando Sahmkow2019-07-174-12/+28
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Maxwell3D: Correct marking dirtiness on CB uploadFernando Sahmkow2019-07-171-0/+1
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | GL_Rasterizer: Rework RenderTarget/DepthBuffer clearingFernando Sahmkow2019-07-173-7/+63
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Maxwell3D: Implement State Dirty Flags.Fernando Sahmkow2019-07-176-44/+199
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Maxwell3D: Rework CBData UploadFernando Sahmkow2019-07-172-8/+45
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Maxwell3D: Rework the dirty system to be more consistant and scaleableFernando Sahmkow2019-07-1710-80/+211
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Update README.mdZach Hilman2019-07-211-1/+1
| |_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2693 from ReinUsesLisp/hsetp2Fernando Sahmkow2019-07-205-61/+70
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | shader/half_set_predicate: Implement missing HSETP2 variants
| * | | | | | | | | | | | shader/half_set_predicate: Fix HSETP2 implementationReinUsesLisp2019-07-204-44/+23
| | | | | | | | | | | | |
| * | | | | | | | | | | | shader/half_set_predicate: Implement missing HSETP2 variantsReinUsesLisp2019-07-202-19/+49
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Update README.mdFlame Sage2019-07-201-1/+1
| | | | | | | | | | | |
* | | | | | | | | | | | Update README.mdFlame Sage2019-07-201-0/+1
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2752 from DarkLordZach/masterFlame Sage2019-07-203-31/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | azure: Fix clang-format and releases
| * | | | | | | | | | | azure: Fix clang-format and releasesZach Hilman2019-07-203-31/+2
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2687 from lioncash/tls-processbunnei2019-07-183-14/+30
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | kernel/process: Allocate the process' TLS region during initialization
| * | | | | | | | | | | kernel/process: Allocate the process' TLS region during initializationLioncash2019-07-073-3/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prior to execution within a process beginning, the process establishes its own TLS region for uses (as far as I can tell) related to exception handling. Now that TLS creation was decoupled from threads themselves, we can add this behavior to our Process class. This is also good, as it allows us to remove a stub within svcGetInfo, namely querying the address of that region.
| * | | | | | | | | | | kernel/process: Move main thread stack allocation to its own functionLioncash2019-07-072-12/+17
| | |_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps this particular set of behavior isolated to its own function.
* | | | | | | | | | | Merge pull request #2738 from lioncash/shader-irbunnei2019-07-188-99/+103
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | shader-ir: Minor cleanup-related changes
| * | | | | | | | | | shader_ir: std::move Node instance where applicableLioncash2019-07-174-60/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are std::shared_ptr instances underneath the hood, which means copying them isn't as cheap as a regular pointer. Particularly so on weakly-ordered systems. This avoids atomic reference count increments and decrements where they aren't necessary for the core set of operations.
| * | | | | | | | | | shader_ir: Rename Get/SetTemporal to Get/SetTemporaryLioncash2019-07-175-36/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is more accurate in terms of describing what the functions are actually doing. Temporal relates to time, not the setting of a temporary itself.
| * | | | | | | | | | shader_ir: Remove unused includesLioncash2019-07-171-3/+0
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes unnecessary header dependencies.
* | | | | | | | | | Merge pull request #2741 from FernandoS27/trace-logDavid2019-07-181-4/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | Kernel: Downgrade WaitForAddress and SignalToAddress messages to Trace.
| * | | | | | | | | Kernel: Downgrade WaitForAddress and SignalToAddress messages to Trace.Fernando Sahmkow2019-07-181-4/+4
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This messages were originally set as warnning since few games used these svcs and it was needed for debugging. This is no longer the case.
* | | | | | | | | Merge pull request #2740 from lioncash/braFernando Sahmkow2019-07-171-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | shader/decode/other: Correct branch indirect argument within BRA handling
| * | | | | | | | | shader/decode/other: Correct branch indirect argument within BRA handlingLioncash2019-07-161-1/+1
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This appears to have been a copy/paste error introduced within 8a6fc529a968e007f01464abadd32f9b5eb0a26c
* | | | | | | | | Merge pull request #2726 from lioncash/accessRodrigo Locatti2019-07-172-7/+6
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | core: Remove CurrentArmInterface() global accessor
| * | | | | | | | core: Remove CurrentArmInterface() global accessorLioncash2019-07-132-7/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Replaces the final usage of the global accessor function and removes it. Removes one more enabler of global state.
* | | | | | | | | Merge pull request #2565 from ReinUsesLisp/track-indirectFernando Sahmkow2019-07-166-35/+36
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | shader/track: Track indirect buffers
| * | | | | | | | shader: Allow tracking of indirect buffers without variable offsetReinUsesLisp2019-07-156-35/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While changing this code, simplify tracking code to allow returning the base address node, this way callers don't have to manually rebuild it on each invocation.
* | | | | | | | | Merge pull request #2695 from ReinUsesLisp/layer-viewportFernando Sahmkow2019-07-1510-40/+137
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement gl_ViewportIndex and gl_Layer in vertex shaders
| * | | | | | | | | gl_shader_decompiler: Fix gl_PointSize redeclarationReinUsesLisp2019-07-111-1/+1
| | | | | | | | | |
| * | | | | | | | | gl_shader_decompiler: Fix conditional usage of GL_ARB_shader_viewport_layer_arrayReinUsesLisp2019-07-111-2/+3
| | | | | | | | | |
| * | | | | | | | | gl_shader_decompiler: Implement gl_ViewportIndex and gl_Layer in vertex shadersReinUsesLisp2019-07-0810-40/+136
| | |_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit implements gl_ViewportIndex and gl_Layer in vertex and geometry shaders. In the case it's used in a vertex shader, it requires ARB_shader_viewport_layer_array. This extension is available on AMD and Nvidia devices (mesa and proprietary drivers), but not available on Intel on any platform. At the moment of writing this description I don't know if this is a hardware limitation or a driver limitation. In the case that ARB_shader_viewport_layer_array is not available, writes to these registers on a vertex shader are ignored, with the appropriate logging.
* | | | | | | | | Merge pull request #2705 from FernandoS27/tex-cache-fixesbunnei2019-07-157-22/+58
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | GPU: Fixes to Texture Cache and Include Microprofiles for GL State/BufferCopy/Macro Interpreter
| * | | | | | | | Texture_Cache: Address FeedbackFernando Sahmkow2019-07-143-13/+17
| | | | | | | | |
| * | | | | | | | Texture_Cache: Remove some unprecise fallback case and clang formatFernando Sahmkow2019-07-142-13/+5
| | | | | | | | |
| * | | | | | | | Texture_Cache: Force Framebuffer reset if an active render target is unregistered.Fernando Sahmkow2019-07-143-10/+36
| | | | | | | | |
| * | | | | | | | GPU: Add a microprofile for macro interpreterFernando Sahmkow2019-07-142-1/+6
| | | | | | | | |
| * | | | | | | | GL_State: Add a microprofile timer to OpenGL state.Fernando Sahmkow2019-07-141-0/+4
| | | | | | | | |
| * | | | | | | | Gl_Texture_Cache: Measure Buffer Copy TimesFernando Sahmkow2019-07-141-0/+2
| | | | | | | | |
| * | | | | | | | Texture_Cache: Correct Linear Structural Match.Fernando Sahmkow2019-07-141-3/+6
| | | | | | | | |
* | | | | | | | | Merge pull request #2675 from ReinUsesLisp/opengl-buffer-cachebunnei2019-07-1516-407/+537
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | buffer_cache: Implement a generic buffer cache and its OpenGL backend
| * | | | | | | | buffer_cache: Avoid [[nodiscard]] to make clang-format happyReinUsesLisp2019-07-061-5/+4
| | | | | | | | |
| * | | | | | | | buffer_cache: Try to fix MinGW buildReinUsesLisp2019-07-061-1/+1
| | | | | | | | |
| * | | | | | | | gl_rasterizer: Fix nullptr dereference on disabled buffersReinUsesLisp2019-07-063-5/+5
| | | | | | | | |
| * | | | | | | | gl_rasterizer: Minor style changesReinUsesLisp2019-07-064-32/+22
| | | | | | | | |
| * | | | | | | | gl_rasterizer: Fix vertex and index data invalidationsReinUsesLisp2019-07-064-8/+67
| | | | | | | | |
| * | | | | | | | gl_buffer_cache: Implement with generic buffer cacheReinUsesLisp2019-07-068-291/+92
| | | | | | | | |
| * | | | | | | | buffer_cache: Implement a generic buffer cacheReinUsesLisp2019-07-062-0/+301
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements a templated class with a similar approach to our current generic texture cache. It is designed to be compatible with Vulkan and OpenGL,
| * | | | | | | | gl_buffer_cache: Remove global system gettersReinUsesLisp2019-07-063-9/+14
| | | | | | | | |
| * | | | | | | | gl_device: Query SSBO alignmentReinUsesLisp2019-07-062-0/+6
| | | | | | | | |
| * | | | | | | | gl_buffer_cache: Implement flushingReinUsesLisp2019-07-062-2/+11
| | | | | | | | |
| * | | | | | | | gl_rasterizer: Drop gl_global_cache in favor of gl_buffer_cacheReinUsesLisp2019-07-067-206/+35
| | | | | | | | |
| * | | | | | | | gl_buffer_cache: Rework to support internalized buffersReinUsesLisp2019-07-063-65/+174
| | | | | | | | |
| * | | | | | | | gl_buffer_cache: Store in CachedBufferEntry the used buffer handleReinUsesLisp2019-07-062-23/+30
| | | | | | | | |
| * | | | | | | | gl_buffer_cache: Return used buffer from Upload functionReinUsesLisp2019-07-064-36/+35
| | | | | | | | |
| * | | | | | | | gl_rasterizer: Add some commentariesReinUsesLisp2019-07-061-0/+5
| | | | | | | | |
| * | | | | | | | gl_rasterizer: Make DrawParameters rasterizer instance constReinUsesLisp2019-07-061-1/+1
| | | | | | | | |
| * | | | | | | | gl_rasterizer: Move index buffer uploading to its own methodReinUsesLisp2019-07-062-7/+18
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2690 from SciresM/physmem_fixesFernando Sahmkow2019-07-1411-45/+507
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implement MapPhysicalMemory/UnmapPhysicalMemory
| * | | | | | | | Remove unicorn mappings/unmappingsMichael Scire2019-07-121-19/+0
| | | | | | | | |
| * | | | | | | | prefer system reference over global accessorMichael Scire2019-07-093-9/+13
| | | | | | | | |
| * | | | | | | | Prevent merging of device mapped memory blocks.Michael Scire2019-07-092-1/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This sets the DeviceMapped attribute for GPU-mapped memory blocks, and prevents merging device mapped blocks. This prevents memory mapped from the gpu from having its backing address changed by block coalesce.
| * | | | | | | | Remove unused member function declarationMichael Scire2019-07-071-9/+0
| | | | | | | | |
| * | | | | | | | physmem: add helpers, cleanup logic.Michael Scire2019-07-072-171/+170
| | | | | | | | |
| * | | | | | | | clang-format fixesMichael Scire2019-07-072-3/+3
| | | | | | | | |
| * | | | | | | | address review commentaryMichael Scire2019-07-075-36/+42
| | | | | | | | |
| * | | | | | | | Implement MapPhysicalMemory/UnmapPhysicalMemoryMichael Scire2019-07-078-21/+475
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implements svcMapPhysicalMemory/svcUnmapPhysicalMemory for Yuzu, which can be used to map memory at a desired address by games since 3.0.0. It also properly parses SystemResourceSize from NPDM, and makes information available via svcGetInfo. This is needed for games like Super Smash Bros. and Diablo 3 -- this PR's implementation does not run into the "ASCII reads" issue mentioned in the comments of #2626, which was caused by the following bugs in Yuzu's memory management that this PR also addresses: * Yuzu's memory coalescing does not properly merge blocks. This results in a polluted address space/svcQueryMemory results that would be impossible to replicate on hardware, which can lead to game code making the wrong assumptions about memory layout. * This implements better merging for AllocatedMemoryBlocks. * Yuzu's implementation of svcMirrorMemory unprotected the entire virtual memory range containing the range being mirrored. This could lead to games attempting to map data at that unprotected range/attempting to access that range after yuzu improperly unmapped it. * This PR fixes it by simply calling ReprotectRange instead of Reprotect.
* | | | | | | | Merge pull request #2692 from ReinUsesLisp/tlds-f16Fernando Sahmkow2019-07-142-2/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader/texture: Add F16 support for TLDS
| * | | | | | | | shader/texture: Add F16 support for TLDSReinUsesLisp2019-07-072-2/+9
| |/ / / / / / /
* | | | | | | | Merge pull request #2730 from DarkLordZach/masterFlame Sage2019-07-1429-35/+572
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Finalize Azure Pipelines Definitions
| * | | | | | | Finalize Azure Pipelines DefinitionsZach Hilman2019-07-1429-35/+572
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | d
* | | | | | | | Merge pull request #2725 from ogniK5377/mult-audbufferZach Hilman2019-07-124-7/+12
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | "AudioRenderer" thread should have a unique name
| * | | | | | | Clang formatDavid Marcec2019-07-123-4/+8
| | | | | | | |
| * | | | | | | Addressed issuesDavid Marcec2019-07-122-2/+2
| | | | | | | |
| * | | | | | | "AudioRenderer" thread should have a unique nameDavid Marcec2019-07-124-7/+8
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Creating multiple "AudioRenderer" threads cause the previous thread to be overwritten. The thread will name be renamed to AudioRenderer-InstanceX, where X is the current instance number.
* | | | | | | Merge pull request #2609 from FernandoS27/new-scanbunnei2019-07-1116-122/+776
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement a New Shader Scanner, Decompile Flow Stack and implement BRX BRA.CC
| * | | | | | | shader_ir: Add comments on missing instruction.Fernando Sahmkow2019-07-092-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also shows Nvidia's address space on comments.
| * | | | | | | shader_ir: limit explorastion to best known program size.Fernando Sahmkow2019-07-091-1/+1
| | | | | | | |
| * | | | | | | control_flow: Correct block breaking algorithm.Fernando Sahmkow2019-07-091-17/+17
| | | | | | | |
| * | | | | | | control_flow: Assert shaders bigger than limit.Fernando Sahmkow2019-07-091-0/+2
| | | | | | | |
| * | | | | | | control_flow: Address feedback.Fernando Sahmkow2019-07-091-89/+37
| | | | | | | |
| * | | | | | | shader_ir: Correct parsing of scheduling instructions and correct sizingFernando Sahmkow2019-07-092-13/+30
| | | | | | | |
| * | | | | | | shader_ir: Correct max sizingFernando Sahmkow2019-07-092-2/+2
| | | | | | | |
| * | | | | | | shader_ir: Remove unnecessary constructors and use optional for ScanFlow resultFernando Sahmkow2019-07-093-28/+17
| | | | | | | |
| * | | | | | | shader_ir: Corrections, documenting and asserting control_flowFernando Sahmkow2019-07-093-52/+54
| | | | | | | |
| * | | | | | | shader_ir: Unify blocks in decompiled shaders.Fernando Sahmkow2019-07-097-58/+85
| | | | | | | |
| * | | | | | | shader_ir: Decompile Flow StackFernando Sahmkow2019-07-094-11/+206
| | | | | | | |
| * | | | | | | shader_ir: propagate shader size to the IRFernando Sahmkow2019-07-096-17/+28
| | | | | | | |
| * | | | | | | shader_ir: Implement BRX & BRA.CCFernando Sahmkow2019-07-096-4/+76
| | | | | | | |
| * | | | | | | shader_ir: Remove the old scanner.Fernando Sahmkow2019-07-092-77/+0
| | | | | | | |
| * | | | | | | shader_ir: Implement a new shader scannerFernando Sahmkow2019-07-096-16/+477
| | | | | | | |
* | | | | | | | Merge pull request #2717 from SciresM/unmirror_memorybunnei2019-07-112-7/+34
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Restore memory perms on svcUnmapMemory/UnloadNro
| * | | | | | | | Restore memory perms on svcUnmapMemory/UnloadNroMichael Scire2019-07-112-7/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prior to PR, Yuzu did not restore memory to RW- on unmap of mirrored memory or unloading of NRO. (In fact, in the NRO case, the memory was unmapped instead of reprotected to --- on Load, so it was actually lost entirely...) This PR addresses that, and restores memory to RW- as it should. This fixes a crash in Super Smash Bros when creating a World of Light save for the first time, and possibly other games/circumstances.
* | | | | | | | | Merge pull request #2723 from lioncash/membunnei2019-07-1115-80/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/arm: Remove obsolete Unicorn memory mapping
| * | | | | | | | | yuzu: Remove setting for using UnicornLioncash2019-07-119-29/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The JIT is mature enough that this setting can be removed, falling back to Unicorn only on unsupported architectures. Any missing features from Unicorn (of which there are extremely few), are mostly developer-oriented, which most users don't care about. Features should be coordinated with the JIT, not the interpreter, anyhow.
| * | | | | | | | | core/arm: Remove obsolete Unicorn memory mappingLioncash2019-07-116-51/+0
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was initially necessary when AArch64 JIT emulation was in its infancy and all memory-related instructions weren't implemented. Given the JIT now has all of these facilities implemented, we can remove these functions from the CPU interface.
* | | | | | | | | Merge pull request #2724 from lioncash/sleepbunnei2019-07-112-2/+33
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | service/am: Implement SetAutoSleepDisabled/IsAutoSleepDisabled
| * | | | | | | | service/am: Implement IsAutoSleepDisabledLioncash2019-07-112-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This simply queries whether or not auto-sleep facilities are disabled and has no special handling. It's a basic getter function.
| * | | | | | | | service/am: Implement SetAutoSleepDisabledLioncash2019-07-112-1/+23
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a basic implementation of SetAutoSleepDisabled. Until idle handling is implemented, this is about the best we can do. In the meantime, provide a rough documenting of specifics that occur when this function is called on actual hardware.
* | | | | | | | Merge pull request #2714 from DarkLordZach/repo-sync-pipelineFlame Sage2019-07-111-0/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Add Repository Sync Pipeline
| * | | | | | | | Add Repository Sync PipelineZach Hilman2019-07-111-0/+19
|/ / / / / / / /
* | | | | | | | Merge pull request #2697 from lioncash/docbunnei2019-07-101-7/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer: Amend documentation comment for ConfigureFramebuffers()
| * | | | | | | | gl_rasterizer: Amend documentation comment for ConfigureFramebuffers()Lioncash2019-07-091-7/+9
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | must_reconfigure isn't a parameter for this function any more, so it can be replaced with current_state. While we're at it, we can make the parameters of the declaration match the same name as the ones in the definition.
* | | | | | | | Merge pull request #2686 from ReinUsesLisp/vk-schedulerbunnei2019-07-106-50/+60
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vk_scheduler: Drop execution context in favor of views
| * | | | | | | | vk_scheduler: Drop execution context in favor of viewsReinUsesLisp2019-07-076-50/+60
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of passing by copy an execution context through out the whole Vulkan call hierarchy, use a command buffer view and fence view approach. This internally dereferences the command buffer or fence forcing the user to be unable to use an outdated version of it on normal usage. It is still possible to keep store an outdated if it is casted to VKFence& or vk::CommandBuffer. While changing this file, add an extra parameter for Flush and Finish to allow releasing the fence from this calls.
* | | | | | | | Merge pull request #2700 from ogniK5377/GetFriendListbunnei2019-07-101-1/+34
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | IFriendService::GetFriendList
| * | | | | | | | IFriendService::GetFriendListDavid Marcec2019-07-091-1/+34
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | We don't have any friends implemented in Yuzu yet so it doesn't make sense to return any friends. For now we'll be returning 0 friends however the information provided will allow a proper implementation of this cmd when needed.
* | | | | | | | Merge pull request #2611 from DarkLordZach/pm-info-cmdbunnei2019-07-103-16/+116
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | pm: Implement various pm commands for finding process and title IDs
| * | | | | | | | pm: Implement pm:shell and pm:dmnt GetApplicationPidZach Hilman2019-06-273-7/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the process ID of the current application or 0 if no app is running.
| * | | | | | | | pm: Implement pm:dmnt GetTitlePidZach Hilman2019-06-271-7/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Takes a title ID and searches for a matching process, returning error if it doesn't exist, otherwise the process ID.
| * | | | | | | | pm: Implement pm:info GetTitleIdZach Hilman2019-06-271-2/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Searches the process list for a process with the specified ID, returning the title ID if it exists.
* | | | | | | | | Merge pull request #2650 from DarkLordZach/mii-iface-verbunnei2019-07-101-1/+15
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | mii: Implement IDatabaseService SetInterfaceVersion
| * | | | | | | | | mii: Implement IDatabaseService SetInterfaceVersionZach Hilman2019-07-071-1/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Appears to set a member variable used to affect the API that games access, and the method used to store data.
* | | | | | | | | | Merge pull request #2691 from lioncash/overridebunnei2019-07-102-7/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core: Add missing override specifiers
| * | | | | | | | | | vk_sampler_cache: Remove unused includesLioncash2019-07-071-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are no longer used within this header, so they can be removed.
| * | | | | | | | | | video_core: Add missing override specifiersLioncash2019-07-072-4/+4
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2706 from DarkLordZach/azure-1Flame Sage2019-07-104-0/+38
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | Add Pipeline Definitions for Azure CI
| * | | | | | | | | Add Pipeline DefinitionsZach Hilman2019-07-104-0/+38
|/ / / / / / / / /
* | | | / / / / / Set up CI with Azure PipelinesFlame Sage2019-07-101-0/+19
| |_|_|/ / / / / |/| | | | | | | | | | | | | | | [skip ci]
* | | | | | | | Merge pull request #2661 from ogniK5377/audren-loopZach Hilman2019-07-081-3/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audren: Only manage wave buffers with a size
| * | | | | | | | addressed issueDavid Marcec2019-07-081-1/+1
| | | | | | | | |
| * | | | | | | | audren: Only manage wave buffers with a sizeDavid Marcec2019-07-011-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We shouldn't be incrementing if wave buffers are empty. They are considered invalid/unused wave buffers. This fixes the issue of certain sounds looping when they shouldn't
* | | | | | | | | Merge pull request #2657 from ogniK5377/npad-assignmentsZach Hilman2019-07-086-3/+100
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignment
| * | | | | | | | | addressed issuesDavid Marcec2019-07-081-6/+7
| | | | | | | | | |
| * | | | | | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignmentDavid Marcec2019-07-016-3/+99
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | StartLrAssignmentMode and StopLrAssignmentMode don't require any implementation as it's just used for showing the screen of changing the controller orientation if the user wishes to do so. Ever since #1634 this has not been needed as users can specify the controller orientation from the config and swap at any time. We store a private member just in case this gets used for anything extra in the future
* | | | | | | | | Merge pull request #2651 from DarkLordZach/apm-boost-mode-1bunnei2019-07-0814-57/+258
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | apm: Initial implementation of performance config and boost mode
| * | | | | | | | | am: Implement SetCpuBoostMode in terms of APMZach Hilman2019-06-295-13/+26
| | | | | | | | | |
| * | | | | | | | | core: Keep instance of APM ControllerZach Hilman2019-06-292-0/+20
| | | | | | | | | |
| * | | | | | | | | apm: Implement SetCpuBoostModeZach Hilman2019-06-292-0/+14
| | | | | | | | | |
| * | | | | | | | | apm: Add getters for performance config and modeZach Hilman2019-06-292-33/+49
| | | | | | | | | |
| * | | | | | | | | apm: Add apm:am serviceZach Hilman2019-06-292-11/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 8.0.0+ identical version of apm
| * | | | | | | | | apm: Add Controller class to manage speed data and applicationZach Hilman2019-06-293-0/+140
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2642 from DarkLordZach/fsp-log-2bunnei2019-07-089-28/+99
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | fsp-srv: Implement Access Logging Functionality
| * | | | | | | | fsp-srv: Implement GetAccessLogVersionInfoZach Hilman2019-06-292-3/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns some misc. data about logging to help the game determine if it should log.
| * | | | | | | | reporter: Add report class for filesystem access logsZach Hilman2019-06-292-0/+25
| | | | | | | | |
| * | | | | | | | fsp-srv: Implement OutputAccessLogToSdCardZach Hilman2019-06-297-27/+62
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Allows games to log data to the SD.
* | | | | | | | Merge pull request #2694 from FearlessTobi/patch-1Hexagon122019-07-071-0/+0
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | Delete decode_integer_set.cpp
| * | | | | | | Delete decode_integer_set.cppTobias2019-07-071-0/+0
|/ / / / / / /
* | | | | | | Merge pull request #2674 from lioncash/reporterZach Hilman2019-07-072-15/+35
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core/reporter: Minor changes
| * | | | | | | core/reporter: Allow moves into SaveToFile()Lioncash2019-07-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Taking the json instance as a constant reference, makes all moves into the parameter non-functional, resulting in copies. Taking it by value allows moves to function.
| * | | | | | | core/reporter: Add missing includes and forward declarationsLioncash2019-07-052-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds missing inclusions to prevent potential compilation issues.
| * | | | | | | core/reporter: Remove unnecessary namespace qualifiersLioncash2019-07-052-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Reporter class is part of the Core namespace, so the System class doesn't need to be qualified.
| * | | | | | | core/reporter: Remove pessimizing move in GetHLERequestContextData()Lioncash2019-07-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This can inhibit copy-elision, so we can remove this redundant move.
| * | | | | | | core/reporter: Make bracing consistentLioncash2019-07-051-8/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes all control statements braced, regardless of their size, making code more uniform.
| * | | | | | | core/reporter: Return in error case in SaveToFile()Lioncash2019-07-051-1/+3
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | If the path couldn't be created, then we shouldn't be attempting to save the file.
* | | | | | | Merge pull request #2677 from lioncash/assertZach Hilman2019-07-075-43/+48
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/vm_manager: Handle stack/TLS IO region placement a little better
| * | | | | | | memory: Remove unused includesLioncash2019-07-061-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't used within the central memory management code, so they can be removed.
| * | | | | | | memory: Remove unused PageTable forward declarationLioncash2019-07-061-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used by anything in the header file, so it can be removed.
| * | | | | | | kernel/vm_manager: Rename 'new map' to 'stack'Lioncash2019-07-063-37/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a more accurate name for the memory region and also disambiguates between the map and new map regions of memory, making it easier to understand.
| * | | | | | | kernel/vm_manager: Handle stack/TLS IO region placement betterLioncash2019-07-061-2/+13
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Handles the placement of the stack a little nicer compared to the previous code, which was off in a few ways. e.g. The stack (new map) region, shouldn't be the width of the entire address space if the size of the region calculation ends up being zero. It should be placed at the same location as the TLS IO region and also have the same size. In the event the TLS IO region contains a size of zero, we should also be doing the same thing. This fixes our memory layout a little bit and also resolves some cases where assertions can trigger due to the memory layout being incorrect.
* | | | | | | Merge pull request #2684 from SciresM/suspend_tickZach Hilman2019-07-072-7/+20
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | am: Implement GetAccumulatedSuspendedTickValue
| * | | | | | clang-format fixesMichael Scire2019-07-061-4/+5
| | | | | | |
| * | | | | | am: Implement GetAccumulatedSuspendedTickValueMichael Scire2019-07-062-7/+19
|/ / / / / /
* | | | | | Merge pull request #2601 from FernandoS27/texture_cacheZach Hilman2019-07-0563-3269/+4196
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement a new Texture Cache
| * | | | | | texture_cache: Address FeedbackFernando Sahmkow2019-07-057-22/+35
| | | | | | |
| * | | | | | texture_cache: Correct Texture Buffer UploadingFernando Sahmkow2019-07-053-2/+18
| | | | | | |
| * | | | | | texture_cache: Pack sibling queries inside a methodReinUsesLisp2019-06-301-6/+8
| | | | | | |
| * | | | | | texture_cache: Use std::vector reservation for sampled_texturesReinUsesLisp2019-06-301-17/+10
| | | | | | |
| * | | | | | texture_cache: Style changesReinUsesLisp2019-06-303-17/+13
| | | | | | |
| * | | | | | texture_cache: Use std::array for siblings_tableReinUsesLisp2019-06-291-10/+13
| | | | | | |
| * | | | | | texture_cache: Address feedbackReinUsesLisp2019-06-294-30/+13
| | | | | | |
| * | | | | | texture_cache: Correct variable naming.Fernando Sahmkow2019-06-261-3/+3
| | | | | | |
| * | | | | | gl_texture_cache: Correct assertsFernando Sahmkow2019-06-262-2/+2
| | | | | | |
| * | | | | | texture_cache: Corrections, documentation and assertsFernando Sahmkow2019-06-261-42/+42
| | | | | | |
| * | | | | | surface_params: Corrections, asserts and documentation.Fernando Sahmkow2019-06-262-43/+58
| | | | | | |
| * | | | | | copy_params: use constexpr for constructorFernando Sahmkow2019-06-251-3/+4
| | | | | | |
| * | | | | | gl_texture_cache: Corrections and fixesFernando Sahmkow2019-06-252-13/+9
| | | | | | |
| * | | | | | gl_resource_manager: Correct MakeStreamCopyFernando Sahmkow2019-06-252-3/+2
| | | | | | |
| * | | | | | texture_cache: Query MemoryManager from the systemFernando Sahmkow2019-06-255-20/+7
| | | | | | |
| * | | | | | texture_cache: Include "core/core.h"ReinUsesLisp2019-06-241-4/+1
| | | | | | |
| * | | | | | gl_texture_cache: Explicitly add indirect includeReinUsesLisp2019-06-241-0/+1
| | | | | | |
| * | | | | | texture_cache/surface_view: Address feedbackReinUsesLisp2019-06-241-1/+0
| | | | | | |
| * | | | | | texture_cache/surface_base: Address feedbackReinUsesLisp2019-06-242-2/+10
| | | | | | |
| * | | | | | video_core/surface: Address feedbackReinUsesLisp2019-06-241-2/+2
| | | | | | |
| * | | | | | decode/texture: Address feedbackReinUsesLisp2019-06-241-0/+1
| | | | | | |
| * | | | | | renderer_opengl/utils: Remove unused includes and unused forward declarationReinUsesLisp2019-06-241-4/+0
| | | | | | |
| * | | | | | gl_texture_cache: Address some feedbackReinUsesLisp2019-06-241-2/+4
| | | | | | |
| * | | | | | gl_shader_disk_cache: Address feedbackReinUsesLisp2019-06-242-4/+8
| | | | | | |
| * | | | | | gl_shader_decompiler: Address feedbackReinUsesLisp2019-06-241-11/+12
| | | | | | |
| * | | | | | shader_bytecode: Include missing <array>ReinUsesLisp2019-06-241-0/+1
| | | | | | |
| * | | | | | common/alignment: Address feedbackReinUsesLisp2019-06-241-2/+3
| | | | | | |
| * | | | | | texture_cache: Style and CorrectionsFernando Sahmkow2019-06-217-71/+75
| | | | | | |
| * | | | | | shader_cache: Correct versioning and size calculation.Fernando Sahmkow2019-06-212-2/+7
| | | | | | |
| * | | | | | texture_cache: Eliminate linear textures fallthroughFernando Sahmkow2019-06-211-4/+0
| | | | | | |
| * | | | | | texture_cache: Correct format R16U as siblingFernando Sahmkow2019-06-212-1/+2
| | | | | | |
| * | | | | | texture_cache: Implement texception detection and texture barriers.Fernando Sahmkow2019-06-212-7/+40
| | | | | | |
| * | | | | | texture_cache: Corrections to buffers and shadow formats use.Fernando Sahmkow2019-06-211-10/+34
| | | | | | |
| * | | | | | texture_cache: Implement Irregular Views in surfacesFernando Sahmkow2019-06-212-4/+24
| | | | | | |
| * | | | | | surface: Correct format S8Z24Fernando Sahmkow2019-06-214-9/+5
| | | | | | |
| * | | | | | texture_cache: Initialize all siblings to invalid pixel format.Fernando Sahmkow2019-06-211-6/+15
| | | | | | |
| * | | | | | gl_texture_cache: Use Stream Buffers instead of Persistant for Buffer Copies.Fernando Sahmkow2019-06-213-5/+4
| | | | | | |
| * | | | | | gl_texture_cache: Correct Image BlitFernando Sahmkow2019-06-211-1/+1
| | | | | | |
| * | | | | | decoders: correct block calculationFernando Sahmkow2019-06-217-29/+41
| | | | | | |
| * | | | | | texture_cache: Use siblings textures on Rebuild and fix possible error on blittingFernando Sahmkow2019-06-212-11/+24
| | | | | | |
| * | | | | | texture_cache: Remove old rasterizer cacheFernando Sahmkow2019-06-212-1956/+0
| | | | | | |
| * | | | | | texture_cache: Implement siblings texture formats.Fernando Sahmkow2019-06-212-12/+31
| | | | | | |
| * | | | | | fermi2d: Correct Origin ModeFernando Sahmkow2019-06-211-5/+10
| | | | | | |
| * | | | | | texture_cache: correct texture buffer on surface paramsFernando Sahmkow2019-06-211-4/+11
| | | | | | |
| * | | | | | texture_cache: eliminate accelerated depth->color/color->depth copies due to driver instability.Fernando Sahmkow2019-06-214-22/+6
| | | | | | |
| * | | | | | texture_cache: correct mutex locksFernando Sahmkow2019-06-211-4/+4
| | | | | | |
| * | | | | | shader_ir: Fix image copy rebase issuesFernando Sahmkow2019-06-211-2/+7
| | | | | | |
| * | | | | | texture_cache: Don't Image Copy if component types differFernando Sahmkow2019-06-211-1/+2
| | | | | | |
| * | | | | | texture_cache: move some large methods to cpp filesFernando Sahmkow2019-06-214-139/+135
| | | | | | |
| * | | | | | texture_cache: Optimize GetSurface and use references on functions that don't change a surface.Fernando Sahmkow2019-06-213-12/+12
| | | | | | |
| * | | | | | texture_cache: Implement Buffer Copy and detect Turing GPUs Image CopiesFernando Sahmkow2019-06-218-12/+148
| | | | | | |
| * | | | | | texture_cache uncompress-compress is untopological.Fernando Sahmkow2019-06-215-19/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes conflicts between non compress and compress textures to be auto recycled. It also limits the amount of mipmaps a texture can have if it goes above it's limit.
| * | | | | | texture_cache: Correct copying between compressed and uncompressed formatsFernando Sahmkow2019-06-213-10/+27
| | | | | | |
| * | | | | | texture_cache: Only load on recycle with accurate GPU.Fernando Sahmkow2019-06-211-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Testing so far has proven this to be quite safe as texture memory read added a 2-5ms load to the current cache.
| * | | | | | Fix rebase errorsFernando Sahmkow2019-06-213-3/+13
| | | | | | |
| * | | | | | texture_cache: Handle uncontinuous surfaces.Fernando Sahmkow2019-06-214-21/+82
| | | | | | |
| * | | | | | texture_cache: return null surface on invalid addressFernando Sahmkow2019-06-211-0/+12
| | | | | | |
| * | | | | | texture_cache: Add checks for texture buffers.Fernando Sahmkow2019-06-211-2/+16
| | | | | | |
| * | | | | | texture_cache: Fermi2D reform and implement View MirageFernando Sahmkow2019-06-2111-77/+125
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also does some fixes on compressed textures reinterpret and on the Fermi2D engine in general.
| * | | | | | gl_shader_decompiler: Implement image binding settingsReinUsesLisp2019-06-215-24/+52
| | | | | | |
| * | | | | | shader: Implement bindless imagesReinUsesLisp2019-06-213-2/+40
| | | | | | |
| * | | | | | shader: Decode SUST and implement backing image functionalityReinUsesLisp2019-06-2110-3/+284
| | | | | | |
| * | | | | | gl_rasterizer: Track texture buffer usageReinUsesLisp2019-06-216-74/+119
| | | | | | |
| * | | | | | video_core: Make ARB_buffer_storage a required extensionReinUsesLisp2019-06-215-8/+12
| | | | | | |
| * | | | | | gl_rasterizer_cache: Use texture buffers to emulate texture buffersReinUsesLisp2019-06-215-11/+35
| | | | | | |
| * | | | | | maxwell_3d: Partially implement texture buffers as 1D texturesReinUsesLisp2019-06-214-10/+24
| | | | | | |
| * | | | | | gl_shader_decompiler: Allow 1D textures to be texture buffersReinUsesLisp2019-06-211-4/+38
| | | | | | |
| * | | | | | shader: Implement texture buffersReinUsesLisp2019-06-213-0/+62
| | | | | | |
| * | | | | | texture_cache: loose TryReconstructSurface when accurate GPU is not on.Fernando Sahmkow2019-06-213-4/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Also corrects some asserts.
| * | | | | | texture_cache: Document the most important methods.Fernando Sahmkow2019-06-211-8/+87
| | | | | | |
| * | | | | | texture_cache: Try to Reconstruct Surface on bigger than overlap.Fernando Sahmkow2019-06-211-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes clouds in SMO Cap Kingdom and lens on Cloud Kingdom. Also moved accurate_gpu setting check to Pick Strategy
| * | | | | | texture_cache: Implement Guard mechanismFernando Sahmkow2019-06-212-1/+12
| | | | | | |
| * | | | | | texture_cache: General FixesFernando Sahmkow2019-06-218-47/+170
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixed ASTC mipmaps loading Fixed alignment on openGL upload/download Fixed Block Height Calculation Removed unalign_height
| * | | | | | surface_params: Ensure pitch is always written to avoid surface leaksReinUsesLisp2019-06-211-0/+2
| | | | | | |
| * | | | | | gl_framebuffer_cache: Use a hashed struct to cache framebuffersReinUsesLisp2019-06-216-62/+148
| | | | | | |
| * | | | | | texture_cache return invalid buffer on deactivated color_maskFernando Sahmkow2019-06-212-2/+9
| | | | | | |
| * | | | | | engine_upload: Addapt to new Texture CacheFernando Sahmkow2019-06-212-5/+5
| | | | | | |
| * | | | | | surface_params: Optimize CreateForTextureReinUsesLisp2019-06-212-72/+76
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of using Common::AlignUp, use Common::AlignBits to align the texture compression factor.
| * | | | | | gl_texture_cache: Make main views be proxy textures instead of a full view.Fernando Sahmkow2019-06-212-11/+25
| | | | | | |
| * | | | | | texture_cache: Add ASync ProtectionsFernando Sahmkow2019-06-211-0/+10
| | | | | | |
| * | | | | | Remove Framebuffer reconfiguration and restrict rendertarget protectionFernando Sahmkow2019-06-214-39/+27
| | | | | | |
| * | | | | | texture_cache: Implement GPU Dirty FlagsFernando Sahmkow2019-06-211-15/+22
| | | | | | |
| * | | | | | texture_cache: Optimize GetMipBlockHeight and GetMipBlockDepthFernando Sahmkow2019-06-212-13/+50
| | | | | | |
| * | | | | | texture_cache: Implement L1_Inner_cacheFernando Sahmkow2019-06-211-13/+30
| | | | | | |
| * | | | | | video_core: Use un-shifted block sizes to avoid integer divisionsReinUsesLisp2019-06-2110-60/+78
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of storing all block width, height and depths in their shifted form: block_width = 1U << block_shift; Store them like they are provided by the emulated hardware (their block_shift form). This way we can avoid doing the costly Common::AlignUp operation to align texture sizes and drop CPU integer divisions with bitwise logic (defined in Common::AlignBits).
| * | | | | | texture_cache: Change internal cache from lists to vectorsReinUsesLisp2019-06-211-6/+7
| | | | | | |
| * | | | | | Reduce amount of size calculations.Fernando Sahmkow2019-06-218-88/+97
| | | | | | |
| * | | | | | texture_cache: Correct premature texceptionsFernando Sahmkow2019-06-214-14/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Due to our current infrastructure, it is possible for a mipmap to be set on as a render target before a texception of that mipmap's superset be set afterwards. This is problematic as we rely on texture views to set up texceptions and protecting render targets targets for 3D texture rendering. One simple solution is to configure framebuffers after texture setup but this brings other problems. This solution, forces a reconfiguration of the framebuffers after such event happens.
| * | | | | | texture_cache: Implement guest flushingFernando Sahmkow2019-06-213-10/+29
| | | | | | |
| * | | | | | Fixes to mipmap's process and reconstruct processFernando Sahmkow2019-06-212-3/+3
| | | | | | |
| * | | | | | surface_base: Add parenthesis to EmplaceOverview's predicateReinUsesLisp2019-06-211-3/+2
| | | | | | |
| * | | | | | Texture Cache: Implement Blitting and Fermi CopiesFernando Sahmkow2019-06-217-100/+93
| | | | | | |
| * | | | | | surface_view: Add constructor for ViewParamsReinUsesLisp2019-06-213-39/+23
| | | | | | |
| * | | | | | surface_base: Split BreakDown into layered and non-layered variantsReinUsesLisp2019-06-211-45/+48
| | | | | | |
| * | | | | | surface_base: Silence truncation warnings and minor renames and reorderingReinUsesLisp2019-06-212-32/+37
| | | | | | |
| * | | | | | copy_params: Use constructor instead of C-like initializationReinUsesLisp2019-06-213-47/+39
| | | | | | |
| * | | | | | Correct Mipmaps View method in Texture CacheFernando Sahmkow2019-06-213-32/+29
| | | | | | |
| * | | | | | Change texture_cache chaching from GPUAddr to CacheAddrFernando Sahmkow2019-06-217-101/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also reverses the changes to make invalidation and flushing through the GPU address.
| * | | | | | Corrections to Structural MatchingFernando Sahmkow2019-06-212-24/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The texture will now be reconstructed if the width only matches on GoB alignment.
| * | | | | | Implement Texture Cache V2Fernando Sahmkow2019-06-216-381/+568
| | | | | | |
| * | | | | | Correct Surface Base and Views for new Texture CacheFernando Sahmkow2019-06-217-380/+466
| | | | | | |
| * | | | | | Add OGLTextureViewFernando Sahmkow2019-06-212-0/+43
| | | | | | |
| * | | | | | Deglobalize Memory Manager on texture cahe and Implement Invalidation and Flushing using GPUVAddrFernando Sahmkow2019-06-214-1/+20
| | | | | | |
| * | | | | | texture_cache: Remove execution context copies from the texture cacheReinUsesLisp2019-06-217-168/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is done to simplify the OpenGL implementation, it is needed for Vulkan.
| * | | | | | gl_texture_cache: Implement fermi copiesReinUsesLisp2019-06-215-2/+105
| | | | | | |
| * | | | | | texture_cache: Split texture cache into different filesReinUsesLisp2019-06-2112-876/+965
| | | | | | |
| * | | | | | texture_cache: Move staging buffer into a generic implementationReinUsesLisp2019-06-214-181/+211
| | | | | | |
| * | | | | | texture_cache: Flush 3D textures in the order they are drawnReinUsesLisp2019-06-215-19/+44
| | | | | | |
| * | | | | | gl_texture_cache: Minor changesReinUsesLisp2019-06-215-140/+185
| | | | | | |
| * | | | | | gl_texture_cache: Add copy from multiple overlaps into a single surfaceReinUsesLisp2019-06-213-6/+84
| | | | | | |
| * | | | | | gl_texture_cache: Attach surface textures instead of viewsReinUsesLisp2019-06-213-20/+32
| | | | | | |
| * | | | | | gl_texture_cache: Add fast copy pathReinUsesLisp2019-06-214-7/+60
| | | | | | |
| * | | | | | gl_texture_cache: Initial implementationReinUsesLisp2019-06-219-47/+809
| | | | | | |
* | | | | | | Merge pull request #2669 from FearlessTobi/move-cpujit-settingZach Hilman2019-07-0411-36/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu: Move CPU Jit setting to Debug tab
| * | | | | | | yuzu: Remove CPU Jit setting from the UIfearlessTobi2019-07-0411-36/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A normal user shouldn't change this, as it will slow down the emulation and can lead to bugs or crashes. The renaming is done in order to prevent users from leaving this on without a way to turn it off from the UI.
* | | | | | | | Merge pull request #2555 from lioncash/tlsZach Hilman2019-07-046-81/+148
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/process: Decouple TLS handling from threads
| * | | | | | | | kernel/process: Default initialize all member variablesLioncash2019-07-041-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures a Process instance is always created with a deterministic initial state.
| * | | | | | | | kernel/process: Decouple TLS handling from threadsLioncash2019-07-044-66/+97
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Extracts out all of the thread local storage management from thread instances themselves and makes the owning process handle the management of the memory. This brings the memory management slightly more in line with how the kernel handles these allocations. Furthermore, this also makes the TLS page management a little more readable compared to the lingering implementation that was carried over from Citra.
| * | | | | | | | kernel/vm_manager: Add overload of FindFreeRegion() that operates on a boundaryLioncash2019-07-042-13/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary for making our TLS slot management slightly more straightforward. This can also be utilized for other purposes in the future. We can implement the existing simpler overload in terms of this one anyways, we just pass the beginning and end of the ASLR region as the boundaries.
* | | | | | | | | Merge pull request #2670 from DarkLordZach/fix-merge-discrep-1bunnei2019-07-042-5/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_cache: Make CachedShader constructor private
| * | | | | | | | | gl_shader_cache: Make CachedShader constructor privateZach Hilman2019-07-042-5/+5
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes missing review comments introduced.
* | | | | | | | | Merge pull request #2658 from ogniK5377/QueryAudioDeviceOutputEventbunnei2019-07-041-3/+16
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | IAudioDevice::QueryAudioDeviceOutputEvent
| * | | | | | | | | IAudioDevice::QueryAudioDeviceOutputEventDavid Marcec2019-07-011-3/+16
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | The event should only be signaled when an output audio device gets changed. Example, Speaker to USB headset. We don't identify different devices internally yet so there's no need to signal the event yet.
* | | | | | | | | Merge pull request #2638 from DarkLordZach/quest-flagbunnei2019-07-048-2/+36
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | set: Implement GetQuestFlag with config option
| * | | | | | | | set: Implement GetQuestFlagZach Hilman2019-06-292-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | Simply returns a true/false value indicating if the system is a kiosk system. This has been mapped to a config option for the purposes of yuzu.
| * | | | | | | | settings: Add config option for kiosk (quest) modeZach Hilman2019-06-296-1/+26
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2613 from ogniK5377/InitalizeApplicationInfoZach Hilman2019-07-045-6/+110
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestricted
| * | | | | | | | Added errors.h to cmakelistDavid Marcec2019-06-281-0/+1
| | | | | | | | |
| * | | | | | | | Addressed issuesDavid Marcec2019-06-282-17/+12
| | | | | | | | |
| * | | | | | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestrictedDavid Marcec2019-06-274-6/+114
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | InitializeApplicationInfoRestricted will need further implementation as it's checking for other user requirements about the game. As we're emulating, we're assuming the user owns the game so we skip these checks currently, implementation will need to be added further on
* | | | | | | | Merge pull request #2608 from ogniK5377/Time_GetSharedMemoryNativeHandleZach Hilman2019-07-048-28/+260
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implement Time::GetSharedMemoryNativeHandle
| * | | | | | | | Addressed issuesDavid Marcec2019-06-265-37/+53
| | | | | | | | |
| * | | | | | | | Implement Time::GetSharedMemoryNativeHandleDavid Marcec2019-06-258-29/+245
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This PR attempts to implement the shared memory provided by GetSharedMemoryNativeHandle. There is still more work to be done however that requires a rehaul of the current time module to handle clock contexts. This PR is mainly to get the basic functionality of the SharedMemory working and allow the use of addition to it whilst things get improved on. Things to note: Memory Barriers are used in the SharedMemory and a better solution would need to be done to implement this. Currently in this PR I’m faking the memory barriers as everything is sync and single threaded. They work by incrementing the counter and just populate the two data slots. On data reading, it will read the last added data. Specific values in the shared memory would need to be updated periodically. This isn't included in this PR since we don't actively do this yet. In a later PR when time is refactored this should be done. Finally, as we don't handle clock contexts. When time is refactored, we will need to update the shared memory for specific contexts. This PR does this already however since the contexts are all identical and not separated. We're just updating the same values for each context which in this case is empty. Tiime:SetStandardUserSystemClockAutomaticCorrectionEnabled, Time:IsStandardUserSystemClockAutomaticCorrectionEnabled are also partially implemented in this PR. The reason the implementation is partial is because once again, a lack of clock contexts. This will be improved on in a future PR. This PR closes issue #2556
* | | | | | | | | Merge pull request #2563 from ReinUsesLisp/shader-initializersZach Hilman2019-07-042-52/+53
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | gl_shader_cache: Use static constructors for CachedShader initialization
| * | | | | | | | gl_shader_cache: Use static constructors for CachedShader initializationReinUsesLisp2019-06-082-52/+53
| | | | | | | | |
* | | | | | | | | Merge pull request #2604 from ogniK5377/INotificationServicebunnei2019-07-035-1/+130
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | | Implemented INotificationService
| * | | | | | | | Attemp clang format fix?David Marcec2019-06-281-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Seems to be an issue with clang format
| * | | | | | | | Addressed issuesDavid Marcec2019-06-282-13/+13
| | | | | | | | |
| * | | | | | | | SizedNotificationInfo should be 0x10 bytes, user_uuid is incorrect, this should be the users account idDavid Marcec2019-06-251-1/+3
| | | | | | | | |
| * | | | | | | | fixed spelling errors and fixed issue with Pop not returning the SizedNotificationInfoDavid Marcec2019-06-251-6/+8
| | | | | | | | |
| * | | | | | | | Implemented INotificationServiceDavid Marcec2019-06-245-1/+127
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2659 from FernandoS27/safe-cachesbunnei2019-07-033-1/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | rasterizer_cache: Protect inherited caches from submission level
| * | | | | | | | rasterizer_cache: Protect inherited caches from submission levelFernando Sahmkow2019-07-013-1/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #2660 from bakugo/deltafragmentsZach Hilman2019-07-026-14/+21
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | file_sys: Ignore DeltaFragment NCAs during installation
| * | | | | | | file_sys: Rename other ContentRecordType membersBakugo2019-07-025-7/+8
| | | | | | | |
| * | | | | | | file_sys/registered_cache: Improve missing metadata errorBakugo2019-07-011-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This can happen when installing NSPs too, not just XCIs.
| * | | | | | | file_sys/submission_package: Don't warn about missing DeltaFragment NCAsBakugo2019-07-011-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | DeltaFragments are not useful to us and are often not included in patch NSPs.
| * | | | | | | file_sys/registered_cache: Ignore DeltaFragment NCAs during installationBakugo2019-07-011-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | DeltaFragments are only used to download and apply partial patches on a real console, and are not useful to us at all. Most patch NSPs do not include them, and when they do, it's a waste of space to install them.
| * | | | | | | file_sys: Rename ContentRecordType::Patch to DeltaFragmentBakugo2019-07-011-1/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Avoids potential confusion, since patches and DeltaFragments are not the same thing. Actual full patches are listed under the Program type.
* | | | | | | Merge pull request #2583 from FernandoS27/core-timing-safebunnei2019-06-305-60/+25
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Core_Timing: Make core_timing threadsafe by default.
| * | | | | | | Core_Timing: Make core_timing threadsafe by default.Fernando Sahmkow2019-06-165-60/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The old implementation had faulty Threadsafe methods where events could be missing. This implementation unifies unsafe/safe methods and makes core timing thread safe overall.
* | | | | | | | Merge pull request #2653 from FearlessTobi/revert-2474-patch-1Zach Hilman2019-06-292-15/+18
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | Revert "CMake: Get Git submodule dependencies via CMake"
| * | | | | | | Revert "CMake: Get Git submodule dependencies via CMake (#2474)"Tobias2019-06-292-15/+18
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | This reverts commit 5cef446f42e698a524c6c3240fedb0031f8e5694.
* | | | | | | Merge pull request #2533 from DarkLordZach/memory-frozenbunnei2019-06-284-0/+274
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | memory: Add class to manage and enforce memory freezing
| * | | | | | freezer: Update documentationZach Hilman2019-06-211-1/+8
| | | | | | |
| * | | | | | core: Move Freezer class to tools namespaceZach Hilman2019-06-214-17/+17
| | | | | | |
| * | | | | | freezer: Add documentation for methodsZach Hilman2019-06-212-30/+49
| | | | | | |
| * | | | | | memory: Add class to manage and enforce memory freezingZach Hilman2019-06-214-0/+248
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2548 from DarkLordZach/applet-shopnbunnei2019-06-2620-129/+890
|\ \ \ \ \ \ | | | | | | | | | | | | | | applets: Implement backend and default frontend for Parental Controls and EShop (ShopN) applets
| * | | | | | applets: Pass current process title ID to appletsZach Hilman2019-06-2511-41/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids using system accessor to get current process in applet code.
| * | | | | | general_frontend: Add documentation for parental controls and ecommerce appletsZach Hilman2019-06-255-27/+55
| | | | | | |
| * | | | | | web_browser: Only delete temporary directory if it was createdZach Hilman2019-06-251-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents crashes with ShopN applet occasionally.
| * | | | | | web_browser: Take ECommerce applet frontend optionally in constructorZach Hilman2019-06-251-1/+6
| | | | | | | | | | | | | | | | | | | | | If it is needed but wasn't passed (or passed nullptr), the Shop handling code will alert and throw an error.
| * | | | | | frontend: Add base class and default impl for ECommerce applet frontendZach Hilman2019-06-252-0/+102
| | | | | | |
| * | | | | | web_browser: Use function tables for execute and initializeZach Hilman2019-06-252-7/+285
| | | | | | | | | | | | | | | | | | | | | Allows easy handling of multiple shim types, as they have enough in common to be the same backend but not enough to share init/exec.
| * | | | | | web_browser: Correct structures and properly parse TLVs/ShimKindZach Hilman2019-06-252-61/+168
| | | | | | | | | | | | | | | | | | | | | Much, much more HW-accurate and allows us to easily support all of the different web 'shim' types.
| * | | | | | yuzu: Accept default applets for Parental Controls and ECommerceZach Hilman2019-06-251-5/+7
| | | | | | |
| * | | | | | applets: Track ECommerce and Parental Control applet frontendsZach Hilman2019-06-252-7/+29
| | | | | | |
| * | | | | | web_browser: Rename OpenPage to OpenPageLocalZach Hilman2019-06-254-11/+11
| | | | | | | | | | | | | | | | | | | | | This is more representative of what actually occurs, as web does support remote URLs which wouldn't need a romfs callback. This paves for easy future support of this with a call like 'OpenPageRemote' or similar.
| * | | | | | frontend: Add base class and default impl of parent controls applet frontendZach Hilman2019-06-252-1/+52
| | | | | | |
| * | | | | | applets: Implement Auth applet backendZach Hilman2019-06-252-0/+146
| | |_|/ / / | |/| | | | | | | | | | This is responsible for parental controls and supports verifying, changing, and registering PIN codes.
* | | | | | Merge pull request #2607 from DarkLordZach/arp-1bunnei2019-06-2619-97/+730
|\ \ \ \ \ \ | |/ / / / / |/| | | | | glue: Implement arp:w and arp:r services
| * | | | | glue: Correct missing bytes in ApplicationLaunchParameterZach Hilman2019-06-267-37/+71
| | | | | |
| * | | | | core: Keep track of ARPManager and register current application on bootZach Hilman2019-06-252-0/+76
| | | | | |
| * | | | | glue: Implement arp:w and arp:r servicesZach Hilman2019-06-253-2/+330
| | | | | | | | | | | | | | | | | | | | | | | | These keep track of running process' launch properties and control properties and allows for issuing and reading them by process and title ID.
| * | | | | glue: Add errors for glue/arp servicesZach Hilman2019-06-254-2/+65
| | | | | |
| * | | | | glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
| | | | | |
| * | | | | arp: Move to glue servicesZach Hilman2019-06-252-91/+0
| | | | | | | | | | | | | | | | | | | | | | | | Glue is the name of the sysmodule that contains both arp and bgtc.
| * | | | | glue: Add manager to keep track of application registryZach Hilman2019-06-253-0/+121
| | | | | | | | | | | | | | | | | | | | | | | | Manages mapping between title IDs and application launch and control properties.
| * | | | | registered_cache: Add getter to determine source slot in content provider unionZach Hilman2019-06-252-0/+17
| | | | | | | | | | | | | | | | | | | | | | | | Used to determine StorageId source for application data.
| * | | | | patch_manager: Add getter for title versionZach Hilman2019-06-252-2/+14
|/ / / / /
* | | | | Merge pull request #2603 from WamWooWam/masterZach Hilman2019-06-221-5/+5
|\ \ \ \ \ | | | | | | | | | | | | HexVectorToString -> HexToString
| * | | | | Update reporter.cppThomas May2019-06-221-5/+5
|/ / / / /
* | | | | Merge pull request #2579 from ReinUsesLisp/fix-aoffi-testbunnei2019-06-211-1/+2
|\ \ \ \ \ | | | | | | | | | | | | gl_device: Fix TestVariableAoffi test
| * | | | | gl_device: Fix TestVariableAoffi testReinUsesLisp2019-06-121-1/+2
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This test is intended to be invalid GLSL, but it was being invalid in two points instead of one. The intention is to use a non-immediate parameter in a textureOffset like function. The problem is that this shader was being compiled as a separable shader object and the text was writting to gl_Position without a redeclaration, being invalid GLSL. Address that issue by using a user-defined output attribute.
* | | | | Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\ \ \ \ \ | | | | | | | | | | | | service/acc: Silence truncation warnings
| * | | | | service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
| | |/ / / | |/| | | | | | | | | | | | | | | | | | The sanitizing function ensures that the returned type is always the correct type. This eliminates warnings without extra casts.
* | | | | Merge pull request #2575 from DarkLordZach/process-id-typesbunnei2019-06-216-10/+29
|\ \ \ \ \ | | | | | | | | | | | | kernel: Differentiate kernel and user processes when picking ID
| * | | | | kernel: Differentiate kernel and user processes when picking IDZach Hilman2019-06-106-10/+29
| | |_|_|/ | |/| | | | | | | | | | | | | This allows kernel internal type processes to be assigned IDs in the KIP range while userland processes are assigned in the user range.
* | | | | Merge pull request #2546 from DarkLordZach/kipsbunnei2019-06-2111-121/+522
|\ \ \ \ \ | | | | | | | | | | | | loader, file_sys: Add support for parsing and loading KIP (Kernel Internal Process) files
| * | | | | kernel_executable: Optimize BLZ decompressionZach Hilman2019-06-072-10/+13
| | | | | |
| * | | | | game_list: Accept *.kip as a file extension of executablesZach Hilman2019-06-052-3/+2
| | | | | |
| * | | | | loader: Add recognition for KIP file typeZach Hilman2019-06-052-0/+11
| | | | | |
| * | | | | loader: Add KIP and INI file parser-specific errorsZach Hilman2019-06-052-1/+9
| | | | | |
| * | | | | loader: Add AppLoader_KIP for KIP filesZach Hilman2019-06-053-0/+135
| | | | | |
| * | | | | program_metadata: Add function to load meta from raw parametersZach Hilman2019-06-052-0/+20
| | | | | | | | | | | | | | | | | | | | | | | | Needed for KIP loading as KIPs do not have an NPDM but do have the essential parts of the data within.
| * | | | | partition_data_manager: Remove KIP processing and use FileSysZach Hilman2019-06-051-118/+13
| | | | | | | | | | | | | | | | | | | | | | | | Previously, this TU contained the necessary headers to parse KIP/INI but now it should just use the FileSys class.
| * | | | | file_sys: Add classes to parse KIP1 and INI1 filesZach Hilman2019-06-053-0/+330
| | | | | |
* | | | | | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-2134-54/+825
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Add detailed local reporting feature for development
| * | | | | | loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-2622-81/+148
| | | | | | | | | | | | | | | | | | | | | Also cleanup of general stuff
| * | | | | | prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Logs a lot of seemingly innocuous telemetry games generate.
| * | | | | | fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Matches offical behavior with creport and replaces old log/text based report system.
| * | | | | | service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| | | | | | |
| * | | | | | applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This matches official behavior with the erpt/eclct/eupld service chain.
| * | | | | | applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This also reworks the applet data storage to be peekable.
| * | | | | | svc: Save report on call to svcBreakZach Hilman2019-05-251-1/+7
| | | | | | |
| * | | | | | core: Add Reporter class to take/save reportsZach Hilman2019-05-255-1/+416
| | | | | | |
| * | | | | | qt: Make UI option for 'Reporting Services' temporaryZach Hilman2019-05-252-0/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Reports are unnecessary for normal users and this is to prevent 'power' users from enabling the feature by accident.
| * | | | | | settings: Add 'Reporting Services' config optionZach Hilman2019-05-253-10/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Full enable/disable for all reports.
| * | | | | | arm_interface: Expand backtrace generationZach Hilman2019-05-252-7/+194
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns results as a vector of entries for further processing. Logs addresses, offsets, and mangled name.
| * | | | | | core: Track load offsets of NSO modulesZach Hilman2019-05-253-0/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed for backtrace decomposition
* | | | | | | Merge pull request #2291 from DarkLordZach/homebrew-testingbunnei2019-06-2112-0/+993
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | yuzu_tester: Add and implement testing utility for homebrew
| * | | | | | yuzutest: Add minor commentsZach Hilman2019-06-102-8/+9
| | | | | | |
| * | | | | | yuzu_tester: Display results in table formatZach Hilman2019-06-103-12/+50
| | | | | | |
| * | | | | | yuzutest: Support multiple tests per executableZach Hilman2019-06-104-33/+41
| | | | | | |
| * | | | | | yuzu_tester: Add 'yuzutest' serviceZach Hilman2019-06-102-0/+123
| | | | | | |
| * | | | | | yuzu_tester: Add SDL2-based EmuWindow that doesn't show the windowZach Hilman2019-06-102-0/+164
| | | | | | |
| * | | | | | yuzu_tester: Use config, icon, and main from yuzu-cmdZach Hilman2019-06-106-0/+624
| | | | | | |
| * | | | | | yuzu_tester: Add project subdirectoryZach Hilman2019-06-102-0/+35
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2596 from FernandoS27/revert-2590bunnei2019-06-201-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Revert PR 2590.
| * | | | | | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Even though it has been proven that IAudioRenderer:SystemEvent is actually an automatic event. The current implementation of such event is all thought to be manual. Thus it's implementation needs to be corrected when doing such change. As it is right now this PR introduced a series of regressions on softlocks on multiple games. Therefore, this pr reverts such change until a correct implementation is made.
* | | | | | | Merge pull request #2595 from jonsn0w/patch-1Hexagon122019-06-201-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Update content_archive.cpp
| * | | | | | Update content_archive.cppjonsn0w2019-06-201-2/+2
| | | | | | | | | | | | | | | | | | | | | log clutter in debug logs when theres really no need
* | | | | | | Merge pull request #2591 from lioncash/recordbunnei2019-06-205-399/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Remove unused CiTrace source files
| * | | | | | | core: Remove unused CiTrace source filesLioncash2019-06-185-399/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These source files have been unused for the entire lifecycle of the project. They're a hold-over from Citra and only add to the build time of the project, so they can be removed. There's also likely no way this would ever work in yuzu in its current form without revamping quite a bit of it, given how different the GPU on the Switch is compared to the 3DS.
* | | | | | | | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/audio/audren_u: Correct event reset type for the system event
| * | | | | | | | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is actually an auto-reset event in the audio service itself, not a manual one.
* | / / / / / / CMake: Get Git submodule dependencies via CMake (#2474)Frederic L2019-06-202-18/+15
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * CMake: Get Git submodule dependencies via CMake * CMakeLists: Fixed unintentional line break * travis: Bring parity between linux-mingw and linux build script * CMakeLists: Fixed typo in error message
* | | | | | | Merge pull request #2594 from FearlessTobi/very-important-changeZach Hilman2019-06-201-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/configure_input: Add missing space in window title
| * | | | | | | Change to a more descriptive nameTobias2019-06-191-1/+1
| | | | | | | |
| * | | | | | | yuzu/configure_input: Add missing space in window nameTobias2019-06-191-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #2593 from deadmeu/patch-1Mat M2019-06-191-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Added missing space between two words
| * | | | | | | | Added missing space between two wordsAlex Subaric2019-06-191-1/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | Added missing whitespace character between two words in the "Warning Missing Derivation Components" warning message box.
* | | | | | | | Merge pull request #2584 from ogniK5377/cadenceZach Hilman2019-06-1918-37/+134
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEvent
| * | | | | | | | Addressed issuesDavid Marcec2019-06-174-9/+14
| | | | | | | | |
| * | | | | | | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
| | | | | | | | |
| * | | | | | | | CleanupDavid Marcec2019-06-1612-30/+39
| | | | | | | | |
| * | | | | | | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-1610-11/+93
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | IPC-100 was changed to InitializeApplicationInfoOld instead of InitializeApplicationInfo. IPC-150 makes an indentical call to IPC-100 however does extra processing. They should not have the same name as it's quite confusing to debug.
* | | | | | | | | Merge pull request #2562 from ReinUsesLisp/split-cbuf-uploadbunnei2019-06-186-56/+69
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | video_core/engines: Move ConstBufferInfo out of Maxwell3D
| * | | | | | | | gl_rasterizer: Remove unused parameters in descriptor uploadsReinUsesLisp2019-06-082-8/+6
| | | | | | | | |
| * | | | | | | | video_core/engines: Move ConstBufferInfo out of Maxwell3DReinUsesLisp2019-06-086-49/+64
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #2538 from ReinUsesLisp/ssy-pbkZach Hilman2019-06-164-27/+78
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader: Split SSY and PBK stack
| * | | | | | | | shader: Split SSY and PBK stackReinUsesLisp2019-06-074-27/+78
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Hardware testing revealed that SSY and PBK push to a different stack, allowing code like this: SSY label1; PBK label2; SYNC; label1: PBK; label2: EXIT;
* | | | | | | | | Merge pull request #2581 from lioncash/hexZach Hilman2019-06-1511-39/+45
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()
| * | | | | | | | | common/hex_util: Reserve std::string memory ahead of timeLioncash2019-06-121-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially performing multiple reallocations (depending on the size of the input data) by reserving the necessary amount of memory ahead of time. This is trivially doable, so there's no harm in it.
| * | | | | | | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-1211-39/+40
| | |_|_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These can be generified together by using a concept type to designate them. This also has the benefit of not making copies of potentially very large arrays.
* | | | | | | | | Merge pull request #2582 from lioncash/reservedbunnei2019-06-141-1/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | file_sys/ips_layer: Remove unnecessary reserve() call
| * | | | | | | | | file_sys/ips_layer: Remove unnecessary reserve() callLioncash2019-06-131-1/+0
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given 'replace' is assigned to on the following line, this isn't necessary, given the underlying data is going to be overwritten entirely.
* | | | | | | | | Merge pull request #2580 from lioncash/redundantZach Hilman2019-06-131-3/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/vm_manager: Remove redundant Reset call in destructor
| * | | | | | | | | kernel/vm_manager: Remove redundant Reset call in destructorLioncash2019-06-121-3/+1
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is performing more work than would otherwise be necessary during VMManager's destruction. All we actually want to occur in this scenario is for any allocated memory to be freed, which will happen automatically as the VMManager instance goes out of scope. Anything else being done is simply unnecessary work.
* | | | | | | | | Merge pull request #2577 from lioncash/fsZach Hilman2019-06-131-17/+29
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | file_sys/card_image: Minor cleanup
| * | | | | | | | file_sys/card_image: Remove obsolete TODOLioncash2019-06-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already support Rev 1+.
| * | | | | | | | file_sys/card_image: Deduplicate casts within AddNCAFromPartition()Lioncash2019-06-111-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes for nicer reading.
| * | | | | | | | file_sys/card_image: Make bracing consistentLioncash2019-06-111-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes for more consistent reading.
| * | | | | | | | file_sys/card_image: Assign collapsed NCA contents directly to ncas memberLioncash2019-06-111-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same thing, significantly less noisy.
| * | | | | | | | file_sys/card_image: Deduplicate type castLioncash2019-06-111-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same thing, less duplication. We can also std::move raw into the PartitionFilesystem constructor.
| * | | | | | | | file_sys/card_image: Get rid of a magic numberLioncash2019-06-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use the size of the array to dehardcode it.
| * | | | | | | | file_sys/card_image: Use std::array deduction guidesLioncash2019-06-111-1/+6
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | Same thing, less code.
* | | | | | | | Merge pull request #2578 from lioncash/cnmtbunnei2019-06-121-2/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys/nca_metadata: Update CNMT structures
| * | | | | | | | file_sys/nca_metadata: Update CNMT structuresLioncash2019-06-111-2/+7
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Names a few more entries in relevant structures. Information based off SwitchBrew and my own RE.
* | | | | | | | Merge pull request #2572 from FernandoS27/gpu-membunnei2019-06-121-2/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | GPUVM: Correct GPU VM virtual address space
| * | | | | | | GPUVM: Correct GPU VM virtual address spaceFernando Sahmkow2019-06-091-2/+2
| | | | | | | |
* | | | | | | | Merge pull request #2571 from lioncash/refZach Hilman2019-06-102-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/process: Make Create()'s name parameter be taken by value
| * | | | | | | | kernel/process: Make Create()'s name parameter be taken by valueLioncash2019-06-102-2/+2
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface more flexible in terms of how Create() may be called, while still allowing the parameter itself to be moved into.
* | | | | | | | Merge pull request #2570 from lioncash/svcZach Hilman2019-06-105-9/+48
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel/svc: Handle TotalPhysicalMemoryAvailableWithoutMmHeap and TotalPhysicalMemoryUsedWithoutMmHeap
| * | | | | | | kernel/svc: Implement TotalMemoryUsedWithoutMmHeap/TotalMemoryAvailableWithoutMmHeapLioncash2019-06-103-2/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we don't currently implement the personal heap yet, the existing memory querying functions are essentially doing what the memory querying types introduced in 6.0.0 do. So, we can build the necessary machinery over the top of those and just use them as part of info types.
| * | | | | | | kernel/svc: Amend naming for TotalMemoryUsage in svcGetInfo()Lioncash2019-06-103-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Disambiguates and makes the name a little more consistent with TotalPhysicalMemoryUsed.
| * | | | | | | kernel/svc: Remove duplicate enum entry in svcGetInfo()Lioncash2019-06-101-2/+1
|/ / / / / / /
* | | | | | | Merge pull request #2564 from ReinUsesLisp/block-dim-x-fixZach Hilman2019-06-081-3/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kepler_compute: Minor changes
| * | | | | | | kepler_compute: Use std::array for cbuf infoReinUsesLisp2019-06-081-2/+3
| | | | | | | |
| * | | | | | | kepler_compute: Fix block_dim_x encodingReinUsesLisp2019-06-081-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2567 from FearlessTobi/patch-1Zach Hilman2019-06-081-0/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | .github: Create FUNDING.yml
| * | | | | | .github: Create FUNDING.ymlTobias2019-06-081-0/+3
|/ / / / / /
* | | | | | Merge pull request #2553 from lioncash/languageZach Hilman2019-06-0831-58/+326
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu/configuration: Make all widgets and dialogs aware of language changes
| * | | | | | yuzu/configuration: Make all widgets and dialogs aware of language changesLioncash2019-06-0631-58/+326
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | To prepare for translation support, this makes all of the widgets cognizant of the language change event that occurs whenever installTranslator() is called and automatically retranslates their text where necessary. This is important as calling the backing UI's retranslateUi() is often not enough, particularly in cases where we add our own strings that aren't controlled by it. In that case we need to manually refresh the strings ourselves.
* | | | | | | Merge pull request #2293 from DarkLordZach/system-constantsZach Hilman2019-06-085-28/+43
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | core: Remove duplicated account JPEG data structure
| * | | | | | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-075-28/+43
|/ / / / / /
* | | | | | Merge pull request #2514 from ReinUsesLisp/opengl-compatZach Hilman2019-06-0724-252/+45
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | video_core: Drop OpenGL core in favor of OpenGL compatibility
| * | | | | gl_buffer_cache: Remove unused ReserveMemory methodReinUsesLisp2019-05-302-13/+0
| | | | | |
| * | | | | maxwell_to_gl: Use GL_CLAMP to emulate Clamp wrap modeReinUsesLisp2019-05-303-7/+4
| | | | | |
| * | | | | gl_rasterizer: Move alpha testing to the OpenGL pipelineReinUsesLisp2019-05-308-71/+33
| | | | | | | | | | | | | | | | | | | | | | | | Removes the alpha testing code from each fragment shader invocation.
| * | | | | gl_rasterizer: Use GL_QUADS to emulate quads renderingReinUsesLisp2019-05-306-132/+5
| | | | | |
| * | | | | rasterizer_opengl: Remove OpenGL core profileReinUsesLisp2019-05-308-29/+3
| | | | | |
* | | | | | Merge pull request #2558 from ReinUsesLisp/shader-nodesbunnei2019-06-076-493/+528
|\ \ \ \ \ \ | | | | | | | | | | | | | | shader: Move Node declarations out of the shader IR header
| * | | | | | cmake: Add missing shader hash file entriesReinUsesLisp2019-06-072-0/+6
| | | | | | |
| * | | | | | shader/node: Minor changesReinUsesLisp2019-06-071-50/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reflect std::shared_ptr nature of Node on initializers and remove constant members in nodes. Add some commentaries.
| * | | | | | shader: Move Node declarations out of the shader IR headerReinUsesLisp2019-06-074-493/+518
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Analysis passes do not have a good reason to depend on shader_ir.h to work on top of nodes. This splits node-related declarations to their own file and leaves the IR in shader_ir.h
* | | | | | Merge pull request #2552 from ReinUsesLisp/shader-shared-ptrZach Hilman2019-06-0735-248/+296
|\ \ \ \ \ \ | | | | | | | | | | | | | | shader: Use shared_ptr to store nodes and move initialization to file
| * | | | | | shader: Use shared_ptr to store nodes and move initialization to fileReinUsesLisp2019-06-0635-248/+296
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of having a vector of unique_ptr stored in a vector and returning star pointers to this, use shared_ptr. While changing initialization code, move it to a separate file when possible. This is a first step to allow code analysis and node generation beyond the ShaderIR class.
* | | | | | | Merge pull request #2549 from lioncash/headerZach Hilman2019-06-061-1/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/process: Remove unused boost header include
| * | | | | | | kernel/process: Remove unused boost header includeLioncash2019-06-051-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Boost headers typically include a lot of other headers, so removing this can prevent a bit of unnecessary compiler churn when building.
* | | | | | | | Merge pull request #2550 from lioncash/frontendZach Hilman2019-06-061-0/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu/CMakeLists: Pass compilation flags that make it more difficult to cause bugs in Qt code
| * | | | | | | | yuzu/CMakeLists: Disable implicit QString->QUrl conversionsLioncash2019-06-051-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Enforces the use of the proper URL resolution functions. e.g. url = some_local_path_string; should actually be: url = QUrl::fromLocalPath(some_local_path_string); etc. This makes it harder to cause bugs when operating with both strings and URLs at the same time.
| * | | | | | | | yuzu/CMakeLists: Disable unsafe overloads of QProcess' start() functionLioncash2019-06-051-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Other overloads of start() are considerably much safer to use if we ever need this in the future and need to pass arguments to the program, given it contains separate parameters for the program path and the arguments themselves, whereas this unsafe overload contains both as a single string. Given the alternatives are much safer, we can disable this.
| * | | | | | | | yuzu/CMakeLists: Disable implicit type narrowing in connect() callsLioncash2019-06-051-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents hard-to-diagnose bugs from potentially occurring and requires any type narrowing to be explicitly performed by our code.
* | | | | | | | | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | service/ns: Add missing override specifiers
| * | | | | | | | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
| | | | | | | | |
* | | | | | | | | Merge pull request #2520 from ReinUsesLisp/vulkan-refreshbunnei2019-06-065-88/+218
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_device,vk_shader_decompiler: Miscellaneous changes
| * | | | | | | | | vk_device: Let formats array type be deducedReinUsesLisp2019-05-261-33/+33
| | | | | | | | | |
| * | | | | | | | | vk_shader_decompiler: Misc fixesReinUsesLisp2019-05-263-45/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix missing OpSelectionMerge instruction. This caused devices loses on most hardware, Intel didn't care. Fix [-1;1] -> [0;1] depth conversions. Conditionally use VK_EXT_scalar_block_layout. This allows us to use non-std140 layouts on UBOs. Update external Vulkan headers.
| * | | | | | | | | vk_device: Enable features when available and misc changesReinUsesLisp2019-05-262-43/+151
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps track of native ASTC support, VK_EXT_scalar_block_layout availability and SSBO range. Check for independentBlend and vertexPipelineStorageAndAtomics as a required feature. Always enable it. Use vk::to_string format to log Vulkan enums. Style changes.
* | | | | | | | | | Merge pull request #2540 from ReinUsesLisp/remove-guest-positionbunnei2019-06-062-36/+21
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Remove guest "position" varying
| * | | | | | | | | | gl_shader_decompiler: Remove guest "position" varyingReinUsesLisp2019-06-032-36/+21
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | "position" was being written but not read anywhere besides geometry shaders, where it had the same value as gl_Position. This commit replaces "position" with gl_Position, reducing the complexity of our code and the emitted GLSL code.
* | | | | | | | | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | lr: Add command handler skeletons for Open*LocationResolver
| * | | | | | | | | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns an object of type IAddOnContentLocationResolver for the provided StorageId.
| * | | | | | | | | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns an object of type IRegisteredLocationResolver for the StorageId.
| * | | | | | | | | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | Returns an object of type ILocationResolver with the provided StorageId.
* | | | | | | | | Merge pull request #2521 from lioncash/namingbunnei2019-06-0633-213/+234
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu/configuration: Make function naming consistent
| * | | | | | | | | yuzu/configuration: Make function naming consistentLioncash2019-06-0533-213/+234
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2512 from ReinUsesLisp/comp-indexingbunnei2019-06-063-3/+80
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | gl_shader_decompiler: Pessimize uniform buffer access on AMD's prorpietary driver
| * | | | | | | | | gl_shader_decompiler: Use an if based cbuf indexing for broken driversReinUsesLisp2019-05-241-3/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The following code is broken on AMD's proprietary GLSL compiler: ```glsl uint idx = ...; vec4 values = ...; float some_value = values[idx & 3]; ``` It index the wrong components, to fix this the following pessimized code is emitted when that bug is present: ```glsl uint idx = ...; vec4 values = ...; float some_value; if ((idx & 3) == 0) some_value = values.x; if ((idx & 3) == 1) some_value = values.y; if ((idx & 3) == 2) some_value = values.z; if ((idx & 3) == 3) some_value = values.w; ```
| * | | | | | | | | gl_device: Add test to detect broken component indexingReinUsesLisp2019-05-242-0/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Component indexing on AMD's proprietary driver is broken. This commit adds a test to detect when we are on a driver that can't successfully manage component indexing. It dispatches a dummy draw with just one vertex shader that writes to an indexed SSBO from the GPU with data sent through uniforms, it then reads that data from the CPU and compares the expected output.
* | | | | | | | | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-059-75/+98
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | core/telemetry_session: Remove usages of the global system accessor
| * | | | | | | | | | core/core: Remove unnecessary includesLioncash2019-05-293-13/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The contents of these includes aren't used anywhere in this translation unit.
| * | | | | | | | | | yuzu_cmd/yuzu: Correct formatting specifierLioncash2019-05-291-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends the formatting specifier to obey libfmt. Prevents the application from terminating due to a formatting issue in the error case.
| * | | | | | | | | | core/loader: Remove LoadKernelSystemModeLioncash2019-05-295-29/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a hold-over from Citra and doesn't apply to yuzu.
| * | | | | | | | | | core/telemetry_session: Remove unnecessary web service nulling out in destructorLioncash2019-05-291-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will automatically occur when the backend instance goes out of scope at the end of the destructor's execution.
| * | | | | | | | | | core/telemetry_session: Remove usages of the global system accessorLioncash2019-05-293-30/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the dependency explicit in the TelemetrySession's interface instead of making it a hidden dependency. This also revealed a hidden issue with the way the telemetry session was being initialized. It was attempting to retrieve the app loader and log out title-specific information. However, this isn't always guaranteed to be possible. During the initialization phase, everything is being constructed. It doesn't mean an actual title has been selected. This is what the Load() function is for. This potentially results in dead code paths involving the app loader. Instead, we explicitly add this information when we know the app loader instance is available.
| * | | | | | | | | | core/telemetry_session: Explicitly delete copy and move constructorsLioncash2019-05-291-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | NonCopyable is misleading here. It also makes the class non-moveable as well, so we can be explicit about this.
| * | | | | | | | | | core/telemetry_session: Remove unused includeLioncash2019-05-291-1/+0
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-057-78/+38
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | core/core_timing_util: Use std::chrono types for specifying time units
| * | | | | | | | | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-053-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the casing consistent with all of our general function naming conventions.
| * | | | | | | | | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-057-36/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface more type-safe and consistent in terms of return values.
| * | | | | | | | | | core/core_timing_utils: Simplify overload setLioncash2019-06-052-49/+2
| | |_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes unused overloads, simplifying the overall interface, deduplicating some code.
* | | | | | | | | | Merge pull request #2541 from lioncash/inputZach Hilman2019-06-053-78/+76
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | input_common/sdl/sdl_impl: Minor cleanup
| * | | | | | | | | input_common/sdl/sdl_impl: Correct logging string in SDLState constructorLioncash2019-06-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If this path was ever taken, a runtime exception would occur due to the lack of a formatting specifier to insert the error code into the format string.
| * | | | | | | | | input_common/sdl/sdl_impl: Move documentation comments to header where applicableLioncash2019-06-032-7/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Places the documentation comments with the rest of SDLState's member function documentation.
| * | | | | | | | | input_common/sdl/sdl_impl: Amend names for axes for SDLAnalogPollerLioncash2019-06-031-13/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds another underscore to clearly indicate the axis names.
| * | | | | | | | | input_common/sdl/sdl_impl: Mark variables const where applicableLioncash2019-06-031-10/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Make it explicit that these aren't modified elsewhere (either through functions by reference, or by other operations).
| * | | | | | | | | input_common/sdl/sdl_impl: Mark SDLEventToButtonParamPackage() as staticLioncash2019-06-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Its prototype declared at the top of the translation unit contains the static qualifier, so the function itself should also contain it to make it a proper internally linked function.
| * | | | | | | | | input_common/sdl/sdl_impl: Convert reinterpret_cast into a static_castLioncash2019-06-031-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's valid to static_cast a void pointer back into its proper type.
| * | | | | | | | | input_common/sdl/sdl_impl: Use insert_or_assign() where applicableLioncash2019-06-031-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, but without a potential need to unnecessarily default construct a value.
| * | | | | | | | | input_common/sdl/sdl_impl: Simplify SDL_Joystick deleter handlingLioncash2019-06-031-15/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The deleter can just be set in the constructor and maintained throughout the lifetime of the object. If a contained pointer is null, then the deleter won't execute, so this is safe to do. We don't need to swap it out with a version of a deleter that does nothing.
| * | | | | | | | | input_common/sdl/sdl_impl: Resolve two sign conversion warningsLioncash2019-06-031-10/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences the final two warnings in SDL code.
| * | | | | | | | | input_common/sdl: Remove unused header includes and forward declarationsLioncash2019-06-033-11/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of a few unnecessary inclusion dependencies. It also uncovered a few indirect inclusion dependencies being relied upon.
| * | | | | | | | | input_common/sdl/sdl_impl: Use nested namespace specifiers where applicableLioncash2019-06-031-5/+2
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-0510-402/+1081
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | Implement/Fix IApplicationFunctions::GetDesiredLanguage
| * | | | | | | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| | | | | | | | |
| * | | | | | | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| | | | | | | | |
| * | | | | | | | Address review commentsMichael Scire2019-05-236-47/+120
| | | | | | | | |
| * | | | | | | | clang-format fixesMichael Scire2019-05-234-31/+32
| | | | | | | | |
| * | | | | | | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-239-403/+1010
| | | | | | | | |
* | | | | | | | | Merge pull request #2527 from lioncash/indexZach Hilman2019-06-055-34/+16
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu/{profile_select, software_keyboard}: Tidy up interface
| * | | | | | | | | yuzu/software_keyboard: Remove unnecessary GetStatus() member functionLioncash2019-05-293-10/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like with the profile selection dialog, we can just use the result of QDialog's exec() function to determine whether or not a dialog was accepted.
| * | | | | | | | | profile_select: Remove unnecessary GetStatus() member functionLioncash2019-05-293-18/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This behavior is already provided by the built-in exec() function. We just need to check the return value of it.
| * | | | | | | | | profile_select: Return int instead of u32 for GetIndex()Lioncash2019-05-293-8/+9
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt uses a signed value to represent indices. We should follow this convention where applicable to avoid unnecessary sign-conversion warnings, as well as making it easier to interoperate with other aspects of Qt. While we're at it, we can also make a sign-conversion explicit.
* | | | | | | | | Merge pull request #2534 from ReinUsesLisp/shader-cleanupZach Hilman2019-06-052-31/+36
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_cache: Minor style changes
| * | | | | | | | | gl_shader_cache: Store a system class and drop global accessorsReinUsesLisp2019-05-302-7/+9
| | | | | | | | | |
| * | | | | | | | | gl_shader_cache: Add commentaries explaining the intention in shaders creationReinUsesLisp2019-05-301-0/+2
| | | | | | | | | |
| * | | | | | | | | gl_shader_cache: Flip if condition in GetStageProgram to reduce indentationReinUsesLisp2019-05-301-25/+26
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2531 from ReinUsesLisp/qt-warningsZach Hilman2019-06-053-15/+15
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | qt: Silence name collision warnings
| * | | | | | | | | qt: Silence name collision warningsReinUsesLisp2019-05-303-15/+15
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2515 from lioncash/narrowingZach Hilman2019-06-051-6/+5
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu/configuration/configure_graphics: Eliminate type narrowing in a connect call
| * | | | | | | | | | yuzu/configuration/configure_graphics: Eliminate type narrowing in a connect callLioncash2019-05-251-6/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A checkbox is able to be tri-state, giving it three possible activity types, so in the connect call here, it would actually be truncating an int into a bool. Instead, we can just listen on the toggled() signal, which passes along a bool, not an int.
* | | | | | | | | | | Merge pull request #2532 from ShalokShalom/patch-2Zach Hilman2019-06-051-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Remove outdated info about compability
| * | | | | | | | | | | Remove outdated info about compabilityShalokShalom2019-05-301-1/+1
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2536 from lioncash/cacheZach Hilman2019-06-051-36/+26
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | game_list_worker: Use QFile over our own IOFile instance or std streams for the game list cache
| * | | | | | | | | | | game_list_worker: Use QFile over our own IOFile instance or std streamsLioncash2019-05-311-28/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Stays consistent in our code with using Qt's provided mechanisms, and also properly handles Unicode paths (which file streams on Windows don't do very well).
| * | | | | | | | | | | game_list_worker: Remove template specializationsLioncash2019-05-311-8/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is equivalent to specifying two separate functions, so we can just do that.
* | | | | | | | | | | | Merge pull request #2529 from lioncash/bootRodrigo Locatti2019-06-054-44/+61
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / |/| | | | | | | | | | | yuzu/bootmanager: Minor interface tidying
| * | | | | | | | | | | yuzu/bootmanager: Log out screenshot destination pathLioncash2019-06-031-6/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can make this message more meaningful by indicating the location the screenshot has been saved to. We can also log out whenever a screenshot could not be saved (e.g. due to filesystem permissions or some other reason).
| * | | | | | | | | | | yuzu/bootmanager: Treat the resolution factor as a u32Lioncash2019-06-034-16/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Treating it as a u16 can result in a sign-conversion warning when performing arithmetic with it, as u16 promotes to an int when aritmetic is performed on it, not unsigned int. This also makes the interface more uniform, as the layout interface now operates on u32 across the board.
| * | | | | | | | | | | yuzu/bootmanager: Default EmuThread's destructor in the cpp fileLioncash2019-06-032-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This class contains non-trivial members, so we should default the destructor's definition within the cpp file.
| * | | | | | | | | | | yuzu/bootmanager: unsigned -> u32Lioncash2019-06-032-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same thing (for platforms we support), less reading.
| * | | | | | | | | | | yuzu/bootmanager: Change false literal to 0 for setSwapInterval()Lioncash2019-06-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is defined as taking an int, not a bool.
| * | | | | | | | | | | yuzu/bootmanager: Remove pointer downcast in GRenderWindow's constructorLioncash2019-06-032-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just pass a pointer to GMainWindow directly and make it a requirement of the interface. This makes the interface a little safer, since this would technically otherwise allow any random QWidget to be the parent of a render window, downcasting it to GMainWindow (which is undefined behavior).
| * | | | | | | | | | | yuzu/bootmanager: Remove unnecessary pointer castsLioncash2019-06-031-5/+6
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just invoke these functions by qualifying the object name before the function.
* | | | | | | | | | | Merge pull request #2525 from FearlessTobi/remove-unused-settingsMat M2019-06-043-170/+44
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | yuzu: Remove unused birthday setting
| * | | | | | | | | | | yuzu: Remove unused birthday settingfearlessTobi2019-05-293-170/+44
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes #2522.
* | | | | | | | | | | Merge pull request #2543 from FernandoS27/exit-flowHexagon122019-06-041-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | shader_bytecode: Mark EXIT as flow instruction
| * | | | | | | | | | shader_bytecode: Mark EXIT as flow instructionFernando Sahmkow2019-06-041-1/+1
|/ / / / / / / / / /
* | | | | | | | | | input_common/sdl/sdl_impl: Silence sign conversion warningsLioncash2019-05-311-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the conversions explicit, as opposed to implicit.
* | | | | | | | | | common/math_util: Provide a template deduction guide for Common::RectangleLioncash2019-05-311-0/+3
| |/ / / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows for things such as: auto rect = Common::Rectangle{0, 0, 0, 0}; as opposed to being required to explicitly write out the underlying type, such as: auto rect = Common::Rectangle<int>{0, 0, 0, 0}; The only requirement for the deduction is that all constructor arguments be the same type.
* | | | | | | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-3018-127/+1157
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | mii: Implement MiiManager backend and several mii service commands
| * | | | | | | | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| | | | | | | | | |
| * | | | | | | | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-259-29/+27
| | | | | | | | | |
| * | | | | | | | | mii: Implement Delete and Destroy fileZach Hilman2019-04-254-13/+122
| | | | | | | | | |
| * | | | | | | | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| | | | | | | | | |
| * | | | | | | | | mii_manager: Cleanup and optimizationZach Hilman2019-04-255-39/+55
| | | | | | | | | |
| * | | | | | | | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-252-15/+244
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since the MiiManager was designed around the IPC interface, this is quite easy. Only functions that were clearly defined were implemented.
| * | | | | | | | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides serialization/deserialization to the database in system save files, accessors for database state and proper handling of both major Mii formats (MiiInfo and MiiStoreData)
| * | | | | | | | | common: Extract UUID to its own classZach Hilman2019-04-256-78/+108
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since the Mii database uses UUIDs very similar to the Accounts database, it makes no sense to not share code between them.
* | | | | | | | | | Merge pull request #2431 from DarkLordZach/game-list-cachebunnei2019-05-305-7/+133
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | yuzu: Implement a caching mechanism for the game list
| * | | | | | | | | main: Remove extraneous commentZach Hilman2019-05-301-1/+0
| | | | | | | | | |
| * | | | | | | | | game_list_worker: Add better error handling to cachingZach Hilman2019-05-262-23/+42
| | | | | | | | | |
| * | | | | | | | | yuzu: Clear partial/full game list cache when data is updatedZach Hilman2019-05-262-0/+13
| | | | | | | | | |
| * | | | | | | | | game_list: Implement caching for game listZach Hilman2019-05-261-7/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Preserves list of add ons and the icon, which are the two costliest parts of game list population.
| * | | | | | | | | ui_settings: Add option to cache game listZach Hilman2019-05-262-0/+3
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2446 from ReinUsesLisp/tidbunnei2019-05-294-22/+76
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | shader: Implement S2R Tid{XYZ} and CtaId{XYZ}
| * | | | | | | | | shader: Implement S2R Tid{XYZ} and CtaId{XYZ}ReinUsesLisp2019-05-204-15/+69
| | | | | | | | | |
| * | | | | | | | | gl_shader_decompiler: Make GetSwizzle constexprReinUsesLisp2019-05-201-7/+7
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2518 from ReinUsesLisp/sdl2-windowbunnei2019-05-299-186/+216
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | yuzu_cmd: Split emu_window OpenGL implementation into its own file
| * | | | | | | | | emu_window: Pass OnMinimalClientAreaChangeRequest argument by copyReinUsesLisp2019-05-265-10/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no performance improvement in passing an unsigned pair by reference.
| * | | | | | | | | yuzu_cmd: Split emu_window OpenGL implementation into its own fileReinUsesLisp2019-05-256-176/+211
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2519 from lioncash/signbunnei2019-05-272-5/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | loader/nso, core/core_timing_util: Silence sign-comparison warning
| * | | | | | | | | core_timing_util: Silence sign-comparison warningsLioncash2019-05-251-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just make the conversion explicit instead of implicit here to silence -Wsign-compare warnings.
| * | | | | | | | | loader/nso: Silence sign-comparison warningLioncash2019-05-251-1/+1
| | |_|_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was previously performing a size_t == int comparison. Silences a -Wsign-compare warning.
* | | | | | | | | Merge pull request #2524 from ReinUsesLisp/fixup-extensionbunnei2019-05-273-7/+6
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | gl_shader_gen: Always declare extensions after the version declaration
| * | | | | | | | gl_device: Add commentary to AOFFI unit test source codeReinUsesLisp2019-05-271-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The intention behind this commit is to hint someone inspecting an apitrace dump to ignore this ill-formed GLSL code.
| * | | | | | | | gl_shader_gen: Always declare extensions after the version declarationReinUsesLisp2019-05-272-7/+5
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This addresses a bug on geometry shaders where code was being written before all #extension declarations were done. Ref to #2523
* | | | | | | | Merge pull request #2516 from lioncash/labelbunnei2019-05-262-10/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | renderer_opengl/utils: Use a std::string_view with LabelGLObject()
| * | | | | | | | renderer_opengl/utils: Use a std::string_view with LabelGLObject()Lioncash2019-05-252-10/+10
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses a std::string_view instead of a std::string, given the pointed to string isn't modified and is only used in a formatting operation. This is nice because a few usages directly supply a string literal to the function, allowing these usages to otherwise not heap allocate, unlike the std::string overloads. While we're at it, we can combine the address formatting into a single formatting call.
* | | | | | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/aoc_u: Minor cleanup
| * | | | | | | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the code was accumulating data into a std::vector and then tossing all of it away if a setting was disabled. Instead, we can just check if it's disabled and do no work at all if possible. If it's enabled, then we can append to the vector and allocate. Unlikely to impact usage much, but it is slightly less sloppy with resources.
| * | | | | | | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes two header dependencies related to file handling that aren't actually used within the source file.
| * | | | | | | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A few of the aoc service stubs/implementations weren't fully popping all of the parameters passed to them. This ensures that all parameters are popped and, at minimum, logged out.
* | | | | | | | Merge pull request #2511 from lioncash/file-strbunnei2019-05-263-45/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/file_util: Minor cleanup
| * | | | | | | | common/file_util: Remove unnecessary return at end of void StripTailDirSlashes()Lioncash2019-05-231-6/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, also invert the conditional into a guard clause.
| * | | | | | | | common/file_util: Make GetCurrentDir() return a std::optionalLioncash2019-05-232-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | nullptr was being returned in the error case, which, at a glance may seem perfectly OK... until you realize that std::string has the invariant that it may not be constructed from a null pointer. This means that if this error case was ever hit, then the application would most likely crash from a thrown exception in std::string's constructor. Instead, we can change the function to return an optional value, indicating if a failure occurred.
| * | | | | | | | common/file_util: Remove duplicated documentation commentsLioncash2019-05-231-25/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are already present within the header, so they don't need to be repeated in the cpp file.
| * | | | | | | | common/file_util: Make ReadFileToString and WriteStringToFile consistentLioncash2019-05-233-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the parameter ordering consistent, and also makes the filename parameter a std::string. A std::string would be constructed anyways with the previous code, as IOFile's only constructor with a filepath is one taking a std::string. We can also make WriteStringToFile's string parameter utilize a std::string_view for the string, making use of our previous changes to IOFile.
| * | | | | | | | common/file_util: Remove unnecessary c_str() callsLioncash2019-05-231-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The file stream open functions have supported std::string overloads since C++11, so we don't need to use c_str() here. Same behavior, less code.
| * | | | | | | | common/file_util: Make IOFile's WriteString take a std::string_viewLioncash2019-05-231-2/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to force the usage of a std::string here, and can instead use a std::string_view, which allows writing out other forms of strings (e.g. C-style strings) without any unnecessary heap allocations.
* | | | | | | | Merge pull request #2517 from lioncash/hotkeybunnei2019-05-264-35/+25
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | configure_hotkeys: Minor cleanup
| * | | | | | | configure_hotkeys: Remove unnecessary Settings::Apply() callLioncash2019-05-251-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nothing from the hotkeys dialog relies on this call occurring, and is already called from the dialog that calls applyConfiguration().
| * | | | | | | configure_hotkeys: Tidy up key sequence conflict error stringLioncash2019-05-251-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids mentioning the user and formalizes the error itself.
| * | | | | | | configure_hotkeys: Change critical error dialog into a warning dialogLioncash2019-05-251-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | critical() is intended for critical/fatal errors that threaten the overall stability of an application. A user entering a conflicting key sequence is neither of those.
| * | | | | | | configure_hotkeys: Move conflict detection logic to IsUsedKey()Lioncash2019-05-252-14/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to extract the entire set of hotkeys into a list and then iterate through it. We can traverse the list and early-exit if we're able to.
| * | | | | | | configure_hotkeys: Remove unused EmitHotkeysChanged()Lioncash2019-05-253-13/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 1. This is something that should be solely emitted by the hotkey dialog itself 2. This is functionally unused, given there's nothing listening for the signal.
| * | | | | | | sequence_dialog: Reorganize the constructorLioncash2019-05-251-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous code was all "smushed" together wasn't really grouped together that well. This spaces things out and separates them by relation to one another, making it easier to visually parse the individual sections of code that make up the constructor.
| * | | | | | | sequence_dialog: Remove unnecessary horizontal specifierLioncash2019-05-251-2/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | QDialogButtonBoxes are horizontal by default.
* | | | | | | Merge pull request #2513 from lioncash/stringbunnei2019-05-255-126/+168
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/main: Specify string conversions explicitly
| * | | | | | | yuzu/CMakeLists: Disable implicit QString conversionsLioncash2019-05-251-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that all of our code is compilable with implicit QString conversions, we can enforce it at compile-time by disabling them.
| * | | | | | | yuzu/applets/software_keyboard: Remove unused assert headerLioncash2019-05-251-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't actually used anywhere, so it can be removed.
| * | | | | | | yuzu/applets/software_keyboard: std::move argument in MainWindowFinishedText()Lioncash2019-05-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the std::optional can contain an object type that heap allocates, we can use std::move to avoid an unnecessary copy/allocation from occurring.
| * | | | | | | yuzu/applets/software_keyboard: Resolve sign mismatch comparisonLioncash2019-05-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt uses a signed value to represent container sizes, so this was causing a sign mismatch warning.
| * | | | | | | yuzu/applets/software_keyboard: Specify string conversions explicitlyLioncash2019-05-252-10/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the software keyboard applet code to compile with implicit string conversions disabled.
| * | | | | | | yuzu/applets/error: Specify string conversions explicitlyLioncash2019-05-251-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the error applet to build successfully with implicit string conversions disabled.
| * | | | | | | yuzu/main: Specify string conversions where applicableLioncash2019-05-251-115/+145
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #2358 from ReinUsesLisp/parallel-shaderbunnei2019-05-259-62/+122
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_cache: Use shared contexts to build shaders in parallel at boot
| * | | | | | gl_shader_cache: Fix clang strict standard build issuesReinUsesLisp2019-05-213-9/+13
| | | | | | |
| * | | | | | gl_shader_cache: Use shared contexts to build shaders in parallelReinUsesLisp2019-05-217-56/+112
| | | | | | |
* | | | | | | Merge pull request #2485 from ReinUsesLisp/generic-memorybunnei2019-05-253-35/+73
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader/memory: Implement generic memory stores and loads (ST and LD)
| * | | | | | | shader/memory: Implement ST (generic memory)ReinUsesLisp2019-05-212-21/+36
| | | | | | | |
| * | | | | | | shader/memory: Implement LD (generic memory)ReinUsesLisp2019-05-213-15/+38
| |/ / / / / /
* | | | | | | Merge pull request #2504 from lioncash/configbunnei2019-05-252-33/+43
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/configuration/config: Specify string conversions explicitly
| * | | | | | | yuzu/configuration/config: Make default hotkeys an internally-linked array in the cpp fileLioncash2019-05-212-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the array is a private static array, we can just make it internally linked to hide it from external code. This also allows us to remove an inclusion within the header.
| * | | | | | | yuzu/configuration/config: Specify string conversions explicitlyLioncash2019-05-211-30/+42
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the configuration code to build successfully with implicit string conversions disabled.
* | | | | | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-254-9/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port citra-emu/citra#4716: "HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThread"
| * | | | | | | Address review commentTobias2019-05-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: Mat M. <mathew1800@gmail.com>
| * | | | | | | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-184-9/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reduces the boilerplate that services have to write out the current thread explicitly. Using current thread instead of client thread is also semantically incorrect, and will be a problem when we implement multicore (at which time there will be multiple current threads)
* | | | | | | | Merge pull request #2505 from ReinUsesLisp/glad-updatebunnei2019-05-253-542/+2983
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | externals: Update glad to support OpenGL 4.6 compatibility profile
| * | | | | | | externals: Update glad to support OpenGL 4.6 compatibility profileReinUsesLisp2019-05-223-542/+2983
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have an OpenGL compatibility profile we might want to use OpenGL compatibility symbols that are not available in our current glad. This commit has been generated with https://glad.dav1d.de/ with all extensions enabled and OpenGL 4.6 compatibility profile.
* | | | | | | | shader/shader_ir: Make Comment() take a std::string by valueLioncash2019-05-232-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows for forming comment nodes without making unnecessary copies of the std::string instance. e.g. previously: Comment(fmt::format("Base address is c[0x{:x}][0x{:x}]", cbuf->GetIndex(), cbuf_offset)); Would result in a copy of the string being created, as CommentNode() takes a std::string by value (a const ref passed to a value parameter results in a copy). Now, only one instance of the string is ever moved around. (fmt::format returns a std::string, and since it's returned from a function by value, this is a prvalue (which can be treated like an rvalue), so it's moved into Comment's string parameter), we then move it into the CommentNode constructor, which then moves the string into its member variable).
* | | | | | | | shader/decode/*: Add missing newline to files lacking themLioncash2019-05-2318-18/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the shader code file endings consistent.
* | | | | | | | shader/decode/*: Eliminate indirect inclusionsLioncash2019-05-236-1/+5
| |_|_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends cases where we were using things that were indirectly being satisfied through other headers. This way, if those headers change and eliminate dependencies on other headers in the future, we don't have cascading compilation errors.
* | | | | | | shader/decode/memory: Remove left in debug pragmaLioncash2019-05-221-2/+0
|/ / / / / /
* | / / / / renderer_opengl/gl_shader_decompiler: Remove redundant name specification in format stringLioncash2019-05-211-1/+1
| |/ / / / |/| | | | | | | | | | | | | | This accidentally slipped through a rebase.
* | | | | Merge pull request #2455 from lioncash/configbunnei2019-05-212-315/+573
|\ \ \ \ \ | | | | | | | | | | | | configuration/config: Move config loading and saving to functions based off groups
| * | | | | configuration/config: Move config loading and saving to functions based off groupsLioncash2019-05-092-315/+573
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Over time our config values have grown quite numerous in size. Unfortunately it also makes the single functions we have for loading and saving values more error prone. For example, we were loading the core settings twice when they only should have been loaded once. In another section, a variable was shadowing another variable used to load settings from a completely different section. Finally, in one other case, there was an extraneous endGroup() call used that didn't need to be done. This was essentially dead code and also a bug waiting to happen. This separates the section loading code into its own separate functions. This keeps variables only visible to the code that actually needs it, and makes it much easier to visually see the end of each individual configuration group. It also makes it much easier to visually catch bugs during code review. While we're at it, this also uses QStringLiteral instead of raw string literals, which both avoids constructing a lot of QString instances, but also makes it much easier to disable implicit ASCII to QString and vice-versa in the future via setting QT_NO_CAST_FROM_ASCII and QT_NO_CAST_TO_ASCII as compilation flags.
* | | | | | Merge pull request #2503 from lioncash/utilbunnei2019-05-217-84/+92
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu/game_list: Specify string conversions explicitly
| * | | | | | yuzu/game_list: Specify string conversions explicitlyLioncash2019-05-202-50/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the game list code to compile successfully with implicit string conversions disabled.
| * | | | | | yuzu/game_list_worker: Specify string conversions explicitlyLioncash2019-05-201-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the game list worker code to compile successfully with implicit string conversions disabled.
| * | | | | | yuzu/game_list_p: Amend mentions of SMDH in commentsLioncash2019-05-201-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | SMDH is a metadata format used in some executable formats for the Nintendo 3DS. Switch executables don't utilize this metadata format, so this just a holdover from Citra and can be corrected.
| * | | | | | yuzu/game_list_p: Specify string conversions explicitlyLioncash2019-05-201-10/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the game list item code to build with implicit string conversions disabled.
| * | | | | | yuzu/loading_screen: Specify string conversions explicitlyLioncash2019-05-201-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the loading screen code to compile with implicit string conversions disabled. While we're at it remove unnecessary const usages, and add it to nearby variables where appropriate.
| * | | | | | yuzu/bootmanager: Specify string conversions explicitlyLioncash2019-05-201-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the bootmanager code to compile with implicit string conversions disabled.
| * | | | | | yuzu/util: Specify string conversions explicitlyLioncash2019-05-201-8/+10
| | |_|/ / / | |/| | | | | | | | | | | | | | | | Allows the util code to build with implicit string conversions disabled.
* | | | | | Merge pull request #2494 from lioncash/shader-textbunnei2019-05-211-181/+195
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_decompiler: Add AddLine() overloads with single function that forwards to libfmt
| * | | | | gl_shader_decompiler: Tidy up minor remaining cases of unnecessary std::string concatenationLioncash2019-05-201-21/+20
| | | | | |
| * | | | | gl_shader_decompiler: Replace individual overloads with the fmt-based oneLioncash2019-05-201-28/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to special-case brace handling depending on the overload used, and makes it consistent across the board with how fmt handles them. Strings with compile-time deducible strings are directly forwarded to std::string's constructor, so we don't need to worry about the performance difference here, as it'll be identical.
| * | | | | gl_shader_decompiler: Utilize fmt overload of AddLine() where applicableLioncash2019-05-201-136/+152
| | | | | |
| * | | | | gl_shader_decompiler: Add AddLine() overload that forwards to fmtLioncash2019-05-191-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In a lot of places throughout the decompiler, string concatenation via operator+ is used quite heavily. This is usually fine, when not heavily used, but when used extensively, can be a problem. operator+ creates an entirely new heap allocated temporary string and given we perform expressions like: std::string thing = a + b + c + d; this ends up with a lot of unnecessary temporary strings being created and discarded, which kind of thrashes the heap more than we need to. Given we utilize fmt in some AddLine calls, we can make this a part of the ShaderWriter's API. We can make an overload that simply acts as a passthrough to fmt. This way, whenever things need to be appended to a string, the operation can be done via a single string formatting operation instead of discarding numerous temporary strings. This also has the benefit of making the strings themselves look nicer and makes it easier to spot errors in them.
* | | | | | Merge pull request #2499 from lioncash/translatebunnei2019-05-2010-119/+192
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu/configuration: Specify string conversions explicitly
| * | | | | | yuzu/configuration/configure_web: Specify string conversions explicitlyLioncash2019-05-191-8/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the web config code to compile with implicit string conversions disabled. We can also deduplicate the calls to create the pixmap.
| * | | | | | yuzu/configuration/configure_system: Specify string conversions explicitlyLioncash2019-05-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the system config code to build successfully with implicit string conversions disabled.
| * | | | | | yuzu/configuration/configure_profile_manager: Mark UI string as translatableLioncash2019-05-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a user-facing string, so it should be marked as translatable.
| * | | | | | yuzu/configuration/configure_per_general: Specify string conversions explicitlyLioncash2019-05-191-6/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the per-game configuration to be successfully built with implicit string conversions disabled.
| * | | | | | yuzu/configuration/configure_mouse_advanced: Clean up array accessesLioncash2019-05-191-19/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Deduplicates array accesses and uses a named variable where appropriate.
| * | | | | | yuzu/configuration/configure_mouse_advanced: Specify string conversions explicitlyLioncash2019-05-191-11/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the advanced mouse configuration code to build with implicit string conversions disabled.
| * | | | | | yuzu/configuration/configure_input_player: Clean up array accessesLioncash2019-05-191-32/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than repeatedly index arrays that have quite a large array index, we can just use a named variable instead.
| * | | | | | yuzu/configuration/configure_input_player: Specify string conversions explicitlyLioncash2019-05-191-24/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the player input configuration code to compile with implicit string conversions disabled.
| * | | | | | yuzu/configuration/configure_input: Mark controller type names as translateableLioncash2019-05-191-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These are user-facing strings, so they should be localizable.
| * | | | | | yuzu/configuration/configure_general: Specify string conversions explicitlyLioncash2019-05-191-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the general configuration code to successfully compile with implicit string conversions disabled.
| * | | | | | yuzu/configuration/configure_gamelist: Specify string conversions explicitlyLioncash2019-05-191-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the gamelist configuration code to compile with implicit string conversions disabled.
| * | | | | | yuzu/configuration/configure_audio: Store power on query into a variableLioncash2019-05-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids using the system accessor more than necessary, and ensures that both dialog boxes see the same power on state.
| * | | | | | yuzu/configuration/configure_audio: Tidy up function castLioncash2019-05-191-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use qOverload here to tidy up the function cast.
| * | | | | | yuzu/configuration/configure_audio: Specify string conversions explicitlyLioncash2019-05-191-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the audio configuration code to build with implicit string conversions disabled.
* | | | | | | Merge pull request #2500 from FernandoS27/revert-2466Hexagon122019-05-191-1/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Revert #2466
| * | | | | | Revert #2466Fernando Sahmkow2019-05-191-1/+3
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts a tested behavior on delay slots not exiting if the exit flag is set. Currently new tests are required in order to ensure this behavior.
* | | | | | Merge pull request #2441 from ReinUsesLisp/al2pbunnei2019-05-1910-157/+310
|\ \ \ \ \ \ | | | | | | | | | | | | | | shader: Implement AL2P and ALD.PHYS
| * | | | | | shader_ir/other: Implement IPA.IDXReinUsesLisp2019-05-032-5/+9
| | | | | | |
| * | | | | | gl_shader_decompiler: Skip physical unused attributesReinUsesLisp2019-05-031-18/+27
| | | | | | |
| * | | | | | shader_ir/memory: Assert on non-32 bits ALD.PHYSReinUsesLisp2019-05-031-0/+3
| | | | | | |
| * | | | | | shader: Add physical attributes commentariesReinUsesLisp2019-05-034-4/+8
| | | | | | |
| * | | | | | gl_shader_decompiler: Implement GLSL physical attributesReinUsesLisp2019-05-032-66/+101
| | | | | | |
| * | | | | | shader_ir/memory: Implement physical input attributesReinUsesLisp2019-05-034-6/+32
| | | | | | |
| * | | | | | gl_shader_decompiler: Abstract generic attribute operationsReinUsesLisp2019-05-031-29/+26
| | | | | | |
| * | | | | | gl_shader_decompiler: Declare all possible varyings on physical attribute usageReinUsesLisp2019-05-034-27/+88
| | | | | | |
| * | | | | | shader: Remove unused AbufNode Ipa modeReinUsesLisp2019-05-036-35/+14
| | | | | | |
| * | | | | | shader_ir/memory: Emit AL2P IRReinUsesLisp2019-05-032-0/+22
| | | | | | |
| * | | | | | shader_bytecode: Add AL2P decodingReinUsesLisp2019-05-031-2/+15
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2410 from lioncash/affinitybunnei2019-05-192-42/+58
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/svc: Reorganize and fix up the initial handling of svcSetThreadCoreMask()
| * | | | | | kernel/svc: Make svcCreateThread/svcStartThread/svcSleepThread/svcExitThread calls show up in the debug logLioncash2019-04-291-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are actually quite important indicators of thread lifetimes, so they should be going into the debug log, rather than being treated as misc info and delegated to the trace log.
| * | | | | | kernel/svc: Reorganize svcSetThreadCoreMask()Lioncash2019-04-291-32/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the code much nicer to follow in terms of behavior and control flow. It also fixes a few bugs in the implementation. Notably, the thread's owner process shouldn't be accessed in order to retrieve the core mask or ideal core. This should be done through the current running process. The only reason this bug wasn't encountered yet is because we currently only support running one process, and thus every owner process will be the current process. We also weren't checking against the process' CPU core mask to see if an allowed core is specified or not. With this out of the way, it'll be less noisy to implement proper handling of the affinity flags internally within the kernel thread instances.
| * | | | | | kernel/thread: Update thread processor ID flagsLioncash2019-04-292-7/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the missing flags to the enum and documents them.
* | | | | | | Merge pull request #2491 from FernandoS27/dma-fixHexagon122019-05-191-0/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Dma_pusher: ASSERT on empty command_list
| * | | | | | | Dma_pusher: ASSERT on empty command_listFernando Sahmkow2019-05-191-0/+7
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This is a measure to avoid crashes on command list reading as an empty command_list is considered a NOP.
* | | | | | | Merge pull request #2452 from FernandoS27/raster-cache-fixHexagon122019-05-191-1/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Correct possible error on Rasterizer Caches
| * | | | | | | Correct possible error on Rasterizer CachesFernando Sahmkow2019-05-071-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There was a weird bug that could happen if the object died directly and the cache address wasn't stored.
* | | | | | | | Merge pull request #2497 from lioncash/shader-irHexagon122019-05-193-32/+28
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader/shader_ir: Minor changes
| * | | | | | | | shader/shader_ir: Remove unnecessary inline specifiersLioncash2019-05-191-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | constexpr internally links by default, so the inline specifier is unnecessary.
| * | | | | | | | shader/shader_ir: Simplify constructors for OperationNodeLioncash2019-05-191-15/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of these constructors don't even need to be templated. The only ones that need to be templated are the ones that actually make use of the parameter pack. Even then, since std::vector accepts an initializer list, we can supply the parameter pack directly to it instead of creating our own copy of the list, then copying it again into the std::vector.
| * | | | | | | | shader/shader_ir: Remove unnecessary template parameter packs from Operation() overloads where applicableLioncash2019-05-191-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These overloads don't actually make use of the parameter pack, so they can be turned into regular non-template function overloads.
| * | | | | | | | shader/shader_ir: Mark tracking functions as const member functionsLioncash2019-05-192-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't actually modify instance state, so they can be marked as const member functions
| * | | | | | | | shader/shader_ir: Place implementations of constructor and destructor in cpp fileLioncash2019-05-192-5/+9
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the class contains quite a lot of non-trivial types, place the constructor and destructor within the cpp file to avoid inlining construction and destruction code everywhere the class is used.
* | | | | | | | Merge pull request #2495 from lioncash/cacheHexagon122019-05-192-34/+48
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_disk_cache: Minor cleanup
| * | | | | | | | gl_shader_disk_cache: in-class initialize virtual file offset of ShaderDiskCacheOpenGLLioncash2019-05-192-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the offset is assigned a fixed value in the constructor, we can just assign it directly and get rid of the need to write the name of the variable again in the constructor initializer list.
| * | | | | | | | gl_shader_disk_cache: Default ShaderDiskCacheOpenGL's destructor in the cpp fileLioncash2019-05-192-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the disk shader cache contains non-trivial types, we should default it in the cpp file in order to prevent inlining of the complex destruction logic.
| * | | | | | | | gl_shader_disk_cache: Make hash specializations noexceptLioncash2019-05-191-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The standard library expects hash specializations that don't throw exceptions. Make this explicit in the type to allow selection of better code paths if possible in implementations.
| * | | | | | | | gl_shader_disk_cache: Remove redundant code string construction in LoadDecompiledEntry()Lioncash2019-05-191-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to load the code into a vector and then construct a string over the data. We can just create a string with the necessary size ahead of time, and read the data directly into it, getting rid of an unnecessary heap allocation.
| * | | | | | | | gl_shader_disk_cache: Make variable non-const in decompiled entry caseLioncash2019-05-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::move does nothing when applied to a const variable. Resources can't be moved if the object is immutable. With this change, we don't end up making several unnecessary heap allocations and copies.
| * | | | | | | | gl_shader_disk_cache: Special-case boolean handlingLioncash2019-05-192-24/+37
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Booleans don't have a guaranteed size, but we still want to have them integrate into the disk cache system without needing to actually use a different type. We can do this by supplying non-template overloads for the bool type. Non-template overloads always have precedence during function resolution, so this is safe to provide. This gets rid of the need to smatter ternary conditionals, as well as the need to use u8 types to store the value in.
* | | | | | | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/audren_u: Get rid of magic values within GetAudioRendererWorkBufferSize
| * | | | | | | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also introduced in REV5 was a variable-size audio command buffer. This also affects how the size of the work buffer should be determined, so we can add handling for this as well. Thankfully, no other alterations were made to how the work buffer size is calculated in 7.0.0-8.0.0. There were indeed changes made to to how some of the actual audio commands are generated though (particularly in REV7), however they don't apply here.
| * | | | | | | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Introduced in REV5. This is trivial to add support for, now that everything isn't a mess of random magic constant values. All this is, is a change in data type sizes as far as this function cares.
| * | | | | | | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | "Unmagics" quite a few magic constants within this code, making it much easier to understand. Particularly given this factors out specific sections into their own self-contained lambda functions.
* | | | | | | | Merge pull request #2467 from lioncash/moveHexagon122019-05-191-6/+0
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | video_core/gpu_thread: Remove redundant copy constructor for CommandDataContainer
| * | | | | | | video_core/gpu_thread: Remove redundant copy constructor for CommandDataContainerLioncash2019-05-141-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::move within a copy constructor (on a data member that isn't mutable) will always result in a copy. Because of that, the behavior of this copy constructor is identical to the one that would be generated automatically by the compiler, so we can remove it.
* | | | | | | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/set: Correct and simplify behavior related to copying language codes
| * | | | | | | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This corrects cases where it was possible to write more entries into the write buffer than were requested. Now, we check the size of the buffer before actually writing into them. We were also returning the wrong value for GetAvailableLanguageCodeCount2(). This was previously returning 64, but only 17 should have been returned. 64 entries is the size of the static array used in MakeLanguageCode() within the service binary itself, but isn't the actual total number of language codes present.
* | | | | | | | | Merge pull request #2466 from yuzu-emu/mme-exit-delay-slotHexagon122019-05-191-3/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | GPU/MMEInterpreter: Ignore the 'exit' flag when it's executed inside a delay slot.
| * | | | | | | | | GPU/MMEInterpreter: Ignore the 'exit' flag when it's executed inside a delay slot.Sebastian Valle2019-05-121-3/+3
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It seems instructions marked with the 'exit' flag will not cause an exit when executed within a delay slot. This was hwtested by fincs.
* | | | | | | | | Merge pull request #2468 from lioncash/deductionHexagon122019-05-193-3/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu: Remove explicit types from locks where applicable
| * | | | | | | | | yuzu: Remove explicit types from locks where applicableLioncash2019-05-143-3/+3
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With C++17's deduction guides, the type doesn't need to be explicitly specified within locking primitives anymore.
* | | | | | | | | Merge pull request #2472 from FernandoS27/ticHexagon122019-05-191-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | maxwell_3d: reduce severity of different component formats assert.
| * | | | | | | | | maxwell_3d: reduce sevirity of different component formats assert.Fernando Sahmkow2019-05-141-1/+1
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was reduced due to happening on most games and at such constant rate that it affected performance heavily for the end user. In general, we are well aware of the assert and an implementation is already planned.
* | | | | | | | | Merge pull request #2469 from lioncash/copyableHexagon122019-05-191-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core/engines/maxwell_3d: Add is_trivially_copyable_v check for Regs
| * | | | | | | | | video_core/engines/maxwell_3d: Add is_trivially_copyable_v check for RegsLioncash2019-05-141-0/+2
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::memset is used to clear the entire register structure, which requires that the Regs struct be trivially copyable (otherwise undefined behavior is invoked). This prevents the case where a non-trivial type is potentially added to the struct.
* | | | | | | | | Merge pull request #2470 from lioncash/ranged-forSebastian Valle2019-05-191-18/+18
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core/engines/maxwell_3d: Simplify for loops into ranged for loops within InitializeRegisterDefaults()
| * | | | | | | | | video_core/engines/maxwell3d: Get rid of three magic values in CallMethod()Lioncash2019-05-141-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use the named constant instead of using 32 directly.
| * | | | | | | | | video_core/engines/maxwell_3d: Simplify for loops into ranged for loops within InitializeRegisterDefaults()Lioncash2019-05-141-15/+15
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Lessens the amount of code that needs to be read, and gets rid of the need to introduce an indexing variable. Instead, we just operate on the objects directly.
* | | | | | | | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service/am: Add missing return in error case for IStorageAccessor's Read/Write()
| * | | | | | | | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this would fall through and return successfully, despite being an out of bounds read or write.
* | | | | | | | | Merge pull request #2480 from ReinUsesLisp/fix-quadsHexagon122019-05-191-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Pass the right number of array quad vertices count
| * | | | | | | | | gl_rasterizer: Pass the right number of array quad vertices countReinUsesLisp2019-05-171-2/+2
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2483 from ReinUsesLisp/fix-point-sizeHexagon122019-05-191-1/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Limit OpenGL point size to a minimum of 1
| * | | | | | | | | | gl_rasterizer: Limit OpenGL point size to a minimum of 1ReinUsesLisp2019-05-181-1/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2471 from lioncash/engine-uploadSebastian Valle2019-05-192-6/+8
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core/engines/engine_upload: Minor tidying
| * | | | | | | | | | video_core/engines/engine_upload: Amend constructor initializer list orderLioncash2019-05-141-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences a -Wreorder warning.
| * | | | | | | | | | video_core/engines/engine_upload: Default destructor in the cpp fileLioncash2019-05-142-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids inlining destruction logic where applicable, and also makes forward declarations not cause unexpected compilation errors depending on where the State class is used.
| * | | | | | | | | | video_core/engines/engine_upload: Remove unnecessary const on parameters in function declarationsLioncash2019-05-141-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These only apply in the definition of the function. They can be omitted from the declaration.
| * | | | | | | | | | video_core/engines/engine_upload: Remove unnecessary includesLioncash2019-05-142-2/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2484 from ReinUsesLisp/triangle-fanSebastian Valle2019-05-191-0/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | maxwell_to_gl: Add TriangleFan primitive topology
| * | | | | | | | | | maxwell_to_gl: Add TriangleFan primitive topologyReinUsesLisp2019-05-181-0/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2490 from lioncash/floatHexagon122019-05-191-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | ipc_helpers: Amend floating-point type in Pop<double> specialization
| * | | | | | | | | | ipc_helpers: Amend floating-point type in Pop<double> specializationLioncash2019-05-191-1/+1
| | |_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, this overload isn't used, so this wasn't actually hit in any code, only the float overload is used.
* | | | | | | | | | Merge pull request #2492 from lioncash/debuggerHexagon122019-05-193-17/+20
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu/debugger: Specify string conversions explicitly
| * | | | | | | | | | yuzu/debugger/graphics/graphics_breakpoints: Specify string conversions explicitlyLioncash2019-05-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the graphics breakpoints to compile with implicit string conversions disabled.
| * | | | | | | | | | yuzu/debugger/profiler: Specify string conversions explicitlyLioncash2019-05-191-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows the microprofile widget to compile with implicit string conversions disabled.
| * | | | | | | | | | yuzu/debugger/wait_tree: Specify string conversions explicitlyLioncash2019-05-191-14/+17
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows compiling the wait tree widget with implicit string conversions disabled.
* | | | | | | | | | Merge pull request #2486 from lioncash/resetnameSebastian Valle2019-05-1919-35/+36
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | core/kernel/object: Rename ResetType enum members for clarity
| * | | | | | | | | | core/kernel/object: Rename ResetType enum membersLioncash2019-05-1819-35/+36
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Renames the members to more accurately indicate what they signify. "OneShot" and "Sticky" are kind of ambiguous identifiers for the reset types, and can be kind of misleading. Automatic and Manual communicate the kind of reset type in a clearer manner. Either the event is automatically reset, or it isn't and must be manually cleared. The "OneShot" and "Sticky" terminology is just a hold-over from Citra where the kernel had a third type of event reset type known as "Pulse". Given the Switch kernel only has two forms of event reset types, we don't need to keep the old terminology around anymore.
* | | | | | | | | | Merge pull request #2488 from lioncash/static-fnSebastian Valle2019-05-191-4/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/svc: Mark GetThreadList() and UnmapProcessCodeMemory() as internally linked
| * | | | | | | | | | kernel/svc: Mark GetThreadList() and UnmapProcessCodeMemory() as internally linkedLioncash2019-05-191-4/+4
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only used from within this translation unit, so they don't need to have external linkage. They were intended to be marked with this anyways to be consistent with the other service functions.
* | | | | | | | | | Merge pull request #2493 from lioncash/translateSebastian Valle2019-05-191-2/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu/applets/profile_select: Mark header string as translatable
| * | | | | | | | | | yuzu/applets/profile_select: Mark header string as translatableLioncash2019-05-191-2/+2
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a user-facing string, so it should be marked as translatable.
* | | | | | | | | | Merge pull request #2496 from lioncash/move-conSebastian Valle2019-05-191-7/+7
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_shader_gen: std::move objects where applicable
| * | | | | | | | | | gl_shader_gen: std::move objects where applicableLioncash2019-05-191-7/+7
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids performing copies into the pair being returned. Instead, we can just move the resources into the pair, avoiding the need to make copies of both the std::string and ShaderEntries struct.
* | | | | | | | | | Merge pull request #2473 from lioncash/vs2019Hexagon122019-05-191-3/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | CMakeLists: Handle VS 2019 in a less annoying manner
| * | | | | | | | | | CMakeLists: Handle VS 2019 in a less annoying mannerLioncash2019-05-151-3/+3
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | VS 2019 is binary compatible with VS 2017, so we can safely use the prebuilt libraries for VS 2017 with VS 2019. This makes it less annoying to build yuzu with the most up to date toolchain.
* | | | | | | | | | Merge pull request #2476 from ReinUsesLisp/fix-compatHexagon122019-05-191-0/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu/bootmanager: Explicitly enable deprecated OpenGL features on compat
| * | | | | | | | | | yuzu/bootmanager: Explicitly enable deprecated OpenGL features on compatReinUsesLisp2019-05-171-0/+1
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nvidia's proprietary driver creates a real OpenGL compatibility profile without this option, meanwhile Intel (and probably AMD, I haven't tested it) require that QSurfaceFormat::FormatOption::DeprecatedFunctions is explicitly enabled.
* | | | | | | | | | Merge pull request #2498 from lioncash/unused-codeHexagon122019-05-193-366/+0
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | yuzu/util: Remove unused spinbox.cpp/.h
| * | | | | | | | | yuzu/util: Remove unused spinbox.cpp/.hLioncash2019-05-193-366/+0
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This has been left unused since the removal of the vestigial surface viewer. Given it has no uses left, this can be removed as well.
* | | | | | | | | Merge pull request #2457 from lioncash/aboutbunnei2019-05-173-11/+23
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | yuzu/{about_dialog, main}: Specify string conversions explicitly for SCM-related info
| * | | | | | | | yuzu/main: Move window title updating logic to its own functionLioncash2019-05-092-7/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For similar reasons to the previous change, we move this to a single function, so we don't need to duplicate the conversion logic in several places within main.cpp.
| * | | | | | | | yuzu/about_dialog: Specify string conversions explicitlyLioncash2019-05-091-4/+4
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Specifies the conversions explicitly to avoid implicit conversions from const char* to QString. This makes it easier to disable implicit QString conversions in the future. In this case, the implicit conversion was technically wrong as well. The implicit conversion treats the input strings as ASCII characters. This would result in an incorrect conversion being performed in the rare case a branch name was created with a non-ASCII Unicode character, likely resulting in junk being displayed.
* | | | | | | | Merge pull request #2477 from ReinUsesLisp/fix-sdl2bunnei2019-05-171-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu_cmd: Make OpenGL's context current
| * | | | | | | | yuzu_cmd: Make OpenGL's context currentReinUsesLisp2019-05-171-0/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The SDL2 frontend never bound the OpenGL context, resulting on a white screen and no-ops all over the backend.
* | | | | | | | Merge pull request #2478 from ReinUsesLisp/sdl2-compatbunnei2019-05-171-1/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu_cmd: Use OpenGL compat when asked in the settings
| * | | | | | | | yuzu_cmd: Use OpenGL compat when asked in the settingsReinUsesLisp2019-05-171-1/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #2479 from ReinUsesLisp/qt-shadowbunnei2019-05-171-2/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | qt/configure_graphics: Shadow options at runtime
| * | | | | | | qt/configure_graphics: Shadow options at runtimeReinUsesLisp2019-05-171-2/+6
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Compatibility profile and the disk shader cache settings shouldn't be changed at runtime. This aims to address that shadowing those options.
* | | | | | | Merge pull request #2462 from lioncash/video-mmMat M2019-05-142-17/+20
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core/memory_manager: Minor tidying
| * | | | | | | video_core/memory_manager: Mark IsBlockContinuous() as a const member functionLioncash2019-05-102-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects the typo in its name and marks the function as a const member function, given it doesn't actually modify memory manager state.
| * | | | | | | video_core/memory_manager: Mark the constructor as explicitLioncash2019-05-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit converting constructions of the memory manager.
| * | | | | | | video_core/memory_manager: Default the destructor within the cpp fileLioncash2019-05-102-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the class less surprising when it comes to forward declaring the type, and also prevents inlining the destruction code of the class, given it contains non-trivial types.
| * | | | | | | video_core/memory_manager: Amend doxygen commentsLioncash2019-05-101-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects references to non-existent parameters and corrects typos.
| * | | | | | | video_core/memory_manager: Remove superfluous const from function declarationsLioncash2019-05-101-7/+7
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are able to be omitted from the declaration of functions, since they don't do anything at the type system level. The definitions of the functions can retain the use of const though, since they make the variables immutable in the implementation of the function where they're used.
* | | | | | | Merge pull request #2461 from lioncash/unused-varMat M2019-05-147-22/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Remove a few unused variables and functions
| * | | | | | | video_core/renderer_opengl/gl_shader_cache: Correct member initialization orderLioncash2019-05-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences a -Wreorder warning.
| * | | | | | | video_core/shader/decode/texture: Remove unused variable from GetTld4Code()Lioncash2019-05-101-1/+0
| | | | | | | |
| * | | | | | | renderer_vulkan/vk_shader_decompiler: Remove unused variable from DeclareInternalFlags()Lioncash2019-05-101-1/+0
| | | | | | | |
| * | | | | | | video_core/renderer_opengl/gl_shader_decompiler: Remove unused Composite() functionLioncash2019-05-101-11/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used at all, so it can be removed.
| * | | | | | | video_core/renderer_opengl/gl_rasterizer_cache: Remove unused variable in UploadGLMipmapTexture()Lioncash2019-05-101-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This variable is unused entirely, so it can be removed.
| * | | | | | | video_core/gpu_thread: Remove unused local variableLioncash2019-05-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of retrieving the data from the std::variant instance, we can just check if the variant contains that type of data. This is essentially the same behavior, only it returns a bool indicating whether or not the type in the variant is currently active, instead of actually retrieving the data.
| * | | | | | | video_core/textures/astc: Remove unused variablesLioncash2019-05-101-6/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Silences a few compilation warnings.
* | | | | | | Merge pull request #2460 from lioncash/volatileMat M2019-05-141-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Specify /volatile:iso for MSVC
| * | | | | | | CMakeLists: Specify /volatile:iso for MSVCLioncash2019-05-091-0/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | By default, MSVC doesn't use standards-compliant volatile semantics. This makes it behave in a standards-compliant manner, making expectations more uniform across compilers.
* | | | | | | Merge pull request #2450 from lioncash/warn-levelMat M2019-05-141-1/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Explicitly specify -Wall for the non-MSVC case
| * | | | | | | CMakeLists: Explicitly specify -Wall for the non-MSVC caseLioncash2019-05-041-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that -Wall is always active as a compilation flag.
* | | | | | | | Merge pull request #2413 from FernandoS27/opt-gpuRodrigo Locatti2019-05-147-33/+54
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Rasterizer Cache: refactor flushing & optimize memory usage of surfaces
| * | | | | | | Rasterizer Cache: Use a temporal storage for Surfaces loading/flushing.Fernando Sahmkow2019-04-214-18/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This PR should heavily reduce memory usage since temporal buffers are no longer stored per Surface but instead managed by the Rasterizer Cache.
| * | | | | | | RasterizerCache Redesign: Flush Fernando Sahmkow2019-04-206-17/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | flushing is now responsability of children caches instead of the cache object. This change will allow the specific cache to pass extra parameters on flushing and will allow more flexibility.
* | | | | | | | Merge pull request #2437 from lioncash/audctlbunnei2019-05-091-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/audctl: Update documentation comments to be relative to 8.0.0
| * | | | | | | | service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | The state of these service calls are still the same in version 8.0.0.
* | | | | | | | Merge pull request #2454 from lioncash/cflagbunnei2019-05-091-9/+21
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | src/CMakeLists: Add /Zc:externConstexpr to the MSVC build flags
| * | | | | | | | src/CMakeLists: Add /Zc:externConstexpr to the MSVC build flagsLioncash2019-05-071-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The C++ standard allows constexpr variables declared with the extern keyword to have external linkage. Previously MSVC wasn't abiding by this. This just makes the compiler more standards compliant during builds. Given we currently don't make use of anything that would break by this, this is safe to enable.
| * | | | | | | | src/CMakeLists: Vertically order compilation flagsLioncash2019-05-071-9/+19
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it much nicer to visually scan the options. This also starts the flag descriptions from the same column for the same reason.
* | | | | | | | Merge pull request #2442 from FernandoS27/astc-fixbunnei2019-05-091-1/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fix Layered ASTC Textures
| * | | | | | | | Fix Layered ASTC TexturesFernando Sahmkow2019-05-011-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | By adding the missing layer offset in ASTC compression.
* | | | | | | | | Merge pull request #2443 from ReinUsesLisp/skip-repeated-variantsbunnei2019-05-091-1/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_disk_cache: Skip stored shader variants instead of asserting
| * | | | | | | | | gl_shader_disk_cache: Skip stored shader variants instead of assertingReinUsesLisp2019-05-011-1/+4
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of asserting on already stored shader variants, silently skip them. This shouldn't be happening but when a shader is invalidated and it is not stored in the shader cache, this assert would hit and save that shader anyways when the asserts are disabled.
* | | | | | | | | Merge pull request #2445 from FearlessTobi/port-4749bunnei2019-05-092-9/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4749: "web_service: Misc fixes"
| * | | | | | | | | core/telemetry_session: Only create the backend when we really need itzhupengfei2019-05-042-9/+9
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | The backend is not used until we decide to submit the testcase/telemetry, and creating it early prevents users from updating the credentials properly while the games are running.
* | | | | | | | | Merge pull request #2458 from lioncash/hotkeybunnei2019-05-091-2/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu/hotkeys: Remove unnecessary constructor
| * | | | | | | | | yuzu/hotkeys: Remove unnecessary constructorLioncash2019-05-091-2/+0
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The behavior of the Hotkey constructor is already accomplished via in-class member initializers, so the constructor is superfluous here.
* | | | | | | | | Merge pull request #2456 from lioncash/qualifierbunnei2019-05-091-3/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu/compatdb: Remove unnecessary qualifiers
| * | | | | | | | | yuzu/compatdb: Remove unnecessary qualifiersLioncash2019-05-091-3/+3
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the code consistent in regards to how the buttons are referred to.
* | | | | | | | | Merge pull request #2459 from lioncash/whatbunnei2019-05-091-0/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | configure_dialog: Remove the Whats This? button from the dialog
| * | | | | | | | | configure_dialog: Remove the Whats This? button from the dialogLioncash2019-05-091-0/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2453 from lioncash/enumbunnei2019-05-091-9/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/memory: Remove unused FlushMode enum
| * | | | | | | | | core/memory: Remove unused FlushMode enumLioncash2019-05-071-9/+0
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Recent changes to memory-related code resulted in this being unused, so we can remove it.
* | | | | | | | | Merge pull request #2429 from FernandoS27/computebunnei2019-05-0913-142/+483
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Corrections and Implementation on GPU Engines
| * | | | | | | | | Refactors and name corrections.Fernando Sahmkow2019-05-016-35/+35
| | | | | | | | | |
| * | | | | | | | | Fixes and Corrections to DMA EngineFernando Sahmkow2019-04-232-37/+57
| | | | | | | | | |
| * | | | | | | | | Add Swizzle Parameters to the DMA engineFernando Sahmkow2019-04-232-2/+27
| | | | | | | | | |
| * | | | | | | | | Add Documentation Headers to all the GPU EnginesFernando Sahmkow2019-04-235-0/+29
| | | | | | | | | |
| * | | | | | | | | Corrections and stylingFernando Sahmkow2019-04-235-6/+9
| | | | | | | | | |
| * | | | | | | | | Implement Maxwell3D Data UploadFernando Sahmkow2019-04-232-3/+32
| | | | | | | | | |
| * | | | | | | | | Introduce skeleton of the GPU Compute Engine.Fernando Sahmkow2019-04-233-8/+202
| | | | | | | | | |
| * | | | | | | | | Revamp Kepler Memory to use a subegine to manage uploadsFernando Sahmkow2019-04-236-93/+134
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2440 from lioncash/dynarmicbunnei2019-05-092-4/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | externals: Update dynarmic to master
| * | | | | | | | | externals: Update dynarmic to masterLioncash2019-05-072-4/+4
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Better instruction support has been added since the last update.
* | | | | | | | | Merge pull request #2451 from lioncash/travisMerry2019-05-071-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | travis: Update to using Xcode 10.2
| * | | | | | | | | travis: Update to using Xcode 10.2Lioncash2019-05-071-1/+1
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the CI toolchain updated. This is also necessary for updating dynarmic.
* | | | | | | | | Merge pull request #2447 from lioncash/dtorRodrigo Locatti2019-05-072-0/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | core/frontend/emu_window: Make GraphicsContext's destructor virtual
| * | | | | | | | | core/frontend/emu_window: Make GraphicsContext's destructor virtualLioncash2019-05-042-0/+4
| | |_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This class is used in a polymorphic context, so destruction of the context will lead to undefined behavior if the destructor isn't virtual.
* | | | | | | | | Merge pull request #2448 from lioncash/pragmaRodrigo Locatti2019-05-071-2/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/zstd_compression: Remove #pragma once directive from source file
| * | | | | | | | | common/zstd_compression: Remove #pragma once directive from source fileLioncash2019-05-041-2/+0
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Introduced in 72477731ed20c56a4d6f18a22f43224fab667cef. This is only necessary within header files.
* | | | | | | | | Merge pull request #2449 from lioncash/unused-varRodrigo Locatti2019-05-072-3/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | gl_rasterizer: Silence unused variable warnings
| * | | | | | | | shader/decode/texture: Remove unused variableLioncash2019-05-041-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used anywhere, so we can get rid of it.
| * | | | | | | | gl_rasterizer: Silence unused variable warningLioncash2019-05-041-2/+2
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Makes use of src, so it's not considered unused.
* | | | | | | | Merge pull request #2408 from FearlessTobi/port-4215bunnei2019-05-033-3/+4
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Port citra-emu/citra#4215: "travis: Use Ninja for Travis builds"
| * | | | | | | travis: Use Ninja for Travis buildsCameron Cawley2019-04-163-3/+4
| | |_|_|_|/ / | |/| | | | |
* | | | | | | loader/nso: Remove left-in debug pragmaLioncash2019-05-011-2/+0
| |_|/ / / / |/| | | | | | | | | | | | | | | | | Unintentionally introduced in 552d5071fa171165e4054392d8bb6bf2ecc924e2
* | | | | | Merge pull request #2406 from FearlessTobi/port-3839bunnei2019-05-017-18/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port citra-emu/citra#3839: "travis: use prebuilt image"
| * | | | | | GenerateSCMRev: fix Travis compilation on repo forksfearlessTobi2019-04-161-1/+1
| | | | | | |
| * | | | | | travis: use prebuilt image (#3839)liushuyu2019-04-156-17/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * travis: use prebuilt image * travis: use prebuilt image (MinGW)
* | | | | | Merge pull request #2100 from FreddyFunk/disk-cache-precompiled-filebunnei2019-05-013-133/+170
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_disk_cache: Improve precompiled shader cache generation speed and size
| * | | | | | Re added new lines at the end of filesFreddyFunk2019-04-232-2/+2
| | | | | | |
| * | | | | | gl_shader_disk_cache: Compress precompiled shader cache file with Zstandardunknown2019-04-231-6/+10
| | | | | | |
| * | | | | | gl_shader_disk_cache: Use VectorVfsFile for the virtual precompiled shader cache fileunknown2019-04-233-101/+168
| | | | | | |
| * | | | | | gl_shader_disk_cache: Remove per shader compressionunknown2019-04-232-45/+11
| | | | | | |
* | | | | | | Merge pull request #2435 from ReinUsesLisp/misc-vcbunnei2019-04-292-3/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader_ir: Miscellaneous fixes
| * | | | | | | shader_ir: Move Sampler index entry in operand< to sort declarationsReinUsesLisp2019-04-261-2/+2
| | | | | | | |
| * | | | | | | shader_ir: Add missing entry to Sampler operand< comparisonReinUsesLisp2019-04-261-2/+3
| | | | | | | |
| * | | | | | | shader_ir/texture: Fix sampler const buffer key shiftReinUsesLisp2019-04-261-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2412 from lioncash/systembunnei2019-04-293-7/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/vm_manager: Remove usages of global system accessors
| * | | | | | | kernel/vm_manager: Remove usages of global system accessorsLioncash2019-04-173-7/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the dependency on the system instance explicit within VMManager's interface.
* | | | | | | | Merge pull request #2322 from ReinUsesLisp/wswitchbunnei2019-04-2910-77/+106
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: Silent -Wswitch warnings
| * | | | | | | | video_core: Silent -Wswitch warningsReinUsesLisp2019-04-1810-77/+106
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2423 from FernandoS27/half-correctbunnei2019-04-292-15/+16
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | Corrections on Half Float operations: HADD2 HMUL2 and HFMA2
| * | | | | | | Corrections Half Float operations on const buffers and implement saturation.Fernando Sahmkow2019-04-212-15/+16
| | | | | | | |
* | | | | | | | Merge pull request #2416 from lioncash/waitbunnei2019-04-257-51/+54
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/svc: Clean up wait synchronization related functionality
| * | | | | | | | kernel/thread: Unify wait synchronization typesLioncash2019-04-177-45/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a holdover from Citra, where the 3DS has both WaitSynchronization1 and WaitSynchronizationN. The switch only has one form of wait synchronizing (literally WaitSynchonization). This allows us to throw out code that doesn't apply at all to the Switch kernel. Because of this unnecessary dichotomy within the wait synchronization utilities, we were also neglecting to properly handle waiting on multiple objects. While we're at it, we can also scrub out any lingering references to WaitSynchronization1/WaitSynchronizationN in comments, and change them to WaitSynchronization (or remove them if the mention no longer applies).
| * | | | | | | | kernel/svc: Migrate svcCancelSynchronization behavior to a thread functionLioncash2019-04-173-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The actual behavior of this function is slightly more complex than what we're currently doing within the supervisor call. To avoid dumping most of this behavior in the supervisor call itself, we can migrate this to another function.
* | | | | | | | | Merge pull request #2424 from FernandoS27/compatbunnei2019-04-257-1/+21
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Allow picking a Compatibility Profile for OpenGL.
| * | | | | | | | | Allow picking a Compatibility Profile for OpenGL.Fernando Sahmkow2019-04-207-1/+21
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This option allows picking the compatibility profile since a lot of bugs are fixed in it. We devs will use this option to easierly debug current problems in our Core implementation.:wq
* | | | | | | | | Merge pull request #2426 from FearlessTobi/port-4748bunnei2019-04-251-12/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4748: "Launch directly in Mac without terminal"
| * | | | | | | | | Launch directly in Mac without terminaltkeph6162019-04-201-12/+0
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2526-115/+764
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | applets: Add AppletManager and implement PhotoViewer and Error applets
| * | | | | | | | | | web_browser: Make OpenPage non-constZach Hilman2019-04-1713-25/+30
| | | | | | | | | | |
| * | | | | | | | | | main: Add GMainWindow hooks for Error displayZach Hilman2019-04-174-3/+11
| | | | | | | | | | |
| * | | | | | | | | | main: Switch to AppletManager for frontendZach Hilman2019-04-171-3/+9
| | | | | | | | | | |
| * | | | | | | | | | qt: Add dialog implementation of Error appletZach Hilman2019-04-173-0/+94
| | | | | | | | | | |
| * | | | | | | | | | general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| | | | | | | | | | |
| * | | | | | | | | | general_frontend: Add frontend scaffold for PhotoViewer appletZach Hilman2019-04-172-0/+55
| | | | | | | | | | |
| * | | | | | | | | | frontend: Add frontend receiver for Error appletZach Hilman2019-04-173-2/+79
| | | | | | | | | | |
| * | | | | | | | | | applets: Add Error appletZach Hilman2019-04-173-24/+224
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Responsible for displaying error codes and messages
| * | | | | | | | | | applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As opposed to using Core::System::GetInstance()
| * | | | | | | | | | web_browser: Make OpenPage constZach Hilman2019-04-174-7/+7
| | | | | | | | | | |
| * | | | | | | | | | core: Remove specific applets in favor of AppletManagerZach Hilman2019-04-172-47/+32
| | | | | | | | | | |
| * | | | | | | | | | am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| | | | | | | | | | |
| * | | | | | | | | | applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2404 from lioncash/unicodebunnei2019-04-252-4/+9
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | CMakeLists: Ensure we specify Unicode as the codepage on Windows
| * | | | | | | | | CMakeLists: Ensure we specify Unicode as the codepage on WindowsLioncash2019-04-172-4/+9
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were building with MBCS, which is pretty undesirable. We want the application to be Unicode-aware in general. Currently, we make the command line variant of yuzu use ANSI variants of the non-standard getopt functions that we link in for Windows, given we only have an ANSI option-set. We should really replace getopt with a library that we make all build types of yuzu link in, but this will have to do for the time being.
* | | | | | | | | Merge pull request #2422 from ReinUsesLisp/fixup-samplersHexagon122019-04-231-3/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_state: Fix samplers memory corruption
| * | | | | | | | | gl_state: Fix samplers memory corruptionReinUsesLisp2019-04-191-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It was possible for "samplers" to be read without being written. This addresses that.
* | | | | | | | | | Merge pull request #2425 from FernandoS27/y-directionHexagon122019-04-231-0/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fix flipping on some games by applying Y direction register
| * | | | | | | | | | Apply Position Y DirectionFernando Sahmkow2019-04-201-0/+3
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2383 from ReinUsesLisp/aoffi-testbunnei2019-04-2311-75/+163
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Disable variable AOFFI on unsupported devices
| * | | | | | | | | | gl_shader_decompiler: Use variable AOFFI on supported hardwareReinUsesLisp2019-04-1410-71/+102
| | | | | | | | | | |
| * | | | | | | | | | gl_device: Implement interface and add uniform offset alignmentReinUsesLisp2019-04-105-13/+70
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #2420 from lioncash/audctlbunnei2019-04-232-2/+32
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()
| * | | | | | | | | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These two service functions are literally hardcoded to always return these values without any other error checking.
* | | | | | | | | | Merge pull request #2403 from FernandoS27/compressed-linearbunnei2019-04-221-2/+5
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Support compressed formats on linear textures.
| * | | | | | | | | | Support compressed formats on linear textures.Fernando Sahmkow2019-04-151-2/+5
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2411 from FernandoS27/unsafe-gpubunnei2019-04-225-15/+99
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | GPU Manager: Implement ReadBlockUnsafe and WriteBlockUnsafe
| * | | | | | | | | | make ReadBlockunsafe and WriteBlockunsafe, ignore invalid pages.Fernando Sahmkow2019-04-201-4/+12
| | | | | | | | | | |
| * | | | | | | | | | Implement IsBlockContinousFernando Sahmkow2019-04-172-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This detects when a GPU Memory Block is not continous within host cpu memory.
| * | | | | | | | | | Use ReadBlockUnsafe for fetyching DMA CommandListsFernando Sahmkow2019-04-162-4/+2
| | | | | | | | | | |
| * | | | | | | | | | Document unsafe versions and add BlockCopyUnsafeFernando Sahmkow2019-04-163-16/+45
| | | | | | | | | | |
| * | | | | | | | | | Use ReadBlockUnsafe for Shader CacheFernando Sahmkow2019-04-161-5/+7
| | | | | | | | | | |
| * | | | | | | | | | Use ReadBlockUnsafe on TIC and TSC readingFernando Sahmkow2019-04-162-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use ReadBlockUnsafe on TIC and TSC reading as memory is never flushed from host GPU there.
| * | | | | | | | | | GPU MemoryManager: Implement ReadBlockUnsafe and WriteBlockUnsafeFernando Sahmkow2019-04-162-0/+34
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2400 from FernandoS27/corret-kepler-membunnei2019-04-224-17/+81
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | Implement Kepler Memory on both Linear and BlockLinear.
| * | | | | | | | | Apply Const correctness to SwizzleKepler and replace u32 for size_t on iterators.Fernando Sahmkow2019-04-162-9/+12
| | | | | | | | | |
| * | | | | | | | | Use WriteBlock and ReadBlock.Fernando Sahmkow2019-04-161-10/+6
| | | | | | | | | |
| * | | | | | | | | Implement Block Linear copies in Kepler Memory.Fernando Sahmkow2019-04-163-5/+38
| | | | | | | | | |
| * | | | | | | | | Correct Kepler Memory on Linear Pushes.Fernando Sahmkow2019-04-152-16/+48
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2407 from FernandoS27/f2fbunnei2019-04-202-23/+73
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | Do some corrections in conversion shader instructions.
| * | | | | | | | Do some corrections in conversion shader instructions.Fernando Sahmkow2019-04-162-23/+73
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects encodings for I2F, F2F, I2I and F2I Implements Immediate variants of all four conversion types. Add assertions to unimplemented stuffs.
* | | | | | | | Merge pull request #2409 from ReinUsesLisp/half-floatsbunnei2019-04-209-136/+181
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | shader_ir/decode: Miscellaneous fixes to half-float decompilation
| * | | | | | | vk_shader_decompiler: Add missing operationsReinUsesLisp2019-04-161-0/+7
| | | | | | | |
| * | | | | | | shader_ir/decode: Fix half float pre-operations and remove MetaHalfArithmeticReinUsesLisp2019-04-169-85/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Operations done before the main half float operation (like HAdd) were managing a packed value instead of the unpacked one. Adding an unpacked operation allows us to drop the per-operand MetaHalfArithmetic entry, simplifying the code overall.
| * | | | | | | gl_shader_decompiler: Fix MrgH0 decompilationReinUsesLisp2019-04-161-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GLSL decompilation for HMergeH0 was wrong. This addresses that issue.
| * | | | | | | shader_ir/decode: Implement half float saturationReinUsesLisp2019-04-165-8/+31
| | | | | | | |
| * | | | | | | shader_ir/decode: Reduce severity of unimplemented half-float FTZReinUsesLisp2019-04-163-3/+9
| | | | | | | |
| * | | | | | | renderer_opengl: Implement half float NaN comparisonsReinUsesLisp2019-04-163-36/+59
| | | | | | | |
| * | | | | | | shader_ir: Avoid using static on heap-allocated objectsReinUsesLisp2019-04-161-5/+4
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using static here might be faster at runtime, but it adds a heap allocation called before main.
* | | | | | | Merge pull request #2415 from lioncash/constbunnei2019-04-202-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member function
| * | | | | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member functionLioncash2019-04-172-2/+2
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't actually modify internal state of a wait object, so it can be const qualified.
* | | | | | | Merge pull request #2414 from lioncash/reorderbunnei2019-04-202-5/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/bootmanager: Resolve constructor initializer list warnings
| * | | | | | | yuzu/bootmanager: Replace unnnecessary constructor initializer list member of GGLContextLioncash2019-04-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The default constructor will always run, even when not specified, so this is redundant. However, the context member can indeed be initialized in the constructor initializer list.
| * | | | | | | yuzu/bootmanager: Remove unnecessary includesLioncash2019-04-171-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This include isn't used anymore so it can be removed.
| * | | | | | | yuzu/bootmanager: Resolve constructor initializer list warningsLioncash2019-04-171-2/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves -Wreorder warnings. These will automatically be initialized to nullptr anyways, so these were redundant.
* | | | | | | Merge pull request #2421 from lioncash/svc-callbunnei2019-04-201-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/svc: Name supervisor call 0x36
| * | | | | | | kernel/svc: Name supervisor call 0x36Lioncash2019-04-191-1/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This call was added to the SVC handlers in the 8.0.0 kernel, so we can finally give it a name.
* | | | | | | Merge pull request #2374 from lioncash/pagetablebunnei2019-04-2038-177/+253
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | core: Reorganize boot order
| * | | | | | core/core: Move process execution start to System's Load()Lioncash2019-04-1220-107/+144
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gives us significantly more control over where in the initialization process we start execution of the main process. Previously we were running the main process before the CPU or GPU threads were initialized (not good). This amends execution to start after all of our threads are properly set up.
| * | | | | | core/process: Remove unideal page table setting from LoadFromMetadata()Lioncash2019-04-121-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Initially required due to the split codepath with how the initial main process instance was initialized. We used to initialize the process like: Init() { main_process = Process::Create(...); kernel.MakeCurrentProcess(main_process.get()); } Load() { const auto load_result = loader.Load(*kernel.GetCurrentProcess()); if (load_result != Loader::ResultStatus::Success) { // Handle error here. } ... } which presented a problem. Setting a created process as the main process would set the page table for that process as the main page table. This is fine... until we get to the part that the page table can have its size changed in the Load() function via NPDM metadata, which can dictate either a 32-bit, 36-bit, or 39-bit usable address space. Now that we have full control over the process' creation in load, we can simply set the initial process as the main process after all the loading is done, reflecting the potential page table changes without any special-casing behavior. We can also remove the cache flushing within LoadModule(), as execution wouldn't have even begun yet during all usages of this function, now that we have the initialization order cleaned up.
| * | | | | | core/core: Move main process creation into Load()Lioncash2019-04-121-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have dependencies on the initialization order, we can move the creation of the main process to a more sensible area: where we actually load in the executable data. This allows localizing the creation and loading of the process in one location, making the initialization of the process much nicer to trace.
| * | | | | | video_core/gpu: Create threads separately from initializationLioncash2019-04-1210-25/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like with CPU emulation, we generally don't want to fire off the threads immediately after the relevant classes are initialized, we want to do this after all necessary data is done loading first. This splits the thread creation into its own interface member function to allow controlling when these threads in particular get created.
| * | | | | | core/cpu_core_manager: Create threads separately from initialization.Lioncash2019-04-1211-39/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Our initialization process is a little wonky than one would expect when it comes to code flow. We initialize the CPU last, as opposed to hardware, where the CPU obviously needs to be first, otherwise nothing else would work, and we have code that adds checks to get around this. For example, in the page table setting code, we check to see if the system is turned on before we even notify the CPU instances of a page table switch. This results in dead code (at the moment), because the only time a page table switch will occur is when the system is *not* running, preventing the emulated CPU instances from being notified of a page table switch in a convenient manner (technically the code path could be taken, but we don't emulate the process creation svc handlers yet). This moves the threads creation into its own member function of the core manager and restores a little order (and predictability) to our initialization process. Previously, in the multi-threaded cases, we'd kick off several threads before even the main kernel process was created and ready to execute (gross!). Now the initialization process is like so: Initialization: 1. Timers 2. CPU 3. Kernel 4. Filesystem stuff (kind of gross, but can be amended trivially) 5. Applet stuff (ditto in terms of being kind of gross) 6. Main process (will be moved into the loading step in a following change) 7. Telemetry (this should be initialized last in the future). 8. Services (4 and 5 should ideally be alongside this). 9. GDB (gross. Uses namespace scope state. Needs to be refactored into a class or booted altogether). 10. Renderer 11. GPU (will also have its threads created in a separate step in a following change). Which... isn't *ideal* per-se, however getting rid of the wonky intertwining of CPU state initialization out of this mix gets rid of most of the footguns when it comes to our initialization process.
* | | | | | | Merge pull request #2397 from lioncash/thread-unusedbunnei2019-04-183-18/+17
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/thread: Remove unused guest_handle member variable
| * | | | | | | svc: Specify handle value in thread's nameLioncash2019-04-152-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the handle to be seen alongside the entry point.
| * | | | | | | kernel/thread: Remove unused guest_handle member variableLioncash2019-04-143-16/+7
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This member variable is entirely unused. It was only set but never actually utilized. Given that, we can remove it to get rid of noise in the thread interface.
* | | | | | | Merge pull request #2318 from ReinUsesLisp/sampler-cachebunnei2019-04-189-181/+183
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_sampler_cache: Port sampler cache to OpenGL
| * | | | | | | gl_sampler_cache: Port sampler cache to OpenGLReinUsesLisp2019-04-025-123/+82
| | | | | | | |
| * | | | | | | video_core: Abstract vk_sampler_cache into a templated classReinUsesLisp2019-04-025-58/+101
| | | | | | | |
* | | | | | | | Merge pull request #2348 from FernandoS27/guest-bindlessbunnei2019-04-188-44/+217
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Implement Bindless Textures on Shader Decompiler and GL backend
| * | | | | | | Adapt Bindless to work with AOFFIFernando Sahmkow2019-04-081-7/+18
| | | | | | | |
| * | | | | | | Move ConstBufferAccessor to Maxwell3d, correct mistakes and clang format.Fernando Sahmkow2019-04-089-44/+25
| | | | | | | |
| * | | | | | | Fix bad rebaseFernando Sahmkow2019-04-081-2/+1
| | | | | | | |
| * | | | | | | Fix TMMLFernando Sahmkow2019-04-081-5/+7
| | | | | | | |
| * | | | | | | Simplify ConstBufferAccessorFernando Sahmkow2019-04-085-53/+22
| | | | | | | |
| * | | | | | | Refactor GetTextureCode and GetTexCode to use an optional instead of optional parametersFernando Sahmkow2019-04-082-34/+33
| | | | | | | |
| * | | | | | | Implement TXQ_BFernando Sahmkow2019-04-082-2/+10
| | | | | | | |
| * | | | | | | Implement TMML_BFernando Sahmkow2019-04-081-5/+10
| | | | | | | |
| * | | | | | | Corrections to TEX_BFernando Sahmkow2019-04-082-4/+37
| | | | | | | |
| * | | | | | | Fixes to Const Buffer Accessor and FormattingFernando Sahmkow2019-04-083-10/+10
| | | | | | | |
| * | | | | | | Implement Bindless Handling on SetupTextureFernando Sahmkow2019-04-084-18/+34
| | | | | | | |
| * | | | | | | Unify both sampler types.Fernando Sahmkow2019-04-084-22/+48
| | | | | | | |
| * | | | | | | Implement Bindless Samplers and TEX_B in the IR.Fernando Sahmkow2019-04-084-16/+77
| | | | | | | |
| * | | | | | | Implement Const Buffer AccessorFernando Sahmkow2019-04-085-2/+65
| | | | | | | |
* | | | | | | | Merge pull request #2315 from ReinUsesLisp/severity-decompilerbunnei2019-04-172-5/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader_ir/decode: Reduce the severity of common assertions
| * | | | | | | | shader_ir/memory: Reduce severity of LD_L cache management and log itReinUsesLisp2019-04-032-2/+9
| | | | | | | | |
| * | | | | | | | shader_ir/memory: Reduce severity of ST_L cache management and log itReinUsesLisp2019-04-032-3/+11
| | | | | | | | |
* | | | | | | | | Merge pull request #2384 from ReinUsesLisp/gl-state-clearbunnei2019-04-171-4/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Apply just the needed state on Clear
| * | | | | | | | | gl_rasterizer: Apply just the needed state on ClearReinUsesLisp2019-04-101-4/+4
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2405 from lioncash/qtbunnei2019-04-172-1/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | CMakeLists: Define QT_USE_QSTRINGBUILDER for the Qt target
| * | | | | | | | | CMakeLists: Define QT_USE_QSTRINGBUILDER for the Qt targetLioncash2019-04-152-1/+7
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a compile definition introduced in Qt 4.8 for reducing the total potential number of strings created when performing string concatenation. This allows for less memory churn. This can be read about here: https://blog.qt.io/blog/2011/06/13/string-concatenation-with-qstringbuilder/ For a change that isn't source-compatible, we only had one occurrence that actually need to have its type clarified, which is pretty good, as far as transitioning goes.
* | | | | | | | | Merge pull request #2092 from ReinUsesLisp/stgbunnei2019-04-1711-89/+186
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | shader/memory: Implement STG and global memory flushing
| * | | | | | | | | shader_ir: Implement STG, keep track of global memory usage and flushReinUsesLisp2019-04-1411-89/+186
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2376 from lioncash/constbunnei2019-04-173-12/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu/configure_hotkey: Minor changes
| * | | | | | | | | configure_hotkeys: Pass the dialog as a parent to SequenceDialog()Lioncash2019-04-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Without passing in a parent, this can result in focus being stolen from the dialog in certain cases. Example: On Windows, if the logging window is left open, the logging Window will potentially get focus over the hotkey dialog itself, since it brings all open windows for the application into view. By specifying a parent, we only bring windows for the parent into view (of which there are none, aside from the hotkey dialog).
| * | | | | | | | | configure_hotkeys: Avoid dialog memory leak within Configure()Lioncash2019-04-101-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Without a parent, this dialog won't have its memory freed when it happens to get destroyed.
| * | | | | | | | | configure_hotkeys: Mark member variables as const where applicable in Configure()Lioncash2019-04-101-7/+7
| | | | | | | | | |
| * | | | | | | | | configure_hotkeys: Make comparison check a little more self-documentingLioncash2019-04-101-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is checking if an index is valid or not and returning early if it isn't.
| * | | | | | | | | configure_dialog: Amend constructor initializer list orderLioncash2019-04-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids a -Wreorder compiler warning.
| * | | | | | | | | configure_hotkey: Remove unnecessary includeLioncash2019-04-101-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids dumping all of the core settings machinery into whatever files include this header. Nothing inside the header itself actually made use of anything in settings.h anyways.
| * | | | | | | | | configure_hotkey: Make IsUsedKey() a const member functionLioncash2019-04-102-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't actually modify instance state of the dialog, so this can be made const.
* | | | | | | | | | Merge pull request #2401 from lioncash/guardbunnei2019-04-172-0/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / |/| | | | | | | | | common/{lz4_compression, zstd_compression}: Add missing header guards
| * | | | | | | | | common/{lz4_compression, zstd_compression}: Add missing header guardsLioncash2019-04-152-0/+4
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | These two files were missing the #pragma once directive.
* | | | | | | | | Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: Update service function tables
| * | | | | | | | | service: Update service function tablesLioncash2019-04-1127-57/+262
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Updates function tables based off information from SwitchBrew.
* | | | | | | | | Merge pull request #2393 from lioncash/svcbunnei2019-04-164-2/+274
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/svc: Implement svcMapProcessCodeMemory/svcUnmapProcessCodeMemory
| * | | | | | | | | kernel/svc: Implement svcUnmapProcessCodeMemoryLioncash2019-04-133-1/+143
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Essentially performs the inverse of svcMapProcessCodeMemory. This unmaps the aliasing region first, then restores the general traits of the aliased memory. What this entails, is: - Restoring Read/Write permissions to the VMA. - Restoring its memory state to reflect it as a general heap memory region. - Clearing the memory attributes on the region.
| * | | | | | | | | kernel/svc: Implement svcMapProcessCodeMemoryLioncash2019-04-134-1/+131
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is utilized for mapping code modules into memory. Notably, the ldr service would call this in order to map objects into memory.
* | | | | | | | | Merge pull request #2398 from lioncash/boostbunnei2019-04-162-11/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/thread: Remove BoostPriority()
| * | | | | | | | | kernel/thread: Remove BoostPriority()Lioncash2019-04-152-11/+0
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a holdover from Citra that currently remains unused, so it can be removed from the Thread interface.
* | | | | | | | | Merge pull request #2399 from FernandoS27/fermi-fixbunnei2019-04-161-4/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Correct Pitch in Fermi2D
| * | | | | | | | Correct Pitch in Fermi2DFernando Sahmkow2019-04-151-4/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ldr: Minor amendments to IPC-related parameters
| * | | | | | | | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify instance state, so it can be made const.
| * | | | | | | | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The initial two words indicate a process ID. Also UnloadNro only specifies one address, not two.
* | | | | | | | Merge pull request #2373 from FernandoS27/z32bunnei2019-04-142-2/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Set Pixel Format to Z32 if its R32F and depth compare enabled, and Implement format ZF32_X24S8
| * | | | | | | | Implement Texture Format ZF32_X24S8.Fernando Sahmkow2019-04-091-0/+2
| | | | | | | | |
| * | | | | | | | Correct depth compare with color formats for R32FFernando Sahmkow2019-04-091-2/+17
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-145-6/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Add a toggle to force 30FPS mode
| * | | | | | | | added a toggle to force 30fps modezarroboogs2019-04-095-6/+23
| |/ / / / / / /
* | | | | | | | Merge pull request #2381 from lioncash/fsbunnei2019-04-141-8/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | fsp_srv: Minor cleanup related changes
| * | | | | | | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | IDirectory's Read() function doesn't take any input parameters. It only uses the output parameters that we already provide.
| * | | | | | | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These indicate options that alter how a read/write is performed. Currently we don't need to handle these, as the only one that seems to be used is for writes, but all the custom options ever seem to do is immediate flushing, which we already do by default.
* | | | | | | | Merge pull request #2386 from ReinUsesLisp/shader-managerbunnei2019-04-142-34/+61
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_manager: Move code to source file and minor clean up
| * | | | | | | | gl_shader_manager: Move code to source file and minor clean upReinUsesLisp2019-04-112-34/+61
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2017 from jroweboy/glwidgetbunnei2019-04-147-94/+240
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Frontend: Migrate to QOpenGLWindow and support shared contexts
| * | | | | | | | bootmanager: Bypass input focus issuesReinUsesLisp2019-03-254-55/+78
| | | | | | | | |
| * | | | | | | | bootmanager: Bypass resizing issueReinUsesLisp2019-03-251-7/+12
| | | | | | | | |
| * | | | | | | | bootmanager: Delete container to avoid crash on game restartingReinUsesLisp2019-03-252-14/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we are at it, remove nullptr checks for deletion, since the C++ standard defines that delete does it by its own
| * | | | | | | | QT: Hide GLWidget immediately after showing.James Rowe2019-01-221-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With the loading screen merged, we don't want to actually show at this point, but it still needs to be shown to actually create the context. Turns out you can just show and hide it immediately and it'll work.
| * | | | | | | | SDL Frontend: Add shared context supportJames Rowe2019-01-222-1/+38
| | | | | | | | |
| * | | | | | | | QT Frontend: Migrate to QOpenGLWindowJames Rowe2019-01-224-30/+113
| | | | | | | | |
* | | | | | | | | Merge pull request #2389 from FreddyFunk/rename-gamedirbunnei2019-04-145-20/+25
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | ui_settings: Rename game directory variables
| * | | | | | | | | Fix Clang FormatFreddyFunk2019-04-122-5/+10
| | | | | | | | | |
| * | | | | | | | | ui_settings: Rename game directory variablesFreddyFunk2019-04-115-20/+20
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2391 from lioncash/scopebunnei2019-04-131-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/scope_exit: Replace std::move with std::forward in ScopeExit()
| * | | | | | | | | common/scope_exit: Replace std::move with std::forward in ScopeExit()Lioncash2019-04-121-1/+1
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The template type here is actually a forwarding reference, not an rvalue reference in this case, so it's more appropriate to use std::forward to preserve the value category of the type being moved.
* | | | | | | | | Merge pull request #2392 from lioncash/swapbunnei2019-04-131-69/+27
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | common/swap: Minor cleanup and improvements to byte swapping functions
| * | | | | | | | common/swap: Improve codegen of the default swap fallbacksLioncash2019-04-121-3/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses arithmetic that can be identified more trivially by compilers for optimizations. e.g. Rather than shifting the halves of the value and then swapping and combining them, we can swap them in place. e.g. for the original swap32 code on x86-64, clang 8.0 would generate: mov ecx, edi rol cx, 8 shl ecx, 16 shr edi, 16 rol di, 8 movzx eax, di or eax, ecx ret while GCC 8.3 would generate the ideal: mov eax, edi bswap eax ret now both generate the same optimal output. MSVC used to generate the following with the old code: mov eax, ecx rol cx, 8 shr eax, 16 rol ax, 8 movzx ecx, cx movzx eax, ax shl ecx, 16 or eax, ecx ret 0 Now MSVC also generates a similar, but equally optimal result as clang/GCC: bswap ecx mov eax, ecx ret 0 ==== In the swap64 case, for the original code, clang 8.0 would generate: mov eax, edi bswap eax shl rax, 32 shr rdi, 32 bswap edi or rax, rdi ret (almost there, but still missing the mark) while, again, GCC 8.3 would generate the more ideal: mov rax, rdi bswap rax ret now clang also generates the optimal sequence for this fallback as well. This is a case where MSVC unfortunately falls short, despite the new code, this one still generates a doozy of an output. mov r8, rcx mov r9, rcx mov rax, 71776119061217280 mov rdx, r8 and r9, rax and edx, 65280 mov rax, rcx shr rax, 16 or r9, rax mov rax, rcx shr r9, 16 mov rcx, 280375465082880 and rax, rcx mov rcx, 1095216660480 or r9, rax mov rax, r8 and rax, rcx shr r9, 16 or r9, rax mov rcx, r8 mov rax, r8 shr r9, 8 shl rax, 16 and ecx, 16711680 or rdx, rax mov eax, -16777216 and rax, r8 shl rdx, 16 or rdx, rcx shl rdx, 16 or rax, rdx shl rax, 8 or rax, r9 ret 0 which is pretty unfortunate.
| * | | | | | | | common/swap: Mark byte swapping free functions with [[nodiscard]] and noexceptLioncash2019-04-121-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the compiler to inform when the result of a swap function is being ignored (which is 100% a bug in all usage scenarios). We also mark them noexcept to allow other functions using them to be able to be marked as noexcept and play nicely with things that potentially inspect "nothrowability".
| * | | | | | | | common/swap: Simplify swap function ifdefsLioncash2019-04-121-48/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Including every OS' own built-in byte swapping functions is kind of undesirable, since it adds yet another build path to ensure compilation succeeds on. Given we only support clang, GCC, and MSVC for the time being, we can utilize their built-in functions directly instead of going through the OS's API functions. This shrinks the overall code down to just if (msvc) use msvc's functions else if (clang or gcc) use clang/gcc's builtins else use the slow path
| * | | | | | | | common/swap: Remove 32-bit ARM pathLioncash2019-04-121-13/+0
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't plan to support host 32-bit ARM execution environments, so this is essentially dead code.
* | | | | | | | Merge pull request #2235 from ReinUsesLisp/spirv-decompilerbunnei2019-04-126-1/+1473
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vk_shader_decompiler: Implement a SPIR-V decompiler
| * | | | | | | | vk_shader_decompiler: Implement flow primitivesReinUsesLisp2019-04-101-5/+82
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Implement most common texture primitivesReinUsesLisp2019-04-101-8/+65
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Implement texture decompilation helper functionsReinUsesLisp2019-04-101-0/+32
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Implement Assign and LogicalAssignReinUsesLisp2019-04-101-2/+64
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Implement non-OperationCode visitsReinUsesLisp2019-04-101-7/+129
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Implement OperationCode decompilation interfaceReinUsesLisp2019-04-101-1/+411
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Implement VisitReinUsesLisp2019-04-101-1/+50
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Implement labels tree and flowReinUsesLisp2019-04-101-0/+71
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Implement declarationsReinUsesLisp2019-04-101-3/+457
| | | | | | | | |
| * | | | | | | | vk_shader_decompiler: Declare and stub interface for a SPIR-V decompilerReinUsesLisp2019-04-103-0/+127
| | | | | | | | |
| * | | | | | | | video_core: Add sirit as optional dependency with VulkanReinUsesLisp2019-04-104-1/+12
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | sirit is a runtime assembler for SPIR-V
* | | | | | | | Merge pull request #2360 from lioncash/svc-globalbunnei2019-04-128-364/+413
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/svc: Deglobalize the supervisor call handlers
| * | | | | | | | kernel/svc: Deglobalize the supervisor call handlersLioncash2019-04-088-364/+413
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adjusts the interface of the wrappers to take a system reference, which allows accessing a system instance without using the global accessors. This also allows getting rid of all global accessors within the supervisor call handling code. While this does make the wrappers themselves slightly more noisy, this will be further cleaned up in a follow-up. This eliminates the global system accessors in the current code while preserving the existing interface.
* | | | | | | | Merge pull request #2388 from lioncash/constexprbunnei2019-04-1210-10/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel: Make handle type declarations constexpr
| * | | | | | | | kernel: Make handle type declarations constexprLioncash2019-04-1110-10/+10
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some objects declare their handle type as const, while others declare it as constexpr. This makes the const ones constexpr for consistency, and prevent unexpected compilation errors if these happen to be attempted to be used within a constexpr context.
* | | | | | | | Merge pull request #2387 from FernandoS27/fast-copy-relaxbunnei2019-04-121-4/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Relax restrictions on FastCopySurface
| * | | | | | | | gl_rasterizer_cache: Relax restrictions on FastCopySurface and FastLayeredCopySurfaceFernando Sahmkow2019-04-111-4/+10
|/ / / / / / / /
* | | | | | | | Merge pull request #2278 from ReinUsesLisp/vc-texture-cachebunnei2019-04-113-0/+974
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: Implement API agnostic view based texture cache
| * | | | | | | | video_core: Implement API agnostic view based texture cacheReinUsesLisp2019-03-223-0/+974
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements an API agnostic texture view based texture cache. Classes defined here are intended to be inherited by the API implementation and used in API-specific code. This implementation exposes protected virtual functions to be called from the implementer. Before executing any surface copies methods (defined in API-specific code) it tries to detect if the overlapping surface is a superset and if it is, it creates a view. Views are references of a subset of a surface, it can be a superset view (the same as referencing the whole texture). Current code manages 1D, 1D array, 2D, 2D array, cube maps and cube map arrays with layer and mipmap level views. Texture 3D slices views are not implemented. If the view attempt fails, the fast path is invoked with the overlapping textures (defined in the implementer). If that one fails (returning nullptr) it will flush and reload the texture.
* | | | | | | | | Merge pull request #2372 from FernandoS27/fermi-fixbunnei2019-04-111-0/+4
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | Correct Fermi Copy on Linear Textures.
| * | | | | | | | Correct Fermi Copy on Linear Textures.Fernando Sahmkow2019-04-091-0/+4
| | | | | | | | |
* | | | | | | | | Merge pull request #2345 from ReinUsesLisp/multibindbunnei2019-04-104-30/+69
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Use ARB_multi_bind to update buffers with a single call per drawcall
| * | | | | | | | | renderer_opengl/utils: Skip empty bindsReinUsesLisp2019-04-061-0/+3
| | | | | | | | | |
| * | | | | | | | | gl_rasterizer: Use ARB_multi_bind to update SSBOsReinUsesLisp2019-04-062-9/+9
| | | | | | | | | |
| * | | | | | | | | gl_rasterizer: Use ARB_multi_bind to update UBOs across stagesReinUsesLisp2019-04-064-22/+58
| | | | | | | | | |
* | | | | | | | | | Merge pull request #2377 from lioncash/todobunnei2019-04-101-7/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/server_session: Remove obsolete TODOs
| * | | | | | | | | | kernel/server_session: Remove obsolete TODOsLioncash2019-04-101-7/+2
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | These are holdovers from Citra.
* | | | | | | | | | Merge pull request #2375 from FernandoS27/fix-ldcbunnei2019-04-101-2/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Remove unnecessary bounding in LD_C
| * | | | | | | | | | Remove bounding in LD_CFernando Sahmkow2019-04-101-2/+1
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2353 from lioncash/surfacebunnei2019-04-105-622/+0
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | yuzu/debugger: Remove graphics surface viewer
| * | | | | | | | | yuzu/debugger: Remove graphics surface viewerLioncash2019-04-065-622/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't actually work anymore, and given how long it's been left in that state, it's unlikely anyone actually seriously used it. Generally it's preferable to use RenderDoc or Nsight to view surfaces.
* | | | | | | | | | Merge pull request #2354 from lioncash/headerbunnei2019-04-108-3/+10
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core/texures/texture: Remove unnecessary includes
| * | | | | | | | | | video_core/textures/convert: Replace include with a forward declarationLioncash2019-04-062-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids dragging in a direct dependency in a header.
| * | | | | | | | | | video_core/texures/texture: Remove unnecessary includesLioncash2019-04-066-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nothing in this header relies on common_funcs or the memory manager. This gets rid of reliance on indirect inclusions in the OpenGL caches.
* | | | | | | | | | | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-1022-276/+461
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | file_sys: Provide generic interface for accessing game data
| * | | | | | | | | | | patch_manager: Dump NSO name with build IDZach Hilman2019-03-284-9/+11
| | | | | | | | | | | |
| * | | | | | | | | | | game_list: Register content with ContentProviderZach Hilman2019-03-278-91/+102
| | | | | | | | | | | |
| * | | | | | | | | | | core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-278-27/+32
| | | | | | | | | | | |
| * | | | | | | | | | | core: Store system-wide ContentProvider for the emulatorZach Hilman2019-03-272-0/+40
| | | | | | | | | | | |
| * | | | | | | | | | | file_sys: Create ContentProvider interface and default implementationsZach Hilman2019-03-272-152/+279
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2366 from FernandoS27/xmad-fixbunnei2019-04-102-9/+33
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Correct XMAD mode, psl and high_b on different encodings.
| * | | | | | | | | | | | Correct XMAD mode, psl and high_b on different encodings.Fernando Sahmkow2019-04-082-9/+33
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2132 from FearlessTobi/port-4437bunnei2019-04-1023-208/+426
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4437: "citra-qt: Make hotkeys configurable via the GUI (Attempt 2)"
| * | | | | | | | | | | | yuzu: Make hotkeys configurable via the GUIAdityarup Laha2019-03-1623-208/+426
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Adds a new Hotkeys tab in the Controls group. * Double-click a Hotkey to rebind it.
* | | | | | | | | | | | | Merge pull request #2370 from lioncash/qt-warnbunnei2019-04-091-1/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu/loading_screen: Resolve runtime Qt string formatting warnings
| * | | | | | | | | | | | | yuzu/loading_screen: Resolve runtime Qt string formatting warningsLioncash2019-04-091-1/+6
| | |/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In our error console, when loading a game, the strings: QString::arg: Argument missing: "Loading...", 0 QString::arg: Argument missing: "Launching...", 0 would occasionally pop up when the loading screen was running. This was due to the strings being assumed to have formatting indicators in them, however only two out of the four strings actually have them. This only applies the arguments to the strings that have formatting specifiers provided, which avoids these warnings from occurring.
* | | | | | | | | | | | | Merge pull request #2369 from FernandoS27/mip-alignbunnei2019-04-092-4/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_backend: Align Pixel Storage
| * | | | | | | | | | | | | gl_backend: Align Pixel StorageFernando Sahmkow2019-04-082-4/+12
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit makes sure GL reads on the correct pack size for the respective texture buffer.
* | | | | | | | | | | | | Merge pull request #2368 from FernandoS27/fix-lopbunnei2019-04-091-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | | Correct LOP_IMM encoding
| * | | | | | | | | | | | Correct LOP_IMN encodingFernando Sahmkow2019-04-081-1/+1
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2371 from lioncash/pagetableHexagon122019-04-091-0/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | kernel/process: Set page table when page table resizes occur.
| * | | | | | | | | | | kernel/process: Set page table when page table resizes occur.Lioncash2019-04-091-0/+2
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We need to ensure dynarmic gets a valid pointer if the page table is resized (the relevant pointers would be invalidated in this scenario). In this scenario, the page table can be resized depending on what kind of address space is specified within the NPDM metadata (if it's present).
* | | | | | | | | | | Merge pull request #2300 from FernandoS27/null-shaderbunnei2019-04-072-0/+22
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | shader_cache: Permit a Null Shader in case of a bad host_ptr.
| * | | | | | | | | | | Permit a Null Shader in case of a bad host_ptr.Fernando Sahmkow2019-04-072-0/+22
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2355 from ReinUsesLisp/sync-pointbunnei2019-04-071-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | maxwell_3d: Reduce severity of ProcessSyncPoint
| * | | | | | | | | | | | maxwell_3d: Reduce severity of ProcessSyncPointReinUsesLisp2019-04-061-2/+2
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2359 from FearlessTobi/port-2-prsbunnei2019-04-071-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4718: "fix clang-format target when using a path with spaces on windows"
| * | | | | | | | | | | | fix clang-format target when using a path with spaces on windowskhang062019-04-071-1/+1
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2306 from ReinUsesLisp/aoffibunnei2019-04-074-71/+205
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | shader_ir: Implement AOFFI for TEX and TLD4
| * | | | | | | | | | | | gl_shader_decompiler: Hide local definitions inside an anonymous namespaceReinUsesLisp2019-03-311-6/+8
| | | | | | | | | | | | |
| * | | | | | | | | | | | shader_ir/decode: Silent implicit sign conversion warningMat M2019-03-311-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | | | | | | | | | gl_shader_decompiler: Add AOFFI backing implementationReinUsesLisp2019-03-301-38/+85
| | | | | | | | | | | | |
| * | | | | | | | | | | | shader_ir/decode: Implement AOFFI for TEX and TLD4ReinUsesLisp2019-03-302-27/+94
| | | | | | | | | | | | |
| * | | | | | | | | | | | shader_ir: Implement immediate register trackingReinUsesLisp2019-03-302-1/+19
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2361 from lioncash/pagetablebunnei2019-04-078-20/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | core/memory: Minor simplifications to page table management
| * | | | | | | | | | | | | core/memory: Remove GetCurrentPageTable()Lioncash2019-04-072-6/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that nothing actually touches the internal page table aside from the memory subsystem itself, we can remove the accessor to it.
| * | | | | | | | | | | | | arm/arm_dynarmic: Remove unnecessary current_page_table memberLioncash2019-04-072-8/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the page table will always be guaranteed to be that of whatever the current process is, we no longer need to keep this around.
| * | | | | | | | | | | | | kernel: Handle page table switching within MakeCurrentProcess()Lioncash2019-04-074-6/+3
| | |/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Centralizes the page table switching to one spot, rather than making calling code deal with it everywhere.
* | | | | | | | | | | | | Merge pull request #2321 from ReinUsesLisp/gl-state-reworkbunnei2019-04-073-339/+324
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_state: Rework to enable individual applies
| * | | | | | | | | | | | | gl_state: Rework to enable individual appliesReinUsesLisp2019-04-043-339/+324
| | |_|_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2098 from FreddyFunk/disk-cache-zstdbunnei2019-04-077-7/+111
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_disk_cache: Use Zstandard for compression
| * | | | | | | | | | | | | gitmodules: Replace taps with spacesunknown2019-03-291-2/+2
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | common/zstd_compression: simplify decompression interfaceunknown2019-03-293-13/+11
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | gl_shader_disk_cache: Fixup clang formatunknown2019-03-291-2/+3
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | gl_shader_disk_cache: Use Zstandard for compressionunknown2019-03-291-6/+6
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | common/zstd_compression: Add Zstandard wrapperunknown2019-03-293-0/+98
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | common: Link libzstd_staticunknown2019-03-291-1/+1
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | externals: Add libzstd_static to externals CMakeLists.txtunknown2019-03-291-0/+4
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | externals: Add Zstandard v1.3.8unknown2019-03-292-0/+3
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Addressed feedbackunknown2019-03-291-1/+0
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-291-0/+1
| | | | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2356 from lioncash/pairbunnei2019-04-076-18/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/{server_port, server_session}: Return pairs instead of tuples from pair creation functions
| * | | | | | | | | | | | | | kernel/server_session: Return a std::pair from CreateSessionPair()Lioncash2019-04-064-11/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the return type consistent with the function name. While we're at it, we can also reduce the amount of boilerplate involved with handling these by using structured bindings.
| * | | | | | | | | | | | | | kernel/server_port: Return a std::pair from CreatePortPair()Lioncash2019-04-062-7/+7
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the same type that the function name describes.
* | | | | | | | | | | | | | Merge pull request #2362 from lioncash/enumbunnei2019-04-071-10/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | core/memory: Remove unused enum constants
| * | | | | | | | | | | | | | core/memory: Remove unused enum constantsLioncash2019-04-071-10/+0
| |/ / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are holdovers from Citra and can be removed.
* | | | | | | | | | | | | | Merge pull request #2352 from bunnei/mem-manager-fixesbunnei2019-04-073-12/+84
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | | memory_manager: Improved implementation of read/write/copy block.
| * | | | | | | | | | | | | memory_manager: Improved implementation of read/write/copy block.bunnei2019-04-063-12/+84
| | |_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes graphical issues with Chocobo's Mystery Dungeon EVERY BUDDY! - Fixes a crash with Mario Tennis Aces
* | | | | | | | | | | | | Merge pull request #2317 from FernandoS27/syncbunnei2019-04-062-1/+27
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implement SyncPoint Register in the GPU.
| * | | | | | | | | | | | | Implement SyncPoint Register in the GPU.Fernando Sahmkow2019-04-062-1/+27
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2325 from lioncash/namebunnei2019-04-061-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/server_session: Provide a GetName() override
| * | | | | | | | | | | | | kernel/server_session: Provide a GetName() overrideLioncash2019-04-031-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given server sessions can be given a name, we should allow retrieving it instead of using the default implementation of GetName(), which would just return "[UNKNOWN KERNEL OBJECT]".
* | | | | | | | | | | | | | Merge pull request #2342 from lioncash/warningbunnei2019-04-062-9/+9
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/multi_level_queue: Silence truncation warnings
| * | | | | | | | | | | | | | common/multi_level_queue: Silence truncation warning in iterator operator++Lioncash2019-04-051-1/+1
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | common/bit_util: Make CountLeading/CountTrailing functions have the same return typesLioncash2019-04-051-8/+8
| | |_|_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the return type consistently uniform (like the intrinsics we're wrapping). This also conveniently silences a truncation warning within the kernel multi_level_queue.
* | | | | | | | | | | | | | Merge pull request #2240 from FearlessTobi/port-4651bunnei2019-04-063-4/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4651: "gdbstub: Fix some bugs in IsMemoryBreak() and ServeBreak. Add workaround to let watchpoints break into GDB."
| * | | | | | | | | | | | | | gdbstub: Fix some bugs in IsMemoryBreak() and ServeBreak. Add workaround to let watchpoints break into GDB. (#4651)Dimitri A2019-03-153-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * gdbstub: fix IsMemoryBreak() returning false while connected to client As a result, the only existing codepath for a memory watchpoint hit to break into GDB (InterpeterMainLoop, GDB_BP_CHECK, ARMul_State::RecordBreak) is finally taken, which exposes incorrect logic* in both RecordBreak and ServeBreak. * a blank BreakpointAddress structure is passed, which sets r15 (PC) to NULL * gdbstub: DynCom: default-initialize two members/vars used in conditionals * gdbstub: DynCom: don't record memory watchpoint hits via RecordBreak() For now, instead check for GDBStub::IsMemoryBreak() in InterpreterMainLoop and ServeBreak. Fixes PC being set to a stale/unhit breakpoint address (often zero) when a memory watchpoint (rwatch, watch, awatch) is handled in ServeBreak() and generates a GDB trap. Reasons for removing a call to RecordBreak() for memory watchpoints: * The``breakpoint_data`` we pass is typed Execute or None. It describes the predicted next code breakpoint hit relative to PC; * GDBStub::IsMemoryBreak() returns true if a recent Read/Write operation hit a watchpoint. It doesn't specify which in return, nor does it trace it anywhere. Thus, the only data we could give RecordBreak() is a placeholder BreakpointAddress at offset NULL and type Access. I found the idea silly, compared to simply relying on GDBStub::IsMemoryBreak(). There is currently no measure in the code that remembers the addresses (and types) of any watchpoints that were hit by an instruction, in order to send them to GDB as "extended stop information." I'm considering an implementation for this. * gdbstub: Change an ASSERT to DEBUG_ASSERT I have never seen the (Reg[15] == last_bkpt.address) assert fail in practice, even after several weeks of (locally) developping various branches around GDB. Only leave it inside Debug builds.
* | | | | | | | | | | | | | | Merge pull request #2346 from lioncash/headerbunnei2019-04-0610-22/+39
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | | | video_core/engines: Remove unnecessary inclusions where applicable
| * | | | | | | | | | | | | | video_core/engines: Make memory manager members privateLioncash2019-04-069-13/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't used externally by anything, so they can be made private data members.
| * | | | | | | | | | | | | | video_core/engines: Remove unnecessary inclusions where applicableLioncash2019-04-0610-9/+25
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Replaces header inclusions with forward declarations where applicable and also removes unused headers within the cpp file. This reduces a few more dependencies on core/memory.h
* | | | | | | | | | | | | | Merge pull request #2350 from lioncash/vmembunnei2019-04-062-22/+38
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core/memory_manager: Mark a few member functions with the const qualifier
| * | | | | | | | | | | | | | video_core/memory_manager: Make Read() a const qualified member functionLioncash2019-04-062-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this doesn't actually alter internal state, this can be made a const member function.
| * | | | | | | | | | | | | | video_core/memory_manager: Make ReadBlock() a const qualifier member functionLioncash2019-04-062-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now, since we have a const qualified variant of GetPointer(), we can put it to use in ReadBlock() to retrieve the source pointer that is passed into memcpy. Now block reading may be done from a const context.
| * | | | | | | | | | | | | | video_core/memory_manager: Add a const qualified variant of GetPointer()Lioncash2019-04-062-2/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows retrieving read-only pointers from a const context externally.
| * | | | | | | | | | | | | | video_core/memory_manager: Make FindFreeRegion() a const member functionLioncash2019-04-062-10/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify internal state, so it can be made a const member function.
| * | | | | | | | | | | | | | video_core/memory_manager: Make GpuToCpuAddress() a const member functionLioncash2019-04-062-3/+3
| |/ / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify any internal state, so it can be made a const member function to allow its use in const contexts.
* | | | | | | | | | | | | | Merge pull request #2340 from lioncash/viewbunnei2019-04-061-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | file_sys/fsmitm_romfsbuild: Utilize a string_view in romfs_calc_path_hash
| * | | | | | | | | | | | | | file_sys/fsmitm_romfsbuild: Utilize a string_view in romfs_calc_path_hash()Lioncash2019-04-051-1/+3
| |/ / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The given string instance doesn't need to be copied entirely, we can just use a view instead.
* | | | | | | | | | | | | | Merge pull request #2334 from lioncash/overridebunnei2019-04-0613-23/+9
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | core: Add missing override specifiers where applicable
| * | | | | | | | | | | | | | core: Add missing override specifiers where applicableLioncash2019-04-0413-23/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Applies the override specifier where applicable. In the case of destructors that are defaulted in their definition, they can simply be removed. This also removes the unnecessary inclusions being done in audin_u and audrec_u, given their close proximity.
* | | | | | | | | | | | | | | Merge pull request #2347 from lioncash/truncbunnei2019-04-061-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core/gpu_thread: Silence truncation warning in ThreadManager's constructor
| * | | | | | | | | | | | | | | video_core/gpu_thread: Silence truncation warning in ThreadManager's constructorLioncash2019-04-061-1/+1
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since c5d41fd812d7eb1a04f36b76c08fe971cee0868c callback parameters were changed to use an s64 to represent late cycles instead of an int, so this was causing a truncation warning to occur here. Changing it to s64 is sufficient to silence the warning.
* | | | | | | | | | | | | | | Merge pull request #2341 from lioncash/comparebunnei2019-04-062-11/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | file_sys/nca_metadata: Remove unnecessary comparison operators for TitleType
| * | | | | | | | | | | | | | | file_sys/nca_metadata: Remove unnecessary comparison operators for TitleTypeLioncash2019-04-052-11/+0
| |/ / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | enum class elements from the same enum can already be compared against one another without the need for explicitly defined comparison operators.
* | | | | | | | | | | | | | | Merge pull request #2339 from lioncash/rankbunnei2019-04-065-17/+29
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structs
| * | | | | | | | | | | | | | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-054-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Passing around a 64 byte data struct by value is kind of wasteful, instead pass a reference to the struct.
| * | | | | | | | | | | | | | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The unknown member here is actually padding due to being passed as a struct. We can do the same, and remove the need to pop a padding word.
| * | | | | | | | | | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-053-4/+15
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I realized that I updated the documentation on SwitchBrew a while ago, but never actually updated the structs within yuzu.
* | | | | | | | | | | | | | | Merge pull request #2327 from ReinUsesLisp/crash-safe-visitbunnei2019-04-061-1/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Return early when an operation is invalid
| * | | | | | | | | | | | | | | gl_shader_decompiler: Return early when an operation is invalidReinUsesLisp2019-04-031-1/+6
| | |_|_|_|_|_|/ / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2343 from lioncash/todobunnei2019-04-062-15/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | file_sys/program_metadata: Remove obsolete TODOs
| * | | | | | | | | | | | | | | file_sys/program_metadata: Remove obsolete TODOsLioncash2019-04-052-15/+14
| | |_|/ / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | BitField has been trivially copyable since e99a14862841841d74be8d0ea9426c2d23546b5e, so we can eliminate these TODO comments and use ReadObject() directly instead of memcpying the data.
* | | | | | | | | | | | | | | Merge pull request #2337 from lioncash/temporarybunnei2019-04-061-12/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Rename GenerateTemporal() to GenerateTemporary()
| * | | | | | | | | | | | | | | gl_shader_decompiler: Rename GenerateTemporal() to GenerateTemporary()Lioncash2019-04-051-12/+12
| | |_|/ / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Temporal generally indicates a relation to time, but this is just creating a temporary, so this isn't really an accurate name for what the function is actually doing.
* | | | | | | | | | | | | | | Merge pull request #2329 from lioncash/sanitizebunnei2019-04-061-0/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomic
| * | | | | | | | | | | | | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomicLioncash2019-04-041-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We need to be checking whether or not the given address is within the kernel address space or if the given address isn't word-aligned and bail in these scenarios instead of trashing any kernel state.
* | | | | | | | | | | | | | | | Merge pull request #2344 from lioncash/resultbunnei2019-04-061-4/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | hle/result: Remove unnecessary bitfield entry for ResultCode
| * | | | | | | | | | | | | | | | hle/result: Remove unnecessary bitfield entry for ResultCodeLioncash2019-04-051-4/+0
| | |_|/ / / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a hold over from the 3DS error codes in Citra.
* | | | | | | | | | | | | | | | Merge pull request #2349 from lioncash/surfacebunnei2019-04-061-75/+131
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu/debugger/graphics/graphics_surface: General cleanup
| * | | | | | | | | | | | | | | | yuzu/debugger/graphics_surface: Display error messages for file I/O errorsLioncash2019-04-061-7/+25
| | | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | | yuzu/debugger/graphics_surface: Tidy up SaveSurfaceLioncash2019-04-061-15/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Use QStringLiteral where applicable. - Use const where applicable - Remove unnecessary precondition check (we already assert the pixbuf being non null)
| * | | | | | | | | | | | | | | | yuzu/debugger/graphics_surface: Clean up connection overload deductionLioncash2019-04-061-12/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can utilize qOverload with the signal connections to make the function deducing a little less ugly.
| * | | | | | | | | | | | | | | | yuzu/debugger/graphics_surface: Fill in missing surface format listingsLioncash2019-04-061-43/+84
| |/ / / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fills in the missing surface types that were marked as unknown. The order corresponds with the TextureFormat enum within video_core/texture.h. We also don't need to all of these strings as translatable (only the first string, as it's an English word).
* | | | | | | | | | | | | | | | Merge pull request #2351 from lioncash/macrobunnei2019-04-061-13/+7
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core/macro_interpreter: Simplify GetRegister()
| * | | | | | | | | | | | | | | | video_core/macro_interpreter: Remove assertion within FetchParameter()Lioncash2019-04-061-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use .at(), which essentially does the same thing, but with less code.
| * | | | | | | | | | | | | | | | video_core/macro_interpreter: Simplify GetRegister()Lioncash2019-04-061-11/+6
| |/ / / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we already ensure nothing can set the zeroth register in SetRegister(), we don't need to check if the index is zero and special case it. We can just access the register normally, since it's already going to be zero. We can also replace the assertion with .at() to perform the equivalent behavior inline as part of the API.
* | | | | | | | | | | | | | | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / / / |/| | | | | | | | | | | | | | | filesystem: Use a std::string_view in OpenFile()
| * | | | | | | | | | | | | | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than make a full copy of the path, we can just use a string view and truncate the viewed portion of the string instead of creating a totally new truncated string.
* | | | | | | | | | | | | | | Merge pull request #2282 from bunnei/gpu-asynch-v2bunnei2019-04-053-51/+65
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gpu_thread: Improve synchronization by using CoreTiming.
| * | | | | | | | | | | | | | | gpu_thread: Improve synchronization by using CoreTiming.bunnei2019-04-023-51/+65
| | | | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2292 from lioncash/nacpbunnei2019-04-052-12/+24
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | file_sys/control_metadata: Amend naming of members
| * | | | | | | | | | | | | | | | file_sys/control_metadata: Amend naming of membersLioncash2019-04-042-12/+24
| | |_|_|_|_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Quite a bit of these were out of sync with Switchbrew (and in some cases entirely wrong). While we're at it, also expand the section of named members. A segment within the control metadata is used to specify maximum values for the user, device, and cache storage max sizes and journal sizes. These appear to be generally used by the am service (e.g. in CreateCacheStorage, etc).
* | | | | | | | | | | | | | | | Merge pull request #2335 from lioncash/service-unusedbunnei2019-04-058-62/+58
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | hle/service: Resolve unused variable warnings
| * | | | | | | | | | | | | | | | hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
| | |_|/ / / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In several places, we have request parsers where there's nothing to really parse, simply because the HLE function in question operates on buffers. In these cases we can just remove these instances altogether. In the other cases, we can retrieve the relevant members from the parser and at least log them out, giving them some use.
* | | | | | | | | | | | | | | | Merge pull request #2336 from ReinUsesLisp/txqbunnei2019-04-051-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Fix TXQ types
| * | | | | | | | | | | | | | | | gl_shader_decompiler: Fix TXQ typesReinUsesLisp2019-04-051-2/+3
| | |_|_|_|/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TXQ returns integer types. Shaders usually do: R0 = TXQ(); // => int R0 = static_cast<float>(R0); If we don't treat it as an integer, it will cast a binary float value as float - resulting in a corrupted number.
* | | | | | | | | | | | | | | | Merge pull request #2331 from lioncash/cachebunnei2019-04-051-9/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu/main: Minor adjustments to OnTransferableShaderCacheOpenFile()
| * | | | | | | | | | | | | | | | yuzu/main: Use QStringLiteral where applicable within OnTransferableShaderCacheOpenFile()Lioncash2019-04-041-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows these strings to have no allocation cost when used at runtime.
| * | | | | | | | | | | | | | | | yuzu/main: Tidy up the error dialog string in OnTransferableShaderCacheOpenFile()Lioncash2019-04-041-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than scream that the file doesn't exist, we can clearly state what specifically doesn't exist, to avoid ambiguity, and make it easier to understand for non-primary English speakers/readers.
| * | | | | | | | | | | | | | | | yuzu/main: Remove unnecessary string concatenation in OnTransferableShaderCacheOpenFile()Lioncash2019-04-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just make the trailing portion of the string part of the formatting, getting rid of the need to make another temporary string.
| * | | | | | | | | | | | | | | | yuzu/main: Make open_target a QStringLioncash2019-04-041-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the amount of string conversions necessary. We also don't need to log out what occurs here.
| * | | | | | | | | | | | | | | | yuzu/main: Use static variant of QFile's exists()Lioncash2019-04-041-1/+1
| | |/ / / / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need to construct a QFile instance just to check for its existence.
* | | | | | | | | | | | | | | | Merge pull request #2333 from lioncash/video-includebunnei2019-04-0513-24/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core/renderer_opengl: Remove unnecessary includes
| * | | | | | | | | | | | | | | | video_core/renderer_opengl: Remove unnecessary includesLioncash2019-04-0413-24/+4
| |/ / / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Quite a few unused includes have built up over time, particularly on core/memory.h. Removing these includes means the source files including those files will no longer need to be rebuilt if they're changed, making compilation slightly faster in this scenario.
* | | | | | | | | | | | | | | | Merge pull request #2332 from lioncash/includebunnei2019-04-051-5/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / / / |/| | | | | | | | | | | | | | | yuzu/main: Remove unnecessary includes
| * | | | | | | | | | | | | | | yuzu/main: Remove unnecessary includesLioncash2019-04-041-5/+8
|/ / / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, don't use <QtGui> and <QtWidgets> and instead include exactly which headers we actually need.
* | | | | | | | | | | | | | | Merge pull request #2330 from lioncash/pragmabunnei2019-04-041-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/lz4_compression: Remove #pragma once directive from the cpp file
| * | | | | | | | | | | | | | | common/lz4_compression: Remove #pragma once directive from the cpp fileLioncash2019-04-041-2/+0
|/ / / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Introduced within 798d76f4c7018174e58702fb06a042dc8c84f0be, this only really has an effect within header files. Silences a -Wpragma-once-outside-header warning with clang.
* | | | | | | | | | | | | | | Merge pull request #2328 from lioncash/transferbunnei2019-04-043-17/+37
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()
| * | | | | | | | | | | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For whatever reason, shared memory was being used here instead of transfer memory, which (quite clearly) will not work based off the name of the function. This corrects this wonky usage of shared memory.
| * | | | | | | | | | | | | | | kernel/transfer_memory: Add accessors to data and sizesLioncash2019-04-032-11/+31
| | |_|_|/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also amend erroneous use of size_t. We should be using u64 here.
* | | | | | | | | | | | | | | Merge pull request #2095 from FreddyFunk/open-transferable-shader-cachebunnei2019-04-044-0/+44
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | frontend: Open transferable shader cache for a selected game in the gamelist
| * | | | | | | | | | | | | | | Use QString instead of std::string where applicableunknown2019-02-081-17/+11
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | Use constexpr char array instead of string where applicableMat M2019-02-081-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: FreddyFunk <frederic.laing.development@gmail.com>
| * | | | | | | | | | | | | | | frontend: Open transferable shader cache for a selected game in the gamelistunknown2019-02-084-0/+50
| | | | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2093 from FreddyFunk/disk-cache-better-compressionbunnei2019-04-047-50/+153
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | Better LZ4 compression utilization for the disk based shader cache and the yuzu build system
| * | | | | | | | | | | | | | | gl_shader_disk_cache: Use LZ4HC with compression level 9 instead of compression level 12 for less compression timeunknown2019-03-291-3/+3
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | Addressed feedbackunknown2019-03-297-91/+145
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-292-11/+8
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | gl_shader_disk_cache: Use better compression for transferable and precompiled shader disk chache filesunknown2019-03-293-10/+26
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | data_compression: Move LZ4 compression from video_core/gl_shader_disk_cache to common/data_compressionunknown2019-03-295-39/+75
| | |_|_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2299 from lioncash/maxwellbunnei2019-04-044-17/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_manager: Remove reliance on a global accessor within MaxwellUniformData::SetFromRegs()
| * | | | | | | | | | | | | | | gl_shader_manager: Remove unnecessary gl_shader_manager inclusionLioncash2019-03-281-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used at all in the OpenGL shader cache, so we can remove it's include here, meaning one less file needs to be recompiled if any changes ever occur within that header. core/memory.h is also not used within this file at all, so we can remove it as well.
| * | | | | | | | | | | | | | | gl_shader_manager: Move using statement into the cpp fileLioncash2019-03-282-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids introducing Maxwell3D into the namespace for everything that includes the header.
| * | | | | | | | | | | | | | | gl_shader_manager: Remove reliance on global accessor within MaxwellUniformData::SetFromRegs()Lioncash2019-03-283-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just pass in the Maxwell3D instance instead of going through the system class to get at it. This also lets us simplify the interface a little bit. Since we pass in the Maxwell3D context now, we only really need to pass the shader stage index value in.
| * | | | | | | | | | | | | | | gl_shader_manager: Amend Doxygen string for MaxwellUniformDataLioncash2019-03-271-3/+3
| | |_|_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously only one line of the whole comment was in proper Doxygen formatting.
* | | | | | | | | | | | | | | Merge pull request #2324 from lioncash/enum-unusedbunnei2019-04-042-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | | | kernel/object: Remove unused handle type entry
| * | | | | | | | | | | | | | kernel/object: Remove unused handle type entryLioncash2019-04-032-2/+0
| | |_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The AddressArbiter type isn't actually used, given the arbiter itself isn't a direct kernel object (or object that implements the wait object facilities). Given this, we can remove the enum entry entirely.
* | | | | | | | | | | | | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | service/am: Implement EnterFatalSection/LeaveFatalSection
| * | | | | | | | | | | | | | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions act in tandem similar to how a lock or mutex require a balanced lock()/unlock() sequence. EnterFatalSection simply increments a counter for how many times it has been called, while LeaveFatalSection ensures that a previous call to EnterFatalSection has occured. If a previous call has occurred (the counter is not zero), then the counter gets decremented as one would expect. If a previous call has not occurred (the counter is zero), then an error code is returned.
| * | | | | | | | | | | | | | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the declaration order of the handling functions consistent with the handler table itself.
* | | | | | | | | | | | | | Merge pull request #2323 from lioncash/includebunnei2019-04-032-4/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / |/| | | | | | | | | | | | | yuzu/debugger/profiler: Remove unnecessary includes
| * | | | | | | | | | | | | yuzu/debugger/profiler: Remove unnecessary includesLioncash2019-04-032-4/+6
| | |/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves includes into the cpp file where necessary. This way, microprofile-related stuff isn't dumped into other UI-related code when the dialog header gets included.
* | | | | | | | | | | | | Merge pull request #2302 from ReinUsesLisp/vk-swapchainbunnei2019-04-033-1/+305
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | vk_swapchain: Implement a swapchain manager
| * | | | | | | | | | | | | vk_swapchain: Implement a swapchain managerReinUsesLisp2019-03-293-1/+305
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2305 from lioncash/sharedbunnei2019-04-033-5/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/shared_memory: Sanitize supplied size when unmapping
| * | | | | | | | | | | | | kernel/shared_memory: Remove unused core/memory.h includeLioncash2019-03-291-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nothing from this header is used, so we can remove this include, getting rid of a dependency on it.
| * | | | | | | | | | | | | kernel/shared_memory: Sanitize supplied size when unmappingLioncash2019-03-293-4/+18
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel makes sure that the given size to unmap is always the same size as the entire region managed by the shared memory instance, otherwise it returns an error code signifying an invalid size. This is similarly done for transfer memory (which we already check for).
* | | | | | | | | | | | | Merge pull request #2314 from lioncash/constbunnei2019-04-0311-18/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/thread: Minor interface cleanup
| * | | | | | | | | | | | | kernel/thread: Make AllWaitObjectsReady() a const qualified member functionLioncash2019-04-022-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that ShouldWait() is a const qualified member function, this one can be made const qualified as well, since it can handle passing a const qualified this pointer to ShouldWait().
| * | | | | | | | | | | | | kernel/wait_object: Make ShouldWait() take thread members by pointer-to-constLioncash2019-04-0211-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is intended as a querying function, it doesn't make sense to allow the implementer to modify the state of the given thread.
| * | | | | | | | | | | | | kernel/thread: Avoid sign conversion within GetCommandBufferAddress()Lioncash2019-04-011-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this was performing a u64 + int sign conversion. When dealing with addresses, we should generally be keeping the arithmetic in the same signedness type. This also gets rid of the static lifetime of the constant, as there's no need to make a trivial type like this potentially live for the entire duration of the program.
| * | | | | | | | | | | | | kernel/thread: Make parameter of GetWaitObjectIndex() const qualifiedLioncash2019-04-012-3/+3
| | |_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The pointed to member is never actually modified, so it can be made const.
* | | | | | | | | | | | | Merge pull request #2326 from lioncash/translationbunnei2019-04-032-11/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | | yuzu/applets/{profile_select, software_keyboard}: Use QDialogButtonBox standard buttons instead of custom ones where applicable
| * | | | | | | | | | | | yuzu/applets/software_keyboard: Use QDialogButtonBox standard buttons instead of custom buttonsLioncash2019-04-031-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the previous change, this allows Qt to handle proper translations of the UI buttons, rather than us needing to handle it.
| * | | | | | | | | | | | yuzu/applets/profile_select: Use QDialogButtonBox standard buttons instead of custom buttonsLioncash2019-04-031-4/+1
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes for shorter code, while also not requiring the buttons to be directly translated, they'll be handled by Qt itself.
* | | | | | | | | | | | Merge pull request #2270 from lioncash/plistbunnei2019-04-037-2/+123
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/svc: Implement svcGetProcessList and svcGetThreadList
| * | | | | | | | | | | | kernel/svc: Implement svcGetThreadListLioncash2019-04-024-1/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similarly like svcGetProcessList, this retrieves the list of threads from the current process. In the kernel itself, a process instance maintains a list of threads, which are used within this function. Threads are registered to a process' thread list at thread initialization, and unregistered from the list upon thread destruction (if said thread has a non-null owning process). We assert on the debug event case, as we currently don't implement kernel debug objects.
| * | | | | | | | | | | | kernel/svc: Implement svcGetProcessListLioncash2019-04-024-1/+53
| | |_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function simply copies out a specified number of kernel process IDs, while simultaneously reporting the total number of processes.
* | | | | | | | | | | | Merge pull request #2313 from lioncash/reslimitbunnei2019-04-023-14/+6
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | kernel/resource_limit: Remove the name member from resource limits
| * | | | | | | | | | | kernel/resource_limit: Remove the name member from resource limitsLioncash2019-04-013-14/+6
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't really provide any benefit to the resource limit interface. There's no way for callers to any of the service functions for resource limits to provide a custom name, so all created instances of resource limits other than the system resource limit would have a name of "Unknown". The system resource limit itself is already trivially identifiable from its limit values, so there's no real need to take up space in the object to identify one object meaningfully out of N total objects.
* | | | | | | | | | | Merge pull request #2316 from ReinUsesLisp/fixup-processMat M2019-04-021-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | process: Fix up compilation
| * | | | | | | | | | | process: Fix up compilationReinUsesLisp2019-04-021-1/+1
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2281 from lioncash/memorybunnei2019-04-025-7/+8
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | kernel/codeset: Make CodeSet's memory data member a regular std::vector
| * | | | | | | | | | kernel/codeset: Make CodeSet's memory data member a regular std::vectorLioncash2019-03-225-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The use of a shared_ptr is an implementation detail of the VMManager itself when mapping memory. Because of that, we shouldn't require all users of the CodeSet to have to allocate the shared_ptr ahead of time. It's intended that CodeSet simply pass in the required direct data, and that the memory manager takes care of it from that point on. This means we just do the shared pointer allocation in a single place, when loading modules, as opposed to in each loader.
* | | | | | | | | | | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-017-28/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | core/yuzu: Remove enable_nfc setting
| * | | | | | | | | | | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-297-28/+1
| | |_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was initially added to prevent problems from stubbed/not implemented NFC services, but as we never encountered such and as it's only used in a deprecated function anyway, I guess we can just remove it to prevent more clutter of the settings.
* | | | | | | | | | | Merge pull request #2283 from FearlessTobi/port-4517bunnei2019-04-012-83/+14
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4517 & citra-emu/citra#4686: Changes to macOS buildscripts
| * | | | | | | | | | | travis/macos: Use macpack to bundle dependenciesAlex James2019-03-232-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This appears to properly handle the ffmpeg libraries that dylibbundler failed to patch.
| * | | | | | | | | | | travis: Simplify macos/upload.shMerryMage2019-03-231-81/+11
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2312 from lioncash/locksbunnei2019-04-0123-75/+77
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | general: Use deducation guides for std::lock_guard and std::unique_lock
| * | | | | | | | | | | | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-0123-75/+77
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since C++17, the introduction of deduction guides for locking facilities means that we no longer need to hardcode the mutex type into the locks themselves, making it easier to switch mutex types, should it ever be necessary in the future.
* | | | | | | | | | | | Merge pull request #2304 from lioncash/memsizebunnei2019-03-313-9/+28
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/process: Report total physical memory used to svcGetInfo slightly better
| * | | | | | | | | | | | kernel/process: Report total physical memory used to svcGetInfoLioncash2019-03-293-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reports the (mostly) correct size through svcGetInfo now for queries to total used physical memory. This still doesn't correctly handle memory allocated via svcMapPhysicalMemory, however, we don't currently handle that case anyways.
| * | | | | | | | | | | | kernel/process: Store the total size of the code memory loadedLioncash2019-03-292-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary to properly report the used memory size in svcGetInfo.
| * | | | | | | | | | | | kernel/process: Store the main thread stack size to a data memberLioncash2019-03-282-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary in order to properly report memory usage within svcGetInfo.
| * | | | | | | | | | | | kernel/process: Make Run's stack size parameter a u64Lioncash2019-03-282-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will make operating with the process-related SVC commands much nicer in the future (the parameter representing the stack size in svcStartProcess is a 64-bit value).
| * | | | | | | | | | | | kernel/process: Ensure that given stack size is always page-alignedLioncash2019-03-281-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel always makes sure that the given stack size is aligned to page boundaries.
* | | | | | | | | | | | | Merge pull request #2303 from lioncash/threadbunnei2019-03-312-41/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/thread: Remove unused functions
| * | | | | | | | | | | | | common/thread: Remove unused functionsLioncash2019-03-292-41/+0
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of these functions are carried over from Dolphin (where they aren't used anymore). Given these have no use (and we really shouldn't be screwing around with OS-specific thread scheduler handling from the emulator, these can be removed. The function for setting the thread name is left, however, since it can have debugging utility usages.
* | | | | | | | | | | | | Merge pull request #2297 from lioncash/reorderbunnei2019-03-316-14/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core: Amend constructor initializer list order where applicable
| * | | | | | | | | | | | | video_core: Amend constructor initializer list order where applicableLioncash2019-03-276-14/+14
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Specifies the members in the same order that initialization would take place in. This also silences -Wreorder warnings.
* | | | | | | | | | | | | Merge pull request #2298 from lioncash/variablebunnei2019-03-315-14/+7
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core/{gl_rasterizer, gpu_thread}: Remove unused class variables where applicable
| * | | | | | | | | | | | | gpu_thread: Remove unused dma_pusher class member variable from ThreadManagerLioncash2019-03-272-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The pusher instance is only ever used in the constructor of the ThreadManager for creating the thread that the ThreadManager instance contains. Aside from that, the member is unused, so it can be removed.
| * | | | | | | | | | | | | gl_rasterizer: Remove unused reference member variable from RasterizerOpenGLLioncash2019-03-273-9/+5
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This member variable is no longer being used, so it can be removed, removing a dependency on EmuWindow from the rasterizer's interface"
* | | | | | | | | | | | | Merge pull request #2308 from lioncash/deductionbunnei2019-03-313-12/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/scheduler: Minor tidying up
| * | | | | | | | | | | | | kernel/scheduler: Remove unused parameter to AddThread()Lioncash2019-03-303-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was made unused in b404fcdf1443b91ac9994c05ad1fe039fcd9675e, but the parameter itself wasn't removed.
| * | | | | | | | | | | | | kernel/scheduler: Use deduction guides on mutex locksLioncash2019-03-301-8/+8
| | |_|_|_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since C++17, we no longer need to explicitly specify the type of the mutex within the lock_guard. The type system can now deduce these with deduction guides.
* | | | | | | | | | | | | Merge pull request #2307 from lioncash/regnamesbunnei2019-03-311-38/+51
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | service/fatal: Name FatalInfo structure members
| * | | | | | | | | | | | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
| | | | | | | | | | | | |
| * | | | | | | | | | | | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves a -Wextra-semi warning.
| * | | | | | | | | | | | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, most of these structure members are register values, which makes, sense given this service is used to convey fatal errors. One member indicates the program entry point address, one is a set of bit flags used to determine which registers to print, and one member indicates the architecture type. The only member that still isn't determined is the final member within the data structure.
* | | | | | | | | | | | Merge pull request #2266 from FernandoS27/arbitrationbunnei2019-03-296-14/+22
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Kernel: Fixes to Arbitration and SignalProcessWideKey Management
| * | | | | | | | | | | | Fix small bug that kept a thread as a condvar thread after being signalled.Fernando Sahmkow2019-03-202-6/+8
| | | | | | | | | | | | |
| * | | | | | | | | | | | Add CondVar Thread State.Fernando Sahmkow2019-03-205-4/+10
| | | | | | | | | | | | |
| * | | | | | | | | | | | Small fixes to address_arbiter to better match the IDB.Fernando Sahmkow2019-03-202-5/+5
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2265 from FernandoS27/multilevelqueuebunnei2019-03-298-19/+484
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | | Replace old Thread Queue for a new Multi Level Queue
| * | | | | | | | | | | | Fixes and corrections on formatting.Fernando Sahmkow2019-03-275-41/+30
| | | | | | | | | | | | |
| * | | | | | | | | | | | Fixes to multilevelqueue's iterator.Fernando Sahmkow2019-03-271-1/+5
| | | | | | | | | | | | |
| * | | | | | | | | | | | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-273-31/+34
| | | | | | | | | | | | |
| * | | | | | | | | | | | Add MultiLevelQueue TestsFernando Sahmkow2019-03-272-0/+56
| | | | | | | | | | | | |
| * | | | | | | | | | | | Implement intrinsics CountTrailingZeroes and test it.Fernando Sahmkow2019-03-273-12/+76
| | | | | | | | | | | | |
| * | | | | | | | | | | | Implement a MultiLevelQueueFernando Sahmkow2019-03-273-0/+349
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2284 from lioncash/heap-allocbunnei2019-03-283-59/+81
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/vm_manager: Unify heap allocation/freeing functions
| * | | | | | | | | | | | kernel/vm_manager: Handle shrinking of the heap size within SetHeapSize()Lioncash2019-03-242-24/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | One behavior that we weren't handling properly in our heap allocation process was the ability for the heap to be shrunk down in size if a larger size was previously requested. This adds the basic behavior to do so and also gets rid of HeapFree, as it's no longer necessary now that we have allocations and deallocations going through the same API function. While we're at it, fully document the behavior that this function performs.
| * | | | | | | | | | | | kernel/vm_manager: Rename HeapAllocate to SetHeapSizeLioncash2019-03-243-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it more obvious that this function is intending to stand in for the actual supervisor call itself, and not acting as a general heap allocation function. Also the following change will merge the freeing behavior of HeapFree into this function, so leaving it as HeapAllocate would be misleading.
| * | | | | | | | | | | | kernel/vm_manager: Handle case of identical calls to HeapAllocateLioncash2019-03-241-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In cases where HeapAllocate is called with the same size of the current heap, we can simply do nothing and return successfully. This avoids doing work where we otherwise don't have to. This is also what the kernel itself does in this scenario.
| * | | | | | | | | | | | kernel/vm_manager: Remove unused class variablesLioncash2019-03-241-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Over time these have fallen out of use due to refactoring, so these can be removed.
| * | | | | | | | | | | | kernel/vm_manager: Remove unnecessary heap_used data memberLioncash2019-03-243-13/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't required anymore, as all the kernel ever queries is the size of the current heap, not the total usage of it.
| * | | | | | | | | | | | kernel/vm_manager: Tidy up heap allocation codeLioncash2019-03-243-27/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another holdover from citra that can be tossed out is the notion of the heap needing to be allocated in different addresses. On the switch, the base address of the heap will always be managed by the memory allocator in the kernel, so this doesn't need to be specified in the function's interface itself. The heap on the switch is always allocated with read/write permissions, so we don't need to add specifying the memory permissions as part of the heap allocation itself either. This also corrects the error code returned from within the function. If the size of the heap is larger than the entire heap region, then the kernel will report an out of memory condition.
* | | | | | | | | | | | | Merge pull request #2296 from lioncash/overridebunnei2019-03-283-4/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core: Add missing override specifiers
| * | | | | | | | | | | | | video_core: Add missing override specifiersLioncash2019-03-273-4/+4
| | |/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that the signatures will always match with the base class. Also silences a few compilation warnings.
* | | | | | | | | | | | | Merge pull request #2295 from lioncash/typobunnei2019-03-282-7/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | video_core/gpu: Amend typo in GPU member variable name
| * | | | | | | | | | | | video_core/gpu: Amend typo in GPU member variable nameLioncash2019-03-272-7/+8
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | smaphore -> semaphore
* | | | | | | | | | | | Merge pull request #2285 from lioncash/unused-structbunnei2019-03-261-8/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | kernel/process: Remove unused AddressMapping struct
| * | | | | | | | | | | kernel/process: Remove unused AddressMapping structLioncash2019-03-241-8/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another leftover from citra that's now no longer necessary.
* | | | | | | | | | | | Merge pull request #2287 from lioncash/coretiming-cbbunnei2019-03-267-12/+12
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | core/core_timing: Make callback parameters consistent
| * | | | | | | | | | | | core/core_timing: Make callback parameters consistentLioncash2019-03-247-12/+12
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In some cases, our callbacks were using s64 as a parameter, and in other cases, they were using an int, which is inconsistent. To make all callbacks consistent, we can just use an s64 as the type for late cycles, given it gets rid of the need to cast internally. While we're at it, also resolve some signed/unsigned conversions that were occurring related to the callback registration.
* | | | | | | | | | | | Merge pull request #2286 from lioncash/fwdbunnei2019-03-261-3/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/kernel: Remove unnecessary forward declaration
| * | | | | | | | | | | | kernel/kernel: Remove unnecessary forward declarationLioncash2019-03-241-3/+0
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is no longer necessary, as ResultVal isn't used anywhere in the header.
* | | | | | | | | | | | Merge pull request #2288 from lioncash/linkagebunnei2019-03-261-0/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | core/cheat_engine: Make MemoryReadImpl and MemoryWriteImpl internally linked
| * | | | | | | | | | | core/cheat_engine: Make MemoryReadImpl and MemoryWriteImpl internally linkedLioncash2019-03-241-0/+2
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't need to be visible outside of the translation unit, so they can be enclosed within an anonymous namespace.
* | | | | | | | | | | Merge pull request #2232 from lioncash/transfer-memorybunnei2019-03-246-6/+282
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | core/hle/kernel: Split transfer memory handling out into its own class
| * | | | | | | | | | core/hle/kernel/svc: Implement svcUnmapTransferMemoryLioncash2019-03-131-1/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similarly, like svcMapTransferMemory, we can also implement svcUnmapTransferMemory fairly trivially as well.
| * | | | | | | | | | core/hle/kernel/svc: Implement svcMapTransferMemoryLioncash2019-03-131-1/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that transfer memory handling is separated from shared memory, we can implement svcMapTransferMemory pretty trivially.
| * | | | | | | | | | core/hle/kernel: Split transfer memory handling out into its own classLioncash2019-03-136-4/+177
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Within the kernel, shared memory and transfer memory facilities exist as completely different kernel objects. They also have different validity checking as well. Therefore, we shouldn't be treating the two as the same kind of memory. They also differ in terms of their behavioral aspect as well. Shared memory is intended for sharing memory between processes, while transfer memory is intended to be for transferring memory to other processes. This breaks out the handling for transfer memory into its own class and treats it as its own kernel object. This is also important when we consider resource limits as well. Particularly because transfer memory is limited by the resource limit value set for it. While we currently don't handle resource limit testing against objects yet (but we do allow setting them), this will make implementing that behavior much easier in the future, as we don't need to distinguish between shared memory and transfer memory allocations in the same place.
* | | | | | | | | | | Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-237-3/+154
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversion
| * | | | | | | | | | | set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | set_sys: Use official nintendo version stringZach Hilman2019-03-114-19/+25
| | | | | | | | | | | |
| * | | | | | | | | | | system_version: Correct sizes on VectorVfsFile constructionZach Hilman2019-03-111-4/+4
| | | | | | | | | | | |
| * | | | | | | | | | | set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| | | | | | | | | | | |
| * | | | | | | | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-106-3/+128
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses the synthesized system archive 9 (SystemVersion) and reports v5.1.0-0.0
* | | | | | | | | | | | Merge pull request #2253 from lioncash/flagsbunnei2019-03-232-79/+70
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Migrate off directly modifying CMAKE_* compilation-related flags directly
| * | | | | | | | | | | | CMakeLists: Move off of modifying CMAKE_*-related flagsLioncash2019-03-171-20/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Modifying CMAKE_* related flags directly applies those changes to every single CMake target. This includes even the targets we have in the externals directory. So, if we ever increased our warning levels, or enabled particular ones, or enabled any other compilation setting, then this would apply to externals as well, which is often not desirable. This makes our compilation flag setup less error prone by only applying our settings to our targets and leaving the externals alone entirely. This also means we don't end up clobbering any provided flags on the command line either, allowing users to specifically use the flags they want.
| * | | | | | | | | | | | CMakeLists: Move compilation flags into the src directoryLioncash2019-03-172-79/+78
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We generally shouldn't be hijacking CMAKE_CXX_FLAGS, etc as a means to append flags to the targets, since this adds the compilation flags to everything, including our externals, which can result in weird issues and makes the build hierarchy fragile. Instead, we want to just apply these compilation flags to our targets, and let those managing external libraries to properly specify their compilation flags. This also results in us not getting as many warnings, as we don't raise the warning level on every external target.
* | | | | | | | | | | | | Merge pull request #2280 from lioncash/nsobunnei2019-03-233-73/+92
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | | loader/nso: Minor refactoring
| * | | | | | | | | | | | loader/nso: Place translation unit specific functions into an anonymous namespaceLioncash2019-03-221-20/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it impossible to indirectly violate the ODR in some other translation unit due to these existing.
| * | | | | | | | | | | | loader/nso: Clean up use of magic constantsLioncash2019-03-221-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the NSO header has the proper size, we can just use sizeof on it instead of having magic constants.
| * | | | | | | | | | | | file_sys/patch_manager: Deduplicate NSO headerLioncash2019-03-223-64/+65
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This source file was utilizing its own version of the NSO header. Instead of keeping this around, we can have the patch manager also use the version of the header that we have defined in loader/nso.h
| * | | | | | | | | | | | loader/nso: Fix definition of the NSO header structLioncash2019-03-221-3/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The total struct itself is 0x100 (256) bytes in size, so we should be providing that amount of data. Without the data, this can result in omitted data from the final loaded NSO file.
| * | | | | | | | | | | | file_sys/patch_manager: Remove two magic valuesLioncash2019-03-221-2/+5
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These correspond to the NSOBuildHeader.
* | | | | | | | | | | | Merge pull request #2279 from lioncash/cheat-globalbunnei2019-03-226-48/+57
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | file_sys/cheat_engine: Remove use of global system accessors
| * | | | | | | | | | | | file_sys/cheat_engine: Silence truncation and sign-conversion warningsLioncash2019-03-222-5/+6
| | | | | | | | | | | | |
| * | | | | | | | | | | | file_sys/cheat_engine: Remove use of global system accessorsLioncash2019-03-226-43/+51
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, pass in the core timing instance and make the dependency explicit in the interface.
* | | | | | | | | | | | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-2228-257/+550
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | gpu: Rewrite MemoryManager based on the VMManager implementation.
| * | | | | | | | | | | | memory_manager: Cleanup FindFreeRegion.bunnei2019-03-212-12/+6
| | | | | | | | | | | | |
| * | | | | | | | | | | | memory_manager: Use Common::AlignUp in public interface as needed.bunnei2019-03-211-11/+22
| | | | | | | | | | | | |
| * | | | | | | | | | | | memory_manager: Bug fixes and further cleanup.bunnei2019-03-212-73/+72
| | | | | | | | | | | | |
| * | | | | | | | | | | | memory: Check that core is powered on before attempting to use GPU.bunnei2019-03-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - GPU will be released on shutdown, before pages are unmapped. - On subsequent runs, current_page_table will be not nullptr, but GPU might not be valid yet.
| * | | | | | | | | | | | maxwell_dma: Check for valid source in destination before copy.bunnei2019-03-211-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Avoid a crash in Octopath Traveler.
| * | | | | | | | | | | | memory_manager: Add protections for invalid GPU addresses.bunnei2019-03-212-22/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Avoid a crash in Xenoblade Chronicles 2.
| * | | | | | | | | | | | gl_rasterizer_cache: Check that backing memory is valid before creating a surface.bunnei2019-03-212-15/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a crash in Puyo Puyo Tetris.
| * | | | | | | | | | | | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-2113-212/+481
| | | | | | | | | | | | |
| * | | | | | | | | | | | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-2117-39/+31
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #2277 from bunnei/fix-smo-transitionsbunnei2019-03-223-8/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | | Revert "Devirtualize Register/Unregister and use a wrapper instead."
| * | | | | | | | | | | | Revert "Devirtualize Register/Unregister and use a wrapper instead."bunnei2019-03-223-8/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes graphical issues from transitions in Super Mario Odyssey.
* | | | | | | | | | | | | Merge pull request #2234 from lioncash/mutexbunnei2019-03-225-29/+62
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | core/hle/kernel: Make Mutex a per-process class.
| * | | | | | | | | | | | | core/hle/kernel/mutex: Remove usages of global system accessorsLioncash2019-03-151-11/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the use of global system accessors, and instead uses the explicit interface provided.
| * | | | | | | | | | | | | core/hle/kernel: Make Mutex a per-process class.Lioncash2019-03-155-18/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it an instantiable class like it is in the actual kernel. This will also allow removing reliance on global accessors in a following change, now that we can encapsulate a reference to the system instance in the class.
* | | | | | | | | | | | | | Merge pull request #2274 from lioncash/includebunnei2019-03-221-3/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | | core/memory: Remove unnecessary includes
| * | | | | | | | | | | | | core/memory: Remove unnecessary includesLioncash2019-03-211-3/+0
| | |_|_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In 93da8e0abfcdcc6e3cb5488a0db12373429f1377, the page table construct was moved to the common library (which utilized these inclusions). Since the move, nothing requires these headers to be included within the memory header.
* | | | | | | | | | | | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-224-22/+20
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/vm_manager: Amend flag value for code data
| * | | | | | | | | | | | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-214-22/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it more evident that one is for actual code and one is for actual data. Mutable and static are less than ideal terms here, because read-only data is technically not mutable, but we were mapping it with that label.
| * | | | | | | | | | | | | kernel/vm_manager: Amend flag values for CodeMutableLioncash2019-03-211-1/+1
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This should actually be using the data flags, rather than the code flags.
* | | | | | | | | | | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | service/am: Add function table for IDebugFunctions
| * | | | | | | | | | | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have the service related stuff set up for this, however, it's missing the function table.
* | | | | | | | | | | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-2210-0/+813
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | file_sys: Implement parser and interpreter for game memory cheats
| * | | | | | | | | | | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-0510-77/+56
| | | | | | | | | | | | |
| * | | | | | | | | | | | core: Add support for registering and controlling ownership of CheatEngineZach Hilman2019-03-052-0/+13
| | | | | | | | | | | | |
| * | | | | | | | | | | | cheat_engine: Add parser and interpreter for game cheatsZach Hilman2019-03-053-0/+715
| | | | | | | | | | | | |
| * | | | | | | | | | | | loader/nso: Set main code region in VMManagerZach Hilman2019-03-053-2/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For rom directories (and by extension, XCI/NSP/NAX/NCA) this is for the NSO with name 'main', for regular NSOs, this is the NSO.
| * | | | | | | | | | | | vm_manager: Add support for storing and getting main code regionZach Hilman2019-03-052-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used as root for one region of cheats, set by loader
| * | | | | | | | | | | | patch_manager: Display cheats in game list add-onsZach Hilman2019-03-051-0/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | patch_manager: Add support for loading cheats listsZach Hilman2019-03-052-0/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses load/<title_id>/<mod_name>/cheats as root dir, file name is all upper or lower hex first 8 bytes build ID.
| * | | | | | | | | | | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows frontend/features to access pressed buttons conveniently as possible
* | | | | | | | | | | | | Merge pull request #2260 from lioncash/sdlbunnei2019-03-213-12/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | input_common/sdl: Correct return values within GetPollers implementations
| * | | | | | | | | | | | | input_common/sdl: Correct return values within implementations of GetPollers()Lioncash2019-03-182-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In both cases, we weren't actually returning anything, which is undefined behavior.
| * | | | | | | | | | | | | input_common/sdl: Use a type alias to shorten declaration of GetPollersLioncash2019-03-183-11/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Just makes the definitions a little bit more tidy.
* | | | | | | | | | | | | | common/bit_util: Fix bad merge duplicating the copy constructorLioncash2019-03-211-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Introduced as a result of #2090, we already define the copy constructor further down below, so this isn't needed.
* | | | | | | | | | | | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-2110-134/+337
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4244 and citra-emu/citra#4599: Changes to BitField
| * | | | | | | | | | | | | | Make bitfield assignment operator publicfearlessTobi2019-02-131-6/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This change needs to be made to get the code compiling again. It was suggested after a conversation with Lioncash. The conversation can be seen here: https://user-images.githubusercontent.com/20753089/45064197-b6107800-b0b2-11e8-9db8-f696299fb86a.PNG
| * | | | | | | | | | | | | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-066-96/+96
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit it automatically generated by command in zsh: sed -i -- 's/BitField<\(.*\)_le>/BitField<\1>/g' **/*(D.) BitField is now aware to endianness and default to little endian. It expects a value representation type without storage specification for its template parameter.
| * | | | | | | | | | | | | | common/bitfield: make it endianness-awareWeiyi Wang2019-02-063-3/+100
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | common/swap: remove default value for swap type internal storageWeiyi Wang2019-02-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is compromise for swap type being used in union. A union has deleted default constructor if it has at least one variant member with non-trivial default constructor, and no variant member of T has a default member initializer. In the use case of Bitfield, all variant members will be the swap type on endianness mismatch, which would all have non-trivial default constructor if default value is specified, and non of them can have member initializer
| * | | | | | | | | | | | | | common/swap: use template and tag for LE/BE specificationWeiyi Wang2019-02-061-39/+91
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The tag can be useful for other type-generic templates like BitFields to forward the endianness specification
| * | | | | | | | | | | | | | common/swap: add swap template for enumWeiyi Wang2019-02-061-0/+52
| | | | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2262 from lioncash/enumbunnei2019-03-212-2/+15
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | file_sys/content_archive: Amend name of Data_Unknown5 enum entry
| * | | | | | | | | | | | | | | file_sys/content_archive: Amend name of Data_Unknown5 enum entryLioncash2019-03-192-2/+15
| | |_|_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, give each entry some documentation.
* | | | | | | | | | | | | | | Merge pull request #2273 from lioncash/guardbunnei2019-03-212-0/+9
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/uint128: Add missing header guard
| * | | | | | | | | | | | | | | common/uint128: Add missing header guardLioncash2019-03-211-0/+2
| | | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | common/uint128: Add missing top-file source textLioncash2019-03-212-0/+7
| | |_|_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2268 from lioncash/codesetbunnei2019-03-218-45/+111
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / / |/| | | | | | | | | | | | | | core/kernel: Migrate CodeSet to its own source files
| * | | | | | | | | | | | | | kernel/process: Make MapSegment lambda reference parameter constLioncash2019-03-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The segment itself isn't actually modified.
| * | | | | | | | | | | | | | kernel: Move CodeSet structure to its own source filesLioncash2019-03-208-44/+110
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is utilized by the loaders, this allows avoiding inclusion of the kernel process definitions where avoidable. This also keeps the loading format for all executable data separate from the kernel objects.
* | | | | | | | | | | | | | | Merge pull request #2272 from lioncash/boostbunnei2019-03-211-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/CMakeLists: Amend boost dependency
| * | | | | | | | | | | | | | | common/CMakeLists: Amend boost dependencyLioncash2019-03-211-1/+1
|/ / / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When #2247 was created, thread_queue_list.h was the only user of boost-related code, however #2252 moved the page table struct into common, which makes use of Boost.ICL, so we need to add the dependency to the common library's link interface again.
* | | | | | | | | | | | | | | Merge pull request #2267 from FernandoS27/fix-2238bunnei2019-03-211-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix crash caused by #2238.
| * | | | | | | | | | | | | | | Fix crash caused by 2238.Fernando Sahmkow2019-03-201-1/+2
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2247 from lioncash/includebunnei2019-03-212-4/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/thread_queue_list: Remove unnecessary dependency on boost
| * | | | | | | | | | | | | | | common/thread_queue_list: Remove unnecessary dependency on boostLioncash2019-03-162-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We really don't need to pull in several headers of boost related machinery just to perform the erase-remove idiom (particularly with C++20 around the corner, which adds universal container std::erase and std::erase_if, which we can just use instead). With this, we don't need to link in anything boost-related into common.
* | | | | | | | | | | | | | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packets
| * | | | | | | | | | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After doing a little more reading up on the Opus codec, it turns out that the multistream API that is part of libopus can handle regular packets. Regular packets are just a degenerate case of multistream Opus packets, and all that's necessary is to pass the number of streams as 1 and provide a basic channel mapping, then everything works fine for that case. This allows us to get rid of the need to use both APIs in the future when implementing multistream variants in a follow-up PR, greatly simplifying the code that needs to be written.
* | | | | | | | | | | | | | | | | Merge pull request #2239 from FearlessTobi/port-4684bunnei2019-03-211-3/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / / / / |/| | | | | | | | | | | | | | | | Port citra-emu/citra#4684: "frontend: qt: fix a freeze where if you click on entry in the game list too fast, citra will hang"
| * | | | | | | | | | | | | | | | frontend: qt: fix a freeze where if you click on entry in the game list too fast, citra will hangliushuyu2019-03-151-3/+1
| | |_|_|_|_|_|_|_|_|_|_|/ / / / | |/| | | | | | | | | | | | | |
* | | | | | | | | | | | | | | | Merge pull request #2264 from lioncash/linkerbunnei2019-03-205-189/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | core/loader: Remove vestigial Linker class
| * | | | | | | | | | | | | | | | loader: Remove Linker classLioncash2019-03-203-185/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the class is now currently unused, it can be removed.
| * | | | | | | | | | | | | | | | loader: Remove Linker inheritance from NRO and NSO loadersLioncash2019-03-202-4/+4
| | |_|_|/ / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither the NRO or NSO loaders actually make use of the functions or members provided by the Linker interface, so we can just remove the inheritance altogether.
* | | | | | | | | | | | | | | | Merge pull request #2263 from FearlessTobi/port-4697bunnei2019-03-201-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / / / |/| | | | | | | | | | | | | | | Port citra-emu/citra#4697: "Fix getopt on systems where char is unsigned by default"
| * | | | | | | | | | | | | | | Fix getopt on systems where char is unsigned by defaultxperia642019-03-191-2/+2
|/ / / / / / / / / / / / / / /
* | | | | | | | | | | | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | | | service/am: Supply remaining missing IAudioController functions
| * | | | | | | | | | | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All this does is supply a new volume level and a fade time in nanoseconds for the volume transition to occur within.
| * | | | | | | | | | | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other volume setter, this mainly just sets a data member within the service, nothing too special.
| * | | | | | | | | | | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function passes in the desired main applet and library applet volume levels. We can then just pass those values back within the relevant volume getter functions, allowing us to unstub those as well. The initial values for the library and main applet volumes differ. The main applet volume is 0.25 by default, while the library applet volume is initialized to 1.0 by default in the services themselves.
* | | | | | | | | | | | | | | Merge pull request #2259 from lioncash/fspbunnei2019-03-182-1/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | fsp_srv: Unstub SetCurrentProcess
| * | | | | | | | | | | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This just acts as a basic setter for a given PID value and performs no further checking, so we can just store the passed in value.
* | | | | | | | | | | | | | | | Merge pull request #2254 from lioncash/redundantbunnei2019-03-181-3/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / / / |/| | | | | | | | | | | | | | | input_common/sdl_impl: Minor cleanup in SDLState constructor
| * | | | | | | | | | | | | | | input_common/sdl_impl: Make lambda capture more specific in SDLState constructorLioncash2019-03-171-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to universally capture by reference. We specifically just need to capture the this pointer.
| * | | | | | | | | | | | | | | input_common/sdl_impl: Remove unnecessary std::chrono::duration constructionLioncash2019-03-171-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Specifying the time unit itself is sufficient here.
| * | | | | | | | | | | | | | | input_common/sdl_impl: Remove unused variable in SDLState constructorLioncash2019-03-171-1/+0
| | |_|_|/ / / / / / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2238 from lioncash/threadbunnei2019-03-182-21/+41
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / / |/| | | | | | | | | | | | | | kernel/thread: Amend conditional test and assignment within UpdatePriority()
| * | | | | | | | | | | | | | kernel/thread: Expand documentation of nominal_priority and current_priorityLioncash2019-03-162-3/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aims to disambiguate why each priority instance exists a little bit. While we're at it, also add an explanatory comment to UpdatePriority().
| * | | | | | | | | | | | | | kernel/thread: Make bracing consistent within UpdatePriority()Lioncash2019-03-161-2/+4
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | kernel/thread: Amend condition within UpdatePriority()Lioncash2019-03-161-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This condition was checking against the nominal thread priority, whereas the kernel itself checks against the current priority instead. We were also assigning the nominal priority, when we should be assigning current_priority, which takes priority inheritance into account. This can lead to the incorrect priority being assigned to a thread. Given we recursively update the relevant threads, we don't need to go through the whole mutex waiter list. This matches what the kernel does as well (only accessing the first entry within the waiting list).
| * | | | | | | | | | | | | | kernel/thread: Maintain priority ordering of added mutex waiting threadsLioncash2019-03-161-14/+24
| | |_|_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel keeps the internal waiting list ordered by priority. This is trivial to do with std::find_if followed by an insertion.
* | | | | | | | | | | | | | Merge pull request #2257 from MerryMage/boost-1.66Mat M2019-03-181-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CMakeLists: Raise minimum Boost requirement to 1.66.0
| * | | | | | | | | | | | | | CMakeLists: Raise minimum Boost requirement to 1.66.0MerryMage2019-03-181-2/+2
|/ / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Required due to bugfix in boost for changed template resolving rules in GCC 7.3.0 in C++17 mode
* | | | | | | | | | | | | | Merge pull request #2252 from bunnei/move-page-tablebunnei2019-03-1716-171/+215
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | core: Move PageTable struct into Common.
| * | | | | | | | | | | | | core: Move PageTable struct into Common.bunnei2019-03-1716-171/+215
| | | | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2251 from bunnei/skip-zero-flushbunnei2019-03-171-0/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Skip zero addr/sized regions on flush/invalidate.
| * | | | | | | | | | | | | | gl_rasterizer: Skip zero addr/sized regions on flush/invalidate.bunnei2019-03-171-0/+6
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2249 from lioncash/ipcbunnei2019-03-171-0/+30
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ipc_helpers: Allow pushing and popping floating-point values
| * | | | | | | | | | | | | | ipc_helpers: Allow pushing and popping floating-point valuesLioncash2019-03-161-0/+30
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Certain values that are passed through the IPC buffer are actually floating point values, not solely integral values.
* | | | | | | | | | | | | | Merge pull request #2246 from lioncash/opus-forkbunnei2019-03-171-0/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | externals: Update opus to latest master
| * | | | | | | | | | | | | | externals: Update opus to latest masterLioncash2019-03-161-0/+0
| |/ / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents yuzu from getting 2000+ warnings in MSVC in a future change.
* | | | | | | | | | | | | | Merge pull request #2245 from lioncash/unused-defbunnei2019-03-171-6/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | | kernel/thread: Actually remove the definition of ExitCurrentThread()
| * | | | | | | | | | | | | kernel/thread: Actually remove the definition of ExitCurrentThread()Lioncash2019-03-161-6/+0
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was intended to be removed in 51d7f6bffcc0498a47abc7de27bf0906fc523dae, but I guess I forgot to actually save the file like a dingus.
* | | | | | | | | | | | | Merge pull request #2244 from bunnei/gpu-mem-refactorbunnei2019-03-1720-189/+196
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core: Refactor to use MemoryManager interface for all memory access.
| * | | | | | | | | | | | | video_core: Refactor to use MemoryManager interface for all memory access.bunnei2019-03-1620-189/+196
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/video_core/engines/kepler_memory.cpp # src/video_core/engines/maxwell_3d.cpp # src/video_core/morton.cpp # src/video_core/morton.h # src/video_core/renderer_opengl/gl_global_cache.cpp # src/video_core/renderer_opengl/gl_global_cache.h # src/video_core/renderer_opengl/gl_rasterizer_cache.cpp
* | | | | | | | | | | | | | Merge pull request #2243 from bunnei/mem-simplify-cachebunnei2019-03-173-68/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | memory: Simplify rasterizer cache operations.
| * | | | | | | | | | | | | | memory: Simplify rasterizer cache operations.bunnei2019-03-163-68/+22
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2129 from FernandoS27/cntpctbunnei2019-03-176-2/+69
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | | Correct CNTPCT from using CPU Cycles to using Clock Cycles
| * | | | | | | | | | | | | Corrections, documenting and fixes.Fernando Sahmkow2019-02-164-13/+14
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Use u128 on Clock Cycles calculation.Fernando Sahmkow2019-02-165-27/+32
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Implement 128 bits Unsigned Integer Multiplication and Division.Fernando Sahmkow2019-02-163-0/+50
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Correct CNTPCT to use Clock Cycles instead of Cpu Cycles.Fernando Sahmkow2019-02-163-2/+13
| | | | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2241 from lioncash/compile-flagsbunnei2019-03-161-8/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CMakeLists: Remove now-unnecessary GCC special-casing
| * | | | | | | | | | | | | | CMakeLists: Remove now-unnecessary GCC special-casingLioncash2019-03-161-8/+2
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This issue has since been fixed in newer versions of Boost, so we don't need to worry about this anymore.
* | | | | | | | | | | | | | Merge pull request #2242 from lioncash/thread-fnbunnei2019-03-164-33/+31
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / / |/| | | | | | | | | | | | | kernel/thread: Remove WaitCurrentThread_Sleep() and ExitCurrentThread()
| * | | | | | | | | | | | | kernel/thread: Move thread exiting logic from ExitCurrentThread to svcExitThreadLioncash2019-03-162-8/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Puts the operation on global state in the same places as the rest of the svc calls.
| * | | | | | | | | | | | | kernel/thread: Migrate WaitCurrentThread_Sleep into the Thread interfaceLioncash2019-03-164-25/+24
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than make a global accessor for this sort of thing. We can make it a part of the thread interface itself. This allows getting rid of a hidden global accessor in the kernel code.
* | | | | | | | | | | | | Merge pull request #2237 from bunnei/cache-host-addrbunnei2019-03-1626-294/+394
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | | | gpu: Use host address for caching instead of guest address.
| * | | | | | | | | | | | gpu: Use host address for caching instead of guest address.bunnei2019-03-1526-294/+394
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2048 from FearlessTobi/port-3924bunnei2019-03-162-203/+250
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | / | | |_|_|_|_|_|_|_|_|/ | |/| | | | | | | | | Port citra-emu/citra#3924: "citra_qt: Settings (configuration) rework"
| * | | | | | | | | | citra_qt: Settings (configuration) reworkzhupengfei2019-03-072-203/+250
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #2233 from ReinUsesLisp/morton-cleanupbunnei2019-03-154-187/+146
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | video_core/morton: Miscellaneous changes
| * | | | | | | | | | | video_core/morton: Use enum to describe MortonCopyPixels128 modeReinUsesLisp2019-03-133-7/+10
| | | | | | | | | | | |
| * | | | | | | | | | | video_core/morton: Remove unused parameter in MortonSwizzleReinUsesLisp2019-03-133-8/+7
| | | | | | | | | | | |
| * | | | | | | | | | | video_core/morton: Remove clang-format off when it's not neededReinUsesLisp2019-03-131-133/+129
| | | | | | | | | | | |
| * | | | | | | | | | | video_core/morton: Remove unused functionsReinUsesLisp2019-03-131-39/+0
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2229 from ReinUsesLisp/vk-sampler-cachebunnei2019-03-154-24/+168
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | | vk_sampler_cache: Implement a sampler cache
| * | | | | | | | | | vk_sampler_cache: Use operator== instead of memcmpMat M2019-03-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | | | | | | | vk_sampler_cache: Implement a sampler cacheReinUsesLisp2019-03-134-1/+140
| | | | | | | | | | |
| * | | | | | | | | | video_core/texture: Add a raw representation of TSCEntryReinUsesLisp2019-03-121-24/+29
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #2230 from lioncash/globalbunnei2019-03-152-8/+9
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | kernel/process: Remove use of global system accessors
| * | | | | | | | | | | kernel/process: Remove use of global system accessorsLioncash2019-03-132-8/+9
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we pass in a reference to the system instance, we can utilize it to eliminate the global accessors in Process-related code.
* | | | | | | | | | | Merge pull request #2216 from ReinUsesLisp/rasterizer-systembunnei2019-03-142-29/+31
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Use system instance passed from argument
| * | | | | | | | | | | gl_rasterizer: Use system instance passed from argumentReinUsesLisp2019-03-112-29/+31
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2227 from lioncash/overridebunnei2019-03-132-5/+5
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | renderer_opengl/gl_global_cache: Add missing override specifiers
| * | | | | | | | | | | renderer_opengl/gl_global_cache: Replace indexing for assignment with insert_or_assignLioncash2019-03-112-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous code had some minor issues with it, really not a big deal, but amending it is basically 'free', so I figured, "why not?". With the standard container maps, when: map[key] = thing; is done, this can cause potentially undesirable behavior in certain scenarios. In particular, if there's no value associated with the key, then the map constructs a default initialized instance of the value type. In this case, since it's a std::shared_ptr (as a type alias) that is the value type, this will construct a std::shared_pointer, and then assign over it (with objects that are quite large, or actively heap allocate this can be extremely undesirable). We also make the function take the region by value, as we can avoid a copy (and by extension with std::shared_ptr, a copy causes an atomic reference count increment), in certain scenarios when ownership isn't a concern (i.e. when ReserveGlobalRegion is called with an rvalue reference, then no copy at all occurs). So, it's more-or-less a "free" gain without many downsides.
| * | | | | | | | | | | renderer_opengl/gl_global_cache: Append missing override specifiersLioncash2019-03-111-2/+2
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two of the functions here are overridden functions, so we can append these specifiers to make it explicit.
* | | | | | | | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-134-14/+36
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | kernel/server_port: Make data members private
| * | | | | | | | | | | kernel/server_port: Make data members privateLioncash2019-03-114-14/+36
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With this, all kernel objects finally have all of their data members behind an interface, making it nicer to reason about interactions with other code (as external code no longer has the freedom to totally alter internals and potentially messing up invariants).
* | | | | | | | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-133-19/+5
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | core/hle/result: Tidy up the base error code result header.
| * | | | | | | | | | | core/hle/result: Remove now-unnecessary manually defined copy assignment operatorLioncash2019-03-101-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this was required, as BitField wasn't trivially copyable. BitField has since been made trivially copyable, so now this isn't required anymore.
| * | | | | | | | | | | core/hle/result: Amend error in comment description for ResultCodeLioncash2019-03-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of another holdover from Citra, and describes the OS on the Switch instead.
| * | | | | | | | | | | core/hle/result: Remove now-unused constructor for ResultCodeLioncash2019-03-101-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the final stray ErrorDescription member was relocated, we can finally remove it and its relevant constructor in the ResultCode union.
| * | | | | | | | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-103-3/+4
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Relocates the error code to where it's most related, similar to how all the other error codes are. Previously we were including a non-generic error in the main result code header.
* | | | | | | | | | | Merge pull request #2187 from FearlessTobi/port-sdl-thingsbunnei2019-03-139-691/+785
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Port various Citra changes to input_common, including deadzone support
| * | | | | | | | | | | fixup! Joystick: Allow for background events; Add deadzone to SDLAnalogB3n302019-03-021-6/+17
| | | | | | | | | | | |
| * | | | | | | | | | | input/sdl: lock map mutex after SDL callWeiyi Wang2019-03-021-11/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Any SDL invocation can call the even callback on the same thread, which can call GetSDLJoystickBySDLID and eventually cause double lock on joystick_map_mutex. To avoid this, lock guard should be placed as closer as possible to the object accessing code, so that any SDL invocation is with the mutex unlocked
| * | | | | | | | | | | Input: Remove global variables from SDL InputJames Rowe2019-03-029-809/+206
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Changes the interface as well to remove any unique methods that frontends needed to call such as StartJoystickEventHandler by conditionally starting the polling thread only if the frontend hasn't started it already. Additionally, moves all global state into a single SDLState class in order to guarantee that the destructors are called in the proper order
| * | | | | | | | | | | Input: Copy current SDL.h/cpp files to implJames Rowe2019-03-022-0/+680
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This should make reviewing much easier as you can then see what changed happened between the old file and the new one
* | | | | | | | | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-139-40/+146
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service/vi: Unstub GetDisplayService
| * | | | | | | | | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is also supposed to check its given policy type with the permission of the service itself. This implements the necessary machinery to unstub these functions. Policy::User seems to just be basic access (which is probably why vi:u is restricted to that policy), while the other policy seems to be for extended abilities regarding which displays can be managed and queried, so this is assumed to be for a background compositor (which I've named, appropriately, Policy::Compositor).
| * | | | | | | | | | | | core/ipc_helper: Allow popping all signed value types with RequestParserLioncash2019-02-271-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real reason this shouldn't be allowed, given some values sent via a request can be signed. This also makes it less annoying to work with popping enum values, given an enum class with no type specifier will work out of the box now. It's also kind of an oversight to allow popping s64 values, but nothing else.
| * | | | | | | | | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This didn't really provide much benefit here, especially since the subsequent change requires that the behavior for each service's GetDisplayService differs in a minor detail. This also arguably makes the services nicer to read, since it gets rid of an indirection in the class hierarchy.
* | | | | | | | | | | | | Merge pull request #2231 from ReinUsesLisp/fixup-biasbunnei2019-03-131-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / |/| | | | | | | | | | | | video_core/texture: Fix up sampler lod bias
| * | | | | | | | | | | | video_core/texture: Fix up sampler lod biasReinUsesLisp2019-03-131-1/+1
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2211 from lioncash/arbiterbunnei2019-03-129-65/+81
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | kernel: Make the address arbiter instance per-process
| * | | | | | | | | | | | kernel: Make the address arbiter instance per-processLioncash2019-03-088-28/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have the address arbiter extracted to its own class, we can fix an innaccuracy with the kernel. Said inaccuracy being that there isn't only one address arbiter. Each process instance contains its own AddressArbiter instance in the actual kernel. This fixes that and gets rid of another long-standing issue that could arise when attempting to create more than one process.
| * | | | | | | | | | | | kernel/svc: Move address arbiter signaling behind a unified API functionLioncash2019-03-083-22/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to how WaitForAddress was isolated to its own function, we can also move the necessary conditional checking into the address arbiter class itself, allowing us to hide the implementation details of it from public use.
| * | | | | | | | | | | | kernel/svc: Move address arbiter waiting behind a unified API functionLioncash2019-03-083-19/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than let the service call itself work out which function is the proper one to call, we can make that a behavior of the arbiter itself, so we don't need to directly expose those implementation details.
* | | | | | | | | | | | | Merge pull request #2222 from lioncash/cstrbunnei2019-03-121-4/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | | service/service: Remove unncessary calls to c_str()
| * | | | | | | | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| | |_|_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These can just be passed regularly, now that we use fmt instead of our old logging system. While we're at it, make the parameters to MakeFunctionString std::string_views.
* | | | | | | | | | | | Merge pull request #2215 from ReinUsesLisp/samplersbunnei2019-03-123-64/+72
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | gl_rasterizer: Encapsulate sampler queries into methods
| * | | | | | | | | | | gl_rasterizer: Encapsulate sampler queries into methodsReinUsesLisp2019-03-093-64/+72
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service/audio/hwopus: Move decoder state to its own class
| * | | | | | | | | | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the non-multistream specific state to its own class. This will be necessary to support the multistream variants of opus decoding.
| * | | | | | | | | | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This indicates the entropy coder's final range.
| * | | | | | | | | | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be utilized by more than just that class in the future. This also renames it from OpusHeader to OpusPacketHeader to be more specific about what kind of header it is.
| * | | | | | | | | | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it impossible to violate the ODR, as well as providing a place for future changes.
* | | | | | | | | | | | | Merge pull request #2193 from lioncash/globalbunnei2019-03-105-17/+23
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/scheduler: Pass in system instance in constructor
| * | | | | | | | | | | | | kernel/scheduler: Pass in system instance in constructorLioncash2019-03-045-17/+23
| | |_|_|_|_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids directly relying on the global system instance and instead makes an arbitrary system instance an explicit dependency on construction. This also allows removing dependencies on some global accessor functions as well.
* | | | | | | | | | | | | Merge pull request #2147 from ReinUsesLisp/texture-cleanbunnei2019-03-109-527/+590
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | shader_ir: Remove "extras" from the MetaTexture
| * | | | | | | | | | | | | shader/decode: Remove extras from MetaTextureReinUsesLisp2019-02-264-40/+65
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | shader/decode: Split memory and texture instructions decodingReinUsesLisp2019-02-268-501/+539
| | | | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2143 from ReinUsesLisp/texviewbunnei2019-03-103-32/+42
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Create texture views for array discrepancies
| * | | | | | | | | | | | | | gl_rasterizer_cache: Create texture views for array discrepanciesReinUsesLisp2019-02-273-32/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a texture is sampled in a shader with a different array mode than the cached state, create a texture view and bind that to the shader instead.
* | | | | | | | | | | | | | | Merge pull request #2220 from lioncash/cubebbunnei2019-03-102-4/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | | | | | audio_core/cubeb_sink: Convert _MSC_VER ifdefs to _WIN32
| * | | | | | | | | | | | | | audio_core/cubeb_sink: Convert _MSC_VER ifdefs to _WIN32Lioncash2019-03-102-4/+4
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This behavior also needs to be visible for MinGW builds as well.
* | | | | | | | | | | | | | Merge pull request #2217 from ReinUsesLisp/rasterizer-loggerMat M2019-03-101-19/+13
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Minor logger changes
| * | | | | | | | | | | | | | gl_rasterizer: Minor logger changesReinUsesLisp2019-03-091-19/+13
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2219 from Hexagon12/log-settingsMat M2019-03-101-0/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | core/settings: Log more setting values
| * | | | | | | | | | | | | | clang fixHexagon122019-03-091-1/+2
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | Log 2 new setting valuesHexagon122019-03-091-0/+2
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2218 from ReinUsesLisp/cmd-castMat M2019-03-101-5/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | | yuzu_cmd/config: Silent implicit cast warning
| * | | | | | | | | | | | | yuzu_cmd/config: Replace C casts with static_castReinUsesLisp2019-03-091-4/+5
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | yuzu_cmd/config: Silent implicit cast warningReinUsesLisp2019-03-091-1/+1
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #2210 from lioncash/optionalbunnei2019-03-087-58/+56
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optional
| * | | | | | | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optionalLioncash2019-03-084-47/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real need to use a shared lifetime here, since we don't actually expose them to anything else. This is also kind of an unnecessary use of the heap given the objects themselves are so small; small enough, in fact that changing over to optionals actually reduces the overall size of the HLERequestContext struct (818 bytes to 808 bytes).
| * | | | | | | | | | | | | travis: Bump macOS version to 10.14Lioncash2019-03-082-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | For whatever bizarre reason, Apple only made a few of std::optional's member functions available on newer SDK versions. Given we can't even run yuzu on macOS, and we keep the builder around to ensure that it always at least compiles on macOS, we can bump this up a version.
| * | | | | | | | | | | | | common/bit_field: Make BitField trivially copyableLioncash2019-03-071-9/+7
| | |_|_|_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes the class much more flexible and doesn't make performing copies with classes that contain a bitfield member a pain. Given BitField instances are only intended to be used within unions, the fact the full storage value would be copied isn't a big concern (only sizeof(union_type) would be copied anyways). While we're at it, provide defaulted move constructors for consistency.
* | | | | | | | | | | | | Merge pull request #2209 from lioncash/reorderbunnei2019-03-081-5/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core/gpu_thread: Silence a -Wreorder warning
| * | | | | | | | | | | | | video_core/gpu_thread: Remove unimplemented WaitForIdle function prototypeLioncash2019-03-071-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function didn't have a definition, so we can remove it to prevent accidentally attempting to use it.
| * | | | | | | | | | | | | video_core/gpu_thread: Amend constructor initializer list orderLioncash2019-03-071-2/+2
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the data members to satisfy the order they're declared as in the constructor initializer list. Silences a -Wreorder warning.
* | | | | | | | | | | | | Merge pull request #2208 from lioncash/gpubunnei2019-03-083-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | video_core/gpu: Make GPU's destructor virtual
| * | | | | | | | | | | | | video_core/gpu: Make GPU's destructor virtualLioncash2019-03-073-3/+3
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Because of the recent separation of GPU functionality into sync/async variants, we need to mark the destructor virtual to provide proper destruction behavior, given we use the base class within the System class. Prior to this, it was undefined behavior whether or not the destructor in the derived classes would ever execute.
* | | | | | | | | | | | | Merge pull request #2191 from ReinUsesLisp/maxwell-to-vkbunnei2019-03-084-3/+553
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | maxwell_to_vk: Initial implementation
| * | | | | | | | | | | | | maxwell_to_vk: Initial implementationReinUsesLisp2019-03-044-3/+553
| | | | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2212 from ReinUsesLisp/dma-push-fixbunnei2019-03-081-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | dma_pusher: Store command_list_header by copy
| * | | | | | | | | | | | | | dma_pusher: Store command_list_header by copyReinUsesLisp2019-03-081-1/+1
|/ / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of holding a reference that will get invalidated by dma_pushbuffer.pop(), hold it as a copy. This doesn't have any performance cost since CommandListHeader is 8 bytes long.
* | | | | | | | | | | | | | Merge pull request #2195 from lioncash/shared-globalbunnei2019-03-071-3/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()
| * | | | | | | | | | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()Lioncash2019-03-041-3/+2
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we already pass in a reference to the kernel that the shared memory instance is created under, we can just use that to check the current process, rather than using the global accessor functions. This allows removing direct dependency on the system instance entirely.
* | | | | | | | | | | | | Merge pull request #2196 from DarkLordZach/web-applet-escbunnei2019-03-072-0/+7
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | web_browser: Add shortcut to Enter key to exit applet
| * | | | | | | | | | | | | web_browser: Add shortcut to Enter key to exit appletZach Hilman2019-03-052-0/+7
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | Addresses issues where a user in fullscreen could not exit some web applets without leaving fullscreen.
* | | | | | | | | | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-076-36/+78
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/client_session, kernel/server_session: Make data members private
| * | | | | | | | | | | | | kernel/server_session: Make data members privateLioncash2019-03-065-32/+73
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it much nicer to locally reason about server session behavior, as part of its functionality isn't placed around other classes.
| * | | | | | | | | | | | | kernel/client_session: Make data members privateLioncash2019-03-061-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These can be made private, as they aren't accessed in contexts that require them to be public.
* | | | | | | | | | | | | | Merge pull request #2205 from FearlessTobi/docked-undocked-hotkeybunnei2019-03-071-0/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu: add a hotkey to switch between undocked and docked mode
| * | | | | | | | | | | | | | yuzu: add a hotkey to switch between undocked and docked modefearlessTobi2019-03-061-0/+8
| | | | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playing
| * | | | | | | | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The service itself only does further actions if the stream is playing. If the stream is already stopped, then it just exits successfully.
* | | | | | | | | | | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-0726-52/+529
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Asynchronous GPU command processing
| * | | | | | | | | | | | | | gpu_thread: Fix deadlock with threading idle state check.bunnei2019-03-072-7/+11
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gpu_thread: (HACK) Ignore flush on FlushAndInvalidateRegion.bunnei2019-03-071-3/+1
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gpu: Always flush.bunnei2019-03-072-13/+6
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gpu: Refactor a/synchronous implementations into their own classes.bunnei2019-03-078-65/+162
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gpu: Move command processing to another thread.bunnei2019-03-079-15/+358
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | bootmanager: Ensure that we have a context for shader loading.bunnei2019-03-071-4/+6
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-075-17/+26
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gpu: Refactor to take RendererBase instead of RasterizerInterface.bunnei2019-03-073-18/+23
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | settings: Add new graphics setting for use_asynchronous_gpu_emulation.bunnei2019-03-077-0/+24
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | core: Set is_powered_on before GPU is initialized.bunnei2019-03-071-1/+3
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #2149 from ReinUsesLisp/decoders-stylebunnei2019-03-078-150/+183
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Move format conversion functions to their own file
| * | | | | | | | | | | | | | gl_rasterizer_cache: Move format conversion to its own fileReinUsesLisp2019-02-277-136/+175
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | decoders: Minor style changesReinUsesLisp2019-02-272-14/+8
| | |_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-076-8/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | core/hle/ipc: Remove unnecessary includes
| * | | | | | | | | | | | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-056-8/+12
| | |_|_|/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes a few inclusion dependencies from the headers or replaces existing ones with ones that don't indirectly include the required headers. This allows removing an inclusion of core/memory.h, meaning that if the memory header is ever changed in the future, it won't result in rebuilding the entirety of the HLE services (as the IPC headers are used quite ubiquitously throughout the HLE service implementations).
* | | | | | | | | | | | | | Merge pull request #2190 from lioncash/ogl-globalbunnei2019-03-077-26/+28
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / / |/| | | | | | | | | | | | | core: Remove the global telemetry accessor function
| * | | | | | | | | | | | | core/core: Remove the global telemetry accessor functionLioncash2019-03-041-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all usages converted off of it, this function can be removed.
| * | | | | | | | | | | | | yuzu: Remove usage of the global telemetry accessorLioncash2019-03-042-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In these cases the system object is nearby, and in the other, the long-form of accessing the telemetry instance is already used, so we can get rid of the use of the global accessor.
| * | | | | | | | | | | | | yuzu-cmd/yuzu: Replace direct usage of the global system telemetry accessor in main()Lioncash2019-03-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have the system instance around, so we can use that instead of the accessor.
| * | | | | | | | | | | | | core/core: Replace direct usage of the global system telemetry accessor from Shutdown()Lioncash2019-03-041-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The telemetry instance is actually a member of the class itself, so we can access it directly instead of going through the global accessor.
| * | | | | | | | | | | | | video_core/renderer_opengl: Replace direct usage of global system object accessorsLioncash2019-03-042-11/+17
| | |_|_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already pass a reference to the system object to the constructor of the renderer, so we can just use that instead of using the global accessor functions.
* | | | | | | | | | | | | Merge pull request #2199 from lioncash/arbiterbunnei2019-03-067-115/+187
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/address_arbiter: Convert the address arbiter into a class
| * | | | | | | | | | | | | kernel/address_arbiter: Pass in system instance to constructorLioncash2019-03-056-26/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows getting rid of reliance on the global accessor functions and instead operating on the provided system instance.
| * | | | | | | | | | | | | kernel/address_arbiter: Minor tidying upLioncash2019-03-051-18/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Invert conditions into guard clases where applicable. - Mark std::vector parameter of WakeThreads as const
| * | | | | | | | | | | | | kernel/address_arbiter: Convert the address arbiter into a classLioncash2019-03-055-82/+135
| | |/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Places all of the functions for address arbiter operation into a class. This will be necessary for future deglobalizing efforts related to both the memory and system itself.
* | | | | | | | | | | | | Merge pull request #2201 from lioncash/audio-retvalbunnei2019-03-061-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()
| * | | | | | | | | | | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were overwriting the error case with a success code further down (which is definitely not what we should be doing here).
* | | | | | | | | | | | | Merge pull request #2204 from lioncash/wait-treebunnei2019-03-062-5/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | yuzu/debugger/wait_tree: Remove use of global CurrentProcess accessor
| * | | | | | | | | | | | yuzu/debugger/wait_tree: Remove use of global CurrentProcess accessorLioncash2019-03-062-5/+6
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have the thread instance that was created under the current process, so we can just pass the handle table of it along to retrieve the owner of the mutex.
* | | | | | | | | | | | Merge pull request #2194 from lioncash/membunnei2019-03-063-30/+66
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | svc: Move memory range checking functions to the VMManager class
| * | | | | | | | | | | | vm_manager: Use range helpers in HeapAlloc() and HeapFree()Lioncash2019-03-041-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Significantly tidies up two guard conditionals.
| * | | | | | | | | | | | vm_manager: Provide address range checking functions for other memory regionsLioncash2019-03-042-4/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface uniform when it comes to checking various memory regions.
| * | | | | | | | | | | | svc: Migrate address range checking functions to VMManagerLioncash2019-03-043-23/+30
| | |_|_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a bit of a more proper interface for these functions.
* | | | | | | | | | | | Merge pull request #2200 from lioncash/audiobunnei2019-03-064-10/+21
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | hle/service/audio: Extract audio error codes to a header
| * | | | | | | | | | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-054-10/+21
| | |/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Places all error codes in an easily includable header. This also corrects the unsupported error code (I accidentally used the hex value when I meant to use the decimal one).
* | | | | | | | | | | | Merge pull request #2203 from lioncash/engines-includebunnei2019-03-0610-11/+11
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | video_core/engines: Remove unnecessary includes
| * | | | | | | | | | | | video_core/engines: Remove unnecessary includesLioncash2019-03-0610-11/+11
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes a few unnecessary dependencies on core-related machinery, such as the core.h and memory.h, which reduces the amount of rebuilding necessary if those files change. This also uncovered some indirect dependencies within other source files. This also fixes those.
* | | | | | | | | | | | Merge pull request #2198 from lioncash/todobunnei2019-03-062-4/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | {kernel/thread, video_core/surface}: Remove obsolete TODOs
| * | | | | | | | | | | video_core/surface: Remove obsolete TODO in PixelFormatFromRenderTargetFormat()Lioncash2019-03-051-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't needed anymore, according to Hexagon
| * | | | | | | | | | | kernel/thread: Remove obsolete TODO in Create()Lioncash2019-03-051-2/+0
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a TODO carried over from Citra that doesn't apply here.
* | | | | | | | | | | Merge pull request #2185 from FearlessTobi/port-4630bunnei2019-03-051-6/+0
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | Port citra-emu/citra#4630: "Memory: don't lock hle mutex in memory read/write"
| * | | | | | | | | | Memory: don't lock hle mutex in memory read/writeWeiyi Wang2019-03-021-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The comment already invalidates itself: neither MMIO nor rasterizer cache belongsHLE kernel state. This mutex has a too large scope if MMIO or cache is included, which is prone to dead lock when multiple thread acquires these resource at the same time. If necessary, each MMIO component or rasterizer should have their own lock.
* | | | | | | | | | | Merge pull request #2165 from ReinUsesLisp/unbind-texbunnei2019-03-042-14/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Unbind textures but don't apply the gl_state
| * | | | | | | | | | | gl_rasterizer: Remove texture unbinding after dispatching a draw callReinUsesLisp2019-02-281-12/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Unbinding was required when OpenGL delete operations didn't unbind a resource if it was bound. This is no longer needed and can be removed.
| * | | | | | | | | | | gl_state: Fixup multibind bugReinUsesLisp2019-02-281-2/+2
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2188 from lioncash/log-staticbunnei2019-03-042-29/+25
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | logging/backend: Move CreateEntry into the Impl class. Relocate local static to a class variable
| * | | | | | | | | | | | logging/backend: Make time_origin a class variable instead of a local staticLioncash2019-03-021-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves local global state into the Impl class itself and initializes it at the creation of the instance instead of in the function. This makes it nicer for weakly-ordered architectures, given the CreateEntry() class won't need to have atomic loads executed for each individual call to the CreateEntry class.
| * | | | | | | | | | | | logging/backend: Move CreateEntry into the Impl classLioncash2019-03-022-29/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is only ever used within this source file and makes it easier to remove static state in the following change.
* | | | | | | | | | | | | Merge pull request #2189 from lioncash/webbunnei2019-03-042-3/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / / |/| | | | | | | | | | | | web_service: Remove unnecessary inclusions
| * | | | | | | | | | | | web_service: Remove unnecessary inclusionsLioncash2019-03-022-3/+0
| | |_|_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reduces the potential amount of rebuilding necessary if any headers change. In particular, we were including a header from the core library when we don't even link the core library to the web_service library, so this also gets rid of an indirect dependency.
* | | | | | | | | | | | Merge pull request #2154 from FearlessTobi/port-4647Mat M2019-03-021-1/+4
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | | Port citra-emu/citra#4647: "citra_qt/main: make SPEED_LIMIT_STEP static constexpr"
| * | | | | | | | | | | citra_qt/main: make SPEED_LIMIT_STEP static constexprfearlessTobi2019-03-021-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MSVC does not seem to like using constexpr values in a lambda that were declared outside of it. Previously on MSVC build the hotkeys to inc-/decrease the speed limit were not working correctly because in the lambda the SPEED_LIMIT_STEP had garbage values. After googling around a bit I found: https://github.com/codeplaysoftware/computecpp-sdk/issues/95 which seems to be a similar issue. Trying the suggested fix to make the variable static constexpr also fixes the bug here.
* | | | | | | | | | | | Merge pull request #2183 from ReinUsesLisp/vk-buffer-cache-clangMat M2019-03-021-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | | vk_buffer_cache: Fix clang-format
| * | | | | | | | | | | vk_buffer_cache: Fix clang-formatReinUsesLisp2019-03-021-3/+3
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2186 from honzapatCZ/patch-1James Rowe2019-03-021-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | | Yuzu can render 3D.
| * | | | | | | | | | | Yuzu can render 3D.Nejcraft2019-03-021-1/+1
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | Yuzu can now render 3D graphics to some degree.
* | | | | | | | | | | Merge pull request #2182 from bunnei/my-wasted-fridaybunnei2019-03-021-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | fuck git for ruining my day, I will learn but I will not forgive
| * | | | | | | | | | fuck git for ruining my day, I will learn but I will not forgivebunnei2019-03-021-1/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #2178 from ReinUsesLisp/vk-buffer-cachebunnei2019-03-023-0/+205
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | vk_buffer_cache: Implement a buffer cache
| * | | | | | | | | | vk_buffer_cache: Implement a buffer cacheReinUsesLisp2019-03-013-0/+205
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This buffer cache is just like OpenGL's buffer cache with some minor style changes. It uses VKStreamBuffer.
* | | | | | | | | | Merge pull request #2173 from lioncash/capturebunnei2019-03-011-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu/compatdb: Remove unused lambda capture
| * | | | | | | | | | yuzu/compatdb: Remove unused lambda captureLioncash2019-02-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences a compiler warning with clang.
* | | | | | | | | | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service/audio: Provide an implementation of ExecuteAudioRendererRendering
| * | | | | | | | | | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function appears to do nothing noteworthy on the switch. All it does at the moment is either return an error code or abort the system. Given we obviously don't want to kill the system, we just opt for always returning the error code.
* | | | | | | | | | | Merge pull request #2181 from lioncash/audren2bunnei2019-03-012-7/+20
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | service/audio/audren_u: Implement OpenAudioRendererAuto
| * | | | | | | | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This currently has the same behavior as the regular OpenAudioRenderer API function, so we can just move the code within OpenAudioRenderer to an internal function that both service functions call.
* | | | | | | | | | Merge pull request #2174 from lioncash/fwdbunnei2019-02-281-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service/hid: Amend forward declaration of ServiceManager
| * | | | | | | | | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The SM namespace is within the Service namespace, so this was forward declaring a type that didn't exist.
* | | | | | | | | | Merge pull request #2152 from ReinUsesLisp/vk-stream-bufferbunnei2019-02-285-8/+172
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vk_stream_buffer: Implement a stream buffer
| * | | | | | | | | | vk_stream_buffer: Remove copy code pathReinUsesLisp2019-02-262-53/+18
| | | | | | | | | | |
| * | | | | | | | | | vk_stream_buffer: Implement a stream bufferReinUsesLisp2019-02-243-1/+200
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This manages two kinds of streaming buffers: one for unified memory models and one for dedicated GPUs. The first one skips the copy from the staging buffer to the real buffer, since it creates an unified buffer. This implementation waits for all fences to finish their operation before "invalidating". This is suboptimal since it should allocate another buffer or start searching from the beginning. There is room for improvement here. This could also handle AMD's "pinned" memory (a heap with 256 MiB) that seems to be designed for buffer streaming.
| * | | | | | | | | | vk_resource_manager: Minor VKFenceWatch changesReinUsesLisp2019-02-242-7/+7
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #2121 from FernandoS27/texception2bunnei2019-02-284-16/+213
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Improve the Accuracy of the Rasterizer Cache through a Texception Pass
| * | | | | | | | | | | Devirtualize Register/Unregister and use a wrapper instead.Fernando Sahmkow2019-02-283-12/+8
| | | | | | | | | | | |
| * | | | | | | | | | | Corrections and redesign.Fernando Sahmkow2019-02-282-51/+51
| | | | | | | | | | | |
| * | | | | | | | | | | Fix linux compile error.Fernando Sahmkow2019-02-281-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | Remove NotifyFrameBuffer as we are doing a texception pass every drawcall.Fernando Sahmkow2019-02-282-25/+0
| | | | | | | | | | | |
| * | | | | | | | | | | Remove certain optimizations that caused texception to fail in certain scenarios.Fernando Sahmkow2019-02-283-24/+1
| | | | | | | | | | | |
| * | | | | | | | | | | Bug fixes and formattingFernando Sahmkow2019-02-282-3/+4
| | | | | | | | | | | |
| * | | | | | | | | | | rasterizer_cache_gl: Implement Texception PassFernando Sahmkow2019-02-283-0/+51
| | | | | | | | | | | |
| * | | | | | | | | | | rasterizer_cache_gl: Implement Partial Reinterpretation of Surfaces.Fernando Sahmkow2019-02-282-0/+100
| | | | | | | | | | | |
| * | | | | | | | | | | rasterizer_cache: mark reinterpreted surfaces and add ability to reload marked surfaces on next use.Fernando Sahmkow2019-02-282-0/+78
| | | | | | | | | | | |
| * | | | | | | | | | | rasterizer_cache_gl: Notify on framebuffer changeFernando Sahmkow2019-02-282-4/+23
| | | | | | | | | | | |
| * | | | | | | | | | | rasterizer_cache: Expose FlushObject to Child classes and allow redefining of Register and UnregisterFernando Sahmkow2019-02-281-11/+11
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2172 from lioncash/reorderbunnei2019-02-282-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | gl_rasterizer/vk_memory_manager: Silence -Wreorder warnings
| * | | | | | | | | | | vk_memory_manager: Reorder constructor initializer list in terms of member declaration orderLioncash2019-02-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reorders members in the order that they would actually be initialized in. Silences a -Wreorder warning.
| * | | | | | | | | | | gl_rasterizer: Reorder constructor initializer list in terms of member declaration orderLioncash2019-02-271-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the members in the order they would actually be initialized in. Silences a -Wreorder warning.
* | | | | | | | | | | | Merge pull request #2163 from ReinUsesLisp/bitset-dirtybunnei2019-02-284-52/+51
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | maxwell_3d: Use std::bitset to manage dirty flags
| * | | | | | | | | | | | maxwell_3d: Use std::bitset to manage dirty flagsReinUsesLisp2019-02-264-52/+51
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Speed up memory page mapping (#2141)Annomatg2019-02-271-6/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Memory::MapPages total samplecount was reduced from 4.6% to 1.06%. - From main menu into the game from 1.03% to 0.35%
* | | | | | | | | | | | Merge pull request #2176 from lioncash/combunnei2019-02-272-0/+19
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | | audio_core/cubeb_sink: Ensure COM is initialized on Windows prior to calling cubeb_init
| * | | | | | | | | | | audio_core/cubeb_sink: Ensure COM is initialized on Windows prior to calling cubeb_initLioncash2019-02-272-0/+19
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | cubeb now requires that COM explicitly be initialized on the thread prior to calling cubeb_init.
* | | | | | | | | | | Merge pull request #2169 from lioncash/namingbunnei2019-02-272-19/+21
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | audio_core/audio_renderer: Provide names for some parameters of AudioRendererParameter
| * | | | | | | | | | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-272-19/+21
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides names for previously unknown entries (aside from the two u8 that appear to be padding bytes, and a single word that also appears to be reserved or padding). This will be useful in subsequent changes when unstubbing behavior related to the audio renderer services.
* | | | | | | | | | | Merge pull request #2170 from lioncash/emu-windowbunnei2019-02-272-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | core/frontend/emu_window: Make ClipToTouchScreen a const member function
| * | | | | | | | | | core/frontend/emu_window: Make ClipToTouchScreen a const member functionLioncash2019-02-272-2/+2
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This member function doesn't modify instance state, so it can have the const specifier applied to it.
* | | | | | | | | | Merge pull request #2161 from lioncash/handle-tablebunnei2019-02-276-19/+63
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/handle_table: Allow process capabilities to limit the handle table size
| * | | | | | | | | | kernel/handle_table: Make local variables as const where applicableLioncash2019-02-251-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes immutable state explicit.
| * | | | | | | | | | kernel/handle_table: Allow process capabilities to limit the handle table sizeLioncash2019-02-256-10/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel allows restricting the total size of the handle table through the process capability descriptors. Until now, this functionality wasn't hooked up. With this, the process handle tables become properly restricted. In the case of metadata-less executables, the handle table will assume the maximum size is requested, preserving the behavior that existed before these changes.
| * | | | | | | | | | kernel/handle-table: In-class initialize data membersLioncash2019-02-252-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Directly initializes members where applicable.
| * | | | | | | | | | kernel/handle_table: Resolve truncation warningsLioncash2019-02-251-2/+2
| | |_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids implicit truncation warnings from u32 -> u16 (the truncation is desirable behavior here).
* | | | | | | | | | Merge pull request #2168 from lioncash/cubebbunnei2019-02-271-0/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | externals: Update cubeb to the master version
| * | | | | | | | | | externals: Update cubeb to 6f2420de8f155b10330cf973900ac7bdbfee589dLioncash2019-02-271-0/+0
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the audio library we use up to date.
* | | | | | | | | | Merge pull request #2167 from lioncash/namespacebunnei2019-02-2723-81/+81
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | common: Move Quaternion, Rectangle, Vec2, Vec3, and Vec4 into the Common namespace
| * | | | | | | | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-2718-40/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These types are within the common library, so they should be within the Common namespace.
| * | | | | | | | | | common/vector_math: Move Vec[x] types into the Common namespaceLioncash2019-02-276-38/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These types are within the common library, so they should be using the Common namespace.
| * | | | | | | | | | common/quaternion: Move Quaternion into the Common namespaceLioncash2019-02-272-6/+6
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Quaternion is within the common library, so it should be using the Common namespace.
* | | | | | | | | | Merge pull request #2171 from lioncash/pragmabunnei2019-02-271-2/+0
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | gl_shader_disk_cache: Remove #pragma once from cpp file
| * | | | | | | | | gl_shader_disk_cache: Remove #pragma once from cpp fileLioncash2019-02-271-2/+0
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only necessary in headers. Silences a warning with clang.
* | | | | | | | | Merge pull request #2164 from ReinUsesLisp/configure-blitbunnei2019-02-261-0/+1
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | renderer_opengl: Update pixel format tracking
| * | | | | | | | renderer_opengl: Update pixel format trackingReinUsesLisp2019-02-261-0/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #2156 from FreddyFunk/patch-1bunnei2019-02-261-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys/vfs_vector: Fix ignored offset on Write
| * | | | | | | | file_sys/vfs_vector: Fix ignored offset on WriteFrederic L2019-02-251-1/+1
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2158 from lioncash/tablebunnei2019-02-261-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/vi: Update IManagerDisplayService's function table
| * | | | | | | | service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Amends it to add the 7.0.0+ CreateStrayLayer function.
* | | | | | | | Merge pull request #2160 from lioncash/audio-warnbunnei2019-02-262-6/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audio_core: Resolve compilation warnings
| * | | | | | | | audio_core/cubeb_sink: Initialize CubebSinkStream's last_frame data memberLioncash2019-02-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that all member variables are initialized in a deterministic manner across the board.
| * | | | | | | | audio_core/cubeb_sink: Add override specifier to destructorLioncash2019-02-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CubebSinkStream inherits from a base class with a virtual destructor, so override can be appended to CubebSinkStream's destructor.
| * | | | | | | | audio_core/cubeb_sink: Resolve variable shadowing warnings in SamplesInQueueLioncash2019-02-251-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The name of the parameter was shadowing the member variable of the same name. Instead, alter the name of the parameter to prevent said shadowing.
| * | | | | | | | audio_core/codec: Resolve truncation warnings within DecodeADPCMLioncash2019-02-251-2/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The assignments here were performing an implicit truncation from int to s16. Make it explicit that this is desired behavior.
* | | | | | | | Merge pull request #2159 from lioncash/warnbunnei2019-02-251-5/+5
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | shader/track: Resolve variable shadowing warnings
| * | | | | | | shader/track: Resolve variable shadowing warningsLioncash2019-02-251-5/+5
|/ / / / / / /
* | | | | | | Merge pull request #2118 from FernandoS27/ipa-improvebunnei2019-02-256-38/+74
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader_decompiler: Improve Accuracy of Attribute Interpolation.
| * | | | | | | shader_decompiler: Improve Accuracy of Attribute Interpolation.Fernando Sahmkow2019-02-146-38/+74
| | | | | | | |
* | | | | | | | Merge pull request #2119 from FernandoS27/fix-copybunnei2019-02-251-1/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | rasterizer_cache_gl: Only do fast layered copy on the same format.
| * | | | | | | | rasterizer_cache_gl: Only do fast layered copy on the same format. AsFernando Sahmkow2019-02-131-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | glCopyImageSubData does not support different formats.
* | | | | | | | | Merge pull request #2155 from FearlessTobi/port-4655bunnei2019-02-251-3/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4655: "Remove GCC version checks"
| * | | | | | | | | Remove GCC version checkstgsm2019-02-241-3/+3
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Citra can't be compiled using GCC <7 because of required C++17 support, so these version checks don't need to exist anymore.
* | | | | | | | | Merge pull request #2144 from lioncash/factorbunnei2019-02-257-67/+209
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | service/vi: Convert Display and Layer structs into classes
| * | | | | | | | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The NVFlinger service is already passed into services that need to guarantee its lifetime, so the BufferQueue instances will already live as long as they're needed. Making them std::shared_ptr instances in this case is unnecessary.
| * | | | | | | | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the previous changes made to the Display struct, this prepares the Layer struct for changes to its interface. Given Layer will be given more invariants in the future, we convert it into a class to better signify that.
| * | | | | | | | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With the display and layer structures relocated to the vi service, we can begin giving these a proper interface before beginning to properly support the display types. This converts the display struct into a class and provides it with the necessary functions to preserve behavior within the NVFlinger class.
* | | | | | | | | Merge pull request #2139 from degasus/dma_pusherbunnei2019-02-242-28/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | video_core/dma_pusher: The full list of headers at once.
| * | | | | | | | video_core/dma_pusher: Simplyfy Step() logic.Markus Wick2019-02-192-81/+77
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As fetching command list headers and and the list of command headers is a fixed 1:1 relation now, they can be implemented within a single call. This cleans up the Step() logic quite a bit.
| * | | | | | | | video_core/dma_pusher: The full list of headers at once.Markus Wick2019-02-192-48/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fetching every u32 from memory leads to a big overhead. So let's fetch all of them as a block if possible. This reduces the Memory::* calls by the dma_pusher by a factor of 10.
* | | | | | | | | Merge pull request #2146 from ReinUsesLisp/vulkan-schedulerbunnei2019-02-243-1/+132
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vk_scheduler: Implement a scheduler
| * | | | | | | | | vk_scheduler: Implement a schedulerReinUsesLisp2019-02-223-1/+132
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The scheduler abstracts command buffer and fence management with an interface that's able to do OpenGL-like operations on Vulkan command buffers. It returns by value a command buffer and fence that have to be used for subsequent operations until Flush or Finish is executed, after that the current execution context (the pair of command buffers and fences) gets invalidated a new one must be fetched. Thankfully validation layers will quickly detect if this is skipped throwing an error due to modifications to a sent command buffer.
* | | | | | | | | | Merge pull request #2150 from ReinUsesLisp/fixup-layer-swizzlebunnei2019-02-241-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Fixup parameter order in layered swizzle
| * | | | | | | | | | gl_rasterizer_cache: Fixup parameter order in layered swizzleReinUsesLisp2019-02-241-1/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2151 from ReinUsesLisp/fixup-vk-memory-managerbunnei2019-02-241-2/+1
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | vk_memory_manager: Fixup commit interval allocation
| * | | | | | | | | vk_memory_manager: Fixup commit interval allocationReinUsesLisp2019-02-241-2/+1
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | VKMemoryCommitImpl was using as the end of its interval "begin + end". That ended up wasting memory.
* | | | | | | | | Merge pull request #2138 from ReinUsesLisp/vulkan-memory-managerbunnei2019-02-224-0/+342
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | vk_memory_manager: Implement memory manager
| * | | | | | | | vk_memory_manager: Implement memory managerReinUsesLisp2019-02-194-0/+342
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A memory manager object handles the memory allocations for a device. It allocates chunks of Vulkan memory objects and then suballocates.
* | | | | | | | Merge pull request #2125 from ReinUsesLisp/fixup-glstatebunnei2019-02-211-83/+61
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_state: Synchronize gl_state even when state is disabled
| * | | | | | | | gl_state: Synchronize gl_state even when state is disabledReinUsesLisp2019-02-151-83/+61
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There are some potential edge cases where gl_state may fail to track the state if a related state changes while the toggle is disabled or it didn't change. This addresses that.
* | | | | | | | | Merge pull request #2130 from lioncash/system_enginebunnei2019-02-219-23/+49
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core: Remove usages of System::GetInstance() within the engines
| * | | | | | | | | video_core: Remove usages of System::GetInstance() within the enginesLioncash2019-02-169-23/+49
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the use of the global accessor in favor of explicitly making the system a dependency within the interface.
* | | | | | | | | Fixes Unicode Key File Directories (#2120)Jungy2019-02-211-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixes Unicode Key File Directories Adds code so that when loading a file it converts to UTF16 first, to ensure the files can be opened. Code borrowed from FileUtil::Exists. * Update src/core/crypto/key_manager.cpp Co-Authored-By: Jungorend <Jungorend@users.noreply.github.com> * Update src/core/crypto/key_manager.cpp Co-Authored-By: Jungorend <Jungorend@users.noreply.github.com> * Using FileUtil instead to be cleaner. * Update src/core/crypto/key_manager.cpp Co-Authored-By: Jungorend <Jungorend@users.noreply.github.com>
* | | | | | | | | Merge pull request #2142 from lioncash/relocatebunnei2019-02-217-57/+123
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | service/nvflinger: Relocate definitions of Layer and Display to the vi service
| * | | | | | | | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-207-57/+123
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are more closely related to the vi service as opposed to the intermediary nvflinger. This also places them in their relevant subfolder, as future changes to these will likely result in subclassing to represent various displays and services, as they're done within the service itself on hardware. The reasoning for prefixing the display and layer source files is to avoid potential clashing if two files with the same name are compiled (e.g. if 'display.cpp/.h' or 'layer.cpp/.h' is added to another service at any point), which MSVC will actually warn against. This prevents that case from occurring. This also presently coverts the std::array introduced within f45c25aabacc70861723a7ca1096a677bd987487 back to a std::vector to allow the forward declaration of the Display type. Forward declaring a type within a std::vector is allowed since the introduction of N4510 (http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2015/n4510.html) by Zhihao Yuan.
* | | | | | | | Merge pull request #2122 from ReinUsesLisp/vulkan-resource-managerbunnei2019-02-193-1/+468
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vk_resource_manager: Implement fence and command buffer allocator
| * | | | | | | | vk_resource_manager: Implement a command buffer pool with VKFencedPoolReinUsesLisp2019-02-142-1/+59
| | | | | | | | |
| * | | | | | | | vk_resource_manager: Add VKFencedPool interfaceReinUsesLisp2019-02-142-0/+83
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Handles a pool of resources protected by fences. Manages resource overflow allocating more resources. This class is intended to be used through inheritance.
| * | | | | | | | vk_resource_manager: Implement VKResourceManager and fence allocatorReinUsesLisp2019-02-142-0/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CommitFence iterates a pool of fences until one is found. If all fences are being used at the same time, allocate more.
| * | | | | | | | vk_resource_manager: Implement VKFenceWatchReinUsesLisp2019-02-142-0/+68
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A fence watch is used to keep track of the usage of a fence and protect a resource or set of resources without having to inherit from their handlers.
| * | | | | | | | vk_resource_manager: Implement VKFenceReinUsesLisp2019-02-142-0/+131
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fences take ownership of objects, protecting them from GPU-side or driver-side concurrent access. They must be commited from the resource manager. Their usage flow is: commit the fence from the resource manager, protect resources with it and use them, send the fence to an execution queue and Wait for it if needed and then call Release. Used resources will automatically be signaled when they are free to be reused.
| * | | | | | | | vk_resource_manager: Add VKResource interfaceReinUsesLisp2019-02-143-1/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | VKResource is an interface that gets signaled by a fence when it is free to be reused.
* | | | | | | | | Merge pull request #2134 from lioncash/namingbunnei2019-02-172-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | audio_core/buffer: Make const and non-const getter for samples consistent
| * | | | | | | | | audio_core/buffer: Make const and non-const getter for samples consistentLioncash2019-02-162-2/+2
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | This way proper const/non-const selection can occur.
* | | | | | | | | Merge pull request #2133 from lioncash/arbiterbunnei2019-02-162-8/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | address_arbiter: Use nested namespaces where applicable
| * | | | | | | | | address_arbiter: Use nested namespaces where applicableLioncash2019-02-162-8/+4
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A fairly trivial change. Other sections of the codebase use nested namespaces instead of separate namespaces here. This one must have just been overlooked.
* | | | | | | | | Merge pull request #2127 from FearlessTobi/fix-screenshot-srgbbunnei2019-02-161-1/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | renderer_opengl: respect the sRGB colorspace for the screenshot feature
| * | | | | | | | | renderer_opengl: respect the sRGB colorspace for the screenshot featurefearlessTobi2019-02-151-1/+2
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we were completely ignoring for screenshots whether the game uses RGB or sRGB. This resulted in screenshot colors that looked off for some titles.
* | | | | | | | | Merge pull request #2128 from FearlessTobi/port-4197bunnei2019-02-163-12/+26
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | Port citra-emu/citra#4197: "threadsafe_queue: Add PopWait and use it where possible "
| * | | | | | | | Adressed review commentsB3n302019-02-152-7/+9
| | | | | | | | |
| * | | | | | | | threadsafe_queue: Add WaitIfEmpty and use it in loggingB3n302019-02-153-14/+26
| |/ / / / / / /
* | | | | | | | Merge pull request #2123 from lioncash/coretiming-globalJames Rowe2019-02-1653-412/+548
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | core_timing: De-globalize core_timing facilities
| * | | | | | | core_timing: Convert core timing into a classLioncash2019-02-1653-412/+548
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the largest set of mutable global state within the core. This also paves a way for eliminating usages of GetInstance() on the System class as a follow-up. Note that no behavioral changes have been made, and this simply extracts the functionality into a class. This also has the benefit of making dependencies on the core timing functionality explicit within the relevant interfaces.
* | | | | | | Merge pull request #2112 from lioncash/shadowingbunnei2019-02-151-7/+13
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer_cache: Get rid of variable shadowing
| * | | | | | | gl_rasterizer_cache: Remove unnecessary newlineLioncash2019-02-121-2/+0
| | | | | | | |
| * | | | | | | gl_rasterizer_cache: Get rid of variable shadowingLioncash2019-02-121-6/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids shadowing the members of the struct itself, which results in a -Wshadow warning.
* | | | | | | | Merge pull request #2111 from ReinUsesLisp/fetch-fixbunnei2019-02-152-22/+35
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | gl_shader_decompiler: Re-implement TLDS lod
| * | | | | | | gl_shader_decompiler: Re-implement TLDS lodReinUsesLisp2019-02-122-22/+35
| | | | | | | |
* | | | | | | | Merge pull request #2113 from ReinUsesLisp/vulkan-basebunnei2019-02-149-0/+409
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | vulkan: Add dependencies and device abstraction
| * | | | | | | vk_device: Abstract device handling into a classReinUsesLisp2019-02-133-1/+351
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | VKDevice contains all the data required to manage and initialize a physical device. Its intention is to be passed across Vulkan objects to query device-specific data (for example the logical device and the dispatch loader).
| * | | | | | | renderer_vulkan: Add declarations fileReinUsesLisp2019-02-122-0/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This file is intended to be included instead of vulkan/vulkan.hpp. It includes declarations of unique handlers using a dynamic dispatcher instead of a static one (which would require linking to a Vulkan library).
| * | | | | | | logging: Add Vulkan backend logging class typeReinUsesLisp2019-02-122-0/+2
| | | | | | | |
| * | | | | | | cmake: Add Vulkan optionReinUsesLisp2019-02-121-0/+2
| | | | | | | |
| * | | | | | | gitmodules: Add Vulkan headers dependencyReinUsesLisp2019-02-122-0/+3
| |/ / / / / /
* | | | | | | Merge pull request #2115 from lioncash/localbunnei2019-02-141-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core_timing: Make EmptyTimedCallback a local variable
| * | | | | | | core_timing: Make EmptyTimedCallback a local variableLioncash2019-02-131-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is only used in one place, it can be moved closest to its usage site.
* | | | | | | | Merge pull request #2116 from lioncash/sizebunnei2019-02-142-21/+18
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | threadsafe_queue: Remove NeedSize template parameter
| * | | | | | | threadsafe_queue: Use std::size_t for representing sizeLioncash2019-02-131-7/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it consistent with the regular standard containers in terms of size representation. This also gets rid of dependence on our own type aliases, removing the need for an include.
| * | | | | | | threadsafe_queue: Remove NeedSize template parameterLioncash2019-02-132-15/+13
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The necessity of this parameter is dubious at best, and in 2019 probably offers completely negligible savings as opposed to just leaving this enabled. This removes it and simplifies the overall interface.
* | | | | | | Merge pull request #2099 from greggameplayer/BGRA8-Framebuffer-Realbunnei2019-02-133-0/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Implement BGRA8 framebuffer format
| * | | | | | Implement BGRA8 framebuffer formatgreggameplayer2019-02-093-0/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2114 from lioncash/globalbunnei2019-02-131-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_opengl: Remove reference to global system instance
| * | | | | | renderer_opengl: Remove reference to global system instanceLioncash2019-02-131-3/+3
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already store a reference to the system instance that the renderer is created with, so we don't need to refer to the system instance via Core::System::GetInstance()
* | | | | | Merge pull request #2110 from lioncash/namespacebunnei2019-02-1335-174/+172
|\ \ \ \ \ \ | | | | | | | | | | | | | | core_timing: Rename CoreTiming namespace to Core::Timing
| * | | | | | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1235-174/+172
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Places all of the timing-related functionality under the existing Core namespace to keep things consistent, rather than having the timing utilities sitting in its own completely separate namespace.
* | | | | | Merge pull request #2104 from ReinUsesLisp/compute-assertbunnei2019-02-136-52/+59
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | kepler_compute: Fixup assert and rename the engine
| * | | | | kepler_compute: Fixup assert and rename enginesReinUsesLisp2019-02-106-52/+59
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When I originally added the compute assert I used the wrong documentation. This addresses that. The dispatch register was tested with homebrew against hardware and is triggered by some games (e.g. Super Mario Odyssey). What exactly is missing to get a valid program bound by this engine requires more investigation.
* | | | | Merge pull request #2108 from FernandoS27/fix-ccbunnei2019-02-121-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Fix incorrect value for CC bit in IADD
| * | | | | Fix incorrect value for CC bit in IADDFernando Sahmkow2019-02-111-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #2109 from FernandoS27/fix-f2ibunnei2019-02-122-4/+4
|\ \ \ \ \ | | | | | | | | | | | | Corrected F2I None mode to RoundEven.
| * | | | | Corrected F2I None mode to RoundEven.Fernando Sahmkow2019-02-112-4/+4
| |/ / / /
* | | | | Merge pull request #2068 from ReinUsesLisp/shader-cleanup-texturesbunnei2019-02-123-153/+123
|\ \ \ \ \ | |/ / / / |/| | | | shader_ir: Clean texture management code
| * | | | shader_ir: Remove F4 prefix to texture operationsReinUsesLisp2019-02-073-26/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was originally included because texture operations returned a vec4. These operations now return a single float and the F4 prefix doesn't mean anything.
| * | | | shader_ir: Clean texture management codeReinUsesLisp2019-02-073-133/+104
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previous code relied on GLSL parameter order (something that's always ill-formed on an IR design). This approach passes spatial coordiantes through operation nodes and array and depth compare values in the the texture metadata. It still contains an "extra" vector containing generic nodes for bias and component index (for example) which is still a bit ill-formed but it should be better than the previous approach.
* | | | Merge pull request #1904 from bunnei/better-fermi-copybunnei2019-02-097-72/+206
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement a more accurate fermi 2D copy.
| * | | | gl_rasterizer_cache: Mark surface copy destinations as modified.bunnei2019-02-072-4/+18
| | | | |
| * | | | gl_rasterizer: Implement a more accurate fermi 2D copy.bunnei2019-02-077-68/+188
| | | | | | | | | | | | | | | | | | | | - This is a blit, use the blit registers.
* | | | | Merge pull request #2096 from FearlessTobi/patch-3bunnei2019-02-091-3/+3
|\ \ \ \ \ | | | | | | | | | | | | nvdisp_disp0: change drawing message log level from Warning to Trace
| * | | | | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
| | |/ / / | |/| | | | | | | | | | | | | | | | | | This is a leftover from the early yuzu days. We shouldn't log every time when we are drawing by default, so let's change the log level to Trace.
* | | | | Implement linear textures (#2089)Fernando Sahmkow2019-02-092-5/+39
| | | | |
* | | | | Merge pull request #2097 from ReinUsesLisp/fixup-texviewbunnei2019-02-081-2/+2
|\ \ \ \ \ | |/ / / / |/| | | | gl_rasterizer_cache: Fixup texture view parameters
| * | | | gl_rasterizer_cache: Fixup texture view parametersReinUsesLisp2019-02-081-2/+2
|/ / / / | | | | | | | | | | | | | | | | These parameters were declared as constants and passed to glTextureView but then they were removed on a rabase. This addresses that mistake.
* | | | Merge pull request #2083 from ReinUsesLisp/shader-ir-cbuf-trackingbunnei2019-02-0730-127/+141
|\ \ \ \ | |/ / / |/| | | shader/track: Add a more permissive global memory tracking
| * | | shader/track: Search inside of conditional nodesReinUsesLisp2019-02-031-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | Some games search conditionally use global memory instructions. This allows the heuristic to search inside conditional nodes for the source constant buffer.
| * | | shader_ir: Rename BasicBlock to NodeBlockReinUsesLisp2019-02-0330-122/+120
| | | | | | | | | | | | | | | | It's not always used as a basic block. Rename it for consistency.
| * | | shader_ir: Pass decoded nodes as a whole instead of per basic blocksReinUsesLisp2019-02-0327-57/+62
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some games call LDG at the top of a basic block, making the tracking heuristic to fail. This commit lets the heuristic the decoded nodes as a whole instead of per basic blocks. This may lead to some false positives but allows it the heuristic to track cases it previously couldn't.
* | | | Merge pull request #2091 from FearlessTobi/port-4603bunnei2019-02-071-4/+10
|\ \ \ \ | | | | | | | | | | Port citra-emu/citra#4603: "gdbstub: only let Execute breakpoints write/restore BKPT opcodes into target memory"
| * | | | gdbstub: only let Execute breakpoints write/restore BKPT opcodes into target memoryDimitri ALBORA2019-02-061-4/+10
| | | | |
* | | | | Merge pull request #2021 from ReinUsesLisp/disk-cachebunnei2019-02-0740-260/+1623
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_cache: Disk based shader cache
| * | | | | cmake: Fix title bar issueReinUsesLisp2019-02-072-9/+15
| | | | | |
| * | | | | gl_shader_disk_cache: Check LZ4 size limitFrederic L2019-02-071-0/+4
| | | | | | | | | | | | | | | | | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | | gl_shader_disk_cache: Consider compressed size zero as an errorFrederic L2019-02-071-2/+2
| | | | | | | | | | | | | | | | | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | | cmake: Use CMAKE_COMMAND instead of "cmake"Frederic L2019-02-071-1/+1
| | | | | | | | | | | | | | | | | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | | gl_shader_disk_cache: Use unordered containersReinUsesLisp2019-02-074-56/+64
| | | | | |
| * | | | | gl_shader_cache: Fixup GLSL unique identifiersReinUsesLisp2019-02-072-3/+3
| | | | | |
| * | | | | cmake: Fixup application stringMichael2019-02-071-2/+2
| | | | | | | | | | | | | | | | | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | | loading_screen: Unchunk progress barReinUsesLisp2019-02-071-1/+3
| | | | | |
| * | | | | gl_shader_cache: Link loading screen with disk shader cache loadReinUsesLisp2019-02-0710-12/+62
| | | | | |
| * | | | | gl_shader_cache: Set GL_PROGRAM_SEPARABLE to dumped shadersReinUsesLisp2019-02-071-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | i965 (and probably all mesa drivers) require GL_PROGRAM_SEPARABLE when using glProgramBinary. This is probably required by the standard but it's ignored by permisive proprietary drivers.
| * | | | | gl_shader_disk_cache: Pass core system as argument and guard against games without title idsReinUsesLisp2019-02-0711-18/+58
| | | | | |
| * | | | | gl_shader_disk_cache: Guard reads and writes against failureReinUsesLisp2019-02-072-216/+339
| | | | | |
| * | | | | gl_shader_disk_cache: Address miscellaneous feedbackReinUsesLisp2019-02-075-43/+57
| | | | | |
| * | | | | gl_shader_disk_cache: Pass return values returning instead of by parametersReinUsesLisp2019-02-073-39/+37
| | | | | |
| * | | | | gl_shader_disk_cache: Compress program binaries using LZ4ReinUsesLisp2019-02-071-7/+28
| | | | | |
| * | | | | gl_shader_disk_cache: Compress GLSL code using LZ4ReinUsesLisp2019-02-072-6/+57
| | | | | |
| * | | | | gl_shader_disk_cache: Save GLSL and entries into the precompiled fileReinUsesLisp2019-02-079-135/+234
| | | | | |
| * | | | | settings: Hide shader cache behind a settingReinUsesLisp2019-02-078-0/+42
| | | | | |
| * | | | | gl_shader_disk_cache: Invalidate shader cache changes with CMake hashReinUsesLisp2019-02-076-59/+173
| | | | | |
| * | | | | gl_shader_cache: Refactor to support disk shader cacheReinUsesLisp2019-02-072-121/+388
| | | | | |
| * | | | | gl_shader_disk_cache: Add transferable cache invalidationReinUsesLisp2019-02-072-0/+8
| | | | | |
| * | | | | gl_shader_disk_cache: Add precompiled loadReinUsesLisp2019-02-072-0/+45
| | | | | |
| * | | | | gl_shader_disk_cache: Add precompiled saveReinUsesLisp2019-02-072-0/+57
| | | | | |
| * | | | | gl_shader_disk_cache: Add transferable loadReinUsesLisp2019-02-072-0/+56
| | | | | |
| * | | | | gl_shader_disk_cache: Add transferable storesReinUsesLisp2019-02-072-0/+194
| | | | | |
| * | | | | gl_shader_disk_cache: Add ShaderDiskCacheOpenGL class and helpersReinUsesLisp2019-02-072-0/+76
| | | | | |
| * | | | | gl_shader_disk_cache: Add file and move BaseBindings declarationReinUsesLisp2019-02-074-10/+58
| | | | | |
| * | | | | gl_shader_decompiler: Remove name entriesReinUsesLisp2019-02-072-28/+10
| | | | | |
| * | | | | gl_shader_util: Add parameter to handle retrievable programsReinUsesLisp2019-02-073-6/+10
| | | | | |
| * | | | | rasterizer_interface: Add disk cache entry for the rasterizerReinUsesLisp2019-02-076-0/+17
| | | | | |
| * | | | | file_util: Add shader directoryReinUsesLisp2019-02-073-0/+3
| | | | | |
| * | | | | shader_decode: Implement LDG and basic cbuf trackingReinUsesLisp2019-02-071-0/+33
|/ / / / /
* | | | | Merge pull request #2042 from ReinUsesLisp/nouveau-texbunnei2019-02-0711-79/+82
|\ \ \ \ \ | | | | | | | | | | | | maxwell_3d: Allow texture handles with TIC id zero
| * | | | | video_core: Assert on invalid GPU to CPU address queriesReinUsesLisp2019-02-038-47/+67
| | | | | |
| * | | | | maxwell_3d: Allow sampler handles with TSC id zeroReinUsesLisp2019-02-031-10/+6
| | | | | |
| * | | | | maxwell_3d: Allow texture handles with TIC id zeroReinUsesLisp2019-02-033-21/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also remove "enabled" field from Tegra::Texture::FullTextureInfo because it would become unused.
| * | | | | memory_manager: Check for reserved page statusReinUsesLisp2019-02-031-1/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #2071 from ReinUsesLisp/dsa-texturebunnei2019-02-078-216/+153
|\ \ \ \ \ | |_|/ / / |/| | | | gl_rasterizer: Use DSA for textures and move swizzling to texture state
| * | | | gl_rasterizer_cache: Fixup test clauseReinUsesLisp2019-01-301-6/+5
| | | | |
| * | | | gl_rasterizer_cache: Guard clause swizzle testingMat M2019-01-301-1/+3
| | | | | | | | | | | | | | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | gl_state: Remove texture target trackingReinUsesLisp2019-01-302-5/+0
| | | | |
| * | | | gl_rasterizer_cache: Move swizzling to textures instead of stateReinUsesLisp2019-01-306-28/+35
| | | | |
| * | | | gl_state: Use DSA and multi bind to update texture bindingsReinUsesLisp2019-01-301-8/+22
| | | | |
| * | | | gl_rasterizer: Use DSA for texturesReinUsesLisp2019-01-305-185/+105
| | | | |
* | | | | Merge pull request #2057 from FearlessTobi/port-4586bunnei2019-02-062-7/+15
|\ \ \ \ \ | | | | | | | | | | | | Port citra-emu/citra#4586: "Use QPixmap/QIcon for background color selection button"
| * | | | | Use QPixmap/QIcon for background color selection buttonxperia642019-01-262-7/+15
| | | | | |
* | | | | | Merge pull request #2086 from FearlessTobi/port-4583bunnei2019-02-061-6/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port citra-emu/citra#4583: "citra_qt: Fix saving screenshot when no file extension is provided"
| * | | | | | Fix crash when no files are selectedxperia642019-02-051-6/+6
| | | | | | |
| * | | | | | Add file extension to screenshot filename if not providedxperia642019-02-051-3/+7
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2087 from lioncash/constbunnei2019-02-064-50/+136
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/nvflinger, service/vi: Improve error case handling
| * | | | | | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Converts many of the Find* functions to return a std::optional<T> as opposed to returning the raw return values directly. This allows removing a few assertions and handles error cases like the service itself does.
| * | | | | | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This member function doesn't actually modify instance state, so it can be marked as a const member function.
| * | | | | | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | This was missed within #2075. Renames the member function to make it consistent with the rest of the Find* functions.
* | | | | | Merge pull request #2088 from jroweboy/hbunnei2019-02-061-1/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | QT: Fix the loading screen 'H' switch logo to not glitch out
| * | | | | | QT: Fix the loading screen 'H' switch logo to not glitch outJames Rowe2019-02-061-1/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2085 from ReinUsesLisp/cube-minus-onebunnei2019-02-051-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | video_core/texture: Fix BitField size for depth_minus_one
| * | | | | video_core/texture: Fix BitField size for depth_minus_oneReinUsesLisp2019-02-051-1/+1
| | | | | |
* | | | | | Merge pull request #2081 from ReinUsesLisp/lmem-64bunnei2019-02-052-15/+46
|\ \ \ \ \ \ | |/ / / / / |/| | | | | shader_ir/memory: Add LD_L 64 bits loads
| * | | | | shader_ir/memory: Add ST_L 64 and 128 bits storesReinUsesLisp2019-02-031-3/+11
| | | | | |
| * | | | | shader_ir/memory: Add LD_L 128 bits loadsReinUsesLisp2019-02-031-7/+19
| | | | | |
| * | | | | shader_bytecode: Rename BytesN enums to BitsNReinUsesLisp2019-02-032-7/+7
| | | | | |
| * | | | | shader_ir/memory: Add LD_L 64 bits loadsReinUsesLisp2019-02-031-6/+17
| | |_|/ / | |/| | |
* | | | | Merge pull request #2082 from FernandoS27/txq-stlbunnei2019-02-052-6/+13
|\ \ \ \ \ | |/ / / / |/| | | | Fix TXQ not using the component mask.
| * | | | Update src/video_core/engines/shader_bytecode.hMat M2019-02-041-1/+1
| | | | | | | | | | | | | | | Co-Authored-By: FernandoS27 <fsahmkow27@gmail.com>
| * | | | Fix TXQ not using the component mask.Fernando Sahmkow2019-02-032-6/+13
| | | | |
* | | | | Merge pull request #2074 from ReinUsesLisp/shader-ir-unify-offsetbunnei2019-02-0117-25/+36
|\ \ \ \ \ | | | | | | | | | | | | shader_ir: Unify constant buffer offset values
| * | | | | shader_ir: Unify constant buffer offset valuesReinUsesLisp2019-01-3017-25/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Constant buffer values on the shader IR were using different offsets if the access direct or indirect. cbuf34 has a non-multiplied offset while cbuf36 does. On shader decoding this commit multiplies it by four on cbuf34 queries.
* | | | | | Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\ \ \ \ \ \ | | | | | | | | | | | | | | hwopus: Implement DecodeInterleaved (the newest variant)
| * | | | | | hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This functions almost identically to DecodeInterleavedWithPerfOld, however this function also has the ability to reset the decoder context. This is documented as a potentially desirable thing in the libopus manual in some circumstances as it says for the OPUS_RESET_STATE ctl: "This should be called when switching streams in order to prevent the back to back decoding from giving different result from one at a time decoding."
| * | | | | | hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the logic in one spot for use by both functions.
| * | | | | | hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't really offer anything over the use of a direct pointer, so we can just use that instead.
| * | | | | | hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes non-mutable state more explicit.
| * | | | | | hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
| |/ / / / / | | | | | | | | | | | | | | | | | | Filled in via information provided by SwitchBrew.
* | | | | | Merge pull request #2067 from ReinUsesLisp/workaround-fbbunnei2019-02-012-14/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: Workaround invalid zeta clears
| * | | | | | gl_rasterizer: Workaround invalid zeta clearsReinUsesLisp2019-01-302-14/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some games (like Xenoblade Chronicles 2) clear both depth and stencil buffers while there's a depth-only texture attached (e.g. D16 Unorm). This commit reads the zeta format of the bound surface on ConfigureFramebuffers and returns if depth and/or stencil attachments were set. This is ignored on DrawArrays but on Clear it's used to just clear those attachments, bypassing an OpenGL error.
* | | | | | | Merge pull request #2078 from lioncash/timerbunnei2019-02-019-259/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: Remove the Timer class
| * | | | | | | kernel: Remove the Timer classLioncash2019-02-019-259/+0
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A holdover from citra, the Horizon kernel on the switch has no prominent kernel object that functions as a timer. At least not to the degree of sophistication that this class provided. As such, this can be removed entirely. This class also wasn't used at all in any meaningful way within the core, so this was just code sitting around doing nothing. This also allows removing a few things from the main KernelCore class that allows it to use slightly less resources overall (though very minor and not anything really noticeable).
* | | | | | | Merge pull request #2079 from ReinUsesLisp/remove-fillbunnei2019-02-015-17/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | video_core: Remove unused Fill related code
| * | | | | | rasterizer_interface: Remove unused AccelerateFill operationReinUsesLisp2019-02-013-11/+0
| | | | | | |
| * | | | | | video_core: Remove unused Fill surface typeReinUsesLisp2019-02-012-6/+1
|/ / / / / /
* | | | | | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Update function tables
| * | | | | | service/ns: Update function tablesLioncash2019-01-301-14/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | | | | | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | | | | | service/audio: Update function tablesLioncash2019-01-304-8/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | | | | | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | | | | | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | | | | | service/btm: Update function tablesLioncash2019-01-301-55/+97
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | | | | | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | | | | | service/psc: Update function tablesLioncash2019-01-301-8/+9
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Updates the function tables based off information on SwitchBrew. Gets rid of a swath of unknown names.
* | | | | | Merge pull request #2077 from lioncash/virtbunnei2019-01-315-15/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directly
| * | | | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directlyLioncash2019-01-301-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | No inheritors of the WaitObject class actually make use of their own implementations of these functions, so they can be made non-virtual. It's also kind of sketchy to allow overriding how the threads get added to the list anyways, given the kernel itself on the actual hardware doesn't seem to customize based off this.
| * | | | | | kernel/timer: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implementation just calls the base class variant of the function, so this isn't necessary.
| * | | | | | kernel/readable_event: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This just calls the base variant of the function, so it can be removed.
* | | | | | | Merge pull request #2075 from lioncash/findbunnei2019-01-313-23/+47
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/nvflinger: Minor renaming changes
| * | | | | | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This member function doesn't actually modify instance state, so it can be const-qualified.
| * | | | | | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This more accurately describes what the function is actually attempting to do (it's not a simple trivial getter).
* | | | | | | Merge pull request #1818 from ccawley2011/patch-1Hexagon122019-01-301-0/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Add missing environment variables to travis-ci.env
| * | | | | | Add missing environment variables to travis-ci.envCameron Cawley2018-11-281-0/+2
| | | | | | |
* | | | | | | Merge pull request #2076 from lioncash/encHexagon122019-01-301-1/+1
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | video_core/dma_pusher: Silence C4828 warnings
| * | | | | | video_core/dma_pusher: Silence C4828 warningsLioncash2019-01-301-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was previously causing: warning C4828: The file contains a character starting at offset 0xa33 that is illegal in the current source character set (codepage 65001). warnings on Windows when compiling yuzu.
* | | | | | Merge pull request #1485 from FernandoS27/render-infobunnei2019-01-302-2/+57
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Add more info into textures' object labels
| * | | | | Add more info into textures' object labelsFernandoS272018-12-092-2/+57
| | | | | |
* | | | | | Merge pull request #2070 from ReinUsesLisp/cubearray-viewbunnei2019-01-304-3/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_cache: Fix texture view for cubemaps as cubemap arrays
| * | | | | | gl_shader_cache: Fix texture view for cubemaps as cubemap arraysReinUsesLisp2019-01-304-3/+28
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cubemaps are considered layered and to create a texture view the texture mustn't be a layered texture, resulting in cubemaps being bound as cubemap arrays. To fix this issue this commit introduces an extra surface parameter called "is_array" and uses this to query for texture view creation. Now that texture views for cubemaps are actually being created, this also fixes the number of layers created for the texture view (since they have to be 6 to create a texture view of cubemaps).
* | | | | | Merge pull request #2069 from lioncash/vibunnei2019-01-302-21/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/nvflinger: Add the null display type
| * | | | | | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In addition to the default, external, EDID, and internal displays, there's also a null display provided as well, which as the name suggests, does nothing but discard all commands given to it. This is provided for completeness.
| * | | | | | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Opening a display isn't really a thing to warn about. It's an expected thing, so this can be a debug log. This also alters the string to indicate the display name better. Opening "Default" display reads a little nicer compared to Opening display Default.
| * | | | | | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
| | | | | | |
| * | | | | | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes non-mutable state more explicit.
| * | | | | | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | The built-in set of displays is fixed, so we can utilize an array instead of a vector here.
* | | | | | Merge pull request #1987 from ReinUsesLisp/explicit-shader-ldgbunnei2019-01-307-249/+194
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_cache: Use explicit bindings
| * | | | | | gl_shader_cache: Use explicit bindingsReinUsesLisp2019-01-307-249/+194
|/ / / / / /
* | | | | | Merge pull request #1960 from ReinUsesLisp/shader-ir-ldgbunnei2019-01-3013-14/+380
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: Implement LDG through heuristics based on IR
| * | | | | | gl_rasterizer: Implement global memory managementReinUsesLisp2019-01-306-4/+140
| | | | | | |
| * | | | | | shader_decode: Implement LDG and basic cbuf trackingReinUsesLisp2019-01-307-10/+240
|/ / / / / /
* / / / / / video_core/GPU Implemented the GPU PFIFO puller semaphore operations. (#1908)Kevin2019-01-302-12/+242
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented the puller semaphore operations. * Nit: Fix 2 style issues * Nit: Add Break to default case. * Fix style. * Update for comments. Added ReferenceCount method * Forgot to remove GpuSmaphoreAddress union. * Fix the clang-format issues. * More clang formatting. * two more white spaces for the Clang formatting. * Move puller members into the regs union * Updated to use Memory::WriteBlock instead of Memory::Write* * Fix clang style issues * White space clang error * Removing unused funcitons and other pr comment * Removing unused funcitons and other pr comment * More union magic for setting regs value. * union magic refcnt as well * Remove local var * Set up the regs and regs_assert_positions up properly * Fix clang error
* | | | | hle/ipc_helpers: Fix clang-format warningsLioncash2019-01-301-1/+0
| | | | |
* | | | | hle/ipc_helpers: Allow pushing signed valuesLioncash2019-01-291-0/+22
| | | | | | | | | | | | | | | | | | | | | | | | | This is kind of a large hole in the API, given we allow popping signed values. This fixes that.
* | | | | Merge pull request #2063 from lioncash/pessimizingbunnei2019-01-292-6/+6
|\ \ \ \ \ | | | | | | | | | | | | video_core/shader: Minor changes
| * | | | | shader/shader_ir: Amend three comment typosLioncash2019-01-281-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we're in the area, these are three trivial typos that can be corrected.
| * | | | | shader/shader_ir: Amend constructor initializer ordering for AbufNodeLioncash2019-01-281-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the class members in the same order that they would actually be initialized in. Gets rid of two compiler warnings.
| * | | | | shader/decode: Avoid a pessimizing std::move within DecodeRange()Lioncash2019-01-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::moveing a local variable in a return statement has the potential to prevent copy elision from occurring, so this can just be converted into a regular return.
* | | | | | Merge pull request #2065 from lioncash/pmbunnei2019-01-292-3/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/pm: Implement SetMaintenanceBoot
| * | | | | | service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This quite literally functions as a basic setter. No other error checking or anything (since there's nothing to really check against). With this, it completes the pm:bm interface in terms of functionality.
| * | | | | | service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
|/ / / / / / | | | | | | | | | | | | | | | | | | Just minor tidying of interfaces.
* | | | | | Merge pull request #2064 from lioncash/vi-stubbunnei2019-01-281-2/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | service/vi: Remove stubbed notifier from SetLayerVisibility
| * | | | | service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This appears to be a vestigial API function that's only kept around for compatibility's sake, given the function only returns a success error code and exits. Since that's the case, we can remove the stubbed notification from the log, since doing nothing is technically the correct behavior in this case.
* | | | | Merge pull request #2060 from lioncash/exceptionbunnei2019-01-271-0/+4
|\ \ \ \ \ | | | | | | | | | | | | kernel/svc: Log out uncaught C++ exceptions from svcBreak
| * | | | | kernel/svc: Log out uncaught C++ exceptions from svcBreakLioncash2019-01-271-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Looking into the implementation of the C++ standard facilities that seem to be within all modules, it appears that they use 7 as a break reason to indicate an uncaught C++ exception. This was primarily found via the third last function called within Horizon's equivalent of libcxxabi's demangling_terminate_handler(), which passes the value 0x80000007 to svcBreak.
* | | | | | Merge pull request #2058 from ReinUsesLisp/trunc-warningbunnei2019-01-271-3/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: Silent implicit conversion warning
| * | | | | | video_core: Silent implicit conversion warningReinUsesLisp2019-01-261-3/+4
| |/ / / / /
* | | | | | Merge pull request #2059 from FearlessTobi/port-4601bunnei2019-01-271-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Port citra-emu/citra#4601: "dsp_interface: fix sound being played while volume is 0"
| * | | | | dsp_interface: fix sound being played while volume is 0fearlessTobi2019-01-261-1/+1
|/ / / / / | | | | | | | | | | | | | | | | | | | | According to documentation, if the argument of std::exp is zero, one is returned. However we want the return value to be also zero in this case so no audio is played.
* | | | | Merge pull request #1927 from ReinUsesLisp/shader-irbunnei2019-01-2639-3808/+5497
|\ \ \ \ \ | |_|_|/ / |/| | | | video_core: Replace gl_shader_decompiler with an IR based decompiler
| * | | | shader_ir: Fixup clang buildReinUsesLisp2019-01-161-4/+6
| | | | |
| * | | | gl_shader_decompiler: replace std::get<> with std::get_if<> for macOS compatibilityReinUsesLisp2019-01-151-44/+58
| | | | |
| * | | | gl_shader_decompiler: Inline textureGather componentReinUsesLisp2019-01-151-15/+16
| | | | |
| * | | | shader_decode: Fixup XMADReinUsesLisp2019-01-151-1/+1
| | | | |
| * | | | shader_ir: Pass to decoder functions basic block's codeReinUsesLisp2019-01-1527-82/+83
| | | | |
| * | | | shader_decode: Improve zero flag implementationReinUsesLisp2019-01-1515-75/+79
| | | | |
| * | | | shader_ir: Remove composite primitives and use temporals insteadReinUsesLisp2019-01-154-241/+224
| | | | |
| * | | | gl_shader_decompiler: Fixup AssignCompositeHalfReinUsesLisp2019-01-151-1/+1
| | | | |
| * | | | shader_decode: Use proper primitive namesReinUsesLisp2019-01-154-25/+21
| | | | |
| * | | | shader_decode: Use BitfieldExtract instead of shift + andReinUsesLisp2019-01-158-48/+37
| | | | |
| * | | | shader_ir: Remove Ipa primitiveReinUsesLisp2019-01-153-13/+2
| | | | |
| * | | | gl_shader_decompiler: Use rasterizer's UBO size limitReinUsesLisp2019-01-151-1/+3
| | | | |
| * | | | gl_shader_gen: Fixup code formattingReinUsesLisp2019-01-152-18/+22
| | | | |
| * | | | video_core: Rename glsl_decompiler to gl_shader_decompilerReinUsesLisp2019-01-157-7/+7
| | | | |
| * | | | shader_ir: Remove RZ and use Register::ZeroIndex insteadReinUsesLisp2019-01-153-12/+16
| | | | |
| * | | | shader_decode: Implement TEXS.F16ReinUsesLisp2019-01-153-15/+57
| | | | |
| * | | | shader_decode: Fixup R2PReinUsesLisp2019-01-151-2/+3
| | | | |
| * | | | glsl_decompiler: Fixup TLDSReinUsesLisp2019-01-151-1/+0
| | | | |
| * | | | glsl_decompiler: Fixup geometry shadersReinUsesLisp2019-01-152-15/+17
| | | | |
| * | | | shader_decode: Fixup WriteLogicOperation zero comparisonReinUsesLisp2019-01-151-1/+1
| | | | |
| * | | | glsl_decompiler: Fixup permissive member function declarationsReinUsesLisp2019-01-151-133/+133
| | | | |
| * | | | shader_decode: Fixup PSETReinUsesLisp2019-01-151-2/+3
| | | | |
| * | | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-152-2/+4
| | | | |
| * | | | video_core: Implement IR based geometry shadersReinUsesLisp2019-01-154-10/+102
| | | | |
| * | | | shader_decode: Implement VMAD and VSETPReinUsesLisp2019-01-155-2/+129
| | | | |
| * | | | shader_decode: Implement HSET2ReinUsesLisp2019-01-153-1/+50
| | | | |
| * | | | shader_decode: Rework HSETP2ReinUsesLisp2019-01-154-47/+57
| | | | |
| * | | | shader_decode: Implement R2PReinUsesLisp2019-01-151-1/+28
| | | | |
| * | | | shader_decode: Implement CSETPReinUsesLisp2019-01-151-14/+37
| | | | |
| * | | | shader_decode: Implement PSETReinUsesLisp2019-01-151-1/+16
| | | | |
| * | | | shader_decode: Implement HFMA2ReinUsesLisp2019-01-154-5/+60
| | | | |
| * | | | glsl_decompiler: Remove HNegate inliningReinUsesLisp2019-01-151-10/+0
| | | | |
| * | | | shader_decode: Implement POPCReinUsesLisp2019-01-154-1/+22
| | | | |
| * | | | shader_decode: Implement TLDS (untested)ReinUsesLisp2019-01-153-10/+92
| | | | |
| * | | | shader_decode: Update TLD4 reflecting #1862 changesReinUsesLisp2019-01-152-52/+52
| | | | |
| * | | | shader_ir: Fixup TEX and TEXS and partially fix TLD4 decompilingReinUsesLisp2019-01-153-60/+72
| | | | |
| * | | | shader_decode: Fixup FSETReinUsesLisp2019-01-151-2/+2
| | | | |
| * | | | shader_decode: Implement IADD32IReinUsesLisp2019-01-151-0/+11
| | | | |
| * | | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-151-1/+1
| | | | |
| * | | | video_core: Return safe values after an assert hitsReinUsesLisp2019-01-158-8/+19
| | | | |
| * | | | shader_decode: Implement FFMAReinUsesLisp2019-01-151-1/+36
| | | | |
| * | | | video_core: Address feedbackReinUsesLisp2019-01-154-13/+16
| | | | |
| * | | | shader_ir: Fixup file inclusions and clang-formatReinUsesLisp2019-01-153-2/+2
| | | | |
| * | | | shader_ir: Move comment node stringMat M2019-01-151-2/+2
| | | | | | | | | | | | | | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
| * | | | shader_ir: Address feedback to avoid UB in bit castingReinUsesLisp2019-01-151-2/+4
| | | | |
| * | | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-152-3/+2
| | | | |
| * | | | shader_decode: Implement LEAReinUsesLisp2019-01-151-0/+55
| | | | |
| * | | | shader_decode: Implement IADD3ReinUsesLisp2019-01-151-0/+61
| | | | |
| * | | | shader_decode: Implement LOP3ReinUsesLisp2019-01-152-0/+62
| | | | |
| * | | | shader_decode: Implement ST_LReinUsesLisp2019-01-151-0/+17
| | | | |
| * | | | shader_decode: Implement LD_LReinUsesLisp2019-01-151-0/+18
| | | | |
| * | | | shader_decode: Implement HSETP2ReinUsesLisp2019-01-151-1/+37
| | | | |
| * | | | shader_decode: Implement HADD2 and HMUL2ReinUsesLisp2019-01-151-1/+48
| | | | |
| * | | | shader_decode: Implement HADD2_IMM and HMUL2_IMMReinUsesLisp2019-01-151-1/+28
| | | | |
| * | | | shader_decode: Implement MOV_SYSReinUsesLisp2019-01-151-0/+27
| | | | |
| * | | | shader_decode: Implement IMNMXReinUsesLisp2019-01-151-0/+16
| | | | |
| * | | | shader_decode: Implement F2F_CReinUsesLisp2019-01-151-2/+10
| | | | |
| * | | | shader_decode: Implement I2IReinUsesLisp2019-01-151-0/+26
| | | | |
| * | | | shader_decode: Implement BRA internal flagReinUsesLisp2019-01-151-4/+8
| | | | |
| * | | | shader_decode: Implement ISCADDReinUsesLisp2019-01-151-0/+15
| | | | |
| * | | | shader_decode: Implement XMADReinUsesLisp2019-01-151-1/+85
| | | | |
| * | | | shader_decode: Implement PBK and BRKReinUsesLisp2019-01-151-1/+22
| | | | |
| * | | | shader_decode: Implement LOPReinUsesLisp2019-01-151-0/+15
| | | | |
| * | | | shader_decode: Implement SELReinUsesLisp2019-01-151-0/+8
| | | | |
| * | | | shader_decode: Implement IADDReinUsesLisp2019-01-151-1/+28
| | | | |
| * | | | shader_decode: Implement ISETPReinUsesLisp2019-01-151-1/+30
| | | | |
| * | | | shader_decode: Implement BFIReinUsesLisp2019-01-151-1/+22
| | | | |
| * | | | shader_decode: Implement ISETReinUsesLisp2019-01-151-1/+27
| | | | |
| * | | | shader_decode: Implement LD_CReinUsesLisp2019-01-151-0/+31
| | | | |
| * | | | shader_decode: Implement SHLReinUsesLisp2019-01-151-0/+8
| | | | |
| * | | | shader_decode: Implement SHRReinUsesLisp2019-01-151-1/+26
| | | | |
| * | | | shader_decode: Implement LOP32IReinUsesLisp2019-01-152-1/+72
| | | | |
| * | | | shader_decode: Implement BFEReinUsesLisp2019-01-151-1/+25
| | | | |
| * | | | shader_decode: Implement FSETReinUsesLisp2019-01-151-1/+36
| | | | |
| * | | | shader_decode: Implement F2IReinUsesLisp2019-01-151-0/+37
| | | | |
| * | | | shader_decode: Implement I2FReinUsesLisp2019-01-151-0/+23
| | | | |
| * | | | shader_decode: Implement F2FReinUsesLisp2019-01-151-1/+37
| | | | |
| * | | | shader_decode: Stub DEPBARReinUsesLisp2019-01-151-0/+4
| | | | |
| * | | | shader_decode: Implement SSY and SYNCReinUsesLisp2019-01-151-0/+19
| | | | |
| * | | | shader_decode: Implement PSETPReinUsesLisp2019-01-151-1/+21
| | | | |
| * | | | shader_decode: Implement TMMLReinUsesLisp2019-01-151-3/+45
| | | | |
| * | | | shader_decode: Implement TEX and TXQReinUsesLisp2019-01-152-0/+223
| | | | |
| * | | | shader_decode: Implement TEXS (F32)ReinUsesLisp2019-01-152-0/+217
| | | | |
| * | | | shader_decode: Implement FSETPReinUsesLisp2019-01-151-1/+33
| | | | |
| * | | | shader_decode: Partially implement BRAReinUsesLisp2019-01-151-0/+12
| | | | |
| * | | | shader_decode: Implement IPAReinUsesLisp2019-01-151-0/+12
| | | | |
| * | | | shader_decode: Implement EXITReinUsesLisp2019-01-151-1/+32
| | | | |
| * | | | shader_decode: Implement ST_AReinUsesLisp2019-01-151-0/+30
| | | | |
| * | | | shader_decode: Implement LD_AReinUsesLisp2019-01-151-1/+39
| | | | |
| * | | | shader_decode: Implement FADD32IReinUsesLisp2019-01-151-0/+12
| | | | |
| * | | | shader_decode: Implement FMUL32_IMMReinUsesLisp2019-01-151-0/+10
| | | | |
| * | | | shader_decode: Implement MOV32_IMMReinUsesLisp2019-01-151-1/+9
| | | | |
| * | | | shader_decode: Stub RRO_C, RRO_R and RRO_IMMReinUsesLisp2019-01-151-0/+9
| | | | |
| * | | | shader_decode: Implement FMNMX_C, FMNMX_R and FMNMX_IMMReinUsesLisp2019-01-151-0/+18
| | | | |
| * | | | shader_decode: Implement MUFUReinUsesLisp2019-01-151-0/+29
| | | | |
| * | | | shader_decode: Implement FADD_C, FADD_R and FADD_IMMReinUsesLisp2019-01-151-0/+15
| | | | |
| * | | | shader_decode: Implement FMUL_C, FMUL_R and FMUL_IMMReinUsesLisp2019-01-151-0/+42
| | | | |
| * | | | shader_decode: Implement MOV_C and MOV_RReinUsesLisp2019-01-151-1/+23
| | | | |
| * | | | video_core: Replace gl_shader_decompilerReinUsesLisp2019-01-158-4185/+57
| | | | |
| * | | | glsl_decompiler: ImplementationReinUsesLisp2019-01-153-0/+1483
| | | | |
| * | | | shader_ir: Add condition code helperReinUsesLisp2019-01-152-0/+13
| | | | |
| * | | | shader_ir: Add predicate combiner helperReinUsesLisp2019-01-152-0/+15
| | | | |
| * | | | shader_ir: Add comparison helpersReinUsesLisp2019-01-152-0/+106
| | | | |
| * | | | shader_ir: Add half float helpersReinUsesLisp2019-01-152-0/+44
| | | | |
| * | | | shader_ir: Add integer helpersReinUsesLisp2019-01-152-0/+40
| | | | |
| * | | | shader_ir: Add float helpersReinUsesLisp2019-01-152-0/+24
| | | | |
| * | | | shader_ir: Add settersReinUsesLisp2019-01-152-0/+24
| | | | |
| * | | | shader_ir: Add local memory gettersReinUsesLisp2019-01-152-0/+7
| | | | |
| * | | | shader_ir: Add internal flag gettersReinUsesLisp2019-01-152-0/+10
| | | | |
| * | | | shader_ir: Add attribute gettersReinUsesLisp2019-01-152-0/+26
| | | | |
| * | | | shader_ir: Add constant buffer gettersReinUsesLisp2019-01-152-0/+25
| | | | |
| * | | | shader_ir: Add register getterReinUsesLisp2019-01-152-0/+9
| | | | |
| * | | | shader_ir: Add immediate node constructorsReinUsesLisp2019-01-152-1/+34
| | | | |
| * | | | shader_ir: Initial implementationReinUsesLisp2019-01-1530-0/+1573
| | | | |
| * | | | shader_bytecode: Fixup encodingReinUsesLisp2019-01-151-1/+1
| | | | |
| * | | | shader_header: Make local memory size getter constantReinUsesLisp2019-01-151-1/+1
| | | | |
* | | | | Merge pull request #2054 from bunnei/scope-context-refactorbunnei2019-01-247-36/+54
|\ \ \ \ \ | | | | | | | | | | | | frontend: Refactor ScopeAcquireWindowContext out of renderer_opengl.
| * | | | | frontend: Refactor ScopeAcquireWindowContext out of renderer_opengl.bunnei2019-01-247-36/+54
| | | | | |
* | | | | | Merge pull request #2049 from FearlessTobi/port-3928bunnei2019-01-245-0/+35
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Port citra-emu/citra#3928: "citra_qt: Log settings on launch"
| * | | | | citra_qt: Log settings on launchzhupengfei2019-01-225-0/+35
|/ / / / /
* | | | | Merge pull request #2047 from FearlessTobi/patch-3bunnei2019-01-221-5/+16
|\ \ \ \ \ | | | | | | | | | | | | ISSUE_TEMPLATE: changes to make it more expressive and prevent low-quality issues
| * | | | | ISSUE_TEMPLATE: changes to make it more expressive and prevent low-quality issuesTobias2019-01-221-5/+16
|/ / / / /
* | | | | Merge pull request #2043 from ReinUsesLisp/rt-separatebunnei2019-01-222-4/+6
|\ \ \ \ \ | | | | | | | | | | | | maxwell_3d: Set rt_separate_frag_data to 1 by default
| * | | | | maxwell_3d: Set rt_separate_frag_data to 1 by defaultReinUsesLisp2019-01-222-4/+6
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commercial games assume that this value is 1 but they never set it. On the other hand nouveau manually sets this register. On ConfigureFramebuffers we were asserting for what we are actually implementing (according to envytools).
* | | | | Merge pull request #2035 from lioncash/fwd-declbunnei2019-01-217-17/+14
|\ \ \ \ \ | |_|_|_|/ |/| | | | yuzu/configuration: Remove unnecessary inclusions where applicable
| * | | | yuzu/configuration/configure_input_player: Forward declare types where applicableLioncash2019-01-172-2/+7
| | | | | | | | | | | | | | | | | | | | | | | | | Allows removing the inclusion of the main input common header from the UI config header.
| * | | | yuzu/configuration/configure_touchscreen_advanced: Remove unnecessary header inclusionsLioncash2019-01-171-2/+0
| | | | |
| * | | | yuzu/configuration/configure_per_general: Remove unused header inclusionsLioncash2019-01-172-4/+3
| | | | |
| * | | | yuzu/configuration/configure_debug: Remove unused header inclusionsLioncash2019-01-171-1/+0
| | | | |
| * | | | yuzu/configuration/configure_system: Remove unused header inclusionsLioncash2019-01-171-8/+4
| |/ / /
* | | | Merge pull request #2038 from jroweboy/loading-progress-barbunnei2019-01-215-57/+316
|\ \ \ \ | | | | | | | | | | Loading progress bar upgrades
| * | | | Change const char* to const char[]James Rowe2019-01-211-4/+4
| | | | |
| * | | | Fix mingw compile error and warningsJames Rowe2019-01-212-6/+6
| | | | |
| * | | | Add fade out effect to the loading screenJames Rowe2019-01-214-94/+158
| | | | |
| * | | | Set Minimum Size to the same as renderwindowJames Rowe2019-01-211-0/+1
| | | | |
| * | | | Remove blue box around loading screenJames Rowe2019-01-211-1/+0
| | | | |
| * | | | Change the background color of Stage Complete to yuzu blueJames Rowe2019-01-211-1/+1
| | | | |
| * | | | Rename step 1 and step 2 to be a little more descriptiveJames Rowe2019-01-212-8/+8
| | | | |
| * | | | Prevent estimated time from flashing after slow shader compilation startsJames Rowe2019-01-211-1/+1
| | | | |
| * | | | Move progress bar style into constexpr stringsJames Rowe2019-01-211-28/+32
| | | | |
| * | | | Hide progress bar on Prepare stepJames Rowe2019-01-201-7/+8
| | | | |
| * | | | QT: Upgrade the Loading Bar to look much betterJames Rowe2019-01-204-11/+201
|/ / / /
* | | | Merge pull request #2034 from jroweboy/loading-widgetbunnei2019-01-209-11/+262
|\ \ \ \ | | | | | | | | | | QT Frontend: Add a Loading screen with progressbar
| * | | | Add a workaround if QMovie isn't availableJames Rowe2019-01-202-1/+20
| | | | |
| * | | | QT Frontend: Add a Loading screen with progressbarJames Rowe2019-01-209-11/+243
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With shader caches on the horizon, one requirement is to provide visible feedback for the progress. The shader cache reportedly takes several minutes to load for large caches that were invalidated, and as such we should provide a loading screen with progress. Adds a loading screen widget that will be shown until the first frame of the game is swapped. This was chosen in case shader caches are not being used, several games still take more than a few seconds to launch and could benefit from a loading screen.
* | | | | Merge pull request #2008 from ReinUsesLisp/dirty-framebuffersbunnei2019-01-206-8/+78
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Use dirty flags for framebuffers
| * | | | | gl_rasterizer: Skip framebuffer configuration if rendertargets have not been changedReinUsesLisp2019-01-072-1/+31
| | | | | |
| * | | | | gl_rasterizer_cache: Use dirty flags for the depth bufferReinUsesLisp2019-01-074-3/+23
| | | | | |
| * | | | | gl_rasterizer_cache: Use dirty flags for color buffersReinUsesLisp2019-01-074-4/+24
| | | | | |
* | | | | | Merge pull request #2002 from ReinUsesLisp/dsa-vao-bufferbunnei2019-01-209-103/+73
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: Use DSA for VAOs and buffers
| * | | | | | gl_rasterizer: Workaround Intel VAO DSA bugReinUsesLisp2019-01-093-7/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There is a bug on Intel's blob driver where it fails to properly build a vertex array object if it's not bound even after creating it with glCreateVertexArrays. This workaround binds it after creating it to bypass the issue.
| * | | | | | gl_stream_buffer: Use DSA for buffer managementReinUsesLisp2019-01-063-17/+14
| | | | | | |
| * | | | | | gl_rasterizer: Use DSA for vertex array objectsReinUsesLisp2019-01-066-79/+53
| | | | | | |
| * | | | | | gl_state: Drop uniform buffer state trackingReinUsesLisp2019-01-063-10/+0
| | | | | | |
* | | | | | | Merge pull request #2032 from lioncash/webbunnei2019-01-201-6/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/configuration/configure_web: Amend verification string
| * | | | | | | yuzu/configuration/configure_web: Remove an unused lambda captureLioncash2019-01-171-5/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 'this' isn't actually used within the lambda, since what we need from the class is already assigned within the capture section of the lambda.
| * | | | | | | yuzu/configuration/configure_web: Use an ellipsis with 'Verifying' textLioncash2019-01-171-1/+1
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | It's a common UI pattern to use an ellipsis to indicate an ongoing action, rather than just specifying the word by itself.
* | | | | | | Merge pull request #2025 from DarkLordZach/loader-banner-logobunnei2019-01-2011-0/+77
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | loader: Add getters for application banner and logo
| * | | | | | loader: Propagate NCA logo section to ReadBanner and ReadLogoZach Hilman2019-01-159-0/+61
| | | | | | |
| * | | | | | content_archive: Add getter for logo section of NCAZach Hilman2019-01-152-0/+16
| |/ / / / /
* | | | | | Merge pull request #2031 from lioncash/privbunnei2019-01-197-26/+36
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu/web_browser: Minor cleanup
| * | | | | | core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of a few indirect inclusions.
| * | | | | | core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-177-20/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a function that definitely doesn't always have a non-modifying behavior across all implementations, so this should be made non-const. This gets rid of the need to mark data members as mutable to work around the fact mutating data members needs to occur.
| * | | | | | yuzu/web_browser: std::move std::function instances in OpenPage()Lioncash2019-01-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to potentially reallocate the contained callbacks.
| * | | | | | yuzu/web_browser: Make slot functions privateLioncash2019-01-171-2/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | These currently aren't used by anything other than the QtWebBrowser class itself, and can be made private.
* | | | | | Merge pull request #2033 from ReinUsesLisp/fixup-clip-warningbunnei2019-01-191-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: Silent unsafe mix warning
| * | | | | | gl_rasterizer: Silent unsafe mix warningReinUsesLisp2019-01-181-1/+1
| |/ / / / /
* | | | | | Merge pull request #2036 from lioncash/unused-classbunnei2019-01-191-23/+0
|\ \ \ \ \ \ | |/ / / / / |/| | | | | file_sys/directory: Remove unused DirectoryBackend class
| * | | | | file_sys/directory: Remove unused DirectoryBackend classLioncash2019-01-181-23/+0
|/ / / / / | | | | | | | | | | | | | | | This isn't used at all, so we can just get rid of it.
* | | | | Merge pull request #2020 from otaviopace/remove-spacesHexagon122019-01-141-2/+2
|\ \ \ \ \ | | | | | | | | | | | | audio_core: remove unnecessary spaces on comments
| * | | | | audio_core: remove unnecessary spaces on commentsOtávio Pace2019-01-141-2/+2
|/ / / / /
* | | | | Merge pull request #1848 from FreddyFunk/QJsonArraybunnei2019-01-121-2/+2
|\ \ \ \ \ | | | | | | | | | | | | game_list: Remove a reference of a reference
| * | | | | game_list: Remove a reference of a referenceFrederic Laing2018-12-031-2/+2
| | | | | |
* | | | | | Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-108-39/+120
|\ \ \ \ \ \ | | | | | | | | | | | | | | settings: Add support for setting the RTC manually
| * | | | | | settings: Fix comment structureZach Hilman2019-01-082-5/+7
| | | | | | |
| * | | | | | settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-086-17/+21
| | | | | | |
| * | | | | | time: Use custom RTC settings if applicable for gameZach Hilman2019-01-082-8/+12
| | | | | | |
| * | | | | | core: Set custom RTC differential on game bootZach Hilman2019-01-081-0/+7
| | | | | | |
| * | | | | | qt: Provide UI to edit custom RTC settingsZach Hilman2019-01-082-28/+66
| | | | | | |
| * | | | | | settings: Add custom RTC settingsZach Hilman2019-01-084-4/+30
| | | | | | | | | | | | | | | | | | | | | Stored as signed seconds since epoch.
* | | | | | | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-1030-591/+1381
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | applets: Implement HLE web browser applet (LibAppletOff)
| * | | | | | | build: Copy web engine resources to correct locationZach Hilman2019-01-051-2/+1
| | | | | | | |
| * | | | | | | build: Copy QtWebEngineProcess[d].exe to release dir on windowsZach Hilman2019-01-041-0/+1
| | | | | | | |
| * | | | | | | Update Qt MSVC external to 5.12.0Zach Hilman2018-12-312-2/+2
| | | | | | | |
| * | | | | | | travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-294-5/+4
| | | | | | | |
| * | | | | | | web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-2910-146/+160
| | | | | | | |
| * | | | | | | cmake: Add USE_QT_WEB_ENGINE flag and update build systemZach Hilman2018-12-285-4/+37
| | | | | | | |
| * | | | | | | main: Add main window integrations for QtWebBrowserAppletZach Hilman2018-12-283-0/+168
| | | | | | | |
| * | | | | | | qt: Implement Qt frontend to web browserZach Hilman2018-12-282-0/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using a custom reimplementation of QWebEngineView and an injector script.
| * | | | | | | core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-284-2/+22
| | | | | | | |
| * | | | | | | frontend: Add frontend responder for web browserZach Hilman2018-12-282-0/+52
| | | | | | | |
| * | | | | | | applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-284-0/+234
| | | | | | | |
| * | | | | | | loader: Add accessor for Manual RomFSZach Hilman2018-12-285-0/+30
| | | | | | | |
| * | | | | | | hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| | | | | | | |
| * | | | | | | romfs: Add SingleDiscard extraction typeZach Hilman2018-12-282-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed for manual RomFS extraction, as Full generates an extra directory and Truncated generates variable results.
| * | | | | | | am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
| | | | | | | |
* | | | | | | | Merge pull request #2010 from ReinUsesLisp/gmembunnei2019-01-085-3/+96
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | gl_global_cache: Add dummy global cache manager
| * | | | | | | gl_global_cache: Add dummy global cache managerReinUsesLisp2019-01-085-3/+96
|/ / / / / / /
* | | | | | | Merge pull request #1999 from ReinUsesLisp/dirty-shaderbunnei2019-01-075-2/+23
|\ \ \ \ \ \ \ | | |_|_|/ / / | |/| | | | | gl_shader_cache: Use dirty flags for shaders
| * | | | | | gl_shader_cache: Use dirty flags for shadersReinUsesLisp2019-01-075-2/+23
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/vi: Unstub IApplicationDisplayService's SetLayerScalingMode
| * | | | | | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These values are not equivalent, based off RE. The internal value is put into a lookup table with the following values: [3, 0, 1, 2, 4] So the values absolutely do not map 1:1 like the comment was indicating.
| * | | | | | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids entangling the IPC buffer appending with the actual operation of converting the scaling values over. This also inserts the proper error handling for invalid scaling values.
| * | | | | | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This appears to only check if the scaling mode can actually be handled, rather than actually setting the scaling mode for the layer. This implements the same error handling performed on the passed in values.
* | | | | | | Merge pull request #1992 from DarkLordZach/move-profile-manager-uibunnei2019-01-079-427/+565
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt: Move profile manager to own UI tab
| * | | | | | | qt: Move profile manager to own UI tabZach Hilman2019-01-049-427/+565
| |/ / / / / /
* | | | | | | Merge pull request #1990 from ReinUsesLisp/copy-surface-stream-copybunnei2019-01-071-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | gl_rasterizer_cache: Use GL_STREAM_COPY for PBOs
| * | | | | | gl_rasterizer_cache: Use GL_STREAM_COPY for PBOsReinUsesLisp2019-01-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Since the data is doing the path CPU -> GPU -> GPU copy is the most approximate hint. Using GL_STREAM_DRAW generated a performance warning on Nvidia's stack. Changing this hint removed the warning.
* | | | | | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()
| * | | | | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Within the actual service, it makes no distinguishing between docked and undocked modes. This will always return the constants values reporting 1280x720 as the dimensions.
* | | | | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Return no application area when games try to open an application area
| * | | | | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This will prompt CreateApplicationArea
* | | | | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Proper no message handling for AM::PopMessage
| * | | | | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ / / / / | | | | | | | | | | | | | | | | | | When we have no messages, we should be returning an error code.
* | | | | | Merge pull request #1984 from ogniK5377/remove-pulseMat M2019-01-044-9/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | Removed pulse event type
| * | | | | | Removed pulse event typeDavid Marcec2019-01-044-9/+0
|/ / / / / / | | | | | | | | | | | | | | | | | | Pulse is considered a hack and nothing should be using it. We should completely remove it
* | | | | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/vi: Minor updates and corrections to the DisplayInfo struct
| * | | | | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, it appears that almost all display types seem to use 1920x1080 except for a few (null display, edid display).
| * | | | | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It appears that the two members indicate whether a display has a bounded number of layers (and if set, the second member indicates the total number of layers).
* | | | | | | Merge pull request #1979 from ogniK5377/30-fpsbunnei2019-01-041-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Fixed botw deadlock due to incorrect event signal type
| * | | | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Upon investigating the issue with #1878, I found that games are the ones who handle the vsync event resetting and not us.
* | | | | | | Merge pull request #1724 from FearlessTobi/port-4412Hexagon122019-01-031-136/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Port citra-emu/citra#4412: "CONTRIBUTING.md: migrate to the wiki"
| * | | | | | CONTRIBUTING.md: migrate to the wikiTobias2018-11-171-136/+1
| | | | | | |
* | | | | | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplay
| * | | | | | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Internally within the vi services, this is essentially all that OpenDefaultDisplay does, so it's trivial to just do the same, and forward the default display string into the function.
* | | | | | | Merge pull request #1978 from lioncash/enabledbunnei2019-01-031-1/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/vi: Implement SetDisplayEnabled()
| * | | | | | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This IPC command is simply a stub inside the actual service itself, and just returns a successful error code regardless of input. This is likely only retained in the service interface to not break older code that relied upon it succeeding in some way.
* | | | | | | | Merge pull request #1942 from DarkLordZach/profile-select-game-bootbunnei2019-01-036-0/+32
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt: Add setting to prompt for user on game boot
| * | | | | | | | qt: Add setting to prompt for user on game bootZach Hilman2018-12-256-0/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | Using the QtProfileSelectorDialog, this implementation is trivial. This mimics the real switch behavior of asking which user on every game boot, but it is default disabled as that might get inconvenient.
* | | | | | | | | Merge pull request #1941 from DarkLordZach/profile-select-save-databunnei2019-01-031-22/+16
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | qt: Use ProfileSelectionDialog when selecting user for save data
| * | | | | | | | qt: Use ProfileSelectionDialog when selecting user for save dataZach Hilman2018-12-251-22/+16
| |/ / / / / / / | | | | | | | | | | | | | | | | This allows us to present a much nicer UI to the user over a simple combo box and is made easy with the modular nature of the profile-selection applet frontend.
* | | | | | | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/vi: Log more information where applicable
| * | | | | | | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In many cases, we didn't bother to log out any of the popped data members. This logs them out to the console within the logging call to provide more contextual information.
* | | | | | | | Merge pull request #1961 from ReinUsesLisp/tex-view-2dbunnei2019-01-023-14/+74
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Texture view if shader samples array but OGL is not
| * | | | | | | | gl_rasterizer_cache: Texture view if shader samples array but OGL is notReinUsesLisp2018-12-303-14/+74
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a shader samples a texture array but that texture in OpenGL is created without layers, use a texture view to increase the texture hierarchy. For example, instead of binding a GL_TEXTURE_2D bind a GL_TEXTURE_2D_ARRAY view.
* | | | | | | | Merge pull request #1944 from FearlessTobi/port-4187bunnei2019-01-023-59/+124
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4187: "Qt/Configure: Use sidebar to divide tabs into smaller groups"
| * | | | | | | | Qt/Configure: Use sidebar to divide tabs into smaller groupsspycrab2018-12-283-59/+124
| |/ / / / / / /
* | | | | | | | Merge pull request #1969 from lioncash/castbunnei2019-01-022-3/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu: Fix truncation warnings within UI code
| * | | | | | | | yuzu/configure_general: Silence truncation warnings in loadConfiguration()Lioncash2019-01-011-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The QPixmap API expects an unsigned int.
| * | | | | | | | yuzu/config: Silence truncation warningsLioncash2019-01-011-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1970 from lioncash/headerbunnei2019-01-0216-16/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | core/kernel: Remove unnecessary inclusions
| * | | | | | | core/kernel: Remove unnecessary inclusionsLioncash2019-01-0116-16/+22
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Gets rid of a few unnecessary header dependencies in some source files.
* | | | | | | Merge pull request #1966 from lioncash/backtracebunnei2018-12-312-7/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | arm_interface: Minor cleanup
| * | | | | | | arm_interface: Make include path relative for arm_interface.hLioncash2018-12-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it consistent with the rest of the includes.
| * | | | | | | arm_interface: Make LogBacktrace() a const member functionLioncash2018-12-312-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't modify instance state, so it can be made const.
| * | | | | | | arm_interface: Mark variables as const where applicable in LogBacktrace()Lioncash2018-12-311-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two of these variables have fixed values, so we can make that immediately obvious from the get-go.
| * | | | | | | arm_interface: Remove unnecessary semicolonLioncash2018-12-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Namespaces don't require the use of a semicolon. Silences a -Wextra-semi warning.
* | | | | | | | Merge pull request #1967 from lioncash/threadbunnei2018-12-312-24/+30
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/svc: Sanitize core and priority masks within CreateThread
| * | | | | | | | kernel/svc: Correct misleading error message within CreateThread()Lioncash2018-12-311-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a bounds check to ensure that the thread priority is within the valid range of 0-64. If it exceeds 64, that doesn't necessarily mean that an actual priority of 64 was expected (it actually means whoever called the function screwed up their math). Instead clarify the message to indicate the allowed range of thread priorities.
| * | | | | | | | kernel/svc: Sanitize core number and thread priorities in CreateThread()Lioncash2018-12-311-6/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we handle the kernel capability descriptors we can correct CreateThread to properly check against the core and priority masks like the actual kernel does.
| * | | | | | | | kernel/process: Rename GetAllowedProcessorMask() and GetAllowedThreadPriorityMask()Lioncash2018-12-312-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes them consistent with their kernel capability counterparts.
| * | | | | | | | kernel/svc: Simplify thread core ID sanitizing in CreateThreadLioncash2018-12-311-7/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than use a switch here, this can be collapsed into a simple range check, which is a little easier on the eyes.
* | | | | | | | Merge pull request #1965 from lioncash/fmtbunnei2018-12-311-0/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | externals: Update fmt to 5.3.0
| * | | | | | | externals: Update fmt to 5.3.0Lioncash2018-12-301-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates fmt from 5.2.1 to 5.3.0
* | | | | | | | Merge pull request #1956 from lioncash/process-threadSebastian Valle2018-12-316-59/+53
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/process: Start the main thread using the specified ideal core
| * | | | | | | | kernel/process: Start the main thread using the specified ideal coreLioncash2018-12-281-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This matches kernel behavior in that processes are started using their specified ideal core, rather than always starting on core 0.
| * | | | | | | | kernel: Rename 'default' CPU core to 'ideal' coreLioncash2018-12-285-23/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes the naming more closely match its meaning. It's just a preferred core, not a required default core. This also makes the usages of this term consistent across the thread and process implementations.
| * | | | | | | | kernel/thread: Move process thread initialization into process.cppLioncash2018-12-283-36/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function isn't a general purpose function that should be exposed to everything, given it's specific to initializing the main thread for a Process instance. Given that, it's a tad bit more sensible to place this within process.cpp, which keeps it visible only to the code that actually needs it.
* | | | | | | | | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-306-1/+41
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Print backtrace on svcBreak
| * | | | | | | | | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-294-18/+36
| | | | | | | | | |
| * | | | | | | | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-198-47/+20
| | | | | | | | | |
| * | | | | | | | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-036-14/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Added to both dynarmic and unicorn
| * | | | | | | | | Print backtrace on svcBreakDavid Marcec2018-12-033-0/+24
| | |_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | When we get an svcBreak we get a backtrace now
* | | | | | | | | Merge pull request #1964 from lioncash/timebunnei2018-12-302-14/+18
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | service/time: Minor cleanup
| * | | | | | | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves some variables closer to their actual usage sites.
| * | | | | | | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
| | | | | | | | |
* | | | | | | | | Merge pull request #1955 from bunnei/g8r8-fixbunnei2018-12-294-79/+46
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | gpu: Remove PixelFormat G8R8U and G8R8S, as they do not seem to exist.
| * | | | | | | | gpu: Remove PixelFormat G8R8U and G8R8S, as they do not seem to exist.bunnei2018-12-284-79/+46
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | - Fixes UI rendering issues in The Legend of Zelda: Breath of the Wild.
* | | | | | | | Merge pull request #1958 from lioncash/audiobunnei2018-12-283-10/+6
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | audio_core: Convert LOG_CRITICAL + UNREACHABLE over to UNIMPLEMENTED/UNIMPLEMENTED_MSG
| * | | | | | | audio_core: Convert LOG_CRITICAL + UNREACHABLE over to UNIMPLEMENTED/UNIMPLEMENTED_MSGLioncash2018-12-283-10/+6
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These two macros being used in tandem were used prior to the introduction of UNIMPLEMENTED and UNIMPLEMENTED_MSG. This provides equivalent behavior, just with less typing/reading involved.
* | | | | | | Merge pull request #1954 from lioncash/npdmbunnei2018-12-281-3/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys/program_metadata: Print out more descriptive address space descriptions
| * | | | | | | file_sys/program_metadata: Print out more descriptive address space descriptionsLioncash2018-12-281-3/+7
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides extra information that makes it easier to tell if an executable being run is using a 36-bit address space or a 39-bit address space. While we don't support AArch32 executables yet, this also puts in distinguishing information for the 32-bit address space types as well.
* | | | | | | Merge pull request #1953 from lioncash/membunnei2018-12-284-49/+35
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | kernel/process: Remove most allocation functions from Process' interface
| * | | | | | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-284-49/+35
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In all cases that these functions are needed, the VMManager can just be retrieved and used instead of providing the same functions in Process' interface. This also makes it a little nicer dependency-wise, since it gets rid of cases where the VMManager interface was being used, and then switched over to using the interface for a Process instance. Instead, it makes all accesses uniform and uses the VMManager instance for all necessary tasks. All the basic memory mapping functions did was forward to the Process' VMManager instance anyways.
* | | | | | Merge pull request #1951 from Tinob/masterbunnei2018-12-271-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add missing uintBitsToFloat to SetRegisterToHalfFloat
| * | | | | | Add missing uintBitsToFloat to SetRegisterToHalfFloatRodolfo Bogado2018-12-271-2/+2
|/ / / / / /
* | | | | | Merge pull request #1928 from lioncash/capsbunnei2018-12-2714-125/+732
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: Handle kernel capability descriptors
| * | | | | | kernel/process: Hook up the process capability parser to the process itselfLioncash2018-12-217-122/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, we can also toss out the leftover capability parsing from Citra.
| * | | | | | kernel/process_capability: Handle debug capability flagsLioncash2018-12-212-1/+18
| | | | | | |
| * | | | | | kernel/process_capability: Handle handle table capability flagsLioncash2018-12-212-1/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This just specifies the handle table size. There's also a section of reserved bits that are checked against.
| * | | | | | kernel/process_capability: Handle kernel version capability flagsLioncash2018-12-212-1/+18
| | | | | | |
| * | | | | | kernel/process_capability: Handle program capability flagsLioncash2018-12-213-2/+29
| | | | | | |
| * | | | | | kernel/process_capability: Handle interrupt capability flagsLioncash2018-12-211-1/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to the service capability flags, however, we currently don't emulate the GIC, so this currently handles all interrupts as being valid for the time being.
| * | | | | | kernel/process_capability: Handle syscall capability flagsLioncash2018-12-212-1/+29
| | | | | | |
| * | | | | | kernel/process_capability: Handle the priority mask and core mask flagsLioncash2018-12-212-1/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Handles the priority mask and core mask flags to allow building up the masks to determine the usable thread priorities and cores for a kernel process instance.
| * | | | | | kernel/process: Introduce process capability parsing skeletonLioncash2018-12-215-3/+468
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We've had the old kernel capability parser from Citra, however, this is unused code and doesn't actually map to how the kernel on the Switch does it. This introduces the basic functional skeleton for parsing process capabilities.
| * | | | | | common: Add basic bit manipulation utility function to CommonLioncash2018-12-212-0/+62
| | | | | | |
* | | | | | | Merge pull request #1892 from Tinob/masterbunnei2018-12-271-113/+122
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Improve Zero flag implementation
| * | | | | | | Apply CC test to the final value to be stored in the registerRodolfo Bogado2018-12-261-9/+12
| | | | | | | |
| * | | | | | | Includde saturation in the evaluation of the control codeRodolfo Bogado2018-12-221-3/+4
| | | | | | | |
| * | | | | | | Handle RZ cases evaluating the expression instead of the register value.Rodolfo Bogado2018-12-221-14/+22
| | | | | | | |
| * | | | | | | complete emulation of ZeroFlagRodolfo Bogado2018-12-221-100/+97
| | | | | | | |
* | | | | | | | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid: Fix SetNpadJoyHoldType and improve logging.
| * | | | | | | | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
| | | | | | | | |
* | | | | | | | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | npad: Remove code to invert input in horizontal mode.
| * | | | | | | | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This was incorrect, the game appears to handle this for us. - Fixes horizontal mode with Puyo Puyo Tetris and Super Mario Odyssey.
* | | | | | | | | Merge pull request #1949 from lioncash/unmapbunnei2018-12-271-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/vm_manager: Reset region attributes when unmapping a VMA
| * | | | | | | | | kernel/vm_manager: Reset region attributes when unmapping a VMALioncash2018-12-271-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other members related to memory regions, the attributes need to be reset back to their defaults as well.
* | | | | | | | | | Merge pull request #1879 from DarkLordZach/am-save-data-sizebunnei2018-12-2715-32/+199
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | am: Implement GetSaveDataSize and ExtendSaveData using files
| * | | | | | | | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-276-8/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions come in a pair and are needed by Smash Ultimate, Minecraft, and Skyrim, amongst others.
| * | | | | | | | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
| | | | | | | | | | |
| * | | | | | | | | | savedata_factory: Partially implement IVFC save sizes using filesZach Hilman2018-12-272-0/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This stores a file in the save directory called '.yuzu_save_size' which stores the two save sizes (normal area and journaled area) sequentially as u64s.
| * | | | | | | | | | loader: Add accessor for game control dataZach Hilman2018-12-275-9/+14
| | | | | | | | | | |
| * | | | | | | | | | control_metadata: Update NACP fields with latest Switchbrew dataZach Hilman2018-12-272-6/+29
| | | | | | | | | | |
| * | | | | | | | | | control_metadata: Use value member instead of unique_ptr to store structZach Hilman2018-12-272-10/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Serves no actual purpose in this instance besides making NACP's copy assignment deleted, which is not intended behavior.
| * | | | | | | | | | vfs: Add reinterpret_casts to WriteArray and ObjectZach Hilman2018-12-271-2/+2
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | Allows these functions to compile when T is not u8.
* | | | | | | | | | Merge pull request #1946 from lioncash/declbunnei2018-12-271-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | renderer_opengl: Correct forward declaration of FramebufferLayout
| * | | | | | | | | | renderer_opengl: Correct forward declaration of FramebufferLayoutLioncash2018-12-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is actually a struct, not a class, which can lead to compilation warnings.
* | | | | | | | | | | Merge pull request #1948 from lioncash/translatablebunnei2018-12-271-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | configure_per_general: Mark UI strings as translatable in the constructor
| * | | | | | | | | | configure_per_general: Mark UI strings as translatable in the constructorLioncash2018-12-261-2/+2
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are user-facing strings, so they should be translatable.
* | | | | | | | | | Merge pull request #1947 from lioncash/initbunnei2018-12-271-12/+7
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | configure_input_simple: Make input profile array constexpr
| * | | | | | | | | configure_input_simple: Make input profile array constexprLioncash2018-12-261-12/+7
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Calling tr() from a file-scope array isn't advisable, since it can be executed before the Qt libraries are even fully initialized, which can lead to crashes. Instead, the translatable strings should be annotated, and the tr() function should be called at the string's usage site.
* | | | | | | | | Fixed shader linking error due to TLDS (#1934)David2018-12-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed shader linking error due to TLDS coord should be coords * Fix remaining coords
* | | | | | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-265-6/+77
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | svc: Implement SetThreadActivity (thread suspension)
| * | | | | | | | | debugger: Set paused thread colorLuke Street2018-12-041-1/+2
| | | | | | | | | |
| * | | | | | | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-045-6/+76
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1943 from ReinUsesLisp/fixup-texsbunnei2018-12-261-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | shader_bytecode: Fixup TEXS.F16 encoding
| * | | | | | | | | shader_bytecode: Fixup TEXS.F16 encodingReinUsesLisp2018-12-261-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1886 from FearlessTobi/port-4164bunnei2018-12-2315-43/+228
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4164: "citra_qt, video_core: Screenshot functionality"
| * | | | | | | | | yuzu, video_core: Screenshot functionalityzhupengfei2018-12-1815-43/+228
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Allows capturing screenshot at the current internal resolution (native for software renderer), but a setting is available to capture it in other resolutions. The screenshot is saved to a single PNG in the current layout.
* | | | | | | | | Merge pull request #1930 from lioncash/commonbunnei2018-12-231-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/quaternion: Ensure that w is always initialized
| * | | | | | | | | common/quaternion: Ensure that w is always initializedLioncash2018-12-211-1/+1
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously xyz was always being zero initialized due to its constructor, but w wasn't. Ensures that we always have a deterministic initial state.
* | | | | | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-2313-0/+466
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | am: Implement HLE profile selector applet
| * | | | | | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-035-14/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes bugs relating to signalling in software keyboard.
| * | | | | | | | | qt: Implement GUI dialog frontend for ProfileSelectorZach Hilman2018-12-036-0/+269
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Presents profiles in a list, similar to switch.
| * | | | | | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| | | | | | | | | |
| * | | | | | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the player to select an emulated profile.
| * | | | | | | | | qt: Register to use Qt ProfileSelector instead of defaultZach Hilman2018-12-031-0/+2
| | | | | | | | | |
| * | | | | | | | | core: Add getter/setter for ProfileSelector in SystemZach Hilman2018-12-032-0/+16
| | | | | | | | | |
| * | | | | | | | | frontend: Add frontend applet for ProfileSelectZach Hilman2018-12-033-0/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Responsible for selecting a profile and firing callback upon completion.
| * | | | | | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, ILibraryAppletAccessor would signal upon creation of any applet, but this is incorrect. A flag inside of the applet code determines whether or not creation should signal state change and swkbd happens to be one of these applets.
* | | | | | | | | | Merge pull request #1780 from DarkLordZach/controller-profilesbunnei2018-12-2312-66/+401
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | configure_input: Add Controller Setup Profiles and simplify input UI
| * | | | | | | | | configure_input_simple: Properly signal docked mode changeZach Hilman2018-12-053-33/+31
| | | | | | | | | |
| * | | | | | | | | configure_input: Add ConfigureInputSimple as default input UI configZach Hilman2018-12-058-1/+293
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Greatly simplifies the current input UI, while still allowing power users to tweak advanced settings. Adds 'input profiles', which are easy autoconfigurations to make getting started easy and fast. Also has a custom option which brings up the current, full UI.
| * | | | | | | | | configure_input: Convert into QDialogZach Hilman2018-12-053-7/+47
| | | | | | | | | |
| * | | | | | | | | configure: Use ConfigureInputSimple for Input tabZach Hilman2018-12-051-26/+26
| | | | | | | | | |
| * | | | | | | | | ui_settings: Add UI setting for input profile indexZach Hilman2018-12-052-0/+5
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-2114-3/+34
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fixed uninitialized memory due to missing returns in canary
| * | | | | | | | | | hopefully fix clang format issueDavid Marcec2018-12-191-0/+1
| | | | | | | | | | |
| * | | | | | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-1914-3/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Functions which are suppose to crash on non canary builds usually don't return anything which lead to uninitialized memory being used.
* | | | | | | | | | | Merge pull request #1920 from heapo/texture_format_selectionbunnei2018-12-211-1/+11
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Texture format fixes for RGBA16UI for copies and R16U when used as depth
| * | | | | | | | | | | Texture format fixes: Flag RGBA16UI as GL_RGBA_INTEGER format, and interpret R16U as Z16 when depth_compare is enabled.heapo2018-12-181-1/+11
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-217-28/+59
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | kernel/{process, thread}: Amend behavior related to IDs
| * | | | | | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a thread handle is passed to svcGetProcessId, the kernel attempts to access the process ID via the thread's instance's owning process. Technically, this function should also be handling the kernel debug objects as well, however we currently don't handle those kernel objects yet, so I've left a note via a comment about it to remind myself when implementing it in the future.
| * | | | | | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Starts the process ID counter off at 81, which is what the kernel itself checks against internally when creating processes. It's actually supposed to panic if the PID is less than 81 for a userland process.
| * | | | | | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The service call uses a 64-bit value, just like svcGetProcessId. This amends the function signature accordingly.
| * | | | | | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-194-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel uses a 64-bit value for the thread ID, so we shouldn't be using a 32-bit value.
| * | | | | | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcGetProcessId's out parameter is a pointer to a 64-bit value, not a 32-bit one.
| * | | | | | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the actual kernel, this is a 64-bit value, so we shouldn't be using a 32-bit type to handle it.
* | | | | | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | service/am: Unstub GetAppletResourceUserId
| * | | | | | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is supposed to return the current process' ID. (0 indicates an invalid ID for both process IDs and ARU IDs).
* | | | | | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Device handle should not be a random id, instead it's the current npad id
| * | | | | | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Found during hardware testing
* | | | | | | | | | | Merge pull request #1909 from heapo/shadow_sampling_fixesbunnei2018-12-191-16/+14
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Fix arrayed texture LOD selection and depth comparison ordering
| * | | | | | | | | | | Fix arrayed shadow sampler array slice/depth comparison ordering, as well as invalid GLSL LOD selection.heapo2018-12-171-16/+14
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | | service/sm: Improve debug log for RegisterService
| * | | | | | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now it also indicates the name and max session count. This also gives a name to the unknown bool. This indicates if the created port is supposed to be using light handles or regular handles internally. This is passed to the respective svcCreatePort parameter internally.
* | | | | | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | kernel/svc: Implement svcSetMemoryAttribute
| * | | | | | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all the basic backing functionality implemented, we can now unstub svcSetMemoryAttribute.
| * | | | | | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This puts the backing functionality for svcSetMemoryAttribute in place, which will be utilized in a following change.
| * | | | | | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| | | | | | | | | |
| * | | | | | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is shorter and more concise. This also removes the now-innaccurate comment, as it's not returned wholesale to svcQueryMemory anymore.
| * | | | | | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the barebones enumeration constants and functions in place to handle memory attributes, while also essentially leaving the attribute itself non-functional.
* | | | | | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/thread: Set default fpcr
| * | | | | | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1918 from MerryMage/cntfrqbunnei2018-12-181-0/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | arm_dynarmic: Set CNTFRQ value
| * | | | | | | | | | arm_dynarmic: Set CNTFRQ valueMerryMage2018-12-181-0/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1917 from ReinUsesLisp/fixup-halfbunnei2018-12-181-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | shader_bytecode: Fixup half float's operator B encoding
| * | | | | | | | | | shader_bytecode: Fixup half float's operator B encodingReinUsesLisp2018-12-181-1/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | applets: Correct usage of SignalStateChanged event
| * | | | | | | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | |_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This was causing some games (most notably Pokemon Quest) to softlock due to an event being fired when not supposed to. This also removes a hack wherein we were firing the state changed event when the game retrieves it, which is incorrect.
* | | | | | | | | | Merge pull request #1903 from heapo/fmul_postfactorbunnei2018-12-182-5/+21
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | Implement postfactor multiplication/division for fmul instructions
| * | | | | | | | | Implement postfactor multiplication/division for fmul instructionsheapo2018-12-172-5/+21
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | nvhost_gpu: Skip empty GPU command lists.
| * | | | | | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | Fix Service object leak on emulation stop
| * | | | | | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Services created with the ServiceFramework base class install themselves as HleHandlers with an owning shared_ptr in the ServerPort ServiceFrameworkBase::port member variable, creating a cyclic ownership between ServiceFrameworkBase and the ServerPort, preventing deletion of the service objects. Fix that by removing the ServiceFrameworkBase::port member because that was only used to detect multiple attempts at installing a port. Instead store a flag if the port was already installed to achieve the same functionality.
* | | | | | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-155-9/+181
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | svc: Implement yield types 0 and -1
| * | | | | | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| | | | | | | | | | |
| * | | | | | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will automatically occur anyway when PrepareReschedule is called
| * | | | | | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| | | | | | | | | | |
| * | | | | | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| | | | | | | | | | |
| * | | | | | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-226-79/+141
| | | | | | | | | | |
| * | | | | | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-196-2/+130
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1902 from lioncash/audiobunnei2018-12-157-36/+58
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | audio_core: Make g_sink_details internally linked
| * | | | | | | | | | audio_core: Make g_sink_details internally linkedLioncash2018-12-137-36/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can hide the direct array from external view and instead provide functions to retrieve the necessary info. This has the benefit of completely hiding the makeup of the SinkDetails structure from the rest of the code. Given that this makes the array hidden, we can also make the array constexpr by altering the members slightly. This gets rid of several static constructor calls related to std::vector and std::function. Now we don't have heap allocations here that need to occur before the program can even enter main(). It also has the benefit of saving a little bit of heap space, but this doesn't matter too much, since the savings in that regard are pretty tiny.
* | | | | | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | vm_manager/svc: Modify MemoryState enum, and correct error handling for svcQueryMemory
| * | | | | | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcQueryProcessMemory is trivial to implement, given all the behavior necessary for it is present, it just needs a handler for it.
| * | | | | | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the previous change, the memory writing was moved into the service function itself, however it still had a problem, in that the entire MemoryInfo structure wasn't being written out, only the first 32 bytes of it were being written out. We still need to write out the trailing two reference count members and zero out the padding bits. Not doing this can result in wrong behavior in userland code in the following scenario: MemoryInfo info; // Put on the stack, not quaranteed to be zeroed out. svcQueryMemory(&info, ...); if (info.device_refcount == ...) // Whoops, uninitialized read. This can also cause the wrong thing to happen if the user code uses std::memcmp to compare the struct, with another one (questionable, but allowed), as the padding bits are not guaranteed to be a deterministic value. Note that the kernel itself also fully zeroes out the structure before writing it out including the padding bits.
| * | | | | | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the memory writes directly into QueryProcessMemory instead of letting the wrapper function do it. It would be inaccurate to allow the handler to do it because there's cases where memory shouldn't even be written to. For example, if the given process handle is invalid. HOWEVER, if the memory writing is within the wrapper, then we have no control over if these memory writes occur, meaning in an error case, 68 bytes of memory randomly get trashed with zeroes, 64 of those being written to wherever the memory info address points to, and the remaining 4 being written wherever the page info address points to. One solution in this case would be to just conditionally check within the handler itself, but this is kind of smelly, given the handler shouldn't be performing conditional behavior itself, it's a behavior of the managed function. In other words, if you remove the handler from the equation entirely, does the function still retain its proper behavior? In this case, no. Now, we don't potentially trash memory from this function if an invalid query is performed.
| * | | | | | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These should be swapped.
| * | | | | | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel returns a memory info instance with the base address set to the end of the address space, and the size of said block as 0 - address_space_end, it doesn't set both of said members to zero.
| * | | | | | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to directly access the managed VMAs outside of the memory manager itself just for querying memory.
| * | | | | | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets the two structures out of an unrelated header and places them with the rest of the memory management code. This also corrects the structures. PageInfo appears to only contain a 32-bit flags member, and the extra padding word in MemoryInfo isn't necessary.
| * | | | | | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends the MemoryState enum to use the same values like the actual kernel does. Also provides the necessary operators to operate on them. This will be necessary in the future for implementing svcSetMemoryAttribute, as memory block state is checked before applying the attribute.
* | | | | | | | | | | Merge pull request #1871 from lioncash/movebunnei2018-12-142-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | yuzu/wait_tree: Pass QString by value and std::move in the initializer list for WaitTreeText
| * | | | | | | | | | | yuzu/wait_tree: Pass QString by value and std::move in the initializer list for WaitTreeTextLioncash2018-12-062-2/+2
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Just a trivial modernization that potentially avoids copying strings in certain scenarios.
* | | | | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | svc_wrap: Correct register index for a wrapper specialization
| * | | | | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This would result in svcSetMemoryAttribute getting the wrong value for its third parameter. This is currently fine, given the service function is stubbed, however this will be unstubbed in a future change, so this needs to change.
* | | | | | | | | | Merge pull request #1890 from jschmer/masterMat M2018-12-123-13/+12
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fix Process object leak on emulation stop
| * | | | | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Process object kept itself alive indefinitely because its handle_table contains a SharedMemory object which owns a reference to the same Process object, creating a circular ownership scenario. Break that up by storing only a non-owning pointer in the SharedMemory object.
* | | | | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | fsp_srv: Implement IStorage::GetSize
| * | | | | | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Takes no input and returns the size as a u64. Needed by Katamari Damacy Reroll to boot.
* | | | | | | | | | Merge pull request #1893 from lioncash/warnbunnei2018-12-121-3/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_shader_cache: Resolve truncation compiler warning
| * | | | | | | | | | gl_shader_cache: Dehardcode constant in CalculateProgramSize()Lioncash2018-12-111-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This constant is related to the size of the instruction.
| * | | | | | | | | | gl_shader_cache: Resolve truncation compiler warningLioncash2018-12-111-1/+1
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous code would cause a warning, as it was truncating size_t (64-bit) to a u32 (32-bit) implicitly.
* | | | | | | | | | Merge pull request #1895 from lioncash/uninitbunnei2018-12-121-4/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFS
| * | | | | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFSLioncash2018-12-111-4/+3
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | fmt::format() returns a std::string instance by value, so calling .c_str() on it here is equivalent to doing: auto* ptr = std::string{}.c_str(); The data being pointed to isn't guaranteed to actually be valid anymore after that expression ends. Instead, we can just take the string as is, and provide the necessary formatting parameters.
* | | | | | | | | | Merge pull request #1877 from heapo/audio_interpbunnei2018-12-112-4/+8
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Perf: Avoid (expensive) audio interpolation when sample rates already match
| * | | | | | | | | | Avoid (expensive) audio interpolation when sample rates already matchheapo2018-12-062-4/+8
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1888 from marcosvitali/glFrontFacingbunnei2018-12-111-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | gl_shader_decompiler: IPA fix FrontFacing.
| * | | | | | | | | | gl_shader_decompiler: IPA FrontFacing: the right value when is the front face is 0xFFFFFFFF.Marcos Vitali2018-12-101-1/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1846 from lioncash/dirbunnei2018-12-111-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | file_sys/directory: Amend path buffer size for directory entries
| * | | | | | | | | | | file_sys/directory: Amend path buffer size for directory entriesLioncash2018-12-031-2/+2
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The path buffer is actually 0x301 (769) characters in length, with the extra character being intended for the null-terminator.
* | | | | | | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-1123-15/+691
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | patch_manager: Add support for disabling patches
| * | | | | | | | | | | qt: Add Properties menu to game list right-clickZach Hilman2018-12-049-22/+54
| | | | | | | | | | | |
| * | | | | | | | | | | qt: Add UI to display game properties and disable add-onsZach Hilman2018-12-034-0/+501
| | | | | | | | | | | |
| * | | | | | | | | | | loader: Add support for reading the name of game's developerZach Hilman2018-12-035-0/+26
| | | | | | | | | | | |
| * | | | | | | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| | | | | | | | | | | |
| * | | | | | | | | | | patch_manager: Obey disabled add-ons list when patching gameZach Hilman2018-12-032-11/+50
| | | | | | | | | | | |
| * | | | | | | | | | | core: Make GetGameFileFromPath function externally accessibleZach Hilman2018-12-032-3/+9
| | | | | | | | | | | |
| * | | | | | | | | | | config: Store and load disabled add-ons listZach Hilman2018-12-033-0/+55
| | | | | | | | | | | |
| * | | | | | | | | | | settings: Store list of disabled add-ons per title IDZach Hilman2018-12-031-0/+5
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1887 from FearlessTobi/port-4476bunnei2018-12-111-8/+4
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4476: "web_service: move telemetry condition from TelemetrySession constructor to destructor"
| * | | | | | | | | | | web_service: move telemetry condition from TelemetrySession constructor to destructorfearlessTobi2018-12-081-8/+4
| | |_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes an issue where Testcases couldn't be sent when Telemetry was disabled, because both things are tied closely together in the backend.
* | | | | | | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()
| * | | | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, the backing code only ever seems to use 0-2 as the range of values 1 being a generic log enable, with 2 indicating logging should go to the SD card. These are used as a set of flags internally. Given we only care about receiving the log in general, we can just always signify that we want logging in general.
* | | | | | | | | | | | Merge pull request #1885 from lioncash/data_idbunnei2018-12-111-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enum
| * | | | | | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enumLioncash2018-12-081-1/+3
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends it with missing values deduced from RE (ProperSystem being from SwitchBrew for naming) (SdCardUser wasn't that difficult to discern given it's used alongside SdCardSystem when creating the save data indexer, based off the usage of the string "saveDataIxrDbSd" nearby).
* | | | | | | | | | | | Merge pull request #1740 from FernandoS27/shader_propsbunnei2018-12-104-0/+57
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Implemented Shader Unique Identifiers
| * | | | | | | | | | | | Implemented a shader unique identifier.Fernando Sahmkow2018-12-094-0/+57
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | kernel/process: Set ideal core from metadata
| * | | | | | | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A very trivial change. If metadata is available, the process should use it to retrieve the desired core for the process to run on.
* | | | | | | | | | | | Merge pull request #1880 from DarkLordZach/cache-storageHexagon122018-12-101-1/+7
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | savedata_factory: Add CacheStorage and delete TemporaryStorage on boot
| * | | | | | | | | | | | savedata_factory: Add support for CacheStorageZach Hilman2018-12-071-0/+2
| | | | | | | | | | | | |
| * | | | | | | | | | | | savedata_factory: Delete TemporaryStorage on startupZach Hilman2018-12-071-1/+5
| | |/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Mimics hardware behavior.
* | | | | | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-105-28/+41
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | vm_manager: Make vma_map private
| * | | | | | | | | | | | memory: Convert ASSERT into a DEBUG_ASSERT within GetPointerFromVMA()Lioncash2018-12-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given memory should always be expected to be valid during normal execution, this should be a debug assertion, rather than a check in regular builds.
| * | | | | | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-065-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was only ever public so that code could check whether or not a handle was valid or not. Instead of exposing the object directly and allowing external code to potentially mess with the map contents, we just provide a member function that allows checking whether or not a handle is valid. This makes all member variables of the VMManager class private except for the page table.
* | | | | | | | | | | | | Merge pull request #1862 from marcosvitali/tldsbunnei2018-12-101-106/+134
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | | gl_shader_decompiler: TLDS/TLD4/TLD4S Reworked reflecting the source registers, bugs fixed and modularize.
| * | | | | | | | | | | | gl_shader_decompiler: TLDS/TLD4/TLD4S Reworked reflecting the source registers, bugs fixed and modularize.Marcos Vitali2018-12-071-106/+134
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service/ldr: Amend layouts of NRO and NRR headers
| * | | | | | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The first word is just a padding byte, it's not an actual entry instruction. Also renames the rest of the entries according to SwitchBrew.
| * | | | | | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The padding after the magic signature value should be 12 bytes rather than 28 bytes. The other 16 should be placed after the title ID pattern.
* | | | | | | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | hle/service, hle/sm: Minor cleanup
| * | | | | | | | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Combines the two into one, shortening the amount of code here.
| * | | | | | | | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only one usage of the specified objects made use of the lack of namespacing. Given the low usage, we can just remove these.
| * | | | | | | | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These auto-deduce the result based off its arguments, so there's no need to do that work for the compiler, plus, the function return value itself already indicates what we're returning.
| * | | | | | | | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to keep the variables separate from their actual initialization spots.
* | | | | | | | | | | | | Merge pull request #1882 from FearlessTobi/backport-4418-fixbunnei2018-12-081-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Backport review comment from citra-emu/citra#4418
| * | | | | | | | | | | | | Backport review comment from citra-emu/citra#4418Tobias2018-12-071-2/+2
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Original reason: As Windows multi-byte character codec is unspecified while we always assume std::string uses UTF-8 in our code base, this can output gibberish when the string contains non-ASCII characters. ::OutputDebugStringW combined with Common::UTF8ToUTF16W is preferred here.
* | | | | | | | | | | | | Merge pull request #1873 from lioncash/constbunnei2018-12-0811-19/+25
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | loaders: Make GetFileType() a const qualified member function
| * | | | | | | | | | | | yuzu/game_list_worker: Don't retrieve the file type twice in AddFstEntriesToGameList()Lioncash2018-12-051-5/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similarly, here we can avoid doing unnecessary work twice by retrieving the file type only once and comparing it against relevant operands, avoiding potential unnecessary object construction/destruction.
| * | | | | | | | | | | | yuzu/game_list_worker: Don't retrieve file type and file type strings twice in MakeGameListEntry()Lioncash2018-12-051-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While GetFileType() is indeed a getter function, that doesn't mean it's a trivial function, given some case require reading from the data or constructing other objects in the background. Instead, only do necessary work once.
| * | | | | | | | | | | | loaders: Make GetFileType() a const qualified member functionLioncash2018-12-0510-10/+10
| | |_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | No implementations actually modify instance state (and it would be questionable to do that in the first place given the name), so we can make this a const member function.
* | | | | | | | | | | | Merge pull request #1868 from lioncash/configbunnei2018-12-061-43/+38
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | configuration/config: Use an intermediary variable for accessing players
| * | | | | | | | | | | | configuration/config: Use an intermediary variable for accessing playersLioncash2018-12-051-43/+38
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids typing the same long accessor just to retrieve player attributes.
* | | | | | | | | | | | Merge pull request #1875 from DarkLordZach/oss-ngword2bunnei2018-12-063-1/+41
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | system_archive: Implement open source NgWord2
| * | | | | | | | | | | | system_archive: Implement open source NgWord2Zach Hilman2018-12-063-1/+41
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | kernel/svc: Correct behavior of svcResetSignal()
| * | | | | | | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While partially correct, this service call allows the retrieved event to be null, as it also uses the same handle to check if it was referring to a Process instance. The previous two changes put the necessary machinery in place to allow for this, so we can simply call those member functions here and be done with it.
| * | | | | | | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Process instances can be waited upon for state changes. This is also utilized by svcResetSignal, which will be modified in an upcoming change. This simply puts all of the WaitObject related machinery in place.
| * | | | | | | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcResetSignal relies on the event instance to have already been signaled before attempting to reset it. If this isn't the case, then an error code has to be returned.
* | | | | | | | | | | | Merge pull request #1824 from ReinUsesLisp/fbcachebunnei2018-12-062-40/+82
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Implement a framebuffer cache
| * | | | | | | | | | | | gl_rasterizer: Implement a framebuffer cacheReinUsesLisp2018-11-292-40/+82
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1863 from ReinUsesLisp/texs-f16bunnei2018-12-062-18/+55
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | | gl_shader_decompiler: Implement TEXS.F16
| * | | | | | | | | | | | gl_shader_decompiler: Implement TEXS.F16ReinUsesLisp2018-12-052-13/+51
| | | | | | | | | | | | |
| * | | | | | | | | | | | gl_shader_decompiler: Fixup inverted ifReinUsesLisp2018-12-051-6/+5
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1867 from lioncash/allocbunnei2018-12-062-4/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | system_archive: Use a regular function pointer instead of std::function for the file-scope system archive array
| * | | | | | | | | | | | ng_word: Deduplicate use of a constant valueLioncash2018-12-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We've already given the constant to the vector itself, so we don't need to re-hardcode it in the array.
| * | | | | | | | | | | | system_archive: Use a regular function pointer instead of std::function for file-scope system archive arrayLioncash2018-12-051-3/+2
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows the array to be constexpr. std::function is also allowed to allocate memory, which makes its constructor non-trivial, we definitely don't want to have all of these execute at runtime, taking up time before the application can actually load.
* | | | | | | | | | | | Merge pull request #1866 from lioncash/cachebunnei2018-12-061-8/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()
| * | | | | | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| | |_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to specify all of the ARM interfaces explicitly.
* | | | | | | | | | | Merge pull request #1870 from heapo/pagetable_shrink_to_fitMat M2018-12-061-0/+8
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | Perf: Call shrink_to_fit after page-table vector resizing to actually reduce vector capacity
| * | | | | | | | | | Call shrink_to_fit after page-table vector resizing to cause crt to actually lower vector capacity. For 36-bit titles saves 800MB of commit.heapo2018-12-051-0/+8
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1859 from heapo/lut_array_codegenbunnei2018-12-051-275/+277
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | Convert high-frequency LUT arrays from constexpr to static constexpr
| * | | | | | | | | Improve msvc codegen for hot-path array LUTsheapo2018-12-051-275/+277
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In some constexpr functions, msvc is building the LUT at runtime (pushing each element onto the stack) out of an abundance of caution. Moving the arrays into be file-scoped constexpr's avoids this and turns the functions into simple look-ups as intended.
* | | | | | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-058-1/+227
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | file_sys: Implement open source system archives
| * | | | | | | | | | file_sys: Implement system archive synthesizer for NgWord (806)Zach Hilman2018-11-235-6/+61
| | | | | | | | | | |
| * | | | | | | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| | | | | | | | | | |
| * | | | | | | | | | file_sys: Add framework for synthesizing open source archivesZach Hilman2018-11-163-0/+109
| | | | | | | | | | |
| * | | | | | | | | | vfs_vector: Add VFS backend for std::arrayZach Hilman2018-11-161-0/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows using constexpr/static const data with VFS.
* | | | | | | | | | | Merge pull request #1837 from lioncash/mapbunnei2018-12-051-59/+46
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | yuzu/game_list_worker: Minor cleanup and code deduplication
| * | | | | | | | | | yuzu/game_list_worker: Move std::string construction after the termination check in callbacksLioncash2018-12-051-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially allocating a std::string instance when it isn't needed.
| * | | | | | | | | | yuzu/game_list_worker: Deduplicate game list entry creationLioncash2018-12-021-47/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids duplicating the same code twice verbatim.
| * | | | | | | | | | yuzu/game_list_worker: Tidy up string handling in FillControlMap()Lioncash2018-12-021-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to call out to our own file handling functions when we're going to construct a QFileInfo instance right after it. We also don't need to convert to a std::string again just to compare the file extension.
* | | | | | | | | | | Merge pull request #1838 from lioncash/dedupbunnei2018-12-051-27/+26
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | file_sys/registered_cache: Eliminate variable shadowing
| * | | | | | | | | | | file_sys/registered_cache: Eliminate variable shadowingLioncash2018-12-021-27/+26
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also inverts if statements where applicable to allow unindenting code a little bit.
* | | | | | | | | | | Merge pull request #1836 from lioncash/unusedbunnei2018-12-051-1/+0
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()
| * | | | | | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()Lioncash2018-12-021-1/+0
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1860 from lioncash/eventbunnei2018-12-052-3/+58
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | kernel/svc: Implement svcCreateEvent and svcSignalEvent
| * | | | | | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
| | | | | | | | | | |
| * | | | | | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function simply does a handle table lookup for a writable event instance identified by the given handle value. If a writable event cannot be found for the given handle, then an invalid handle error is returned. If a writable event is found, then it simply signals the event, as one would expect.
| * | | | | | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcCreateEvent operates by creating both a readable and writable event and then attempts to add both to the current process' handle table. If adding either of the events to the handle table fails, then the relevant error from the handle table is returned. If adding the readable event after the writable event to the table fails, then the writable event is removed from the handle table and the relevant error from the handle table is returned. Note that since we do not currently test resource limits, we don't check the resource limit table yet.
* | | | | | | | | | Merge pull request #1845 from lioncash/nrobunnei2018-12-045-19/+23
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | loader/{nro, nso}: Remove dependency on the System class
| * | | | | | | | | | loader/nso: Remove dependency on the System classLioncash2018-12-033-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to the NRO changes, we can also pass the process explicitly as a parameter from Load instead of indirecting through the System class.
| * | | | | | | | | | loader/nro: Make the static LoadNro function internally linkedLioncash2018-12-032-7/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This simply acts as a forwarding function for the Load() function, so this doesn't need to be directly exposed.
| * | | | | | | | | | loader/nro: Remove dependency on the System classLioncash2018-12-032-10/+13
| | |_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Load() is already given the process instance as a parameter, so instead of coupling the class to the System class, we can just forward that parameter to LoadNro()
* | | | | | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-046-11/+20
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/object: Amend handle types to distinguish between readable and writable events
| * | | | | | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-046-11/+20
| | |_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two kernel object should absolutely never have the same handle ID type. This can cause incorrect behavior when it comes to retrieving object types from the handle table. In this case it allows converting a WritableEvent into a ReadableEvent and vice-versa, which is undefined behavior, since the object types are not the same. This also corrects ClearEvent() to check both kernel types like the kernel itself does.
* | | | | | | | | | Rewrited TEX/TEXS (TEX Scalar). (#1826)Marcos2018-12-041-259/+177
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Rewrited TEX/TEXS (TEX Scalar). * Style fixes. * Styles issues.
* | | | | | | | | | Merge pull request #1857 from lioncash/res-infobunnei2018-12-045-11/+37
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/svc: Implement the resource limit svcGetInfo option
| * | | | | | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another hold-over from Citra.
| * | | | | | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows a process to register the resource limit as part of its handle table.
* | | | | | | | | | Merge pull request #1854 from Subv/old_command_processorbunnei2018-12-042-142/+6
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | Don't try to route PFIFO methods (0-0x40) to the other engines.
| * | | | | | | | | Removed unused file.Subv2018-12-041-142/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a leftover from #1792
| * | | | | | | | | GPU: Don't try to route PFIFO methods (0-0x40) to the other engines.Subv2018-12-041-0/+6
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1852 from VPeruS/fix-format-stringMat M2018-12-041-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's arguments
| * | | | | | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categories
| * | | | | | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel uses the handle table of the current process to retrieve the process that should be used to retrieve certain information. To someone not familiar with the kernel, this might raise the question of "Ok, sounds nice, but doesn't this make it impossible to retrieve information about the current process?". No, it doesn't, because HandleTable instances in the kernel have the notion of a "pseudo-handle", where certain values allow the kernel to lookup objects outside of a given handle table. Currently, there's only a pseudo-handle for the current process (0xFFFF8001) and a pseudo-handle for the current thread (0xFFFF8000), so to retrieve the current process, one would just pass 0xFFFF8001 into svcGetInfo. The lookup itself in the handle table would be something like: template <typename T> T* Lookup(Handle handle) { if (handle == PSEUDO_HANDLE_CURRENT_PROCESS) { return CurrentProcess(); } if (handle == PSUEDO_HANDLE_CURRENT_THREAD) { return CurrentThread(); } return static_cast<T*>(&objects[handle]); } which, as is shown, allows accessing the current process or current thread, even if those two objects aren't actually within the HandleTable instance.
| * | | | | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Our implementation of svcGetInfo was slightly incorrect in that we weren't doing proper error checking everywhere. Instead, reorganize it to be similar to how the kernel seems to do it.
* | | | | | | | Merge pull request #1842 from lioncash/slotbunnei2018-12-039-14/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu/configuration: Minor clean-up related changes
| * | | | | | | | yuzu/configuration: Make slots private where applicableLioncash2018-12-025-7/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These slots are only ever attached to event handling mechanisms within the class itself, they're never used externally. Because of this, we can make the functions private. This also removes redundant usages of the private access specifier.
| * | | | | | | | yuzu/configuration: Add missing override specifiers to configuration-related classesLioncash2018-12-027-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves trivial compiler warnings.
| * | | | | | | | yuzu/configuration/configure_input: Default destructor in the cpp fileLioncash2018-12-022-0/+3
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous code could potentially be a compilation issue waiting to occur, given we forward declare the type for a std::unique_ptr. If the complete definition of the forward declared type isn't visible in a translation unit that the class is used in, then it would fail to compile. Defaulting the destructor in a cpp file ensures the std::unique_ptr's destructor is only invoked where its complete type is known.
* | | | | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-038-40/+26
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | filesystem: De-globalize registered_cache_union
| * | | | | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-028-40/+26
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just return a new instance of this when it's requested. This only ever holds pointers to the existing registed caches, so it's not a large object. Plus, this also gets rid of the need to keep around a separate member function just to properly clear out the union. Gets rid of one of five globals in the filesystem code.
* | | | | | | | Merge pull request #1822 from ReinUsesLisp/glsl-scopebunnei2018-12-031-250/+213
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Introduce a scoped object and style changes
| * | | | | | | | gl_shader_decompiler: Remove texture temporal in TLD4ReinUsesLisp2018-11-291-3/+1
| | | | | | | | |
| * | | | | | | | gl_shader_decompiler: Flip negated if else statementReinUsesLisp2018-11-291-3/+3
| | | | | | | | |
| * | | | | | | | gl_shader_decompiler: Use GLSL scope on instructions unrelated to texturesReinUsesLisp2018-11-291-35/+10
| | | | | | | | |
| * | | | | | | | gl_shader_decompiler: Move texture code generation into lambdasReinUsesLisp2018-11-291-97/+78
| | | | | | | | |
| * | | | | | | | gl_shader_decompiler: Clean up texture instructionsReinUsesLisp2018-11-291-87/+56
| | | | | | | | |
| * | | | | | | | gl_shader_decompiler: Scope GLSL variables with a scoped objectReinUsesLisp2018-11-291-32/+72
| | | | | | | | |
* | | | | | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0337-247/+410
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel: Divide Event into ReadableEvent and WritableEvent
| * | | | | | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| | | | | | | | | |
| * | | | | | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2932-317/+175
| | | | | | | | | |
| * | | | | | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2929-164/+287
| | | | | | | | | |
| * | | | | | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| | | | | | | | | |
| * | | | | | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used to store ReadableEvents of all events on the system.
| * | | | | | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-296-61/+210
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | More hardware accurate. On the actual system, there is a differentiation between the signaler and signalee, they form a client/server relationship much like ServerPort and ClientPort.
| * | | | | | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-035-5/+97
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service/fsp_srv: Implement CleanDirectoryRecursively
| * | | | | | | | | file_sys: Override missing mutating functions to be stubbed out for ReadOnlyVfsDirectory by defaultLioncash2018-12-012-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that read only indeed means read only.
| * | | | | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-015-5/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the same behavior-wise as DeleteDirectoryRecursively, with the only difference being that it doesn't delete the top level directory in the hierarchy, so given: root_dir/ - some_dir/ - File.txt - OtherFile.txt The end result is just: root_dir/
* | | | | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service/audio/audout_u: Amend constructor initialization list order
| * | | | | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the constructor initializer list the same way the members of the class are declared. Prevents -Wreorder warnings
* | | | | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fixed crash with SetNpadMode
| * | | | | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | fixed crash due to handheld
* | | | | | | | | | Merge pull request #1843 from lioncash/tableSebastian Valle2018-12-032-6/+8
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | hle/service: Update function tables for erpt:c and usb's IClientEpSession
| * | | | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table for IClientEpSession based off information provided by SwitchBrew.
| * | | | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table according to information provided by SwitchBrew.
* | | | | | | | | Merge pull request #1827 from ReinUsesLisp/clip-and-shaderbunnei2018-12-025-13/+37
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Enable clip distances when set in register and in shader
| * | | | | | | | | gl_rasterizer: Enable clip distances when set in register and in shaderReinUsesLisp2018-11-295-13/+37
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1825 from ReinUsesLisp/shader-pipeline-cachebunnei2018-12-021-4/+17
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_manager: Update pipeline when programs have changed
| * | | | | | | | | gl_shader_manager: Update pipeline when programs have changedReinUsesLisp2018-11-291-4/+17
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1795 from ReinUsesLisp/vc-cleanupbunnei2018-12-025-32/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core: Minor style changes
| * | | | | | | | | gl_rasterizer: Signal UNIMPLEMENTED when rt_separate_frag_data is not zeroReinUsesLisp2018-11-291-1/+1
| | | | | | | | | |
| * | | | | | | | | gl_rasterizer_cache: Use brackets for two-line single-expresion blocksReinUsesLisp2018-11-291-1/+2
| | | | | | | | | |
| * | | | | | | | | gl_rasterizer: Remove unused struct declarationsReinUsesLisp2018-11-291-14/+0
| | | | | | | | | |
| * | | | | | | | | gl_rasterizer: Remove extension booleansReinUsesLisp2018-11-294-16/+4
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1823 from bunnei/fix-surface-copybunnei2018-12-021-145/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Fix several surface copy issues.
| * | | | | | | | | gl_rasterizer_cache: Update AccurateCopySurface to flush complete source surface.bunnei2018-11-301-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes issues with Breath of the Wild with use_accurate_gpu_emulation setting.
| * | | | | | | | | gl_rasterizer_cache: Remove BlitSurface and replace with more accurate copy.bunnei2018-11-291-144/+1
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - BlitSurface with different texture targets is inherently broken. - When target is the same, we can just use FastCopySurface. - Fixes rendering issues with Breath of the Wild.
* | | | | | | | | Merge pull request #1832 from Simek/remove-game-list-borderbunnei2018-12-021-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | UI: Remove border from Game List
| * | | | | | | | | remove border from GameListBartosz Kaszubowski2018-11-301-0/+1
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.
| * | | | | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Assert that it is not empty before using it in the DequeueBuffer wait callback.
* | | | | | | | | Fix debug buildLioncash2018-12-012-5/+3
| |/ / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A non-existent parameter was left in some formatting calls (the logging macro for which only does anything meaningful on debug builds)
* | | | | | | | Merge pull request #1829 from lioncash/langbunnei2018-11-302-2/+20
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | service/set: Implement MakeLanguageCode
| * | | | | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This code was around prior to the introduction of PushEnum, so convert it over so we don't need to cast here.
| * | | | | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | This function simply converts a given index into a language code.
* | / / / / / configure_input: Amend clang-format discrepanciesLioncash2018-11-301-1/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1768 from greggameplayer/patch-2bunnei2018-11-291-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Uncheck automatically joycons docked when docked mode is enable
| * | | | | | correct clang-formatgreggameplayer2018-11-221-1/+1
| | | | | | |
| * | | | | | Automatically disable joycons dockedgreggameplayer2018-11-221-0/+4
| | | | | | | | | | | | | | | | | | | | | when docked mode is enable
* | | | | | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Changed logging to be "Log before execution", Added more error logging, all services/svc should now log on some level
| * | | | | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| | | | | | |
| * | | | | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| | | | | | |
| * | | | | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| | | | | | |
| * | | | | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| | | | | | |
| * | | | | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| | | | | | |
| * | | | | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| | | | | | |
| * | | | | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
| | | | | | |
* | | | | | | Merge pull request #1808 from Tinob/masterbunnei2018-11-283-15/+31
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix clip distance and viewport
| * | | | | | | remove viewport_transform_enabled as it seems to be inactive when valid transforms are used.Rodolfo Bogado2018-11-271-12/+5
| | | | | | | |
| * | | | | | | Add support for Clip Distance enabled registerRodolfo Bogado2018-11-273-3/+26
| | | | | | | |
* | | | | | | | Merge pull request #1786 from Tinob/DepthClampbunnei2018-11-285-10/+58
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Add Depth Clamp Support
| * | | | | | | | Implement depth clampRodolfo Bogado2018-11-275-10/+58
| |/ / / / / / /
* | | | | | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | npad: Use NPadIdToIndex to prevent invalid array access
| * | | | | | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-2818-110/+365
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ |/| | | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.
| * | | | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-283-13/+23
| | | | | | | |
| * | | | | | | gpu: Move command list profiling to DmaPusher::DispatchCalls.bunnei2018-11-282-5/+5
| | | | | | | |
| * | | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-2718-108/+353
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - More accurate impl., fixes Undertale (among other games).
* | | | | | | | Merge pull request #1735 from FernandoS27/tex-spacingbunnei2018-11-288-36/+55
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Texture decoder: Implemented Tile Width Spacing
| * | | | | | | | Implemented Tile Width SpacingFernandoS272018-11-268-36/+55
| | | | | | | | |
* | | | | | | | | Merge pull request #1814 from lioncash/ptrbunnei2018-11-283-33/+31
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()
| * | | | | | | | | file_sys/registered_cache: Remove unused <map> includeLioncash2018-11-271-1/+0
| | | | | | | | | |
| * | | | | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()Lioncash2018-11-273-32/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These parameters don't need to utilize a shared lifecycle directly in the interface. Instead, the caller should provide a regular reference for the function to use. This also allows the type system to flag attempts to pass nullptr and makes it more generic, since it can now be used in contexts where a shared_ptr isn't being used (in other words, we don't constrain the usage of the interface to a particular mode of memory management).
* | | | | | | | | | Merge pull request #1811 from lioncash/inputbunnei2018-11-286-94/+72
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | yuzu/input: Minor changes
| * | | | | | | | | | yuzu/configure_input_player: Use std::size_t to represent the player index instead of u8Lioncash2018-11-272-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents compiler warnings related to truncation when invoking the dialog. It's also extremely suspect to use a u8 value here instead of a more general type to begin with.
| * | | | | | | | | | yuzu/configure_input: Make CallConfigureDialog a non-member template functionLioncash2018-11-273-21/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't depend on any part of the private interface, so it can be made a non-member internal function.
| * | | | | | | | | | yuzu/configure_input_player: Use a lambda expression instead of std::bindLioncash2018-11-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::bind is the pre-C++11 way of doing this.
| * | | | | | | | | | yuzu/configure_input_player: Amend constructor initializer list orderLioncash2018-11-271-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the elements the way they would actually be initialized in. Resolves compiler warnings with gcc and clang
| * | | | | | | | | | yuzu/configure_input: Remove unused function MoveGridElementLioncash2018-11-271-7/+0
| | | | | | | | | | |
| * | | | | | | | | | yuzu/configure_input*: Move data members after function declarationsLioncash2018-11-272-41/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The common pattern is to put the data members after the function interface where applicable.
| * | | | | | | | | | yuzu/configure_input: Remove unnecessary includesLioncash2018-11-273-17/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1815 from DarkLordZach/npad-pos-fixbunnei2018-11-271-3/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | npad: Fix copy/paste error with LED position assignments
| * | | | | | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | profile_manager: Save and load ProfileData from disk
| * | | | | | | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The ProfileData is a 0x80-sized structure that stores various pieces of miscellaneous data for the account.
* | | | | | | | | | | Merge pull request #1812 from lioncash/nacpbunnei2018-11-271-7/+17
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)
| * | | | | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)Lioncash2018-11-271-7/+17
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, organize the array linearly, since clang formats the array elements quite wide length-wise with the addition of the missing 'u'. Technically also fixes patch lookup and icon lookup with Portuguese, though I doubt anyone has actually run into this issue.
* | | | | | | | | | | Merge pull request #1813 from ReinUsesLisp/fixup-clipbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Fixup clip distance index
| * | | | | | | | | | | gl_shader_decompiler: Fixup clip distance indexReinUsesLisp2018-11-271-1/+1
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #1810 from degasus/dirty_flagsbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | gl_rasterizer: Fixup for #1723.
| * | | | | | | | | | gl_rasterizer: Fixup for #1723.Markus Wick2018-11-271-1/+1
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On invalidating the streaming buffer, we need to reupload all vertex buffers. But we don't need to reconfigure the vertex format. This was a (silly) misstake in #1723. Thanks at Rodrigo for discovering the issue. Fun fact, as configuring the vertex format also invalidate the vertex buffer, this misstake had no affect on the behavior.
* | | | | | | | | | Merge pull request #1806 from ReinUsesLisp/morton-fixupbunnei2018-11-271-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | morton: Fixup compiler warning
| * | | | | | | | | | morton: Fixup compiler warningReinUsesLisp2018-11-271-1/+2
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1804 from lioncash/castbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | gdbstub: Silence value truncation warning within FpuWrite()
| * | | | | | | | | gdbstub: Silence value truncation warning within FpuWrite()Lioncash2018-11-271-1/+1
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this would cause an implicit truncation warning about assigning a u64 value to a u32 value without an explicit cast.
* | | | | | | | | Merge pull request #1805 from lioncash/resourcebunnei2018-11-273-5/+130
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | svc: Implement svcCreateResourceLimit, svcGetResourceLimitCurrentValue(), svcGetResourceLimitLimitValue(), and svcSetResourceLimitLimitValue()
| * | | | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The opposite of the getter functions, this function sets the limit value for a particular ResourceLimit resource category, with the restriction that the new limit value must be equal to or greater than the current resource value. If this is violated, then ERR_INVALID_STATE is returned. e.g. Assume: current[Events] = 10; limit[Events] = 20; a call to this service function lowering the limit value to 10 would be fine, however, attempting to lower it to 9 in this case would cause an invalid state error.
| * | | | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This kernel service function is essentially the exact same as svcGetResourceLimitLimitValue(), with the only difference being that it retrieves the current value for a given resource category using the provided resource limit handle, rather than retrieving the limiting value of that resource limit instance. Given these are exactly the same and only differ on returned values, we can extract the existing code for svcGetResourceLimitLimitValue() to handle both values.
| * | | | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This kernel service function retrieves the maximum allowable value for a provided resource category for a given resource limit instance. Given we already have the functionality added to the resource limit instance itself, it's sufficient to just hook it up. The error scenarios for this are: 1. If an invalid resource category type is provided, then ERR_INVALID_ENUM is returned. 2. If an invalid handle is provided, then ERR_INVALID_HANDLE is returned (bad thing goes in, bad thing goes out, as one would expect). If neither of the above error cases occur, then the out parameter is provided with the maximum limit value for the given category and success is returned.
| * | | | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function simply creates a ResourceLimit instance and attempts to create a handle for it within the current process' handle table. If the kernal fails to either create the ResourceLimit instance or create a handle for the ResourceLimit instance, it returns a failure code (OUT_OF_RESOURCE, and HANDLE_TABLE_FULL respectively). Finally, it exits by providing the output parameter with the handle value for the ResourceLimit instance and returning that it was successful. Note: We do not return OUT_OF_RESOURCE because, if yuzu runs out of available memory, then new will currently throw. We *could* allocate the kernel instance with std::nothrow, however this would be inconsistent with how all other kernel objects are currently allocated.
* | | | | | | | Merge pull request #1794 from Tinob/masterbunnei2018-11-272-8/+32
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Add support for viewport_transfom_enable register
| * | | | | | | | Limit the amount of viewports tested for state changes only to the usable onesRodolfo Bogado2018-11-251-2/+10
| | | | | | | | |
| * | | | | | | | Add support for viewport_transfom_enable registerRodolfo Bogado2018-11-242-6/+22
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1723 from degasus/dirty_flagsbunnei2018-11-279-6/+60
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer: Skip VB upload if the state is clean.
| * | | | | | | | gl_rasterizer: Skip VB upload if the state is clean.Markus Wick2018-11-179-6/+60
| | | | | | | | |
* | | | | | | | | GPU States: Implement Polygon Offset. This is used in SMO all the time. (#1784)Marcos2018-11-275-5/+107
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GPU States: Implement Polygon Offset. This is used in SMO all the time. * Clang Format fixes. * Initialize polygon_offset in the constructor.
* | | | | | | | | Merge pull request #1713 from FernandoS27/bra-ccbunnei2018-11-271-4/+14
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Implemented BRA CC conditional and FSET CC Setting
| * | | | | | | | | Implemented BRA CC conditional and FSET CC SettingFernandoS272018-11-241-4/+14
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1798 from ReinUsesLisp/y-directionbunnei2018-11-275-16/+26
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | gl_shader_decompiler: Implement S2R's Y_DIRECTION
| * | | | | | | | gl_shader_decompiler: Implement S2R's Y_DIRECTIONReinUsesLisp2018-11-255-16/+26
| |/ / / / / / /
* | | | | | | | Merge pull request #1763 from ReinUsesLisp/bfibunnei2018-11-262-0/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement BFI_IMM_R
| * | | | | | | | gl_shader_decompiler: Implement BFI_IMM_RReinUsesLisp2018-11-212-0/+23
| | | | | | | | |
* | | | | | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service/sm: Take std::string by const reference in UnregisterService
| * | | | | | | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to create a copy of the std::string instance (potentially allocating). The only reason RegisterService takes its argument by value is because it's std::moved internally.
* | | | | | | | | Merge pull request #1760 from ReinUsesLisp/r2pbunnei2018-11-262-0/+42
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement R2P_IMM
| * | | | | | | | | gl_shader_decompiler: Implement R2P_IMMReinUsesLisp2018-11-212-0/+42
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1782 from FernandoS27/dcbunnei2018-11-261-116/+188
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fixed Coordinate Encodings in TEX and TEXS instructions
| * | | | | | | | | Fix Texture OverlappingFernandoS272018-11-241-43/+70
| | | | | | | | | |
| * | | | | | | | | Fix TEXS Instruction encodingsFernandoS272018-11-241-22/+48
| | | | | | | | | |
| * | | | | | | | | Fix one encoding in TEX InstructionFernandoS272018-11-241-3/+3
| | | | | | | | | |
| * | | | | | | | | Corrected inputs indexing in TEX instructionFernandoS272018-11-241-66/+85
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1783 from ReinUsesLisp/clip-distancesbunnei2018-11-263-21/+58
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement clip distances
| * | | | | | | | | | gl_shader_decompiler: Implement clip distancesReinUsesLisp2018-11-233-21/+58
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1796 from ReinUsesLisp/morton-movebunnei2018-11-266-345/+391
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | | video_core: Move morton functions out of gl_rasterizer_cache
| * | | | | | | | | | morton: Style changesReinUsesLisp2018-11-251-12/+12
| | | | | | | | | | |
| * | | | | | | | | | video_core: Move morton functions to their own fileReinUsesLisp2018-11-256-345/+391
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1800 from encounter/svcgetinfoMat M2018-11-251-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfo
| * | | | | | | | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.
| * | | | | | | | | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | Merge pull request #1787 from bunnei/fix-gpu-mmbunnei2018-11-252-1/+9
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | memory_manager: Do not allow 0 to be a valid GPUVAddr.
| * | | | | | | | | memory_manager: Do not allow 0 to be a valid GPUVAddr.bunnei2018-11-232-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a bug with Undertale using 0 for a render target.
* | | | | | | | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | sm: Implement RegisterService and UnregisterService
| * | | | | | | | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are needed by Edizon to boot. They are used to see if a user is using SX OS, as SX OS registers a custom service called 'tx' and attempting to register a service of the same name lets the application know if it is present.
* | | | | | | | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | filesystem: Clear registered union paths on factory creation
| * | | | | | | | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1725 from FernandoS27/gl43bunnei2018-11-2410-2216/+2710
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Update OpenGL's backend version from 3.3 to 4.3
| * | | | | | | | | | | Removed pre 4.3 ARB extensionsFernandoS272018-11-217-48/+13
| | | | | | | | | | | |
| * | | | | | | | | | | Update OpenGL's backend version from 3.3 to 4.3FernandoS272018-11-215-2168/+2697
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1785 from Tinob/masterbunnei2018-11-245-28/+95
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Add support for clear_flags register
| * | | | | | | | | | | | Add support for clear_flags registerRodolfo Bogado2018-11-245-28/+95
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1692 from Hedges/GDBCleanbunnei2018-11-242-38/+87
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | GDBStub Improvements
| * | | | | | | | | | | | GDBStub improvements:Hedges2018-11-132-38/+87
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Add FPU support - Fix access to TLS Fix clang-format.
* | | | | | | | | | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-243-60/+78
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Report resolution scaling support for vi and am
| * | | | | | | | | | | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | Report resolution scaling support for vi and amDavid Marcec2018-11-163-60/+76
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Specifying an internal resolution in yuzu now will report the scaled changes to vi and am.
* | | | | | | | | | | | | | Merge pull request #1747 from DarkLordZach/exefs-lfsbunnei2018-11-247-2/+65
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | patch_manager: Add support for applying LayeredFS patches to ExeFS
| * | | | | | | | | | | | | | patch_manager: Show LayeredExeFS patch in add-ons columnZach Hilman2018-11-212-4/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The decision was made to name them LayeredExeFS instead of just LayeredFS to differentiate from normal RomFS-based mods. The name may be long/unweildy, but conveys the meaning well.
| * | | | | | | | | | | | | | patch_manager: Apply LayeredExeFS patchesZach Hilman2018-11-201-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will scan the <mod>/exefs dir for all files and then layer those on top of the game's exefs and use this as the new exefs. This allows for overriding of the compressed NSOs or adding new files. This does use the same dir as IPS/IPSwitch patch, but since the loader will not look for those they are ignored.
| * | | | | | | | | | | | | | settings: Add option to dump ExeFS of games upon launchZach Hilman2018-11-207-0/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When enabled, all exefs(es) will be copied to yuzu/dump/<title_id>/exefs.
* | | | | | | | | | | | | | | Merge pull request #1769 from ReinUsesLisp/ccbunnei2018-11-242-70/+81
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / / |/| | | | | | | | | | | | | | gl_shader_decompiler: Rename cc to condition code and name internal flags
| * | | | | | | | | | | | | | gl_shader_decompiler: Add a message for unimplemented cc generationReinUsesLisp2018-11-221-23/+46
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gl_shader_decompiler: Rename internal flag stringsReinUsesLisp2018-11-221-15/+20
| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gl_shader_decompiler: Rename control codes to condition codesReinUsesLisp2018-11-222-67/+50
| | |_|_|_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #1744 from degasus/shader_cachebunnei2018-11-244-8/+24
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | shader_cache: Only lock covered instructions.
| * | | | | | | | | | | | | | shader_cache: Only lock covered instructions.Markus Wick2018-11-204-8/+24
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #1741 from lioncash/kbdbunnei2018-11-242-12/+11
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | software_keyboard: Minor changes
| * | | | | | | | | | | | | yuzu/applets/software_keyboard: Override accept() and reject() instead of providing own differently named member functionsLioncash2018-11-202-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses Qt's built-in interface instead of rolling our own separate one on top of it. This also fixes a bug in reject() where we were calling accept() instead of reject().
| * | | | | | | | | | | | | yuzu/applets/software_keyboard: std::move std::function instances where applicableLioncash2018-11-201-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::function instances can potentially allocate. std::moveing them prevents an avoidable allocation in that case.
| * | | | | | | | | | | | | yuzu/applets/software_keyboard: Make slots private functionsLioncash2018-11-201-2/+1
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't required to be public.
* | | | | | | | | | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-234-4/+102
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | applets: Add StubApplet and use it as fallback when AppletId is not implemented
| * | | | | | | | | | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | applets: Add StubAppletZach Hilman2018-11-223-0/+98
| | |/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will log all data it receives, log all calls to its methods and push dummy data into both channels on execution.
* | | | | | | | | | | | | Merge pull request #1777 from lioncash/core-mgrbunnei2018-11-234-97/+225
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | core: Relocate CPU core management to its own class
| * | | | | | | | | | | | | core: Relocate CPU core management to its own classLioncash2018-11-224-97/+225
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the CPU-specific behavior from being spread throughout the main System class. This will also act as the home to contain member functions that perform operations on all cores. The reason for this being that the following pattern is sort of prevalent throughout sections of the codebase: If clearing the instruction cache for all 4 cores is necessary: Core::System::GetInstance().ArmInterface(0).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(1).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(2).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(3).ClearInstructionCache(); This is kind of... well, silly to copy around whenever it's needed. especially when it can be reduced down to a single line. This change also puts the basics in place to begin "ungrafting" all of the forwarding member functions from the System class that are used to access CPU state or invoke CPU-specific behavior. As such, this change itself makes no changes to the direct external interface of System. This will be covered by another changeset.
* | | | | | | | | | | | | | Merge pull request #1773 from lioncash/threadbunnei2018-11-232-41/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/thread: Minor cleanup
| * | | | | | | | | | | | | | common/thread: Drop Hungarian notation on SetCurrentThreadName's parameterLioncash2018-11-221-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is inconsistent with our coding style.
| * | | | | | | | | | | | | | common/thread: Make Barrier's 'count' member non-constLioncash2018-11-221-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While admirable as a means to ensure immutability, this has the unfortunate downside of making the class non-movable. std::move cannot actually perform a move operation if the provided operand has const data members (std::move acts as an operation to "slide" resources out of an object instance). Given Barrier contains move-only types such as std::mutex, this can lead to confusing error messages if an object ever contained a Barrier instance and said object was attempted to be moved.
| * | | | | | | | | | | | | | common/thread: Initialize class member variables where applicableLioncash2018-11-221-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the constructor interfaces for Barrier and Event classes.
| * | | | | | | | | | | | | | common/thread: Group non-member functions togetherLioncash2018-11-221-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the non-member interface in one spot instead of split into two places, making it nicer to locate functions.
| * | | | | | | | | | | | | | common/thread: Remove SleepCurrentThread()Lioncash2018-11-222-12/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is also unused and superceded by standard functionality. The standard library provides std::this_thread::sleep_for(), which provides a much more flexible interface, as different time units can be used with it.
| * | | | | | | | | | | | | | common/thread: Remove unused CurrentThreadId()Lioncash2018-11-222-12/+0
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is an old function that's no longer necessary. C++11 introduced proper threading support to the language and a thread ID can be retrieved via std::this_thread::get_id() if it's ever needed.
* | | | | | | | | | | | | | Added predicate comparison LessEqualWithNan (#1736)Hexagon122018-11-232-5/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added predicate comparison LessEqualWithNan * oops * Clang fix
* | | | | | | | | | | | | | Merge pull request #1756 from ReinUsesLisp/fix-texturesbunnei2018-11-231-60/+78
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Fix register overwriting on texture calls
| * | | | | | | | | | | | | | gl_shader_decompiler: Fix register overwriting on texture callsReinUsesLisp2018-11-221-60/+78
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #1766 from FernandoS27/fix-txqbunnei2018-11-231-2/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Properly Implemented TXQ Instruction
| * | | | | | | | | | | | | | Properly Implemented TXQ InstructionFernandoS272018-11-211-2/+12
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.
| * | | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | | | | | | Merge pull request #1779 from DarkLordZach/debug-pad-unmappedMat M2018-11-221-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)
| * | | | | | | | | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
|/ / / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents memory exceptions when the debug pad is enabled.
* | | | | | | | | | | | | | Merge pull request #1775 from bunnei/blend-eqbunnei2018-11-222-0/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | maxwell_3d: Implement alternate blend equations.
| * | | | | | | | | | | | | | maxwell_3d: Implement alternate blend equations.bunnei2018-11-222-0/+12
| |/ / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | audout_u: Add support for multiple IAudioOut streams.
| * | | | | | | | | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | | | | | Merge pull request #1764 from bunnei/macrointerpreterbunnei2018-11-222-8/+25
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | | macro_interpreter: Implement AddWithCarry and SubtractWithBorrow.
| * | | | | | | | | | | | | macro_interpreter: Implement AddWithCarry and SubtractWithBorrow.bunnei2018-11-222-8/+25
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | | | | Merge pull request #1737 from FernandoS27/layer-copybunnei2018-11-222-2/+30
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implemented Fast Layered Copy
| * | | | | | | | | | | | | Implemented Fast Layered CopyFernandoS272018-11-202-2/+30
| | |_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1771 from lioncash/bit-setbunnei2018-11-222-245/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | common: Remove bit_set.h
| * | | | | | | | | | | | | common: Remove bit_set.hLioncash2018-11-222-245/+0
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is an analog of BitSet from Dolphin that was introduced to allow iterating over a set of bits. Given it's currently unused, and given that std::bitset exists, we can remove this. If it's ever needed in the future it can be brought back.
* | | | | | | | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | kernel/handle_table: Minor changes
| * | | | | | | | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't depend on class state, and are effectively implementation details, so they can go into the cpp file .
| * | | | | | | | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous handle table size is a holdover from Citra. The actual handle table construct on Horizon only allows for a maximum of 1024 entries.
| * | | | | | | | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| | |_|_|_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to potentially inline the teardown logic of all of the handle instances.
* | | | | | | | | | | | Merge pull request #1753 from FernandoS27/ufbtypebunnei2018-11-212-0/+8
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Use default values for unknown framebuffer pixel format
| * | | | | | | | | | | | Use default values for unknown framebuffer pixel formatFernandoS272018-11-212-0/+8
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1752 from ReinUsesLisp/unimpl-decompilerbunnei2018-11-211-371/+258
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Use UNIMPLEMENTED when applicable
| * | | | | | | | | | | | gl_shader_decompiler: Use UNIMPLEMENTED instead of LOG+UNREACHABLE when applicableReinUsesLisp2018-11-211-371/+258
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | | am/applets: Minor cleanup
| * | | | | | | | | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The accessor should be doing just that, accessing, rather than retaining the lifetime of the data broker as well.
| * | | | | | | | | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also resolve places where includes should have been provided, but weren't.
| * | | | | | | | | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
| | |/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids wonky wrapping and makes it nicer to read.
* | | | | | | | | | | | Merge pull request #1754 from ReinUsesLisp/zero-registerbunnei2018-11-211-2/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Remove UNREACHABLE when setting RZ
| * | | | | | | | | | | | gl_shader_decompiler: Remove UNREACHABLE when setting RZReinUsesLisp2018-11-211-2/+1
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1758 from lioncash/rectbunnei2018-11-211-11/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/math_util: Minor cleanup
| * | | | | | | | | | | | | common/math_util: Simplify std::make_signed usages to std::make_signed_tLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to use typename to access the ::type alias.
| * | | | | | | | | | | | | common/math_util: Make Rectangle's constructors constexprLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows objects that contain rectangle instances to be constexpr constructible as well.
| * | | | | | | | | | | | | common/math_util: Remove unnecessary static from PILioncash2018-11-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | const/constexpr variables have internal linkage by default.
| * | | | | | | | | | | | | common/math_util: Remove unused IntervalsIntersect() functionLioncash2018-11-211-6/+0
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This hasn't been used since the project started, so we may as well get rid of it to keep it from bit rotting.
* | | | | | | | | | | | | Merge pull request #1759 from lioncash/unusedbunnei2018-11-216-286/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | common: Remove depencency on xbyak
| * | | | | | | | | | | | common: Remove dependency on xbyakLioncash2018-11-216-286/+0
|/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Xbyak is currently entirely unused. Rather than carting it along, remove it and get rid of a dependency. If it's ever needed in the future, then it can be re-added (and likely be more up to date at that point in time).
* | | | | | | | | | | | Merge pull request #1751 from bunnei/color-mask-fixbunnei2018-11-211-0/+9
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | maxwell_3d: Initialize rasterizer color mask registers as enabled.
| * | | | | | | | | | | maxwell_3d: Initialize rasterizer color mask registers as enabled.bunnei2018-11-211-0/+9
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes rendering regression with Sonic Mania.
* | | | | | | | | | | Merge pull request #1750 from lioncash/amendbunnei2018-11-211-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | am: Correct build failure
| * | | | | | | | | | am: Correct build failureLioncash2018-11-211-2/+2
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The interface for shared memory was changed, but another commit was merged that relied on the (previously public) internals of SharedMemory. This amends that discrepancy.
* | | | | | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/shared_memory: Make data members private, plus minor interface changes
| * | | | | | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Both member functions assume the passed in target process will not be null. Instead of making this assumption implicit, we can change the functions to be references and enforce this at the type-system level.
| * | | | | | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this doesn't mutate instance state, we can provide a const-qualified variant as well.
| * | | | | | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the interface consistent with the regular Create() function.
| * | | | | | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface nicer to use in terms of 64-bit code, as it makes it less likely for one to get truncation warnings (and also makes sense in the context of the rest of the interface where 64-bit types are used for sizes and offsets
| * | | | | | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than allow unfettered access to the class internals, we hide all members by default and create and API that other code can operate against.
* | | | | | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | ldr: Clean up error codes
| * | | | | | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The separate enum isn't particularly necessary here, and the values can just be directly put into the ResultCode instances, given the names are also self-documenting here.
* | | | | | | | | | Merge pull request #1746 from lioncash/randombunnei2018-11-212-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/process: Move <random> include to the cpp file
| * | | | | | | | | | kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | <random> isn't necesary directly within the header and can be placed in the cpp file where its needed. Avoids propagating random generation utilities via a header file.
* | | | | | | | | | Merge pull request #1748 from lioncash/assertbunnei2018-11-211-1/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | common/assert: Make the UNIMPLEMENTED macro properly assert
| * | | | | | | | | | common/assert: Add UNIMPLEMENTED_IF and UNIMPLEMENTED_IF_MSG for conditional assertionsLioncash2018-11-211-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, there's no way to specify if an assertion should conditionally occur due to unimplemented behavior. This is useful when something is only partially implemented (e.g. due to ongoing RE work). In particular, this would be useful within the graphics code. The rationale behind this is it allows a dev to disable unimplemented feature assertions (which can occur in an unrelated work area), while still enabling regular assertions, which act as behavior guards for conditions or states which must not occur. Previously, the only way a dev could temporarily disable asserts, was to disable the regular assertion macros, which has the downside of also disabling, well, the regular assertions which hold more sanitizing value, as opposed to unimplemented feature assertions.
| * | | | | | | | | | common/assert: Make the UNIMPLEMENTED macro properly assertLioncash2018-11-201-1/+1
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, this was only performing a logging call, which doesn't actually invoke any assertion behavior. This is unlike UNIMPLEMENTED_MSG, which *does* assert. This makes the expected behavior uniform across both macros.
* | | | | | | | | | Merge pull request #1749 from lioncash/gc-infobunnei2018-11-211-1/+12
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | file_sys/card_image: Provide named members for the GamecardInfo struct
| * | | | | | | | | file_sys/card_image: Provide named members for the GamecardInfo structLioncash2018-11-211-1/+12
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Fills out the struct according to information provided by SwitchBrew
* | | | | | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-2019-106/+1133
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | am: Implement HLE software keyboard applet
| * | | | | | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| | | | | | | | | |
| * | | | | | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| | | | | | | | | |
| * | | | | | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This cleans up most of the callbacks and such in the Applets::Applet interface, while also properly implementing all four data channels.
| * | | | | | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| | | | | | | | | |
| * | | | | | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| | | | | | | | | |
| * | | | | | | | | software_keyboard: Add max and current length display to dialogZach Hilman2018-11-182-1/+11
| | | | | | | | | |
| * | | | | | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| | | | | | | | | |
| * | | | | | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| | | | | | | | | |
| * | | | | | | | | applet: Add operation completed callbackZach Hilman2018-11-188-9/+34
| | | | | | | | | |
| * | | | | | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| | | | | | | | | |
| * | | | | | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-189-29/+64
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | a
| * | | | | | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-1810-64/+62
| | | | | | | | | |
| * | | | | | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-182-4/+9
| | | | | | | | | |
| * | | | | | | | | am: Implement text check software keyboard modeZach Hilman2018-11-186-14/+120
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the game to verify and send a message to the frontend.
| * | | | | | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-1817-100/+180
| | | | | | | | | |
| * | | | | | | | | qt/main: Register Qt Software Keyboard frontend with AMZach Hilman2018-11-183-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows using Qt provider over default.
| * | | | | | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows use of software keyboard applet and future applets to be easily added by adding enum ID and a switch case.
| * | | | | | | | | qt/applets: Provide Qt frontend implementation of software keyboardZach Hilman2018-11-183-0/+171
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements all of the features of the keyboard, including length, default text, character validation, and UTF-16 character support.
| * | | | | | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-183-0/+130
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a middleman between the Frontend provider class and the expected AM::Applets::Applet class needed by ILibraryAppletAccessor
| * | | | | | | | | frontend/applets: Add frontend software keyboard provider and defaultZach Hilman2018-11-183-0/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Default implementation will return "yuzu" for any string. GUI clients (or CLI) can implement the Frontend::SoftwareKeyboardApplet class and register an instance to provide functionality.
| * | | | | | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-183-0/+77
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds an Initialize and Execute methods which are used by the ILibraryAppletAccessor to start and control the applet.
| * | | | | | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now starts the applet provided in constructor.
| * | | | | | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by software keyboard applet for data transfer.
| * | | | | | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::stack was no longer suitable for non-trivial operations
| * | | | | | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needs to be accessible by applet files.
| * | | | | | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Writes to an AM::IStorage object through an IStorageAccessor will now be preserved once the accessor is destroyed.
| * | | | | | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates an AM::IStorage object with the contents of the transfer memory located at the handle provided.
| * | | | | | | | | string_util: Implement buffer to UTF-16 string helper functionZach Hilman2018-11-182-0/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed as most all software keyboard functions use fixed-length UTF16 string buffers.
| * | | | | | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | Seems to be used and created identically to SharedMemory, so just reuse that.
* | | | | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | lm: Implement SetDestination by doing nothing
| * | | | | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function was likely intended to be a way to redirect where the output of a log went. e.g. Firing a log over a network, dumping over a tunneling session, etc. Given we always want to see the log and not change its output. It's one of the lucky service functions where the easiest implementation is to just do nothing at all and return success.
* | | | | | | | | | Merge pull request #1738 from lioncash/res-limitbunnei2018-11-206-190/+81
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | kernel/resource_limit: Clean up interface
| * | | | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleans out the citra/3DS-specific implementation details that don't apply to the Switch. Sets the stage for implementing ResourceLimit instances properly. While we're at it, remove the erroneous checks within CreateThread() and SetThreadPriority(). While these are indeed checked in some capacity, they are not checked via a ResourceLimit instance. In the process of moving out Citra-specifics, this also replaces the system ResourceLimit instance's values with ones from the Switch.
* | | | | | | | | Merge pull request #1634 from DarkLordZach/better-hid-2bunnei2018-11-1933-1321/+4618
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | hid: Add support for multiplayer and multilayout controllers
| * | | | | | | | configure_input: Use Joycons Docked instead of Connected as labelZach Hilman2018-11-191-1/+1
| | | | | | | | |
| * | | | | | | | configure_input_player: Set minimum width on controlsZach Hilman2018-11-192-23/+30
| | | | | | | | |
| * | | | | | | | configure_input: Properly update UI components on removal of playerZach Hilman2018-11-191-0/+2
| | | | | | | | |
| * | | | | | | | configure_input: Make None a controller option instead of checkboxZach Hilman2018-11-1911-152/+148
| | | | | | | | |
| * | | | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-1916-296/+234
| | | | | | | | |
| * | | | | | | | qt: Move controller button config to separate dialogZach Hilman2018-11-194-0/+1767
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Handles button configuration for all controller layouts and debug pads. Configurable at construction.
| * | | | | | | | qt: Add UI to configure touchscreen parametersZach Hilman2018-11-194-0/+281
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows adjusting the finger, diameter, and angle of the emulated touchscreen. It also provides a warning to the user about what changing these parameters can do.
| * | | | | | | | qt: Add UI to configure mouse buttonsZach Hilman2018-11-194-0/+542
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Supports setting the five mouse buttons to any valid controller button/keyboard key (Left, Right, Middle, Foward, Back)
| * | | | | | | | configure_input: Add support for multiplayer and controller typesZach Hilman2018-11-193-998/+525
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This moves the actual button configuration to a separate dialog and only has the enabled and type controls in the tab.
| * | | | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
| | | | | | | | |
| * | | | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Including finger ID, diamater x/y, and angle. Additionally, checks if the touchscreen is enabled.
| * | | | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
| | | | | | | | |
| * | | | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
| | | | | | | | |
| * | | | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by developers to test games, not present on retail systems. Some games are known to respond to DebugPad input though, for example Kirby Star Allies.
| * | | | | | | | yuzu/config: Add (de-)serialization for multiplayerZach Hilman2018-11-192-21/+331
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Defaults to full keyboard for keyboard -- It did not seem to be necessary to make the keyboard configurable (besides enabled/disabled).
| * | | | | | | | yuzu_cmd/config: Add config deserialization for multiplayerZach Hilman2018-11-191-37/+254
| | | | | | | | |
| * | | | | | | | settings: Add settings for multiple players and controllersZach Hilman2018-11-191-3/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses the PlayerInput struct to represent all of the data that constitutes a player.
| * | | | | | | | settings: Add Native type for keyboardZach Hilman2018-11-191-0/+210
| | | | | | | | |
| * | | | | | | | settings: Add Native type for mouse buttonsZach Hilman2018-11-192-0/+34
| | | | | | | | |
| * | | | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
| | | | | | | | |
| * | | | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
| | | | | | | | |
| * | | | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
| | | | | | | | |
| * | | | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
| | | | | | | | |
| * | | | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
| | | | | | | | |
| * | | | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
| | | | | | | | |
| * | | | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
|/ / / / / / / /
* | | | | | | | Merge pull request #1717 from FreddyFunk/swizzle-gobbunnei2018-11-191-37/+33
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | textures/decoders: Replace magic numbers
| * | | | | | | | textures/decoders: Replace magic numbersFrederic Laing2018-11-171-37/+33
| | | | | | | | |
* | | | | | | | | Merge pull request #1693 from Tinob/masterbunnei2018-11-199-211/+315
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Missing ogl states
| * | | | | | | | | drop support for non separate alpha as it seems to cause issues in some gamesRodolfo Bogado2018-11-183-61/+35
| | | | | | | | | |
| * | | | | | | | | fix sampler configuration, thanks to Marcos for his investigationRodolfo Bogado2018-11-173-19/+57
| | | | | | | | | |
| * | | | | | | | | small type fixRodolfo Bogado2018-11-171-6/+6
| | | | | | | | | |
| * | | | | | | | | small fix for alphaToOne bit locationRodolfo Bogado2018-11-171-2/+2
| | | | | | | | | |
| * | | | | | | | | fix for gcc compilationRodolfo Bogado2018-11-171-60/+61
| | | | | | | | | |
| * | | | | | | | | add AlphaToCoverage and AlphaToOneRodolfo Bogado2018-11-175-1/+39
| | | | | | | | | |
| * | | | | | | | | add support for fragment_color_clampRodolfo Bogado2018-11-175-1/+24
| | | | | | | | | |
| * | | | | | | | | add missing MirrorOnceBorder support where supportedRodolfo Bogado2018-11-171-0/+6
| | | | | | | | | |
| * | | | | | | | | set border color not depending on the wrap modeRodolfo Bogado2018-11-171-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | only enable color mask for the first framebuffer id independent blending is disabled
| * | | | | | | | | set default value for point size registerRodolfo Bogado2018-11-172-5/+4
| | | | | | | | | |
| * | | | | | | | | fix viewport and scissor behaviorRodolfo Bogado2018-11-176-64/+89
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1555 from ccawley2011/clang-format-dockerbunnei2018-11-193-5/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | travis: Use pre-built image for clang-format target
| * | | | | | | | | travis: Use pre-built image for clang-format targetCameron Cawley2018-10-243-5/+2
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1619 from janisozaur/patch-12bunnei2018-11-191-2/+6
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Handle missing git info when building
| * | | | | | | | | | Handle missing git info when buildingMichał Janiszewski2018-10-291-2/+6
| | | | | | | | | | |
* | | | | | | | | | | Eliminated unnessessary memory allocation and copy (#1702)Frederic L2018-11-193-9/+20
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1640 from DarkLordZach/game-list-reloadbunnei2018-11-195-1/+28
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | game_list: Only reload game list after relevant settings changed
| * | | | | | | | | | | game_list: Only reload game list after relevant settings changedZach Hilman2018-11-045-1/+28
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | Prevents unnecessary reloads on every configuration operation.
* | | | | | | | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-197-23/+405
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | ldr_ro: Complete LDR:RO implementation
| * | | | | | | | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| | | | | | | | | | | |
| * | | | | | | | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes actual unmapping and address error checking.
| * | | | | | | | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes NRO and BSS error checking, maximum loaded NRO check, NRR hash check, and proper remapping of BSS data.
| * | | | | | | | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes initialization check, proper address check, alignment check, and actual unloading of a loaded NRR.
| * | | | | | | | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes parameter error checking, hash enforcement, initialization check, and max NRR load check.
| * | | | | | | | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-152-3/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Credits to Subv
| * | | | | | | | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes unmapped spam in SMP and buffer size errors in some other games
* | | | | | | | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUser
| * | | | | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Seems pokemon calls this sometimes and it caused "random crashes"
* | | | | | | | | | | | Correctly sets default system language for yuzu-CLI (#1727)Schplee2018-11-191-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Correctly sets default system language for yuzu-CLI A user reported that yuzu_cmd runs games in Japanese rather than the correct default of English (like yuzu-qt does correctly), this change fixes that. * fix clang issue deleted whitespace
* | | | | | | | | | | | Merge pull request #1730 from ReinUsesLisp/fix-intelbunnei2018-11-191-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Remove default clip distance
| * | | | | | | | | | | | gl_rasterizer: Remove default clip distanceReinUsesLisp2018-11-191-2/+0
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBuffer
| * | | | | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by homebrew on exit. According to switchbrew, returns an empty response parcel with one zero in it.
* | | | | | | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | svc: ResetSignal is not stubbed
| * | | | | | | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
| | |_|_|_|_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | https://user-images.githubusercontent.com/20753089/48677874-b8e01c80-eb7b-11e8-8043-b99faa29022c.PNG
* | | | | | | | | | | Merge pull request #1722 from MysticExile/enable-applictation-crash-reportHexagon122018-11-172-10/+18
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | am: Stub EnableApplicationCrashReport
| * | | | | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1678 from FearlessTobi/amiibo-hotkeysbunnei2018-11-171-1/+9
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4387: "yuzu: Add hotkey for Amiibo loading"
| * | | | | | | | | | yuzu: Add hotkey for Amiibo loadingfearlessTobi2018-11-131-1/+9
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1705 from Jcw87/mingw-jpegbunnei2018-11-172-9/+11
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Include QT imageformat dependencies with releases
| * | | | | | | | | | | Remove whitespaceJcw872018-11-161-1/+1
| | | | | | | | | | | |
| * | | | | | | | | | | Include imageformat dependencies with releases (appveyor)Jcw872018-11-161-9/+10
| | | | | | | | | | | |
| * | | | | | | | | | | Include imageformat dependencies with releasesJcw872018-11-161-0/+1
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Added various bluetooth based cmds for palma
| * | | | | | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It seems palma is done through bluetooth, we need this for pokemon go however more research needs to be done when we actually get palma working. This is presumably used for transfering data between the controller and the console, it does not seem for actual input as far as I know.
* | | | | | | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.
| * | | | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes audio issues with Pokemon: Let's Go Pikachu & Eevee.
* | | | | | | | | | | | Merge pull request #1714 from lioncash/kern-errbunnei2018-11-172-62/+32
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | kernel/errors: Clean up error codes
| * | | | | | | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to PR 1706, which cleans up the error codes for the filesystem code, but done for the kernel error codes. This removes the ErrCodes namespace and specifies the errors directly. This also fixes up any straggling lines of code that weren't using the named error codes where applicable.
* | | | | | | | | | | | Merge pull request #1712 from FearlessTobi/port-4426bunnei2018-11-161-9/+10
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | Port citra-emu/citra#4426: "Common/Bitfield: store value as unsigned type"
| * | | | | | | | | | | Common/Bitfield: store value as unsigned typeWeiyi Wang2018-11-161-9/+10
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Storing signed type causes the following behaviour: extractValue can do overflow/negative left shift. Now it only relies on two implementation-defined behaviours (which are almost always defined as we want): unsigned->signed conversion and signed right shift
* | | | | | | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Implement SetMemoryPermission
| * | | | | | | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| | | | | | | | | | | |
| * | | | | | | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1700 from FreddyFunk/cleanupbunnei2018-11-161-3/+3
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer_chache: Minor cleanup
| * | | | | | | | | | | gl_rasterizer_chache: Minor cleanupFrederic Laing2018-11-151-3/+3
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1701 from FreddyFunk/decodersbunnei2018-11-161-16/+16
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | textures/decoders: Minor cleanup
| * | | | | | | | | | | textures/decoders: Minor cleanupFrederic Laing2018-11-151-16/+16
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-1616-133/+200
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | game_list: Optimize game list refresh
| * | | | | | | | | | | game_list: Make add-ons column optionalZach Hilman2018-11-026-119/+166
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As the add-ons column takes the most processing time out of any (as it needs to search registration for updates/dlc, patch control NCAs, search for mods, etc.), an option was added to disable it. This does not affect the application of add-ons. In large game collections, this decreases game list refresh time by as much as 70%.
| * | | | | | | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents unnecessary re-reads of the metadata and unnecessary temporary objects.
| * | | | | | | | | | | file_sys: Use common KeyManager in NCA container typesZach Hilman2018-11-026-7/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates a single KeyManager for the entire container and then passes it into the NCA constructor, eliminating several unnecessary KeyManager reads.
| * | | | | | | | | | | content_archive: Add optional KeyManager parameter to constructorZach Hilman2018-11-022-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows resuing a common KeyManager when a large amount of NCAs are handled by the same class. Should the parameter not be provided, a new KeyManager will be constructed, as was the default behavior prior to this.
* | | | | | | | | | | | Merge pull request #1676 from lioncash/warnbunnei2018-11-162-3/+4
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | gl_state: Amend compilation warnings
| * | | | | | | | | | | | gl_state: Amend compilation warningsLioncash2018-11-132-3/+4
| | |_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes float -> integral conversions explicit via casts and also silences a sign conversion warning.
* | | | | | | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-164-33/+16
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | file_sys/errors: Clean up error code values
| * | | | | | | | | | | | file_sys/errors: Remove currently unused filesystem error codesLioncash2018-11-161-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than keeping around unused values, we can just introduce them as needed.
| * | | | | | | | | | | | file_sys/errors: Get rid of the ErrCodes namespaceLioncash2018-11-161-17/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real point to keeping the separate enum around, especially given the name of the error code itself is supposed to document what the value actually represents.
| * | | | | | | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-164-14/+19
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps filesystem-related error codes in one spot.
* | | | | | | | | | | | Merge pull request #1710 from ogniK5377/palma-lets-gobunnei2018-11-161-2/+14
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostMode
| * | | | | | | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently unclear what these do yet, will be researched at a later time when we want to implement palma.
* | | | | | | | | | | Merge pull request #1709 from ogniK5377/docked-mode-crashHexagon122018-11-161-0/+3
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | Fixed switching operation modes when not running a game
| * | | | | | | | | | Fixed switching operation modes when not running a gameDavid Marcec2018-11-161-0/+3
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The service manager seems to be a nullptr before a game boots
* | | | | | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed priority switching edge case for handheld We accidently used controller index instead of npad id * Moved NPadIdToIndex
* | | | | | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | csrng: Use random integer distribution instead of raw engine
| * | | | | | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents returning the same value every single call.
* | | | | | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/thread: Deduplicate scheduler switching code
| * | | | | | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The code in both places was the same verbatim, so we can extract it to a function to deduplicate the logic.
* | | | | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-1512-8/+75
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | patch_manager: Add support for dumping uncompressed NSOs
| * | | | | | | | | | patch_manager: Add support for dumping decompressed NSOsZach Hilman2018-10-292-1/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When enabled in settings, PatchNSO will dump the unmodified NSO that it was passed to a file named <build id>.nso in the dump root for the current title ID.
| * | | | | | | | | | settings: Add setting to control NSO dumpingZach Hilman2018-10-296-1/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also adds UI option in Debug > Dump section, with the idea later things to be dumped (i.e. other game data or textures, etc) will use the same group box.
| * | | | | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-294-6/+33
| | |_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Equates to yuzu_dir/dump/<title id>/
* | | | | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdate
| * | | | | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, they both currently go through the same codepath with no difference in behavior.
* | | | | | | | | | Merge pull request #1637 from FernandoS27/cachebunnei2018-11-151-18/+17
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Improved GPU Caches lookup Speed
| * | | | | | | | | | Improved GPU Caches lookup SpeedFernandoS272018-11-111-18/+17
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | acc/profile_manager: Minor cleanup-related changes
| * | | | | | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| | | | | | | | | | | |
| * | | | | | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids relying on fmt always being indirectly included.
* | | | | | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()
| * | | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | empty() in this case will always return false, since the returned container is a std::array. Instead, check if all given users are invalid before returning the error code.
* | | | | | | | | | | | Merge pull request #1695 from lioncash/trbunnei2018-11-151-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | yuzu/configure_system: Mark the entropy mask string as nontranslatable
| * | | | | | | | | | | | yuzu/configure_system: Mark the entropy mask string as nontranslatableLioncash2018-11-141-1/+1
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need for translators to concern themselves with the validation mask used by the entry field.
* | | | | | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()
| * | | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous expression would copy sizeof(size_t) amount of bytes (8 on a 64-bit platform) rather than the full 10 bytes comprising the uuid member. Given the source and destination types are the same, we can just use an assignment here instead.
* | | | | | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate
| * | | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.
| * | | | | | | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When yuzu is compiled in release mode this function is unused, however, when compiled in debug mode, it's used within a LOG_TRACE statement. This prevents erroneous compilation warnings about an unused function (that isn't actually totally unused).
* | | | | | | | | | | | Merge pull request #1684 from lioncash/commonbunnei2018-11-142-88/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | | common/string_util: Minor cleanup
| * | | | | | | | | | | string_util: Remove ArrayToString()Lioncash2018-11-142-21/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An old function from Dolphin. This is also unused, and pretty inflexible when it comes to printing out different data types (for example, one might not want to print out an array of u8s but a different type instead. Given we use fmt, there's no need to keep this implementation of the function around.
| * | | | | | | | | | | string_util: Remove TryParse()Lioncash2018-11-142-54/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is an unused hold-over from Dolphin that was primarily used to parse values out of the .ini files. Given we already have libraries that do this for us, we don't need to keep this around.
| * | | | | | | | | | | string_util: Remove ThousandSeparate()Lioncash2018-11-131-14/+0
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is currently unused and doesn't really provide much value to keep around either.
* | | | | | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-146-8/+33
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | svc: Use proper random entropy generation algorithm
| * | | | | | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-136-8/+33
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1662 from FreddyFunk/CopySurface-Optimizationbunnei2018-11-141-10/+7
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: CopySurface optimization
| * | | | | | | | | | gl_rasterizer_cache: Remove unnecessary memory allocation and copy in CopySurfaceFrederic Laing2018-11-081-10/+7
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1686 from DarkLordZach/move-open-yuzu-folderbunnei2018-11-141-1/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | qt: Move Open yuzu Folder action from Help to File
| * | | | | | | | | | | qt: Move Open yuzu Folder action from Help to FileZach Hilman2018-11-131-1/+2
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1685 from lioncash/basebunnei2018-11-141-1/+0
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | video_core/renderer_base: Remove GL include from the renderer base class files
| * | | | | | | | | | | video_core/renderer_base: Remove GL include from the renderer base class filesLioncash2018-11-131-1/+0
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the base class source files implementation-agnostic.
* | | | | | | | | | | Merge pull request #1677 from FreddyFunk/skip-vao-binding-cleanupbunnei2018-11-141-4/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | engines/maxwell_3d: Minor cleanup
| * | | | | | | | | | | gl_rasterizer: Minor cleanupFrederic L2018-11-131-4/+2
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | Minor code cleanup from unaddressed feedback in #1654
* | | | | | | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm manager
| * | | | | | | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've moved all of the heap-related stuff to the VMManager class, we can unstub this function, as the necessary members are visible now.
| * | | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids a breach of responsibilities in the interface and keeps the direct code for memory management within the VMManager class.
* | | | | | | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimit
| * | | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These appear to be a basic getter and setter pair, so these are fairly trivial to implement and get out of the way.
* | | | | | | | | | | Merge pull request #1683 from lioncash/typobunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | audio_core/audio_renderer: Fix typo in AuxInfo member name
| * | | | | | | | | | | audio_core/audio_renderer: Fix typo in AuxInfo member nameLioncash2018-11-131-1/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-1410-16/+260
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | [ns|fsp_srv]: Implement various functions to boot Checkpoint
| * | | | | | | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-294-17/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the raw NACP bytes and the raw icon bytes into a title-provided buffer. Pulls from Registration Cache for control data, returning all zeros should it not exist.
| * | | | | | | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An object to read SaveDataInfo objects, which describe a unique save on the system. This implementation iterates through all the directories in the save data space and uses the paths to reconstruct the metadata.
| * | | | | | | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Checkpoint. Returns an object that can iterate through all savedata on the system.
| * | | | | | | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-294-14/+32
| | | | | | | | | | |
| * | | | | | | | | | loader/nro: Call RegisterRomFS from LoadZach Hilman2018-10-291-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows NRO homebrew to use the RomFS in the ASET section.
| * | | | | | | | | | control_metadata: Add GetRawBytes function to NACPZach Hilman2018-10-292-0/+7
| | |_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the raw bytes of the NACP file. Needed for GetApplicationControlData which returns the raw, unprocessed NACP to the game.
* | | | | | | | | | Merge pull request #1628 from greggameplayer/Texture2DArraybunnei2018-11-131-0/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Implement SurfaceTarget Texture2DArray
| * \ \ \ \ \ \ \ \ \ Merge branch 'master' into Texture2DArraygreggameplayer2018-11-0623-195/+392
| |\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | correct syntaxgreggameplayer2018-11-021-4/+3
| | | | | | | | | | | |
| * | | | | | | | | | | Merge branch 'master' into Texture2DArraygreggameplayer2018-11-0227-1066/+1477
| |\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Implement SurfaceTarget Texture2DArraygreggameplayer2018-10-311-0/+1
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ( needed by Mario+Rabbids Kingdom Battle )
* | | | | | | | | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-139-103/+187
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | csrng: Add config option to set RNG seed
| * | | | | | | | | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-132-4/+8
| | | | | | | | | | | | |
| * | | | | | | | | | | | settings: Add config option to set RNG seedZach Hilman2018-11-126-100/+171
| | | | | | | | | | | | |
| * | | | | | | | | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|_|_|_|_|_|_|_|/ | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Implement GetClockSnapshot, ToPosixTime & ToPosixTimeWithMyRule
| * | | | | | | | | | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| | | | | | | | | | | | |
| * | | | | | | | | | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Added instead of using a seperate PR to prevent conflicts
| * | | | | | | | | | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| | | | | | | | | | | | |
| * | | | | | | | | | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by megaman 11
* | | | | | | | | | | | | Implement ASTC_2D_10X8 & ASTC_2D_10X8_SRGB (#1666)greggameplayer2018-11-134-71/+101
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement ASTC_2D_10X8 & ASTC_2D_10X8_SRGB ( needed by Mario+Rabbids Kingdom Battle ) * Small placement correction
* | | | | | | | | | | | | Merge pull request #1650 from FreddyFunk/castbunnei2018-11-131-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | | | yuzu/main: Fix compiler warning
| * | | | | | | | | | | | yuzu/main: Fix compiler warningFrederic Laing2018-11-061-1/+2
| | | | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1674 from FearlessTobi/fullscreen-fixJames Rowe2018-11-121-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | | yuzu: Add a missing "!" to fix the stuck-in-fullscreen bug
| * | | | | | | | | | | | yuzu: Add a missing "!" to fix the stuck-in-fullscreen bugTobias2018-11-121-1/+1
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1660 from Tinob/masterbunnei2018-11-129-88/+138
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Map more missing opengl states
| * | | | | | | | | | | | Use core extensions when available to set max anisotropic filtering levelRodolfo Bogado2018-11-111-2/+7
| | | | | | | | | | | | |
| * | | | | | | | | | | | Improve state management by splitting some of the states id separated function to avoid a full apply overheadRodolfo Bogado2018-11-116-39/+40
| | | | | | | | | | | | |
| * | | | | | | | | | | | Try to fix problems with stencil test in some games, relax translation to opengl enums to avoid crashing and only generate logs of the errors.Rodolfo Bogado2018-11-114-37/+61
| | | | | | | | | | | | |
| * | | | | | | | | | | | set sampler max lod, min lod, lod bias and max anisotropyRodolfo Bogado2018-11-113-13/+33
| | |_|_|_|_|_|_|/ / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1652 from FreddyFunk/static-castbunnei2018-11-112-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | configure_system: Fix compiler warning
| * | | | | | | | | | | | configure_system: Fix compiler warningFrederic Laing2018-11-062-3/+3
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1664 from FreddyFunk/cast2bunnei2018-11-111-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | | gl_rasterizer: Fix compiler warnings
| * | | | | | | | | | | gl_rasterizer: Fix compiler warningsFrederic Laing2018-11-081-2/+2
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1669 from ReinUsesLisp/fixup-gsbunnei2018-11-114-15/+24
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Guard out of bound geometry shader input reads
| * | | | | | | | | | | gl_shader_decompiler: Guard out of bound geometry shader input readsReinUsesLisp2018-11-104-15/+24
| | |_|_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Geometry shaders follow a pattern that results in out of bound reads. This pattern is: - VSETP to predicate - Use that predicate to conditionally set a register a big number - Use the register to access geometry shaders At the time of writing this commit I don't know what's the intent of this number. Some drivers argue about these out of bound reads. To avoid this issue, input reads are guarded limiting reads to the highest posible vertex input of the current topology (e.g. points to 1 and triangles to 3).
* | | | | | | | | | | Merge pull request #1663 from lioncash/rasterbunnei2018-11-119-10/+25
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | rasterizer_cache: Remove reliance on the System singleton
| * | | | | | | | | | | rasterizer_cache: Remove reliance on the System singletonLioncash2018-11-089-10/+25
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than have a transparent dependency, we can make it explicit in the interface. This also gets rid of the need to put the core include in a header.
* | | | | | | | | | | Merge pull request #1648 from FernandoS27/texs-3-arraybunnei2018-11-111-7/+11
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Implement 3 coordinate array in TEXS instruction
| * | | | | | | | | | | Correct issue where texturelod could not be applied to 2darrayshadowFernandoS272018-11-081-1/+5
| | | | | | | | | | | |
| * | | | | | | | | | | Implement 3 coordinate array in TEXS instructionFernandoS272018-11-071-6/+6
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1654 from degasus/dirty_flagsbunnei2018-11-114-7/+37
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Skip VAO binding if the state is clean.
| * | | | | | | | | | | gl_rasterizer: Skip VAO binding if the state is clean.Markus Wick2018-11-063-2/+21
| | | | | | | | | | | |
| * | | | | | | | | | | gl_rasterizer: Split VAO and VB setup functions.Markus Wick2018-11-062-5/+16
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-108-36/+170
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Ability to switch between docked and undocked mode in-game
| * | | | | | | | | | | Renamed CheckIfOperationChanged to OnDockedModeChangedDavid Marcec2018-11-082-21/+23
| | | | | | | | | | | |
| * | | | | | | | | | | FixupsDavid Marcec2018-11-073-12/+17
| | | | | | | | | | | |
| * | | | | | | | | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-077-36/+163
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Started implementation of the AM message queue mainly used in state getters. Added the ability to switch docked mode whilst in game without stopping emulation. Also removed some things which shouldn't be labelled as stubs as they're implemented correctly
* | | | | | | | | | | Merge pull request #1661 from lioncash/dtorJames Rowe2018-11-103-0/+10
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | rasterizer_cache: Add missing virtual destructor to RasterizerCacheObject
| * | | | | | | | | | rasterizer_cache: Add missing virtual destructor to RasterizerCacheObjectLioncash2018-11-083-0/+10
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that destruction will always do the right thing in any context.
* | | | | | | | | | gl_resource_manager: Amend clang-format discrepanciesLioncash2018-11-081-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes the buildbot.
* | | | | | | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Updated npad styles on holdtype switches
| * | | | | | | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes input for megaman
* | | | | | | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * svcBreak now dumps information from the debug buffer passed info1 and info2 seem to somtimes hold an address to a buffer, this is usually 4 bytes or the size of the int and contains an error code. There's other circumstances where it can be something different so we hexdump these to examine them at a later date. * Addressed comments
* | | | | | | | | | Merge pull request #1655 from ogniK5377/shantaebunnei2018-11-085-3/+26
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | Implement acc:TrySelectUserWithoutInteraction
| * | | | | | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
| | | | | | | | | |
| * | | | | | | | | Added missing logDavid Marcec2018-11-071-0/+1
| | | | | | | | | |
| * | | | | | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed for Shantae - Half-Genie Hero - Ultimate Edition!
* | | | | | | | | Merge pull request #1630 from bunnei/fix-mapbufferexbunnei2018-11-072-31/+52
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | memory_manager: Do not MapBufferEx over already in use memory.
| * | | | | | | | | memory_manager: Do not MapBufferEx over already in use memory.bunnei2018-11-012-31/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This fixes rendering when changing areas in Super Mario Odyssey.
* | | | | | | | | | Merge pull request #1635 from Tinob/masterbunnei2018-11-076-153/+338
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Implement multi-target viewports and blending
| * | | | | | | | | | Add support to color mask to avoid issues in blending caused by wrong values in the alpha channel in some render targets.Rodolfo Bogado2018-11-055-25/+79
| | | | | | | | | | |
| * | | | | | | | | | Implement multi-target viewports and blendingRodolfo Bogado2018-11-056-128/+259
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1653 from degasus/profilerbunnei2018-11-074-6/+53
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | gl_rasterizer: Update microprofile scopes.
| * | | | | | | | | | gl_rasterizer_cache: Add profiles for Copy and Blit.Markus Wick2018-11-061-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | They were missed, and Copy is very high in profile here. It doesn't block the GPU, but it stalls the driver thread. So with our bad GL instructions, this might block quite a while.
| * | | | | | | | | | gl_resource_manager: Profile creation and deletion.Markus Wick2018-11-061-0/+42
| | | | | | | | | | |
| * | | | | | | | | | gl_stream_buffer: Profile orphaning of stream buffer.Markus Wick2018-11-061-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This serialize to the driver thread and so it may block for a while. So if it is in the benchmark, we get noticed if it happens too often.
| * | | | | | | | | | microprofile: Drop ReleaseActiveBuffer scope.Markus Wick2018-11-061-4/+0
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was created with the unfinished resampling PR in mind. As the resampling is now on the audio thread, we don't need to care about this here any more.
* | | | | | | | | | Merge pull request #1649 from degasus/split_resource_managerbunnei2018-11-065-114/+167
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | gl_resource_manager: Split implementations in .cpp file.
| * | | | | | | | | gl_resource_manager: Split implementations in .cpp file.Markus Wick2018-11-065-114/+167
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Those implementations are quite costly, so there is no need to inline them to the caller. Ressource deletion is often a performance bug, so in this way, we support to add breakpoints to them.
* | | | | | | | | Merge pull request #1616 from FernandoS27/cube-arraybunnei2018-11-054-0/+20
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Implement Cube Arrays
| * | | | | | | | | Implement Cube ArraysFernandoS272018-11-014-0/+20
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fixed HID crash when launching more than 1 game & signaled styleset change event
| * | | | | | | | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
| | |_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This should fix crashes when launching multiple games in yuzu
* | | | | | | | | | Merge pull request #1441 from CarlKenner/DebuggerLogbunnei2018-11-054-2/+29
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | logging: Add DebuggerBackend for logging to Visual Studio
| * | | | | | | | | | logging: Add DebuggerBackend for logging to Visual StudioCarl Kenner2018-10-074-2/+29
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1639 from DarkLordZach/open-yuzu-folderbunnei2018-11-053-0/+13
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | qt: Add help option to open yuzu folder
| * | | | | | | | | | qt: Add help option to open yuzu folderZach Hilman2018-11-033-0/+13
| | |_|_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Opens a new file manager window at the UserDir.
* | | | | | | | | | Merge pull request #1625 from FernandoS27/astcbunnei2018-11-059-75/+154
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Implement ASTC Textures 5x5 and fix a bunch of ASTC texture problems
| * | | | | | | | | | Fix ASTC Decompressor to support depth parameterFernandoS272018-11-027-65/+131
| | | | | | | | | | |
| * | | | | | | | | | Fix ASTC formatsFernandoS272018-11-014-12/+21
| | | | | | | | | | |
| * | | | | | | | | | Implemented ASTC 5x5FernandoS272018-11-011-1/+5
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1645 from dharmin/masterMat M2018-11-051-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Fix quickstart link
| * | | | | | | | | | | Fix quickstart linkDharmin K Shah2018-11-041-1/+1
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1643 from FreddyFunk/typoMat M2018-11-051-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | Fix typo in BufferTransformFlags
| * | | | | | | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1636 from ogniK5377/hwopus-bad-assertbunnei2018-11-031-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | Fixed incorrect hwopus assert
| * | | | | | | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1615 from lioncash/inputbunnei2018-11-025-25/+113
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | configure_system: Contrain profile usernames to 32 characters
| * | | | | | | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-315-25/+113
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we would let a user enter an unbounded name and then silently truncate away characters that went over the 32-character limit. This is kind of bad from the UX point of view, because we're essentially not doing what the user intended in certain scenarios. Instead, we clamp it to 32 characters and make that visually apparent in the dialog box to provide a name for a user.
* | | | | | | | | Merge pull request #1623 from Tinob/masterbunnei2018-11-013-105/+158
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | Improve OpenGL state handling
| * | | | | | | | Improve OpenGL state handlingRodolfo Bogado2018-10-313-105/+158
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1527 from FernandoS27/assert-flowbunnei2018-11-012-2/+27
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Assert Control Flow Instructions using Control Codes
| * | | | | | | | Assert Control Flow Instructions using Control CodesFernandoS272018-10-292-3/+28
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1622 from bunnei/fix-macrosbunnei2018-11-014-27/+55
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | maxwell_3d: Restructure macro upload to use a single macro code memory.
| * | | | | | | | maxwell_3d: Restructure macro upload to use a single macro code memory.bunnei2018-11-014-27/+55
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes an issue where macros could be skipped. - Fixes rendering of distant objects in Super Mario Odyssey.
* | | | | | | | Merge pull request #1604 from FearlessTobi/port-4369bunnei2018-11-017-7/+65
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4369: "compatdb: Use a seperate endpoint for testcase submission"
| * | | | | | | | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-287-7/+65
| | | | | | | | |
* | | | | | | | | Merge pull request #1528 from FernandoS27/assert-control-codesbunnei2018-11-012-1/+103
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | | Assert Control Codes Generation on Shader Instructions
| * | | | | | | | Assert Control Codes GenerationFernandoS272018-10-302-1/+103
| | | | | | | | |
* | | | | | | | | Merge pull request #1614 from ReinUsesLisp/surface-paramsbunnei2018-11-016-898/+954
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core: Move surface declarations out of gl_rasterizer_cache
| * | | | | | | | | video_core: Move surface declarations out of gl_rasterizer_cacheReinUsesLisp2018-10-306-898/+954
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1626 from lioncash/tablebunnei2018-11-011-3/+3
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | service/usb: Update IPdSession's function table
| * | | | | | | | service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information on SwitchBrew.
* | | | | | | | Merge pull request #1624 from lioncash/boostbunnei2018-10-303-4/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | general: Remove unused boost inclusions where applicable
| * | | | | | | | general: Remove unused boost inclusions where applicableLioncash2018-10-303-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleans up unused includes and trims off some dependencies on externals.
* | | | | | | | | Merge pull request #1595 from FreddyFunk/castbunnei2018-10-301-1/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | configure_system: Fix compiler warning
| * | | | | | | | configure_system: Fix compiler warningFrederic Laing2018-10-281-1/+1
| | | | | | | | |
* | | | | | | | | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-3049-266/+274
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * get rid of boost::optional * Remove optional references * Use std::reference_wrapper for optional references * Fix clang format * Fix clang format part 2 * Adressed feedback * Fix clang format and MacOS build
* | | | | | | | | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointer
| * | | | | | | | | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to call the getter and then check for null.
| * | | | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nothing requires the shared owner ship here, so we can just return a plain pointer.
* | | | | | | | | Merge pull request #1611 from lioncash/constbunnei2018-10-304-13/+52
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | core: Add missing const variants of getters for the System class
| * | | | | | | | core: Make System references const where applicableLioncash2018-10-282-3/+3
| | | | | | | | |
| * | | | | | | | core: Add missing const variants of getters for the System classLioncash2018-10-282-10/+49
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of the Current<Thing> getters (as well as a few others) were missing const qualified variants, which makes it a pain to retrieve certain things from const qualified references to System.
* | | | | | | | Merge pull request #1580 from FernandoS27/mm-implbunnei2018-10-306-109/+254
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implemented Mipmaps
| * | | | | | | | Fixed black textures, pixelation and we no longer require to auto-generate mipmapsFernandoS272018-10-291-14/+2
| | | | | | | | |
| * | | | | | | | Fixed mipmap block autosizing algorithmFernandoS272018-10-293-13/+25
| | | | | | | | |
| * | | | | | | | Fixed Invalid Image size and Mipmap calculationFernandoS272018-10-291-4/+7
| | | | | | | | |
| * | | | | | | | Fixed Block Resizing algorithm and Clang FormatFernandoS272018-10-293-12/+19
| | | | | | | | |
| * | | | | | | | Implement Mip FilterFernandoS272018-10-294-10/+33
| | | | | | | | |
| * | | | | | | | Zero out memory region of recreated surface before flushingFernandoS272018-10-291-0/+2
| | | | | | | | |
| * | | | | | | | Implement MipmapsFernandoS272018-10-282-101/+211
| |/ / / / / / /
* | | | | | | | Merge pull request #1617 from FearlessTobi/fix-stretch-delaybunnei2018-10-301-3/+3
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | | time_stretch: Switch to values of Citra
| * | | | | | | time_stretch: Switch to values of CitrafearlessTobi2018-10-291-3/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1613 from ReinUsesLisp/gl-utilsbunnei2018-10-296-30/+61
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | video_core: Move OpenGL specific utils to its renderer
| * | | | | | video_core: Move OpenGL specific utils to its rendererReinUsesLisp2018-10-296-30/+61
| |/ / / / /
* | | | | | Merge pull request #1610 from slashiee/dxt1-alphabunnei2018-10-291-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_opengl: Enable alpha channel for DXT1 texture format
| * | | | | | Enable alpha channel for DXT1 texture formatMichael2018-10-281-2/+2
| |/ / / / /
* | | | | | Merge pull request #1612 from Tinob/masterbunnei2018-10-291-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | renderer_opengl: Correct bpp value for ASTC_2D_8X5_SRGB
| * | | | | renderer_opengl: Correct bpp value for ASTC_2D_8X5_SRGBRodolfo Bogado2018-10-291-1/+1
|/ / / / /
* | | | | Merge pull request #1607 from FearlessTobi/patch-3bunnei2018-10-281-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | renderer_opengl: Correct bpp value for ASTC_2D_8X5
| * | | | Correct bpp value for ASTC_2D_8X5Tobias2018-10-281-1/+1
|/ / / /
* | | | Merge pull request #1601 from FernandoS27/shader-precisionbunnei2018-10-281-20/+35
|\ \ \ \ | | | | | | | | | | Improved Shader accuracy on Vertex and Geometry Shaders.
| * | | | Refactor precise usage and add FMNMX, MUFU, FMUL32 and FADD332FernandoS272018-10-282-74/+37
| | | | |
| * | | | Improved Shader accuracy on Vertex and Geometry Shaders with FFMA, FMUL and FADDFernandoS272018-10-282-6/+58
| |/ / /
* | | | Merge pull request #1606 from FearlessTobi/revert-1581-macosx-target-versionbunnei2018-10-281-1/+1
|\ \ \ \ | | | | | | | | | | Revert "Update MACOSX_DEPLOYMENT_TARGET to 10.14"
| * | | | Revert "Update MACOSX_DEPLOYMENT_TARGET to 10.14"Tobias2018-10-281-1/+1
|/ / / /
* | | | Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ \ \ \ | | | | | | | | | | svc: Implement svcGetInfo command 0xF0000002
| * | | | svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| | | | | | | | | | | | | | | | | | | | Nothing from this enum is intended to be used outside of this function.
| * | | | svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This retrieves: if (curr_thread == handle_thread) { result = total_thread_ticks + (hardware_tick_count - last_context_switch_ticks); } else if (curr_thread == handle_thread && sub_id == current_core_index) { result = hardware_tick_count - last_context_switch_ticks; }
* | | | | Merge pull request #1581 from FreddyFunk/macosx-target-versionbunnei2018-10-281-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Update MACOSX_DEPLOYMENT_TARGET to 10.14
| * | | | | Update MACOSX_DEPLOYMENT_TARGET to 10.14Frederic L2018-10-251-1/+1
| | | | | |
* | | | | | file_sys/patch_manager: Remove unnecessary if-statements (#1586)Frederic L2018-10-281-7/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * remove unnecessary if-statements * Addressed feedback
* | | | | | Merge pull request #1598 from DeeJayBro/delete-directorybunnei2018-10-281-2/+26
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/filesystem: Implemented DeleteDirectory & DeleteDirectoryRecursive
| * | | | | | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1600 from DarkLordZach/nsp-secondary-loader-fixbunnei2018-10-281-17/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | loader/nsp: Move secondary loader initialization to constructor
| * | | | | | loader/nsp: Move secondary loader initialization to constructorZach Hilman2018-10-271-17/+20
| |/ / / / / | | | | | | | | | | | | | | | | | | Prevents nullptr bug when trying to dump the RomFS of an NSP resulting from secondary_loader not being initialized.
* | | | | | Merge pull request #1582 from Tinob/masterbunnei2018-10-288-40/+197
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement sRGB support
| * | | | | | Implement sRGB Support, including workarounds for nvidia driver issues and QT sRGB supportRodolfo Bogado2018-10-288-40/+197
|/ / / / / /
* | | | | | Merge pull request #1602 from DarkLordZach/key-derivation-isxdigitbunnei2018-10-281-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | key_manager: Use isxdigit instead of isdigit when reading key file
| * | | | | | key_manager: Use isxdigit instead of isdigit when reading key fileZach Hilman2018-10-281-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Crypto revisions are hex numbers and this function only checks if the string is valid for stoul in base 16, so it should be isxdigit.
* | | | | | Merge pull request #1597 from lioncash/errorbunnei2018-10-281-51/+70
|\ \ \ \ \ \ | | | | | | | | | | | | | | configure_system: Indicate when filesystem operations fail
| * | | | | | configure_system: Make GetIcon() return the scaled 64x64 iconLioncash2018-10-271-14/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to put the scaling parameters all over the place for the common case. The only other time scaling is done is to generate the smaller 48x48 image, so this is fine.
| * | | | | | configure_system: Move entry formatting for the user account list entries to its own functionLioncash2018-10-271-18/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to duplicate this all over the place, and makes it translator-friendly across the board.
| * | | | | | configure_system: Display errors to the user if file operations fail when setting user imagesLioncash2018-10-271-24/+46
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | We should display an error to the user if setting a user image for an account fails, rather than continuing onwards.
* | | | | | Merge pull request #1594 from FreddyFunk/static-castbunnei2018-10-281-2/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | gl_rasterizer_cache: Fix compiler warning
| * | | | | gl_rasterizer_cache: Fix compiler warningFrederic Laing2018-10-271-2/+2
| |/ / / /
* | | | | Merge pull request #1596 from FearlessTobi/port-4367bunnei2018-10-271-1/+2
|\ \ \ \ \ | | | | | | | | | | | | Port citra-emu/citra#4367: "cubeb_sink: ignore null-name device when selecting"
| * | | | | cubeb_sink: ignore null-name device when selectingWeiyi Wang2018-10-271-1/+2
| |/ / / / | | | | | | | | | | | | | | | We already ignore them on listing devices. We should do the same when selecting devices. This fix a crash when opening a specific device while there is a null device in the list
* | | | | Merge pull request #1592 from bunnei/prim-restartbunnei2018-10-275-1/+40
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Implement primitive restart.
| * | | | | gl_rasterizer: Implement primitive restart.bunnei2018-10-265-1/+40
| |/ / / /
* | | | | Merge pull request #1599 from FernandoS27/stalematebunnei2018-10-271-0/+62
|\ \ \ \ \ | |/ / / / |/| | | | Implement Default Block Height for each format
| * | | | Implement Default Block Height for each formatFernandoS272018-10-271-0/+62
|/ / / /
* | | | Merge pull request #1533 from FernandoS27/lmembunnei2018-10-263-1/+138
|\ \ \ \ | | | | | | | | | | Implemented Shader Local Memory
| * | | | Implemented LD_L and ST_LFernandoS272018-10-243-12/+112
| | | | |
| * | | | Implement Shader Local MemoryFernandoS272018-10-241-0/+37
| | | | |
* | | | | Merge pull request #1430 from DarkLordZach/remove-promote-dirbunnei2018-10-2617-95/+1
|\ \ \ \ \ | | | | | | | | | | | | vfs: Remove InterpretAsDirectory and related functions
| * | | | | vfs: Remove InterpretAsDirectory and related functionsZach Hilman2018-10-1917-95/+1
| | | | | | | | | | | | | | | | | | | | | | | | When writing VFS, it initally seemed useful to include a function to in-place convert container files into directories in one homogenous directory structure, but re-evaluating it now there have been plenty of chances to use it and there has always been a better way. Removing as it is unused and likely will not be used.
* | | | | | Merge pull request #1591 from bunnei/depth-rangebunnei2018-10-266-14/+41
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: Implement depth range.
| * | | | | | maxwell_3d: Add code for initializing register defaults.bunnei2018-10-262-1/+21
| | | | | | |
| * | | | | | gl_rasterizer: Implement depth range.bunnei2018-10-264-13/+20
| | | | | | |
* | | | | | | Merge pull request #1569 from lioncash/amiibobunnei2018-10-263-17/+40
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/main: Notify user of loading errors with Amiibo data
| * | | | | | | yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-243-17/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We shouldn't silently continue if loading failed, since the general assumption is that no messages showing up implicitly indicates success.
* | | | | | | | Merge pull request #1587 from lioncash/privatebunnei2018-10-262-45/+46
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | configure_system: Minor cleanup-related changes
| * | | | | | | | configure_system: Make the file selector text translatableLioncash2018-10-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This should be localizable, since it's user-facing text.
| * | | | | | | | configure_system: Make GetAccountUsername() an internal functionLioncash2018-10-252-25/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just make the function accept an arbitrary ProfileManager reference and operate on that instead of tying the function to the class itself. This allows us to keep the function internal to the cpp file and removes the need to forward declare the UUID struct.
| * | | | | | | | configure_system: Default initialize member variablesLioncash2018-10-251-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These should be initialized to deterministic values so it's easier to catch improper behavior, as it'll always be reproducable, instead of performing uninitialized reads.
| * | | | | | | | configure_system: Simplify UUID generation call in AddUser()Lioncash2018-10-251-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a static function so we can just perform an assignment directly.
| * | | | | | | | configure_system: Amend function casingLioncash2018-10-252-6/+6
| | | | | | | | |
| * | | | | | | | configure_system: Add missing override specifier on the destructorLioncash2018-10-251-1/+1
| | | | | | | | |
| * | | | | | | | configure_system: Make public slots privateLioncash2018-10-251-7/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only used within this class, so we can make them private to keep their use contained. This also gets rid of the pre-Qt5 'slot' identifier, since Qt 5's connection syntax doesn't require a function to be declared a slot anymore.
* | | | | | | | | Merge pull request #1557 from bunnei/ldr_robunnei2018-10-266-9/+101
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Implement the LoadNro functions from the ldr:ro service.
| * | | | | | | | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This is an incomplete implementation. It was tested with Super Mario Party.
| * | | | | | | | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
| | | | | | | | |
| * | | | | | | | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
| | | | | | | | |
| * | | | | | | | nro: Make LoadNro method accessible outside of apploader code.bunnei2018-10-262-6/+18
|/ / / / / / / /
* | | | | | | | Merge pull request #1583 from DarkLordZach/rle-sizeMat M2018-10-251-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | ips_layer: Use rle_size instead of data_size in RLE patch application
| * | | | | | | ips_layer: Use rle_size instead of data_size in RLE patch applicationZach Hilman2018-10-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents a potential bug when using RLE records in an IPS patch.
* | | | | | | | Merge pull request #1584 from FearlessTobi/patch-3James Rowe2018-10-251-0/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Delete git file
| * | | | | | | Delete gitTobias2018-10-251-0/+0
|/ / / / / / /
* | | | | | | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/usb: Update service function tables
| * | | | | | | service/usb: Update service function tablesLioncash2018-10-251-21/+22
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Updated based off the information provided by Hexkyz on Switchbrew.
* | | | | | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/acc: Silence compiler truncation warnings
| * | | | | | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just flat data, so it doesn't really need to be in the function itself. This also allows deduplicating the constant for the backup size in GetImageSize().
| * | | | | | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences compiler warnings related to truncation. This also introduces a small helper function to perform the clamping of the image size.
| * | | | | | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Allows unindenting the other branch's code.
* | | | | | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/error: Amend error return code values
| * | | | | | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've gotten the innaccurate error codes out of the way, we can finally toss away a bunch of these, trimming down the error codes to ones that are actually used and knocking out two TODO comments.
| * | | | | | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is more consistent with what the kernel does.
| * | | | | | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| | | | | | | |
| * | | | | | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is what the kernel does in this instance.
| * | | | | | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are now entirely unused and can be removed.
| * | | | | | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like with the previous change, the kernel doesn't return NOT_AUTHORIZED here. It returns INVALID_THREAD_PRIORITY.
| * | | | | | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All priority checks are supposed to occur before checking the validity of the thread handle, we're also not supposed to return ERR_NOT_AUTHORIZED here.
| * | | | | | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel appears to return 0xE601 for this situation. Particularly in svcWaitSynchronization, svcReplyAndReceive, and svcGetThreadContext
| * | | | | | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | The kernel appears to return 0xF601 for this case.
* | | | | | | Merge pull request #1524 from FernandoS27/layers-fixbunnei2018-10-253-72/+109
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | rasterizer: Fix Layered Textures Loading and Cubemaps
| * | | | | | | Fixed Layered Textures Loading and CubemapsFernandoS272018-10-233-72/+109
| | | | | | | |
* | | | | | | | Merge pull request #1575 from lioncash/qstringbunnei2018-10-251-4/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | game_list_worker: Use QString's formatting instead of fmt in FormatPatchNameVersions()
| * | | | | | | | game_list_worker: Use QString's formatting instead of fmt in FormatPatchNameVersions()Lioncash2018-10-241-4/+9
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using fmt here requires unnecessary string conversions back into QString. Instead, we can just use QString's formatting and get the end result of the formatting operation in the proper type.
* | | | | | | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-255-48/+53
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | profile_manager: Use std::optional instead of boost::optional
| * | | | | | | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-245-48/+53
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we can actually use std::optional on macOS, we don't need to continue using boost::optional here.
* | | | | | | | Merge pull request #1558 from lioncash/ptrbunnei2018-10-252-13/+14
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | yuzu/configuration/config: Use a std::unique_ptr for qt_config instead of a raw pointer
| * | | | | | | yuzu/configuration/config: Use a std::unique_ptr for qt_config instead of a raw pointerLioncash2018-10-242-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, less code.
| * | | | | | | yuzu/configuration/config: Reorganize member variable and function layoutLioncash2018-10-241-6/+7
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | Makes the class layout consistent with the others.
* | | | | | | Merge pull request #1565 from lioncash/audiobunnei2018-10-242-3/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | time_stretch: Remove unused m_channel_count member variable
| * | | | | | | time_stretch: Remove unused m_channel_count member variableLioncash2018-10-242-3/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | This is only stored to, but never read from.
* | | | | | | Merge pull request #1554 from FernandoS27/pointsizebunnei2018-10-243-5/+28
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement PointSize Output Attribute.
| * | | | | | | Implement PointSizeFernandoS272018-10-233-5/+28
| | | | | | | |
* | | | | | | | Merge pull request #1571 from lioncash/debug-translatebunnei2018-10-242-15/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | graphic_breakpoints: Correct translation of strings in BreakpointModel's data() function
| * | | | | | | | graphic_breakpoints: Correct translation of strings in BreakpointModel's data() functionLioncash2018-10-242-15/+20
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | tr() will not function properly on static/global data like this, as the object is only ever constructed once, so the strings won't translate if the language is changed without restarting the program, which is undesirable. Instead we can just turn the map into a plain old function that maps the values to their equivalent strings. This is also lessens the memory allocated, since it's only allocating memory for the strings themselves, and not an encompassing map as well.
* | | | | | | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | npad: Remove unused controller variable from OnInit()
| * | | | | | | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also gets rid of variable shadowing related to the lambda parameter a little bit below this code as well.
* | | | | | | | Merge pull request #1568 from lioncash/dirbunnei2018-10-241-4/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | game_list: Use QFileInfo instead of common's file functions
| * | | | | | | | game_list: Use QFileInfo instead of common's file functionsLioncash2018-10-241-4/+3
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use the facilities that Qt provides instead of pulling in stuff from common. While we're at it, we can also simplify the nearby logging statement's argument by just calling .toStdString()
* | | | | | | | Merge pull request #1567 from lioncash/translatebunnei2018-10-241-5/+5
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | game_list: Make game list column headers translatable
| * | | | | | | | game_list: Make game list column headers translatableLioncash2018-10-241-5/+5
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | These are user-facing strings, so they should be marked as translatable
* | | | | | | | Merge pull request #1566 from lioncash/strbunnei2018-10-241-4/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | bootmanager: Use QStringLiteral instead of std::string to represent the window title.
| * | | | | | | | bootmanager: Use QStringLiteral instead of std::string to represent the window titleLioncash2018-10-241-4/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gets rid of an unnecessary type conversion. We can just use the regular QStringLiteral to already format the string as the type setWindowTitle accepts instead of converting from a std::string instance.
* | | | | | | | Merge pull request #1563 from lioncash/framebunnei2018-10-241-4/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | perf_stats: Remove unused variable within DoFrameLimiting()
| * | | | | | | | perf_stats: Remove unused variable within DoFrameLimiting()Lioncash2018-10-241-4/+0
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | This hasn't been used since ba8ff096fdc9f7ab101851c4cd06c3244a7d84c3
* | | | | | | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() function
| * | | | | | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just call the function instead of duplicating the code here. This also prevents an unused function warning. We also don't need to take the lambda capture by reference. It's just a u64 value, so by value is fine here.
* | | | | | | | Merge pull request #1560 from lioncash/unusedbunnei2018-10-242-2/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | maxwell_3d/decoders: Remove unused variables
| * | | | | | | | decoders: Remove unused variable within SwizzledData()Lioncash2018-10-241-1/+0
| | | | | | | | |
| * | | | | | | | maxwell_3d: Remove unused variable within ProcessQueryGet()Lioncash2018-10-241-1/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #1561 from lioncash/fsbunnei2018-10-242-3/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys: Remove unused variables
| * | | | | | | | vfs: Handle failure of file reading within VfsRawCopy()Lioncash2018-10-241-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also gets rid of an unused variable.
| * | | | | | | | key_manager: Remove unused variable in DeriveBase()Lioncash2018-10-241-1/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #1559 from lioncash/logbunnei2018-10-242-0/+5
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | logging/backend: Add missing services to the log filters
| * | | | | | | logging/backend: Add missing services to the log filtersLioncash2018-10-242-0/+5
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Just a few overlooked services.
* | | | | | | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-2411-118/+742
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | qt: Add UI to manage emulated user profiles
| * | | | | | configure_system: Clear current username before overwritingZach Hilman2018-10-242-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents bug where old username would remain if the new username was shorter in length.
| * | | | | | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-244-18/+42
| | | | | | |
| * | | | | | acc: Fix account UUID duplication errorZach Hilman2018-10-248-80/+106
| | | | | | |
| * | | | | | configure_system: Clear selection after user deleteZach Hilman2018-10-242-12/+18
| | | | | | |
| * | | | | | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-2411-133/+308
| | | | | | |
| * | | | | | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| | | | | | |
| * | | | | | qt: Allow user to select emu user on open save dataZach Hilman2018-10-241-3/+24
| | | | | | |
| * | | | | | qt: Add Profile Manager UI to system settingsZach Hilman2018-10-243-76/+350
| | | | | | |
| * | | | | | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| | | | | | |
| * | | | | | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| | | | | | |
| * | | | | | settings: Add users and current_user settings and remove usernameZach Hilman2018-10-243-6/+54
| | | | | | |
* | | | | | | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Added break types to svcBreak
| * | | | | | Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| | | | | | |
| * | | | | | Added break types to svcBreakDavid Marcec2018-10-231-4/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | There seems to be more such as type 1, and 2. Unsure what these currently are but when a game hits them we can investigate and add the rest
* | | | | | | Added Amiibo support (#1390)David2018-10-2412-80/+386
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed conflict with nfp * Few fixups for nfc * Conflict 2 * Fixed AttachAvailabilityChangeEvent * Conflict 3 * Fixed byte padding * Refactored amiibo to not reside in "System" * Removed remaining references of nfc from system * used enum for Nfc GetStateOld * Added missing newline * Moved file operations to front end * Conflict 4 * Amiibos now use structs and added mutexes * Removed amiibo_path
* | | | | | | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-246-16/+97
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | patch_manager: Add support for LayeredFS on DLC RomFS
| * | | | | | qt: Add support for dumping a DLC Data RomFSZach Hilman2018-10-184-11/+73
| | | | | | |
| * | | | | | registered_cache: Deduplicate results of ListEntry and ListEntryFilterZach Hilman2018-10-172-2/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents a Entry from appearing in the list twice if the user has it installed in two places (e.g. User NAND and SDMC)
| * | | | | | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| | | | | | |
| * | | | | | patch_manager: Add support for using LayeredFS with DataZach Hilman2018-10-171-2/+3
| | | | | | |
* | | | | | | Merge pull request #1542 from lioncash/projectbunnei2018-10-243-24/+24
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Use PROJECT_SOURCE_DIR instead of CMAKE_SOURCE_DIR
| * | | | | | | CMakeLists: Use PROJECT_SOURCE_DIR instead of CMAKE_SOURCE_DIRLioncash2018-10-203-24/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is more localized to what we want to enforce directory-wise with the project. CMAKE_SOURCE_DIR indicates the root of the source tree, but this would cause the wrong behavior if someone included yuzu as part of a larger buildsystem (for whatever reason). Instead, we want to use the directory where the "project(yuzu)" command was declared as the root path reference.
* | | | | | | | Merge pull request #1553 from lioncash/membunnei2018-10-244-204/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common: Remove memory_util.h/.cpp
| * | | | | | | | CMakeLists: Remove EMU_ARCH_BITS definitionLioncash2018-10-231-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was only ever used by the now-removed memory_util functions. Also, given we don't plan to support 32-bit architectures, this is just a leftover from citra at this point.
| * | | | | | | | common: Remove memory_util.cpp/.hLioncash2018-10-233-200/+0
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Everything from here is completely unused and also written with the notion of supporting 32-bit architecture variants in mind. Given the Switch itself is on a 64-bit architecture, we won't be supporting 32-bit architectures. If we need specific allocation functions in the future, it's likely more worthwhile to new functions for that purpose.
* | | | | | | | Merge pull request #1540 from lioncash/handlebunnei2018-10-249-100/+97
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel/process: Make the handle table per-process
| * | | | | | | kernel/process: Make the handle table per-processLioncash2018-10-209-100/+97
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the kernel, there isn't a singular handle table that everything gets tossed into or used, rather, each process gets its own handle table that it uses. This currently isn't an issue for us, since we only execute one process at the moment, but we may as well get this out of the way so it's not a headache later on.
* | | | | | | Merge pull request #1552 from FearlessTobi/port-4336bunnei2018-10-232-6/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port citra-emu/citra#4336: "Only redefine some 64-bit file operation for MSVC"
| * | | | | | | cmake: mingw also needs _FILE_OFFSET_BITS=64Weiyi Wang2018-10-231-1/+1
| | | | | | | |
| * | | | | | | only redefine 64 bit file operation for MSVCWeiyi Wang2018-10-231-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MinGW provides POSIX functions
* | | | | | | | Merge pull request #1519 from ReinUsesLisp/vsetpbunnei2018-10-232-75/+108
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement VSETP
| * | | | | | | | gl_shader_decompiler: Implement VSETPReinUsesLisp2018-10-232-0/+26
| | | | | | | | |
| * | | | | | | | gl_shader_decompiler: Abstract VMAD into a video subsetReinUsesLisp2018-10-232-75/+82
| | | | | | | | |
* | | | | | | | | Merge pull request #1539 from lioncash/dmabunnei2018-10-233-19/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | maxwell_dma: Silence compilation warnings
| * | | | | | | | | engines/maxwell_*: Use nested namespace specifiers where applicableLioncash2018-10-203-12/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These three source files are the only ones within the engines directory that don't use nested namespaces. We may as well change these over to keep things consistent.
| * | | | | | | | | maxwell_dma: Make variables const where applicable within HandleCopy()Lioncash2018-10-201-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are never modified, so we can make that assumption explicit.
| * | | | | | | | | maxwell_dma: Make FlushAndInvalidate's size parameter a u64Lioncash2018-10-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This prevents truncation warnings at the lambda's usage sites.
| * | | | | | | | | maxwell_dma: Remove unused variables in HandleCopy()Lioncash2018-10-201-3/+0
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | These pointer variables are never used, so we can get rid of them.
* | | | | | | | | Merge pull request #1470 from FernandoS27/alpha_testingbunnei2018-10-237-20/+87
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Implemented Alpha Test using Shader Emulation
| * | | | | | | | Assert that multiple render targets are not set while alpha testingFernandoS272018-10-223-3/+17
| | | | | | | | |
| * | | | | | | | Use standard UBO and fix/stylize the codeFernandoS272018-10-228-91/+51
| | | | | | | | |
| * | | | | | | | Cache uniform locations and restructure the implementationFernandoS272018-10-223-33/+29
| | | | | | | | |
| * | | | | | | | Remove SyncAlphaTest and clang formatFernandoS272018-10-224-8/+9
| | | | | | | | |
| * | | | | | | | Added Alpha FuncFernandoS272018-10-222-3/+43
| | | | | | | | |
| * | | | | | | | Implemented Alpha TestingFernandoS272018-10-226-3/+59
| | | | | | | | |
* | | | | | | | | Merge pull request #1512 from ReinUsesLisp/brkbunnei2018-10-232-22/+43
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | gl_shader_decompiler: Implement PBK and BRK
| * | | | | | | | gl_shader_decompiler: Implement PBK and BRKReinUsesLisp2018-10-182-22/+43
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1550 from FernandoS27/fmul32bunnei2018-10-232-3/+8
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Added Saturation to FMUL32I
| * | | | | | | Added Saturation to FMUL32IFernandoS272018-10-232-3/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1543 from lioncash/targetbunnei2018-10-231-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Use target_compile_definitions instead of add_definitions to define YUZU_ENABLE_COMPATIBILITY_REPORTING
| * | | | | | | CMakeLists: Use target_compile_definitions instead of add_definitions to define YUZU_ENABLE_COMPATIBILITY_REPORTINGLioncash2018-10-201-1/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the definition constrained to the yuzu target and prevents polluting anything else in the same directory (should that ever happen). It also keeps it consistent with how the USE_DISCORD_PRESENCE definition is introduced below it.
* | | | | | | Merge pull request #1537 from lioncash/shaderbunnei2018-10-231-6/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Minor changes
| * | | | | | | gl_shader_decompiler: Allow std::move to function in SetPredicateLioncash2018-10-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the variable being moved is const, then std::move will always perform a copy (since it can't actually move the data).
| * | | | | | | gl_shader_decompiler: Get rid of variable shadowing warningsLioncash2018-10-201-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A variable with the same name was previously declared in an outer scope.
| * | | | | | | gl_shader_decompiler: Fix a few comment typosLioncash2018-10-201-3/+4
| |/ / / / / /
* | | | | | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-225-0/+91
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | psm: Add psm service and stub commands 0 and 1
| * | | | | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| | | | | | | | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed as connected to official Nintendo Switch dock.
| * | | | | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed to return 100% charge.
| * | | | | | service: Add skeleton for psm serviceZach Hilman2018-10-215-0/+75
| |/ / / / / | | | | | | | | | | | | | | | | | | Seems to be the power controller. Listed in switchbrew under the category PTM services.
* | | | | | Merge pull request #1541 from lioncash/definebunnei2018-10-221-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | web_service/CMakeLists: Make the CPPHTTPLIB_OPENSSL_SUPPORT constrained to the web_service library only
| * | | | | | web_service/CMakeLists: Make the CPPHTTPLIB_OPENSSL_SUPPORT constrained to the web_service library onlyLioncash2018-10-201-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we link in httplib privately, we can also make the definition enabling OpenSSL support private as well. Prevents leaking a definition into other libraries that link with this one, like the core library.
* | | | | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Fix vma boundary check in svcQueryMemory
| * | | | | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This should be comparing against the queried process' vma_map, not the current process'. The only reason this hasn't become an issue yet is we currently only handle one process being active at any time.
* | | | | | Merge pull request #1547 from FernandoS27/fix-fsetbunnei2018-10-222-30/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fixed FSETP and FSET
| * | | | | | Fixed FSETP and FSETFernandoS272018-10-222-30/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1546 from lioncash/svc-againbunnei2018-10-2213-53/+255
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Update service function tables
| * | | | | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-214-2/+109
| | | | | | |
| * | | | | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-214-0/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Added based off information provided by Switchbrew.
| * | | | | | am: Update service function tablesLioncash2018-10-214-15/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from Switchbrew
| * | | | | | prepo: Update service function table.Lioncash2018-10-211-8/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also introduces the new prepo:a2 service. Updated based off information provided by Switchbrew.
| * | | | | | lbl: Update service function table namesLioncash2018-10-211-28/+28
| |/ / / / / | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | | | | Merge pull request #1548 from FernandoS27/fix-vaobunnei2018-10-221-2/+14
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fixed VAOs Float types only returning GL_FLOAT
| * | | | | | Fixed VAOs Float types only returning GL_FLOAT in cases that they had to return GL_HALF_FLOATFernandoS272018-10-221-2/+14
| |/ / / / /
* | | | | | Merge pull request #1544 from DarkLordZach/reinitialize-keys-toolsbunnei2018-10-221-1/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | | qt: Move Reinitialize Keys to Tools menu
| * | | | | qt: Move Reinitialize Keys to Tools menuZach Hilman2018-10-211-1/+7
| |/ / / /
* | | | | Merge pull request #1531 from ogniK5377/hid-fixesbunnei2018-10-212-4/+189
|\ \ \ \ \ | |/ / / / |/| | | | Added auto controller switching to supported controllers and single joycon button rotation
| * | | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
| | | | | | | | | | | | | | | | | | | | This is a subset of the better-hid-2 changes, this fixes input in various games which don't support dual joycons. This pr will search for the next best controller which is supported by the current game
* | | | | Merge pull request #1535 from ReinUsesLisp/fixup-positionbunnei2018-10-203-13/+9
|\ \ \ \ \ | |/ / / / |/| | | | gl_shader_decompiler: Move position varying declaration back to gl_shader_gen
| * | | | gl_shader_decompiler: Move position varying declaration back to gl_shader_genReinUsesLisp2018-10-203-13/+9
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | The intention of declaring them in gl_shader_decompiler was to be able to use blocks to implement geometry shaders. But that wasn't needed in the end and it caused issues when both vertex stages were being used, resulting in a redeclaration of "position".
* | | | Merge pull request #1501 from ReinUsesLisp/half-floatbunnei2018-10-202-0/+458
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Implement H* instructions
| * | | | gl_shader_decompiler: Implement HSET2_RReinUsesLisp2018-10-152-0/+62
| | | | |
| * | | | gl_shader_decompiler: Implement HSETP2_RReinUsesLisp2018-10-152-0/+65
| | | | |
| * | | | gl_shader_decompiler: Implement HFMA2 instructionsReinUsesLisp2018-10-152-0/+85
| | | | |
| * | | | gl_shader_decompiler: Implement HADD2_IMM and HMUL2_IMMReinUsesLisp2018-10-152-0/+73
| | | | |
| * | | | gl_shader_decompiler: Implement non-immediate HADD2 and HMUL2 instructionsReinUsesLisp2018-10-152-0/+75
| | | | |
| * | | | gl_shader_decompiler: Setup base for half float unpacking and settingReinUsesLisp2018-10-152-0/+98
| | | | |
* | | | | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ \ \ \ | | | | | | | | | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemory
| * | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the changes clarifying the address spaces has been merged, we can wrap the checks that the kernel performs when mapping shared memory (and other forms of memory) into its own helper function and then use those within MapSharedMemory and UnmapSharedMemory to complete the sanitizing checks that are supposed to be done.
* | | | | | Merge pull request #1517 from bunnei/dmabunnei2018-10-209-23/+144
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU/DMA: Flush the source region and invalidate the destination region when doing a DMA transfer.
| * | | | | | GPU: Improved implementation of maxwell DMA (Subv).bunnei2018-10-193-17/+66
| | | | | | |
| * | | | | | decoders: Introduce functions for un/swizzling subrects.bunnei2018-10-192-0/+49
| | | | | | |
| * | | | | | GPU: Invalidate destination address of kepler_memory writes.bunnei2018-10-193-3/+17
| | | | | | |
| * | | | | | fermi_2d: Add support for more accurate surface copies.bunnei2018-10-192-3/+12
| | | | | | |
* | | | | | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: Update function tables
| * | | | | | | es: Update service function tablesLioncash2018-10-191-7/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | audio: Update service function tablesLioncash2018-10-191-17/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | omm: Update service function tablesLioncash2018-10-191-16/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by switchbrew.
| * | | | | | | hid: Update service function tablesLioncash2018-10-191-6/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Added based off information provided by Switchbrew
| * | | | | | | ns: Update service function tableLioncash2018-10-191-6/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | set_cal: Update service function tableLioncash2018-10-191-1/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Updated based on information from Switchbrew.
* | | | | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | aoc_u: Stub GetAddOnContentListChangedEvent
| * | | | | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | This event signals the game when new DLC is purchased from the eShop while the game is running. Since, for the forseeable future, yuzu will not have this ability, it seems safe to stub with a dummy event that will never fire. This is needed to boot Sonic Mania Plus (update v1.04).
* | | | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid: Minor cleanup-related changes
| * | | | | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | swap.h only needs to be present in the header for the type aliases and definitions, it's not actually needed in the cpp files though. input.h is just unused entirely in xpad.h
| * | | | | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given it's unused, we may as well toss it.
| * | | | | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| | | | | | | |
| * | | | | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only useful in headers.
| * | | | | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just a lookup table, and since it's private, there's nothing really stateful about it, so we can just move it into the cpp file.
| * | | | | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This literally does nothing.
| * | | | | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These classes are non-trivial and are definitely going to be changed in the future, so we default these to prevent issues with forward declarations, and to keep the compiler from inlining tear-down code.
| * | | | | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | The destructor doesn't need to be a pure-virtual function.
* | | | | | | Merge pull request #1529 from DarkLordZach/key-derivation-crashMat M2018-10-201-1/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | crypto: Use compressed sizes in offset calculation for KIP decompression
| * | | | | | crypto: Use compressed sizes in offset calculation for KIP decompressionZach Hilman2018-10-201-1/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | Fixes a fatal crash on start when deriving keys.
* | | | | | Merge pull request #1525 from ogniK5377/block-homebunnei2018-10-192-4/+36
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Home button blocking stub
| * | | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
|/ / / / / | | | | | | | | | | | | | | | Needed by arms due to new hid rework
* | | | | Merge pull request #1523 from lioncash/lockbunnei2018-10-192-9/+27
|\ \ \ \ \ | | | | | | | | | | | | svc: Add missing error checks in svcArbitrateLock/svcArbitrateUnlock
| * | | | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel itself checks whether or not the provided addresses are word aligned before continuing, so we should be doing the same.
| * | | | | common: Add function for checking word alignment to alignment.hLioncash2018-10-181-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be used in a following change to svcArbitrateLock() and svcArbitrateUnlock()
| * | | | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-182-9/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aligning on 4KB pages isn't a Switch-specific thing, so this can be moved to common so it can be used with other things as well.
* | | | | | Merge pull request #1511 from lioncash/contentbunnei2018-10-192-258/+292
|\ \ \ \ \ \ | | | | | | | | | | | | | | content_archive: Minor reorganization changes
| * | | | | | content_archive: Simpify assignment of bktr_base_romfs in the constructorLioncash2018-10-161-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::move doesn't actually dereference the data, so it doesn't matter whether or not the type is null.
| * | | | | | content_archive: Make IsValidNCA() an internally linked functionLioncash2018-10-162-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only ever used within the cpp file, so it can just be an internal function.
| * | | | | | content_archive: Simplify rights ID checkLioncash2018-10-161-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the same as using std::any_of with an inverted predicate.
| * | | | | | content_archive: Split loading into separate functionsLioncash2018-10-162-253/+290
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The constructor alone is pretty large, the reading code should be split into its consistuent parts to make it easier to understand it without having to build a mental model of a 300+ line function.
| * | | | | | content_archive: Pass and take NCASectionHeader instance by referenceLioncash2018-10-162-3/+3
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | Each header is 512 bytes in size, which is kind of an excessive amount to copy all the time when it's possible to avoid doing so.
* | | | | | Merge pull request #1521 from ogniK5377/imp-mmubunnei2018-10-191-8/+42
|\ \ \ \ \ \ | | | | | | | | | | | | | | Used better names for mm:u and fixed a bad stub
| * | | | | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
| | |_|/ / / | |/| | | | | | | | | | | | | | | | InitializeWithId needs to return an id which is a u32 which should be a non zero value
* | | | | | Merge pull request #1522 from lioncash/corebunnei2018-10-191-2/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | core: Remove unnecessary assert in ArmInterface()
| * | | | | core: Remove unnecessary assert in ArmInterface()Lioncash2018-10-181-2/+1
|/ / / / / | | | | | | | | | | | | | | | | | | | | CpuCore already does this sort of checking, so we can just call that instead of duplicating the assertions.
* | | | | Merge pull request #1510 from lioncash/xcibunnei2018-10-183-7/+8
|\ \ \ \ \ | | | | | | | | | | | | XCI: Add function for checking the existence of the program NCA
| * | | | | XCI: Add function for checking the existence of the program NCALioncash2018-10-163-7/+8
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | The only reason the getter existed was to check whether or not the program NCA was null. Instead, we can just provide a function to query for the existence of it, instead of exposing it entirely.
* | | | | Merge pull request #1505 from FernandoS27/tex-3dbunnei2018-10-184-2/+13
|\ \ \ \ \ | |_|/ / / |/| | | | Implemented 3D Textures
| * | | | Clang format and other fixesFernandoS272018-10-181-16/+0
| | | | |
| * | | | Implement Reinterpret Surface, to accurately blit 3D texturesFernandoS272018-10-181-2/+4
| | | | |
| * | | | Implement GetInRange in the Rasterizer CacheFernandoS272018-10-181-0/+16
| | | | |
| * | | | Implement 3D TexturesFernandoS272018-10-184-1/+10
| | | | |
* | | | | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1822-648/+1720
|\ \ \ \ \ | | | | | | | | | | | | "Better Hid" Rework Part 1
| * | | | | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| | | | | | | | | | | | | | | | | | | | | | | | Reason for the change is to allow both docked and undocked mode to work
| * | | | | WipDavid Marcec2018-10-122-3/+23
| | | | | |
| * | | | | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| | | | | | | | | | | | | | | | | | | | | | | | Kirby input still doesn't work, should fix a lot of other games
| * | | | | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| | | | | | | | | | | | | | | | | | | | | | | | Used by Mario Party
| * | | | | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| | | | | | | | | | | | | | | | | | | | | | | | HandheldVariant is for specific games which expect handheld controllers to be at position 8(kirby), however this doesn't fix all games as some games require handhelds to be at position 0(snipperclips)
| * | | | | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| | | | | |
| * | | | | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| | | | | | | | | | | | | | | | | | | | | | | | Fixes arms
| * | | | | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| | | | | |
| * | | | | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| | | | | |
| * | | | | "Better Hid" rework part 1David Marcec2018-10-1022-644/+1500
| | | | | |
* | | | | | Merge pull request #1489 from FernandoS27/fix-tldsbunnei2018-10-181-1/+5
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | shader_decompiler: Fix TLDS
| * | | | | Fix TLDSFernandoS272018-10-141-1/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #1497 from bunnei/flush-framebuffersbunnei2018-10-1815-188/+429
|\ \ \ \ \ | | | | | | | | | | | | Implement flushing in the rasterizer cache
| * | | | | gl_rasterizer_cache: Remove unnecessary block_depth=1 on Flush.bunnei2018-10-181-1/+0
| | | | | |
| * | | | | gl_rasterizer_cache: Remove unnecessary temporary buffer with unswizzle.bunnei2018-10-181-5/+2
| | | | | |
| * | | | | gl_rasterizer_cache: Use AccurateCopySurface for use_accurate_gpu_emulation.bunnei2018-10-162-2/+18
| | | | | |
| * | | | | config: Rename use_accurate_framebuffers -> use_accurate_gpu_emulation.bunnei2018-10-1610-20/+20
| | | | | | | | | | | | | | | | | | | | | | | | - This will be used as a catch-all for slow-but-accurate GPU emulation paths.
| * | | | | rasterizer_cache: Refactor to support in-order flushing.bunnei2018-10-166-63/+116
| | | | | |
| * | | | | gl_rasterizer_cache: Refactor to only call GetRegionEnd on surface creation.bunnei2018-10-162-16/+23
| | | | | |
| * | | | | gl_rasterizer_cache: Only flush when use_accurate_framebuffers is enabled.bunnei2018-10-162-2/+13
| | | | | |
| * | | | | gl_rasterizer_cache: Separate guest and host surface size managment.bunnei2018-10-162-92/+94
| | | | | |
| * | | | | gl_rasterizer_cache: Rename GetGLBytesPerPixel to GetBytesPerPixel.bunnei2018-10-162-17/+18
| | | | | | | | | | | | | | | | | | | | | | | | - This does not really have anything to do with OpenGL.
| * | | | | gl_rasterizer_cache: Remove unused FlushSurface method.bunnei2018-10-162-7/+0
| | | | | |
| * | | | | gl_rasterizer: Implement flushing.bunnei2018-10-161-1/+25
| | | | | |
| * | | | | gl_rasterizer_cache: Remove usage of Memory::Read/Write functions.bunnei2018-10-161-13/+8
| | | | | | | | | | | | | | | | | | | | | | | | - These cannot be used within the cache, as they change cache state.
| * | | | | gl_rasterizer_cache: Clamp cached surface size to mapped GPU region size.bunnei2018-10-162-19/+37
| | | | | |
| * | | | | memory_manager: Add a method for querying the end of a mapped GPU region.bunnei2018-10-162-0/+11
| | | | | |
| * | | | | rasterizer_cache: Reintroduce method for flushing.bunnei2018-10-163-0/+23
| | | | | |
| * | | | | gl_rasterizer_cache: Reintroduce code for handling swizzle and flush to guest RAM.bunnei2018-10-162-28/+119
| | |_|/ / | |/| | |
* | | | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \ \ \ | | | | | | | | | | | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()
| * | | | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | So, one thing that's puzzled me is why the kernel seemed to *not* use the direct code address ranges in some cases for some service functions. For example, in svcMapMemory, the full address space width is compared against for validity, but for svcMapSharedMemory, it compares against 0xFFE00000, 0xFF8000000, and 0x7FF8000000 as upper bounds, and uses either 0x200000 or 0x8000000 as the lower-bounds as the beginning of the compared range. Coincidentally, these exact same values are also used in svcGetInfo, and also when initializing the user address space, so this is actually retrieving the ASLR extents, not the extents of the address space in general.
* | | | | | Merge pull request #1496 from FernandoS27/tex-arraybunnei2018-10-181-14/+55
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement Arrays on Tex Instruction
| * | | | | | Implement Arrays on Tex InstructionFernandoS272018-10-141-14/+55
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1509 from DarkLordZach/device-save-databunnei2018-10-181-1/+12
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | savedata_factory: Add DeviceSaveData and fix TemporaryStorage
| * | | | | savedata_factory: Add TemporaryStorage SaveDataSpaceIdZach Hilman2018-10-161-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | Required for TemporaryStorage saves (in addition to SaveDataType)
| * | | | | savedata_factory: Add support for DeviceSaveDataZach Hilman2018-10-161-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | Uses the same path as SaveData except with UID 0. Adds a warning if UID is not 0.
* | | | | | Merge pull request #1443 from DarkLordZach/lower-loader-logs-1bunnei2018-10-162-3/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | content_archive/patch_manager: Lower log levels to eliminate some unnecessary logs
| * | | | | | patch_manager: Move non-Program RomFS patch log to DebugZach Hilman2018-10-131-2/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Normal Program-type patches will still be logged to aid in debugging, but for others (mainly Control), it was moved to Debug.
| * | | | | | content_archive: Move get key log to Trace levelZach Hilman2018-10-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids printing live keys in the general log.
* | | | | | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement VI ConvertScalingMode * Fixed push enum * Scale mode now uses Nintendo scale mode as an enum as well
* | | | | | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-1612-60/+76
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Convert shared_ptr instances into unique_ptr instances where applicable for System and Cpu
| * | | | | | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-1510-31/+50
| | | | | | | |
| * | | | | | | core: Make the live Cpu instances unique_ptrs instead of shared_ptrsLioncash2018-10-151-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need for shared ownership here, as the only owning class instance of those Cpu instances is the System class itself. We can also make the thread_to_cpu map use regular pointers instead of shared_ptrs, given that the Cpu instances will always outlive the cases where they're used with that map.
| * | | | | | | core: Make the exclusive monitor a unique_ptr instead of a shared_ptrLioncash2018-10-155-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the barrier, this is owned entirely by the System and will always outlive the encompassing state, so shared ownership semantics aren't necessary here.
| * | | | | | | core: Make CPUBarrier a unique_ptr instead of a shared_ptrLioncash2018-10-153-11/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will always outlive the Cpu instances, since it's destroyed after we destroy the Cpu instances on shutdown, so there's no need for shared ownership semantics here.
* | | | | | | | Merge pull request #1508 from lioncash/unique-regbunnei2018-10-1612-51/+53
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicable
| * | | | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-1612-51/+53
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The data retrieved in these cases are ultimately chiefly owned by either the RegisteredCache instance itself, or the filesystem factories. Both these should live throughout the use of their contained data. If they don't, it should be considered an interface/design issue, and using shared_ptr instances here would mask that, as the data would always be prolonged after the main owner's lifetime ended. This makes the lifetime of the data explicit and makes it harder to accidentally create cyclic references. It also makes the interface slightly more flexible than the previous API, as a shared_ptr can be created from a unique_ptr, but not the other way around, so this allows for that use-case if it ever becomes necessary in some form.
* | | | | | | | Merge pull request #1507 from FearlessTobi/port-4327bunnei2018-10-161-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Port citra-emu/citra#4327: "travis: Ignore binary files when checking for trailing whitespace"
| * | | | | | | travis: Ignore binary files when checking for trailing whitespaceCameron Cawley2018-10-161-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1473 from lioncash/cmakebunnei2018-10-167-199/+214
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | web_service: Make linkage of web_service-related externals and the library private
| * | | | | | | core/CMakeLists: Make all web_service-related libraries privateLioncash2018-10-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that all external dependencies are hidden, we can remove json-headers from the publically linked libraries, as the use of this library is now completely hidden from external users of the web_service library. We can also make the web_services library private as well, considering it's not a requirement. If a library needs to link in web_service, it should be done explicitly -- not via indirect linking.
| * | | | | | | web_backend: Make Client use the PImpl idiomLioncash2018-10-115-142/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like with TelemetryJson, we can make the implementation details private and avoid the need to expose httplib to external libraries that need to use the Client class.
| * | | | | | | telemetry_json: Use the PImpl idiom to avoid unnecessary dependency exposureLioncash2018-10-112-49/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Users of the web_service library shouldn't need to care about an external library like json.h. However, given it's exposed in our interface, this requires that other libraries publicly link in the JSON library. We can do better. By using the PImpl idiom, we can hide this dependency in the cpp file and remove the need to link that library in altogether.
| * | | | | | | telemetry_json: Add missing override specifier to the destructor of TelemetryJsonLioncash2018-10-111-1/+1
| | | | | | | |
| * | | | | | | telemetry_json: Take std::string parameters by valueLioncash2018-10-112-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Taking them by const reference isn't advisable here, because it means the std::move calls were doing nothing and we were always copying the std::string instances.
| * | | | | | | telemetry_json: Remove unnecessary includesLioncash2018-10-112-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes unused includes. Also rectifies a missing <chrono> include.
| * | | | | | | core/CMakeLists: Use target_compile_definitions instead of add_definitions for specifying ENABLE_WEB_SERVICELioncash2018-10-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids introducing the definition to the whole directory space and localizes it to being added to the library that needs it.
* | | | | | | | Merge pull request #1487 from lioncash/maybe-unusedbunnei2018-10-161-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu/main: Apply the [[maybe_unused]] attribute to the parameter of SetDiscordEnabled
| * | | | | | | | yuzu/main: Apply the [[maybe_unused]] attribute to the parameter of SetDiscordEnabled()Lioncash2018-10-131-1/+1
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Depending on whether or not USE_DISCORD_PRESENCE is defined, the "state" parameter can be used or unused. If USE_DISCORD_PRESENCE is not defined, the parameter will be considered unused, which can lead to compiler warnings. So, we can explicitly mark it with [[maybe_unused]] to inform the compiler that this is intentional.
* | | | | | | | Merge pull request #1504 from lioncash/constantbunnei2018-10-161-3/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys/control_metadata: Get rid of magic constants
| * | | | | | | | file_sys/control_metadata: Get rid of magic constantsLioncash2018-10-161-3/+6
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are just the size of the data being passed in, so we can specify that via the size() member function.
* | | | | | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-163-3/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | aoc: Fix various bugs in current AOC implementation
| * | | | | | | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-153-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | Falls back to title ID + 0x1000, which is what HOS does.
| * | | | | | | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #1499 from lioncash/nrobunnei2018-10-157-28/+39
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nro/nso: Minor error handling changes
| * | | | | | | | nso: Return an optional address from LoadModuleLioncash2018-10-155-16/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a malformed NSO is attempted to be loaded, we shouldn't continue onwards. We should be reporting an error and bailing out.
| * | | | | | | | nso: Make LoadModule take a VfsFile by const referenceLioncash2018-10-153-11/+9
| | | | | | | | |
| * | | | | | | | nro: Make LoadNro take a VfsFile by const referenceLioncash2018-10-152-6/+6
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to care about ownership semantics, so we can just pass it a reference to the file itself, rather than a std::shared_ptr alias.
* | | | | | | | Merge pull request #1500 from DarkLordZach/key-derivation-6.0.0bunnei2018-10-152-4/+8
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | crypto: Various crypto fixes for quickstart guide
| * | | | | | | | crypto: Various crypto fixes for quickstart guideZach Hilman2018-10-152-4/+8
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1503 from ReinUsesLisp/misc-vcbunnei2018-10-153-7/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | video_core: Minor style changes
| * | | | | | | shader_bytecode: Add Control Code enum 0xfReinUsesLisp2018-10-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Control Code 0xf means to unconditionally execute the instruction. This value is passed to most BRA, EXIT and SYNC instructions (among others) but this may not always be the case.
| * | | | | | | gl_shader_decompiler: Fixup style inconsistenciesReinUsesLisp2018-10-151-5/+3
| | | | | | | |
| * | | | | | | gl_rasterizer: Silence implicit cast warning in glBindBufferRangeReinUsesLisp2018-10-151-1/+2
|/ / / / / / /
* | | | | | | Merge pull request #1486 from lioncash/filebunnei2018-10-144-63/+72
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | key_manager/partition_data_manager: Minor changes
| * | | | | | | partition_data_manager: Reserve and insert data within output vector in DecryptPackage2()Lioncash2018-10-131-20/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just reserve the memory then perform successive insertions instead of needing to use memcpy. This also avoids the need to zero out the output vector's memory before performing the insertions. We can also std::move the output std::vector into the destination so that we don't need to make a completely new copy of the vector, getting rid of an unnecessary allocation. Additionally, we can use iterators to determine the beginning and end ranges of the std::vector instances that comprise the output vector, as the end of one range just becomes the beginning for the next successive range, and since std::vector's iterator constructor copies data within the range [begin, end), this is more straightforward and gets rid of the need to have an offset variable that keeps getting incremented to determine where to do the next std::memcpy.
| * | | | | | | partition_data_manager: Remove unused std::map instance within DecryptPackage2()Lioncash2018-10-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aside from emplacing elements into the map, the map itself is never actually queried for contained data.
| * | | | | | | partition_data_manager: Take package2_keys by const referenceLioncash2018-10-132-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only ever read from, so we don't need to make a copy of all the keys here.
| * | | | | | | partition_data_manager: Move IV data to where it's needed in DecryptPackage2()Lioncash2018-10-131-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given it's only used in one spot and has a fairly generic name, we can just specify it directly in the function call. This also the benefit of automatically moving it.
| * | | | | | | partition_data_manager: Remove commented out codeLioncash2018-10-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commented out code shouldn't be left in without a reason indicating why in a comment.
| * | | | | | | key_manager/partition_data_manager: Silence truncation compiler warningsLioncash2018-10-134-10/+15
| | | | | | | |
| * | | | | | | partition_data_manager: Dehardcode array boundsLioncash2018-10-132-7/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we can make it part of the type and make named variables for them, so they only require one definition (and if they ever change for whatever reason, they only need to be changed in one spot).
| * | | | | | | partition_data_manager: Take VirtualFile by const reference in constructorLioncash2018-10-132-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the VirtualFile instance isn't stored into the class as a data member, or written to, this can just be turned into a const reference, as the constructor doesn't need to make a copy of it.
| * | | | | | | partition_data_manager: Amend constructor initializer list orderLioncash2018-10-131-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the members in the exact order they would be initialized. This also prevents compiler warnings about this sort of thing.
| * | | | | | | partition_data_manager: Remove unused includesLioncash2018-10-132-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets unused includes out of the headers and moves them into the cpp file if they're used there instead.
| * | | | | | | key_manager: Use std::vector's insert() instead of std::copy with a back_inserterLioncash2018-10-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the data is unconditionally being appended to the back of a std::vector, we can just directly insert it there without the need to insert all of the elements one-by-one with a std::back_inserter.
| * | | | | | | key_manager: Brace long conditional bodyLioncash2018-10-131-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a conditional (or it's body) travels more than one line, it should be braced.
| * | | | | | | key_manager: Don't assume file seeks and reads will always succeedLioncash2018-10-131-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the filesystem should always be assumed to be volatile, we should check and bail out if a seek operation isn't successful. This'll prevent potentially writing/returning garbage data from the function in rare cases. This also allows removing a check to see if an offset is within the bounds of a file before perfoming a seek operation. If a seek is attempted beyond the end of a file, it will fail, so this essentially combines two checks into one in one place.
| * | | | | | | key_manager: Remove unnecessary seek in DeriveSDSeed()Lioncash2018-10-131-1/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the file is opened a few lines above and no operations are done, other than check if the file is in a valid state, the read/write pointer will always be at the beginning of the file.
* | | | | | | Merge pull request #1490 from lioncash/bootbunnei2018-10-141-14/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/main: Simplify OnMenuLoadFile()
| * | | | | | | yuzu/main: Simplify OnMenuLoadFile()Lioncash2018-10-131-14/+12
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can utilize QStringList's join() function to perform all of the appending in a single function call. While we're at it, make the extension list a single translatable string and add a disambiguation comment to explain to translators what %1 actually is.
* | | | | | | Merge pull request #1488 from Hexagon12/astc-typesbunnei2018-10-143-6/+32
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Added ASTC 5x4; 8x5 types
| * | | | | | | Added ASTC 5x4; 8x5Hexagon122018-10-133-6/+32
| | | | | | | |
* | | | | | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-147-20/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem by reference
| * | | | | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-137-20/+19
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither of these functions alter the ownership of the provided pointer, so we can simply make the parameters a reference rather than a direct shared pointer alias. This way we also disallow passing incorrect memory values like nullptr.
* | | | | | | | Merge pull request #1480 from FernandoS27/neue-swizzlebunnei2018-10-148-107/+176
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | Introduce 3D Swizzle seamlessly
| * | | | | | | Shorten the implementation of 3D swizzle to only 3 functionsFernandoS272018-10-141-70/+27
| | | | | | | |
| * | | | | | | Fix a Crash on Zelda BotW and Splatoon 2, and simplified LoadGLBufferFernandoS272018-10-132-19/+2
| | | | | | | |
| * | | | | | | Propagate depth and depth_block on modules using decodersFernandoS272018-10-138-54/+67
| | | | | | | |
| * | | | | | | Remove old Swizzle algorithms and use 3d SwizzleFernandoS272018-10-131-93/+69
| | | | | | | |
| * | | | | | | Implement Precise 3D SwizzleFernandoS272018-10-131-3/+71
| | | | | | | |
| * | | | | | | Implement Fast 3D SwizzleFernandoS272018-10-131-2/+74
| |/ / / / / /
* | | | | | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | svc: Implement svcGetProcessInfo
| * | | | | | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A fairly basic service function, which only appears to currently support retrieving the process state. This also alters the ProcessStatus enum to contain all of the values that a kernel process seems to be able of reporting with regards to state.
* | | | | | | Merge pull request #1495 from ogniK5377/break-stopbunnei2018-10-141-0/+6
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Stop all threads on svcBreak
| * | | | | | Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / / / / / | | | | | | | | | | | | | | | | | | This should help diagnose crashes easier and prevent many users thinking that a game is still running when in fact it's just an audio thread still running(this is typically not killed when svcBreak is hit since the game expects us to do this)
* | | | | | Merge pull request #1409 from DarkLordZach/key-derivationbunnei2018-10-1311-74/+1663
|\ \ \ \ \ \ | | | | | | | | | | | | | | crypto: Add support for full key derivation
| * | | | | | partition_data_manager: Rename system files for hekateZach Hilman2018-10-076-195/+247
| | | | | | | | | | | | | | | | | | | | | | | | | | | | x
| * | | | | | qt: Add rederive keyset menu optionZach Hilman2018-10-073-49/+89
| | | | | | |
| * | | | | | qt: Add key derivation progress bar on initial setupZach Hilman2018-10-071-0/+52
| | | | | | |
| * | | | | | crypto: Add PartitionDataManagerZach Hilman2018-10-073-0/+692
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps track of system files for key derivation
| * | | | | | key_manager: Add support for loading keys from partition dataZach Hilman2018-10-072-0/+88
| | | | | | |
| * | | | | | key_manager: Add ETicket key derivationZach Hilman2018-10-073-2/+277
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Derives titlekeys
| * | | | | | key_manager: Add base key derivationZach Hilman2018-10-072-4/+220
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Derives master keys, game encryption keys, and package1/2 keys
| * | | | | | key_manager: Add BIS key getterZach Hilman2018-10-072-2/+19
| | | | | | |
| * | | | | | key_manager: Add support for more keysZach Hilman2018-10-072-3/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | TSEC, SBK, BIS, and other Sources for proper derivation
| * | | | | | key_manager: Add keyblob supportZach Hilman2018-10-072-0/+14
| | | | | | |
| * | | | | | key_manager: Add support for crypto revisions past 04Zach Hilman2018-10-071-43/+63
| | | | | | |
| * | | | | | key_manager: Add support for comments in keyfilesZach Hilman2018-10-071-0/+3
| | | | | | |
| * | | | | | vfs: Move forward declarations to separate fileZach Hilman2018-10-072-9/+22
| | | | | | |
| * | | | | | key_manager: Add support for console-specific keyfileZach Hilman2018-10-072-3/+13
| | | | | | |
| * | | | | | key_manager: Rename KEK to KekZach Hilman2018-10-072-8/+9
| | | | | | |
| * | | | | | externals/mbedtls: Enable CMAC moduleZach Hilman2018-10-071-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Required for keyblob verification
* | | | | | | Merge pull request #1483 from lioncash/codesetbunnei2018-10-137-83/+45
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/process: Make CodeSet a regular non-inherited object
| * | | | | | | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-127-83/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These only exist to ferry data into a Process instance and end up going out of scope quite early. Because of this, we can just make it a plain struct for holding things and just std::move it into the relevant function. There's no need to make this inherit from the kernel's Object type.
* | | | | | | | Merge pull request #1484 from FernandoS27/calculate-sizebunnei2018-10-132-0/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implemented helper function to correctly calculate a texture's size
| * | | | | | | | Implemented helper function to correctly calculate a texture's sizeFernandoS272018-10-122-0/+22
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemory
| * | | | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixed incorrect types for svcBreak
| * | | | | | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| | | | | | | |
| * | | | | | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | signal_debugger seems like a more fitting name
| * | | | | | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | svcBreak reason should be a u32, not a u64.
* | | | | | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Passing an invalid nmap handle to Remap should throw an error
| * | | | | | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| | | | | | | |
| * | | | | | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Added error for invalid nmap handles
* | | | | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | thread: Remove unnecessary memset from ResetThreadContext()
| * | | | | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Regular value initialization is adequate here for zeroing out data. It also has the benefit of not invoking undefined behavior if a non-trivial type is ever added to the struct for whatever reason.
* | | | | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Added error codes for nvmap
| * | | | | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| | | | | | |
| * | | | | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ / / / /
* | | | | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | HwOpus, Implemented DecodeInterleavedWithPerformance
| * | | | | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / / / / | | | | | | | | | | | | | | | | | | Used by sonic ages
* | | | | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemory
| * | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds the missing address range checking that the service functions do before attempting to map or unmap memory. Given that both service functions perform the same set of checks in the same order, we can wrap these into a function and just call it from both functions, which deduplicates a little bit of code.
* | | | | | Merge pull request #1476 from bunnei/fix-unmap-flushbunnei2018-10-111-3/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvhost_as_gpu: Flush/invalidate CPU VAddr on UnmapBuffer.
| * | | | | | nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1477 from ReinUsesLisp/vmadbunnei2018-10-112-0/+118
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_decompiler: Implement VMAD
| * | | | | gl_shader_decompiler: Implement VMADReinUsesLisp2018-10-112-0/+118
|/ / / / /
* | | | | Merge pull request #1458 from FernandoS27/fix-render-target-block-settingsbunnei2018-10-115-18/+81
|\ \ \ \ \ | |/ / / / |/| | | | Fixed block height settings for RenderTargets and Depth Buffers
| * | | | Add memory Layout to Render Targets and Depth BuffersFernandoS272018-10-103-21/+33
| | | | |
| * | | | Fixed block height settings for RenderTargets and Depth Buffers, and added block width and block depthFernandoS272018-10-105-12/+63
| | | | |
* | | | | Merge pull request #1460 from FernandoS27/scissor_testbunnei2018-10-103-1/+36
|\ \ \ \ \ | | | | | | | | | | | | Implemented Scissor Testing
| * | | | | Implement Scissor TestFernandoS272018-10-091-4/+9
| | | | | |
| * | | | | Assert Scissor testsFernandoS272018-10-093-1/+31
| |/ / / /
* | | | | Merge pull request #1425 from ReinUsesLisp/geometry-shadersbunnei2018-10-1011-120/+543
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement geometry shaders
| * | | | | gl_shader_decompiler: Move position varying location from 15 to 0 and apply an offsetReinUsesLisp2018-10-071-6/+10
| | | | | |
| * | | | | gl_shader_decompiler: Implement geometry shadersReinUsesLisp2018-10-0710-107/+522
| | | | | |
| * | | | | video_core: Allow LabelGLObject to use extra info on any objectReinUsesLisp2018-10-071-10/+14
| | |_|/ / | |/| | |
* | | | | Merge pull request #1469 from lioncash/ptrbunnei2018-10-1010-39/+41
|\ \ \ \ \ | | | | | | | | | | | | kernel/thread: Use a regular pointer for the owner/current process
| * | | | | kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-1010-39/+41
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real need to use a shared pointer in these cases, and only makes object management more fragile in terms of how easy it would be to introduce cycles. Instead, just do the simple thing of using a regular pointer. Much of this is just a hold-over from citra anyways. It also doesn't make sense from a behavioral point of view for a process' thread to prolong the lifetime of the process itself (the process is supposed to own the thread, not the other way around).
* | | | | Merge pull request #1461 from lioncash/warnbunnei2018-10-101-3/+3
|\ \ \ \ \ | | | | | | | | | | | | ips_layer: Silence truncation and conversion warnings
| * | | | | ips_layer: Silence truncation and conversion warningsLioncash2018-10-091-3/+3
| | |/ / / | |/| | | | | | | | | | | | | Makes type conversions explicit to avoid compiler warnings.
* | | | | Merge pull request #1464 from lioncash/uniquebunnei2018-10-107-21/+18
|\ \ \ \ \ | |_|_|/ / |/| | | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptr
| * | | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptrLioncash2018-10-097-21/+18
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither of these functions require the use of shared ownership of the returned pointer. This makes it more difficult to create reference cycles with, and makes the interface more generic, as std::shared_ptr instances can be created from a std::unique_ptr, but the vice-versa isn't possible. This also alters relevant functions to take NCA arguments by const reference rather than a const reference to a std::shared_ptr. These functions don't alter the ownership of the memory used by the NCA instance, so we can make the interface more generic by not assuming anything about the type of smart pointer the NCA is contained within and make it the caller's responsibility to ensure the supplied NCA is valid.
* | | | Merge pull request #1466 from lioncash/unusedbunnei2018-10-101-7/+3
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Remove unused variables in TMML's implementation
| * | | | gl_shader_decompiler: Remove unused variables in TMML's implementationLioncash2018-10-091-7/+3
| |/ / / | | | | | | | | | | | | | | | | Given "y" isn't always used, but "x" is, we can rearrange this to avoid unused variable warnings by changing the names of op_a and op_b
* | | | Merge pull request #1463 from FearlessTobi/port-4310bunnei2018-10-104-10/+131
|\ \ \ \ | | | | | | | | | | Port citra-emu/citra#4310: "Handle touch input"
| * | | | implemented touch in Qt and SDLNeatNit2018-10-094-10/+131
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | change TouchToPixelPos to return std::pair<int, int> static_cast (SDL) various minor style and code improvements style - PascalCase for function names made touch events private const pointer arg in touch events make TouchToPixelPos a const member function did I do this right? braces on barely-multiline if remove question comment (confirmed in Discord) fixed consts remove unused parameter from TouchEndEvent DRY - High-DPI scaled touch put in separate function also fixes a bug where if you start touching (with either mouse or touchscreen) and drag the mouse to the LEFT of the emulator window, the touch point jumps to the RIGHT side of the touchscreen; draggin to above the window would make it jump to the bottom. implicit conversion from QPoint to QPointF, apparently I have no idea what const even means but I'll put it here anyway remove unused or used-once variables make touch scaling functions const, and put their implementations together removed unused FingerID parameters QTouchEvent forward declaration; add comment to TouchBegin that was lost in an edit better DRY in SDL To do -> TODO(NeatNit) remove unused include
* | | | Merge pull request #1459 from ogniK5377/breakbunnei2018-10-091-5/+20
|\ \ \ \ | | | | | | | | | | svcBreak, Signalling to the debugger should not kill execution
| * | | | Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
| | | | |
| * | | | Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
| | | | |
| * | | | svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
| | | | | | | | | | | | | | | | | | | | When loading NROs, svcBreak is called to signal to the debugger that a new "module" is loaded. As no debugger is technically attached we shouldn't be killing the programs execution.
* | | | | Merge pull request #1465 from lioncash/telemetrybunnei2018-10-092-7/+9
|\ \ \ \ \ | | | | | | | | | | | | telemetry_session: Minor miscellaneous changes
| * | | | | telemetry_session: Remove doxygen comment for a non-existent parameterLioncash2018-10-091-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | There's no "func" parameter, so this can just be removed.
| * | | | | telemetry_session: Add missing includesLioncash2018-10-092-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents potential compilation issues in the future by including missing headers for certain functions and types.
| * | | | | telemetry_session: Remove unimplemented FinalizeAsyncJob prototypeLioncash2018-10-091-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | This isn't implemented anywhere, so it can just be removed.
| * | | | | telemetry_session: Use a std::array in GenerateTelemetryId()Lioncash2018-10-091-2/+4
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | We don't need to potentially heap-allocate a std::string instance here, given the data is known ahead of time. We can just place it within an array and pass this to the mbedtls functions.
* | | | | Merge pull request #1462 from lioncash/movebunnei2018-10-092-20/+60
|\ \ \ \ \ | | | | | | | | | | | | ips_layer: Minor miscellaneous changes
| * | | | | ips_layer: Avoid constructing std::vector instances where not necessaryLioncash2018-10-091-6/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just compare the existing std::vector instance with a constexpr std::array containing the desired match. This is lighter resource-wise, as we don't need to allocate on the heap.
| * | | | | ips_layer: Remove unnecessary explicit std::pair constructor in std::arrayLioncash2018-10-091-5/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the layout of the array consistent, by making all elements match, instead of special-casing the first one.
| * | | | | ips_layer: Add missing includesLioncash2018-10-092-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds missing includes to prevent potential compilation issues in the future. Also moves the definition of a struct into the cpp file, so that some includes don't need to be introduced within the header.
| * | | | | ips_layer: std::move data within PatchIPS() and Apply()Lioncash2018-10-091-2/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | We don't need to make a copy of the read data, so we can std::move it into the make_shared call here.
* | | | | Merge pull request #1455 from ogniK5377/smo-softlockfixbunnei2018-10-092-15/+123
|\ \ \ \ \ | |/ / / / |/| | | | Fixed smo softlock due to incorrect effect state updating
| * | | | EffectOutStatus padding is now in hexDavid Marcec2018-10-091-1/+1
| | | | |
| * | | | Fixups for softlockDavid Marcec2018-10-072-6/+7
| | | | |
| * | | | Fixed missing returnDavid Marcec2018-10-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Softlock explanation: after effects are initialized in smo, nothing actually changes the state. It expects the state to always be initialized. With the previous testing, updating the states much like how we handle the memory pools continue to have the softlock(which is why I said it probably wasn't effects) after further examination it seems like effects need to be initialized but the state remains unchanged until further notice. For now, assertions are added for the aux buffers to see if they update, unable to check as I haven't gotten smo to actually update them yet.
| * | | | Fixed smo softlockDavid Marcec2018-10-072-13/+120
| | | | |
* | | | | Merge pull request #1423 from DarkLordZach/romfs-file-extsbunnei2018-10-085-10/+38
|\ \ \ \ \ | | | | | | | | | | | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFS
| * | | | | patch_manager: Avoid romfs_ext requirement for patchingZach Hilman2018-10-041-4/+1
| | | | | |
| * | | | | fsmitm_romfsbuild: Extract stubs and IPS to romfs_ext dirZach Hilman2018-10-045-21/+38
| | | | | |
| * | | | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFSZach Hilman2018-10-041-0/+14
| | | | | |
* | | | | | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-086-23/+323
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | ips_layer: Add support for IPSwitch executable patches
| * | | | | ips_layer: Fix inaccuracies with comments and flagsZach Hilman2018-10-043-16/+51
| | | | | | | | | | | | | | | | | | Specifically bugs/crashes that arise when putting them in positions that are legal but not typical, such as midline, between patch data, or between patch records.
| * | | | | ips_layer: Deduplicate resource usageZach Hilman2018-10-045-33/+39
| | | | | |
| * | | | | ips_layer: Add support for escape sequences and midline commentsZach Hilman2018-10-043-8/+41
| | | | | | | | | | | | | | | | | | | | | | | | More accurately follows IPSwitch specification.
| * | | | | patch_manager: Add support for IPSwitch format patchesZach Hilman2018-10-041-22/+56
| | | | | |
| * | | | | ips_layer: Add IPSwitchCompiler to process IPSwitch formatZach Hilman2018-10-042-0/+168
| | | | | |
| * | | | | hex_util: Add HexVectorToString and HexStringToVectorZach Hilman2018-10-042-0/+24
| |/ / / / | | | | | | | | | | | | | | | Converts between bytes and strings when the size is not known at compile time.
* | | | | Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ \ \ \ \ | | | | | | | | | | | | Fixed assertion due to CountAddOnContent & Casting warnings
| * | | | | Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | Word count should be 3 since we're pushing a result code and a u32. Also fixed up compiler warnings due to casting
* | | | | Merge pull request #1457 from ogniK5377/unmap-bufferbunnei2018-10-081-1/+6
|\ \ \ \ \ | | | | | | | | | | | | Unmapping an unmapped buffer should succeed
| * | | | | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
| |/ / / / | | | | | | | | | | | | | | | Hardware tests show that trying to unmap an unmapped buffer already should always succeed. Hardware test was tested up to 32 iterations of attempting to unmap
* | | | | Merge pull request #1419 from DarkLordZach/homebrew-argsbunnei2018-10-0810-11/+84
|\ \ \ \ \ | |/ / / / |/| | | | nso/nro: Add support for passing command-line arguments to executable
| * | | | nso/nro: Use default allocation size for arg_dataZach Hilman2018-10-074-14/+20
| | | | |
| * | | | cmd: Support passing game arguments from command lineZach Hilman2018-10-074-10/+14
| | | | | | | | | | | | | | | | | | | | Uses -p (--program) and following string as args.
| * | | | qt: Add UI option to configure argumentsZach Hilman2018-10-073-0/+27
| | | | |
| * | | | settings: Add program_args string settingZach Hilman2018-10-071-0/+1
| | | | |
| * | | | nso/nro: Add NSO arguments structure to data sectionZach Hilman2018-10-074-3/+38
|/ / / / | | | | | | | | | | | | Only added if arguments string is non-empty and a pass is requested by loader.
* | | | Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-0716-21/+143
|\ \ \ \ | | | | | | | | | | loader: Add support for packed updates
| * | | | romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-0510-9/+38
| | | | |
| * | | | patch_manager: Add support for NSP packed updatesZach Hilman2018-10-052-3/+10
| | | | | | | | | | | | | | | | | | | | Reads as Update (NSP) in add-ons
| * | | | game_list: Add XCI update versioning to game listZach Hilman2018-10-051-4/+8
| | | | |
| * | | | patch_manager: Add support for packed updatesZach Hilman2018-10-054-5/+18
| | | | | | | | | | | | | | | | | | | | Will prefer any installed update over the packed version.
| * | | | loader: Add getter for packed updateZach Hilman2018-10-056-3/+58
| | | | | | | | | | | | | | | | | | | | Reads the update included with the game if it has one and adds the new ErrorNoPackedUpdate status.
| * | | | loader: Add ReadRomFSIVFCOffset to NSP, XCI, and NAX loadersZach Hilman2018-10-056-6/+20
| |/ / / | | | | | | | | | | | | Fixes errors with certain updates
* | | | Merge pull request #1446 from bunnei/fast_fermi_copybunnei2018-10-0710-40/+121
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement accelerated Fermi2D copies.
| * | | | yuzu/yuzu_cmd: Add checks for required extension ARB_copy_image.bunnei2018-10-062-0/+4
| | | | |
| * | | | fermi_2d: Implement simple copies with AccelerateSurfaceCopy.bunnei2018-10-063-24/+36
| | | | |
| * | | | gl_rasterizer: Add rasterizer cache code to handle accerated fermi copies.bunnei2018-10-065-16/+60
| | | | |
| * | | | gl_rasterizer_cache: Implement a simpler surface copy using glCopyImageSubData.bunnei2018-10-061-0/+21
| | | | |
* | | | | Merge pull request #1437 from FernandoS27/tex-mode2bunnei2018-10-076-69/+265
|\ \ \ \ \ | | | | | | | | | | | | Implemented Depth Compare, Shadow Samplers and Texture Processing Modes for TEXS and TLDS
| * | | | | Implemented Depth Compare and Shadow SamplersFernandoS272018-10-066-65/+224
| | | | | |
| * | | | | Implemented Texture Processing Modes in TEXS and TLDSFernandoS272018-10-031-5/+42
| | | | | |
* | | | | | Merge pull request #1453 from FearlessTobi/port-4311bunnei2018-10-071-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port citra-emu/citra#4311: "Remove "#" in the version number"
| * | | | | | Remove "#" in the version numberfearlessTobi2018-10-061-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | So that people can stop using it in issue/pr comments and randomly link some other issue/pr unintentionally.
* | | | | | Merge pull request #1451 from FearlessTobi/port-4140bunnei2018-10-075-19/+119
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | Port citra-emu/citra#4140: "misc input tab improvements"
| * | | | | citra_qt/configuration: misc input tab improvementszhupengfei2018-10-065-19/+119
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added a context menu on the buttons including Clear & Restore Default * Allow clearing (unsetting) inputs. Added a Clear All button * Allow restoring a single input to default (instead of all)
* | | | | Merge pull request #1450 from FearlessTobi/port-4312Mat M2018-10-071-0/+0
|\ \ \ \ \ | | | | | | | | | | | | Port citra-emu/citra#4312: "Update fmt to 5.2.1"
| * | | | | Update fmt to 5.2.1Weiyi Wang2018-10-061-0/+0
| |/ / / / | | | | | | | | | | | | | | | It seems to fix msvc warnings
* | | | | Merge pull request #1448 from ogniK5377/frontend-accessbunnei2018-10-074-0/+26
|\ \ \ \ \ | | | | | | | | | | | | Ported #4296 from citra
| * | | | | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| | | | | |
| * | | | | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
| | | | | | | | | | | | | | | | | | | | | | | | This will allow us to easily remove the use of "NFC" in "System"
* | | | | | Merge pull request #1454 from ReinUsesLisp/fixup-drawMat M2018-10-071-0/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | gl_rasterizer: Fixup undefined behaviour in SetupDraw
| * | | | | gl_rasterizer: Fixup undefined behaviour in SetupDrawReinUsesLisp2018-10-071-0/+1
| | | | | |
* | | | | | Merge pull request #1452 from FearlessTobi/port-4313Mat M2018-10-061-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Port citra-emu/citra#4313: "CONTRIBUTING.md - remove note about casting numeric types"
| * | | | | CONTRIBUTING.md - remove note about casting numeric typesNeatNit2018-10-061-1/+1
|/ / / / / | | | | | | | | | | Apparently it's not true: https://github.com/citra-emu/citra/pull/4310#discussion_r223174725
* | | | | Merge pull request #1449 from lioncash/linkbunnei2018-10-062-2/+2
|\ \ \ \ \ | | | | | | | | | | | | qt: Update telemetry links
| * | | | | qt: Update telemetry linksLioncash2018-10-062-2/+2
|/ / / / / | | | | | | | | | | | | | | | These were pointing to a non-existent webpage.
* | | | | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-0655-40/+21635
|\ \ \ \ \ | |_|/ / / |/| | | | Port web_service from Citra
| * | | | Review comments - part 5fearlessTobi2018-10-024-8/+7
| | | | |
| * | | | Review comments -part 4fearlessTobi2018-10-024-9/+7
| | | | |
| * | | | Review comments - part 3fearlessTobi2018-10-027-26/+8
| | | | |
| * | | | web_backend: protect jwt cache with a mutexWeiyi Wang2018-10-022-1/+4
| | | | |
| * | | | Address more review commentsfearlessTobi2018-10-022-5/+5
| | | | |
| * | | | Address a bunch of review commentsfearlessTobi2018-10-0211-19/+27
| | | | |
| * | | | Port web_service from CitrafearlessTobi2018-10-0245-39/+1575
| | | | |
| * | | | Add submodulesfearlessTobi2018-10-0211-0/+20069
| | |/ / | |/| |
* | | | Merge pull request #1447 from lioncash/mutexbunnei2018-10-061-1/+1
|\ \ \ \ | |_|/ / |/| | | kernel/mutex: Amend behavior of TransferMutexOwnership()
| * | | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | This was the result of a typo accidentally introduced in e51d715700a35a8f14e5b804b6f7553c9a40888b. This restores the previous correct behavior. The behavior with the reference was incorrect and would cause some games to fail to boot.
* | | Merge pull request #1440 from lioncash/arraybunnei2018-10-063-5/+10
|\ \ \ | | | | | | | | ui_settings: Place definition of the theme array within the cpp file
| * | | ui_settings: Place definition of the theme array within the cpp fileLioncash2018-10-043-5/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Placing the array wholesale into the header places a copy of the whole array into every translation unit that uses the data, which is wasteful. Particularly given that this array is referenced from three different translation units. This also changes the array to contain pairs of const char*, rather than QString instances. This way, the string data is able to be fixed into the read-only segment of the program, as well as eliminate static constructors/heap allocation immediately on program start.
* | | | Merge pull request #1438 from ReinUsesLisp/quadsbunnei2018-10-068-46/+236
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement quads topology
| * | | | gl_rasterizer: Implement quads topologyReinUsesLisp2018-10-048-46/+236
| | | | |
* | | | | Merge pull request #1445 from lioncash/schedbunnei2018-10-062-4/+4
|\ \ \ \ \ | | | | | | | | | | | | thread: Make the scheduler pointer a regular pointer
| * | | | | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Conceptually, it doesn't make sense for a thread to be able to persist the lifetime of a scheduler. A scheduler should be taking care of the threads; the threads should not be taking care of the scheduler. If the threads outlive the scheduler (or we simply don't actually terminate/shutdown the threads), then it should be considered a bug that we need to fix. Attributing this to balika011, as they opened #1317 to attempt to fix this in a similar way, but my refactoring of the kernel code caused quite a few conflicts.
* | | | | Merge pull request #1439 from lioncash/threadbunnei2018-10-0515-227/+418
|\ \ \ \ \ | | | | | | | | | | | | kernel/thread: Make all instance variables private
| * | | | | kernel/thread: Make all instance variables privateLioncash2018-10-0415-227/+418
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of the member variables of the thread class aren't even used outside of the class itself, so there's no need to make those variables public. This change follows in the steps of the previous changes that made other kernel types' members private. The main motivation behind this is that the Thread class will likely change in the future as emulation becomes more accurate, and letting random bits of the emulator access data members of the Thread class directly makes it a pain to shuffle around and/or modify internals. Having all data members public like this also makes it difficult to reason about certain bits of behavior without first verifying what parts of the core actually use them. Everything being public also generally follows the tendency for changes to be introduced in completely different translation units that would otherwise be better introduced as an addition to the Thread class' public interface.
* | | | | Merge pull request #1442 from lioncash/formatbunnei2018-10-051-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()
| * | | | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()Lioncash2018-10-051-1/+1
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | operator+ for std::string creates an entirely new string, which is kind of unnecessary here if we just want to append a null terminator to the existing one. Reduces the total amount of potential allocations that need to be done in the logging path.
* | | | Merge pull request #1415 from DarkLordZach/ipsbunnei2018-10-049-40/+258
|\ \ \ \ | | | | | | | | | | file_sys: Add support for loading IPS patches
| * | | | nso: Optimize loading of IPS patchesZach Hilman2018-10-025-51/+43
| | | | | | | | | | | | | | | | | | | | Avoid resource-heavy classes and remove quasi-duplicated code.
| * | | | deconstructed_rom_directory: Force NSO loader to patch NSOsZach Hilman2018-10-011-1/+3
| | | | |
| * | | | nso: Add framework to support patching of uncompressed NSOsZach Hilman2018-10-012-2/+17
| | | | |
| * | | | patch_manager: Add PatchNSO functionZach Hilman2018-10-013-0/+104
| | | | | | | | | | | | | | | | | | | | While PatchExeFS operated on the entire directory, this function operates on the uncompressed NSO. Avoids copying decompression code to PatchManager.
| * | | | patch_manager: Use strings for patch type instead of enumZach Hilman2018-10-013-33/+36
| | | | |
| * | | | file_sys: Implement function to apply IPS patchesZach Hilman2018-10-012-0/+103
| | | | |
| * | | | nso: Replace NSOHeader padding bytes with build IDZach Hilman2018-10-011-2/+1
| | |_|/ | |/| |
* | | | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ \ \ | | | | | | | | | | aoc_u: Fix edge case with DLC that causes breaks
| * | | | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| |/ / / | | | | | | | | | | | | In some games (Splatoon 2 and Splatoon 2 Splatfest World Premiere, notably), pass offset=0 and count=2047 into the ListAddOnContent method which should return all DLCs for the current title. The (presumably) intended behavior is to successfully return a empty array but because of a < v. <= in an if statement, a failure error code was returned causing these games to svcBreak. This fixes that if statement.
* | | | Merge pull request #1428 from lioncash/qtbunnei2018-10-041-21/+23
|\ \ \ \ | | | | | | | | | | configure_graphics: Make functions internally linked where applicable
| * | | | configure_graphics: Make functions internally linked where applicableLioncash2018-10-031-21/+23
| | |/ / | |/| | | | | | | | | | | | | | These aren't used outside of this translation unit, so they can be internally linked.
* | | | Merge pull request #1431 from lioncash/audiobunnei2018-10-042-16/+34
|\ \ \ \ | | | | | | | | | | configure_audio: Minor cleanup-related changes
| * | | | configure_audio: Move combo box index setting to their own functionsLioncash2018-10-032-11/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the individual behaviors in their own functions, and cleanly separate. We can also do a little better by converting the relevant IDs within the core to a QString only once, instead of converting every string into a std::string.
| * | | | configure_audio: Use QString::fromStdString() for converting audio device namesLioncash2018-10-031-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | This ensures that the proper codec will always be used no matter what. It also avoids relying on ASCII conversions.
| * | | | configure_audio: Add disambiguation comment for the volume percentage stringLioncash2018-10-032-4/+8
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | Disambiguates what the string represents to help translators more easily understand what it is that they're translating. While we're at it, we can move the code to its own function, so that we don't need to specify the same string twice.
* | | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \ \ | | | | | | | | | | services/fsp_srv: Amend service function table
| * | | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| |/ / / | | | | | | | | | | | | | | | | Adds new functions that have been given names to the table. Information is based off what is provided on Switchbrew.
* | | | Merge pull request #1429 from lioncash/translatebunnei2018-10-041-3/+3
|\ \ \ \ | | | | | | | | | | configure_input: Make analog mapping strings translatable
| * | | | configure_input: Make analog mapping strings translatableLioncash2018-10-031-3/+3
| |/ / / | | | | | | | | | | | | | | | | These strings are user-facing, so they should be specified as translatable with tr().
* | | | Merge pull request #1436 from lioncash/viewbunnei2018-10-042-73/+101
|\ \ \ \ | | | | | | | | | | submission_package: Cleanup and bug fixes
| * | | | submission_package: Avoid dangling std::string_view within SetTicketKeys()Lioncash2018-10-031-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetName() returns a std::string by value, not by reference, so after the std::string_view is constructed, it's not well defined to actually execute any member functions of std::string_view that attempt to access the data, as the std::string has already been destroyed. Instead, we can just use a std::string and erase the last four characters.
| * | | | submission_package: Correct location of null check within SetTicketKeys()Lioncash2018-10-031-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | If a ticket file was ever a null pointer, we'd cause a null pointer dereference, as we were calling GetExtension() on the pointer instance.
| * | | | submission_package: Use std::string's rfind() when looking for the extension in InitializeExeFSAndRomFS()Lioncash2018-10-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When searching for a file extension, it's generally preferable to begin the search at the end of the string rather than the beginning, as the whole string isn't going to be walked just to check for something at the end of it.
| * | | | submission_package: Ensure the 'extracted' member variable is always initializedLioncash2018-10-032-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If an error occurs when constructing the PartitionFilesystem instance, the constructor would be exited early, which wouldn't initialize the extracted data member, making it possible for other code to perform an uninitialized read by calling the public IsExtractedType() member function. This prevents that.
| * | | | submission_package: Move ExeFS and RomFS initialization to its own functionLioncash2018-10-032-10/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other two bits of factored out code, this can also be put within its own function. We can also modify the code so that it accepts a const reference to a std::vector of files, this way, we can deduplicate the file retrieval. Now the constructor for NSP isn't a combination of multiple behaviors in one spot. It's nice and separate.
| * | | | submission_package: Move NCA reading code to its own functionLioncash2018-10-032-43/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This too, is completely separate behavior from what is in the constructor, so we can move this to its own isolated function to keep everything self-contained.
| * | | | submission_package: Move ticket key setting to its own functionLioncash2018-10-031-21/+28
| | | | | | | | | | | | | | | | | | | | | | | | | This behavior is entirely independent of the surrounding code, so it can be put in its own function to keep the behavior separate.
| * | | | submission_package: Invert conditionals within NSP's constructor to reduce nestingLioncash2018-10-031-45/+49
| |/ / / | | | | | | | | | | | | We can use early continues here to reduce the amount of nesting.
* | | | Merge pull request #1432 from lioncash/lblbunnei2018-10-041-19/+19
|\ \ \ \ | | | | | | | | | | service/lbl: Update service function table
| * | | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| | |/ / | |/| | | | | | | | | | | | | | Amends the lbl service table to include new names of functions that were added to Switchbrew.
* | | | Merge pull request #1426 from FearlessTobi/port-4253bunnei2018-10-044-158/+7
|\ \ \ \ | | | | | | | | | | Port citra-emu/citra#4253: "common/string_util cleanup"
| * | | | string_util: unify UTF8<->UTF16 conversion to codecvtWeiyi Wang2018-10-022-117/+6
| | | | |
| * | | | string_util: remove TString conversion for windowsWeiyi Wang2018-10-022-19/+1
| | | | | | | | | | | | | | | | | | | | First of all they are foundamentally broken. As our convention is that std::string is always UTF-8, these functions assume that the multi-byte character version of TString (std::string) from windows is also in UTF-8, which is almost always wrong. We are not going to build multi-byte character build, and even if we do, this dirty work should be handled by frontend framework early.
| * | | | string_util: remove ShiftJIS/CP1252 conversion functionWeiyi Wang2018-10-022-22/+0
| |/ / / | | | | | | | | | | | | We always use unicode internally. Any dirty work of conversion with other codec should be handled by frontend framework (Qt). Further more, ShiftJIS/CP1252 are not special (they are not code set used by 3ds, or any guest/host dependencies we have), so there is no reason to specifically include them
* | | | Merge pull request #1435 from lioncash/xcibunnei2018-10-041-1/+3
|\ \ \ \ | |/ / / |/| | | card_image: Ensure program_nca_status is always initialized
| * | | card_image: Ensure program_nca_status is always initializedLioncash2018-10-031-1/+3
| |/ / | | | | | | | | | | | | | | | If any of the error paths before the NCA retrieval are taken, it'll result in program_nca_status being left in an inconsistent state. So we initialize it by default with a value indicating an error.
* | | Merge pull request #1407 from DarkLordZach/dlcbunnei2018-10-015-34/+145
|\ \ \ | |_|/ |/| | aoc_u: Implement functions and add support for DLC loading
| * | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-012-21/+28
| | |
| * | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-013-5/+8
| | | | | | | | | Command #5
| * | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
| | | | | | | | | | | | Commands #2, #3, and #7
| * | romfs_factory: Read from all locations with StorageId NoneZach Hilman2018-10-011-26/+25
| | | | | | | | | | | | Previous behavior was to assert. Seems to mirror expected game behavior.
| * | patch_manager: Add DLC recognition to PatchManagerZach Hilman2018-10-012-0/+27
| | |
* | | Merge pull request #1422 from ReinUsesLisp/fixup-pointsbunnei2018-10-011-1/+4
|\ \ \ | |_|/ |/| | gl_rasterizer: Fixup unassigned point sizes
| * | gl_rasterizer: Fixup unassigned point sizesReinUsesLisp2018-10-011-1/+4
|/ /
* | Merge pull request #1330 from raven02/tldsbunnei2018-10-011-7/+15
|\ \ | | | | | | TLDS: Add 1D sampler
| * | Fix trailing whitespaceraven022018-09-301-1/+4
| | |
| * | Merge branch 'master' into tldsraven022018-09-19164-1068/+1657
| |\ \
| * | | Add 1D sampler for TLDS - TexelFetch (Mario Rabbids)raven022018-09-171-7/+12
| | | |
* | | | Merge pull request #1420 from MerryMage/dynarmicbunnei2018-10-011-0/+0
|\ \ \ \ | | | | | | | | | | externals: Update dynarmic to 4e6848d
| * | | | externals: Update dynarmic to 4e6848dMerryMage2018-09-301-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 4e6848d A32/ir_emitter: Bugfix: ExceptionRaised was producing incorrect PC 41ba9fd value: Move ImmediateToU64() to be a part of Value's interface c6a6271 reg_alloc: Emit AVX instructions where able aedd32a abi: Emit AVX instructions where able f2d9337 a64_exclusive_monitor: Loosen memory ordering requirements 7ca709d travis: Make macOS builds use Xcode 10 14dd45e Fix VShift terminology 88554c4 emit_x64_vector: AVX512 implementation of EmitVectorLogicalVShiftS16 ab4e316 emit_x64_vector: AVX512 implementation of EmitVectorLogicalVShiftS64 0ea84f3 emit_x64_vector: AVX2 implementation of EmitVectorLogicalVShiftS32 c77a2c5 emit_x64_vector: AVX512 implementation of EmitVectorLogicalVShiftU16() e9441fd emit_x64_vector: AVX2 implementation of EmitVectorLogicalVShiftU64() 0e9c33c emit_x64_vector: AVX2 implementation of EmitVectorLogicalVShiftU32() 8f85274 emit_x64_vector: SSSE3 variant of EmitVectorCountLeadingZeros8() be05e75 Merge pull request #397 from VelocityRa/dec-shift-fix bc328fc decoders: Cast to correctly-sized type before shifting 9c3d2d1 a64_emit_x64: Lowercase PAGE_SIZE f538d29 emit_x64_vector_floating_point: SSE4.1 implementation of EmitFPVectorToFixed 1603a6e emit_x64_vector_floating_point: EmitFPVectorRoundInt: Use FCODE 2e1ccaf emit_x64_vector: AVX implementation for EmitVectorCountLeadingZeros8 555bfda emit_x64_vector: SSE implementation of EmitVectorCountLeadingZeros16 71c2589 externals: Update Xbyak to 5.73 1ec1b2f Squashed 'externals/xbyak/' changes from 1de435ed..42462ef9
* | | | | Merge pull request #1322 from bunnei/tex-cubemapbunnei2018-10-015-129/+355
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Implement cubemap textures.
| * | | | | gl_rasterizer_cache: Fixes to how we do render to cubemap.bunnei2018-09-302-32/+5
| | | | | | | | | | | | | | | | | | | | | | | | - Fixes issues with Splatoon 2.
| * | | | | gl_rasterizer_cache: Add check for array rendering to cubemap texture.bunnei2018-09-301-0/+8
| | | | | |
| * | | | | gl_rasterizer_cache: Implement render to cubemap.bunnei2018-09-303-119/+218
| | | | | |
| * | | | | gl_shader_decompiler: TEXS: Implement TextureType::TextureCube.bunnei2018-09-301-0/+8
| | | | | |
| * | | | | gl_rasterizer_cache: Add support for SurfaceTarget::TextureCubemap.bunnei2018-09-302-1/+36
| | | | | |
| * | | | | gl_rasterizer_cache: Implement LoadGLBuffer for Texture2DArray.bunnei2018-09-301-0/+8
| | | | | |
| * | | | | gl_rasterizer_cache: Update BlitTextures to support non-Texture2D ColorTexture surfaces.bunnei2018-09-301-23/+88
| | | | | |
| * | | | | gl_rasterizer_cache: Track texture target and depth in the cache.bunnei2018-09-301-2/+3
| | | | | |
| * | | | | gl_rasterizer_cache: Workaround for Texture2D -> Texture2DArray scenario.bunnei2018-09-303-6/+21
| | | | | |
| * | | | | gl_rasterizer_cache: Keep track of surface 2D size separately from total size.bunnei2018-09-302-32/+46
| |/ / / /
* | | | | Merge pull request #1403 from DarkLordZach/install-sysnandbunnei2018-10-011-4/+14
|\ \ \ \ \ | |_|_|_|/ |/| | | | qt: Install System TitleTypes to System NAND
| * | | | qt: Install System TitleTypes to System NANDZach Hilman2018-09-271-4/+14
| | | | | | | | | | | | | | | Fixes an issue where installed system archive NCAs would be installed to user NAND and not recognized by games.
* | | | | Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\ \ \ \ \ | | | | | | | | | | | | Implement ISystemDisplayService::GetDisplayMode
| * | | | | Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
| | | | | |
* | | | | | Merge pull request #1417 from lioncash/contextbunnei2018-09-3022-82/+183
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | svc: Implement svcGetThreadContext
| * | | | | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have all of the rearranging and proper structure sizes in place, it's fairly trivial to implement svcGetThreadContext(). In the 64-bit case we can more or less just write out the context as is, minus some minor value sanitizing. In the 32-bit case we'll need to clear out the registers that wouldn't normally be accessible from a 32-bit AArch32 exectuable (or process).
| * | | | | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary for the implementation of svcGetThreadContext(), as the kernel checks whether or not the process that owns the thread that has it context being retrieved is a 64-bit or 32-bit process. If the process is 32-bit, then the upper 15 general-purpose registers and upper 16 vector registers are cleared to zero (as AArch32 only has 15 GPRs and 16 128-bit vector registers. not 31 general-purpose registers and 32 128-bit vector registers like AArch64).
| * | | | | kernel/process: Make data member variables privateLioncash2018-09-3018-75/+120
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the public interface consistent in terms of how accesses are done on a process object. It also makes it slightly nicer to reason about the logic of the process class, as we don't want to expose everything to external code.
| * | | | | arm_interface: Add missing fpsr/tpidr members to the ThreadContext structLioncash2018-09-303-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Internally within the kernel, it also includes a member variable for the floating-point status register, and TPIDR, so we should do the same here to match it. While we're at it, also fix up the size of the struct and add a static assertion to ensure it always stays the correct size.
* | | | | | Merge pull request #1418 from FearlessTobi/port-4269Merry2018-09-301-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Port citra-emu/citra#4269: "OSX: Set MACOSX_DEPLOYMENT_TARGET to 10.13"
| * | | | | OSX: Set MACOSX_DEPLOYMENT_TARGET to 10.13B3n302018-09-301-1/+1
| | | | | |
* | | | | | Merge pull request #1414 from lioncash/refbunnei2018-09-2918-42/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | loader: Make the Load() function take a process as a regular reference, not a SharedPtr
| * | | | | | loader: Make the Load() function take a process as a regular reference, not a SharedPtrLioncash2018-09-2918-42/+28
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A process should never require being reference counted in this situation. If the handle to a process is freed before this function is called, it's definitely a bug with our lifetime management, so we can put the requirement in place for the API that the process must be a valid instance.
* | | | | | Merge pull request #1388 from FearlessTobi/port-4258bunnei2018-09-291-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port citra-emu/citra#4258: "Meta: Add gitattributes file"
| * | | | | | Meta: Add gitattributes fileJames Rowe2018-09-221-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Github Linguist will read this file when calculating language stats for the repository. We can use this to exclude any vendored dependencies in externals and dist. Also makes all h files be considered cpp
* | | | | | | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()
| * | | | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | boost::static_pointer_cast for boost::intrusive_ptr (what SharedPtr is), takes its parameter by const reference. Given that, it means that this std::move doesn't actually do anything other than obscure what the function's actual behavior is, so we can remove this. To clarify, this would only do something if the parameter was either taking its argument by value, by non-const ref, or by rvalue-reference.
* | | | | | | | Merge pull request #1411 from ReinUsesLisp/point-sizebunnei2018-09-295-1/+27
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: Implement point_size and add point state sync
| * | | | | | | | video_core: Implement point_size and add point state syncReinUsesLisp2018-09-285-1/+27
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1406 from ReinUsesLisp/multibind-samplersbunnei2018-09-295-8/+25
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_state: Pack sampler bindings into a single ARB_multi_bind
| * | | | | | | | gl_state: Pack sampler bindings into a single ARB_multi_bindReinUsesLisp2018-09-285-8/+25
| | | | | | | | |
* | | | | | | | | Merge pull request #1395 from lioncash/vmbunnei2018-09-2918-160/+418
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | process/vm_manager: Initial modifications to load NPDM metadata
| * | | | | | | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-2511-75/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The locations of these can actually vary depending on the address space layout, so we shouldn't be using these when determining where to map memory or be using them as offsets for calculations. This keeps all the memory ranges flexible and malleable based off of the virtual memory manager instance state.
| * | | | | | | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, these were reporting hardcoded values, but given the regions can change depending on the requested address spaces, these need to report the values that the memory manager contains.
| * | | | | | | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-256-22/+61
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given games can also request a 32-bit or 39-bit address space, we shouldn't be hardcoding the address space range as 36-bit.
| * | | | | | | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-2410-38/+259
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than hard-code the address range to be 36-bit, we can derive the parameters from supplied NPDM metadata if the supplied exectuable supports it. This is the bare minimum necessary for this to be possible. The following commits will rework the memory code further to adjust to this.
* | | | | | | | | Merge pull request #1360 from FearlessTobi/port-3979bunnei2018-09-273-35/+51
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#3979 game_list: move SearchField to game_list_p.h and fix untranslated text
| * | | | | | | | | game_list: move SearchField to game_list_p.h and fix untranslated textzhupengfei2018-09-213-35/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I have tested and made sure the text is translatable, but this would require a translation update to take effect.
* | | | | | | | | | Merge pull request #1394 from lioncash/streambunnei2018-09-275-12/+12
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | stream: Preserve enum class type in GetState()
| * | | | | | | | | stream: Preserve enum class type in GetState()Lioncash2018-09-245-12/+12
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Preserves the meaning/type-safetiness of the stream state instead of making it an opaque u32. This makes it usable for other things outside of the service HLE context.
* | | | | | | | | Merge pull request #1389 from PhiBabin/valgrindMat M2018-09-271-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | FPCR register was uninitialized at start up
| * | | | | | | | | FPCR register was uninitialized at start upPhilippe Babin2018-09-231-1/+1
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1397 from spycrab/cmake_binbunnei2018-09-271-2/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | CMake: Remove superfluous CMAKE_RUNTIME_OUTPUT_DIRECTORY assignment
| * | | | | | | | | | CMake: Remove superfluous CMAKE_RUNTIME_OUTPUT_DIRECTORY assignmentspycrab2018-09-251-2/+0
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1377 from FernandoS27/faster-swizzlebunnei2018-09-271-51/+66
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Improved Fast Swizzle and Legacy Swizzle
| * | | | | | | | | | | Reverse stride align restriction on FastSwizzle due to lost performanceFernandoS272018-09-211-3/+2
| | | | | | | | | | | |
| * | | | | | | | | | | Join both Swizzle methods within one interface functionFernandoS272018-09-211-11/+19
| | | | | | | | | | | |
| * | | | | | | | | | | Standarized Legacy Swizzle to look alike FastSwizzle and use a Swizzling Table insteadFernandoS272018-09-211-42/+38
| | | | | | | | | | | |
| * | | | | | | | | | | Remove same output bpp restriction on FastSwizzleFernandoS272018-09-211-4/+5
| | | | | | | | | | | |
| * | | | | | | | | | | Improved Legacy Swizzler to be better documented and work betterFernandoS272018-09-211-15/+21
| | | | | | | | | | | |
| * | | | | | | | | | | Improved fast swizzle and removed restrictions to itFernandoS272018-09-211-7/+12
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1404 from lioncash/vfsbunnei2018-09-271-14/+13
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | fsmitm_romfsbuild: Minor changes
| * | | | | | | | | | | fsmitm_romfsbuild: std::move std::vector instances in Build()Lioncash2018-09-261-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids making copies of large std::vector instances where it's trivially avoidable to do so.
| * | | | | | | | | | | fsmitm_romfsbuild: Replace manual value aligning with Common::AlignUp()Lioncash2018-09-261-12/+11
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Theres no need to do explicit bitwise arithmetic here, when we have a function that does this with a more descriptive name.
* | | | | | | | | | | Merge pull request #1399 from lioncash/schedbunnei2018-09-264-14/+14
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | kernel/scheduler: Take ARM_Interface instances by reference
| * | | | | | | | | | | core_cpu: Make arm_interface instances a std::unique_ptrLioncash2018-09-252-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only exposed by reference, so we can just make it a unique pointer to get rid of the need to also use reference counting for the pointer.
| * | | | | | | | | | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-253-10/+10
| | |_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It doesn't make sense to allow a scheduler to be constructed around a null pointer.
* | | | | | | | | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service: Add missing headers inclusions where applicable
| * | | | | | | | | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of a few indirect inclusions.
* | | | | | | | | | | | Merge pull request #1402 from ReinUsesLisp/assertsbunnei2018-09-265-3/+92
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | video_core: Add asserts for CS, TFB and alpha testing
| * | | | | | | | | | | | video_core: Add asserts for CS, TFB and alpha testingReinUsesLisp2018-09-265-3/+92
| | |_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Add asserts for compute shader dispatching, transform feedback being enabled and alpha testing. These have in common that they'll probably break rendering without logging.
* | | | | | | | | | | | Merge pull request #1401 from lioncash/vfsbunnei2018-09-2615-175/+172
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | vfs: Minor cleanup related changes to layered VFS code
| * | | | | | | | | | | | patch_manager: Invert conditionals within ApplyLayeredFS()Lioncash2018-09-261-27/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to nest code quite a bit by early-exiting in error cases.
| * | | | | | | | | | | | vfs_vector: Amend initializer list order in VectorVfsFile's constructor initializer listLioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the initializer list members to be in the same order that they would be initialized in. Avoids compiler warnings.
| * | | | | | | | | | | | fsmitm_romfsbuild: Avoid type truncation warningsLioncash2018-09-261-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cast where explicitly necessary and in other cases we can simply modify the algorithm to accomodate larger data.
| * | | | | | | | | | | | fsmitm_romfsbuild: Remove unnecessary constructors and initializers for RomFSBuildFileContext and RomFSBuildDirectoryContextLioncash2018-09-261-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need to duplicate in-class initializers with a constructor initializer list. std::strings also initialize to empty by default.
| * | | | | | | | | | | | fsmitm_romfsbuild: Remove unnecessary loops in Build()Lioncash2018-09-261-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The std::vector instances are already initially allocated with all entries having these values, there's no need to loop through and fill them with it again when they aren't modified.
| * | | | | | | | | | | | fsmitm_romfsbuild: Make auto variable into a std::size_t variable within Build()Lioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | auto x = 0; auto-deduces x to be an int. This is undesirable when working with unsigned values. It also causes sign conversion warnings. Instead, we can make it a proper unsigned value with the correct width that the following expressions operate on.
| * | | | | | | | | | | | yuzu/main: Resolve precedence bug within CalculateRomFSEntrySize()Lioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ternary operators have a lower precedence than arithmetic operators, so what was actually occurring here is "return (out + full) ? x : y" which most definitely isn't intended, given we calculate out recursively above. We were essentially doing a lot of work for nothing.
| * | | | | | | | | | | | yuzu/main: Move functions stored into static std::function instances out of OnGameListDumpRomFS()Lioncash2018-09-261-42/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This can cause warnings about static constructors, and is also not ideal performance-wise due to the indirection through std::function. This also keeps the behavior itself separate from the surrounding code, which can make it nicer to read, due to the size of the code.
| * | | | | | | | | | | | vfs/etc: Append std:: to size_t usagesLioncash2018-09-267-29/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we just recently had a patch backport this from citra, let's try and keep the convention uniform.
| * | | | | | | | | | | | vfs_concat/vfs_layered: Remove friend declarations from ConcatenatedVfsFileLioncash2018-09-268-61/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are only added to the class to allow those functions to access the private constructor, it's a better approach to just make them static functions in the interface, to make the dependency explicit.
| * | | | | | | | | | | | vfs_static: Remove template byte parameter from StaticVfsFileLioncash2018-09-254-42/+42
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This converts it into a regular constructor parameter. There's no need to make this a template parameter on the class when it functions perfectly well as a constructor argument. This also reduces the amount of code bloat produced by the compiler, as it doesn't need to generate the same code for multiple different instantiations of the same class type, but with a different fill value.
* | | | | | | | | | | | Merge pull request #1398 from lioncash/macosbunnei2018-09-261-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | travis: Make macOS builds utilize Xcode 10
| * | | | | | | | | | | travis: Make macOS builds utilize Xcode 10Lioncash2018-09-251-1/+1
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the used toolchain up to date and finally allows the use of <optional> and <variant> standard library headers within the codebase.
* | | | | | | | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-2531-36/+1203
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | file_sys: Add support for LayeredFS mods
| * | | | | | | | | | fsmitm: Cleanup and modernize fsmitm portZach Hilman2018-09-2422-378/+378
| | | | | | | | | | |
| * | | | | | | | | | qt: Add UI elements for LayeredFS and related toolsZach Hilman2018-09-226-5/+162
| | | | | | | | | | |
| * | | | | | | | | | romfs: Implement CreateRomFSZach Hilman2018-09-222-4/+25
| | | | | | | | | | |
| * | | | | | | | | | file_sys: Port Atmosphere-NX fs_mitm implementationZach Hilman2018-09-222-0/+474
| | | | | | | | | | |
| * | | | | | | | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| | | | | | | | | | |
| * | | | | | | | | | bis_factory: Add mod directory VFS getterZach Hilman2018-09-223-3/+18
| | | | | | | | | | |
| * | | | | | | | | | patch_manager: Add LayeredFS mods supportZach Hilman2018-09-222-1/+44
| | | | | | | | | | |
| * | | | | | | | | | vfs_concat: Rewrite and fix ConcatenatedVfsFileZach Hilman2018-09-222-14/+59
| | | | | | | | | | |
| * | | | | | | | | | vfs_layered: Add LayeredVfsDirectoryZach Hilman2018-09-222-0/+178
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reads multiple dirs through as if a waterfall.
| * | | | | | | | | | vfs_vector: Add VectorVfsFileZach Hilman2018-09-222-0/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Maps a vector into the VFS interface.
| * | | | | | | | | | vfs_static: Add StaticVfsFileZach Hilman2018-09-222-0/+78
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Always returns the template argument byte for all reads. Doesn't support writes.
| * | | | | | | | | | vfs: Add and rewite VfsRawCopy functionsZach Hilman2018-09-222-6/+36
| | | | | | | | | | |
| * | | | | | | | | | vfs: Add GetEntries methodZach Hilman2018-09-224-0/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Maps name string to directory or file.
| * | | | | | | | | | common_paths: Add Load and Dump dirsZach Hilman2018-09-223-0/+6
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | svc: Updated svc names
| * | | | | | | | | | svc: Updated svc namestech4me2018-09-241-7/+7
| | | | | | | | | | |
* | | | | | | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented fatal:u properly fatal:u now is properly implemented with all the ipc cmds. Error reports/Crash reports are also now implemented for fatal:u. Crash reports save to yuzu/logs/crash_reports/ The register dump is currently known as sysmodules send all zeros. If there are any non zero values for the "registers" or the unknown values, let me know! * Fatal:U fixups * Made fatal:u execution break more clear * Fatal fixups
* | | | | | | | | | | Stubbed IRS (#1349)David2018-09-244-18/+169
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubbed IRS Currently we have no ideal way of implementing IRS. For the time being we should have the functions stubbed until we come up with a way to emulate IRS properly. * Added IRS to logging backend * Forward declared shared memory for irs
* | | | | | | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | Corrected SSL::SetInterfaceVersion
| * | | | | | | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Should be a single u32
* | | | | | | | | | Added glObjectLabels for renderdoc for textures and shader programs (#1384)David2018-09-234-0/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added glObjectLabels for renderdoc for textures and shader programs * Changed hardcoded "Texture" name to reflect the texture type instead * Removed string initialize
* | | | | | | | | | Merge pull request #1387 from FearlessTobi/port-4245bunnei2018-09-231-8/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4245: "common/thread: remove YieldCPU()"
| * | | | | | | | | | common/thread: remove YieldCPU()Weiyi Wang2018-09-221-8/+0
| | |_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | simply use the standard library yield()
* | | | | | | | | | Merge pull request #1385 from FearlessTobi/port-4214bunnei2018-09-231-2/+6
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4214: "Set citra-qt project as default StartUp Project in Visual Studio"
| * | | | | | | | | | Port citra-emu/citra#4214: "Set citra-qt project as default StartUp Project in Visual Studio"fearlessTobi2018-09-221-2/+6
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1391 from ogniK5377/GetAudioRendererStatebunnei2018-09-235-1/+21
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Added audren:u#GetAudioRendererState
| * | | | | | | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-235-1/+21
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1392 from greggameplayer/correct-BC6Hbunnei2018-09-231-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | Correction of the ComponentType of BC6H_UF16 & BC6H_SF16
| * | | | | | | | | | correct BC6Hgreggameplayer2018-09-231-2/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1378 from lioncash/threadbunnei2018-09-235-100/+145
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | process: Make a few member variables private where applicable
| * | | | | | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reduces the use of Process class members externally and keeps most code related to tearing down a process with the rest of the process code.
| * | | | | | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| | |_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows making several members of the process class private, it also avoids going through Core::CurrentProcess() just to retrieve the owning process.
* | | | | | | | | Merge pull request #1386 from jroweboy/oopsJames Rowe2018-09-221-0/+10
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | Build: Reintroduce Appveyor deploy
| * | | | | | | | Build: Reintroduce Appveyor deployJames Rowe2018-09-221-0/+10
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was erroneously removed when we added travis mingw builds. We still want to push MSVC builds to github for the time being
* | | | | | | | Merge pull request #1380 from lioncash/constbunnei2018-09-221-8/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader_bytecode: Make operator== and operator!= of IpaMode const qualified
| * | | | | | | | shader_bytecode: Lay out the Ipa-related enums betterLioncash2018-09-211-2/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is more consistent with the surrounding enums.
| * | | | | | | | shader_bytecode: Make operator== and operator!= of IpaMode const qualifiedLioncash2018-09-211-6/+7
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't affect the state of the struct and can be const member functions.
* | | | | | | | Merge pull request #1382 from lioncash/incbunnei2018-09-222-4/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_state: Remove unused type alias
| * | | | | | | | gl_state: Remove unused type aliasLioncash2018-09-222-4/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used anywhere within the header, so we can remove it, along with the include that was previously necessary. This also uncovers an indirect include in the cpp file for the assertion macros.
* | | | | | | | Merge pull request #1376 from Subv/timestretch_tracebunnei2018-09-221-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Logging: Change the TimeStretch::Process log from debug to trace level.
| * | | | | | | | Logging: Change the TimeStretch::Process log from debug to trace level.Subv2018-09-211-1/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This function is called too many times and makes the debug logging basically unusable due to the spam.
* | | | | | | | Merge pull request #1381 from valentinvanelslande/patch-1bunnei2018-09-221-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu_cmd: fix sd card directory set to nand directory
| * | | | | | | | Update config.cppValentin Vanelslande2018-09-211-1/+1
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1383 from DarkLordZach/game-list-interpolationJames Rowe2018-09-221-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | game_list: Add Qt SmoothTransformation to picture scaling
| * | | | | | | game_list: Add Qt SmoothTransformation to picture scalingZach Hilman2018-09-221-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1379 from lioncash/bitwisebunnei2018-09-211-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | gl_stream_buffer: Fix use of bitwise OR instead of logical OR in Map()
| * | | | | | gl_stream_buffer: Fix use of bitwise OR instead of logical OR in Map()Lioncash2018-09-211-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was very likely intended to be a logical OR based off the conditioning and testing of inversion in one case. Even if this was intentional, this is the kind of non-obvious thing one should be clarifying with a comment.
* | | | | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added support for uncompressed NSOs * Moved compressed section check to NsoHeader
* | | | | | Merge pull request #1225 from tech4me/travis-windowsJames Rowe2018-09-2112-16/+273
|\ \ \ \ \ \ | | | | | | | | | | | | | | travis: running mingw build on travis ci
| * | | | | | Update MinGWCross.cmake to lowercasetech4me2018-09-191-40/+40
| | | | | | |
| * | | | | | travis: running mingw build on travis citech4me2018-09-1912-16/+273
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit also fixed a broken cmake dependency with unicorn
* | | | | | | Merge pull request #1337 from DarkLordZach/create-fs-cmdbunnei2018-09-211-1/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu-cmd: Add filesystem service initializer call
| * | | | | | | yuzu-cmd: Add call to CreateFactoriesZach Hilman2018-09-191-1/+3
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | Ensures all relevant filesystem objects are initialized and eliminates a crash related to the RegisteredCache.
* | | | | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()
| * | | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The owning process of a thread is required to exist before the thread, so we can enforce this API-wise by using a reference. We can also avoid the reliance on the system instance by using that parameter to access the page table that needs to be set.
* | | | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-215-1/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | arm_interface: Replace kernel vm_manager include with a forward declaration
| * | | | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-215-1/+11
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids an unnecessary inclusion and also uncovers three places where indirect inclusions were relied upon, which allows us to also resolve those.
* | | | | | | Merge pull request #1375 from Subv/gl_clearbunnei2018-09-211-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | RasterizerGL: Use the correct framebuffer when clearing via the CLEAR_BUFFERS register.
| * | | | | | | RasterizerGL: Use the correct framebuffer when clearing via the CLEAR_BUFFERS register.Subv2018-09-211-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were clearing the default backbuffer framebuffer. Found thanks to a Piglit test :)
* | | | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file-sys: Default heavy-weight class destructors in the cpp file
| * | | | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Several classes have a lot of non-trivial members within them, or don't but likely should have the destructor defaulted in the cpp file for future-proofing/being more friendly to forward declarations. Leaving the destructor unspecified allows the compiler to inline the destruction code all over the place, which is generally undesirable from a code bloat perspective.
* | | | | | | Merge pull request #1367 from lioncash/pluralbunnei2018-09-211-9/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | game_list: Handle plurals within setFilterResult() better
| * | | | | | | game_list: Handle plurals within setFilterResult() betterLioncash2018-09-201-9/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt provides an overload of tr() that operates on quantities in relation to pluralization. This also allows the translation to adapt based on the target language rules better. For example, the previous code would result in an incorrect translation for the French language (which doesn't use the pluralized version of "result" in the case of a total of zero. While in English it's correct to use the pluralized version of "result", that is, "results" --- For example: English: "0 results" French: "0 résultat" (uses the singular form) In French, the noun being counted is singular if the quantity is 0 or 1. In English, on the other hand, if the noun being counted has a quantity of 0 or N > 1, then the noun is pluralized. --- For another example in a language that has different counting methods than the above, consider English and Irish. Irish has a special form of of a grammatical number called a dual. Which alters how a word is written when N of something is 2. This won't appear in this case with a direct number "2", but it would change if we ever used "Two" to refer to two of something. For example: English: "Zero results" Irish: "Toradh ar bith" English: "One result" Irish: "Toradh amháin" English: "Two results" Irish: "Dhá thorthaí" <- Dual case Which is an important distinction to make between singular and plural, because in other situations, "two" on its own would be written as "dó" in Irish. There's also a few other cases where the order the words are placed *and* whether or not the plural or singular variant of the word is used *and* whether or not the word is placed after or between a set of numbers can vary. Counting in Irish also differs depending on whether or not you're counting things (like above) or counting people, in which case an entirely different set of numbers are used. It's not important for this case, but it's provided as an example as to why one should never assume the placement of values in text will be like that of English or other languages. Some languages have very different ways to represent counting, and breaking up the translated string like this isn't advisable because it makes it extremely difficult to get right depending on what language a translator is translating text into due to the ambiguity of the strings being presented for translation. In this case a translator would see three fragmented strings on Transifex (and not necessarily grouped beside one another, but even then, it would still be annoying to decipher): - "of" - "result" - "results" There is no way a translator is going to know what those sets of words are actually used for unless they look at the code to see what is being done with them (which they shouldn't have to do).
* | | | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Added IRequest::Submit
| * | | | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| | | | | | | |
| * | | | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes updated versions of SMO. Currently unable to test as I don't have an updated version
* | | | | | | | Merge pull request #1352 from lioncash/sharingbunnei2018-09-211-3/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharing
| * | | | | | | | ring_buffer: Use std::atomic_size_t in a static assertLioncash2018-09-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to repeat "std::" twice
| * | | | | | | | ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharingLioncash2018-09-191-2/+10
| | |_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MSVC 19.11 (A.K.A. VS 15.3)'s C++ standard library implements P0154R1 (http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2016/p0154r1.html) which defines two new constants within the <new> header, std::hardware_destructive_interference_size and std::hardware_constructive_interference_size. std::hardware_destructive_interference_size defines the minimum recommended offset between two concurrently-accessed objects to avoid performance degradation due to contention introduced by the implementation (with the lower-bound being at least alignof(max_align_t)). In other words, the minimum offset between objects necessary to avoid false-sharing. std::hardware_constructive_interference_size on the other hand defines the maximum recommended size of contiguous memory occupied by two objects accessed wth temporal locality by concurrent threads (also defined to be at least alignof(max_align_t)). In other words the maximum size to promote true-sharing. So we can simply use this facility to determine the ideal alignment size. Unfortunately, only MSVC supports this right now, so we need to enclose it within an ifdef for the time being.
* | | | | | | | Merge pull request #1373 from ogniK5377/revert-nifmbunnei2018-09-211-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Revert GetRequestState
| * | | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Even though setting this value to 3 is more correct. We break more games than we fix due to missing implementations. We should keep this as 0 for the time being
* | | | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Correct endianness of BRK
| * | | | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-202-0/+12
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | externals: Update dynarmic to 171d116
| * | | | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| | | | | | |
| * | | | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| | | | | | |
| * | | | | | externals: Update dynarmic to 171d116MerryMage2018-09-191-0/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 171d116 A64: Implement SCVTF, UCVTF (vector, fixed-point), scalar variant f221bb0 emit_x64_floating_point: Reduce fallback LUT code in EmitFPToFixed eb123e2 A64: Implement FCVTZS, FCVTZU, UCVTF, SCVTF (vector, fixed-point), vector variant 487d37a A64: Implement UQSHL's vector immediate and register variants f698933 ir: Add opcodes for unsigned saturating left shifts 7148e66 A64/translate/impl: Make signatures consistent for unimplemented by-element SIMD variants fdde4ca A64: Implement BRK b1490db A64/imm: Add full range of comparison operators to Imm template 1ec40ef IR: Add fbits argument to FPVectorFrom{Signed,Unsigned}Fixed d6d5e98 A64: Implement SCVTF, UCVTF (scalar, fixed-point) 6513595 opcodes.inc: Align columns to a tabstop of 4 6b0d2b5 IR: Add fbits argument to FixedToFP-related opcodes c4b3831 A64: Implement SQSHL's vector immediate variant e0d8d2d A64: Implement SQSHL's vector register variant 5327625 ir: Add opcodes for left signed saturated shifts 9705252 branch: Make variables const where applicable 650946e move_wide: Make variables const where applicable 62b3a6d load_store_register_unprivileged: Make variables const where applicable 3add1c7 load_store_register_immediate: Place conditional bodies on their own line 2fc4088 load_store_load_literal: Make variables const where applicable b2c1462 data_processing_logical: Move datasize declarations after early-exit conditionals 028028f data_processing_conditional_select: Make variables const where applicable c66042d data_processing_addsub: Move datasize declarations after early-exit conditionals 6bc546e data_processing_bitfield: Move datasize variables after early-exit conditionals 2aad5fa A64: Implement CLS's vector variant 6c877ff emit_x64_vector: Make EmitVectorUnsignedSaturatedAccumulateSigned() internally linked 4b5926d perf_map: Use std::string_view instead of std::string for PerfMapRegister() 7445947 A64: Implement SQRDMULH (vector), vector variant 03b80f2 A64: Implement SQDMULL (vector), vector variant 4a2c596 IR: Add VectorSignedSaturatedDoublingMultiplyLong 59dc33e emit_x64_vector: Changes to VectorSignedSaturatedDoublingMultiply bbaebeb IR: Implement Vector{Signed,Unsigned}Multiply{16,32} baac5a8 backend_x64/a64_interface: Re-enable the constant folding pass e78ca19 emit_x64_vector_floating_point: Hardware FMA implementation for RSqrtStepFused 8a5ae9a emit_x64_vector_floating_point: Hardware FMA implementation of FPVectorRecipStepFused 39818f9 emit_x64_floating_point: Hardware FMA implementation of FPRSqrtStepFused 3d0a0b4 emit_x64_floating_point: Hardware FMA implementation of FPRecipStepFused{32,64} 2293dff emit_x64_vector: SSE implementation of VectorSignedSaturatedAccumulateUnsigned{8,16,32} 2047683 emit_x64_vector: Correct static asserts for < 64-bit type checks in saturated accumulate fallbacks 55e9e40 emit_x64_vector: EmitVectorSignedSaturatedAccumulateUnsigned64: SSE implementation 1076651 emit_x64_vector: Simplify fpsr_qc related code 4039030 A64: Implement CLZ's vector variant 0bb908f ir: Add opcodes for vector CLZ operations 3b13259 A64/translate: VectorZeroUpper for V(64) stores 1931d44 simd_two_register_misc: FNEG (vector) with Q == 0 had dirty upper a0790f0 emit_x64_vector: Remove unnecessary [[maybe_unused]] attributes b0e1eb5 A64: Implement USQADD's scalar and vector variants 28424c7 ir: Add opcodes form unsigned saturated accumulations of signed values 9923ea0 A64: Implement SUQADD's scalar and vector variants 4c0adbb ir: Add opcodes for signed saturated accumulations of unsigned values 799bfed A64: Implement SMLAL{2}, SMLSL{2}, UMLAL{2}, and UMLSL{2}'s vector by-element variants 94451ec A64: Implement UMULL{2}'s vector by-element variant 45867de A64: Implement SMULL{2}'s vector by-element variant 0235793 ir/value: Replace includes with forward declarations 450f721 ir/cond: Migrate to C++17 nested namespace specifiers e649988 CMakeLists: Add missing cond.h header to file listing d20e769 A64: Implement URSQRTE 4f3bde5 ir: Add opcodes for performing unsigned reciprocal square root estimates cfeeaec A64: Implement URECPE 622b60e ir: Add opcodes for unsigned reciprocal estimate d17599a Update Xbyak to 5.71 f7c26e9 Squashed 'externals/xbyak/' changes from 671fc805..1de435ed 8782b69 travis: Make macOS build with Xcode 9.4.1 b575b23 A64: Implement SQNEG's scalar and vector variant 06062a9 A64: Add opcodes for signed saturating negations 1c40579 emit_x64_vector: Simplify "position == 0" case for EmitVectorExtract() e335050 emit_x64_vector: Simplify "position == 0" case for EmitVectorExtractLower() 8b13421 A64: Implement SQDMULH's by-element scalar variant 9122a6e A64: Implement SQDMULH's by-element vector variant 176e60e backend/x64: Do not clear fast_dispatch_table if not enabled
* | | | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | savedata_factory: Add TemporaryStorage SaveDataType
| * | | | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ / / | |/| | | | | | | | | | Seems to be used by NSO NES Emulator
* | | | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \ \ \ | | | | | | | | | | | | | | control_metadata: Move language name array definition to the cpp file
| * | | | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need to indent the code here, given the if case contains a return statement at the end of it.
| * | | | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was used in two different translation units (deconstructed_rom_directory and patch_manager). This means we'd be pointlessly duplicating the whole array twice due to it being defined within the header.
* | | | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \ \ \ | | | | | | | | | | | | | | xts_archive/nax: Minor interface changes
| * | | | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These variables aren't used, which still has an impact, as std::vector cannot be optimized away by the compiler (it's constructor and destructor are both non-trivial), so this was just wasting memory.
| * | | | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::shared_ptr isn't strictly necessary here and is only ever used in contexts where the object doesn't depend on being shared. This also makes the interface more flexible, as it's possible to create a std::shared_ptr from a std::unique_ptr (std::shared_ptr has a constructor that accepts a std::unique_ptr), but not the other way around.
| * | | | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An instance of the NAX apploader already has an existing NAX instance in memory. Calling directly into IdentifyType() directly would re-parse the whole file again into yet another NAX instance, only to toss it away again. This gets rid of unnecessary/redundant file parsing and allocations.
| * | | | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AsNCA() allocates an NCA instance every time it's called. In the current manner it's used, it's quite inefficient as it's making a redundant allocation. We can just amend the order of the conditionals to make it easier to just call it once.
| * | | | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that the member always has a deterministic value.
| * | | | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Orders the initializer list in the same order the members would be initialized. Avoids compiler warnings.
* | | | | | Merge pull request #1366 from ogniK5377/splat-fixbunnei2018-09-201-3/+99
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Implemented NTC & IEnsureNetworkClockAvailabilityService
| * | | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
| | | | | |
| * | | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / / / / | | | | | | | | | | | | | | | Needed because of the recent nim fixes
* | | | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Reworked incorrect nifm stubs Need confirmation on `CreateTemporaryNetworkProfile`, unsure which game uses it but according to reversing. It should return a uuid which we currently don't do. Any 0 client id is considered an invalid client id. GetRequestState 0 is considered invalid. * Fixups for nifm
* | | | | Merge pull request #1356 from degasus/hotfixbunnei2018-09-191-6/+7
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Fix StartAddress handling with indexed draw calls.
| * | | | | gl_rasterizer: Fix StartAddress handling with indexed draw calls.Markus Wick2018-09-191-6/+7
| | |/ / / | |/| | | | | | | | | | | | | | | | | | We uploaded the wrong data before. So the offset on the host GPU pointer may work for the first vertices, the last ones run out bounds. Let's just offset the upload instead.
* | | | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ \ \ | | | | | | | | | | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevision
| * | | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ / / / | | | | | | | | | | | | | | | With these, `Nintendo Entertainment System - Nintendo Switch Online` loads
* | | | | Merge pull request #1353 from ogniK5377/remove-MakeBuilderbunnei2018-09-197-34/+26
|\ \ \ \ \ | |/ / / / |/| | | | Removed the use of rp.MakeBuilder in the yuzu codebase
| * | | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
| | | | |
| * | | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / / / | | | | | | | | | | | | Due to keeping the code style consistent in the yuzu codebase. `rb = rp.MakeBuilder(...)` was replaced with `rb{ctx, ...}`
* | | | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ \ \ | | | | | | | | | | Implemented IProfile::GetImageSize
| * | | | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
| | | | |
* | | | | Merge pull request #1319 from lioncash/audiobunnei2018-09-195-43/+59
|\ \ \ \ \ | | | | | | | | | | | | audio_core: Replace includes with forward declarations where applicable.
| * | | | | time_stretch: Remove unused <array> includeLioncash2018-09-171-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | This isn't used within this header and isn't necessary.
| * | | | | stream: Replace includes with forward declarations where applicableLioncash2018-09-172-3/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids propagating includes in headers where it's not necessary to do so.
| * | | | | audio_renderer: Replace includes with forward declarations where applicableLioncash2018-09-172-39/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids including unnecessary headers within the audio_renderer.h header, lessening the likelihood of needing to rebuild source files including this header if they ever change. Given std::vector allows forward declaring contained types, we can move VoiceState to the cpp file and hide the implementation entirely.
* | | | | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implemented GetDefaultDisplayResolution
| * | | | | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | core/core_cpu: Replace exclusive monitor include with forward declaration
| * | | | | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | We don't need to include this as a dependency within the header. A regular forward declaration will suffice here.
* | | | | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc_wrap: Convert the PARAM macro into a function
| * | | | | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This can just be a regular function, getting rid of the need to also explicitly undef the define at the end of the file. Given FuncReturn() was already converted into a function, it's #undef can also be removed.
* | | | | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensor
| * | | | | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| | | | | | |
| * | | | | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| | | | | | |
| * | | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1342 from lioncash/truncbunnei2018-09-191-4/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Avoid truncation warnings within LD_A and ST_A code
| * | | | | | gl_shader_decompiler: Avoid truncation warnings within LD_A and ST_A codeLioncash2018-09-181-4/+4
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | These are internally stored as u64 values, so using u32 here causes truncation warnings. Instead, we can just use u64 and preserve the bit width.
* | | | | | Merge pull request #1279 from FernandoS27/csetpbunnei2018-09-192-21/+133
|\ \ \ \ \ \ | | | | | | | | | | | | | | shader_decompiler: Implemented (Partialy) Control Codes and CSETP
| * | | | | | Implemented Internal FlagsFernandoS272018-09-181-13/+35
| | | | | | |
| * | | | | | Implemented I2I.CC on the NEU control code, used by SMOFernandoS272018-09-172-14/+18
| | | | | | |
| * | | | | | Implemented CSETPFernandoS272018-09-172-14/+49
| | | | | | |
| * | | | | | Implemented Control CodesFernandoS272018-09-172-0/+51
| |/ / / / /
* | | | | | Merge pull request #1299 from FernandoS27/texture-sanatizebunnei2018-09-192-3/+192
|\ \ \ \ \ \ | | | | | | | | | | | | | | shader_decompiler: Asserts for Texture Instructions
| * | | | | | Added asserts for texture misc modes to texture instructionsFernandoS272018-09-171-2/+45
| | | | | | |
| * | | | | | Added texture misc modes to texture instructionsFernandoS272018-09-171-1/+147
| |/ / / / /
* | | | | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-193-3/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fix bug where default username value for yuzu_cmd create an userprofile with uninitialize data as username * Fix format * Apply code review changes * Remove nullptr check
* | | | | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/svc: Handle invalid address cases within svcArbitrateLock() and svcArbitrateUnlock()
| * | | | | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have a ResultCode constant for the case of an invalid address, so we can just use it instead of re-rolling that ResultCode type.
| * | | | | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel does the equivalent of the following check before proceeding: if (address + 0x8000000000 < 0x7FFFE00000) { return ERR_INVALID_MEMORY_STATE; } which is essentially what our IsKernelVirtualAddress() function does. So we should also be checking for this. The kernel also checks if the given input addresses are 4-byte aligned, however our Mutex::TryAcquire() and Mutex::Release() functions already handle this, so we don't need to add code for this case.
* | | | | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \ \ \ \ | | | | | | | | | | | | | | arm_interface: Remove ARM11-isms from the CPU interface
| * | | | | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This modifies the CPU interface to more accurately match an AArch64-supporting CPU as opposed to an ARM11 one. Two of the methods don't even make sense to keep around for this interface, as Adv Simd is used, rather than the VFP in the primary execution state. This is essentially a modernization change that should have occurred from the get-go.
* | | | | | Merge pull request #1345 from lioncash/writebunnei2018-09-181-2/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | arm_dynarmic: Correct ExclusiveWrite128()'s operation
| * | | | | arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Previously the second half of the value being written would overwrite the first half. Thankfully this wasn't a bug that was being encountered, as the function is currently unused.
* | | | | Merge pull request #1290 from FernandoS27/shader-headerbunnei2018-09-183-24/+111
|\ \ \ \ \ | |/ / / / |/| | | | Implemented (Partialy) Shader Header
| * | | | Replace old FragmentHeader for the new HeaderFernandoS272018-09-112-31/+18
| | | | |
| * | | | Implemented (Partialy) Shader HeaderFernandoS272018-09-113-2/+102
| | | | |
* | | | | Merge pull request #1311 from FernandoS27/fast-swizzlebunnei2018-09-171-2/+49
|\ \ \ \ \ | | | | | | | | | | | | Optimized Texture Swizzling
| * | | | | Optimized Texture SwizzlingFernandoS272018-09-141-2/+49
| | | | | |
* | | | | | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/vi: Replace includes with forward declarations where applicable
| * | | | | | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
| | | | | | |
* | | | | | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/errors: Amend error code for ERR_NOT_FOUND
| * | | | | | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the value returned by the kernel for svcConnectToNamedPort() if the named port cannot be found.
* | | | | | | Merge pull request #1314 from lioncash/castbunnei2018-09-171-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | audio_core/time_stretch: Silence truncation warnings in Process()
| * | | | | | | audio_core/time_stretch: Silence truncation warnings in Process()Lioncash2018-09-141-2/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | The SoundTouch API only accepts uint amount of samples.
* | | | | | | Merge pull request #1316 from lioncash/shadowbunnei2018-09-171-2/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Get rid of variable shadowing within LEA instructions
| * | | | | | | gl_shader_decompiler: Get rid of variable shadowing within LEA instructionsLioncash2018-09-141-2/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | These variables are already defined within an outer scope.
* | | | | | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | services/sm: Amend error code constants
| * | | | | | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Courtesy of @ogniK5377. This also moves them into the cpp file and limits the visibility to where they're directly used. It also gets rid of unused or duplicate error codes.
* | | | | | | Merge pull request #1321 from lioncash/audio-shadowbunnei2018-09-171-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cubeb_sink: Get rid of variable shadowing within CubebSink's constructor
| * | | | | | | cubeb_sink: Get rid of variable shadowing within CubebSink's constructorLioncash2018-09-141-4/+4
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | The parameter of the lambda was shadowing the variable that was being assigned to.
* | | | | | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/svc: Handle a few error cases within memory-related functions
| * | | | | | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel caps the size limit of shared memory to 8589930496 bytes (or (1GB - 512 bytes) * 8), so approximately 8GB, where every GB has a 512 byte sector taken off of it. It also ensures the shared memory is created with either read or read/write permissions for both permission types passed in, allowing the remote permissions to also be set as "don't care".
| * | | | | | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Part of the checking done by the kernel is to check if the given address and size are 4KB aligned, as well as checking if the size isn't zero. It also only allows mapping shared memory as readable or read/write, but nothing else, and so we shouldn't allow mapping as anything else either.
| * | | | | | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel checks if the addresses and given size is 4KB aligned before continuing onwards to map the memory.
| * | | | | | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel checks if the given size is a multiple of 2MB and <= to 4GB before going ahead and attempting to allocate that much memory.
* | | | | | | Merge pull request #1320 from lioncash/namebunnei2018-09-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cubeb_sink: Correct context name in ListCubebSinkDevices()
| * | | | | | | cubeb_sink: Correct context name in ListCubebSinkDevices()Lioncash2018-09-141-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | This ain't Citra.
* | | | | | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port #4192 from Citra: "svc: change unknown to thread in CreateThread"
| * | | | | | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1327 from FearlessTobi/port-4171bunnei2018-09-172-16/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port #4171 from Citra: "Tests: Remove glad test OS X work-around"
| * | | | | | | Tests: Remove glad test OS X work-aroundYuri Kunde Schlesner2018-09-152-16/+0
| |/ / / / / /
* | | | | | | Merge pull request #1326 from FearlessTobi/port-4182bunnei2018-09-17146-751/+780
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port #4182 from Citra: "Prefix all size_t with std::"
| * | | | | | | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-15146-751/+780
| |/ / / / / /
* | | | | | | Merge pull request #1329 from raven02/bgr5a1ubunnei2018-09-172-0/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement RenderTargetFormat::BGR5A1_UNORM
| * | | | | | | Implement RenderTargetFormat::BGR5A1_UNORM (Pokken Tournament DX)raven022018-09-152-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #1335 from lioncash/copybunnei2018-09-171-5/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | game_list_p: Take map iterator contents by const reference
| * | | | | | | game_list_p: Amend typo in GameListItemCompat's constructor parameterLioncash2018-09-171-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds a missing 'i' character that was missing in compatibility.
| * | | | | | | game_list_p: Take map iterator contents by const referenceLioncash2018-09-171-1/+1
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to copy the whole struct in this instance, we can just utilize a reference instead.
* | | | | | | Merge pull request #1336 from lioncash/antialiasbunnei2018-09-171-1/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/util: Antialias game list compatibility pixmaps
| * | | | | | | yuzu/util: Antialias game list compatibility pixmapsLioncash2018-09-171-1/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We pass a hint to the QPainter instance that we want anti-aliasing on the compatibility icons, which prevents the circles from looking fairly jagged, and actually makes them look circular.
* | | | | | | Merge pull request #1331 from raven02/astc_8_8bunnei2018-09-173-6/+20
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | Implement ASTC_2D_8X8
| * | | | | | Implement ASTC_2D_8X8 (Bayonetta 2)raven022018-09-163-6/+20
|/ / / / / /
* | | | | | Merge pull request #1273 from Subv/ld_sizesbunnei2018-09-152-7/+58
|\ \ \ \ \ \ | | | | | | | | | | | | | | Shaders: Implemented multiple-word loads and stores to and from attribute memory.
| * | | | | | Shaders: Implemented multiple-word loads and stores to and from attribute memory.Subv2018-09-152-7/+58
| | |/ / / / | |/| | | | | | | | | | | | | | | | This seems to be an optimization performed by nouveau.
* | | | | | Merge pull request #1271 from Subv/kepler_enginebunnei2018-09-156-0/+146
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GPU: Basic implementation of the Kepler Inline Memory engine (p2mf).
| * | | | | GPU: Basic implementation of the Kepler Inline Memory engine (p2mf).Subv2018-09-126-0/+146
| | | | | | | | | | | | | | | | | | | | | | | | This engine writes data from a FIFO register into the configured address.
* | | | | | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-145-38/+39
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/thread: Include thread-related enums within the kernel namespace
| * | | | | | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-135-38/+39
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, these were sitting outside of the Kernel namespace, which doesn't really make sense, given they're related to the Thread class which is within the Kernel namespace.
* | | | | | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Use nested namespace specifiers where applicable
| * | | | | | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There were a few places where nested namespace specifiers weren't being used where they could be within the service code. This amends that to make the namespacing a tiny bit more compact.
* | | | | | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | services/pl_u: Add missing Korean font to the fallback case for shared fonts
| * | | | | services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | Previously this wasn't using the Korean font at all.
* | | | | | Merge pull request #1308 from valentinvanelslande/ipcJames Rowe2018-09-131-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | ipc: fix spelling mistake
| * | | | | | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/ / / / / /
* / / / / / Use ARB_multi_bind for uniform buffers (#1287)ReinUsesLisp2018-09-134-3/+27
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | * gl_rasterizer: use ARB_multi_bind for uniform buffers * address feedback
* | | | | Merge pull request #1298 from lioncash/viewbunnei2018-09-132-2/+4
|\ \ \ \ \ | | | | | | | | | | | | audio_core/sink_details: Change std::string parameter into std::string_view
| * | | | | audio_core/sink_details: Change std::string parameter into std::string_viewLioncash2018-09-122-2/+4
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | The given string is only ever used for lookup and comparison, so we can just utilize a non-owning view to string data here
* | | | | Merge pull request #1302 from lioncash/configbunnei2018-09-132-36/+74
|\ \ \ \ \ | | | | | | | | | | | | yuzu/configure_gamelist: Mark combo-box strings as translatable
| * | | | | yuzu/configure_gamelist: Make combo box strings translatableLioncash2018-09-122-21/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are shown to the user, they should be translatable. While we're at it, also set up the dialog to automatically retranslate the dialog along with the combo boxes if it receives a LanguageChange event.
| * | | | | yuzu/configure_gamelist: Use std::array instead of std::vector for translatable stringsLioncash2018-09-121-6/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to use an allocating container for these, given we know the fixed amount of strings being used. This is just a waste of memory.
| * | | | | yuzu/configure_gamelist: Move combo box initializtion to their own functionsLioncash2018-09-122-23/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the individual initialization of the combo boxes logically separate. We also shouldn't be dumping this sort of thing in the constructor directly.
* | | | | | Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-1321-49/+462
|\ \ \ \ \ \ | | | | | | | | | | | | | | audio_core: Add audio stretching support
| * | | | | | audio_core: Flush stream when not playing anythingMerryMage2018-09-126-0/+23
| | | | | | |
| * | | | | | cubeb_sink: Downsample arbitrary number of channelsMerryMage2018-09-091-10/+9
| | | | | | |
| * | | | | | cubeb_sink: Perform audio stretchingMerryMage2018-09-083-24/+26
| | | | | | |
| * | | | | | audio_core: Add audio stretcherMerryMage2018-09-083-0/+101
| | | | | | |
| * | | | | | cubeb_sink: Hold last available value instead of writing zerosMerryMage2018-09-081-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This reduces clicking in output audio should we underrun.
| * | | | | | cubeb_sink: Use RingBufferMerryMage2018-09-081-40/+26
| | | | | | |
| * | | | | | common: Implement a ring bufferMerryMage2018-09-084-0/+243
| | | | | | |
| * | | | | | Add audio stretching supportfearlessTobi2018-09-0815-0/+49
| | | | | | |
* | | | | | | Merge pull request #1306 from bunnei/fix-b5g6r5ubunnei2018-09-131-1/+1
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | gl_rasterizer_cache: B5G6R5U should use GL_RGB8 as an internal format.
| * | | | | | gl_rasterizer_cache: B5G6R5U should use GL_RGB8 as an internal format.bunnei2018-09-131-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | - Fixes a regression with Sonic Mania with ARB_texture_storage.
* | | | | | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \ \ \ \ \ | | | | | | | | | | | | | | pl_u: Eliminate mutable file-scope state
| * | | | | | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | Converts the PL_U internals to use the PImpl idiom and makes the state part of the Impl struct, eliminating mutable global/file state.
* | | | | | Merge pull request #1263 from FernandoS27/tex-modebunnei2018-09-122-1/+43
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | shader_decompiler: Implemented (Partially) Texture Processing Modes
| * | | | | Implemented Texture Processing ModesFernandoS272018-09-122-1/+43
| |/ / / /
* | | | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \ \ \ | | | | | | | | | | | | kernel/errors: Amend invalid thread priority and invalid processor ID error codes
| * | | | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This is what the kernel does for an out-of-range processor ID.
| * | | | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
| | | | | |
* | | | | | Merge pull request #1304 from lioncash/strbunnei2018-09-122-3/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Do nothing in svcOutputDebugString() if given a length of zero
| * | | | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While unlikely, it does avoid constructing a std::string and unnecessarily calling into the memory code if a game or executable decides to be really silly about their logging.
| * | | | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | This should be a u64 to represent size.
* | | | | | Merge pull request #1305 from FreddyFunk/cmake_yuzu_as_vs_startup_projectbunnei2018-09-121-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Set yuzu project as default StartUp Project in Visual Studio
| * | | | | Update CMakeLists.txtFrederic Laing2018-09-121-0/+3
|/ / / / / | | | | | | | | | | Set yuzu project as default StartUp Project in Visual Studio
* | | | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \ \ \ | | | | | | | | | | | | service/prepo: Move class into the cpp file
| * | | | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't need to be exposed within the header and be kept in the translation unit, eliminating the need to include anything within the header.
* | | | | Merge pull request #1301 from lioncash/qtbunnei2018-09-121-4/+4
|\ \ \ \ \ | |_|_|/ / |/| | | | game_list: Resolve variable shadowing within LoadCompatibilityList()
| * | | | game_list: Resolve variable shadowing within LoadCompatibilityList()Lioncash2018-09-121-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | "value" is already a used variable name within the outermost ranged-for loop, so this variable was shadowing the outer one. This isn't a bug, but it will get rid of a -Wshadow warning.
| * | | | game_list: Use QJsonValueRef() within LoadCompatibilityList()Lioncash2018-09-121-2/+2
| |/ / / | | | | | | | | | | | | This way, we aren't constructing unnecessary QJsonValue instances.
* | | | Merge pull request #1300 from lioncash/audiobunnei2018-09-127-17/+34
|\ \ \ \ | | | | | | | | | | service/audio: Replace includes with forward declarations where applicable
| * | | | service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
| |/ / / | | | | | | | | | | | | | | | | A few headers were including other headers when a forward declaration can be used instead, allowing the include to be moved to the cpp file.
* | | | Merge pull request #1278 from tech4me/bg-color-fixbunnei2018-09-126-0/+46
|\ \ \ \ | | | | | | | | | | Port Citra #4047 & #4052: add change background color support
| * | | | Port Citra #4047 & #4052: add change background color supporttech4me2018-09-096-0/+46
| | | | |
* | | | | Merge pull request #1295 from bunnei/accurate-copiesbunnei2018-09-122-18/+12
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Improve accuracy of caching and copies.
| * | | | | gl_rasterizer_cache: Always blit on recreate, regardless of format.bunnei2018-09-121-6/+10
| | | | | | | | | | | | | | | | | | | | | | | | - Fixes several rendering issues with Super Mario Odyssey.
| * | | | | gl_shader_cache: Remove cache_width/cache_height.bunnei2018-09-122-12/+2
| | |/ / / | |/| | | | | | | | | | | | | | | | | | - This was once an optimization, but we no longer need it with the cache reserve. - This is also inaccurate.
* | | | | Merge pull request #1294 from degasus/optimizationsbunnei2018-09-123-11/+12
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Use ARB_texture_storage.
| * | | | | gl_rasterizer: Use ARB_texture_storage.Markus Wick2018-09-113-11/+12
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It allows us to use texture views and it reduces the overhead within the GPU driver. But it disallows us to reallocate the texture, but we don't do so anyways. In the end, it is the new way to allocate textures, so there is no need to use the old way.
* | | | | Merge pull request #1289 from FernandoS27/lea_psetbunnei2018-09-122-0/+155
|\ \ \ \ \ | |/ / / / |/| | | | shader_decompiler: Implemented LEA and PSET
| * | | | Implemented LEA and PSETFernandoS272018-09-111-0/+91
| | | | |
| * | | | Implemented encodings for LEA and PSETFernandoS272018-09-111-0/+64
|/ / / /
* | | | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \ \ \ | | | | | | | | | | hle/service: Default constructors and destructors in the cpp file where applicable
| * | | | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a destructor isn't defaulted into a cpp file, it can cause the use of forward declarations to seemingly fail to compile for non-obvious reasons. It also allows inlining of the construction/destruction logic all over the place where a constructor or destructor is invoked, which can lead to code bloat. This isn't so much a worry here, given the services won't be created and destroyed frequently. The cause of the above mentioned non-obvious errors can be demonstrated as follows: ------- Demonstrative example, if you know how the described error happens, skip forwards ------- Assume we have the following in the header, which we'll call "thing.h": \#include <memory> // Forward declaration. For example purposes, assume the definition // of Object is in some header named "object.h" class Object; class Thing { public: // assume no constructors or destructors are specified here, // or the constructors/destructors are defined as: // // Thing() = default; // ~Thing() = default; // // ... Some interface member functions would be defined here private: std::shared_ptr<Object> obj; }; If this header is included in a cpp file, (which we'll call "main.cpp"), this will result in a compilation error, because even though no destructor is specified, the destructor will still need to be generated by the compiler because std::shared_ptr's destructor is *not* trivial (in other words, it does something other than nothing), as std::shared_ptr's destructor needs to do two things: 1. Decrement the shared reference count of the object being pointed to, and if the reference count decrements to zero, 2. Free the Object instance's memory (aka deallocate the memory it's pointing to). And so the compiler generates the code for the destructor doing this inside main.cpp. Now, keep in mind, the Object forward declaration is not a complete type. All it does is tell the compiler "a type named Object exists" and allows us to use the name in certain situations to avoid a header dependency. So the compiler needs to generate destruction code for Object, but the compiler doesn't know *how* to destruct it. A forward declaration doesn't tell the compiler anything about Object's constructor or destructor. So, the compiler will issue an error in this case because it's undefined behavior to try and deallocate (or construct) an incomplete type and std::shared_ptr and std::unique_ptr make sure this isn't the case internally. Now, if we had defaulted the destructor in "thing.cpp", where we also include "object.h", this would never be an issue, as the destructor would only have its code generated in one place, and it would be in a place where the full class definition of Object would be visible to the compiler. ---------------------- End example ---------------------------- Given these service classes are more than certainly going to change in the future, this defaults the constructors and destructors into the relevant cpp files to make the construction and destruction of all of the services consistent and unlikely to run into cases where forward declarations are indirectly causing compilation errors. It also has the plus of avoiding the need to rebuild several services if destruction logic changes, since it would only be necessary to recompile the single cpp file.
* | | | | Merge pull request #1292 from ogniK5377/renderdoc-fixbunnei2018-09-112-2/+9
|\ \ \ \ \ | | | | | | | | | | | | Fixed renderdoc input/output textures not working due to multiple render targets
| * | | | | Fixed renderdoc input/output textures not working due to render targetsDavid Marcec2018-09-112-2/+9
| |/ / / /
* | | | | Merge pull request #1293 from lioncash/fontbunnei2018-09-1120-111667/+111727
|\ \ \ \ \ | |/ / / / |/| | | | externals: Place font data within cpp files
| * | | | externals: Place font data within cpp filesLioncash2018-09-1120-111667/+111727
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This places the font data within cpp files, which mitigates the possibility of the font data being duplicated within the binary if it's referred to in more than one translation unit in the future. It also stores the data within a std::array, which is more flexible when it comes to operating with the standard library. Furthermore, it makes the data arrays const. This is what we want, as it allows the compiler to store the data within the read-only segment. As it is, having several large sections of mutable data like this just leaves spots in memory that we can accidentally write to (via accidental overruns, what have you) and actually have it work. This ensures the font data remains the same no matter what.
* | | | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-1111-2/+111695
| | | | | | | | | | | | | | | | | | | | | | | | * Add open-source shared fonts * Address review comments
* | | | Port #4141 from citra: Joystick hotplug support (#1275)Tobias2018-09-117-101/+339
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Joystick hotplug support (#4141) * use SDL_PollEvent instead of SDL_JoystickUpdate Register hot plugged controller by GUID if they were configured in a previous session * Move SDL_PollEvent into its own thread * Don't store SDLJoystick pointer in Input Device; Get pointer on each GetStatus call * Fix that joystick_list gets cleared after SDL_Quit * Add VirtualJoystick for InputDevices thats never nullptr * fixup! Add VirtualJoystick for InputDevices thats never nullptr * fixup! fixup! Add VirtualJoystick for InputDevices thats never nullptr * Remove SDL_GameController, make SDL_Joystick* unique_ptr * fixup! Remove SDL_GameController, make SDL_Joystick* unique_ptr * Adressed feedback; fixed handling of same guid reconnects * fixup! Adressed feedback; fixed handling of same guid reconnects * merge the two joystick_lists into one * make SDLJoystick a member of VirtualJoystick * fixup! make SDLJoystick a member of VirtualJoystick * fixup! make SDLJoystick a member of VirtualJoystick * fixup! fixup! make SDLJoystick a member of VirtualJoystick * SDLJoystick: Addressed review comments * Address one missed review comment
* | | | Merge pull request #1286 from bunnei/multi-clearbunnei2018-09-112-50/+66
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement clear for non-zero render targets.
| * | | | gl_rasterizer: Implement clear for non-zero render targets.bunnei2018-09-102-50/+66
| | | | | | | | | | | | | | | | | | | | - Several misc. changes to ConfigureFramebuffers in support of this.
* | | | | Merge pull request #1285 from bunnei/depth-fixbunnei2018-09-111-6/+22
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Only use depth for applicable texture formats.
| * | | | | gl_rasterizer_cache: Only use depth for applicable texture formats.bunnei2018-09-101-6/+22
| |/ / / / | | | | | | | | | | | | | | | - Fixes an issue with Octopath Traveler leaving stale data here.
* | | | | Merge pull request #1284 from bunnei/bgra8_srgbbunnei2018-09-113-0/+4
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Implement RenderTargetFormat::BGRA8_SRGB.
| * | | | | gl_rasterizer_cache: Implement RenderTargetFormat::BGRA8_SRGB.bunnei2018-09-103-0/+4
| |/ / / / | | | | | | | | | | | | | | | - Used by Octopath Traveler (with multiple render targets).
* | | | | Merge pull request #1288 from MysticExile/remove-multicoreJames Rowe2018-09-112-10/+0
|\ \ \ \ \ | | | | | | | | | | | | Remove the multi-core option from the UI
| * | | | | Remove multicore configure_general.uiMysticExile2018-09-101-7/+0
| | | | | |
| * | | | | remove multicore in configure_general.cppMysticExile2018-09-101-3/+0
| |/ / / /
* | | | | Merge pull request #1264 from degasus/optimizationsbunnei2018-09-119-124/+121
|\ \ \ \ \ | |/ / / / |/| | | | video_core: Optimize the command processor.
| * | | | video_core: Refactor command_processor.Markus Wick2018-09-102-44/+42
| | | | | | | | | | | | | | | | | | | | Inline the WriteReg helper as it is called ~20k times per frame.
| * | | | video_core: Move command buffer loop.Markus Wick2018-09-105-77/+84
| | | | | | | | | | | | | | | | | | | | This moves the hot loop into video_core. This refactoring shall reduce the CPU overhead of calling ProcessCommandList.
| * | | | rasterizer: Drop unused handler.Markus Wick2018-09-104-8/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This virtual function is called in a very hot spot, and it does nothing. If this kind of feature is required, please be more specific and add callbacks in the switch statement within Maxwell3D::WriteReg. There is no point in having another switch statement within the rasterizer.
* | | | Merge pull request #1281 from bunnei/multi-rtbunnei2018-09-105-132/+95
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement multiple color attachments.
| * | | | gl_rasterizer: Implement multiple color attachments.bunnei2018-09-105-132/+95
|/ / / /
* | | | Merge pull request #1258 from tgsm/fix-sdl-loggingbunnei2018-09-101-2/+3
|\ \ \ \ | | | | | | | | | | yuzu-cmd: fix SDL logging
| * | | | yuzu-cmd: fix SDL loggingtgsm2018-09-081-2/+3
| | | | |
* | | | | Merge pull request #1282 from lioncash/compatbunnei2018-09-1010-33/+56
|\ \ \ \ \ | | | | | | | | | | | | yuzu: Move compatibility list specifics to their own source files
| * | | | | game_list: Make CompatibilityList parameter of NavigateToGamedbEntryRequested() a const referenceLioncash2018-09-103-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The compatibility list isn't modified within any of the slots connected to this signal, so we can make it const to enforce immutability.
| * | | | | yuzu: Move compatibility list specifics to their own source filesLioncash2018-09-1010-33/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Lets us keep the generic portions of the compatibility list code together, and allows us to introduce a type alias that makes it so we don't need to type out a very long type declaration anymore, making the immediate readability of some code better.
* | | | | | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Implement ReloadInputDevices
| * | | | | | hid: Implement ReloadInputDevicesfearlessTobi2018-09-092-4/+6
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1283 from lioncash/unusedbunnei2018-09-101-2/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Remove unused g_kernel_named_ports variable
| * | | | | | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With the named port functionality all migrated over to the kernel, there's no need to keep this around anymore.
* | | | | | | Merge pull request #1268 from FernandoS27/tmmlbunnei2018-09-102-5/+67
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | shader_decompiler: Implemented TMML
| * | | | | | Implemented TMMLFernandoS272018-09-102-5/+67
| | | | | | |
* | | | | | | Merge pull request #1272 from Subv/dma_2dbunnei2018-09-101-2/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU/DMA: Partially implemented the 'enable_2d' bit in the DMA engine.
| * | | | | | | GPU/DMA: Partially implemented the 'enable_2d' bit in the DMA engine.Subv2018-09-081-2/+10
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When not set, this tells the GPU to only use the X size when performing a DMA copy. This is only implemented for linear->linear and tiled->tiled copies. Conversion copies still retain the assert. This bit is unset by some games for various purposes, and by nouveau when copying the vertex buffers.
* | | | | | | Merge pull request #1280 from zero334/improvementsbunnei2018-09-105-89/+101
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | video_core: fixed arithmetic overflow warnings & improved code style
| * | | | | | video_core: fixed arithmetic overflow warnings & improved code stylePatrick Elsässer2018-09-095-89/+101
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixed all warnings, for renderer_opengl items, which were indicating a possible incorrect behavior from integral promotion rules and types larger than those in which arithmetic is typically performed. - Added const for variables where possible and meaningful. - Added constexpr where possible.
* | | | | | Merge pull request #1261 from FernandoS27/txqbunnei2018-09-102-2/+37
|\ \ \ \ \ \ | |/ / / / / |/| | | | | shader_decompiler: Implemented (Partialy) TXQ
| * | | | | Implemented TXQ dimension query type, used by SMO.FernandoS272018-09-092-1/+36
| | | | | |
| * | | | | Change name of TEXQ to TXQ, in order to match NVIDIA's namingFernandoS272018-09-091-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #1277 from jroweboy/update-xbyakMat M2018-09-091-0/+0
|\ \ \ \ \ | |/ / / / |/| | | | Externals: Update xbyak
| * | | | Externals: Update xbyakJames Rowe2018-09-091-0/+0
|/ / / /
* | | | Merge pull request #1256 from bunnei/tex-target-supportbunnei2018-09-0811-229/+422
|\ \ \ \ | | | | | | | | | | Initial support for non-2D textures
| * | | | gl_rasterizer_cache: Improve accuracy of RecreateSurface for non-2D textures.bunnei2018-09-082-27/+45
| | | | |
| * | | | maxwell_3d: Remove assert that no longer applies.bunnei2018-09-081-4/+0
| | | | |
| * | | | gl_rasterizer_cache: Partially implement several non-2D texture types.bunnei2018-09-081-30/+111
| | | | |
| * | | | gl_shader_decompiler: Partially implement several non-2D texture types (Subv).bunnei2018-09-082-32/+143
| | | | |
| * | | | gl_rasterizer: Implement texture wrap mode p.bunnei2018-09-082-2/+8
| | | | |
| * | | | gl_rasterizer_cache: Track texture depth.bunnei2018-09-083-4/+15
| | | | |
| * | | | gl_rasterizer_cache: Remove impl. of FlushGLBuffer.bunnei2018-09-081-34/+1
| | | | | | | | | | | | | | | | | | | | - Will not work for non-2d textures, and was not used anyways.
| * | | | gl_rasterizer_cache: Keep track of texture type per surface.bunnei2018-09-083-32/+84
| | | | |
| * | | | gl_rasterizer_cache: Remove unused DownloadGLTexture.bunnei2018-09-082-51/+0
| | | | |
| * | | | gl_state: Keep track of texture target.bunnei2018-09-085-26/+28
| | | | |
* | | | | Merge pull request #1265 from zhaowenlan1779/patch-1bunnei2018-09-081-2/+2
|\ \ \ \ \ | | | | | | | | | | | | yuzu: fix title bar display
| * | | | | yuzu: fix title bar displayPengfei Zhu2018-09-081-2/+2
| | |/ / / | |/| | | | | | | | Previously the version number got hidden after starting a game.
* | | | | Merge pull request #1267 from MerryMage/audio_outbunnei2018-09-082-7/+7
|\ \ \ \ \ | |/ / / / |/| | | | audio_renderer: Rename AudioOut instance to audio_out
| * | | | audio_renderer: Rename AudioOut instance to audio_outMerryMage2018-09-082-7/+7
|/ / / /
* | | | Merge pull request #1246 from degasus/instanced_renderingbunnei2018-09-083-21/+29
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Use baseInstance instead of moving the buffer points.
| * | | | gl_rasterizer: Use baseInstance instead of moving the buffer points.bunnei2018-09-083-21/+29
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | This hopefully helps our cache not to redundant upload the vertex buffer. # Conflicts: # src/video_core/renderer_opengl/gl_rasterizer.cpp
* | | | Merge pull request #1259 from lioncash/relocatebunnei2018-09-085-286/+324
|\ \ \ \ | |/ / / |/| | | yuzu: Move GameListWorker to its own source files
| * | | yuzu: Move GameListWorker to its own source filesLioncash2018-09-075-286/+324
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This has gotten sufficiently large enough to warrant moving it to its own source files. Especially given it dumps the file_sys headers around code that doesn't use it for the most part. This'll also make it easier to introduce a type alias for the compatibility list, so a large unordered_map type declaration doesn't need to be specified all the time (we don't want to propagate the game_list_p.h include via the main game_list.h header).
* | | | video_core: Arithmetic overflow warning fix for gl_rasterizer (#1262)Patrick Elsässer2018-09-081-12/+14
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * video_core: Arithmetic overflow fix for gl_rasterizer - Fixed warnings, which were indicating incorrect behavior from integral promotion rules and types larger than those in which arithmetic is typically performed. - Added const for variables where possible and meaningful. * Changed the casts from C to C++ style Changed the C-style casts to C++ casts as proposed. Took also care about signed / unsigned behaviour.
* | | Merge pull request #1257 from lioncash/processbunnei2018-09-084-5/+34
|\ \ \ | | | | | | | | core: Migrate current_process pointer to the kernel
| * | | core: Migrate current_process pointer to the kernelLioncash2018-09-074-5/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we now have the kernel as a class, it doesn't make sense to keep the current process pointer within the System class, as processes are related to the kernel. This also gets rid of a subtle case where memory wouldn't be freed on core shutdown, as the current_process pointer would never be reset, causing the pointed to contents to continue to live.
* | | | Merge pull request #1260 from MerryMage/dynarmicbunnei2018-09-081-0/+0
|\ \ \ \ | |_|/ / |/| | | externals: Update dynarmic to 9594465
| * | | externals: Update dynarmic to 9594465MerryMage2018-09-071-0/+0
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 9594465 A64: Implement FastDispatchHint 2be95f2 A32: Implement FastDispatchHint 96f23ac ir/terminal: Add FastDispatchHint f5ca9e9 A64: Implement SQDMULH's scalar variant af8bea5 ir: Add opcodes for scalar signed saturated doubling multiplies fed4220 A64: Implement SQDMULH's vector variant 72eb6ad ir: Add opcodes for signed saturated doubling multiplies 0f8ae84 externals: Update catch to 2.4.0 235165b A64: Implement SQABS' scalar variant 1adca93 A64: Implement SQABS' vector variant. f978c44 ir: Add opcodes for signed saturated absolute values d895a84 emit_x64_floating_point: EmitFPToFixed: maxsd optimization c624fe3 emit_x64_floating_point: ZeroIfNaN: pxor -> xorps e987a84 IR: Simplify FP{Single,Double}ToFixed{U,S}{32,64} f1babc8 externals: Update catch to 2.3.0 a0c587a A32/decoder: Add missing <algorithm> includes
* | | Merge pull request #1201 from CaptV0rt3x/titlebarbunnei2018-09-076-10/+30
|\ \ \ | |/ / |/| | Port #3804 from Citra - Better Title Bar Display
| * | For SDL FrontendCaptV0rt3x2018-09-071-2/+2
| | |
| * | Better Title Bar DisplayCaptV0rt3x2018-09-075-8/+28
|/ /
* | Merge pull request #1250 from lioncash/file-sysbunnei2018-09-074-4/+16
|\ \ | | | | | | file_sys/{nca_patch, patch_manager}: Amend unnecessary/missing includes.
| * | file_sys/nca_patch: Amend constructor initializer list orderLioncash2018-09-061-2/+2
| | | | | | | | | | | | | | | | | | Orders the elements in the initializer list in the order they're specified in the class. This prevents compiler warnings about initialization order.
| * | file_sys/nca_patch: Remove unnecessary includesLioncash2018-09-062-2/+9
| | | | | | | | | | | | | | | romfs.h doesn't need to be included in the header, the only real dependency here is common's swap.h that needs to be included.
| * | file_sys/patch_manager: Add missing includesLioncash2018-09-062-0/+5
| | | | | | | | | | | | These includes were previously being satisfied indirectly.
* | | Merge pull request #1249 from FearlessTobi/disable-vsyncbunnei2018-09-072-0/+2
|\ \ \ | | | | | | | | frontend: Set swap interval to 0
| * | | frontend: Set swap interval to 0fearlessTobi2018-09-062-0/+2
| | | |
* | | | Merge pull request #1251 from lioncash/core-incbunnei2018-09-075-2/+5
|\ \ \ \ | | | | | | | | | | core/core: Remove unnecessary sm/controller include
| * | | | core/core: Remove unnecessary sm/controller includeLioncash2018-09-065-2/+5
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The only reason this include was necessary, was because the constructor wasn't defaulted in the cpp file and the compiler would inline it wherever it was used. However, given Controller is forward declared, all those inlined constructors would see an incomplete type, causing a compilation failure. So, we just place the constructor in the cpp file, where it can see the complete type definition, allowing us to remove this include.
* | | | Merge pull request #1252 from lioncash/headerbunnei2018-09-071-0/+1
|\ \ \ \ | | | | | | | | | | video_core/CMakeLists: Add missing gl_buffer_cache.h
| * | | | video_core/CMakeLists: Add missing gl_buffer_cache.hLioncash2018-09-061-0/+1
| |/ / / | | | | | | | | | | | | | | | | Without this, the header file won't show up by default within IDEs such as Visual Studio.
* | | | Merge pull request #1253 from lioncash/explicitbunnei2018-09-072-8/+10
|\ \ \ \ | | | | | | | | | | video_core/gl_buffer_cache: Minor tidying changes
| * | | | gl_buffer_cache: Default initialize member variablesLioncash2018-09-061-3/+3
| | | | | | | | | | | | | | | | | | | | Ensures that the cache always has a deterministic initial state.
| * | | | gl_buffer_cache: Make GetHandle() a const member functionLioncash2018-09-062-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | GetHandle() internally calls GetHandle() on the stream_buffer instance, which is a const member function, so this can be made const as well.
| * | | | gl_buffer_cache: Remove unnecessary includesLioncash2018-09-062-2/+4
| | | | |
| * | | | gl_buffer_cache: Make constructor explicitLioncash2018-09-061-1/+1
| |/ / / | | | | | | | | | | | | Implicit conversions during construction isn't desirable here.
* | | | Merge pull request #1255 from bunnei/minor-optbunnei2018-09-071-4/+2
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Call state.Apply only once on SetupShaders.
| * | | | gl_rasterizer: Call state.Apply only once on SetupShaders.bunnei2018-09-061-4/+2
| |/ / /
* | | | Merge pull request #1254 from bunnei/ipa-saturatebunnei2018-09-071-1/+5
|\ \ \ \ | |/ / / |/| | | gl_shader_decompiler: Implement saturate mode for IPA.
| * | | gl_shader_decompiler: Implement saturate mode for IPA.bunnei2018-09-061-1/+5
|/ / /
* | | Merge pull request #1248 from degasus/shader_fixbunnei2018-09-061-0/+1
|\ \ \ | |/ / |/| | gl_shader_gen: Initialize position.
| * | gl_shader_gen: Initialize position.Markus Wick2018-09-061-0/+1
|/ / | | | | | | | | IMO the old code is fine, but nvidia raises shader compiler warnings. Trivial fix through...
* | Merge pull request #1243 from degasus/VAO_cachebunnei2018-09-063-53/+60
|\ \ | | | | | | gl_rasterizer: Implement a VAO cache.
| * | gl_rasterizer: Implement a VAO cache.Markus Wick2018-09-053-53/+60
| | | | | | | | | | | | | | | | | | This patch caches VAO objects instead of re-emiting all pointers per draw call. Configuring this pointers is known as a fast task, but it yields too many GL calls. So for better performance, just bind the VAO instead of 16 pointers.
* | | Merge pull request #1244 from FernandoS27/ipabunnei2018-09-062-47/+98
|\ \ \ | | | | | | | | shader_decompiler: Implemented IPA Properly (Stage 1)
| * | | Implemented IPA ProperlyFernandoS272018-09-062-47/+98
| | | |
* | | | Merge pull request #1242 from lioncash/file-sysbunnei2018-09-062-8/+17
|\ \ \ \ | | | | | | | | | | file_sys/submission_package: Replace includes with forward declarations where applicable
| * | | | file_sys/submission_package: Correct constructor initialization list orderLioncash2018-09-051-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | Orders the elements in the sequence to match the order in which they'll actually be initialized in.
| * | | | file_sys/submission_package: Replace includes with forward declarations where applicableLioncash2018-09-052-6/+15
| | |/ / | |/| |
* | | | Merge pull request #1179 from DarkLordZach/bktrbunnei2018-09-0632-101/+1132
|\ \ \ \ | | | | | | | | | | file_sys: Add support for BKTR format (Game Updates)
| * | | | bktr: Fix bucket overlap errorZach Hilman2018-09-048-9/+11
| | | | |
| * | | | drd: Parse title ID from program metadataZach Hilman2018-09-042-4/+29
| | | | |
| * | | | patch_manager: Centralize Control-type NCA parsingZach Hilman2018-09-046-80/+89
| | | | |
| * | | | nsp: Fix error masking issue with XCI filesZach Hilman2018-09-043-6/+13
| | | | | | | | | | | | | | | | | | | | Now display correct error instead of catch-all MissingProgramNCA
| * | | | game_list: Fix version display on non-NAND titlesZach Hilman2018-09-044-30/+52
| | | | |
| * | | | bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
| | | | |
| * | | | game_list: Use friendly game versionsZach Hilman2018-09-041-13/+32
| | | | | | | | | | | | | | | | | | | | Mainly, from control.nacp metadata instead of cnmt metadata
| * | | | bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
| | | | | | | | | | | | | | | | | | | | Fixes base game read errors
| * | | | bktr: Fix missing includes and optimize styleZach Hilman2018-09-0412-103/+109
| | | | |
| * | | | main: Make game updates installableZach Hilman2018-09-041-1/+5
| | | | |
| * | | | game_list: Display patch names and versions on listZach Hilman2018-09-042-0/+27
| | | | |
| * | | | loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
| | | | |
| * | | | loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
| | | | |
| * | | | patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
| | | | |
| * | | | file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
| | | | | | | | | | | | | | | | | | | | Right now only includes Updates, but should eventually contain all of the other patches we need.
| * | | | file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
| | | | |
| * | | | content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
| | | | |
| * | | | registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
| | | | | | | | | | | | | | | | | | | | Aggregates multiple caches into one interface
| * | | | game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-043-5/+3
| | | | | | | | | | | | | | | | | | | | Reduces code
| * | | | aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
| | | | | | | | | | | | | | | | | | | | Issues with block size are fixed by making all reads minimum length of 0x10
* | | | | Merge pull request #1245 from degasus/optimizationsbunnei2018-09-051-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | gl_rasterizer: Skip TODO log.
| * | | | gl_rasterizer: Skip TODO log.Markus Wick2018-09-051-1/+1
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | This is called ~3k times per frame in SMO ingame. My laptop spends ~3ms per frame on allocating and freeing this string. Let's just stop printing this kind of redundant information.
* | | | Merge pull request #1217 from degasus/vbo_cache2bunnei2018-09-055-86/+182
|\ \ \ \ | |_|/ / |/| | | renderer_opengl: Implement a buffer cache.
| * | | renderer_opengl: Implement a buffer cache.Markus Wick2018-09-055-86/+182
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | The idea of this cache is to avoid redundant uploads. So we are going to cache the uploaded buffers within the stream_buffer and just reuse the old pointers. The next step is to implement a VBO cache on GPU memory, but for now, I want to check the overhead of the cache management. Fetching the buffer over PCI-E should be quite fast.
* | | Merge pull request #1240 from degasus/optimizationsbunnei2018-09-054-15/+23
|\ \ \ | |/ / |/| | gl_shader_cache: Use an u32 for the binding point cache.
| * | gl_shader_cache: Use an u32 for the binding point cache.Markus Wick2018-09-044-15/+23
| | | | | | | | | | | | | | | | | | | | | The std::string generation with its malloc and free requirement was a noticeable overhead. Also switch to an ordered_map to avoid the std::hash call. As those maps usually have a size of two elements, the lookup time shall not matter.
* | | Merge pull request #1178 from DarkLordZach/nspbunnei2018-09-0419-41/+650
|\ \ \ | |/ / |/| | file_sys: Add Nintendo Submissions Package (NSP) file format
| * | main: Only show DRD deprecation warning onceZach Hilman2018-09-047-6/+19
| | |
| * | control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
| | |
| * | card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
| | |
| * | qt: Add deprecation warnings for DRD formatZach Hilman2018-09-041-0/+10
| | |
| * | registration: Fix NSP installation errorsZach Hilman2018-09-041-1/+1
| | |
| * | nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
| | |
| * | qt: Add UI support for NSP filesZach Hilman2018-09-043-2/+7
| | |
| * | registration: Add support for installing NSP filesZach Hilman2018-09-043-16/+34
| | |
| * | loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
| | |
| * | card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
| | | | | | | | | | | | Eliminated duplicate code and adds support for Rev1+ carts
| * | file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
| | |
| * | drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
| | | | | | | | | | | | Previously only loaded from control metadata
| * | loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
| | |
| * | key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
|/ /
* | Merge pull request #1238 from lioncash/explicitbunnei2018-09-043-8/+8
|\ \ | | | | | | common/logging: Minor changes
| * | common/logging: Amend documentation commentsLioncash2018-09-042-6/+6
| | | | | | | | | | | | | | | | | | | | | Multi-line doc comments still need the '<' after the ///, otherwise it's treated as a regular comment and makes the original doc comment broken in viewers, IDEs, etc. While we're at it, also fix some typos in the comments.
| * | common/logging/filter: Replace C-style case with C++ static_castLioncash2018-09-041-1/+1
| | |
| * | common/logging/filter: Make constructor explicitLioncash2018-09-041-1/+1
| | | | | | | | | | | | Implicit conversions aren't desirable here.
* | | Merge pull request #1237 from degasus/optimizationsbunnei2018-09-044-7/+7
|\ \ \ | | | | | | | | Optimizations
| * | | core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
| | | | | | | | | | | | | | | | This helper is called very often. The memory ownership shall not be transfered, so just return the raw pointer.
| * | | command_processor: Use std::array for bound_engines.Markus Wick2018-09-042-4/+4
| |/ / | | | | | | | | | | | | subchannel is a 3 bit field. So there must not be more than 8 bound engines. And using a hashmap for up to 8 values is a bit overpowered.
* | | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-046-0/+79
|\ \ \ | | | | | | | | file_sys: Allow for custom NAND/SD directories
| * | | qt: Add message about not moving contents on dir changeZach Hilman2018-09-042-6/+23
| | | |
| * | | qt: Add UI options to change NAND/SD dirsZach Hilman2018-09-043-0/+36
| | | |
| * | | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-043-0/+26
| | | |
* | | | Merge pull request #1232 from lioncash/copybunnei2018-09-041-1/+1
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()
| * | | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()Lioncash2018-09-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Using the getter function intended for external code here makes an unnecessary copy of the already-accessible used_shaders vector.
* | | | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0422-27/+64
|\ \ \ \ \ | | | | | | | | | | | | file_sys: Replace includes with forward declarations where applicable
| * | | | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0422-27/+64
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | Cuts down on include dependencies, resulting in less files that need to be rebuilt when certain things are changed.
* | | | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-044-5/+21
|\ \ \ \ \ | | | | | | | | | | | | Update microprofile scopes.
| * | | | | Update microprofile scopes.Markus Wick2018-09-044-5/+21
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Blame the subsystems which deserve the blame :) The updated list is not complete, just the ones I've spotted on random sampling the stack trace.
* | | | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ \ \ | |/ / / / |/| | | | ssl: Move SSL class to cpp file
| * | | | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
| | |_|/ | |/| | | | | | | | | | | | | | | | | | This isn't required to be visible to anything outside of the main source file, and will eliminate needing to rebuild anything else including the header if the SSL class needs to be changed in the future.
* | | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \ \ | | | | | | | | | | service: Migrate global named port map to the KernelCore class
| * | | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ / | |/| | | | | | | | | | | | | | | | | | Now that we have a class representing the kernel in some capacity, we now have a place to put the named port map, so we move it over and get rid of another piece of global state within the core.
* | | | Merge pull request #1229 from lioncash/forward-declbunnei2018-09-0413-15/+45
|\ \ \ \ | |_|_|/ |/| | | vfs_real: Forward declare IOFile
| * | | vfs_real: Forward declare IOFileLioncash2018-09-0213-15/+45
| |/ / | | | | | | | | | | | | | | | Eliminates the need to rebuild some source files if the file_util header ever changes. This also uncovered some indirect inclusions, which have also been fixed.
* | | Merge pull request #1233 from lioncash/dynarmicMat M2018-09-031-0/+0
|\ \ \ | |/ / |/| | externals: Update dynarmic to 0435ac2
| * | externals: Update dynarmic to 0435ac2Lioncash2018-09-031-0/+0
|/ /
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-023-4/+33
|\ \ | | | | | | filesystem/maxwell_3d: Various changes to boot Project Octopath Traveller
| * | maxwell_3d: Use CoreTiming for query timestampZach Hilman2018-09-011-2/+3
| | |
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| | |
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* | Merge pull request #1215 from ogniK5377/texs-nodep-assertbunnei2018-09-022-0/+3
|\ \ | | | | | | Added assert for TEXS nodep
| * | Added assert for TEXS nodepDavid Marcec2018-09-012-0/+3
| |/
* | Merge pull request #1219 from jroweboy/less-artifactsbunnei2018-09-021-4/+0
|\ \ | | | | | | Build - Upload fewer artifacts
| * | Build - Upload fewer artifactsJames Rowe2018-09-011-4/+0
| |/ | | | | | | | | Appveyor has a limit on artifact retention, and we hit the limit all the time, so just lower the number of build artifacts to just the final zip
* | Merge pull request #1220 from FearlessTobi/extensions-qolbunnei2018-09-022-8/+10
|\ \ | | | | | | yuzu: Display the unsupported GL extensions in the popup
| * | citra_qt: Display the unsupported GL extensions in the popupfearlessTobi2018-09-012-8/+10
| |/
* | Merge pull request #1214 from ogniK5377/ipa-assertbunnei2018-09-022-6/+13
|\ \ | | | | | | Added better asserts to IPA, Renamed IPA modes to match mesa
| * | Added better asserts to IPA, Renamed IPA modes to match mesaDavid Marcec2018-09-012-6/+13
| |/ | | | | | | | | | | | | | | | | | | IpaMode is changed to IpaInterpMode IpaMode is suppose to be 2 bits not 3 Added IpaSampleMode Added Saturate Renamed modes based on https://github.com/mesa3d/mesa/blob/d27c7918916cdc8092959124955f887592e37d72/src/gallium/drivers/nouveau/codegen/nv50_ir_emit_gm107.cpp#L2530
* | Merge pull request #1216 from ogniK5377/ffma-assertbunnei2018-09-022-0/+9
|\ \ | | | | | | Added FFMA asserts and missing fields
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| | | | | | | | | | | | Saturate already implemented
| * | Changed tab5980_0 default from 0 -> 1David Marcec2018-09-011-2/+2
| | |
| * | Added FFMA assertsDavid Marcec2018-09-012-0/+11
| |/
* | Merge pull request #1218 from ogniK5377/fmul-assertbunnei2018-09-022-0/+13
|\ \ | | | | | | Added FMUL asserts
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| | | | | | | | | | | | Unneeded as we already implement it
| * | Added FMUL assertsDavid Marcec2018-09-012-0/+15
| |/
* | Merge pull request #1228 from lioncash/constructbunnei2018-09-021-2/+5
|\ \ | |/ |/| filesystem: Move dir retrieval after path checking in DeleteFile()
| * filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/ | | | | We don't need to do the lookup if the path is considered empty currently.
* Merge pull request #1196 from FearlessTobi/ccache-consistencybunnei2018-09-014-16/+6
|\ | | | | .travis: Use Citras ccache for builds instead of yuzus
| * travis: use Citras ccachefearlessTobi2018-08-314-16/+6
| |
* | Merge pull request #1212 from lioncash/forward-declbunnei2018-09-0129-66/+185
|\ \ | |/ |/| core/core: Replace includes with forward declarations where applicable
| * core/core: Replace includes with forward declarations where applicableLioncash2018-08-3129-66/+185
|/ | | | | | | | | | | The follow-up to e2457418dae19b889b2ad85255bb95d4cd0e4bff, which replaces most of the includes in the core header with forward declarations. This makes it so that if any of the headers the core header was previously including change, then no one will need to rebuild the bulk of the core, due to core.h being quite a prevalent inclusion. This should make turnaround for changes much faster for developers.
* Merge pull request #1205 from bunnei/improve-rasterizer-cache-2bunnei2018-08-3111-297/+227
|\ | | | | Various fixes and improvements to rasterizer cache 2: Electric Boogaloo
| * gl_rasterizer_cache: Use accurate framebuffer setting for accurate copies.bunnei2018-08-312-73/+54
| |
| * gl_rasterizer_cache: Also use reserve cache for RecreateSurface.bunnei2018-08-312-24/+18
| |
| * rasterizer_cache: Use boost::interval_map for a more accurate cache.bunnei2018-08-311-33/+45
| |
| * gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-3111-138/+70
| |
| * gl_rasterizer: Fix issues with the rasterizer cache.bunnei2018-08-314-46/+57
|/ | | | | - Use a single cached page map. - Fix calculation of ending page.
* Implement BC6H_UF16 & BC6H_SF16 (#1092)greggameplayer2018-08-313-31/+55
| | | | | | | | | * Implement BC6H_UF16 & BC6H_SF16 Require by ARMS * correct coding style * correct coding style part 2
* Merge pull request #1204 from lioncash/pimplbunnei2018-08-315-279/+387
|\ | | | | core: Make the main System class use the PImpl idiom
| * core: Make the main System class use the PImpl idiomLioncash2018-08-315-279/+387
| | | | | | | | | | | | | | | | | | | | | | | | | | core.h is kind of a massive header in terms what it includes within itself. It includes VFS utilities, kernel headers, file_sys header, ARM-related headers, etc. This means that changing anything in the headers included by core.h essentially requires you to rebuild almost all of core. Instead, we can modify the System class to use the PImpl idiom, which allows us to move all of those headers to the cpp file and forward declare the bulk of the types that would otherwise be included, reducing compile times. This change specifically only performs the PImpl portion.
* | Merge pull request #1207 from degasus/hotfixbunnei2018-08-311-1/+1
|\ \ | | | | | | Report correct shader size.
| * | Report correct shader size.Markus Wick2018-08-311-1/+1
| | | | | | | | | | | | | | | Seems like this was an oversee in regards to 1fd979f50a9f4c21fa8cafba7268d959e3076924 It changed GLShader::ProgramCode to a std::vector, so sizeof is wrong.
* | | Merge pull request #1208 from Hexagon12/pred-comp-14bunnei2018-08-312-3/+4
|\ \ \ | |/ / |/| | Add predicate comparison 14 (GreaterEqualWithNan)
| * | Added predicate comparison GreaterEqualWithNanHexagon122018-08-312-3/+4
|/ /
* | Merge pull request #1195 from FearlessTobi/port-gamelist-compatbunnei2018-08-3113-7/+196
|\ \ | | | | | | yuzu: Show game compatibility in the game list (PR ported from Citra)
| * | Show game compatibility within yuzufearlessTobi2018-08-2913-7/+196
| | |
* | | gl_shader_decompiler: Implement POPC (#1203)Laku2018-08-312-0/+19
| | | | | | | | | | | | | | | | | | * Implement POPC * implement invert
* | | Merge pull request #1200 from bunnei/improve-ipabunnei2018-08-302-1/+39
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.
| * | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.bunnei2018-08-292-1/+39
| | |
* | | Merge pull request #1198 from lioncash/kernelbunnei2018-08-3054-442/+671
|\ \ \ | | | | | | | | kernel: Eliminate kernel global state
| * | | kernel: Eliminate kernel global stateLioncash2018-08-2954-442/+671
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As means to pave the way for getting rid of global state within core, This eliminates kernel global state by removing all globals. Instead this introduces a KernelCore class which acts as a kernel instance. This instance lives in the System class, which keeps its lifetime contained to the lifetime of the System class. This also forces the kernel types to actually interact with the main kernel instance itself instead of having transient kernel state placed all over several translation units, keeping everything together. It also has a nice consequence of making dependencies much more explicit. This also makes our initialization a tad bit more correct. Previously we were creating a kernel process before the actual kernel was initialized, which doesn't really make much sense. The KernelCore class itself follows the PImpl idiom, which allows keeping all the implementation details sealed away from everything else, which forces the use of the exposed API and allows us to avoid any unnecessary inclusions within the main kernel header.
* | | Merge pull request #1202 from FearlessTobi/port-3825bunnei2018-08-302-1/+13
|\ \ \ | | | | | | | | Port #3825 from Citra: "travis: share environment variables with Docker"
| * | | Remove Citra specific variablefearlessTobi2018-08-291-3/+0
| | | |
| * | | travis: share env variables with Dockerliushuyu2018-08-292-1/+16
| |/ /
* | | Merge pull request #1172 from tech4me/impl_iadd3bunnei2018-08-302-1/+84
|\ \ \ | |/ / |/| | Shaders: Implemented IADD3
| * | Shaders: Implemented IADD3tech4me2018-08-292-1/+84
|/ /
* | Merge pull request #1193 from lioncash/privbunnei2018-08-287-26/+40
|\ \ | | | | | | gpu: Make memory_manager private
| * | gpu: Make memory_manager privateLioncash2018-08-287-26/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the class interface consistent and provides accessors for obtaining a reference to the memory manager instance. Given we also return references, this makes our more flimsy uses of const apparent, given const doesn't propagate through pointers in the way one would typically expect. This makes our mutable state more apparent in some places.
* | | Merge pull request #1192 from lioncash/unusedbunnei2018-08-281-2/+0
|\ \ \ | | | | | | | | gl_rasterizer: Remove unused variables
| * | | gl_rasterizer: Remove unused variablesLioncash2018-08-281-2/+0
| |/ /
* | | Merge pull request #1191 from lioncash/noexceptbunnei2018-08-281-1/+1
|\ \ \ | | | | | | | | hle/result: Make ResultVal's move constructor as noexcept
| * | | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many containers within the standard library provide different behaviors based on whether or not a move constructor/assignment operator can be guaranteed not to throw or not. Notably, implementations will generally use std::move_if_noexcept (or an internal implementation of it) to provide strong exception guarantees. If a move constructor potentially throws (in other words, is not noexcept), then certain behaviors will create copies, rather than moving the values. For example, consider std::vector. When a std::vector calls resize(), there are two ways the elements can be relocated to the new block of memory (if a reallocation happens), by copy, or by moving the existing elements into the new block of memory. If a type does not have a guarantee that it will not throw in the move constructor, a copy will happen. However, if it can be guaranteed that the move constructor won't throw, then the elements will be moved. This just allows ResultVal to be moved instead of copied all the time if ever used in conjunction with containers for whatever reason.
* | | Merge pull request #1194 from lioncash/allocbunnei2018-08-281-2/+1
|\ \ \ | |_|/ |/| | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()
| * | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()Lioncash2018-08-281-2/+1
| |/ | | | | | | | | | | | | | | Given std::vector is a type with a non-trivial destructor, this variable cannot be optimized away by the compiler, even if unused. Because of that, something that was intended to be fairly lightweight, was actually allocating 32KB and deallocating it at the end of the function.
* | Merge pull request #1190 from FearlessTobi/im-so-retardedbunnei2018-08-282-1/+2
|\ \ | |/ |/| yuzu: Fix two stupid errors made in #1141
| * Fix two stupid errors made in #1141fearlessTobi2018-08-282-1/+2
|/
* Merge pull request #1165 from bunnei/shader-cachebunnei2018-08-2812-417/+387
|\ | | | | renderer_opengl: Implement a new shader cache.
| * renderer_opengl: Implement a new shader cache.bunnei2018-08-289-285/+250
| |
| * gl_rasterizer_cache: Update to use RasterizerCache base class.bunnei2018-08-283-132/+20
| |
| * video_core: Add RasterizerCache class for common cache management code.bunnei2018-08-282-0/+117
| |
* | Merge pull request #1189 from FearlessTobi/fix-stick-directionsbunnei2018-08-281-2/+2
|\ \ | | | | | | yuzu: Fix input UI direction order for the right stick
| * | yuzu: Fix stick UI direction orderfearlessTobi2018-08-281-2/+2
|/ /
* | Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\ \ | |/ |/| kernel/error: Amend several error codes
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| | | | | | | | | | | | We can make this error code an alias of the resource limit exceeded error code, allowing us to get rid of the lingering 3DS error code of the same type.
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| | | | | | | | | | We can treat this as an alias of TooLarge for documentation purposes. This also lets us get rid of another lingering 3DS-related error code.
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| | | | | | | | | | This replaces the lingering 3DS constant with the proper one, and utilizes it within HandleTable's Create() member function.
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| |
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
| |
* | Merge pull request #1169 from Lakumakkara/selbunnei2018-08-281-1/+1
|\ \ | | | | | | shader_bytecode: fix SEL_IMM bitstring
| * | fix SEL_IMM bitstringLaku2018-08-241-1/+1
| | |
* | | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \ \ | | | | | | | | vfs_real: Remove unused variable in CreateDirectoryRelative()
| * | | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
| | | |
* | | | Merge pull request #1170 from lioncash/retbunnei2018-08-281-1/+1
|\ \ \ \ | | | | | | | | | | file_util: Correct return value in early exit of ReadFileToString()
| * | | | file_util: Correct return value in early exit of ReadFileToString()Lioncash2018-08-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | While still essentially being zero, we should be returning a numeric value here, not a boolean typed value.
* | | | | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \ \ \ \ | | | | | | | | | | | | core: Namespace all code in the arm subdirectory under the Core namespace
| * | | | | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
| |/ / / / | | | | | | | | | | | | | | | Gets all of these types and interfaces out of the global namespace.
* | | | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \ \ \ | | | | | | | | | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()
| * | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ / / | |/| | | | | | | | | | | | | Prevents compiler warnings.
* | | | | Merge pull request #1128 from DarkLordZach/malformed-hex-crashbunnei2018-08-271-5/+17
|\ \ \ \ \ | | | | | | | | | | | | hex_util: Replace logic_errors with LOG_CRITICAL
| * | | | | hex_util: Replace logic_errors with LOG_CRITICALZach Hilman2018-08-231-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | Makes it so malformed hex strings do not crash the entire program.
* | | | | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Return process title ID if queried in GetInfo()
| * | | | | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have the variable itself set up to perform this task, so we can just return its value from the currently executing process instead of always stubbing it to zero.
* | | | | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-275-27/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | debug_utils: Minor individual interface changes
| * | | | | | | debug_utils: Remove unused includesLioncash2018-08-255-24/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Quite a bit of these aren't necessary directly within the debug_utils header and can be removed or included where actually necessary.
| * | | | | | | debug_utils: Make BreakpointObserver class' constructor explicitLioncash2018-08-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids implicit conversions.
| * | | | | | | debug_utils: Initialize active_breakpoint member of DebugContextLioncash2018-08-251-2/+2
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Ensures that all class members are initialized.
* | | | | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | PL:U Added SharedFonts loading via TTF
| * | | | | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| | | | | | | |
| * | | | | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | By having the following TTF files in your yuzu sysdata directory. You can load sharedfonts via TTF files. FontStandard.ttf FontChineseSimplified.ttf FontExtendedChineseSimplified.ttf FontChineseTraditional.ttf FontKorean.ttf FontNintendoExtended.ttf FontNintendoExtended2.ttf
* | | | | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid: Move core include to cpp file
| * | | | | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't required to be in the header. Instead, directly include what this header needs and move it to the cpp file where it belongs.
* | | | | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: Remove always true conditionals in Load()
| * | | | | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These conditions are always true, since the outer conditional already checks for these conditions.
* | | | | | | | Merge pull request #1180 from tech4me/languagecode_fixbunnei2018-08-272-8/+45
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | set: Fixed GetAvailableLanguageCodes() to follow the max_entries
| * | | | | | | set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rightnow, in games use GetAvailableLanguageCodes(), there is a WriteBuffer() with size larger than the buffer_size. (Core Critical core\hle\kernel\hle_ipc.cpp:WriteBuffer:296: size (0000000000000088) is greater than buffer_size (0000000000000078)) 0x88 = 17(languages) * 8 0x78 = 15(languages) * 8 GetAvailableLanguageCodes() can only support 15 languages. After firmware 4.0.0 there are 17 supported language instead of 15, to enable this GetAvailableLanguageCodes2() need to be used. So GetAvailableLanguageCodes() will be caped at 15 languages. Reference: http://switchbrew.org/index.php/Settings_services
* | | | | | | Merge pull request #1173 from lioncash/batchbunnei2018-08-251-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()
| * | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()Lioncash2018-08-251-4/+4
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | The start and finish events should likely not be right after one another like this, otherwise the batch will appear to complete immediately
* | | | | | | Merge pull request #1167 from lioncash/assertbunnei2018-08-251-1/+2
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()
| * | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()Lioncash2018-08-241-1/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Previously the assert would always be hit, since it was the equivalent of: array == nullptr, which is never true.
* | | | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | filesystem: Fix typo in log message
| * | | | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ / / /
* | | | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2531-97/+821
|\ \ \ \ \ | | | | | | | | | | | | file_sys: Add support for NAX archives
| * | | | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| | | | | |
| * | | | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| | | | | |
| * | | | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | This is needed because the title IDs of update NCAs will not use the update title ID. The only sure way to tell is to look for a partition with BKTR crypto.
| * | | | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| | | | | |
| * | | | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | On call to WriteKeyToFile, so that the autogenerated file can be written.
| * | | | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| | | | | |
| * | | | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| | | | | |
| * | | | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| | | | | | | | | | | | | | | | | | | | | | | | Stored in a separate file than manual keys.
| * | | | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| | | | | |
| * | | | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| | | | | | | | | | | | | | | | | | | | | | | | Should make key gets marginally faster.
| * | | | | game_list: Add SD registration loading to game listZach Hilman2018-08-232-12/+12
| | | | | |
| * | | | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| | | | | |
| * | | | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | Returns the file before calling parser on it.
| * | | | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| | | | | |
| * | | | | qt: Make default row data title name and title idZach Hilman2018-08-231-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | Helps with installed games by making the title not a hexadecimal id string, instead the name.
| * | | | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| | | | | |
| * | | | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-233-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | Allows frontend to create registration caches for use before a game has booted.
| * | | | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| | | | | |
| * | | | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| | | | | |
| * | | | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| | | | | |
| * | | | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| | | | | |
| * | | | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | XTS with Nintendo Tweak will fail mysteriously if the sector size is not 0x4000. Upgrade the critical log to an assert to prevent undefined behavior.
| * | | | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | Fixes a bug where data lengths of less than size 0x10 will fail or have misleading return values.
| * | | | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | Prevents NCA-related errors from being masked into MissingProgramNCA or MissingKeyFile
* | | | | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-242-0/+18
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | qt: Add filename and title id to window title while running
| * | | | | qt: Add filename and title id to window title while runningZach Hilman2018-08-232-0/+18
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1164 from tech4me/decode_iadd3bunnei2018-08-241-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | | Shaders: Added decodings for IADD3 instructions
| * | | | Shaders: Added decodings for IADD3 instructionstech4me2018-08-231-0/+6
| |/ / /
* | | | Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" (#1142)Tobias2018-08-241-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | * Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" * Fix compilation
* | | | Added GetBootMode (#1107)David2018-08-244-3/+25
|/ / / | | | | | | | | | | | | | | | | | | | | | * Added GetBootMode Used by homebrew * Added enum for GetBootMode
* | | Merge pull request #1160 from bunnei/surface-reservebunnei2018-08-232-17/+91
|\ \ \ | | | | | | | | gl_rasterizer_cache: Several improvements
| * | | gl_rasterizer_cache: Blit when possible on RecreateSurface.bunnei2018-08-231-5/+12
| | | |
| * | | gl_rasterizer_cache: Reserve surfaces that have already been created for later use.bunnei2018-08-232-3/+61
| | | |
| * | | gl_rasterizer_cache: Remove assert for RecreateSurface type.bunnei2018-08-231-1/+0
| | | |
| * | | gl_rasterizer_cache: Implement compressed texture copies.bunnei2018-08-231-8/+18
| |/ /
* | | Merge pull request #1153 from bunnei/stencil-clearbunnei2018-08-236-69/+188
|\ \ \ | |/ / |/| | gl_rasterizer: Implement partial color clear, stencil clear, and stencil test.
| * | gl_rasterizer: Implement stencil test.bunnei2018-08-233-4/+58
| | | | | | | | | | | | - Used by Splatoon 2.
| * | gl_rasterizer: Implement partial color clear and stencil clear.bunnei2018-08-231-12/+42
| | |
| * | maxwell_3d: Update to include additional stencil registers.bunnei2018-08-231-20/+50
| | |
| * | gl_state: Update to handle stencil front/back face separately.bunnei2018-08-232-33/+38
|/ /
* | Merge pull request #1157 from lioncash/vecbunnei2018-08-232-11/+16
|\ \ | | | | | | gl_shader_gen: Use a std::vector to represent program code instead of std::array
| * | gl_shader_gen: Make ShaderSetup's constructor explicitLioncash2018-08-221-1/+1
| | | | | | | | | | | | Prevents implicit conversions.
| * | gl_shader_gen: Use a std::vector to represent program code instead of std::arrayLioncash2018-08-222-11/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While convenient as a std::array, it's also quite a large set of data as well (32KB). It being an array also means data cannot be std::moved. Any situation where the code is being set or relocated means that a full copy of that 32KB data must be done. If we use a std::vector we do need to allocate on the heap, however, it does allow us to std::move the data we have within the std::vector into another std::vector instance, eliminating the need to always copy the program data (as std::move in this case would just transfer the pointers and bare necessities over to the new vector instance).
* | | Merge pull request #1156 from Lakumakkara/lop3bunnei2018-08-232-0/+60
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Implement LOP3
| * | more fixesLaku2018-08-221-6/+7
| | |
| * | fixesLaku2018-08-221-6/+12
| | |
| * | remove debug loggingLaku2018-08-221-2/+0
| | |
| * | implement lop3Laku2018-08-222-0/+55
| | |
* | | Swap "Plus" with "Minus" on the controller GUI (#1150)literalmente-game2018-08-231-8/+8
| | | | | | | | | | | | | | | * Swap "Plus" with "Minus" on the controller GUI Major fix /s
* | | Merge pull request #1159 from lioncash/fmtJames Rowe2018-08-231-0/+0
|\ \ \ | | | | | | | | externals: Update fmt to 6201052
| * | | externals: Update fmt to 6201052Lioncash2018-08-221-0/+0
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we'd get warnings like: " c:\projects\yuzu\externals\fmt\include\fmt\format.h(2868): warning C4127: conditional expression is constant [C:\projects\yuzu\msvc_build\externals\dynarmic\src\dynarmic.vcxproj] " spamming the build output when compiling on Windows. This updates fmt to include the upstreamed fix that silences this warning.
* | | Merge pull request #1137 from lioncash/namespacebunnei2018-08-2321-23/+70
|\ \ \ | | | | | | | | renderer_opengl: Namespace OpenGL code
| * | | renderer_opengl: Namespace OpenGL codeLioncash2018-08-2221-23/+70
| | |/ | |/| | | | | | | | | | | | | | | | Namespaces all OpenGL code under the OpenGL namespace. Prevents polluting the global namespace and allows clear distinction between other renderers' code in the future.
* | | Merge pull request #1158 from lioncash/boostJames Rowe2018-08-221-0/+0
|\ \ \ | |_|/ |/| | externals/boost: Update to 1.68.0
| * | externals/boost: Update to 1.68.0Lioncash2018-08-221-0/+0
|/ / | | | | | | | | | | | | | | | | | | | | | | This updates the submodule to use 1.68.0. Notably, it gets rid of the silly "Info: Boost.Config is older than your compiler version - probably nothing bad will happen - but you may wish to look for an update Boost version. Define BOOST_CONFIG_SUPPRESS_OUTDATED_MESSAGE to suppress this message." message that spams the output of the build process on Windows.
* | Merge pull request #1155 from tech4me/icon-fixbunnei2018-08-221-1/+1
|\ \ | |/ |/| config: Fixed icon size get set to 0
| * config: Fixed icon size get set to 0tech4me2018-08-221-1/+1
|/
* Merge pull request #1136 from tech4me/masterbunnei2018-08-226-11/+45
|\ | | | | qt/main: Port part of citra(#3411), open savedata works
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-216-11/+45
| |
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-2210-25/+94
|\ \ | | | | | | Port #3353 from Citra: "citra-qt: Add customizable speed limit target "
| * | Port #3353 from CitrafearlessTobi2018-08-2110-25/+94
| | |
* | | Merge pull request #1154 from OatmealDome/topology-linesbunnei2018-08-221-0/+2
|\ \ \ | | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::Lines
| * | | maxwell_to_gl: Implement PrimitiveTopology::LinesOatmealDome2018-08-221-0/+2
| | | | | | | | | | | | Used by Splatoon 2's debug menu.
* | | | Merge pull request #1141 from FearlessTobi/port-3902bunnei2018-08-222-0/+18
|\ \ \ \ | | | | | | | | | | Port #3902 from Citra: "Add restart hotkey & menu option"
| * | | | Port #3902 from Citra: "Add restart hotkey & menu option"fearlessTobi2018-08-212-0/+18
| | |_|/ | |/| |
* | | | Merge pull request #1124 from Subv/logic_opsbunnei2018-08-226-7/+108
|\ \ \ \ | |_|/ / |/| | | GPU: Implemented logic ops.
| * | | GPU: Implemented the logic op functionality of the GPU.Subv2018-08-213-0/+61
| | | | | | | | | | | | | | | | This will ASSERT if blending is enabled at the same time as logic ops.
| * | | GLState: Allow enabling/disabling GL_COLOR_LOGIC_OP independently from blending.Subv2018-08-212-6/+19
| | | |
| * | | GPU: Added registers for the logicop functionality.Subv2018-08-211-1/+28
| | |/ | |/|
* | | Merge pull request #1147 from lioncash/warnbunnei2018-08-221-1/+1
|\ \ \ | | | | | | | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instance
| * | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instanceLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous form of initializing done here is a C-ism, an empty set of braces is sufficient for initializing (and doesn't potentially cause missing brace warnings, given the first member of the struct is a COORD struct).
* | | | Merge pull request #1151 from bunnei/revert-4a2ee191bunnei2018-08-222-153/+31
|\ \ \ \ | | | | | | | | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS …"
| * | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions."bunnei2018-08-222-153/+31
| | | | | | | | | | | | | | | | | | | | | | | | | - This reverts commit 3ef4b3d4b445960576f10d1ba6521580d03e3da8. - This commit had broken a lot of games. We really should do a full implementation of this in one change.
* | | | | Merge pull request #1152 from ogniK5377/plu-includebunnei2018-08-221-0/+1
|\ \ \ \ \ | | | | | | | | | | | | Added missing include for pl:u
| * | | | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
|/ / / / / | | | | | | | | | | | | | | | Should fix any compile errors
* / / / / PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added bfttf loading We can now load system bfttf fonts from system archives AND shared memory dumps. This allows people who have installed their system nand dumps to yuzu to automatically get shared font support. We also now don't hard code the offsets or the sizes of the shared fonts and it's all calculated for us now. * Addressed plu fixups * Style changes for plu * Fixed logic error for plu and added more error checks.
* | | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \ \ | | | | | | | | | | vfs: Replace mode.h include with forward declarations where applicable
| * | | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
| |/ / / | | | | | | | | | | | | | | | | Avoids the need to rebuild these source files if the mode header changes.
* | | | Merge pull request #1146 from lioncash/ambunnei2018-08-221-3/+4
|\ \ \ \ | | | | | | | | | | am: Utilize std::array within PopLaunchParameter()
| * | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
| |/ / / | | | | | | | | | | | | | | | | | | | | Gets rid of the potential for C array-to-pointer decay, and also makes pointer arithmetic to get the end of the copy range unnecessary. We can just use std::array's begin() and end() member functions.
* | | | Merge pull request #1148 from lioncash/audio-warnbunnei2018-08-211-1/+1
|\ \ \ \ | | | | | | | | | | audio_core/filter: Add explicit cast to assignment in Process()
| * | | | audio_core/filter: Add explicit cast to assignment in Process()Lioncash2018-08-211-1/+1
| |/ / / | | | | | | | | | | | | | | | | Previously this would cause warnings about implicit conversions to s16 from a double
* | | | Merge pull request #1149 from lioncash/parenbunnei2018-08-211-1/+1
|\ \ \ \ | |/ / / |/| | | shader_bytecode: Parenthesize conditional expression within GetTextureType()
| * | | shader_bytecode: Parenthesize conditional expression within GetTextureType()Lioncash2018-08-211-1/+1
|/ / / | | | | | | | | | Resolves a -Wlogical-op-parentheses warning.
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \ | | | | | | | | sdmc_factory: Remove unnecessary core include
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/| | | | | | | | | | This doesn't require the central core header to be included, it just needs the vfs headers.
* | | Merge pull request #1139 from lioncash/bitfieldbunnei2018-08-211-2/+1
|\ \ \ | | | | | | | | bit_field: Convert ToBool() into explicit operator bool
| * | | bit_field: Convert ToBool() into explicit operator boolLioncash2018-08-211-2/+1
| |/ / | | | | | | | | | Gets rid of a TODO that is long overdue.
* | | Merge pull request #1140 from FearlessTobi/port-4056bunnei2018-08-212-0/+14
|\ \ \ | | | | | | | | Port #4056 from Citra: "Add Clear Recent Files menu action"
| * | | Port #4056 from Citra: "Add Clear Recent Files menu action"fearlessTobi2018-08-212-0/+14
| |/ /
* | | Merge pull request #1144 from MerryMage/MAX_LAG_TIME_USMat M2018-08-211-1/+1
|\ \ \ | |/ / |/| | perf_stats: Change MAX_LAG_TIME_US to an appropriate value
| * | perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ / | | | | | | | | | | | | | | | | | | 25us is far too small, and would result in std::this_thread::sleep_for being called with this as a maximum value. This means that a guest application that produces frames instantly would only be limited to 40 kHz. 25ms is a more appropriate value, as it allows for a 60 Hz refresh rate while providing enough slack in the negative region.
* | Merge pull request #1123 from lioncash/screenbunnei2018-08-217-30/+25
|\ \ | | | | | | rasterizer_interface: Remove renderer-specific ScreenInfo type from AccelerateDraw() in RasterizerInterface
| * | rasterizer_interface: Remove ScreenInfo from AccelerateDraw()'s signatureLioncash2018-08-215-17/+14
| | | | | | | | | | | | | | | | | | This is an OpenGL renderer-specific data type. Given that, this type shouldn't be used within the base interface for the rasterizer. Instead, we can pass this information to the rasterizer via reference.
| * | renderer_base: Make creation of the rasterizer, the responsibility of the renderers themselvesLioncash2018-08-214-14/+12
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we use a base-class type within the renderer for the rasterizer (RasterizerInterface), we want to allow renderers to perform more complex initialization if they need to do such a thing. This makes it important to reserve type information. Given the OpenGL renderer is quite simple settings-wise, this is just a simple shuffling of the initialization code. For something like Vulkan however this might involve doing something like: // Initialize and call rasterizer-specific function that requires // the full type of the instance created. auto raster = std::make_unique<VulkanRasterizer>(some, params); raster->CallSomeVulkanRasterizerSpecificFunction(); // Assign to base class variable rasterizer = std::move(raster)
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-2111-8/+40
|\ \ | | | | | | romfs_factory, service/filesystem: Use forward declarations where applicable
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-219-5/+28
| | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to rebuild multiple source files if the filesystem code headers change. This also gets rid of a few instances of indirect inclusions being relied upon
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
| | | | | | | | | | | | | | | | | | Avoids the need to rebuild whatever includes the romfs factory header if the loader header ever changes. We also don't need to include the main core header. We can instead include the headers we specifically need.
* | | Merge pull request #1132 from Subv/gl_FragDepthbunnei2018-08-211-1/+6
|\ \ \ | | | | | | | | Shaders: Implement depth writing in fragment shaders.
| * | | Shaders: Implement depth writing in fragment shaders.Subv2018-08-211-1/+6
| | | | | | | | | | | | | | | | We'll write <last color output reg + 2> to gl_FragDepth.
* | | | Merge pull request #1134 from lioncash/logbunnei2018-08-211-1/+1
|\ \ \ \ | | | | | | | | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logs
| * | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logsLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | LOG_TRACE is only enabled on debug builds which can be quite slow when trying to debug graphics issues. Instead we can log the messages to the debug log, which is available on both release and debug builds.
* | | | | Merge pull request #1121 from Subv/tex_reinterpretbunnei2018-08-214-16/+70
|\ \ \ \ \ | |/ / / / |/| | | | Rasterizer: Use PBOs to reinterpret texture formats when games re-use the same memory.
| * | | | Rasterizer: Reinterpret the raw texture bytes instead of blitting (and thus doing format conversion) to a new texture when a game requests an old texture address with a different format.Subv2018-08-201-3/+49
| | | | |
| * | | | Rasterizer: Don't attempt to copy over the old texture's data when doing a format reinterpretation if we're only going to clear the framebuffer.Subv2018-08-204-13/+21
| | |_|/ | |/| |
* | | | Merge pull request #1133 from lioncash/guardbunnei2018-08-211-0/+2
|\ \ \ \ | |_|/ / |/| | | gl_stream_buffer: Add missing header guard
| * | | gl_stream_buffer: Add missing header guardLioncash2018-08-211-0/+2
| | | | | | | | | | | | | | | | | | | | Prevents potential compilation errors from occuring due to multiple inclusions
* | | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \ \ | | | | | | | | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()
| * | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these functions aren't intended to be used frequently, there's no need to keep the std::string instances allocated for the whole lifetime of the program. It's just a waste of memory.
* | | | | Merge pull request #1131 from bunnei/impl-tex3d-texcubebunnei2018-08-212-2/+21
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement TextureCube/Texture3D for TEX/TEXS.
| * | | | | shader_bytecode: Replace some UNIMPLEMENTED logs.bunnei2018-08-211-2/+6
| | | | | |
| * | | | | gl_shader_decompiler: Implement Texture3D for TEXS.bunnei2018-08-211-0/+7
| | | | | |
| * | | | | gl_shader_decompiler: Implement TextureCube for TEX.bunnei2018-08-211-0/+8
| | | | | |
* | | | | | Merge pull request #1106 from Subv/multiple_rendertargetsbunnei2018-08-212-6/+45
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.
| * | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.Subv2018-08-212-6/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were only writing to the first render target before. Note that this is only the GLSL side of the implementation, supporting multiple render targets requires more changes in the OpenGL renderer. Dual Source blending is not implemented and stuff that uses it might not work at all.
* | | | | | Merge pull request #1130 from Subv/tex_2dbunnei2018-08-211-6/+15
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Shaders: Fixed texture coordinates in TEX with Texture2D
| * | | | | Shaders: Fixed the coords in TEX with Texture2D.Subv2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The X and Y coordinates should be in gpr8 and gpr8+1, respectively. This fixes the cutscene rendering in Sonic Mania.
| * | | | | Shaders: Log and crash when using an unimplemented texture type in a texture sampling instruction.Subv2018-08-211-5/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ \ | | | | | | | | | | | | acc/profile_manager: General cleanup
| * | | | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | This is only used in a shared_ptr, so we can forward declare it.
| * | | | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We have an overload of WriteBuffer that accepts containers that satisfy the ContiguousContainer concept, which std::array does, so we only need to pass in the array itself.
| * | | | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Arranges them in the order the members would be initialized
| * | | | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | This is no longer used, so it can be removed.
| * | | | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Makes it a little bit more self-documenting.
| * | | | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the source and destination types are the same std::array type, we can simply use regular assignment to perform the same behavior.
| * | | | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to repeatedly specify the whole array type in multiple places.
| * | | | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ProfileInfo is quite a large struct in terms of data, and we don't need to perform a copy in these instances, so we can just pass constant references instead.
| * | | | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify the passed in array, so this can be a const reference.
| * | | | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This can just be constexpr like the others
| * | | | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use the constructor initializer list and just compare the contained u128's together instead of comparing each element individually. Ditto for comparing against an invalid UUID.
| * | | | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This avoids needing to dump the contents of <random> into other files that include the profile manager header.
| * | | | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | Moving a const reference isn't possible, so this just results in a copy (and given ProfileInfo is composed of trivial types and aggregates, a move wouldn't really do anything).
* | | | | Merge pull request #1125 from bunnei/update-dynarmicbunnei2018-08-211-0/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | | externals: Update dynarmic to a42f301c.
| * | | | externals: Update dynarmic to a42f301c.bunnei2018-08-211-0/+0
| | |/ / | |/| |
* | | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ \ | | | | | | | | | | filesystem: Add support for loading of system archives
| * | | | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| | | | |
| * | | | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
| | | | |
* | | | | Merge pull request #1127 from yuzu-emu/revert-838-port-3616James Rowe2018-08-211-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | Revert "Port #3616 from Citra: "appveyor: set jobs to 4 for mingw""
| * | | | Revert "Port #3616 from Citra: "appveyor: set jobs to 4 for mingw""Zach Hilman2018-08-211-1/+1
|/ / / /
* | | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-213-62/+84
|\ \ \ \ | |_|/ / |/| | | common/telemetry: Migrate core-independent info gathering to common
| * | | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-153-62/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously core itself was the library containing the code to gather common information (build info, CPU info, and OS info), however all of this isn't core-dependent and can be moved to the common code and use the common interfaces. We can then just call those functions from the core instead. This will allow replacing our CPU detection with Xbyak's which has better detection facilities than ours. It also keeps more architecture-dependent code in common instead of core.
* | | | Merge pull request #1104 from Subv/instanced_arraysbunnei2018-08-202-4/+30
|\ \ \ \ | | | | | | | | | | GLRasterizer: Implemented instanced vertex arrays.
| * | | | GLRasterizer: Implemented instanced vertex arrays.Subv2018-08-182-4/+30
| | |_|/ | |/| | | | | | | | | | Before each draw call, for every enabled vertex array configured as instanced, we take the current instance id and divide it by its configured divisor, then we multiply that by the corresponding stride and increment the start address by the resulting amount. This way we can simulate the vertex array being incremented once per instance without actually using OpenGL's instancing functions.
* | | | Merge pull request #1115 from Subv/texs_maskbunnei2018-08-201-18/+18
|\ \ \ \ | | | | | | | | | | Shaders/TEXS: Write to the correct output register when swizzling.
| * | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-201-18/+18
| | | | | | | | | | | | | | | | | | | | Previously we could end up with a TEXS that didn't write any outputs, this was wrong.
* | | | | Merge pull request #1112 from Subv/sampler_typesbunnei2018-08-203-33/+250
|\ \ \ \ \ | | | | | | | | | | | | Shaders: Use the correct shader type when sampling textures.
| * | | | | Shader: Implemented the TLD4 and TLD4S opcodes using GLSL's textureGather.Subv2018-08-191-0/+51
| | | | | | | | | | | | | | | | | | | | | | | | It is unknown how TLD4S determines the sampler type, more research is needed.
| * | | | | Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions.Subv2018-08-192-29/+127
| | | | | | | | | | | | | | | | | | | | | | | | Different sampler types have their parameters in different registers.
| * | | | | Shader: Added bitfields for the texture type of the various sampling instructions.Subv2018-08-191-1/+65
| | | | | |
| * | | | | Shaders: Added decodings for TLD4 and TLD4SSubv2018-08-191-3/+7
| | | | | |
* | | | | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | Added CheckFreeCommunicationPermission
| * | | | | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ / / / | |/| | | | | | | | | | | | | | | | This fixes save files not loading in splatoon 2
* | | | | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ \ \ \ | | | | | | | | | | | | | | New account backend to allow for future extended support
| * | | | | | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| | | | | | |
| * | | | | | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| | | | | | |
| * | | | | | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| | | | | | |
| * | | | | | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| | | | | | |
| * | | | | | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| | | | | | |
| * | | | | | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| | | | | | |
| * | | | | | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| | | | | | |
| * | | | | | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| | | | | | |
| * | | | | | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| | | | | | |
| * | | | | | If statement style changeDavid Marcec2018-08-111-11/+19
| | | | | | |
| * | | | | | Second round of account changesDavid Marcec2018-08-113-18/+21
| | | | | | |
| * | | | | | First round of account changesDavid Marcec2018-08-113-49/+55
| | | | | | |
| * | | | | | Rebase with dynarmic masterDavid Marcec2018-08-111-0/+0
| | | | | | |
| * | | | | | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| | | | | | |
| * | | | | | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1179-635/+1570
| |\ \ \ \ \ \
| * | | | | | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| | | | | | | |
| * | | | | | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| | | | | | | |
| * | | | | | | Open first user addedDavid Marcec2018-08-081-1/+3
| | | | | | | |
| * | | | | | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit verified working on puyo
| * | | | | | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| | | | | | | |
| * | | | | | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| | | | | | | |
| * | | | | | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
| | | | | | | |
* | | | | | | | Merge pull request #1120 from ogniK5377/rgba8-uintbunnei2018-08-204-45/+58
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implemented RGBA8_UINT
| * | | | | | | | Implemented RGBA8_UINTDavid Marcec2018-08-204-45/+58
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Needed by kirby
* | | | | | | | Merge pull request #1119 from lioncash/uninitbunnei2018-08-201-2/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | game_list: Avoid uninitialized variables when retrieving program ID
| * | | | | | | game_list: Avoid uninitialized variables when retrieving program IDLioncash2018-08-201-2/+2
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially leaving this variable uninitialized based off the loader failing to retrieve the ID value.
* | | | | | | Merge pull request #1089 from Subv/neg_bitsbunnei2018-08-192-16/+38
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.
| * | | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.Subv2018-08-182-16/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We should definitely audit our shader generator for more errors like this.
* | | | | | | | Merge pull request #1105 from Subv/convert_negbunnei2018-08-191-2/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.
| * | | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.Subv2018-08-181-2/+0
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1113 from Subv/texs_maskbunnei2018-08-191-6/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.
| * | | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-191-6/+11
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | Previously we could end up with a TEXS that didn't write any outputs, this was wrong.
* | | | | | | | Merge pull request #1102 from ogniK5377/mirror-clamp-edgebunnei2018-08-193-0/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Added WrapMode MirrorOnceClampToEdge
| * | | | | | | | Added check to see if ARB_texture_mirror_clamp_to_edge is supportedDavid Marcec2018-08-192-0/+4
| | | | | | | | |
| * | | | | | | | Added WrapMode MirrorOnceClampToEdgeDavid Marcec2018-08-181-0/+2
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Used by splatoon 2
* | | | | | | | Merge pull request #1101 from Subv/ssy_stackbunnei2018-08-191-3/+36
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.
| * | | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.Subv2018-08-181-3/+36
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | The SSY instruction pushes an address into the stack, and the SYNC instruction pops it. The current stack depth is 20, we should figure out if this is enough or not.
* | | | | | | Merge pull request #1109 from Subv/ldg_decodebunnei2018-08-191-0/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Shaders: Added decodings for the LDG and STG instructions.
| * | | | | | | Shaders: Added decodings for the LDG and STG instructions.Subv2018-08-191-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #1108 from Subv/front_facingbunnei2018-08-192-0/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).
| * | | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).Subv2018-08-192-0/+7
| |/ / / / / /
* | | | | | | Merge pull request #1103 from Subv/lop_predbunnei2018-08-192-11/+39
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | Shader: Implemented the predicate and mode arguments of LOP.
| * | | | | | Shader: Implemented the predicate and mode arguments of LOP.Subv2018-08-182-11/+39
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The mode can be used to set the predicate to true depending on the result of the logic operation. In some cases, this means discarding the result (writing it to register 0xFF (Zero)). This is used by Super Mario Odyssey.
* | | | | | Merge pull request #838 from FearlessTobi/port-3616James Rowe2018-08-181-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Port #3616 from Citra: "appveyor: set jobs to 4 for mingw"
| * | | | | Port #3616 from CitrafearlessTobi2018-07-261-1/+1
| | | | | |
* | | | | | Merge pull request #1100 from ogniK5377/missing-predbunnei2018-08-182-5/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | Added pred-condition GreaterThanWithNan
| * | | | | | Added predcondition GreaterThanWithNanDavid Marcec2018-08-182-5/+8
|/ / / / / /
* | | | | | Merge pull request #1096 from bunnei/supported-blitsbunnei2018-08-181-2/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: Remove asserts for supported blits.
| * | | | | | gl_rasterizer_cache: Remove asserts for supported blits.bunnei2018-08-171-2/+0
| | | | | | |
* | | | | | | Merge pull request #1097 from bunnei/gl-criticalbunnei2018-08-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | renderer_opengl: Treat OpenGL errors as critical.
| * | | | | | | renderer_opengl: Treat OpenGL errors as critical.bunnei2018-08-171-1/+1
| |/ / / / / /
* | | | | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
| | | | | | | | | | | | | | | | | | | | | * Used by Mario Tennis Aces
* | | | | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Delete System copy/move constructors and assignment operators
| * | | | | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents potentially making copies or doing silly things by accident with the System instance, particularly given our current core is designed (unfortunately) around one instantiable instance. This will prevent the accidental case of: auto instance = System::Instance(); being compiled without warning when it's supposed to be: auto& instance = System::Instance();
* | | | | | | | Merge pull request #1091 from lioncash/warningbunnei2018-08-171-78/+83
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt/main: Get rid of compilation warnings
| * | | | | | | | qt/main: Unindent code in OnMenuInstallToNAND()Lioncash2018-08-161-70/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can change this into an early-return if the filename is empty. There's no need to include all of the code within the if statement.
| * | | | | | | | qt/main: Make installation dialog text within OnMenuInstallToNAND() translatableLioncash2018-08-161-14/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is user-facing text, so it should be marked as translatable by Qt.
| * | | | | | | | qt/main: Get rid of compilation warningsLioncash2018-08-161-4/+8
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of truncation warnings about conversion to int. While we're at it, we can also de-hardcode the buffer size being used.
* | | | | | | | Merge pull request #1093 from greggameplayer/GetDefaultDisplayResolutionChangeEventbunnei2018-08-172-1/+13
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Implement GetDefaultDisplayResolutionChangeEvent
| * | | | | | | correct coding stylegreggameplayer2018-08-161-1/+1
| | | | | | | |
| * | | | | | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Require by Toki Tori and Toki Tori 2+
* | | | | | | | Merge pull request #1019 from Subv/vertex_divisorbunnei2018-08-177-5/+28
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Rasterizer: Manually implemented instanced rendering.
| * | | | | | | | Rasterizer: Implemented instanced rendering.Subv2018-08-157-5/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We keep track of the current instance and update an uniform in the shaders to let them know which instance they are. Instanced vertex arrays are not yet implemented.
* | | | | | | | | Merge pull request #1087 from MerryMage/dynarmicbunnei2018-08-172-0/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | dynarmic: Update to 550d662
| * | | | | | | | | dynarmic: Update to 550d662MerryMage2018-08-162-0/+3
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 550d662 load_store_exclusive: Define s == t state to be Constraint_NONE 0b69381 A64/translate: Allow for unpredictable behaviour to be defined 6d236d4 system: Implement MRS CNTFRQ_EL0 6cbb6fb A32/testenv: Add missing headers 6729328 externals: Update xbyak to v5.67 1812bd2 Squashed 'externals/xbyak/' changes from 2794cde7..671fc805 9a95802 externals: Document subtrees 714a840 A64: Implement SQ{ADD, SUB}, and UQ{ADD, SUB}'s vector variants 8cab459 A64: Implement UQADD/UQSUB's scalar variants 18a8151 ir: Add opcodes for unsigned saturating add and subtract a5660ee x64/reg_alloc: Use type alias for array returned by GetArgumentInfo() 29489b5 ir/value: Use type alias CoprocessorInfo for std::array<u8, 8> e23ba26 status_register_access: Add support for bits 0 and 1 of mask to MSR 55190bd fuzz_with_unicorn: Split utility functions into fuzz_util 23b049d A32/translate/load_store: Correct detection of writeback 7ec9f15 A32/translate: Add TranslateSingleInstruction efeecb4 A32/ir_emitter: Bug fix: IREmitter::ExceptionRaised using incorrect opcode 08d1d19 A32/decoders: Split instruction list into include file 2d929cc tests: Refactor unicorn_emu to allow for A32 unicorn f672368 microinstruction: Improve assert messages 7ebff50 emit_x64_vector: EmitVectorNarrow16: AVX512 implementation edce230 emit_x64_vector: EmitVectorNarrow32: prefer pblendw to loading constant
* | | | | | | | | Merge pull request #1084 from bunnei/depthbunnei2018-08-172-16/+26
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | gl_rasterizer_cache: Treat Depth formats differently from DepthStencil.
| * | | | | | | | gl_rasterizer_cache: Treat Depth formats differently from DepthStencil.bunnei2018-08-162-16/+26
| | | | | | | | |
* | | | | | | | | Merge pull request #1085 from lioncash/namespacebunnei2018-08-164-12/+22
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | common: Namespace hex_util.h/.cpp
| * | | | | | | | common: Namespace hex_util.h/.cppLioncash2018-08-164-12/+22
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's in the common code, so it should be under the Common namespace like everything else.
* | | | | | | | Merge pull request #1075 from lioncash/includebunnei2018-08-164-35/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | loader/{nca, xci}: Remove unnecessary includes and unused member variables
| * | | | | | | loader/nca: Remove unnecessary includes and member variablesLioncash2018-08-152-20/+11
| | | | | | | |
| * | | | | | | loader/xci: Remove unnecessary includes and member variablesLioncash2018-08-152-15/+11
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of these aren't necessary and will cause this file to be required to be recompiled whenever any changes to those files are made, which lengthens compile times for no reason. This also removes an unused metadata variable from AppLoader_XCI
* | | | | | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-1634-80/+1437
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys: Add support for registration format
| * | | | | | | registration: Various style and documentation improvementsZach Hilman2018-08-123-18/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix logic in RealVfsFilesystem Create methods Remove magic numbers Fix regex errors
| * | | | | | | registration: Add support for force overwrite of installedZach Hilman2018-08-124-53/+106
| | | | | | | |
| * | | | | | | game_list: Split game list scans to multiple functionsZach Hilman2018-08-122-9/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary rebuilds of control data on every layer of recursion in AddFstEntriesToGameList
| * | | | | | | vfs_real: Add CreateFullPath to Create* operationsZach Hilman2018-08-122-13/+6
| | | | | | | |
| * | | | | | | control_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-2/+1
| | | | | | | |
| * | | | | | | romfs: Remove cyclic shared_ptr leak in romfs codeZach Hilman2018-08-123-8/+8
| | | | | | | |
| * | | | | | | registration: Update documentation and styleZach Hilman2018-08-125-42/+69
| | | | | | | |
| * | | | | | | nca_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-3/+2
| | | | | | | |
| * | | | | | | bis_factory: Create NAND dirs if they don't existZach Hilman2018-08-121-2/+9
| | | | | | | |
| * | | | | | | qt: Use custom RawCopy with progress bar for installsZach Hilman2018-08-121-2/+28
| | | | | | | |
| * | | | | | | registration: Take RawCopy function as parameterZach Hilman2018-08-122-10/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of defaulting to VfsRawCopy
| * | | | | | | game_list: Populate control data from installed NANDZach Hilman2018-08-122-31/+35
| | | | | | | |
| * | | | | | | registered_cache: Fix missing reading from yuzu_metaZach Hilman2018-08-121-7/+16
| | | | | | | |
| * | | | | | | file_sys: Comply to style guidelinesZach Hilman2018-08-128-47/+60
| | | | | | | |
| * | | | | | | qt: Add 'Install to NAND' option to menuZach Hilman2018-08-125-1/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prompts for title type on NCA files.
| * | | | | | | game_list: Modify game list to scan installed titlesZach Hilman2018-08-121-0/+45
| | | | | | | |
| * | | | | | | file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Manages NAND NCA get and install.
| * | | | | | | file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
| | | | | | | |
| * | | | | | | card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
| | | | | | | |
| * | | | | | | vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes bugs with calling CreateFile when the immediate directory does not exist.
| * | | | | | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| | | | | | | |
| * | | | | | | bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates and stores RegisteredCaches for user and system NAND, as creation of a RegisteredCache is expensive.
| * | | | | | | loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | i.e. Load the concatenated 00+01 if 01 exists as well. Needed for split NAND NCAs.
| * | | | | | | loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed to avoid mismatch filetype warnings on split NAND NCAs
| * | | | | | | vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
| | | | | | | |
| * | | | | | | crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Move to hex_util.h in common
| * | | | | | | file_util: Add getter for NAND registration directoryZach Hilman2018-08-122-0/+8
| | | | | | | |
| * | | | | | | common: Move hex string processing to separate fileZach Hilman2018-08-123-0/+64
| | | | | | | |
* | | | | | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | lm: Handle threads and modules within the logger
| * | | | | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using LOG_TRACE here isn't a good idea because LOG_TRACE is only enabled when yuzu is compiled in debug mode. Debug mode is also quite slow, and so we're potentially throwing away logging messages that can provide value when trying to boot games.
| * | | | | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The thread field serves to indicate which thread a log is related to and provides the length of the thread's name, so we can print that out, ditto for modules. Now we can know what threads are potentially spawning off logging messages (for example Lydie & Suelle bounces between MainThread and LoadingThread when initializing the game).
* | | | | | | | Merge pull request #1079 from lioncash/fmtbunnei2018-08-165-14/+18
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | loader: Make ResultStatus directly compatible with fmt
| * | | | | | | | loader: Make ResultStatus directly compatible with fmtLioncash2018-08-155-14/+18
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can make the enum class type compatible with fmt by providing an overload of operator<<. While we're at it, perform proper bounds checking. If something exceeds the array, it should be a hard fail, because it's, without a doubt, a programmer error in this case.
* | | | | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-163-1/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafe
| * | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-133-1/+12
| | | | | | | | |
* | | | | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSize
| * | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | This should be returning a u16 according to Switch Brew.
* | | | | | | | | Merge pull request #1083 from Subv/conv_negbunnei2018-08-161-13/+53
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Shaders: Implemented I2F_C and F2I_C, along with the negation bits of the conversion instructions.
| * | | | | | | | | Shader/Conversion: Implemented the negate bit in F2F and I2I instructions.Subv2018-08-151-4/+12
| | | | | | | | | |
| * | | | | | | | | Shader/I2F: Implemented the negate I2F_C instruction variant.Subv2018-08-151-7/+23
| | | | | | | | | |
| * | | | | | | | | Shader/F2I: Implemented the negate bit in the I2F instructionSubv2018-08-151-0/+4
| | | | | | | | | |
| * | | | | | | | | Shader/F2I: Implemented the F2I_C instruction variant.Subv2018-08-151-2/+10
| | | | | | | | | |
| * | | | | | | | | Shader/F2I: Implemented the negate bit in the F2I instruction.Subv2018-08-151-0/+4
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1081 from lioncash/convertbunnei2018-08-153-3/+8
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | kernel/server_session: Add IsSession() member function
| * | | | | | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows querying the inverse of IsDomain() to make things more readable. This will likely also be usable in the event of implementing ConvertDomainToSession().
* | | | | | | | | Merge pull request #1077 from bunnei/rgba16ubunnei2018-08-151-1/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Add RGBA16U to PixelFormatFromTextureFormat.
| * | | | | | | | | gl_rasterizer_cache: Add RGBA16U to PixelFormatFromTextureFormat.bunnei2018-08-151-1/+9
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1076 from bunnei/format-cleanupbunnei2018-08-152-41/+71
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | gl_rasterizer_cache: Cleanup some PixelFormat names and logging.
| * | | | | | | | gl_rasterizer_cache: Cleanup some PixelFormat names and logging.bunnei2018-08-152-41/+71
|/ / / / / / / /
* | | | | | | | Merge pull request #1069 from bunnei/vtx-szbunnei2018-08-151-5/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | maxwell_to_gl: Properly handle UnsignedInt/SignedInt sizes.
| * | | | | | | | maxwell_to_gl: Properly handle UnsignedInt/SignedInt sizes.bunnei2018-08-151-5/+20
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1070 from bunnei/cbuf-szbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer: Fix upload size for constant buffers.
| * | | | | | | | gl_rasterizer: Fix upload size for constant buffers.bunnei2018-08-151-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1071 from bunnei/fix-ldcbunnei2018-08-151-13/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Several fixes for indirect constant buffer loads.
| * | | | | | | | gl_shader_decompiler: Several fixes for indirect constant buffer loads.bunnei2018-08-151-13/+22
| |/ / / / / / /
* | | | | | | | Merge pull request #1068 from bunnei/g8r8sbunnei2018-08-152-34/+49
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | gl_rasterizer_cache: Implement G8R8S format.
| * | | | | | | gl_rasterizer_cache: Implement G8R8S format.bunnei2018-08-152-34/+49
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | Merge pull request #1067 from lioncash/initbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | emu_window: Ensure WindowConfig members are always initialized
| * | | | | | | emu_window: Ensure WindowConfig members are always initializedLioncash2018-08-151-3/+3
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we weren't always initializing all members of the struct. Prevents potentially wonky behavior from occurring.
* | | | | | | Merge pull request #1073 from lioncash/3dsbunnei2018-08-156-17/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | loader: Remove address mapping remnants from citra
| * | | | | | | loader: Remove address mapping remnants from citraLioncash2018-08-156-17/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | These mappings are leftovers from citra and don't apply to the Switch.
* | | | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/svc: Log svcBreak parameters
| * | | | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given if we hit here all is lost, we should probably be logging the break reason code and associated information to distinguish between the causes.
* | | | | | | Merge pull request #1063 from lioncash/inlinebunnei2018-08-152-15/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/xbyak_abi: Mark defined functions in header as inline
| * | | | | | | common/xbyak_abi: Mark defined functions in header as inlineLioncash2018-08-151-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potential One Definition Rule violations when these are used in the future.
| * | | | | | | common/xbyak: Use nested namespace specifiers where applicableLioncash2018-08-152-8/+4
| |/ / / / / /
* | | | | | | Merge pull request #1074 from greggameplayer/Z16_UNORMbunnei2018-08-151-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement Z16 in PixelFormatFromTextureFormat function
| * | | | | | | Implement Z16_UNORM in PixelFormatFromTextureFormat functiongreggameplayer2018-08-151-0/+2
|/ / / / / / / | | | | | | | | | | | | | | Require by Zelda Breath Of The Wild
* | | | | | | Merge pull request #1054 from zhaowenlan1779/misc-fixupbunnei2018-08-151-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/misc: use windows.h
| * | | | | | | common/misc: use windows.hZhu PengFei2018-08-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | linux-mingw does not really like this.
* | | | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | mm_u: Move interface class into the cpp file
| * | | | | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures both variants go through the same interface, and while we're at it, add Finalize to provide the inverse of Initialize for consistency.
| * | | | | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now if changes are ever made to the behavior of the class, it doesn't involve rebuilding everything that includes the mm_u header.
* | | | | | | | | Merge pull request #1066 from lioncash/aarch64bunnei2018-08-151-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | CMakeLists: Add architecture detection for AArch64
| * | | | | | | | | CMakeLists: Add architecture detection for AArch64Lioncash2018-08-151-0/+2
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have an equivalent in place for the 32-bit ARM architecture, so we should also have one for the newer 64-bit ARM architecture as well.
* | | | | | | | | Merge pull request #1062 from lioncash/unusedbunnei2018-08-153-141/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | common: Remove unused old breakpoint source files
| * | | | | | | | common: Remove unused old breakpoint source filesLioncash2018-08-153-141/+0
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These currently aren't used and contain commented out source code that corresponds to Dolphin's JIT. Given our CPU code is organized quite differently, we shouldn't be keeping this around (at the moment it just adds to compile times marginally).
* | | | | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audout_u: Correct IAudioOut initializer list order
| * | | | | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Orders elements in the precise order they'll be initialized.
* | | | | | | | Merge pull request #1058 from greggameplayer/BC7U_Fixbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fix BC7U
| * | | | | | | | Fix BC7Ugreggameplayer2018-08-141-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #1050 from bunnei/rgba16-unormbunnei2018-08-144-37/+48
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UNORM.
| * | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UNORM.bunnei2018-08-144-37/+48
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1060 from lioncash/logJames Rowe2018-08-141-2/+3
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | logging/backend: Use const reference to refer to log filter
| * | | | | | | | logging/backend: Use const reference to refer to log filterLioncash2018-08-141-2/+3
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The filter is returned via const reference, so this was making a pointless copy of the entire filter every time a message was being pushed into the logger instance.
* | | | | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-146-0/+148
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Added missing channel devices
| * | | | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| | | | | | | |
| * | | | | | | Added missing channel devicesDavid Marcec2018-08-135-0/+144
| | | | | | | |
* | | | | | | | Merge pull request #1052 from ogniK5377/xenobunnei2018-08-134-7/+45
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implement RG32UI and R32UI
| * | | | | | | | Implement RG32UI and R32UIDavid Marcec2018-08-134-7/+45
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Needed for xenoblade
* | | | | | | | Merge pull request #1033 from MerryMage/interpbunnei2018-08-137-3/+267
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audio_core: Interpolate
| * | | | | | | | audio_renderer: samples_remaining counts frames, not samplesMerryMage2018-08-131-1/+1
| | | | | | | | |
| * | | | | | | | audio_core: InterpolateMerryMage2018-08-135-0/+121
| | | | | | | | |
| * | | | | | | | audio_core: Implement low-pass filterMerryMage2018-08-133-2/+145
| | | | | | | | |
* | | | | | | | | Merge pull request #1053 from MerryMage/rm-IsExecutingbunnei2018-08-131-3/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | arm_dynarmic: Remove IsExecuting check from PrepareReschedule
| * | | | | | | | | arm_dynarmic: Remove IsExecuting check from PrepareRescheduleMerryMage2018-08-131-3/+1
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | No longer required. HaltExecution is a no-op if it is not currently executing.
* | | | | | | | | Merge pull request #1049 from bunnei/vtx-size-8Mat M2018-08-131-0/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8.
| * | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8.bunnei2018-08-131-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1032 from lioncash/sanitizebunnei2018-08-131-10/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()
| * | | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()Lioncash2018-08-121-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously these were being unused (or partially unused). While we're at it, use better naming to make it visibly obvious which variant of the path is being used.
* | | | | | | | | | Merge pull request #1031 from lioncash/verbositybunnei2018-08-132-7/+7
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | card_image: Simplify return statement of GetSubdirectories()
| * | | | | | | | | | card_image: Use type aliases to shorten definitionsLioncash2018-08-122-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We have the aliases, so we may as well use 'em.
| * | | | | | | | | | card_image: Simplify return statement of GetSubdirectories()Lioncash2018-08-121-1/+1
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to write out the construction long-form, we can just let the language itself work it out off the return type.
* | | | | | | | | | Merge pull request #1048 from lioncash/atomicbunnei2018-08-132-8/+9
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | kernel/object: Tighten object against data races
| * | | | | | | | | kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Despite being covered by a global mutex, we should still ensure that the class handles its reference counts properly. This avoids potential shenanigans when it comes to data races. Given this is the root object that drives quite a bit of the kernel object hierarchy, ensuring we always have the correct behavior (and no races) is a good thing.
* | | | | | | | | | Merge pull request #1047 from bunnei/rgba16-uintbunnei2018-08-134-34/+45
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UINT.
| * | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UINT.bunnei2018-08-134-34/+45
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | | Merge pull request #1045 from bunnei/rg8-unormbunnei2018-08-134-26/+61
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RG8_UNORM.
| * | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RG8_UNORM.bunnei2018-08-134-26/+61
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1044 from bunnei/linestripbunnei2018-08-131-0/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::LineStrip.
| * | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::LineStrip.bunnei2018-08-131-0/+2
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | Merge pull request #1043 from Subv/timingbunnei2018-08-133-2/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Use an approximated amortized amount of ticks when advancing timing.
| * | | | | | | | CPU/Timing: Use an approximated amortized amount of ticks when advancing timing.Subv2018-08-132-1/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We divide the number of ticks to add by the number of cores (4) to obtain a more or less rough estimate of the actual number of ticks added. This assumes that all 4 cores are doing similar work. Previously we were adding ~4 times the number of ticks, thus making the games think that time was going way too fast. This lets us bypass certain hangs in some games like Breath of the Wild. We should modify our CoreTiming to support multiple cores (both running in a single thread, and in multiple host threads).
| * | | | | | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current core may have nothing to do with the core where the new thread was scheduled to run. In case it's the same core, then the following PrepareReshedule call will take care of that.
* | | | | | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-133-7/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | scheduler: Make HaveReadyThreads() a const member function
| * | | | | | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't modify instance state, so the const qualifier can be added to it.
| * | | | | | | | | thread_queue_list: Make contains() and get_first() const member functionsLioncash2018-08-121-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't directly modify the contained data.
| * | | | | | | | | thread_queue_list: Convert typedef to a type aliasLioncash2018-08-121-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-134-5/+13
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fixed a bunch of race conditions when running in multicore mode.
| * | | | | | | | | Core/HLE: Make the 'reschedule_pending' flag atomic.Subv2018-08-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread may write to this variable while the core in question is in the middle of checking for a reschedule request.
| * | | | | | | | | CPU/HLE: Lock the HLE mutex before performing a reschedule.Subv2018-08-131-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of an SVC, thus altering the state of the schedulers.
| * | | | | | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of a reschedule, thus altering the state of the schedulers.
| * | | | | | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-132-4/+4
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | WakeAfterDelay might be called from any host thread, so err on the side of caution and use the thread-safe CoreTiming::ScheduleEventThreadsafe. Note that CoreTiming is still far from thread-safe, there may be more things we have to work on for it to be up to par with what we want.
* | | | | | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.
| * | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Exit from AddMutexWaiter early if the thread is already waiting for a mutex owned by the owner thread. This accounts for the possibility of a thread that is waiting on a condition variable being awakened twice in a row. Also added more validation asserts. This should fix one of the random crashes in Breath Of The Wild.
* | | | | | | | | Merge pull request #1040 from bunnei/xmadbunnei2018-08-132-4/+120
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement XMAD instruction.
| * | | | | | | | | gl_shader_decompiler: Implement XMAD instruction.bunnei2018-08-132-4/+120
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1039 from lioncash/typebunnei2018-08-134-11/+17
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | vfs: Make type hierarchy objects classes instead of structs
| * | | | | | | | | vfs: Make VfsFilesystem constructor explicitLioncash2018-08-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it consistent with the other VFS interfaces and prevents implicit construction.
| * | | | | | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-124-10/+16
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | struct should be used when the data type is very simple or otherwise has no invariants associated with it. Given these are used to form a hierarchy, class should be used instead.
* | | | | | | | | Merge pull request #1025 from ogniK5377/bad-castbunnei2018-08-124-4/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fixed invalid cast in loader
| * | | | | | | | | made ResultStatus a u16David Marcec2018-08-123-3/+3
| | | | | | | | | |
| * | | | | | | | | Fixed invalid cast in loaderDavid Marcec2018-08-121-1/+1
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | GetMessageForResultStatus takes a u16, not a size_t.
* | | | | | | | | Merge pull request #1038 from MerryMage/lock-cubebbunnei2018-08-121-0/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | cubeb_sink: Protect queue with a mutex
| * | | | | | | | | cubeb_sink: Protect queue with a mutexMerryMage2018-08-121-0/+6
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | GetAudioDeviceServiceWithRevisionInfo (Used by Bloodstained: Curse of the Moon)
| * | | | | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | As we're not handling any anything about the revision data for GetAudioDeviceServiceWithRevisionInfo, it's currently marked as stubbed. However for games this shouldn't affect the result. Proper revision info would be more for homebrew.
* | | | | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-123-6/+42
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCount
| * | | | | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-122-5/+3
| | | | | | | | |
| * | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-123-6/+44
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | GetAudioRendererSampleRate is set as a "STUB" as a game could check if the sample rate it sent and the sample rate it wants don't match. Just a thought of something which could happen so keeping it as stub for the mean time
* | | | | | | | Merge pull request #1034 from lioncash/hidbunnei2018-08-121-5/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid: Stub DisconnectNpad()
| * | | | | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents clang-format from butchering them.
| * | | | | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | This is required by ARMS.
* | | | | | | | Merge pull request #1030 from bunnei/sdl2-2.0.8bunnei2018-08-121-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | externals: Update to SDL2-2.0.8.
| * | | | | | | | externals: Update to SDL2-2.0.8.bunnei2018-08-121-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1006 from degasus/stream_bufferbunnei2018-08-126-303/+176
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | GL renderer: Pick the streambuffer from citra and use them.
| * | | | | | | gl_rasterizer: Use a shared helper to upload from CPU memory.Markus Wick2018-08-122-28/+33
| | | | | | | |
| * | | | | | | gl_state: Don't track constant buffer mappings.Markus Wick2018-08-123-41/+3
| | | | | | | |
| * | | | | | | gl_rasterizer: Use the stream buffer for constant buffers.Markus Wick2018-08-124-29/+32
| | | | | | | |
| * | | | | | | gl_rasterizer: Use the streaming buffer itself for the constant buffer.Markus Wick2018-08-122-33/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Don't emut copies, especially not for data, which is used once. They just end in a huge GPU overhead.
| * | | | | | | gl_rasterizer: Use a helper for aligning the buffer.Markus Wick2018-08-122-15/+22
| | | | | | | |
| * | | | | | | Update the stream_buffer helper from Citra.Markus Wick2018-08-124-184/+98
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Please see https://github.com/citra-emu/citra/pull/3666 for more details.
* | | | | | | Merge pull request #1029 from bunnei/fix-out-attribbunnei2018-08-121-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Fix SetOutputAttributeToRegister empty check.
| * | | | | | gl_shader_decompiler: Fix SetOutputAttributeToRegister empty check.bunnei2018-08-121-2/+2
|/ / / / / /
* | | | | | Merge pull request #922 from lioncash/cmakebunnei2018-08-121-6/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | CMakeLists: Change MSVC14 variable to MSVC_VERSION
| * | | | | | CMakeLists: lowercase find_library usageLioncash2018-08-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The rest of the CMake script uses lowercase for commands (which is the general CMake style), making it more consistent with surrounding code.
| * | | | | | CMakeLists: Change MSVC14 variable to MSVC_VERSIONLioncash2018-08-121-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use of the MSVC14 variable is discouraged in the CMake documentation (which makes sense, since MSVC_VERSION is the more general appliable variable).
* | | | | | | Merge pull request #1026 from ogniK5377/retro-city-rampagebunnei2018-08-121-1/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Stub UpdateUserPresence
| * | | | | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Needed for Retro City Rampage to go in game
* | | | | | | Merge pull request #1027 from bunnei/fix-kilbunnei2018-08-121-0/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Fix GLSL compiler error with KIL instruction.
| * | | | | | gl_shader_decompiler: Fix GLSL compiler error with KIL instruction.bunnei2018-08-121-0/+8
|/ / / / / /
* | | | | | Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\ \ \ \ \ \ | | | | | | | | | | | | | | Several Friend service fixes
| * | | | | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Splatoon 2.
| * | | | | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| | | | | | |
| * | | | | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
| | | | | | |
* | | | | | | Merge pull request #1020 from lioncash/namespacebunnei2018-08-1214-22/+44
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Namespace EmuWindow
| * | | | | | | core: Namespace EmuWindowLioncash2018-08-1214-22/+44
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Gets the class out of the global namespace.
* | | | | | | Merge pull request #1021 from lioncash/warnbunnei2018-08-121-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer: Silence implicit truncation warning in SetupShaders()
| * | | | | | | gl_rasterizer: Silence implicit truncation warning in SetupShaders()Lioncash2018-08-121-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this would warn of truncating a std::size_t to a u32. This is safe because we'll obviously never have more than UINT32_MAX amount of uniform buffers.
* | | | | | | Merge pull request #1024 from Subv/blend_glbunnei2018-08-122-0/+40
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU/Maxwell3D: Implemented an alternative set of blend factors.
| * | | | | | | GPU/Maxwell3D: Implemented an alternative set of blend factors.Subv2018-08-122-0/+40
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | These are used by nouveau and some games like SMO.
* | | | | | | Merge pull request #1023 from Subv/invalid_attribsbunnei2018-08-122-1/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | RasterizerGL: Ignore invalid/unset vertex attributes.
| * | | | | | | RasterizerGL: Ignore invalid/unset vertex attributes.Subv2018-08-122-1/+11
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | This should make the es2gears example not crash anymore.
* / / / / / / Implement R8_UINT RenderTargetFormat & PixelFormat (#1014)greggameplayer2018-08-124-55/+74
|/ / / / / / | | | | | | | | | | | | | | | | | | - Used by Go Vacation
* | | | | | Merge pull request #1010 from bunnei/unk-vert-attrib-shaderbunnei2018-08-122-10/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Improve handling of unknown input/output attributes.
| * | | | | | gl_shader_decompiler: Improve handling of unknown input/output attributes.bunnei2018-08-122-10/+11
| | | | | | |
* | | | | | | Merge pull request #1009 from bunnei/rg8-rgba8-snormbunnei2018-08-124-64/+93
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement render target formats RGBA8_SNORM and RG8_SNORM.
| * | | | | | | gl_rasterizer: Implement render target format RG8_SNORM.bunnei2018-08-124-8/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
| * | | | | | | gl_rasterizer: Implement render target format RGBA8_SNORM.bunnei2018-08-124-64/+83
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1217-179/+248
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | loader: Add more descriptive errors
| * | | | | | game_list: Reorder error checksZach Hilman2018-08-101-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | clang-format fix
| * | | | | | loader: Add more descriptive errorsZach Hilman2018-08-1017-179/+249
| | | | | | | | | | | | | | | | | | | | | Full list of new errors and descriptions in core/loader/loader.h
* | | | | | | Merge pull request #1018 from Subv/ssy_syncbunnei2018-08-122-8/+38
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | GPU/Shader: Implemented SSY and SYNC as a set_target/jump pair.
| * | | | | | GPU/Shader: Don't predicate instructions that don't have a predicate field (SSY).Subv2018-08-112-2/+13
| | | | | | |
| * | | | | | GPU/Shaders: Implemented SSY and SYNC as a way to modify control flow during shader execution.Subv2018-08-111-6/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | SSY sets the target label to jump to when the SYNC instruction is executed.
* | | | | | | Merge pull request #1016 from lioncash/videobunnei2018-08-118-35/+44
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Get rid of global variable g_toggle_framelimit_enabled
| * | | | | | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-118-30/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we make a struct for renderer settings and allow the renderer to update all of these settings, getting rid of the need for global-scoped variables. This also uncovered a few indirect inclusions for certain headers, which this commit also fixes.
| * | | | | | | renderer_base: Remove unused kFramebuffer enumerationLioncash2018-08-111-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is entirely unused and can be removed.
| * | | | | | | video_core: Remove unused Renderer enumerationLioncash2018-08-111-2/+0
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Currently we only have an OpenGL renderer, so this is unused in code (and occupies the Renderer identifier in the VideoCore namespace).
* | | | | | | Merge pull request #1003 from lioncash/varbunnei2018-08-112-4/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Use variable template variants of type_traits interfaces where applicable
| * | | | | | | video_core: Use variable template variants of type_traits interfaces where applicableLioncash2018-08-102-4/+2
| | | | | | | |
* | | | | | | | Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats and more (R16_UNORM needed by Fate Extella) (#848)greggameplayer2018-08-114-19/+92
| |_|/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats Do a separate function in order to get Bytes Per Pixel of DepthFormat Apply the new function in gpu.h delete unneeded white space * correct merging error
* | | | | | | Merge pull request #1015 from lioncash/gamelistJames Rowe2018-08-111-13/+12
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | qt/gamelist: Minor cleanup-related changes
| * | | | | | qt/game_list: Resolve truncation warning within GameListItemPath's constructorLioncash2018-08-111-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences a warning about truncating from size_t to u32
| * | | | | | gt/game_list: Use std::array in GameListItemPath's data() functionLioncash2018-08-111-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to use a heap-allocated std::vector here, given we explicitly know the bounds.
| * | | | | | qt/game_list: Remove redundant base class constructor from initializer listLioncash2018-08-111-3/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | This is called automatically anyways.
* | | | | | Merge pull request #1007 from MerryMage/dynarmicbunnei2018-08-101-0/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | dynarmic: Update to 0118ee0
| * | | | | | dynarmic: Update to 0118ee0MerryMage2018-08-101-0/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | 0118ee0 emit_x64_vector: packusdw is SSE4.1
* | | | | | Merge pull request #1011 from bunnei/misc-vtx-fmtbunnei2018-08-101-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implements VertexAttributes Size_32_32_32 and Size_8_8.
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-101-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_32_32_32.bunnei2018-08-101-0/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | Merge pull request #1004 from lioncash/unusedbunnei2018-08-103-8/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()
| * | | | | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()Lioncash2018-08-103-8/+6
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1008 from yuzu-emu/revert-697-disable-depth-cullbunnei2018-08-101-3/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Revert "gl_state: Temporarily disable culling and depth test."
| * | | | | | Revert "gl_state: Temporarily disable culling and depth test."bunnei2018-08-101-3/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1002 from bunnei/refactor-tex-fmtbunnei2018-08-105-181/+31
|\ \ \ \ \ \ | |/ / / / / |/| | | | | textures: Refactor out for Texture/Depth FormatFromPixelFormat.
| * | | | | textures: Refactor out for Texture/Depth FormatFromPixelFormat.bunnei2018-08-105-181/+31
|/ / / / /
* | | | | Merge pull request #995 from bunnei/gl-buff-boundsbunnei2018-08-101-10/+12
|\ \ \ \ \ | |/ / / / |/| | | | gl_rasterizer_cache: Add bounds checking for gl_buffer copies.
| * | | | gl_rasterizer_cache: Add bounds checking for gl_buffer copies.bunnei2018-08-101-10/+12
| | | | |
* | | | | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \ \ \ \ | | | | | | | | | | | | core: Make function reference parameters const where applicable
| * | | | | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is simply copied by value, so there's no need to make it a modifiable reference. While we're at it, make the names of the parameters match its definition.
| * | | | | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't modify anything within the reference Thread instance.
* | | | | | Merge pull request #989 from lioncash/logbunnei2018-08-102-0/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/logging: Add missing service log categories
| * | | | | | common/logging: Add missing service log categoriesLioncash2018-08-082-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These weren't added when the services were introduced.
* | | | | | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing last
| * | | | | | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given elements inserted into a vector are zeroed out, we can just copy MAX_LEN - 1 elements and the data will already be properly null terminated.
| * | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current way were doing it would require copying a 768 character buffer (part of the Entry struct) to the new element in the vector. Given it's a plain array, std::move won't eliminate that. Instead, we can emplace an instance directly into the destination buffer and then fill it out, avoiding the need to perform any unnecessary copies. Given this is done in a loop, we can request the destination to allocate all of the necessary memory ahead of time, avoiding the need to potentially keep reallocating over and over on every few insertions into the vector.
* | | | | | | Merge pull request #1001 from lioncash/reservebunnei2018-08-101-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()
| * | | | | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()Lioncash2018-08-091-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially perfoming multiple reallocations when we know the total amount of memory we need beforehand.
* | | | | | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1021-129/+602
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | vfs: Add VfsFilesystem and fix RealVfs* implementations
| * | | | | | | vfs: Fix documentationZach Hilman2018-08-092-2/+4
| | | | | | | |
| * | | | | | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-092-4/+5
| | | | | | | |
| * | | | | | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-094-24/+37
| | | | | | | |
| * | | | | | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| | | | | | | |
| * | | | | | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| | | | | | | |
| * | | | | | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| | | | | | | |
| * | | | | | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-0912-22/+52
| | | | | | | |
| * | | | | | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| | | | | | | |
| * | | | | | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| | | | | | | |
| * | | | | | | file_util: Add platform-specific slash option to SanitizePathZach Hilman2018-08-092-5/+16
| | | | | | | |
| * | | | | | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| | | | | | | |
| * | | | | | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #991 from bunnei/ignore-macbunnei2018-08-101-4/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | maxwell_3d: Ignore macros that have not been uploaded yet.
| * | | | | | | | maxwell_3d: Ignore macros that have not been uploaded yet.bunnei2018-08-091-4/+9
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
* | | | | | | | Implement SNORM for BC5/DXN2 (#998)Khangaroo2018-08-102-38/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement BC5/DXN2 (#996) - Used by Kirby Star Allies. * Implement BC5/DXN2 SNORM UNORM for Kirby Star Allies SNORM for Super Mario Odyssey
* | | | | | | | Merge pull request #999 from lioncash/mapbunnei2018-08-101-2/+4
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | gl_rasterizer_cache: Avoid iterator invalidation issues within InvalidateRegion()
| * | | | | | | gl_rasterizer_cache: Avoid iterator invalidation issues within InvalidateRegion()Lioncash2018-08-091-2/+4
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | A range-based for loop can't be used when the container being iterated is also being erased from.
* | | | | | | Merge pull request #992 from bunnei/declr-predbunnei2018-08-091-4/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Declare predicates on use.
| * | | | | | | gl_shader_decompiler: Declare predicates on use.bunnei2018-08-091-4/+5
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (when going in game).
* | | | | | | Merge pull request #994 from lioncash/constbunnei2018-08-091-7/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer_cache: Use std::vector::assign vs resize() then copy for the non-tiled case
| * | | | | | | gl_rasterizer_cache: Invert conditional in LoadGLBuffer()Lioncash2018-08-091-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's generally easier to follow code using conditionals that operate in terms of the true case followed by the false case (no chance of overlooking the exclamation mark).
| * | | | | | | gl_rasterizer_cache: Use std::vector::assign in LoadGLBuffer() for the non-tiled caseLioncash2018-08-091-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | resize() causes the vector to expand and zero out the added members to the vector, however we can avoid this zeroing by using assign(). Given we have the pointer to the data we want to copy, we can calculate the end pointer and directly copy the range of data without the need to perform the resize() beforehand.
| * | | | | | | gl_rasterizer_cache: Make pointer const in LoadGLBuffer()Lioncash2018-08-091-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only ever read from, so we can make the data it's pointing to const.
* | | | | | | Merge pull request #993 from bunnei/smo-vtx-ptsbunnei2018-08-091-0/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement VertexAttribute::Size::Size_16_16_16_16 and PrimitiveTopology::Points.
| * | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_16_16_16_16.bunnei2018-08-091-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
| * | | | | | | maxwell_to_gl: Implement PrimitiveTopology::Points.bunnei2018-08-091-0/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
* | | | | | | Merge pull request #984 from bunnei/rt-nonebunnei2018-08-091-0/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer: Do not render when no render target is configured.
| * | | | | | | gl_rasterizer: Do not render when no render target is configured.bunnei2018-08-091-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | | Implement BC5/DXN2 (#996)Khangaroo2018-08-093-33/+45
| | | | | | | | | | | | | | | | | | | | | | | | - Used by Kirby Star Allies.
* | | | | | | | Merge pull request #988 from lioncash/colorbunnei2018-08-091-19/+31
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/color: Minor cleanup
| * | | | | | | | common/color: Remove unnecessary const qualifiers on return typesLioncash2018-08-081-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are just superfluous and not necessesary
| * | | | | | | | common/color: Get rid of undefined behaviorLioncash2018-08-081-12/+24
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of type punning via reinterpret_cast within functions. Instead, we use memcpy to transfer the contents across types.
* | | | | | | | Merge pull request #977 from bunnei/bgr565bunnei2018-08-092-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.
| * | | | | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.bunnei2018-08-082-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | | | Merge pull request #987 from lioncash/vecbunnei2018-08-091-3/+3
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | vector_math: Use variable template version of is_signed in Vec classes
| * | | | | | | | vector_math: Use variable template version of is_signed in Vec classesLioncash2018-08-081-3/+3
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Same behavior, less code
* | | | | | | | Merge pull request #982 from bunnei/stub-unk-63bunnei2018-08-092-0/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Stub input attribute Unknown_63.
| * | | | | | | | gl_shader_decompiler: Stub input attribute Unknown_63.bunnei2018-08-082-0/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Service/Account: stub LoadImage function
| * | | | | | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #976 from bunnei/shader-immbunnei2018-08-092-11/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Let OpenGL interpret floats.
| * | | | | | | gl_shader_decompiler: Let OpenGL interpret floats.bunnei2018-08-082-11/+6
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | - Accuracy is lost in translation to string, e.g. with NaN. - Needed for Super Mario Odyssey.
* | | | | | | Merge pull request #981 from bunnei/cbuf-corruptbunnei2018-08-094-3/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_3d: Use correct const buffer size and check bounds.
| * | | | | | | maxwell_3d: Use correct const buffer size and check bounds.bunnei2018-08-084-3/+12
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Fixes mem corruption with Super Mario Odyssey and Pokkén Tournament DX.
* | | | | | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.
| * | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| |/ / / / /
* | | | | | Merge pull request #985 from bunnei/rt-r11g11b10bunnei2018-08-091-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.
| * | | | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.bunnei2018-08-081-0/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | Merge pull request #979 from bunnei/vtx88bunnei2018-08-091-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-081-0/+1
| |/ / / / /
* | | | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | am: Stub SetScreenShotImageOrientation.
| * | | | | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | Merge pull request #980 from bunnei/fix-logsbunnei2018-08-082-2/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | renderer_opengl: Use trace log in a few places.
| * | | | | renderer_opengl: Use trace log in a few places.bunnei2018-08-082-2/+2
| |/ / / /
* | | | | Merge pull request #966 from lioncash/modernizebunnei2018-08-085-11/+11
|\ \ \ \ \ | | | | | | | | | | | | common: Convert type traits templates over to variable template versions where applicable
| * | | | | common: Convert type traits templates over to variable template versions where applicableLioncash2018-08-085-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | Uses the C++17 inline variable variants
* | | | | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0825-21/+491
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add Icons and Metadata Support
| * | | | | | configure_gamelist: Use explicit QVariant constructorZach Hilman2018-08-071-2/+4
| | | | | | |
| * | | | | | loader: Add icon and title support to XCIZach Hilman2018-08-077-5/+46
| | | | | | |
| * | | | | | Fix missing qjpeg DLLZach Hilman2018-08-072-0/+7
| | | | | | |
| * | | | | | Use const where applicableZach Hilman2018-08-074-7/+7
| | | | | | |
| * | | | | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-0718-19/+439
| | | | | | |
* | | | | | | Merge pull request #968 from lioncash/vecbunnei2018-08-081-180/+182
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vector_math: Minor cleanups
| * | | | | | | vector_math: Remove unimplemented function prototypesLioncash2018-08-081-23/+0
| | | | | | | |
| * | | | | | | vector_math: Make functions constexpr where applicableLioncash2018-08-081-154/+179
| | | | | | | |
| * | | | | | | vector_math: Convert typedefs to type aliasesLioncash2018-08-081-3/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #969 from lioncash/lz4bunnei2018-08-081-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals/CMakeLists: Add EXCLUDE_FROM_ALL to lz4's add_subdirectory() command
| * | | | | | | externals/CMakeLists: Add EXCLUDE_FROM_ALL to lz4's add_subdirectory() commandLioncash2018-08-081-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to build the lz4 CLI tool, or anything else. We just want to build in the library statically, so we specify this to ensure that. Now, we don't potentially build unnecessary targets.
* | | | | | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | nvdrv: Get rid of global std::weak_ptr
| * | | | | | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Rather than use global state, we can simply pass the instance into the NVFlinger instance directly.
* | | | | | | Merge pull request #972 from lioncash/catchbunnei2018-08-085-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals: Update catch to 2.3.0
| * | | | | | | externals: Update catch to 2.3.0Lioncash2018-08-085-4/+4
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Updates the library from 2.2.3 to 2.3.0
* | | | | | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hle: Remove unused romfs.cpp/.h
| * | | | | | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | These files are no longer used, so we can get rid of them.
* | | | | | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | acc: Add missing function table entries for GetUserCount
| * | | | | | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is stubbed within the common module in 5ac7b84, it should be added to the other relevant tables as well.
* | | | | | | | Merge pull request #983 from mailwl/hid-fixMat M2018-08-081-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | hid: fix IsSixAxisSensorAtRest() response
| * | | | | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / / / / / /
* | | | | | | acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
| | | | | | | | | | | | | | | | | | | | | - Used by Pokken Tournament DX.
* | | | | | | Merge pull request #967 from lioncash/signbunnei2018-08-081-4/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | file_util: Avoid sign-conversions in WriteArray() and ReadArray()
| * | | | | | file_util: Avoid sign-conversions in WriteArray() and ReadArray()Lioncash2018-08-071-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents compiler warnings.
* | | | | | | Merge pull request #971 from DarkLordZach/mbedtls-2.12.0bunnei2018-08-081-0/+0
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | externals/mbedtls: Update to mbedtls v2.12.0
| * | | | | | externals/mbedtls: Update to mbedtls v2.12.0Zach Hilman2018-08-081-0/+0
|/ / / / / /
* | | | | | Merge pull request #964 from Hexagon12/lower-logsbunnei2018-08-081-4/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Lowered down the logging for command processor methods
| * | | | | | Lowered down the logging for methodsHexagon122018-08-071-4/+4
| | | | | | |
* | | | | | | Fixed the sRGB pixel format (#963)Hexagon122018-08-081-1/+2
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Changed the sRGB pixel format return * Add a message about SRGBA -> RGBA conversion
* | | | | | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \ \ \ \ \ | | | | | | | | | | | | | | content_archive: Add support for titlekey cryptography
| * | | | | | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
| | | | | | |
* | | | | | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nvflinger: Correct typo in name of composition event
| * | | | | | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info array
| * | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Updated based off the information on Switch Brew.
* | | | | | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/apm: Add the apm:sys service
| * | | | | | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton of the apm:sys service based off the information on Switch Brew.
* | | | | | | Merge pull request #950 from lioncash/hotkeybunnei2018-08-078-119/+159
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt/hotkey: Get rid of global hotkey map instance
| * | | | | | | qt/hotkey: Get rid of global hotkey map instanceLioncash2018-08-078-119/+159
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we make a proper registry class and house it within the main window, then pass it to whatever needs access to the loaded hotkeys. This way, we avoid a global variable, and don't need to initialize a std::map instance before the program can do anything.
* | | | | | | Merge pull request #948 from hcorion/fix-mbedtls-installing-filesbunnei2018-08-072-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Make mbedtls and cubeb not install headers and libraries
| * | | | | | | Make mbedtls and cubeb not install headers and librariesZion Nimchuk2018-08-072-2/+2
| | | | | | | |
* | | | | | | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nvflinger: Use std::string_view in OpenDisplay()
| * | | | | | | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| | | | | | | | |
| * | | | | | | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to use a std::string here, given all that's done is comparing the character sequence against another. This allows passing regular const char* without needing to heap allocate.
* | | | | | | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()
| * | | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Updates the ID of these based off the information on Switch Brew.
* | | | | | | | Merge pull request #959 from KAMiKAZOW/cubeb-compilationbunnei2018-08-071-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Make building cubeb optional
| * | | | | | | | Make building cubeb optionalKAMiKAZOW2018-08-071-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | nvdrv: Get rid of indirect inclusions
| * | | | | | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The only reason this wasn't a compilation error is because we use little-endian systems.
| * | | | | | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ / / / / /
* | | | | | | Merge pull request #952 from lioncash/usbbunnei2018-08-076-0/+259
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: Add usb services
| * | | | | | | service: Add usb servicesLioncash2018-08-076-0/+259
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Adds basic skeleton for the usb services based off the information provided by Switch Brew.