summaryrefslogtreecommitdiffstats
path: root/src (follow)
Commit message (Collapse)AuthorAgeFilesLines
...
| * | | | | | | | configure_per_general: Mark UI strings as translatable in the constructorLioncash2018-12-261-2/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | These are user-facing strings, so they should be translatable.
* / / / / / / / configure_input_simple: Make input profile array constexprLioncash2018-12-261-12/+7
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Calling tr() from a file-scope array isn't advisable, since it can be executed before the Qt libraries are even fully initialized, which can lead to crashes. Instead, the translatable strings should be annotated, and the tr() function should be called at the string's usage site.
* | | | | | | Fixed shader linking error due to TLDS (#1934)David2018-12-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed shader linking error due to TLDS coord should be coords * Fix remaining coords
* | | | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-265-6/+77
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | svc: Implement SetThreadActivity (thread suspension)
| * | | | | | | debugger: Set paused thread colorLuke Street2018-12-041-1/+2
| | | | | | | |
| * | | | | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-045-6/+76
| | | | | | | |
* | | | | | | | shader_bytecode: Fixup TEXS.F16 encodingReinUsesLisp2018-12-261-1/+1
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #1886 from FearlessTobi/port-4164bunnei2018-12-2315-43/+228
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port citra-emu/citra#4164: "citra_qt, video_core: Screenshot functionality"
| * | | | | | | yuzu, video_core: Screenshot functionalityzhupengfei2018-12-1815-43/+228
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | Allows capturing screenshot at the current internal resolution (native for software renderer), but a setting is available to capture it in other resolutions. The screenshot is saved to a single PNG in the current layout.
* | | | | | | Merge pull request #1930 from lioncash/commonbunnei2018-12-231-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/quaternion: Ensure that w is always initialized
| * | | | | | | common/quaternion: Ensure that w is always initializedLioncash2018-12-211-1/+1
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Previously xyz was always being zero initialized due to its constructor, but w wasn't. Ensures that we always have a deterministic initial state.
* | | | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-2313-0/+466
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | am: Implement HLE profile selector applet
| * | | | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-035-14/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes bugs relating to signalling in software keyboard.
| * | | | | | | qt: Implement GUI dialog frontend for ProfileSelectorZach Hilman2018-12-036-0/+269
| | | | | | | | | | | | | | | | | | | | | | | | Presents profiles in a list, similar to switch.
| * | | | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| | | | | | | |
| * | | | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| | | | | | | | | | | | | | | | | | | | | | | | Allows the player to select an emulated profile.
| * | | | | | | qt: Register to use Qt ProfileSelector instead of defaultZach Hilman2018-12-031-0/+2
| | | | | | | |
| * | | | | | | core: Add getter/setter for ProfileSelector in SystemZach Hilman2018-12-032-0/+16
| | | | | | | |
| * | | | | | | frontend: Add frontend applet for ProfileSelectZach Hilman2018-12-033-0/+48
| | | | | | | | | | | | | | | | | | | | | | | | Responsible for selecting a profile and firing callback upon completion.
| * | | | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | Previously, ILibraryAppletAccessor would signal upon creation of any applet, but this is incorrect. A flag inside of the applet code determines whether or not creation should signal state change and swkbd happens to be one of these applets.
* | | | | | | | Merge pull request #1780 from DarkLordZach/controller-profilesbunnei2018-12-2312-66/+401
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | configure_input: Add Controller Setup Profiles and simplify input UI
| * | | | | | | configure_input_simple: Properly signal docked mode changeZach Hilman2018-12-053-33/+31
| | | | | | | |
| * | | | | | | configure_input: Add ConfigureInputSimple as default input UI configZach Hilman2018-12-058-1/+293
| | | | | | | | | | | | | | | | | | | | | | | | Greatly simplifies the current input UI, while still allowing power users to tweak advanced settings. Adds 'input profiles', which are easy autoconfigurations to make getting started easy and fast. Also has a custom option which brings up the current, full UI.
| * | | | | | | configure_input: Convert into QDialogZach Hilman2018-12-053-7/+47
| | | | | | | |
| * | | | | | | configure: Use ConfigureInputSimple for Input tabZach Hilman2018-12-051-26/+26
| | | | | | | |
| * | | | | | | ui_settings: Add UI setting for input profile indexZach Hilman2018-12-052-0/+5
| | | | | | | |
* | | | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-2114-3/+34
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed uninitialized memory due to missing returns in canary
| * | | | | | | | hopefully fix clang format issueDavid Marcec2018-12-191-0/+1
| | | | | | | | |
| * | | | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-1914-3/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Functions which are suppose to crash on non canary builds usually don't return anything which lead to uninitialized memory being used.
* | | | | | | | | Merge pull request #1920 from heapo/texture_format_selectionbunnei2018-12-211-1/+11
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Texture format fixes for RGBA16UI for copies and R16U when used as depth
| * | | | | | | | | Texture format fixes: Flag RGBA16UI as GL_RGBA_INTEGER format, and interpret R16U as Z16 when depth_compare is enabled.heapo2018-12-181-1/+11
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-217-28/+59
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/{process, thread}: Amend behavior related to IDs
| * | | | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a thread handle is passed to svcGetProcessId, the kernel attempts to access the process ID via the thread's instance's owning process. Technically, this function should also be handling the kernel debug objects as well, however we currently don't handle those kernel objects yet, so I've left a note via a comment about it to remind myself when implementing it in the future.
| * | | | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Starts the process ID counter off at 81, which is what the kernel itself checks against internally when creating processes. It's actually supposed to panic if the PID is less than 81 for a userland process.
| * | | | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The service call uses a 64-bit value, just like svcGetProcessId. This amends the function signature accordingly.
| * | | | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-194-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel uses a 64-bit value for the thread ID, so we shouldn't be using a 32-bit value.
| * | | | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcGetProcessId's out parameter is a pointer to a 64-bit value, not a 32-bit one.
| * | | | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the actual kernel, this is a 64-bit value, so we shouldn't be using a 32-bit type to handle it.
* | | | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | service/am: Unstub GetAppletResourceUserId
| * | | | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is supposed to return the current process' ID. (0 indicates an invalid ID for both process IDs and ARU IDs).
* | | | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Device handle should not be a random id, instead it's the current npad id
| * | | | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Found during hardware testing
* | | | | | | | | Merge pull request #1909 from heapo/shadow_sampling_fixesbunnei2018-12-191-16/+14
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix arrayed texture LOD selection and depth comparison ordering
| * | | | | | | | | Fix arrayed shadow sampler array slice/depth comparison ordering, as well as invalid GLSL LOD selection.heapo2018-12-171-16/+14
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | | service/sm: Improve debug log for RegisterService
| * | | | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now it also indicates the name and max session count. This also gives a name to the unknown bool. This indicates if the created port is supposed to be using light handles or regular handles internally. This is passed to the respective svcCreatePort parameter internally.
* | | | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | kernel/svc: Implement svcSetMemoryAttribute
| * | | | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all the basic backing functionality implemented, we can now unstub svcSetMemoryAttribute.
| * | | | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This puts the backing functionality for svcSetMemoryAttribute in place, which will be utilized in a following change.
| * | | | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| | | | | | | |
| * | | | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is shorter and more concise. This also removes the now-innaccurate comment, as it's not returned wholesale to svcQueryMemory anymore.
| * | | | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the barebones enumeration constants and functions in place to handle memory attributes, while also essentially leaving the attribute itself non-functional.
* | | | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/thread: Set default fpcr
| * | | | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1918 from MerryMage/cntfrqbunnei2018-12-181-0/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | arm_dynarmic: Set CNTFRQ value
| * | | | | | | | arm_dynarmic: Set CNTFRQ valueMerryMage2018-12-181-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1917 from ReinUsesLisp/fixup-halfbunnei2018-12-181-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader_bytecode: Fixup half float's operator B encoding
| * | | | | | | | shader_bytecode: Fixup half float's operator B encodingReinUsesLisp2018-12-181-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | applets: Correct usage of SignalStateChanged event
| * | | | | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | This was causing some games (most notably Pokemon Quest) to softlock due to an event being fired when not supposed to. This also removes a hack wherein we were firing the state changed event when the game retrieves it, which is incorrect.
* | | | | | | | Merge pull request #1903 from heapo/fmul_postfactorbunnei2018-12-182-5/+21
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Implement postfactor multiplication/division for fmul instructions
| * | | | | | | Implement postfactor multiplication/division for fmul instructionsheapo2018-12-172-5/+21
| | | | | | | |
* | | | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nvhost_gpu: Skip empty GPU command lists.
| * | | | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
| | | | | | | | |
* | | | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | Fix Service object leak on emulation stop
| * | | | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Services created with the ServiceFramework base class install themselves as HleHandlers with an owning shared_ptr in the ServerPort ServiceFrameworkBase::port member variable, creating a cyclic ownership between ServiceFrameworkBase and the ServerPort, preventing deletion of the service objects. Fix that by removing the ServiceFrameworkBase::port member because that was only used to detect multiple attempts at installing a port. Instead store a flag if the port was already installed to achieve the same functionality.
* | | | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-155-9/+181
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | svc: Implement yield types 0 and -1
| * | | | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| | | | | | | | |
| * | | | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | This will automatically occur anyway when PrepareReschedule is called
| * | | | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| | | | | | | | |
| * | | | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| | | | | | | | |
| * | | | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-226-79/+141
| | | | | | | | |
| * | | | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-196-2/+130
| | | | | | | | |
* | | | | | | | | Merge pull request #1902 from lioncash/audiobunnei2018-12-157-36/+58
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | audio_core: Make g_sink_details internally linked
| * | | | | | | | audio_core: Make g_sink_details internally linkedLioncash2018-12-137-36/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can hide the direct array from external view and instead provide functions to retrieve the necessary info. This has the benefit of completely hiding the makeup of the SinkDetails structure from the rest of the code. Given that this makes the array hidden, we can also make the array constexpr by altering the members slightly. This gets rid of several static constructor calls related to std::vector and std::function. Now we don't have heap allocations here that need to occur before the program can even enter main(). It also has the benefit of saving a little bit of heap space, but this doesn't matter too much, since the savings in that regard are pretty tiny.
* | | | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vm_manager/svc: Modify MemoryState enum, and correct error handling for svcQueryMemory
| * | | | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcQueryProcessMemory is trivial to implement, given all the behavior necessary for it is present, it just needs a handler for it.
| * | | | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the previous change, the memory writing was moved into the service function itself, however it still had a problem, in that the entire MemoryInfo structure wasn't being written out, only the first 32 bytes of it were being written out. We still need to write out the trailing two reference count members and zero out the padding bits. Not doing this can result in wrong behavior in userland code in the following scenario: MemoryInfo info; // Put on the stack, not quaranteed to be zeroed out. svcQueryMemory(&info, ...); if (info.device_refcount == ...) // Whoops, uninitialized read. This can also cause the wrong thing to happen if the user code uses std::memcmp to compare the struct, with another one (questionable, but allowed), as the padding bits are not guaranteed to be a deterministic value. Note that the kernel itself also fully zeroes out the structure before writing it out including the padding bits.
| * | | | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Moves the memory writes directly into QueryProcessMemory instead of letting the wrapper function do it. It would be inaccurate to allow the handler to do it because there's cases where memory shouldn't even be written to. For example, if the given process handle is invalid. HOWEVER, if the memory writing is within the wrapper, then we have no control over if these memory writes occur, meaning in an error case, 68 bytes of memory randomly get trashed with zeroes, 64 of those being written to wherever the memory info address points to, and the remaining 4 being written wherever the page info address points to. One solution in this case would be to just conditionally check within the handler itself, but this is kind of smelly, given the handler shouldn't be performing conditional behavior itself, it's a behavior of the managed function. In other words, if you remove the handler from the equation entirely, does the function still retain its proper behavior? In this case, no. Now, we don't potentially trash memory from this function if an invalid query is performed.
| * | | | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These should be swapped.
| * | | | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel returns a memory info instance with the base address set to the end of the address space, and the size of said block as 0 - address_space_end, it doesn't set both of said members to zero.
| * | | | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to directly access the managed VMAs outside of the memory manager itself just for querying memory.
| * | | | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets the two structures out of an unrelated header and places them with the rest of the memory management code. This also corrects the structures. PageInfo appears to only contain a 32-bit flags member, and the extra padding word in MemoryInfo isn't necessary.
| * | | | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends the MemoryState enum to use the same values like the actual kernel does. Also provides the necessary operators to operate on them. This will be necessary in the future for implementing svcSetMemoryAttribute, as memory block state is checked before applying the attribute.
* | | | | | | | | Merge pull request #1871 from lioncash/movebunnei2018-12-142-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu/wait_tree: Pass QString by value and std::move in the initializer list for WaitTreeText
| * | | | | | | | | yuzu/wait_tree: Pass QString by value and std::move in the initializer list for WaitTreeTextLioncash2018-12-062-2/+2
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Just a trivial modernization that potentially avoids copying strings in certain scenarios.
* | | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | svc_wrap: Correct register index for a wrapper specialization
| * | | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This would result in svcSetMemoryAttribute getting the wrong value for its third parameter. This is currently fine, given the service function is stubbed, however this will be unstubbed in a future change, so this needs to change.
* | | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Process object kept itself alive indefinitely because its handle_table contains a SharedMemory object which owns a reference to the same Process object, creating a circular ownership scenario. Break that up by storing only a non-owning pointer in the SharedMemory object.
* | | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | fsp_srv: Implement IStorage::GetSize
| * | | | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Takes no input and returns the size as a u64. Needed by Katamari Damacy Reroll to boot.
* | | | | | | | Merge pull request #1893 from lioncash/warnbunnei2018-12-121-3/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_cache: Resolve truncation compiler warning
| * | | | | | | | gl_shader_cache: Dehardcode constant in CalculateProgramSize()Lioncash2018-12-111-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This constant is related to the size of the instruction.
| * | | | | | | | gl_shader_cache: Resolve truncation compiler warningLioncash2018-12-111-1/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous code would cause a warning, as it was truncating size_t (64-bit) to a u32 (32-bit) implicitly.
* | | | | | | | Merge pull request #1895 from lioncash/uninitbunnei2018-12-121-4/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFS
| * | | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFSLioncash2018-12-111-4/+3
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | fmt::format() returns a std::string instance by value, so calling .c_str() on it here is equivalent to doing: auto* ptr = std::string{}.c_str(); The data being pointed to isn't guaranteed to actually be valid anymore after that expression ends. Instead, we can just take the string as is, and provide the necessary formatting parameters.
* | | | | | | | Merge pull request #1877 from heapo/audio_interpbunnei2018-12-112-4/+8
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Perf: Avoid (expensive) audio interpolation when sample rates already match
| * | | | | | | | Avoid (expensive) audio interpolation when sample rates already matchheapo2018-12-062-4/+8
| | | | | | | | |
* | | | | | | | | Merge pull request #1888 from marcosvitali/glFrontFacingbunnei2018-12-111-1/+1
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | gl_shader_decompiler: IPA fix FrontFacing.
| * | | | | | | | gl_shader_decompiler: IPA FrontFacing: the right value when is the front face is 0xFFFFFFFF.Marcos Vitali2018-12-101-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #1846 from lioncash/dirbunnei2018-12-111-2/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | file_sys/directory: Amend path buffer size for directory entries
| * | | | | | | | | file_sys/directory: Amend path buffer size for directory entriesLioncash2018-12-031-2/+2
| | |_|_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The path buffer is actually 0x301 (769) characters in length, with the extra character being intended for the null-terminator.
* | | | | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-1123-15/+691
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | patch_manager: Add support for disabling patches
| * | | | | | | | | qt: Add Properties menu to game list right-clickZach Hilman2018-12-049-22/+54
| | | | | | | | | |
| * | | | | | | | | qt: Add UI to display game properties and disable add-onsZach Hilman2018-12-034-0/+501
| | | | | | | | | |
| * | | | | | | | | loader: Add support for reading the name of game's developerZach Hilman2018-12-035-0/+26
| | | | | | | | | |
| * | | | | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| | | | | | | | | |
| * | | | | | | | | patch_manager: Obey disabled add-ons list when patching gameZach Hilman2018-12-032-11/+50
| | | | | | | | | |
| * | | | | | | | | core: Make GetGameFileFromPath function externally accessibleZach Hilman2018-12-032-3/+9
| | | | | | | | | |
| * | | | | | | | | config: Store and load disabled add-ons listZach Hilman2018-12-033-0/+55
| | | | | | | | | |
| * | | | | | | | | settings: Store list of disabled add-ons per title IDZach Hilman2018-12-031-0/+5
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #1887 from FearlessTobi/port-4476bunnei2018-12-111-8/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4476: "web_service: move telemetry condition from TelemetrySession constructor to destructor"
| * | | | | | | | | web_service: move telemetry condition from TelemetrySession constructor to destructorfearlessTobi2018-12-081-8/+4
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Fixes an issue where Testcases couldn't be sent when Telemetry was disabled, because both things are tied closely together in the backend.
* | | | | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()
| * | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, the backing code only ever seems to use 0-2 as the range of values 1 being a generic log enable, with 2 indicating logging should go to the SD card. These are used as a set of flags internally. Given we only care about receiving the log in general, we can just always signify that we want logging in general.
* | | | | | | | | | Merge pull request #1885 from lioncash/data_idbunnei2018-12-111-1/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enum
| * | | | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enumLioncash2018-12-081-1/+3
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends it with missing values deduced from RE (ProperSystem being from SwitchBrew for naming) (SdCardUser wasn't that difficult to discern given it's used alongside SdCardSystem when creating the save data indexer, based off the usage of the string "saveDataIxrDbSd" nearby).
* | | | | | | | | | Merge pull request #1740 from FernandoS27/shader_propsbunnei2018-12-104-0/+57
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Implemented Shader Unique Identifiers
| * | | | | | | | | | Implemented a shader unique identifier.Fernando Sahmkow2018-12-094-0/+57
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/process: Set ideal core from metadata
| * | | | | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
| | |_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A very trivial change. If metadata is available, the process should use it to retrieve the desired core for the process to run on.
* | | | | | | | | | Merge pull request #1880 from DarkLordZach/cache-storageHexagon122018-12-101-1/+7
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | savedata_factory: Add CacheStorage and delete TemporaryStorage on boot
| * | | | | | | | | | savedata_factory: Add support for CacheStorageZach Hilman2018-12-071-0/+2
| | | | | | | | | | |
| * | | | | | | | | | savedata_factory: Delete TemporaryStorage on startupZach Hilman2018-12-071-1/+5
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Mimics hardware behavior.
* | | | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-105-28/+41
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | vm_manager: Make vma_map private
| * | | | | | | | | | memory: Convert ASSERT into a DEBUG_ASSERT within GetPointerFromVMA()Lioncash2018-12-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given memory should always be expected to be valid during normal execution, this should be a debug assertion, rather than a check in regular builds.
| * | | | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-065-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was only ever public so that code could check whether or not a handle was valid or not. Instead of exposing the object directly and allowing external code to potentially mess with the map contents, we just provide a member function that allows checking whether or not a handle is valid. This makes all member variables of the VMManager class private except for the page table.
* | | | | | | | | | | Merge pull request #1862 from marcosvitali/tldsbunnei2018-12-101-106/+134
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | | gl_shader_decompiler: TLDS/TLD4/TLD4S Reworked reflecting the source registers, bugs fixed and modularize.
| * | | | | | | | | | gl_shader_decompiler: TLDS/TLD4/TLD4S Reworked reflecting the source registers, bugs fixed and modularize.Marcos Vitali2018-12-071-106/+134
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | service/ldr: Amend layouts of NRO and NRR headers
| * | | | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The first word is just a padding byte, it's not an actual entry instruction. Also renames the rest of the entries according to SwitchBrew.
| * | | | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The padding after the magic signature value should be 12 bytes rather than 28 bytes. The other 16 should be placed after the title ID pattern.
* | | | | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | hle/service, hle/sm: Minor cleanup
| * | | | | | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Combines the two into one, shortening the amount of code here.
| * | | | | | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only one usage of the specified objects made use of the lack of namespacing. Given the low usage, we can just remove these.
| * | | | | | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These auto-deduce the result based off its arguments, so there's no need to do that work for the compiler, plus, the function return value itself already indicates what we're returning.
| * | | | | | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| | |_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to keep the variables separate from their actual initialization spots.
* | | | | | | | | | | Merge pull request #1882 from FearlessTobi/backport-4418-fixbunnei2018-12-081-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Backport review comment from citra-emu/citra#4418
| * | | | | | | | | | | Backport review comment from citra-emu/citra#4418Tobias2018-12-071-2/+2
| | |_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Original reason: As Windows multi-byte character codec is unspecified while we always assume std::string uses UTF-8 in our code base, this can output gibberish when the string contains non-ASCII characters. ::OutputDebugStringW combined with Common::UTF8ToUTF16W is preferred here.
* | | | | | | | | | | Merge pull request #1873 from lioncash/constbunnei2018-12-0811-19/+25
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | loaders: Make GetFileType() a const qualified member function
| * | | | | | | | | | yuzu/game_list_worker: Don't retrieve the file type twice in AddFstEntriesToGameList()Lioncash2018-12-051-5/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similarly, here we can avoid doing unnecessary work twice by retrieving the file type only once and comparing it against relevant operands, avoiding potential unnecessary object construction/destruction.
| * | | | | | | | | | yuzu/game_list_worker: Don't retrieve file type and file type strings twice in MakeGameListEntry()Lioncash2018-12-051-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While GetFileType() is indeed a getter function, that doesn't mean it's a trivial function, given some case require reading from the data or constructing other objects in the background. Instead, only do necessary work once.
| * | | | | | | | | | loaders: Make GetFileType() a const qualified member functionLioncash2018-12-0510-10/+10
| | |_|/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | No implementations actually modify instance state (and it would be questionable to do that in the first place given the name), so we can make this a const member function.
* | | | | | | | | | Merge pull request #1868 from lioncash/configbunnei2018-12-061-43/+38
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | configuration/config: Use an intermediary variable for accessing players
| * | | | | | | | | | configuration/config: Use an intermediary variable for accessing playersLioncash2018-12-051-43/+38
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids typing the same long accessor just to retrieve player attributes.
* | | | | | | | | | Merge pull request #1875 from DarkLordZach/oss-ngword2bunnei2018-12-063-1/+41
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | system_archive: Implement open source NgWord2
| * | | | | | | | | | system_archive: Implement open source NgWord2Zach Hilman2018-12-063-1/+41
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | | kernel/svc: Correct behavior of svcResetSignal()
| * | | | | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While partially correct, this service call allows the retrieved event to be null, as it also uses the same handle to check if it was referring to a Process instance. The previous two changes put the necessary machinery in place to allow for this, so we can simply call those member functions here and be done with it.
| * | | | | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Process instances can be waited upon for state changes. This is also utilized by svcResetSignal, which will be modified in an upcoming change. This simply puts all of the WaitObject related machinery in place.
| * | | | | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcResetSignal relies on the event instance to have already been signaled before attempting to reset it. If this isn't the case, then an error code has to be returned.
* | | | | | | | | | Merge pull request #1824 from ReinUsesLisp/fbcachebunnei2018-12-062-40/+82
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Implement a framebuffer cache
| * | | | | | | | | | gl_rasterizer: Implement a framebuffer cacheReinUsesLisp2018-11-292-40/+82
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1863 from ReinUsesLisp/texs-f16bunnei2018-12-062-18/+55
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | gl_shader_decompiler: Implement TEXS.F16
| * | | | | | | | | | gl_shader_decompiler: Implement TEXS.F16ReinUsesLisp2018-12-052-13/+51
| | | | | | | | | | |
| * | | | | | | | | | gl_shader_decompiler: Fixup inverted ifReinUsesLisp2018-12-051-6/+5
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1867 from lioncash/allocbunnei2018-12-062-4/+3
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | system_archive: Use a regular function pointer instead of std::function for the file-scope system archive array
| * | | | | | | | | | ng_word: Deduplicate use of a constant valueLioncash2018-12-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We've already given the constant to the vector itself, so we don't need to re-hardcode it in the array.
| * | | | | | | | | | system_archive: Use a regular function pointer instead of std::function for file-scope system archive arrayLioncash2018-12-051-3/+2
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows the array to be constexpr. std::function is also allowed to allocate memory, which makes its constructor non-trivial, we definitely don't want to have all of these execute at runtime, taking up time before the application can actually load.
* | | | | | | | | | Merge pull request #1866 from lioncash/cachebunnei2018-12-061-8/+2
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()
| * | | | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | We don't need to specify all of the ARM interfaces explicitly.
* | | | | | | | | Call shrink_to_fit after page-table vector resizing to cause crt to actually lower vector capacity. For 36-bit titles saves 800MB of commit.heapo2018-12-051-0/+8
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #1859 from heapo/lut_array_codegenbunnei2018-12-051-275/+277
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Convert high-frequency LUT arrays from constexpr to static constexpr
| * | | | | | | Improve msvc codegen for hot-path array LUTsheapo2018-12-051-275/+277
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In some constexpr functions, msvc is building the LUT at runtime (pushing each element onto the stack) out of an abundance of caution. Moving the arrays into be file-scoped constexpr's avoids this and turns the functions into simple look-ups as intended.
* | | | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-058-1/+227
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys: Implement open source system archives
| * | | | | | | | file_sys: Implement system archive synthesizer for NgWord (806)Zach Hilman2018-11-235-6/+61
| | | | | | | | |
| * | | | | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| | | | | | | | |
| * | | | | | | | file_sys: Add framework for synthesizing open source archivesZach Hilman2018-11-163-0/+109
| | | | | | | | |
| * | | | | | | | vfs_vector: Add VFS backend for std::arrayZach Hilman2018-11-161-0/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows using constexpr/static const data with VFS.
* | | | | | | | | Merge pull request #1837 from lioncash/mapbunnei2018-12-051-59/+46
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | yuzu/game_list_worker: Minor cleanup and code deduplication
| * | | | | | | | yuzu/game_list_worker: Move std::string construction after the termination check in callbacksLioncash2018-12-051-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially allocating a std::string instance when it isn't needed.
| * | | | | | | | yuzu/game_list_worker: Deduplicate game list entry creationLioncash2018-12-021-47/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids duplicating the same code twice verbatim.
| * | | | | | | | yuzu/game_list_worker: Tidy up string handling in FillControlMap()Lioncash2018-12-021-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to call out to our own file handling functions when we're going to construct a QFileInfo instance right after it. We also don't need to convert to a std::string again just to compare the file extension.
* | | | | | | | | Merge pull request #1838 from lioncash/dedupbunnei2018-12-051-27/+26
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | file_sys/registered_cache: Eliminate variable shadowing
| * | | | | | | | | file_sys/registered_cache: Eliminate variable shadowingLioncash2018-12-021-27/+26
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also inverts if statements where applicable to allow unindenting code a little bit.
* | | | | | | | | Merge pull request #1836 from lioncash/unusedbunnei2018-12-051-1/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()
| * | | | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()Lioncash2018-12-021-1/+0
| |/ / / / / / / /
* | | | | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
| | | | | | | | |
* | | | | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function simply does a handle table lookup for a writable event instance identified by the given handle value. If a writable event cannot be found for the given handle, then an invalid handle error is returned. If a writable event is found, then it simply signals the event, as one would expect.
* | | | | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
| |_|/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | svcCreateEvent operates by creating both a readable and writable event and then attempts to add both to the current process' handle table. If adding either of the events to the handle table fails, then the relevant error from the handle table is returned. If adding the readable event after the writable event to the table fails, then the writable event is removed from the handle table and the relevant error from the handle table is returned. Note that since we do not currently test resource limits, we don't check the resource limit table yet.
* | | | | | | | Merge pull request #1845 from lioncash/nrobunnei2018-12-045-19/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | loader/{nro, nso}: Remove dependency on the System class
| * | | | | | | | loader/nso: Remove dependency on the System classLioncash2018-12-033-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to the NRO changes, we can also pass the process explicitly as a parameter from Load instead of indirecting through the System class.
| * | | | | | | | loader/nro: Make the static LoadNro function internally linkedLioncash2018-12-032-7/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This simply acts as a forwarding function for the Load() function, so this doesn't need to be directly exposed.
| * | | | | | | | loader/nro: Remove dependency on the System classLioncash2018-12-032-10/+13
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Load() is already given the process instance as a parameter, so instead of coupling the class to the System class, we can just forward that parameter to LoadNro()
* | | | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-046-11/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/object: Amend handle types to distinguish between readable and writable events
| * | | | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-046-11/+20
| | |_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Two kernel object should absolutely never have the same handle ID type. This can cause incorrect behavior when it comes to retrieving object types from the handle table. In this case it allows converting a WritableEvent into a ReadableEvent and vice-versa, which is undefined behavior, since the object types are not the same. This also corrects ClearEvent() to check both kernel types like the kernel itself does.
* | | | | | | | Rewrited TEX/TEXS (TEX Scalar). (#1826)Marcos2018-12-041-259/+177
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Rewrited TEX/TEXS (TEX Scalar). * Style fixes. * Styles issues.
* | | | | | | | Merge pull request #1857 from lioncash/res-infobunnei2018-12-045-11/+37
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/svc: Implement the resource limit svcGetInfo option
| * | | | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another hold-over from Citra.
| * | | | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows a process to register the resource limit as part of its handle table.
* | | | | | | | Merge pull request #1854 from Subv/old_command_processorbunnei2018-12-042-142/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Don't try to route PFIFO methods (0-0x40) to the other engines.
| * | | | | | | Removed unused file.Subv2018-12-041-142/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a leftover from #1792
| * | | | | | | GPU: Don't try to route PFIFO methods (0-0x40) to the other engines.Subv2018-12-041-0/+6
| | |/ / / / / | |/| | | | |
* | | | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
| | | | | | |
* | | | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categories
| * | | | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel uses the handle table of the current process to retrieve the process that should be used to retrieve certain information. To someone not familiar with the kernel, this might raise the question of "Ok, sounds nice, but doesn't this make it impossible to retrieve information about the current process?". No, it doesn't, because HandleTable instances in the kernel have the notion of a "pseudo-handle", where certain values allow the kernel to lookup objects outside of a given handle table. Currently, there's only a pseudo-handle for the current process (0xFFFF8001) and a pseudo-handle for the current thread (0xFFFF8000), so to retrieve the current process, one would just pass 0xFFFF8001 into svcGetInfo. The lookup itself in the handle table would be something like: template <typename T> T* Lookup(Handle handle) { if (handle == PSEUDO_HANDLE_CURRENT_PROCESS) { return CurrentProcess(); } if (handle == PSUEDO_HANDLE_CURRENT_THREAD) { return CurrentThread(); } return static_cast<T*>(&objects[handle]); } which, as is shown, allows accessing the current process or current thread, even if those two objects aren't actually within the HandleTable instance.
| * | | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Our implementation of svcGetInfo was slightly incorrect in that we weren't doing proper error checking everywhere. Instead, reorganize it to be similar to how the kernel seems to do it.
* | | | | | Merge pull request #1842 from lioncash/slotbunnei2018-12-039-14/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu/configuration: Minor clean-up related changes
| * | | | | | yuzu/configuration: Make slots private where applicableLioncash2018-12-025-7/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These slots are only ever attached to event handling mechanisms within the class itself, they're never used externally. Because of this, we can make the functions private. This also removes redundant usages of the private access specifier.
| * | | | | | yuzu/configuration: Add missing override specifiers to configuration-related classesLioncash2018-12-027-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves trivial compiler warnings.
| * | | | | | yuzu/configuration/configure_input: Default destructor in the cpp fileLioncash2018-12-022-0/+3
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous code could potentially be a compilation issue waiting to occur, given we forward declare the type for a std::unique_ptr. If the complete definition of the forward declared type isn't visible in a translation unit that the class is used in, then it would fail to compile. Defaulting the destructor in a cpp file ensures the std::unique_ptr's destructor is only invoked where its complete type is known.
* | | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-038-40/+26
|\ \ \ \ \ \ | | | | | | | | | | | | | | filesystem: De-globalize registered_cache_union
| * | | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-028-40/+26
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just return a new instance of this when it's requested. This only ever holds pointers to the existing registed caches, so it's not a large object. Plus, this also gets rid of the need to keep around a separate member function just to properly clear out the union. Gets rid of one of five globals in the filesystem code.
* | | | | | Merge pull request #1822 from ReinUsesLisp/glsl-scopebunnei2018-12-031-250/+213
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Introduce a scoped object and style changes
| * | | | | | gl_shader_decompiler: Remove texture temporal in TLD4ReinUsesLisp2018-11-291-3/+1
| | | | | | |
| * | | | | | gl_shader_decompiler: Flip negated if else statementReinUsesLisp2018-11-291-3/+3
| | | | | | |
| * | | | | | gl_shader_decompiler: Use GLSL scope on instructions unrelated to texturesReinUsesLisp2018-11-291-35/+10
| | | | | | |
| * | | | | | gl_shader_decompiler: Move texture code generation into lambdasReinUsesLisp2018-11-291-97/+78
| | | | | | |
| * | | | | | gl_shader_decompiler: Clean up texture instructionsReinUsesLisp2018-11-291-87/+56
| | | | | | |
| * | | | | | gl_shader_decompiler: Scope GLSL variables with a scoped objectReinUsesLisp2018-11-291-32/+72
| | | | | | |
* | | | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0337-247/+410
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: Divide Event into ReadableEvent and WritableEvent
| * | | | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| | | | | | | |
| * | | | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2932-317/+175
| | | | | | | |
| * | | | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2929-164/+287
| | | | | | | |
| * | | | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| | | | | | | |
| * | | | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used to store ReadableEvents of all events on the system.
| * | | | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-296-61/+210
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | More hardware accurate. On the actual system, there is a differentiation between the signaler and signalee, they form a client/server relationship much like ServerPort and ClientPort.
| * | | | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-035-5/+97
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/fsp_srv: Implement CleanDirectoryRecursively
| * | | | | | | file_sys: Override missing mutating functions to be stubbed out for ReadOnlyVfsDirectory by defaultLioncash2018-12-012-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that read only indeed means read only.
| * | | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-015-5/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the same behavior-wise as DeleteDirectoryRecursively, with the only difference being that it doesn't delete the top level directory in the hierarchy, so given: root_dir/ - some_dir/ - File.txt - OtherFile.txt The end result is just: root_dir/
* | | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/audio/audout_u: Amend constructor initialization list order
| * | | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the constructor initializer list the same way the members of the class are declared. Prevents -Wreorder warnings
* | | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed crash with SetNpadMode
| * | | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | fixed crash due to handheld
* | | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table for IClientEpSession based off information provided by SwitchBrew.
* | | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table according to information provided by SwitchBrew.
* | | | | | | Merge pull request #1827 from ReinUsesLisp/clip-and-shaderbunnei2018-12-025-13/+37
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer: Enable clip distances when set in register and in shader
| * | | | | | | gl_rasterizer: Enable clip distances when set in register and in shaderReinUsesLisp2018-11-295-13/+37
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1825 from ReinUsesLisp/shader-pipeline-cachebunnei2018-12-021-4/+17
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_manager: Update pipeline when programs have changed
| * | | | | | | gl_shader_manager: Update pipeline when programs have changedReinUsesLisp2018-11-291-4/+17
| |/ / / / / /
* | | | | | | Merge pull request #1795 from ReinUsesLisp/vc-cleanupbunnei2018-12-025-32/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Minor style changes
| * | | | | | | gl_rasterizer: Signal UNIMPLEMENTED when rt_separate_frag_data is not zeroReinUsesLisp2018-11-291-1/+1
| | | | | | | |
| * | | | | | | gl_rasterizer_cache: Use brackets for two-line single-expresion blocksReinUsesLisp2018-11-291-1/+2
| | | | | | | |
| * | | | | | | gl_rasterizer: Remove unused struct declarationsReinUsesLisp2018-11-291-14/+0
| | | | | | | |
| * | | | | | | gl_rasterizer: Remove extension booleansReinUsesLisp2018-11-294-16/+4
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1823 from bunnei/fix-surface-copybunnei2018-12-021-145/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer_cache: Fix several surface copy issues.
| * | | | | | | gl_rasterizer_cache: Update AccurateCopySurface to flush complete source surface.bunnei2018-11-301-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes issues with Breath of the Wild with use_accurate_gpu_emulation setting.
| * | | | | | | gl_rasterizer_cache: Remove BlitSurface and replace with more accurate copy.bunnei2018-11-291-144/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - BlitSurface with different texture targets is inherently broken. - When target is the same, we can just use FastCopySurface. - Fixes rendering issues with Breath of the Wild.
* | | | | | | Merge pull request #1832 from Simek/remove-game-list-borderbunnei2018-12-021-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | UI: Remove border from Game List
| * | | | | | | remove border from GameListBartosz Kaszubowski2018-11-301-0/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.
| * | | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Assert that it is not empty before using it in the DequeueBuffer wait callback.
* | | | | | | Fix debug buildLioncash2018-12-012-5/+3
| |/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | A non-existent parameter was left in some formatting calls (the logging macro for which only does anything meaningful on debug builds)
* | | | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This code was around prior to the introduction of PushEnum, so convert it over so we don't need to cast here.
* | | | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / / / / | | | | | | | | | | | | | | | This function simply converts a given index into a language code.
* | / / / configure_input: Amend clang-format discrepanciesLioncash2018-11-301-1/+1
| |/ / / |/| | |
* | | | Merge pull request #1768 from greggameplayer/patch-2bunnei2018-11-291-0/+4
|\ \ \ \ | | | | | | | | | | Uncheck automatically joycons docked when docked mode is enable
| * | | | correct clang-formatgreggameplayer2018-11-221-1/+1
| | | | |
| * | | | Automatically disable joycons dockedgreggameplayer2018-11-221-0/+4
| | | | | | | | | | | | | | | when docked mode is enable
* | | | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \ \ \ | |_|/ / / |/| | | | Changed logging to be "Log before execution", Added more error logging, all services/svc should now log on some level
| * | | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| | | | |
| * | | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| | | | |
| * | | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| | | | |
| * | | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| | | | |
| * | | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| | | | |
| * | | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| | | | |
| * | | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
| | | | |
* | | | | Merge pull request #1808 from Tinob/masterbunnei2018-11-283-15/+31
|\ \ \ \ \ | | | | | | | | | | | | Fix clip distance and viewport
| * | | | | remove viewport_transform_enabled as it seems to be inactive when valid transforms are used.Rodolfo Bogado2018-11-271-12/+5
| | | | | |
| * | | | | Add support for Clip Distance enabled registerRodolfo Bogado2018-11-273-3/+26
| | | | | |
* | | | | | Merge pull request #1786 from Tinob/DepthClampbunnei2018-11-285-10/+58
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add Depth Clamp Support
| * | | | | | Implement depth clampRodolfo Bogado2018-11-275-10/+58
| |/ / / / /
* | | | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | npad: Use NPadIdToIndex to prevent invalid array access
| * | | | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
| |/ / / / /
* | | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-2818-110/+365
|\ \ \ \ \ \ | | | | | | | | | | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.
| * | | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-283-13/+23
| | | | | | |
| * | | | | | gpu: Move command list profiling to DmaPusher::DispatchCalls.bunnei2018-11-282-5/+5
| | | | | | |
| * | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-2718-108/+353
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - More accurate impl., fixes Undertale (among other games).
* | | | | | | Merge pull request #1735 from FernandoS27/tex-spacingbunnei2018-11-288-36/+55
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Texture decoder: Implemented Tile Width Spacing
| * | | | | | | Implemented Tile Width SpacingFernandoS272018-11-268-36/+55
| | | | | | | |
* | | | | | | | Merge pull request #1814 from lioncash/ptrbunnei2018-11-283-33/+31
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()
| * | | | | | | | file_sys/registered_cache: Remove unused <map> includeLioncash2018-11-271-1/+0
| | | | | | | | |
| * | | | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()Lioncash2018-11-273-32/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These parameters don't need to utilize a shared lifecycle directly in the interface. Instead, the caller should provide a regular reference for the function to use. This also allows the type system to flag attempts to pass nullptr and makes it more generic, since it can now be used in contexts where a shared_ptr isn't being used (in other words, we don't constrain the usage of the interface to a particular mode of memory management).
* | | | | | | | | Merge pull request #1811 from lioncash/inputbunnei2018-11-286-94/+72
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | yuzu/input: Minor changes
| * | | | | | | | | yuzu/configure_input_player: Use std::size_t to represent the player index instead of u8Lioncash2018-11-272-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents compiler warnings related to truncation when invoking the dialog. It's also extremely suspect to use a u8 value here instead of a more general type to begin with.
| * | | | | | | | | yuzu/configure_input: Make CallConfigureDialog a non-member template functionLioncash2018-11-273-21/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't depend on any part of the private interface, so it can be made a non-member internal function.
| * | | | | | | | | yuzu/configure_input_player: Use a lambda expression instead of std::bindLioncash2018-11-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::bind is the pre-C++11 way of doing this.
| * | | | | | | | | yuzu/configure_input_player: Amend constructor initializer list orderLioncash2018-11-271-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the elements the way they would actually be initialized in. Resolves compiler warnings with gcc and clang
| * | | | | | | | | yuzu/configure_input: Remove unused function MoveGridElementLioncash2018-11-271-7/+0
| | | | | | | | | |
| * | | | | | | | | yuzu/configure_input*: Move data members after function declarationsLioncash2018-11-272-41/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The common pattern is to put the data members after the function interface where applicable.
| * | | | | | | | | yuzu/configure_input: Remove unnecessary includesLioncash2018-11-273-17/+3
| |/ / / / / / / /
* | | | | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
| | | | | | | | |
* | | | | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | profile_manager: Save and load ProfileData from disk
| * | | | | | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The ProfileData is a 0x80-sized structure that stores various pieces of miscellaneous data for the account.
* | | | | | | | | | Merge pull request #1812 from lioncash/nacpbunnei2018-11-271-7/+17
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)
| * | | | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)Lioncash2018-11-271-7/+17
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While we're at it, organize the array linearly, since clang formats the array elements quite wide length-wise with the addition of the missing 'u'. Technically also fixes patch lookup and icon lookup with Portuguese, though I doubt anyone has actually run into this issue.
* | | | | | | | | | gl_shader_decompiler: Fixup clip distance indexReinUsesLisp2018-11-271-1/+1
| | | | | | | | | |
* | | | | | | | | | gl_rasterizer: Fixup for #1723.Markus Wick2018-11-271-1/+1
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On invalidating the streaming buffer, we need to reupload all vertex buffers. But we don't need to reconfigure the vertex format. This was a (silly) misstake in #1723. Thanks at Rodrigo for discovering the issue. Fun fact, as configuring the vertex format also invalidate the vertex buffer, this misstake had no affect on the behavior.
* | | | | | | | | Merge pull request #1806 from ReinUsesLisp/morton-fixupbunnei2018-11-271-1/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | morton: Fixup compiler warning
| * | | | | | | | | morton: Fixup compiler warningReinUsesLisp2018-11-271-1/+2
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1804 from lioncash/castbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | gdbstub: Silence value truncation warning within FpuWrite()
| * | | | | | | | gdbstub: Silence value truncation warning within FpuWrite()Lioncash2018-11-271-1/+1
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this would cause an implicit truncation warning about assigning a u64 value to a u32 value without an explicit cast.
* | | | | | | | Merge pull request #1805 from lioncash/resourcebunnei2018-11-273-5/+130
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | svc: Implement svcCreateResourceLimit, svcGetResourceLimitCurrentValue(), svcGetResourceLimitLimitValue(), and svcSetResourceLimitLimitValue()
| * | | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The opposite of the getter functions, this function sets the limit value for a particular ResourceLimit resource category, with the restriction that the new limit value must be equal to or greater than the current resource value. If this is violated, then ERR_INVALID_STATE is returned. e.g. Assume: current[Events] = 10; limit[Events] = 20; a call to this service function lowering the limit value to 10 would be fine, however, attempting to lower it to 9 in this case would cause an invalid state error.
| * | | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This kernel service function is essentially the exact same as svcGetResourceLimitLimitValue(), with the only difference being that it retrieves the current value for a given resource category using the provided resource limit handle, rather than retrieving the limiting value of that resource limit instance. Given these are exactly the same and only differ on returned values, we can extract the existing code for svcGetResourceLimitLimitValue() to handle both values.
| * | | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This kernel service function retrieves the maximum allowable value for a provided resource category for a given resource limit instance. Given we already have the functionality added to the resource limit instance itself, it's sufficient to just hook it up. The error scenarios for this are: 1. If an invalid resource category type is provided, then ERR_INVALID_ENUM is returned. 2. If an invalid handle is provided, then ERR_INVALID_HANDLE is returned (bad thing goes in, bad thing goes out, as one would expect). If neither of the above error cases occur, then the out parameter is provided with the maximum limit value for the given category and success is returned.
| * | | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function simply creates a ResourceLimit instance and attempts to create a handle for it within the current process' handle table. If the kernal fails to either create the ResourceLimit instance or create a handle for the ResourceLimit instance, it returns a failure code (OUT_OF_RESOURCE, and HANDLE_TABLE_FULL respectively). Finally, it exits by providing the output parameter with the handle value for the ResourceLimit instance and returning that it was successful. Note: We do not return OUT_OF_RESOURCE because, if yuzu runs out of available memory, then new will currently throw. We *could* allocate the kernel instance with std::nothrow, however this would be inconsistent with how all other kernel objects are currently allocated.
* | | | | | | Merge pull request #1794 from Tinob/masterbunnei2018-11-272-8/+32
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Add support for viewport_transfom_enable register
| * | | | | | | Limit the amount of viewports tested for state changes only to the usable onesRodolfo Bogado2018-11-251-2/+10
| | | | | | | |
| * | | | | | | Add support for viewport_transfom_enable registerRodolfo Bogado2018-11-242-6/+22
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1723 from degasus/dirty_flagsbunnei2018-11-279-6/+60
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer: Skip VB upload if the state is clean.
| * | | | | | | gl_rasterizer: Skip VB upload if the state is clean.Markus Wick2018-11-179-6/+60
| | | | | | | |
* | | | | | | | GPU States: Implement Polygon Offset. This is used in SMO all the time. (#1784)Marcos2018-11-275-5/+107
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GPU States: Implement Polygon Offset. This is used in SMO all the time. * Clang Format fixes. * Initialize polygon_offset in the constructor.
* | | | | | | | Merge pull request #1713 from FernandoS27/bra-ccbunnei2018-11-271-4/+14
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implemented BRA CC conditional and FSET CC Setting
| * | | | | | | | Implemented BRA CC conditional and FSET CC SettingFernandoS272018-11-241-4/+14
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1798 from ReinUsesLisp/y-directionbunnei2018-11-275-16/+26
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | gl_shader_decompiler: Implement S2R's Y_DIRECTION
| * | | | | | | gl_shader_decompiler: Implement S2R's Y_DIRECTIONReinUsesLisp2018-11-255-16/+26
| |/ / / / / /
* | | | | | | Merge pull request #1763 from ReinUsesLisp/bfibunnei2018-11-262-0/+23
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement BFI_IMM_R
| * | | | | | | gl_shader_decompiler: Implement BFI_IMM_RReinUsesLisp2018-11-212-0/+23
| | | | | | | |
* | | | | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/sm: Take std::string by const reference in UnregisterService
| * | | | | | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to create a copy of the std::string instance (potentially allocating). The only reason RegisterService takes its argument by value is because it's std::moved internally.
* | | | | | | | Merge pull request #1760 from ReinUsesLisp/r2pbunnei2018-11-262-0/+42
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement R2P_IMM
| * | | | | | | | gl_shader_decompiler: Implement R2P_IMMReinUsesLisp2018-11-212-0/+42
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1782 from FernandoS27/dcbunnei2018-11-261-116/+188
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed Coordinate Encodings in TEX and TEXS instructions
| * | | | | | | | Fix Texture OverlappingFernandoS272018-11-241-43/+70
| | | | | | | | |
| * | | | | | | | Fix TEXS Instruction encodingsFernandoS272018-11-241-22/+48
| | | | | | | | |
| * | | | | | | | Fix one encoding in TEX InstructionFernandoS272018-11-241-3/+3
| | | | | | | | |
| * | | | | | | | Corrected inputs indexing in TEX instructionFernandoS272018-11-241-66/+85
| | | | | | | | |
* | | | | | | | | Merge pull request #1783 from ReinUsesLisp/clip-distancesbunnei2018-11-263-21/+58
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement clip distances
| * | | | | | | | | gl_shader_decompiler: Implement clip distancesReinUsesLisp2018-11-233-21/+58
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1796 from ReinUsesLisp/morton-movebunnei2018-11-266-345/+391
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | video_core: Move morton functions out of gl_rasterizer_cache
| * | | | | | | | | morton: Style changesReinUsesLisp2018-11-251-12/+12
| | | | | | | | | |
| * | | | | | | | | video_core: Move morton functions to their own fileReinUsesLisp2018-11-256-345/+391
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
| | | | | | | | |
* | | | | | | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.
| * | | | | | | | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | Merge pull request #1787 from bunnei/fix-gpu-mmbunnei2018-11-252-1/+9
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | memory_manager: Do not allow 0 to be a valid GPUVAddr.
| * | | | | | | | memory_manager: Do not allow 0 to be a valid GPUVAddr.bunnei2018-11-232-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes a bug with Undertale using 0 for a render target.
* | | | | | | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | sm: Implement RegisterService and UnregisterService
| * | | | | | | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are needed by Edizon to boot. They are used to see if a user is using SX OS, as SX OS registers a custom service called 'tx' and attempting to register a service of the same name lets the application know if it is present.
* | | | | | | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | filesystem: Clear registered union paths on factory creation
| * | | | | | | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1725 from FernandoS27/gl43bunnei2018-11-248-52/+17
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Update OpenGL's backend version from 3.3 to 4.3
| * | | | | | | | | | Removed pre 4.3 ARB extensionsFernandoS272018-11-217-48/+13
| | | | | | | | | | |
| * | | | | | | | | | Update OpenGL's backend version from 3.3 to 4.3FernandoS272018-11-213-4/+4
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1785 from Tinob/masterbunnei2018-11-245-28/+95
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Add support for clear_flags register
| * | | | | | | | | | | Add support for clear_flags registerRodolfo Bogado2018-11-245-28/+95
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1692 from Hedges/GDBCleanbunnei2018-11-241-37/+86
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | GDBStub Improvements
| * | | | | | | | | | | GDBStub improvements:Hedges2018-11-131-37/+86
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Add FPU support - Fix access to TLS Fix clang-format.
* | | | | | | | | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-243-60/+78
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Report resolution scaling support for vi and am
| * | | | | | | | | | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| | | | | | | | | | | | |
| * | | | | | | | | | | | Report resolution scaling support for vi and amDavid Marcec2018-11-163-60/+76
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Specifying an internal resolution in yuzu now will report the scaled changes to vi and am.
* | | | | | | | | | | | | Merge pull request #1747 from DarkLordZach/exefs-lfsbunnei2018-11-247-2/+65
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | patch_manager: Add support for applying LayeredFS patches to ExeFS
| * | | | | | | | | | | | | patch_manager: Show LayeredExeFS patch in add-ons columnZach Hilman2018-11-212-4/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The decision was made to name them LayeredExeFS instead of just LayeredFS to differentiate from normal RomFS-based mods. The name may be long/unweildy, but conveys the meaning well.
| * | | | | | | | | | | | | patch_manager: Apply LayeredExeFS patchesZach Hilman2018-11-201-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will scan the <mod>/exefs dir for all files and then layer those on top of the game's exefs and use this as the new exefs. This allows for overriding of the compressed NSOs or adding new files. This does use the same dir as IPS/IPSwitch patch, but since the loader will not look for those they are ignored.
| * | | | | | | | | | | | | settings: Add option to dump ExeFS of games upon launchZach Hilman2018-11-207-0/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When enabled, all exefs(es) will be copied to yuzu/dump/<title_id>/exefs.
* | | | | | | | | | | | | | Merge pull request #1769 from ReinUsesLisp/ccbunnei2018-11-242-70/+81
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | | gl_shader_decompiler: Rename cc to condition code and name internal flags
| * | | | | | | | | | | | | gl_shader_decompiler: Add a message for unimplemented cc generationReinUsesLisp2018-11-221-23/+46
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | gl_shader_decompiler: Rename internal flag stringsReinUsesLisp2018-11-221-15/+20
| | | | | | | | | | | | | |
| * | | | | | | | | | | | | gl_shader_decompiler: Rename control codes to condition codesReinUsesLisp2018-11-222-67/+50
| | |_|_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1744 from degasus/shader_cachebunnei2018-11-244-8/+24
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | shader_cache: Only lock covered instructions.
| * | | | | | | | | | | | | shader_cache: Only lock covered instructions.Markus Wick2018-11-204-8/+24
| | |_|_|_|/ / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1741 from lioncash/kbdbunnei2018-11-242-12/+11
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | | software_keyboard: Minor changes
| * | | | | | | | | | | | yuzu/applets/software_keyboard: Override accept() and reject() instead of providing own differently named member functionsLioncash2018-11-202-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses Qt's built-in interface instead of rolling our own separate one on top of it. This also fixes a bug in reject() where we were calling accept() instead of reject().
| * | | | | | | | | | | | yuzu/applets/software_keyboard: std::move std::function instances where applicableLioncash2018-11-201-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::function instances can potentially allocate. std::moveing them prevents an avoidable allocation in that case.
| * | | | | | | | | | | | yuzu/applets/software_keyboard: Make slots private functionsLioncash2018-11-201-2/+1
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These aren't required to be public.
* | | | | | | | | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-234-4/+102
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | applets: Add StubApplet and use it as fallback when AppletId is not implemented
| * | | | | | | | | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| | | | | | | | | | | | |
| * | | | | | | | | | | | applets: Add StubAppletZach Hilman2018-11-223-0/+98
| | |/ / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will log all data it receives, log all calls to its methods and push dummy data into both channels on execution.
* | | | | | | | | | | | Merge pull request #1777 from lioncash/core-mgrbunnei2018-11-234-97/+225
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | core: Relocate CPU core management to its own class
| * | | | | | | | | | | | core: Relocate CPU core management to its own classLioncash2018-11-224-97/+225
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the CPU-specific behavior from being spread throughout the main System class. This will also act as the home to contain member functions that perform operations on all cores. The reason for this being that the following pattern is sort of prevalent throughout sections of the codebase: If clearing the instruction cache for all 4 cores is necessary: Core::System::GetInstance().ArmInterface(0).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(1).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(2).ClearInstructionCache(); Core::System::GetInstance().ArmInterface(3).ClearInstructionCache(); This is kind of... well, silly to copy around whenever it's needed. especially when it can be reduced down to a single line. This change also puts the basics in place to begin "ungrafting" all of the forwarding member functions from the System class that are used to access CPU state or invoke CPU-specific behavior. As such, this change itself makes no changes to the direct external interface of System. This will be covered by another changeset.
* | | | | | | | | | | | | Merge pull request #1773 from lioncash/threadbunnei2018-11-232-41/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | common/thread: Minor cleanup
| * | | | | | | | | | | | | common/thread: Drop Hungarian notation on SetCurrentThreadName's parameterLioncash2018-11-221-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is inconsistent with our coding style.
| * | | | | | | | | | | | | common/thread: Make Barrier's 'count' member non-constLioncash2018-11-221-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While admirable as a means to ensure immutability, this has the unfortunate downside of making the class non-movable. std::move cannot actually perform a move operation if the provided operand has const data members (std::move acts as an operation to "slide" resources out of an object instance). Given Barrier contains move-only types such as std::mutex, this can lead to confusing error messages if an object ever contained a Barrier instance and said object was attempted to be moved.
| * | | | | | | | | | | | | common/thread: Initialize class member variables where applicableLioncash2018-11-221-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the constructor interfaces for Barrier and Event classes.
| * | | | | | | | | | | | | common/thread: Group non-member functions togetherLioncash2018-11-221-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the non-member interface in one spot instead of split into two places, making it nicer to locate functions.
| * | | | | | | | | | | | | common/thread: Remove SleepCurrentThread()Lioncash2018-11-222-12/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is also unused and superceded by standard functionality. The standard library provides std::this_thread::sleep_for(), which provides a much more flexible interface, as different time units can be used with it.
| * | | | | | | | | | | | | common/thread: Remove unused CurrentThreadId()Lioncash2018-11-222-12/+0
| | |/ / / / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is an old function that's no longer necessary. C++11 introduced proper threading support to the language and a thread ID can be retrieved via std::this_thread::get_id() if it's ever needed.
* | | | | | | | | | | | | Added predicate comparison LessEqualWithNan (#1736)Hexagon122018-11-232-5/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added predicate comparison LessEqualWithNan * oops * Clang fix
* | | | | | | | | | | | | Merge pull request #1756 from ReinUsesLisp/fix-texturesbunnei2018-11-231-60/+78
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Fix register overwriting on texture calls
| * | | | | | | | | | | | | gl_shader_decompiler: Fix register overwriting on texture callsReinUsesLisp2018-11-221-60/+78
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #1766 from FernandoS27/fix-txqbunnei2018-11-231-2/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | Properly Implemented TXQ Instruction
| * | | | | | | | | | | | | Properly Implemented TXQ InstructionFernandoS272018-11-211-2/+12
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.
| * | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
| |_|_|_|_|_|_|_|_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents memory exceptions when the debug pad is enabled.
* | | | | | | | | | | | | Merge pull request #1775 from bunnei/blend-eqbunnei2018-11-222-0/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | maxwell_3d: Implement alternate blend equations.
| * | | | | | | | | | | | | maxwell_3d: Implement alternate blend equations.bunnei2018-11-222-0/+12
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | | | audout_u: Add support for multiple IAudioOut streams.
| * | | | | | | | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | | | | Merge pull request #1764 from bunnei/macrointerpreterbunnei2018-11-222-8/+25
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / |/| | | | | | | | | | | | macro_interpreter: Implement AddWithCarry and SubtractWithBorrow.
| * | | | | | | | | | | | macro_interpreter: Implement AddWithCarry and SubtractWithBorrow.bunnei2018-11-222-8/+25
| |/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | | | | | | Merge pull request #1737 from FernandoS27/layer-copybunnei2018-11-222-2/+30
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | Implemented Fast Layered Copy
| * | | | | | | | | | | | Implemented Fast Layered CopyFernandoS272018-11-202-2/+30
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1771 from lioncash/bit-setbunnei2018-11-222-245/+0
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | common: Remove bit_set.h
| * | | | | | | | | | | | common: Remove bit_set.hLioncash2018-11-222-245/+0
| | |_|_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is an analog of BitSet from Dolphin that was introduced to allow iterating over a set of bits. Given it's currently unused, and given that std::bitset exists, we can remove this. If it's ever needed in the future it can be brought back.
* | | | | | | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | | kernel/handle_table: Minor changes
| * | | | | | | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't depend on class state, and are effectively implementation details, so they can go into the cpp file .
| * | | | | | | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous handle table size is a holdover from Citra. The actual handle table construct on Horizon only allows for a maximum of 1024 entries.
| * | | | | | | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to potentially inline the teardown logic of all of the handle instances.
* | | | | | | | | | | Merge pull request #1753 from FernandoS27/ufbtypebunnei2018-11-212-0/+8
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Use default values for unknown framebuffer pixel format
| * | | | | | | | | | | Use default values for unknown framebuffer pixel formatFernandoS272018-11-212-0/+8
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1752 from ReinUsesLisp/unimpl-decompilerbunnei2018-11-211-371/+258
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Use UNIMPLEMENTED when applicable
| * | | | | | | | | | | gl_shader_decompiler: Use UNIMPLEMENTED instead of LOG+UNREACHABLE when applicableReinUsesLisp2018-11-211-371/+258
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | | am/applets: Minor cleanup
| * | | | | | | | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The accessor should be doing just that, accessing, rather than retaining the lifetime of the data broker as well.
| * | | | | | | | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also resolve places where includes should have been provided, but weren't.
| * | | | | | | | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
| | |/ / / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids wonky wrapping and makes it nicer to read.
* | | | | | | | | | | Merge pull request #1754 from ReinUsesLisp/zero-registerbunnei2018-11-211-2/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Remove UNREACHABLE when setting RZ
| * | | | | | | | | | | gl_shader_decompiler: Remove UNREACHABLE when setting RZReinUsesLisp2018-11-211-2/+1
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1758 from lioncash/rectbunnei2018-11-211-11/+5
|\ \ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | | | common/math_util: Minor cleanup
| * | | | | | | | | | | | common/math_util: Simplify std::make_signed usages to std::make_signed_tLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to use typename to access the ::type alias.
| * | | | | | | | | | | | common/math_util: Make Rectangle's constructors constexprLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows objects that contain rectangle instances to be constexpr constructible as well.
| * | | | | | | | | | | | common/math_util: Remove unnecessary static from PILioncash2018-11-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | const/constexpr variables have internal linkage by default.
| * | | | | | | | | | | | common/math_util: Remove unused IntervalsIntersect() functionLioncash2018-11-211-6/+0
| | |_|_|/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This hasn't been used since the project started, so we may as well get rid of it to keep it from bit rotting.
* / | | | | | | | | | | common: Remove dependency on xbyakLioncash2018-11-213-274/+0
|/ / / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Xbyak is currently entirely unused. Rather than carting it along, remove it and get rid of a dependency. If it's ever needed in the future, then it can be re-added (and likely be more up to date at that point in time).
* | | | | | | | | | | Merge pull request #1751 from bunnei/color-mask-fixbunnei2018-11-211-0/+9
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | | maxwell_3d: Initialize rasterizer color mask registers as enabled.
| * | | | | | | | | | maxwell_3d: Initialize rasterizer color mask registers as enabled.bunnei2018-11-211-0/+9
| | |/ / / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes rendering regression with Sonic Mania.
* / | | | | | | | | am: Correct build failureLioncash2018-11-211-2/+2
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The interface for shared memory was changed, but another commit was merged that relied on the (previously public) internals of SharedMemory. This amends that discrepancy.
* | | | | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/shared_memory: Make data members private, plus minor interface changes
| * | | | | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Both member functions assume the passed in target process will not be null. Instead of making this assumption implicit, we can change the functions to be references and enforce this at the type-system level.
| * | | | | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this doesn't mutate instance state, we can provide a const-qualified variant as well.
| * | | | | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the interface consistent with the regular Create() function.
| * | | | | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the interface nicer to use in terms of 64-bit code, as it makes it less likely for one to get truncation warnings (and also makes sense in the context of the rest of the interface where 64-bit types are used for sizes and offsets
| * | | | | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than allow unfettered access to the class internals, we hide all members by default and create and API that other code can operate against.
* | | | | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | ldr: Clean up error codes
| * | | | | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The separate enum isn't particularly necessary here, and the values can just be directly put into the ResultCode instances, given the names are also self-documenting here.
* | | | | | | | | Merge pull request #1746 from lioncash/randombunnei2018-11-212-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/process: Move <random> include to the cpp file
| * | | | | | | | | kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | <random> isn't necesary directly within the header and can be placed in the cpp file where its needed. Avoids propagating random generation utilities via a header file.
* | | | | | | | | Merge pull request #1748 from lioncash/assertbunnei2018-11-211-1/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | common/assert: Make the UNIMPLEMENTED macro properly assert
| * | | | | | | | | common/assert: Add UNIMPLEMENTED_IF and UNIMPLEMENTED_IF_MSG for conditional assertionsLioncash2018-11-211-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, there's no way to specify if an assertion should conditionally occur due to unimplemented behavior. This is useful when something is only partially implemented (e.g. due to ongoing RE work). In particular, this would be useful within the graphics code. The rationale behind this is it allows a dev to disable unimplemented feature assertions (which can occur in an unrelated work area), while still enabling regular assertions, which act as behavior guards for conditions or states which must not occur. Previously, the only way a dev could temporarily disable asserts, was to disable the regular assertion macros, which has the downside of also disabling, well, the regular assertions which hold more sanitizing value, as opposed to unimplemented feature assertions.
| * | | | | | | | | common/assert: Make the UNIMPLEMENTED macro properly assertLioncash2018-11-201-1/+1
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, this was only performing a logging call, which doesn't actually invoke any assertion behavior. This is unlike UNIMPLEMENTED_MSG, which *does* assert. This makes the expected behavior uniform across both macros.
* / / / / / / / / file_sys/card_image: Provide named members for the GamecardInfo structLioncash2018-11-211-1/+12
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Fills out the struct according to information provided by SwitchBrew
* | | | | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-2019-106/+1133
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | am: Implement HLE software keyboard applet
| * | | | | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| | | | | | | | |
| * | | | | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| | | | | | | | |
| * | | | | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This cleans up most of the callbacks and such in the Applets::Applet interface, while also properly implementing all four data channels.
| * | | | | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| | | | | | | | |
| * | | | | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| | | | | | | | |
| * | | | | | | | software_keyboard: Add max and current length display to dialogZach Hilman2018-11-182-1/+11
| | | | | | | | |
| * | | | | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| | | | | | | | |
| * | | | | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| | | | | | | | |
| * | | | | | | | applet: Add operation completed callbackZach Hilman2018-11-188-9/+34
| | | | | | | | |
| * | | | | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| | | | | | | | |
| * | | | | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-189-29/+64
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | a
| * | | | | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-1810-64/+62
| | | | | | | | |
| * | | | | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-182-4/+9
| | | | | | | | |
| * | | | | | | | am: Implement text check software keyboard modeZach Hilman2018-11-186-14/+120
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows the game to verify and send a message to the frontend.
| * | | | | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-1817-100/+180
| | | | | | | | |
| * | | | | | | | qt/main: Register Qt Software Keyboard frontend with AMZach Hilman2018-11-183-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows using Qt provider over default.
| * | | | | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | Allows use of software keyboard applet and future applets to be easily added by adding enum ID and a switch case.
| * | | | | | | | qt/applets: Provide Qt frontend implementation of software keyboardZach Hilman2018-11-183-0/+171
| | | | | | | | | | | | | | | | | | | | | | | | | | | Implements all of the features of the keyboard, including length, default text, character validation, and UTF-16 character support.
| * | | | | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-183-0/+130
| | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a middleman between the Frontend provider class and the expected AM::Applets::Applet class needed by ILibraryAppletAccessor
| * | | | | | | | frontend/applets: Add frontend software keyboard provider and defaultZach Hilman2018-11-183-0/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | Default implementation will return "yuzu" for any string. GUI clients (or CLI) can implement the Frontend::SoftwareKeyboardApplet class and register an instance to provide functionality.
| * | | | | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-183-0/+77
| | | | | | | | | | | | | | | | | | | | | | | | | | | Adds an Initialize and Execute methods which are used by the ILibraryAppletAccessor to start and control the applet.
| * | | | | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | Now starts the applet provided in constructor.
| * | | | | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | Used by software keyboard applet for data transfer.
| * | | | | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | std::stack was no longer suitable for non-trivial operations
| * | | | | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | Needs to be accessible by applet files.
| * | | | | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| | | | | | | | | | | | | | | | | | | | | | | | | | | Writes to an AM::IStorage object through an IStorageAccessor will now be preserved once the accessor is destroyed.
| * | | | | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | Creates an AM::IStorage object with the contents of the transfer memory located at the handle provided.
| * | | | | | | | string_util: Implement buffer to UTF-16 string helper functionZach Hilman2018-11-182-0/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | Needed as most all software keyboard functions use fixed-length UTF16 string buffers.
| * | | | | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | |/ / / / / / | |/| | | | | | | | | | | | | | Seems to be used and created identically to SharedMemory, so just reuse that.
* | | | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | lm: Implement SetDestination by doing nothing
| * | | | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function was likely intended to be a way to redirect where the output of a log went. e.g. Firing a log over a network, dumping over a tunneling session, etc. Given we always want to see the log and not change its output. It's one of the lucky service functions where the easiest implementation is to just do nothing at all and return success.
* | | | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleans out the citra/3DS-specific implementation details that don't apply to the Switch. Sets the stage for implementing ResourceLimit instances properly. While we're at it, remove the erroneous checks within CreateThread() and SetThreadPriority(). While these are indeed checked in some capacity, they are not checked via a ResourceLimit instance. In the process of moving out Citra-specifics, this also replaces the system ResourceLimit instance's values with ones from the Switch.
* | | | | | | | configure_input: Use Joycons Docked instead of Connected as labelZach Hilman2018-11-191-1/+1
| | | | | | | |
* | | | | | | | configure_input_player: Set minimum width on controlsZach Hilman2018-11-192-23/+30
| | | | | | | |
* | | | | | | | configure_input: Properly update UI components on removal of playerZach Hilman2018-11-191-0/+2
| | | | | | | |
* | | | | | | | configure_input: Make None a controller option instead of checkboxZach Hilman2018-11-1911-152/+148
| | | | | | | |
* | | | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-1916-296/+234
| | | | | | | |
* | | | | | | | qt: Move controller button config to separate dialogZach Hilman2018-11-194-0/+1767
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Handles button configuration for all controller layouts and debug pads. Configurable at construction.
* | | | | | | | qt: Add UI to configure touchscreen parametersZach Hilman2018-11-194-0/+281
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows adjusting the finger, diameter, and angle of the emulated touchscreen. It also provides a warning to the user about what changing these parameters can do.
* | | | | | | | qt: Add UI to configure mouse buttonsZach Hilman2018-11-194-0/+542
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Supports setting the five mouse buttons to any valid controller button/keyboard key (Left, Right, Middle, Foward, Back)
* | | | | | | | configure_input: Add support for multiplayer and controller typesZach Hilman2018-11-193-998/+525
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This moves the actual button configuration to a separate dialog and only has the enabled and type controls in the tab.
* | | | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
| | | | | | | |
* | | | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Including finger ID, diamater x/y, and angle. Additionally, checks if the touchscreen is enabled.
* | | | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
| | | | | | | |
* | | | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
| | | | | | | |
* | | | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by developers to test games, not present on retail systems. Some games are known to respond to DebugPad input though, for example Kirby Star Allies.
* | | | | | | | yuzu/config: Add (de-)serialization for multiplayerZach Hilman2018-11-192-21/+331
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Defaults to full keyboard for keyboard -- It did not seem to be necessary to make the keyboard configurable (besides enabled/disabled).
* | | | | | | | yuzu_cmd/config: Add config deserialization for multiplayerZach Hilman2018-11-191-37/+254
| | | | | | | |
* | | | | | | | settings: Add settings for multiple players and controllersZach Hilman2018-11-191-3/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uses the PlayerInput struct to represent all of the data that constitutes a player.
* | | | | | | | settings: Add Native type for keyboardZach Hilman2018-11-191-0/+210
| | | | | | | |
* | | | | | | | settings: Add Native type for mouse buttonsZach Hilman2018-11-192-0/+34
| | | | | | | |
* | | | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
| | | | | | | |
* | | | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
| | | | | | | |
* | | | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
| | | | | | | |
* | | | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
| | | | | | | |
* | | | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
| | | | | | | |
* | | | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
| | | | | | | |
* | | | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #1717 from FreddyFunk/swizzle-gobbunnei2018-11-191-37/+33
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | textures/decoders: Replace magic numbers
| * | | | | | | textures/decoders: Replace magic numbersFrederic Laing2018-11-171-37/+33
| | | | | | | |
* | | | | | | | Merge pull request #1693 from Tinob/masterbunnei2018-11-199-211/+315
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Missing ogl states
| * | | | | | | | drop support for non separate alpha as it seems to cause issues in some gamesRodolfo Bogado2018-11-183-61/+35
| | | | | | | | |
| * | | | | | | | fix sampler configuration, thanks to Marcos for his investigationRodolfo Bogado2018-11-173-19/+57
| | | | | | | | |
| * | | | | | | | small type fixRodolfo Bogado2018-11-171-6/+6
| | | | | | | | |
| * | | | | | | | small fix for alphaToOne bit locationRodolfo Bogado2018-11-171-2/+2
| | | | | | | | |
| * | | | | | | | fix for gcc compilationRodolfo Bogado2018-11-171-60/+61
| | | | | | | | |
| * | | | | | | | add AlphaToCoverage and AlphaToOneRodolfo Bogado2018-11-175-1/+39
| | | | | | | | |
| * | | | | | | | add support for fragment_color_clampRodolfo Bogado2018-11-175-1/+24
| | | | | | | | |
| * | | | | | | | add missing MirrorOnceBorder support where supportedRodolfo Bogado2018-11-171-0/+6
| | | | | | | | |
| * | | | | | | | set border color not depending on the wrap modeRodolfo Bogado2018-11-171-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | only enable color mask for the first framebuffer id independent blending is disabled
| * | | | | | | | set default value for point size registerRodolfo Bogado2018-11-172-5/+4
| | | | | | | | |
| * | | | | | | | fix viewport and scissor behaviorRodolfo Bogado2018-11-176-64/+89
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Eliminated unnessessary memory allocation and copy (#1702)Frederic L2018-11-193-9/+20
| | | | | | | |
* | | | | | | | Merge pull request #1640 from DarkLordZach/game-list-reloadbunnei2018-11-195-1/+28
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | game_list: Only reload game list after relevant settings changed
| * | | | | | | | game_list: Only reload game list after relevant settings changedZach Hilman2018-11-045-1/+28
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | Prevents unnecessary reloads on every configuration operation.
* | | | | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-197-23/+405
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | ldr_ro: Complete LDR:RO implementation
| * | | | | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| | | | | | | | |
| * | | | | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes actual unmapping and address error checking.
| * | | | | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes NRO and BSS error checking, maximum loaded NRO check, NRR hash check, and proper remapping of BSS data.
| * | | | | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes initialization check, proper address check, alignment check, and actual unloading of a loaded NRR.
| * | | | | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes parameter error checking, hash enforcement, initialization check, and max NRR load check.
| * | | | | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-152-3/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Credits to Subv
| * | | | | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes unmapped spam in SMP and buffer size errors in some other games
* | | | | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUser
| * | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
| | |_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Seems pokemon calls this sometimes and it caused "random crashes"
* | | | | | | | | Correctly sets default system language for yuzu-CLI (#1727)Schplee2018-11-191-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Correctly sets default system language for yuzu-CLI A user reported that yuzu_cmd runs games in Japanese rather than the correct default of English (like yuzu-qt does correctly), this change fixes that. * fix clang issue deleted whitespace
* | | | | | | | | Merge pull request #1730 from ReinUsesLisp/fix-intelbunnei2018-11-191-2/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Remove default clip distance
| * | | | | | | | | gl_rasterizer: Remove default clip distanceReinUsesLisp2018-11-191-2/+0
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBuffer
| * | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Used by homebrew on exit. According to switchbrew, returns an empty response parcel with one zero in it.
* | | | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | svc: ResetSignal is not stubbed
| * | | | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | https://user-images.githubusercontent.com/20753089/48677874-b8e01c80-eb7b-11e8-8043-b99faa29022c.PNG
* | | | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
| |_|_|_|_|_|/ / |/| | | | | | |
* | | | | | | | Merge pull request #1678 from FearlessTobi/amiibo-hotkeysbunnei2018-11-171-1/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4387: "yuzu: Add hotkey for Amiibo loading"
| * | | | | | | | yuzu: Add hotkey for Amiibo loadingfearlessTobi2018-11-131-1/+9
| | | | | | | | |
* | | | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Added various bluetooth based cmds for palma
| * | | | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It seems palma is done through bluetooth, we need this for pokemon go however more research needs to be done when we actually get palma working. This is presumably used for transfering data between the controller and the console, it does not seem for actual input as far as I know.
* | | | | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.
| * | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes audio issues with Pokemon: Let's Go Pikachu & Eevee.
* | | | | | | | | | Merge pull request #1714 from lioncash/kern-errbunnei2018-11-172-62/+32
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | kernel/errors: Clean up error codes
| * | | | | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Similar to PR 1706, which cleans up the error codes for the filesystem code, but done for the kernel error codes. This removes the ErrCodes namespace and specifies the errors directly. This also fixes up any straggling lines of code that weren't using the named error codes where applicable.
* | | | | | | | | | Merge pull request #1712 from FearlessTobi/port-4426bunnei2018-11-161-9/+10
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | Port citra-emu/citra#4426: "Common/Bitfield: store value as unsigned type"
| * | | | | | | | | Common/Bitfield: store value as unsigned typeWeiyi Wang2018-11-161-9/+10
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | Storing signed type causes the following behaviour: extractValue can do overflow/negative left shift. Now it only relies on two implementation-defined behaviours (which are almost always defined as we want): unsigned->signed conversion and signed right shift
* | | | | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Implement SetMemoryPermission
| * | | | | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| | | | | | | | | |
| * | | | | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1700 from FreddyFunk/cleanupbunnei2018-11-161-3/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer_chache: Minor cleanup
| * | | | | | | | | gl_rasterizer_chache: Minor cleanupFrederic Laing2018-11-151-3/+3
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1701 from FreddyFunk/decodersbunnei2018-11-161-16/+16
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | textures/decoders: Minor cleanup
| * | | | | | | | | textures/decoders: Minor cleanupFrederic Laing2018-11-151-16/+16
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-1616-133/+200
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | game_list: Optimize game list refresh
| * | | | | | | | | game_list: Make add-ons column optionalZach Hilman2018-11-026-119/+166
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As the add-ons column takes the most processing time out of any (as it needs to search registration for updates/dlc, patch control NCAs, search for mods, etc.), an option was added to disable it. This does not affect the application of add-ons. In large game collections, this decreases game list refresh time by as much as 70%.
| * | | | | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents unnecessary re-reads of the metadata and unnecessary temporary objects.
| * | | | | | | | | file_sys: Use common KeyManager in NCA container typesZach Hilman2018-11-026-7/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates a single KeyManager for the entire container and then passes it into the NCA constructor, eliminating several unnecessary KeyManager reads.
| * | | | | | | | | content_archive: Add optional KeyManager parameter to constructorZach Hilman2018-11-022-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows resuing a common KeyManager when a large amount of NCAs are handled by the same class. Should the parameter not be provided, a new KeyManager will be constructed, as was the default behavior prior to this.
* | | | | | | | | | Merge pull request #1676 from lioncash/warnbunnei2018-11-162-3/+4
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_state: Amend compilation warnings
| * | | | | | | | | | gl_state: Amend compilation warningsLioncash2018-11-132-3/+4
| | |_|_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes float -> integral conversions explicit via casts and also silences a sign conversion warning.
* | | | | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-164-33/+16
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | file_sys/errors: Clean up error code values
| * | | | | | | | | | file_sys/errors: Remove currently unused filesystem error codesLioncash2018-11-161-10/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than keeping around unused values, we can just introduce them as needed.
| * | | | | | | | | | file_sys/errors: Get rid of the ErrCodes namespaceLioncash2018-11-161-17/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real point to keeping the separate enum around, especially given the name of the error code itself is supposed to document what the value actually represents.
| * | | | | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-164-14/+19
| | |_|_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps filesystem-related error codes in one spot.
* | | | | | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
| |_|_|_|_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | Currently unclear what these do yet, will be researched at a later time when we want to implement palma.
* | | | | | | | | Fixed switching operation modes when not running a gameDavid Marcec2018-11-161-0/+3
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | The service manager seems to be a nullptr before a game boots
* | | | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed priority switching edge case for handheld We accidently used controller index instead of npad id * Moved NPadIdToIndex
* | | | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | csrng: Use random integer distribution instead of raw engine
| * | | | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Prevents returning the same value every single call.
* | | | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | kernel/thread: Deduplicate scheduler switching code
| * | | | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The code in both places was the same verbatim, so we can extract it to a function to deduplicate the logic.
* | | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-1512-8/+75
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | patch_manager: Add support for dumping uncompressed NSOs
| * | | | | | | | patch_manager: Add support for dumping decompressed NSOsZach Hilman2018-10-292-1/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When enabled in settings, PatchNSO will dump the unmodified NSO that it was passed to a file named <build id>.nso in the dump root for the current title ID.
| * | | | | | | | settings: Add setting to control NSO dumpingZach Hilman2018-10-296-1/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also adds UI option in Debug > Dump section, with the idea later things to be dumped (i.e. other game data or textures, etc) will use the same group box.
| * | | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-294-6/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Equates to yuzu_dir/dump/<title id>/
* | | | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdate
| * | | | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, they both currently go through the same codepath with no difference in behavior.
* | | | | | | | | Merge pull request #1637 from FernandoS27/cachebunnei2018-11-151-18/+17
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Improved GPU Caches lookup Speed
| * | | | | | | | | Improved GPU Caches lookup SpeedFernandoS272018-11-111-18/+17
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | acc/profile_manager: Minor cleanup-related changes
| * | | | | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| | | | | | | | | | |
| * | | | | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids relying on fmt always being indirectly included.
* | | | | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()
| * | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | empty() in this case will always return false, since the returned container is a std::array. Instead, check if all given users are invalid before returning the error code.
* | | | | | | | | | | Merge pull request #1695 from lioncash/trbunnei2018-11-151-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | yuzu/configure_system: Mark the entropy mask string as nontranslatable
| * | | | | | | | | | | yuzu/configure_system: Mark the entropy mask string as nontranslatableLioncash2018-11-141-1/+1
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need for translators to concern themselves with the validation mask used by the entry field.
* | | | | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()
| * | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous expression would copy sizeof(size_t) amount of bytes (8 on a 64-bit platform) rather than the full 10 bytes comprising the uuid member. Given the source and destination types are the same, we can just use an assignment here instead.
* | | | | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate
| * | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.
| * | | | | | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When yuzu is compiled in release mode this function is unused, however, when compiled in debug mode, it's used within a LOG_TRACE statement. This prevents erroneous compilation warnings about an unused function (that isn't actually totally unused).
* | | | | | | | | | | Merge pull request #1684 from lioncash/commonbunnei2018-11-142-88/+2
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | common/string_util: Minor cleanup
| * | | | | | | | | | string_util: Remove ArrayToString()Lioncash2018-11-142-21/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An old function from Dolphin. This is also unused, and pretty inflexible when it comes to printing out different data types (for example, one might not want to print out an array of u8s but a different type instead. Given we use fmt, there's no need to keep this implementation of the function around.
| * | | | | | | | | | string_util: Remove TryParse()Lioncash2018-11-142-54/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is an unused hold-over from Dolphin that was primarily used to parse values out of the .ini files. Given we already have libraries that do this for us, we don't need to keep this around.
| * | | | | | | | | | string_util: Remove ThousandSeparate()Lioncash2018-11-131-14/+0
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is currently unused and doesn't really provide much value to keep around either.
* | | | | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-146-8/+33
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | | svc: Use proper random entropy generation algorithm
| * | | | | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-136-8/+33
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1662 from FreddyFunk/CopySurface-Optimizationbunnei2018-11-141-10/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: CopySurface optimization
| * | | | | | | | | gl_rasterizer_cache: Remove unnecessary memory allocation and copy in CopySurfaceFrederic Laing2018-11-081-10/+7
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1686 from DarkLordZach/move-open-yuzu-folderbunnei2018-11-141-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | qt: Move Open yuzu Folder action from Help to File
| * | | | | | | | | | qt: Move Open yuzu Folder action from Help to FileZach Hilman2018-11-131-1/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1685 from lioncash/basebunnei2018-11-141-1/+0
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core/renderer_base: Remove GL include from the renderer base class files
| * | | | | | | | | | video_core/renderer_base: Remove GL include from the renderer base class filesLioncash2018-11-131-1/+0
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the base class source files implementation-agnostic.
* | | | | | | | | | Merge pull request #1677 from FreddyFunk/skip-vao-binding-cleanupbunnei2018-11-141-4/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | engines/maxwell_3d: Minor cleanup
| * | | | | | | | | | gl_rasterizer: Minor cleanupFrederic L2018-11-131-4/+2
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | Minor code cleanup from unaddressed feedback in #1654
* | | | | | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm manager
| * | | | | | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've moved all of the heap-related stuff to the VMManager class, we can unstub this function, as the necessary members are visible now.
| * | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids a breach of responsibilities in the interface and keeps the direct code for memory management within the VMManager class.
* | | | | | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimit
| * | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These appear to be a basic getter and setter pair, so these are fairly trivial to implement and get out of the way.
* | | | | | | | | | Merge pull request #1683 from lioncash/typobunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | audio_core/audio_renderer: Fix typo in AuxInfo member name
| * | | | | | | | | | audio_core/audio_renderer: Fix typo in AuxInfo member nameLioncash2018-11-131-1/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-1410-16/+260
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | [ns|fsp_srv]: Implement various functions to boot Checkpoint
| * | | | | | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-294-17/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Returns the raw NACP bytes and the raw icon bytes into a title-provided buffer. Pulls from Registration Cache for control data, returning all zeros should it not exist.
| * | | | | | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An object to read SaveDataInfo objects, which describe a unique save on the system. This implementation iterates through all the directories in the save data space and uses the paths to reconstruct the metadata.
| * | | | | | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by Checkpoint. Returns an object that can iterate through all savedata on the system.
| * | | | | | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-294-14/+32
| | | | | | | | | |
| * | | | | | | | | loader/nro: Call RegisterRomFS from LoadZach Hilman2018-10-291-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows NRO homebrew to use the RomFS in the ASET section.
| * | | | | | | | | control_metadata: Add GetRawBytes function to NACPZach Hilman2018-10-292-0/+7
| | |_|_|_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Returns the raw bytes of the NACP file. Needed for GetApplicationControlData which returns the raw, unprocessed NACP to the game.
* | | | | | | | | Merge pull request #1628 from greggameplayer/Texture2DArraybunnei2018-11-131-0/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Implement SurfaceTarget Texture2DArray
| * \ \ \ \ \ \ \ \ Merge branch 'master' into Texture2DArraygreggameplayer2018-11-0623-195/+392
| |\ \ \ \ \ \ \ \ \
| * | | | | | | | | | correct syntaxgreggameplayer2018-11-021-4/+3
| | | | | | | | | | |
| * | | | | | | | | | Merge branch 'master' into Texture2DArraygreggameplayer2018-11-0227-1066/+1477
| |\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Implement SurfaceTarget Texture2DArraygreggameplayer2018-10-311-0/+1
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ( needed by Mario+Rabbids Kingdom Battle )
* | | | | | | | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-139-103/+187
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | csrng: Add config option to set RNG seed
| * | | | | | | | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-132-4/+8
| | | | | | | | | | | |
| * | | | | | | | | | | settings: Add config option to set RNG seedZach Hilman2018-11-126-100/+171
| | | | | | | | | | | |
| * | | | | | | | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|_|_|_|_|_|_|/ | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Implement GetClockSnapshot, ToPosixTime & ToPosixTimeWithMyRule
| * | | | | | | | | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| | | | | | | | | | | |
| * | | | | | | | | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Added instead of using a seperate PR to prevent conflicts
| * | | | | | | | | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| | | | | | | | | | | |
| * | | | | | | | | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed by megaman 11
* | | | | | | | | | | | Implement ASTC_2D_10X8 & ASTC_2D_10X8_SRGB (#1666)greggameplayer2018-11-134-71/+101
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement ASTC_2D_10X8 & ASTC_2D_10X8_SRGB ( needed by Mario+Rabbids Kingdom Battle ) * Small placement correction
* | | | | | | | | | | | Merge pull request #1650 from FreddyFunk/castbunnei2018-11-131-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|/ |/| | | | | | | | | | | yuzu/main: Fix compiler warning
| * | | | | | | | | | | yuzu/main: Fix compiler warningFrederic Laing2018-11-061-1/+2
| | | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1674 from FearlessTobi/fullscreen-fixJames Rowe2018-11-121-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / |/| | | | | | | | | | | yuzu: Add a missing "!" to fix the stuck-in-fullscreen bug
| * | | | | | | | | | | yuzu: Add a missing "!" to fix the stuck-in-fullscreen bugTobias2018-11-121-1/+1
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1660 from Tinob/masterbunnei2018-11-129-88/+138
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | Map more missing opengl states
| * | | | | | | | | | | Use core extensions when available to set max anisotropic filtering levelRodolfo Bogado2018-11-111-2/+7
| | | | | | | | | | | |
| * | | | | | | | | | | Improve state management by splitting some of the states id separated function to avoid a full apply overheadRodolfo Bogado2018-11-116-39/+40
| | | | | | | | | | | |
| * | | | | | | | | | | Try to fix problems with stencil test in some games, relax translation to opengl enums to avoid crashing and only generate logs of the errors.Rodolfo Bogado2018-11-114-37/+61
| | | | | | | | | | | |
| * | | | | | | | | | | set sampler max lod, min lod, lod bias and max anisotropyRodolfo Bogado2018-11-113-13/+33
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1652 from FreddyFunk/static-castbunnei2018-11-112-3/+3
|\ \ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | | | configure_system: Fix compiler warning
| * | | | | | | | | | | configure_system: Fix compiler warningFrederic Laing2018-11-062-3/+3
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1664 from FreddyFunk/cast2bunnei2018-11-111-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | | gl_rasterizer: Fix compiler warnings
| * | | | | | | | | | gl_rasterizer: Fix compiler warningsFrederic Laing2018-11-081-2/+2
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1669 from ReinUsesLisp/fixup-gsbunnei2018-11-114-15/+24
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Guard out of bound geometry shader input reads
| * | | | | | | | | | gl_shader_decompiler: Guard out of bound geometry shader input readsReinUsesLisp2018-11-104-15/+24
| | |_|_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Geometry shaders follow a pattern that results in out of bound reads. This pattern is: - VSETP to predicate - Use that predicate to conditionally set a register a big number - Use the register to access geometry shaders At the time of writing this commit I don't know what's the intent of this number. Some drivers argue about these out of bound reads. To avoid this issue, input reads are guarded limiting reads to the highest posible vertex input of the current topology (e.g. points to 1 and triangles to 3).
* | | | | | | | | | Merge pull request #1663 from lioncash/rasterbunnei2018-11-119-10/+25
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | rasterizer_cache: Remove reliance on the System singleton
| * | | | | | | | | | rasterizer_cache: Remove reliance on the System singletonLioncash2018-11-089-10/+25
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than have a transparent dependency, we can make it explicit in the interface. This also gets rid of the need to put the core include in a header.
* | | | | | | | | | Merge pull request #1648 from FernandoS27/texs-3-arraybunnei2018-11-111-7/+11
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Implement 3 coordinate array in TEXS instruction
| * | | | | | | | | | Correct issue where texturelod could not be applied to 2darrayshadowFernandoS272018-11-081-1/+5
| | | | | | | | | | |
| * | | | | | | | | | Implement 3 coordinate array in TEXS instructionFernandoS272018-11-071-6/+6
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1654 from degasus/dirty_flagsbunnei2018-11-114-7/+37
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer: Skip VAO binding if the state is clean.
| * | | | | | | | | | gl_rasterizer: Skip VAO binding if the state is clean.Markus Wick2018-11-063-2/+21
| | | | | | | | | | |
| * | | | | | | | | | gl_rasterizer: Split VAO and VB setup functions.Markus Wick2018-11-062-5/+16
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-108-36/+170
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Ability to switch between docked and undocked mode in-game
| * | | | | | | | | | Renamed CheckIfOperationChanged to OnDockedModeChangedDavid Marcec2018-11-082-21/+23
| | | | | | | | | | |
| * | | | | | | | | | FixupsDavid Marcec2018-11-073-12/+17
| | | | | | | | | | |
| * | | | | | | | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-077-36/+163
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Started implementation of the AM message queue mainly used in state getters. Added the ability to switch docked mode whilst in game without stopping emulation. Also removed some things which shouldn't be labelled as stubs as they're implemented correctly
* | | / / / / / / / rasterizer_cache: Add missing virtual destructor to RasterizerCacheObjectLioncash2018-11-083-0/+10
| |_|/ / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | Ensures that destruction will always do the right thing in any context.
* | | | | | | | | gl_resource_manager: Amend clang-format discrepanciesLioncash2018-11-081-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes the buildbot.
* | | | | | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Updated npad styles on holdtype switches
| * | | | | | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | Fixes input for megaman
* | | | | | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * svcBreak now dumps information from the debug buffer passed info1 and info2 seem to somtimes hold an address to a buffer, this is usually 4 bytes or the size of the int and contains an error code. There's other circumstances where it can be something different so we hexdump these to examine them at a later date. * Addressed comments
* | | | | | | | | Merge pull request #1655 from ogniK5377/shantaebunnei2018-11-085-3/+26
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Implement acc:TrySelectUserWithoutInteraction
| * | | | | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
| | | | | | | | |
| * | | | | | | | Added missing logDavid Marcec2018-11-071-0/+1
| | | | | | | | |
| * | | | | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Needed for Shantae - Half-Genie Hero - Ultimate Edition!
* | | | | | | | Merge pull request #1630 from bunnei/fix-mapbufferexbunnei2018-11-072-31/+52
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | memory_manager: Do not MapBufferEx over already in use memory.
| * | | | | | | | memory_manager: Do not MapBufferEx over already in use memory.bunnei2018-11-012-31/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - This fixes rendering when changing areas in Super Mario Odyssey.
* | | | | | | | | Merge pull request #1635 from Tinob/masterbunnei2018-11-076-153/+338
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Implement multi-target viewports and blending
| * | | | | | | | | Add support to color mask to avoid issues in blending caused by wrong values in the alpha channel in some render targets.Rodolfo Bogado2018-11-055-25/+79
| | | | | | | | | |
| * | | | | | | | | Implement multi-target viewports and blendingRodolfo Bogado2018-11-056-128/+259
| | | | | | | | | |
* | | | | | | | | | gl_rasterizer_cache: Add profiles for Copy and Blit.Markus Wick2018-11-061-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | They were missed, and Copy is very high in profile here. It doesn't block the GPU, but it stalls the driver thread. So with our bad GL instructions, this might block quite a while.
* | | | | | | | | | gl_resource_manager: Profile creation and deletion.Markus Wick2018-11-061-0/+42
| | | | | | | | | |
* | | | | | | | | | gl_stream_buffer: Profile orphaning of stream buffer.Markus Wick2018-11-061-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This serialize to the driver thread and so it may block for a while. So if it is in the benchmark, we get noticed if it happens too often.
* | | | | | | | | | microprofile: Drop ReleaseActiveBuffer scope.Markus Wick2018-11-061-4/+0
| |_|/ / / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was created with the unfinished resampling PR in mind. As the resampling is now on the audio thread, we don't need to care about this here any more.
* | | | | | | | | gl_resource_manager: Split implementations in .cpp file.Markus Wick2018-11-065-114/+167
| |_|/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Those implementations are quite costly, so there is no need to inline them to the caller. Ressource deletion is often a performance bug, so in this way, we support to add breakpoints to them.
* | | | | | | | Merge pull request #1616 from FernandoS27/cube-arraybunnei2018-11-054-0/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implement Cube Arrays
| * | | | | | | | Implement Cube ArraysFernandoS272018-11-014-0/+20
| | | | | | | | |
* | | | | | | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fixed HID crash when launching more than 1 game & signaled styleset change event
| * | | | | | | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
| | |_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | This should fix crashes when launching multiple games in yuzu
* | | | | | | | | Merge pull request #1441 from CarlKenner/DebuggerLogbunnei2018-11-054-2/+29
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | logging: Add DebuggerBackend for logging to Visual Studio
| * | | | | | | | | logging: Add DebuggerBackend for logging to Visual StudioCarl Kenner2018-10-074-2/+29
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1639 from DarkLordZach/open-yuzu-folderbunnei2018-11-053-0/+13
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | qt: Add help option to open yuzu folder
| * | | | | | | | | qt: Add help option to open yuzu folderZach Hilman2018-11-033-0/+13
| | |_|_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | Opens a new file manager window at the UserDir.
* | | | | | | | | Merge pull request #1625 from FernandoS27/astcbunnei2018-11-059-75/+154
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Implement ASTC Textures 5x5 and fix a bunch of ASTC texture problems
| * | | | | | | | | Fix ASTC Decompressor to support depth parameterFernandoS272018-11-027-65/+131
| | | | | | | | | |
| * | | | | | | | | Fix ASTC formatsFernandoS272018-11-014-12/+21
| | | | | | | | | |
| * | | | | | | | | Implemented ASTC 5x5FernandoS272018-11-011-1/+5
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1645 from dharmin/masterMat M2018-11-051-1/+1
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Fix quickstart link
| * | | | | | | | | | Fix quickstart linkDharmin K Shah2018-11-041-1/+1
| | |/ / / / / / / / | |/| | | | | | | |
* / | | | | | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
|/ / / / / / / / /
* | | / / / / / / Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #1615 from lioncash/inputbunnei2018-11-025-25/+113
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | configure_system: Contrain profile usernames to 32 characters
| * | | | | | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-315-25/+113
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we would let a user enter an unbounded name and then silently truncate away characters that went over the 32-character limit. This is kind of bad from the UX point of view, because we're essentially not doing what the user intended in certain scenarios. Instead, we clamp it to 32 characters and make that visually apparent in the dialog box to provide a name for a user.
* | | | | | | | Merge pull request #1623 from Tinob/masterbunnei2018-11-013-105/+158
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Improve OpenGL state handling
| * | | | | | | Improve OpenGL state handlingRodolfo Bogado2018-10-313-105/+158
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1527 from FernandoS27/assert-flowbunnei2018-11-012-2/+27
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Assert Control Flow Instructions using Control Codes
| * | | | | | | Assert Control Flow Instructions using Control CodesFernandoS272018-10-292-3/+28
| | |/ / / / / | |/| | | | |
* | | | | | | maxwell_3d: Restructure macro upload to use a single macro code memory.bunnei2018-11-014-27/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Fixes an issue where macros could be skipped. - Fixes rendering of distant objects in Super Mario Odyssey.
* | | | | | | Merge pull request #1604 from FearlessTobi/port-4369bunnei2018-11-017-7/+65
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port citra-emu/citra#4369: "compatdb: Use a seperate endpoint for testcase submission"
| * | | | | | | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-287-7/+65
| | | | | | | |
* | | | | | | | Merge pull request #1528 from FernandoS27/assert-control-codesbunnei2018-11-012-1/+103
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | Assert Control Codes Generation on Shader Instructions
| * | | | | | | Assert Control Codes GenerationFernandoS272018-10-302-1/+103
| | | | | | | |
* | | | | | | | Merge pull request #1614 from ReinUsesLisp/surface-paramsbunnei2018-11-016-898/+954
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: Move surface declarations out of gl_rasterizer_cache
| * | | | | | | | video_core: Move surface declarations out of gl_rasterizer_cacheReinUsesLisp2018-10-306-898/+954
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Updated based off information on SwitchBrew.
* | | | | | | Merge pull request #1624 from lioncash/boostbunnei2018-10-303-4/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | general: Remove unused boost inclusions where applicable
| * | | | | | | general: Remove unused boost inclusions where applicableLioncash2018-10-303-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cleans up unused includes and trims off some dependencies on externals.
* | | | | | | | Merge pull request #1595 from FreddyFunk/castbunnei2018-10-301-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | configure_system: Fix compiler warning
| * | | | | | | configure_system: Fix compiler warningFrederic Laing2018-10-281-1/+1
| | | | | | | |
* | | | | | | | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-3049-266/+274
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * get rid of boost::optional * Remove optional references * Use std::reference_wrapper for optional references * Fix clang format * Fix clang format part 2 * Adressed feedback * Fix clang format and MacOS build
* | | | | | | | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointer
| * | | | | | | | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to call the getter and then check for null.
| * | | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nothing requires the shared owner ship here, so we can just return a plain pointer.
* | | | | | | | Merge pull request #1611 from lioncash/constbunnei2018-10-304-13/+52
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | core: Add missing const variants of getters for the System class
| * | | | | | | core: Make System references const where applicableLioncash2018-10-282-3/+3
| | | | | | | |
| * | | | | | | core: Add missing const variants of getters for the System classLioncash2018-10-282-10/+49
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of the Current<Thing> getters (as well as a few others) were missing const qualified variants, which makes it a pain to retrieve certain things from const qualified references to System.
* | | | | | | Merge pull request #1580 from FernandoS27/mm-implbunnei2018-10-306-109/+254
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implemented Mipmaps
| * | | | | | | Fixed black textures, pixelation and we no longer require to auto-generate mipmapsFernandoS272018-10-291-14/+2
| | | | | | | |
| * | | | | | | Fixed mipmap block autosizing algorithmFernandoS272018-10-293-13/+25
| | | | | | | |
| * | | | | | | Fixed Invalid Image size and Mipmap calculationFernandoS272018-10-291-4/+7
| | | | | | | |
| * | | | | | | Fixed Block Resizing algorithm and Clang FormatFernandoS272018-10-293-12/+19
| | | | | | | |
| * | | | | | | Implement Mip FilterFernandoS272018-10-294-10/+33
| | | | | | | |
| * | | | | | | Zero out memory region of recreated surface before flushingFernandoS272018-10-291-0/+2
| | | | | | | |
| * | | | | | | Implement MipmapsFernandoS272018-10-282-101/+211
| |/ / / / / /
* | | | | | | Merge pull request #1617 from FearlessTobi/fix-stretch-delaybunnei2018-10-301-3/+3
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | time_stretch: Switch to values of Citra
| * | | | | | time_stretch: Switch to values of CitrafearlessTobi2018-10-291-3/+3
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1613 from ReinUsesLisp/gl-utilsbunnei2018-10-296-30/+61
|\ \ \ \ \ \ | |/ / / / / |/| | | | | video_core: Move OpenGL specific utils to its renderer
| * | | | | video_core: Move OpenGL specific utils to its rendererReinUsesLisp2018-10-296-30/+61
| |/ / / /
* | | | | Merge pull request #1610 from slashiee/dxt1-alphabunnei2018-10-291-2/+2
|\ \ \ \ \ | | | | | | | | | | | | renderer_opengl: Enable alpha channel for DXT1 texture format
| * | | | | Enable alpha channel for DXT1 texture formatMichael2018-10-281-2/+2
| |/ / / /
* / / / / renderer_opengl: Correct bpp value for ASTC_2D_8X5_SRGBRodolfo Bogado2018-10-291-1/+1
|/ / / /
* / / / Correct bpp value for ASTC_2D_8X5Tobias2018-10-281-1/+1
|/ / /
* | | Merge pull request #1601 from FernandoS27/shader-precisionbunnei2018-10-281-20/+35
|\ \ \ | | | | | | | | Improved Shader accuracy on Vertex and Geometry Shaders.
| * | | Refactor precise usage and add FMNMX, MUFU, FMUL32 and FADD332FernandoS272018-10-282-74/+37
| | | |
| * | | Improved Shader accuracy on Vertex and Geometry Shaders with FFMA, FMUL and FADDFernandoS272018-10-282-6/+58
| |/ /
* | | Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ \ \ | | | | | | | | svc: Implement svcGetInfo command 0xF0000002
| * | | svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| | | | | | | | | | | | | | | | Nothing from this enum is intended to be used outside of this function.
| * | | svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This retrieves: if (curr_thread == handle_thread) { result = total_thread_ticks + (hardware_tick_count - last_context_switch_ticks); } else if (curr_thread == handle_thread && sub_id == current_core_index) { result = hardware_tick_count - last_context_switch_ticks; }
* | | | file_sys/patch_manager: Remove unnecessary if-statements (#1586)Frederic L2018-10-281-7/+6
| | | | | | | | | | | | | | | | | | | | | | | | * remove unnecessary if-statements * Addressed feedback
* | | | Merge pull request #1598 from DeeJayBro/delete-directorybunnei2018-10-281-2/+26
|\ \ \ \ | | | | | | | | | | service/filesystem: Implemented DeleteDirectory & DeleteDirectoryRecursive
| * | | | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
| |/ / /
* | | | Merge pull request #1600 from DarkLordZach/nsp-secondary-loader-fixbunnei2018-10-281-17/+20
|\ \ \ \ | | | | | | | | | | loader/nsp: Move secondary loader initialization to constructor
| * | | | loader/nsp: Move secondary loader initialization to constructorZach Hilman2018-10-271-17/+20
| |/ / / | | | | | | | | | | | | Prevents nullptr bug when trying to dump the RomFS of an NSP resulting from secondary_loader not being initialized.
* | | | Implement sRGB Support, including workarounds for nvidia driver issues and QT sRGB supportRodolfo Bogado2018-10-288-40/+197
| | | |
* | | | Merge pull request #1602 from DarkLordZach/key-derivation-isxdigitbunnei2018-10-281-1/+1
|\ \ \ \ | | | | | | | | | | key_manager: Use isxdigit instead of isdigit when reading key file
| * | | | key_manager: Use isxdigit instead of isdigit when reading key fileZach Hilman2018-10-281-1/+1
| |/ / / | | | | | | | | | | | | Crypto revisions are hex numbers and this function only checks if the string is valid for stoul in base 16, so it should be isxdigit.
* | | | Merge pull request #1597 from lioncash/errorbunnei2018-10-281-51/+70
|\ \ \ \ | | | | | | | | | | configure_system: Indicate when filesystem operations fail
| * | | | configure_system: Make GetIcon() return the scaled 64x64 iconLioncash2018-10-271-14/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to put the scaling parameters all over the place for the common case. The only other time scaling is done is to generate the smaller 48x48 image, so this is fine.
| * | | | configure_system: Move entry formatting for the user account list entries to its own functionLioncash2018-10-271-18/+22
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to duplicate this all over the place, and makes it translator-friendly across the board.
| * | | | configure_system: Display errors to the user if file operations fail when setting user imagesLioncash2018-10-271-24/+46
| |/ / / | | | | | | | | | | | | | | | | We should display an error to the user if setting a user image for an account fails, rather than continuing onwards.
* | | | Merge pull request #1594 from FreddyFunk/static-castbunnei2018-10-281-2/+2
|\ \ \ \ | |_|/ / |/| | | gl_rasterizer_cache: Fix compiler warning
| * | | gl_rasterizer_cache: Fix compiler warningFrederic Laing2018-10-271-2/+2
| |/ /
* | | Merge pull request #1596 from FearlessTobi/port-4367bunnei2018-10-271-1/+2
|\ \ \ | | | | | | | | Port citra-emu/citra#4367: "cubeb_sink: ignore null-name device when selecting"
| * | | cubeb_sink: ignore null-name device when selectingWeiyi Wang2018-10-271-1/+2
| |/ / | | | | | | | | | We already ignore them on listing devices. We should do the same when selecting devices. This fix a crash when opening a specific device while there is a null device in the list
* | | Merge pull request #1592 from bunnei/prim-restartbunnei2018-10-275-1/+40
|\ \ \ | | | | | | | | gl_rasterizer: Implement primitive restart.
| * | | gl_rasterizer: Implement primitive restart.bunnei2018-10-265-1/+40
| |/ /
* / / Implement Default Block Height for each formatFernandoS272018-10-271-0/+62
|/ /
* | Merge pull request #1533 from FernandoS27/lmembunnei2018-10-263-1/+138
|\ \ | | | | | | Implemented Shader Local Memory
| * | Implemented LD_L and ST_LFernandoS272018-10-243-12/+112
| | |
| * | Implement Shader Local MemoryFernandoS272018-10-241-0/+37
| | |
* | | Merge pull request #1430 from DarkLordZach/remove-promote-dirbunnei2018-10-2617-95/+1
|\ \ \ | | | | | | | | vfs: Remove InterpretAsDirectory and related functions
| * | | vfs: Remove InterpretAsDirectory and related functionsZach Hilman2018-10-1917-95/+1
| | | | | | | | | | | | | | | | When writing VFS, it initally seemed useful to include a function to in-place convert container files into directories in one homogenous directory structure, but re-evaluating it now there have been plenty of chances to use it and there has always been a better way. Removing as it is unused and likely will not be used.
* | | | Merge pull request #1591 from bunnei/depth-rangebunnei2018-10-266-14/+41
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement depth range.
| * | | | maxwell_3d: Add code for initializing register defaults.bunnei2018-10-262-1/+21
| | | | |
| * | | | gl_rasterizer: Implement depth range.bunnei2018-10-264-13/+20
| | | | |
* | | | | Merge pull request #1569 from lioncash/amiibobunnei2018-10-263-17/+40
|\ \ \ \ \ | | | | | | | | | | | | yuzu/main: Notify user of loading errors with Amiibo data
| * | | | | yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-243-17/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We shouldn't silently continue if loading failed, since the general assumption is that no messages showing up implicitly indicates success.
* | | | | | Merge pull request #1587 from lioncash/privatebunnei2018-10-262-45/+46
|\ \ \ \ \ \ | | | | | | | | | | | | | | configure_system: Minor cleanup-related changes
| * | | | | | configure_system: Make the file selector text translatableLioncash2018-10-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This should be localizable, since it's user-facing text.
| * | | | | | configure_system: Make GetAccountUsername() an internal functionLioncash2018-10-252-25/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just make the function accept an arbitrary ProfileManager reference and operate on that instead of tying the function to the class itself. This allows us to keep the function internal to the cpp file and removes the need to forward declare the UUID struct.
| * | | | | | configure_system: Default initialize member variablesLioncash2018-10-251-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These should be initialized to deterministic values so it's easier to catch improper behavior, as it'll always be reproducable, instead of performing uninitialized reads.
| * | | | | | configure_system: Simplify UUID generation call in AddUser()Lioncash2018-10-251-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is a static function so we can just perform an assignment directly.
| * | | | | | configure_system: Amend function casingLioncash2018-10-252-6/+6
| | | | | | |
| * | | | | | configure_system: Add missing override specifier on the destructorLioncash2018-10-251-1/+1
| | | | | | |
| * | | | | | configure_system: Make public slots privateLioncash2018-10-251-7/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only used within this class, so we can make them private to keep their use contained. This also gets rid of the pre-Qt5 'slot' identifier, since Qt 5's connection syntax doesn't require a function to be declared a slot anymore.
* | | | | | | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - This is an incomplete implementation. It was tested with Super Mario Party.
* | | | | | | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
| | | | | | |
* | | | | | | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
| | | | | | |
* | | | | | | nro: Make LoadNro method accessible outside of apploader code.bunnei2018-10-262-6/+18
| |_|/ / / / |/| | | | |
* | | | | | ips_layer: Use rle_size instead of data_size in RLE patch applicationZach Hilman2018-10-251-1/+1
|/ / / / / | | | | | | | | | | | | | | | Prevents a potential bug when using RLE records in an IPS patch.
* | | | | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ \ \ \ | | | | | | | | | | | | service/usb: Update service function tables
| * | | | | service/usb: Update service function tablesLioncash2018-10-251-21/+22
| | | | | | | | | | | | | | | | | | | | | | | | Updated based off the information provided by Hexkyz on Switchbrew.
* | | | | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/acc: Silence compiler truncation warnings
| * | | | | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just flat data, so it doesn't really need to be in the function itself. This also allows deduplicating the constant for the backup size in GetImageSize().
| * | | | | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences compiler warnings related to truncation. This also introduces a small helper function to perform the clamping of the image size.
| * | | | | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / / / / | | | | | | | | | | | | | | | | | | Allows unindenting the other branch's code.
* | | | | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/error: Amend error return code values
| * | | | | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we've gotten the innaccurate error codes out of the way, we can finally toss away a bunch of these, trimming down the error codes to ones that are actually used and knocking out two TODO comments.
| * | | | | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is more consistent with what the kernel does.
| * | | | | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| | | | | | |
| * | | | | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is what the kernel does in this instance.
| * | | | | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These are now entirely unused and can be removed.
| * | | | | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like with the previous change, the kernel doesn't return NOT_AUTHORIZED here. It returns INVALID_THREAD_PRIORITY.
| * | | | | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All priority checks are supposed to occur before checking the validity of the thread handle, we're also not supposed to return ERR_NOT_AUTHORIZED here.
| * | | | | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel appears to return 0xE601 for this situation. Particularly in svcWaitSynchronization, svcReplyAndReceive, and svcGetThreadContext
| * | | | | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | The kernel appears to return 0xF601 for this case.
* | | | | | Merge pull request #1524 from FernandoS27/layers-fixbunnei2018-10-253-72/+109
|\ \ \ \ \ \ | | | | | | | | | | | | | | rasterizer: Fix Layered Textures Loading and Cubemaps
| * | | | | | Fixed Layered Textures Loading and CubemapsFernandoS272018-10-233-72/+109
| | | | | | |
* | | | | | | Merge pull request #1575 from lioncash/qstringbunnei2018-10-251-4/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | game_list_worker: Use QString's formatting instead of fmt in FormatPatchNameVersions()
| * | | | | | | game_list_worker: Use QString's formatting instead of fmt in FormatPatchNameVersions()Lioncash2018-10-241-4/+9
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using fmt here requires unnecessary string conversions back into QString. Instead, we can just use QString's formatting and get the end result of the formatting operation in the proper type.
* | | | | | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-255-48/+53
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | profile_manager: Use std::optional instead of boost::optional
| * | | | | | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-245-48/+53
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we can actually use std::optional on macOS, we don't need to continue using boost::optional here.
* | | | | | | Merge pull request #1558 from lioncash/ptrbunnei2018-10-252-13/+14
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | yuzu/configuration/config: Use a std::unique_ptr for qt_config instead of a raw pointer
| * | | | | | yuzu/configuration/config: Use a std::unique_ptr for qt_config instead of a raw pointerLioncash2018-10-242-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Same behavior, less code.
| * | | | | | yuzu/configuration/config: Reorganize member variable and function layoutLioncash2018-10-241-6/+7
| | |_|/ / / | |/| | | | | | | | | | | | | | | | Makes the class layout consistent with the others.
* | | | | | Merge pull request #1565 from lioncash/audiobunnei2018-10-242-3/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | time_stretch: Remove unused m_channel_count member variable
| * | | | | | time_stretch: Remove unused m_channel_count member variableLioncash2018-10-242-3/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | This is only stored to, but never read from.
* | | | | | Merge pull request #1554 from FernandoS27/pointsizebunnei2018-10-243-5/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement PointSize Output Attribute.
| * | | | | | Implement PointSizeFernandoS272018-10-233-5/+28
| | | | | | |
* | | | | | | Merge pull request #1571 from lioncash/debug-translatebunnei2018-10-242-15/+20
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | graphic_breakpoints: Correct translation of strings in BreakpointModel's data() function
| * | | | | | | graphic_breakpoints: Correct translation of strings in BreakpointModel's data() functionLioncash2018-10-242-15/+20
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | tr() will not function properly on static/global data like this, as the object is only ever constructed once, so the strings won't translate if the language is changed without restarting the program, which is undesirable. Instead we can just turn the map into a plain old function that maps the values to their equivalent strings. This is also lessens the memory allocated, since it's only allocating memory for the strings themselves, and not an encompassing map as well.
* | | | | | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | npad: Remove unused controller variable from OnInit()
| * | | | | | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This also gets rid of variable shadowing related to the lambda parameter a little bit below this code as well.
* | | | | | | Merge pull request #1568 from lioncash/dirbunnei2018-10-241-4/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | game_list: Use QFileInfo instead of common's file functions
| * | | | | | | game_list: Use QFileInfo instead of common's file functionsLioncash2018-10-241-4/+3
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use the facilities that Qt provides instead of pulling in stuff from common. While we're at it, we can also simplify the nearby logging statement's argument by just calling .toStdString()
* | | | | | | Merge pull request #1567 from lioncash/translatebunnei2018-10-241-5/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | game_list: Make game list column headers translatable
| * | | | | | | game_list: Make game list column headers translatableLioncash2018-10-241-5/+5
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | These are user-facing strings, so they should be marked as translatable
* | | | | | | Merge pull request #1566 from lioncash/strbunnei2018-10-241-4/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | bootmanager: Use QStringLiteral instead of std::string to represent the window title.
| * | | | | | | bootmanager: Use QStringLiteral instead of std::string to represent the window titleLioncash2018-10-241-4/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gets rid of an unnecessary type conversion. We can just use the regular QStringLiteral to already format the string as the type setWindowTitle accepts instead of converting from a std::string instance.
* | | | | | | Merge pull request #1563 from lioncash/framebunnei2018-10-241-4/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | perf_stats: Remove unused variable within DoFrameLimiting()
| * | | | | | | perf_stats: Remove unused variable within DoFrameLimiting()Lioncash2018-10-241-4/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | This hasn't been used since ba8ff096fdc9f7ab101851c4cd06c3244a7d84c3
* | | | | | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() function
| * | | | | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just call the function instead of duplicating the code here. This also prevents an unused function warning. We also don't need to take the lambda capture by reference. It's just a u64 value, so by value is fine here.
* | | | | | | Merge pull request #1560 from lioncash/unusedbunnei2018-10-242-2/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_3d/decoders: Remove unused variables
| * | | | | | | decoders: Remove unused variable within SwizzledData()Lioncash2018-10-241-1/+0
| | | | | | | |
| * | | | | | | maxwell_3d: Remove unused variable within ProcessQueryGet()Lioncash2018-10-241-1/+0
| |/ / / / / /
* | | | | | | Merge pull request #1561 from lioncash/fsbunnei2018-10-242-3/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys: Remove unused variables
| * | | | | | | vfs: Handle failure of file reading within VfsRawCopy()Lioncash2018-10-241-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also gets rid of an unused variable.
| * | | | | | | key_manager: Remove unused variable in DeriveBase()Lioncash2018-10-241-1/+0
| |/ / / / / /
* | | | | | | Merge pull request #1559 from lioncash/logbunnei2018-10-242-0/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | logging/backend: Add missing services to the log filters
| * | | | | | logging/backend: Add missing services to the log filtersLioncash2018-10-242-0/+5
| |/ / / / / | | | | | | | | | | | | | | | | | | Just a few overlooked services.
* | | | | | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-2411-118/+742
|\ \ \ \ \ \ | |/ / / / / |/| | | | | qt: Add UI to manage emulated user profiles
| * | | | | configure_system: Clear current username before overwritingZach Hilman2018-10-242-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | Prevents bug where old username would remain if the new username was shorter in length.
| * | | | | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-244-18/+42
| | | | | |
| * | | | | acc: Fix account UUID duplication errorZach Hilman2018-10-248-80/+106
| | | | | |
| * | | | | configure_system: Clear selection after user deleteZach Hilman2018-10-242-12/+18
| | | | | |
| * | | | | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-2411-133/+308
| | | | | |
| * | | | | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| | | | | |
| * | | | | qt: Allow user to select emu user on open save dataZach Hilman2018-10-241-3/+24
| | | | | |
| * | | | | qt: Add Profile Manager UI to system settingsZach Hilman2018-10-243-76/+350
| | | | | |
| * | | | | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| | | | | |
| * | | | | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| | | | | |
| * | | | | settings: Add users and current_user settings and remove usernameZach Hilman2018-10-243-6/+54
| | | | | |
* | | | | | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Added break types to svcBreak
| * | | | | Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| | | | | |
| * | | | | Added break types to svcBreakDavid Marcec2018-10-231-4/+42
| | | | | | | | | | | | | | | | | | | | | | | | There seems to be more such as type 1, and 2. Unsure what these currently are but when a game hits them we can investigate and add the rest
* | | | | | Added Amiibo support (#1390)David2018-10-2412-80/+386
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed conflict with nfp * Few fixups for nfc * Conflict 2 * Fixed AttachAvailabilityChangeEvent * Conflict 3 * Fixed byte padding * Refactored amiibo to not reside in "System" * Removed remaining references of nfc from system * used enum for Nfc GetStateOld * Added missing newline * Moved file operations to front end * Conflict 4 * Amiibos now use structs and added mutexes * Removed amiibo_path
* | | | | | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-246-16/+97
|\ \ \ \ \ \ | | | | | | | | | | | | | | patch_manager: Add support for LayeredFS on DLC RomFS
| * | | | | | qt: Add support for dumping a DLC Data RomFSZach Hilman2018-10-184-11/+73
| | | | | | |
| * | | | | | registered_cache: Deduplicate results of ListEntry and ListEntryFilterZach Hilman2018-10-172-2/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents a Entry from appearing in the list twice if the user has it installed in two places (e.g. User NAND and SDMC)
| * | | | | | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| | | | | | |
| * | | | | | patch_manager: Add support for using LayeredFS with DataZach Hilman2018-10-171-2/+3
| | | | | | |
* | | | | | | Merge pull request #1542 from lioncash/projectbunnei2018-10-242-5/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Use PROJECT_SOURCE_DIR instead of CMAKE_SOURCE_DIR
| * | | | | | | CMakeLists: Use PROJECT_SOURCE_DIR instead of CMAKE_SOURCE_DIRLioncash2018-10-202-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is more localized to what we want to enforce directory-wise with the project. CMAKE_SOURCE_DIR indicates the root of the source tree, but this would cause the wrong behavior if someone included yuzu as part of a larger buildsystem (for whatever reason). Instead, we want to use the directory where the "project(yuzu)" command was declared as the root path reference.
* | | | | | | | Merge pull request #1553 from lioncash/membunnei2018-10-243-200/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common: Remove memory_util.h/.cpp
| * | | | | | | | common: Remove memory_util.cpp/.hLioncash2018-10-233-200/+0
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Everything from here is completely unused and also written with the notion of supporting 32-bit architecture variants in mind. Given the Switch itself is on a 64-bit architecture, we won't be supporting 32-bit architectures. If we need specific allocation functions in the future, it's likely more worthwhile to new functions for that purpose.
* | | | | | | | Merge pull request #1540 from lioncash/handlebunnei2018-10-249-100/+97
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | kernel/process: Make the handle table per-process
| * | | | | | | kernel/process: Make the handle table per-processLioncash2018-10-209-100/+97
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In the kernel, there isn't a singular handle table that everything gets tossed into or used, rather, each process gets its own handle table that it uses. This currently isn't an issue for us, since we only execute one process at the moment, but we may as well get this out of the way so it's not a headache later on.
* | | | | | | Merge pull request #1552 from FearlessTobi/port-4336bunnei2018-10-231-5/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Port citra-emu/citra#4336: "Only redefine some 64-bit file operation for MSVC"
| * | | | | | | only redefine 64 bit file operation for MSVCWeiyi Wang2018-10-231-5/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MinGW provides POSIX functions
* | | | | | | | Merge pull request #1519 from ReinUsesLisp/vsetpbunnei2018-10-232-75/+108
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement VSETP
| * | | | | | | | gl_shader_decompiler: Implement VSETPReinUsesLisp2018-10-232-0/+26
| | | | | | | | |
| * | | | | | | | gl_shader_decompiler: Abstract VMAD into a video subsetReinUsesLisp2018-10-232-75/+82
| | | | | | | | |
* | | | | | | | | Merge pull request #1539 from lioncash/dmabunnei2018-10-233-19/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | maxwell_dma: Silence compilation warnings
| * | | | | | | | | engines/maxwell_*: Use nested namespace specifiers where applicableLioncash2018-10-203-12/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These three source files are the only ones within the engines directory that don't use nested namespaces. We may as well change these over to keep things consistent.
| * | | | | | | | | maxwell_dma: Make variables const where applicable within HandleCopy()Lioncash2018-10-201-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are never modified, so we can make that assumption explicit.
| * | | | | | | | | maxwell_dma: Make FlushAndInvalidate's size parameter a u64Lioncash2018-10-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This prevents truncation warnings at the lambda's usage sites.
| * | | | | | | | | maxwell_dma: Remove unused variables in HandleCopy()Lioncash2018-10-201-3/+0
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | These pointer variables are never used, so we can get rid of them.
* | | | | | | | | Merge pull request #1470 from FernandoS27/alpha_testingbunnei2018-10-237-20/+87
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Implemented Alpha Test using Shader Emulation
| * | | | | | | | Assert that multiple render targets are not set while alpha testingFernandoS272018-10-223-3/+17
| | | | | | | | |
| * | | | | | | | Use standard UBO and fix/stylize the codeFernandoS272018-10-228-91/+51
| | | | | | | | |
| * | | | | | | | Cache uniform locations and restructure the implementationFernandoS272018-10-223-33/+29
| | | | | | | | |
| * | | | | | | | Remove SyncAlphaTest and clang formatFernandoS272018-10-224-8/+9
| | | | | | | | |
| * | | | | | | | Added Alpha FuncFernandoS272018-10-222-3/+43
| | | | | | | | |
| * | | | | | | | Implemented Alpha TestingFernandoS272018-10-226-3/+59
| | | | | | | | |
* | | | | | | | | Merge pull request #1512 from ReinUsesLisp/brkbunnei2018-10-232-22/+43
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | gl_shader_decompiler: Implement PBK and BRK
| * | | | | | | | gl_shader_decompiler: Implement PBK and BRKReinUsesLisp2018-10-182-22/+43
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1550 from FernandoS27/fmul32bunnei2018-10-232-3/+8
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Added Saturation to FMUL32I
| * | | | | | | Added Saturation to FMUL32IFernandoS272018-10-232-3/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1543 from lioncash/targetbunnei2018-10-231-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Use target_compile_definitions instead of add_definitions to define YUZU_ENABLE_COMPATIBILITY_REPORTING
| * | | | | | | CMakeLists: Use target_compile_definitions instead of add_definitions to define YUZU_ENABLE_COMPATIBILITY_REPORTINGLioncash2018-10-201-1/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the definition constrained to the yuzu target and prevents polluting anything else in the same directory (should that ever happen). It also keeps it consistent with how the USE_DISCORD_PRESENCE definition is introduced below it.
* | | | | | | Merge pull request #1537 from lioncash/shaderbunnei2018-10-231-6/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Minor changes
| * | | | | | | gl_shader_decompiler: Allow std::move to function in SetPredicateLioncash2018-10-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the variable being moved is const, then std::move will always perform a copy (since it can't actually move the data).
| * | | | | | | gl_shader_decompiler: Get rid of variable shadowing warningsLioncash2018-10-201-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A variable with the same name was previously declared in an outer scope.
| * | | | | | | gl_shader_decompiler: Fix a few comment typosLioncash2018-10-201-3/+4
| |/ / / / / /
* | | | | | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-225-0/+91
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | psm: Add psm service and stub commands 0 and 1
| * | | | | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| | | | | | | | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed as connected to official Nintendo Switch dock.
| * | | | | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed to return 100% charge.
| * | | | | | service: Add skeleton for psm serviceZach Hilman2018-10-215-0/+75
| |/ / / / / | | | | | | | | | | | | | | | | | | Seems to be the power controller. Listed in switchbrew under the category PTM services.
* | | | | | Merge pull request #1541 from lioncash/definebunnei2018-10-221-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | web_service/CMakeLists: Make the CPPHTTPLIB_OPENSSL_SUPPORT constrained to the web_service library only
| * | | | | | web_service/CMakeLists: Make the CPPHTTPLIB_OPENSSL_SUPPORT constrained to the web_service library onlyLioncash2018-10-201-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we link in httplib privately, we can also make the definition enabling OpenSSL support private as well. Prevents leaking a definition into other libraries that link with this one, like the core library.
* | | | | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Fix vma boundary check in svcQueryMemory
| * | | | | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This should be comparing against the queried process' vma_map, not the current process'. The only reason this hasn't become an issue yet is we currently only handle one process being active at any time.
* | | | | | Merge pull request #1547 from FernandoS27/fix-fsetbunnei2018-10-222-30/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fixed FSETP and FSET
| * | | | | | Fixed FSETP and FSETFernandoS272018-10-222-30/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1546 from lioncash/svc-againbunnei2018-10-2213-53/+255
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Update service function tables
| * | | | | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-214-2/+109
| | | | | | |
| * | | | | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-214-0/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Added based off information provided by Switchbrew.
| * | | | | | am: Update service function tablesLioncash2018-10-214-15/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from Switchbrew
| * | | | | | prepo: Update service function table.Lioncash2018-10-211-8/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also introduces the new prepo:a2 service. Updated based off information provided by Switchbrew.
| * | | | | | lbl: Update service function table namesLioncash2018-10-211-28/+28
| |/ / / / / | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | | | | Merge pull request #1548 from FernandoS27/fix-vaobunnei2018-10-221-2/+14
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fixed VAOs Float types only returning GL_FLOAT
| * | | | | | Fixed VAOs Float types only returning GL_FLOAT in cases that they had to return GL_HALF_FLOATFernandoS272018-10-221-2/+14
| |/ / / / /
* | | | | | Merge pull request #1544 from DarkLordZach/reinitialize-keys-toolsbunnei2018-10-221-1/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | | qt: Move Reinitialize Keys to Tools menu
| * | | | | qt: Move Reinitialize Keys to Tools menuZach Hilman2018-10-211-1/+7
| |/ / / /
* | | | | Merge pull request #1531 from ogniK5377/hid-fixesbunnei2018-10-212-4/+189
|\ \ \ \ \ | |/ / / / |/| | | | Added auto controller switching to supported controllers and single joycon button rotation
| * | | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
| | | | | | | | | | | | | | | | | | | | This is a subset of the better-hid-2 changes, this fixes input in various games which don't support dual joycons. This pr will search for the next best controller which is supported by the current game
* | | | | gl_shader_decompiler: Move position varying declaration back to gl_shader_genReinUsesLisp2018-10-203-13/+9
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | The intention of declaring them in gl_shader_decompiler was to be able to use blocks to implement geometry shaders. But that wasn't needed in the end and it caused issues when both vertex stages were being used, resulting in a redeclaration of "position".
* | | | Merge pull request #1501 from ReinUsesLisp/half-floatbunnei2018-10-202-0/+458
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Implement H* instructions
| * | | | gl_shader_decompiler: Implement HSET2_RReinUsesLisp2018-10-152-0/+62
| | | | |
| * | | | gl_shader_decompiler: Implement HSETP2_RReinUsesLisp2018-10-152-0/+65
| | | | |
| * | | | gl_shader_decompiler: Implement HFMA2 instructionsReinUsesLisp2018-10-152-0/+85
| | | | |
| * | | | gl_shader_decompiler: Implement HADD2_IMM and HMUL2_IMMReinUsesLisp2018-10-152-0/+73
| | | | |
| * | | | gl_shader_decompiler: Implement non-immediate HADD2 and HMUL2 instructionsReinUsesLisp2018-10-152-0/+75
| | | | |
| * | | | gl_shader_decompiler: Setup base for half float unpacking and settingReinUsesLisp2018-10-152-0/+98
| | | | |
* | | | | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ \ \ \ | | | | | | | | | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemory
| * | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that the changes clarifying the address spaces has been merged, we can wrap the checks that the kernel performs when mapping shared memory (and other forms of memory) into its own helper function and then use those within MapSharedMemory and UnmapSharedMemory to complete the sanitizing checks that are supposed to be done.
* | | | | | Merge pull request #1517 from bunnei/dmabunnei2018-10-209-23/+144
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU/DMA: Flush the source region and invalidate the destination region when doing a DMA transfer.
| * | | | | | GPU: Improved implementation of maxwell DMA (Subv).bunnei2018-10-193-17/+66
| | | | | | |
| * | | | | | decoders: Introduce functions for un/swizzling subrects.bunnei2018-10-192-0/+49
| | | | | | |
| * | | | | | GPU: Invalidate destination address of kepler_memory writes.bunnei2018-10-193-3/+17
| | | | | | |
| * | | | | | fermi_2d: Add support for more accurate surface copies.bunnei2018-10-192-3/+12
| | | | | | |
* | | | | | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: Update function tables
| * | | | | | | es: Update service function tablesLioncash2018-10-191-7/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | audio: Update service function tablesLioncash2018-10-191-17/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | omm: Update service function tablesLioncash2018-10-191-16/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by switchbrew.
| * | | | | | | hid: Update service function tablesLioncash2018-10-191-6/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Added based off information provided by Switchbrew
| * | | | | | | ns: Update service function tableLioncash2018-10-191-6/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | | | | | | set_cal: Update service function tableLioncash2018-10-191-1/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Updated based on information from Switchbrew.
* | | | | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | aoc_u: Stub GetAddOnContentListChangedEvent
| * | | | | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | This event signals the game when new DLC is purchased from the eShop while the game is running. Since, for the forseeable future, yuzu will not have this ability, it seems safe to stub with a dummy event that will never fire. This is needed to boot Sonic Mania Plus (update v1.04).
* | | | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid: Minor cleanup-related changes
| * | | | | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | swap.h only needs to be present in the header for the type aliases and definitions, it's not actually needed in the cpp files though. input.h is just unused entirely in xpad.h
| * | | | | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given it's unused, we may as well toss it.
| * | | | | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| | | | | | | |
| * | | | | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only useful in headers.
| * | | | | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just a lookup table, and since it's private, there's nothing really stateful about it, so we can just move it into the cpp file.
| * | | | | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This literally does nothing.
| * | | | | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These classes are non-trivial and are definitely going to be changed in the future, so we default these to prevent issues with forward declarations, and to keep the compiler from inlining tear-down code.
| * | | | | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | The destructor doesn't need to be a pure-virtual function.
* | | | | | | crypto: Use compressed sizes in offset calculation for KIP decompressionZach Hilman2018-10-201-1/+2
| |/ / / / / |/| | | | | | | | | | | | | | | | | Fixes a fatal crash on start when deriving keys.
* | | | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / / / |/| | | | | | | | | | | | | | Needed by arms due to new hid rework
* | | | | Merge pull request #1523 from lioncash/lockbunnei2018-10-192-9/+27
|\ \ \ \ \ | | | | | | | | | | | | svc: Add missing error checks in svcArbitrateLock/svcArbitrateUnlock
| * | | | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel itself checks whether or not the provided addresses are word aligned before continuing, so we should be doing the same.
| * | | | | common: Add function for checking word alignment to alignment.hLioncash2018-10-181-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be used in a following change to svcArbitrateLock() and svcArbitrateUnlock()
| * | | | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-182-9/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aligning on 4KB pages isn't a Switch-specific thing, so this can be moved to common so it can be used with other things as well.
* | | | | | Merge pull request #1511 from lioncash/contentbunnei2018-10-192-258/+292
|\ \ \ \ \ \ | | | | | | | | | | | | | | content_archive: Minor reorganization changes
| * | | | | | content_archive: Simpify assignment of bktr_base_romfs in the constructorLioncash2018-10-161-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::move doesn't actually dereference the data, so it doesn't matter whether or not the type is null.
| * | | | | | content_archive: Make IsValidNCA() an internally linked functionLioncash2018-10-162-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only ever used within the cpp file, so it can just be an internal function.
| * | | | | | content_archive: Simplify rights ID checkLioncash2018-10-161-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the same as using std::any_of with an inverted predicate.
| * | | | | | content_archive: Split loading into separate functionsLioncash2018-10-162-253/+290
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The constructor alone is pretty large, the reading code should be split into its consistuent parts to make it easier to understand it without having to build a mental model of a 300+ line function.
| * | | | | | content_archive: Pass and take NCASectionHeader instance by referenceLioncash2018-10-162-3/+3
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | Each header is 512 bytes in size, which is kind of an excessive amount to copy all the time when it's possible to avoid doing so.
* | | | | | Merge pull request #1521 from ogniK5377/imp-mmubunnei2018-10-191-8/+42
|\ \ \ \ \ \ | | | | | | | | | | | | | | Used better names for mm:u and fixed a bad stub
| * | | | | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
| | |_|/ / / | |/| | | | | | | | | | | | | | | | InitializeWithId needs to return an id which is a u32 which should be a non zero value
* | | | | | core: Remove unnecessary assert in ArmInterface()Lioncash2018-10-181-2/+1
| |_|/ / / |/| | | | | | | | | | | | | | | | | | | CpuCore already does this sort of checking, so we can just call that instead of duplicating the assertions.
* | | | | Merge pull request #1510 from lioncash/xcibunnei2018-10-183-7/+8
|\ \ \ \ \ | | | | | | | | | | | | XCI: Add function for checking the existence of the program NCA
| * | | | | XCI: Add function for checking the existence of the program NCALioncash2018-10-163-7/+8
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | The only reason the getter existed was to check whether or not the program NCA was null. Instead, we can just provide a function to query for the existence of it, instead of exposing it entirely.
* | | | | Merge pull request #1505 from FernandoS27/tex-3dbunnei2018-10-184-2/+13
|\ \ \ \ \ | |_|/ / / |/| | | | Implemented 3D Textures
| * | | | Clang format and other fixesFernandoS272018-10-181-16/+0
| | | | |
| * | | | Implement Reinterpret Surface, to accurately blit 3D texturesFernandoS272018-10-181-2/+4
| | | | |
| * | | | Implement GetInRange in the Rasterizer CacheFernandoS272018-10-181-0/+16
| | | | |
| * | | | Implement 3D TexturesFernandoS272018-10-184-1/+10
| | | | |
* | | | | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1822-648/+1720
|\ \ \ \ \ | | | | | | | | | | | | "Better Hid" Rework Part 1
| * | | | | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| | | | | | | | | | | | | | | | | | | | | | | | Reason for the change is to allow both docked and undocked mode to work
| * | | | | WipDavid Marcec2018-10-122-3/+23
| | | | | |
| * | | | | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| | | | | | | | | | | | | | | | | | | | | | | | Kirby input still doesn't work, should fix a lot of other games
| * | | | | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| | | | | | | | | | | | | | | | | | | | | | | | Used by Mario Party
| * | | | | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| | | | | | | | | | | | | | | | | | | | | | | | HandheldVariant is for specific games which expect handheld controllers to be at position 8(kirby), however this doesn't fix all games as some games require handhelds to be at position 0(snipperclips)
| * | | | | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| | | | | |
| * | | | | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| | | | | | | | | | | | | | | | | | | | | | | | Fixes arms
| * | | | | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| | | | | |
| * | | | | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| | | | | |
| * | | | | "Better Hid" rework part 1David Marcec2018-10-1022-644/+1500
| | | | | |
* | | | | | Merge pull request #1489 from FernandoS27/fix-tldsbunnei2018-10-181-1/+5
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | shader_decompiler: Fix TLDS
| * | | | | Fix TLDSFernandoS272018-10-141-1/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #1497 from bunnei/flush-framebuffersbunnei2018-10-1815-188/+429
|\ \ \ \ \ | | | | | | | | | | | | Implement flushing in the rasterizer cache
| * | | | | gl_rasterizer_cache: Remove unnecessary block_depth=1 on Flush.bunnei2018-10-181-1/+0
| | | | | |
| * | | | | gl_rasterizer_cache: Remove unnecessary temporary buffer with unswizzle.bunnei2018-10-181-5/+2
| | | | | |
| * | | | | gl_rasterizer_cache: Use AccurateCopySurface for use_accurate_gpu_emulation.bunnei2018-10-162-2/+18
| | | | | |
| * | | | | config: Rename use_accurate_framebuffers -> use_accurate_gpu_emulation.bunnei2018-10-1610-20/+20
| | | | | | | | | | | | | | | | | | | | | | | | - This will be used as a catch-all for slow-but-accurate GPU emulation paths.
| * | | | | rasterizer_cache: Refactor to support in-order flushing.bunnei2018-10-166-63/+116
| | | | | |
| * | | | | gl_rasterizer_cache: Refactor to only call GetRegionEnd on surface creation.bunnei2018-10-162-16/+23
| | | | | |
| * | | | | gl_rasterizer_cache: Only flush when use_accurate_framebuffers is enabled.bunnei2018-10-162-2/+13
| | | | | |
| * | | | | gl_rasterizer_cache: Separate guest and host surface size managment.bunnei2018-10-162-92/+94
| | | | | |
| * | | | | gl_rasterizer_cache: Rename GetGLBytesPerPixel to GetBytesPerPixel.bunnei2018-10-162-17/+18
| | | | | | | | | | | | | | | | | | | | | | | | - This does not really have anything to do with OpenGL.
| * | | | | gl_rasterizer_cache: Remove unused FlushSurface method.bunnei2018-10-162-7/+0
| | | | | |
| * | | | | gl_rasterizer: Implement flushing.bunnei2018-10-161-1/+25
| | | | | |
| * | | | | gl_rasterizer_cache: Remove usage of Memory::Read/Write functions.bunnei2018-10-161-13/+8
| | | | | | | | | | | | | | | | | | | | | | | | - These cannot be used within the cache, as they change cache state.
| * | | | | gl_rasterizer_cache: Clamp cached surface size to mapped GPU region size.bunnei2018-10-162-19/+37
| | | | | |
| * | | | | memory_manager: Add a method for querying the end of a mapped GPU region.bunnei2018-10-162-0/+11
| | | | | |
| * | | | | rasterizer_cache: Reintroduce method for flushing.bunnei2018-10-163-0/+23
| | | | | |
| * | | | | gl_rasterizer_cache: Reintroduce code for handling swizzle and flush to guest RAM.bunnei2018-10-162-28/+119
| | |_|/ / | |/| | |
* | | | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \ \ \ | | | | | | | | | | | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()
| * | | | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | So, one thing that's puzzled me is why the kernel seemed to *not* use the direct code address ranges in some cases for some service functions. For example, in svcMapMemory, the full address space width is compared against for validity, but for svcMapSharedMemory, it compares against 0xFFE00000, 0xFF8000000, and 0x7FF8000000 as upper bounds, and uses either 0x200000 or 0x8000000 as the lower-bounds as the beginning of the compared range. Coincidentally, these exact same values are also used in svcGetInfo, and also when initializing the user address space, so this is actually retrieving the ASLR extents, not the extents of the address space in general.
* | | | | | Merge pull request #1496 from FernandoS27/tex-arraybunnei2018-10-181-14/+55
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement Arrays on Tex Instruction
| * | | | | | Implement Arrays on Tex InstructionFernandoS272018-10-141-14/+55
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1509 from DarkLordZach/device-save-databunnei2018-10-181-1/+12
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | savedata_factory: Add DeviceSaveData and fix TemporaryStorage
| * | | | | savedata_factory: Add TemporaryStorage SaveDataSpaceIdZach Hilman2018-10-161-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | Required for TemporaryStorage saves (in addition to SaveDataType)
| * | | | | savedata_factory: Add support for DeviceSaveDataZach Hilman2018-10-161-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | Uses the same path as SaveData except with UID 0. Adds a warning if UID is not 0.
* | | | | | Merge pull request #1443 from DarkLordZach/lower-loader-logs-1bunnei2018-10-162-3/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | content_archive/patch_manager: Lower log levels to eliminate some unnecessary logs
| * | | | | | patch_manager: Move non-Program RomFS patch log to DebugZach Hilman2018-10-131-2/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Normal Program-type patches will still be logged to aid in debugging, but for others (mainly Control), it was moved to Debug.
| * | | | | | content_archive: Move get key log to Trace levelZach Hilman2018-10-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids printing live keys in the general log.
* | | | | | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement VI ConvertScalingMode * Fixed push enum * Scale mode now uses Nintendo scale mode as an enum as well
* | | | | | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-1612-60/+76
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Convert shared_ptr instances into unique_ptr instances where applicable for System and Cpu
| * | | | | | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-1510-31/+50
| | | | | | | |
| * | | | | | | core: Make the live Cpu instances unique_ptrs instead of shared_ptrsLioncash2018-10-151-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need for shared ownership here, as the only owning class instance of those Cpu instances is the System class itself. We can also make the thread_to_cpu map use regular pointers instead of shared_ptrs, given that the Cpu instances will always outlive the cases where they're used with that map.
| * | | | | | | core: Make the exclusive monitor a unique_ptr instead of a shared_ptrLioncash2018-10-155-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the barrier, this is owned entirely by the System and will always outlive the encompassing state, so shared ownership semantics aren't necessary here.
| * | | | | | | core: Make CPUBarrier a unique_ptr instead of a shared_ptrLioncash2018-10-153-11/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will always outlive the Cpu instances, since it's destroyed after we destroy the Cpu instances on shutdown, so there's no need for shared ownership semantics here.
* | | | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-1612-51/+53
| |_|/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The data retrieved in these cases are ultimately chiefly owned by either the RegisteredCache instance itself, or the filesystem factories. Both these should live throughout the use of their contained data. If they don't, it should be considered an interface/design issue, and using shared_ptr instances here would mask that, as the data would always be prolonged after the main owner's lifetime ended. This makes the lifetime of the data explicit and makes it harder to accidentally create cyclic references. It also makes the interface slightly more flexible than the previous API, as a shared_ptr can be created from a unique_ptr, but not the other way around, so this allows for that use-case if it ever becomes necessary in some form.
* | | | | | | Merge pull request #1473 from lioncash/cmakebunnei2018-10-167-199/+214
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | web_service: Make linkage of web_service-related externals and the library private
| * | | | | | | core/CMakeLists: Make all web_service-related libraries privateLioncash2018-10-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that all external dependencies are hidden, we can remove json-headers from the publically linked libraries, as the use of this library is now completely hidden from external users of the web_service library. We can also make the web_services library private as well, considering it's not a requirement. If a library needs to link in web_service, it should be done explicitly -- not via indirect linking.
| * | | | | | | web_backend: Make Client use the PImpl idiomLioncash2018-10-115-142/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like with TelemetryJson, we can make the implementation details private and avoid the need to expose httplib to external libraries that need to use the Client class.
| * | | | | | | telemetry_json: Use the PImpl idiom to avoid unnecessary dependency exposureLioncash2018-10-112-49/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Users of the web_service library shouldn't need to care about an external library like json.h. However, given it's exposed in our interface, this requires that other libraries publicly link in the JSON library. We can do better. By using the PImpl idiom, we can hide this dependency in the cpp file and remove the need to link that library in altogether.
| * | | | | | | telemetry_json: Add missing override specifier to the destructor of TelemetryJsonLioncash2018-10-111-1/+1
| | | | | | | |
| * | | | | | | telemetry_json: Take std::string parameters by valueLioncash2018-10-112-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Taking them by const reference isn't advisable here, because it means the std::move calls were doing nothing and we were always copying the std::string instances.
| * | | | | | | telemetry_json: Remove unnecessary includesLioncash2018-10-112-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes unused includes. Also rectifies a missing <chrono> include.
| * | | | | | | core/CMakeLists: Use target_compile_definitions instead of add_definitions for specifying ENABLE_WEB_SERVICELioncash2018-10-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids introducing the definition to the whole directory space and localizes it to being added to the library that needs it.
* | | | | | | | Merge pull request #1487 from lioncash/maybe-unusedbunnei2018-10-161-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu/main: Apply the [[maybe_unused]] attribute to the parameter of SetDiscordEnabled
| * | | | | | | | yuzu/main: Apply the [[maybe_unused]] attribute to the parameter of SetDiscordEnabled()Lioncash2018-10-131-1/+1
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Depending on whether or not USE_DISCORD_PRESENCE is defined, the "state" parameter can be used or unused. If USE_DISCORD_PRESENCE is not defined, the parameter will be considered unused, which can lead to compiler warnings. So, we can explicitly mark it with [[maybe_unused]] to inform the compiler that this is intentional.
* | | | | | | | file_sys/control_metadata: Get rid of magic constantsLioncash2018-10-161-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are just the size of the data being passed in, so we can specify that via the size() member function.
* | | | | | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-163-3/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | aoc: Fix various bugs in current AOC implementation
| * | | | | | | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-153-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | Falls back to title ID + 0x1000, which is what HOS does.
| * | | | | | | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #1499 from lioncash/nrobunnei2018-10-157-28/+39
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nro/nso: Minor error handling changes
| * | | | | | | | nso: Return an optional address from LoadModuleLioncash2018-10-155-16/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a malformed NSO is attempted to be loaded, we shouldn't continue onwards. We should be reporting an error and bailing out.
| * | | | | | | | nso: Make LoadModule take a VfsFile by const referenceLioncash2018-10-153-11/+9
| | | | | | | | |
| * | | | | | | | nro: Make LoadNro take a VfsFile by const referenceLioncash2018-10-152-6/+6
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to care about ownership semantics, so we can just pass it a reference to the file itself, rather than a std::shared_ptr alias.
* | | | | | | | Merge pull request #1500 from DarkLordZach/key-derivation-6.0.0bunnei2018-10-152-4/+8
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | crypto: Various crypto fixes for quickstart guide
| * | | | | | | | crypto: Various crypto fixes for quickstart guideZach Hilman2018-10-152-4/+8
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | shader_bytecode: Add Control Code enum 0xfReinUsesLisp2018-10-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Control Code 0xf means to unconditionally execute the instruction. This value is passed to most BRA, EXIT and SYNC instructions (among others) but this may not always be the case.
* | | | | | | | gl_shader_decompiler: Fixup style inconsistenciesReinUsesLisp2018-10-151-5/+3
| | | | | | | |
* | | | | | | | gl_rasterizer: Silence implicit cast warning in glBindBufferRangeReinUsesLisp2018-10-151-1/+2
|/ / / / / / /
* | | | | | | Merge pull request #1486 from lioncash/filebunnei2018-10-144-63/+72
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | key_manager/partition_data_manager: Minor changes
| * | | | | | | partition_data_manager: Reserve and insert data within output vector in DecryptPackage2()Lioncash2018-10-131-20/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just reserve the memory then perform successive insertions instead of needing to use memcpy. This also avoids the need to zero out the output vector's memory before performing the insertions. We can also std::move the output std::vector into the destination so that we don't need to make a completely new copy of the vector, getting rid of an unnecessary allocation. Additionally, we can use iterators to determine the beginning and end ranges of the std::vector instances that comprise the output vector, as the end of one range just becomes the beginning for the next successive range, and since std::vector's iterator constructor copies data within the range [begin, end), this is more straightforward and gets rid of the need to have an offset variable that keeps getting incremented to determine where to do the next std::memcpy.
| * | | | | | | partition_data_manager: Remove unused std::map instance within DecryptPackage2()Lioncash2018-10-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Aside from emplacing elements into the map, the map itself is never actually queried for contained data.
| * | | | | | | partition_data_manager: Take package2_keys by const referenceLioncash2018-10-132-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are only ever read from, so we don't need to make a copy of all the keys here.
| * | | | | | | partition_data_manager: Move IV data to where it's needed in DecryptPackage2()Lioncash2018-10-131-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given it's only used in one spot and has a fairly generic name, we can just specify it directly in the function call. This also the benefit of automatically moving it.
| * | | | | | | partition_data_manager: Remove commented out codeLioncash2018-10-131-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commented out code shouldn't be left in without a reason indicating why in a comment.
| * | | | | | | key_manager/partition_data_manager: Silence truncation compiler warningsLioncash2018-10-134-10/+15
| | | | | | | |
| * | | | | | | partition_data_manager: Dehardcode array boundsLioncash2018-10-132-7/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we can make it part of the type and make named variables for them, so they only require one definition (and if they ever change for whatever reason, they only need to be changed in one spot).
| * | | | | | | partition_data_manager: Take VirtualFile by const reference in constructorLioncash2018-10-132-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the VirtualFile instance isn't stored into the class as a data member, or written to, this can just be turned into a const reference, as the constructor doesn't need to make a copy of it.
| * | | | | | | partition_data_manager: Amend constructor initializer list orderLioncash2018-10-131-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the members in the exact order they would be initialized. This also prevents compiler warnings about this sort of thing.
| * | | | | | | partition_data_manager: Remove unused includesLioncash2018-10-132-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets unused includes out of the headers and moves them into the cpp file if they're used there instead.
| * | | | | | | key_manager: Use std::vector's insert() instead of std::copy with a back_inserterLioncash2018-10-131-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the data is unconditionally being appended to the back of a std::vector, we can just directly insert it there without the need to insert all of the elements one-by-one with a std::back_inserter.
| * | | | | | | key_manager: Brace long conditional bodyLioncash2018-10-131-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If a conditional (or it's body) travels more than one line, it should be braced.
| * | | | | | | key_manager: Don't assume file seeks and reads will always succeedLioncash2018-10-131-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the filesystem should always be assumed to be volatile, we should check and bail out if a seek operation isn't successful. This'll prevent potentially writing/returning garbage data from the function in rare cases. This also allows removing a check to see if an offset is within the bounds of a file before perfoming a seek operation. If a seek is attempted beyond the end of a file, it will fail, so this essentially combines two checks into one in one place.
| * | | | | | | key_manager: Remove unnecessary seek in DeriveSDSeed()Lioncash2018-10-131-1/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the file is opened a few lines above and no operations are done, other than check if the file is in a valid state, the read/write pointer will always be at the beginning of the file.
* | | | | | | Merge pull request #1490 from lioncash/bootbunnei2018-10-141-14/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu/main: Simplify OnMenuLoadFile()
| * | | | | | | yuzu/main: Simplify OnMenuLoadFile()Lioncash2018-10-131-14/+12
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can utilize QStringList's join() function to perform all of the appending in a single function call. While we're at it, make the extension list a single translatable string and add a disambiguation comment to explain to translators what %1 actually is.
* | | | | | | Merge pull request #1488 from Hexagon12/astc-typesbunnei2018-10-143-6/+32
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Added ASTC 5x4; 8x5 types
| * | | | | | | Added ASTC 5x4; 8x5Hexagon122018-10-133-6/+32
| | | | | | | |
* | | | | | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-147-20/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem by reference
| * | | | | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-137-20/+19
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither of these functions alter the ownership of the provided pointer, so we can simply make the parameters a reference rather than a direct shared pointer alias. This way we also disallow passing incorrect memory values like nullptr.
* | | | | | | | Merge pull request #1480 from FernandoS27/neue-swizzlebunnei2018-10-148-107/+176
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | Introduce 3D Swizzle seamlessly
| * | | | | | | Shorten the implementation of 3D swizzle to only 3 functionsFernandoS272018-10-141-70/+27
| | | | | | | |
| * | | | | | | Fix a Crash on Zelda BotW and Splatoon 2, and simplified LoadGLBufferFernandoS272018-10-132-19/+2
| | | | | | | |
| * | | | | | | Propagate depth and depth_block on modules using decodersFernandoS272018-10-138-54/+67
| | | | | | | |
| * | | | | | | Remove old Swizzle algorithms and use 3d SwizzleFernandoS272018-10-131-93/+69
| | | | | | | |
| * | | | | | | Implement Precise 3D SwizzleFernandoS272018-10-131-3/+71
| | | | | | | |
| * | | | | | | Implement Fast 3D SwizzleFernandoS272018-10-131-2/+74
| |/ / / / / /
* | | | | | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | svc: Implement svcGetProcessInfo
| * | | | | | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A fairly basic service function, which only appears to currently support retrieving the process state. This also alters the ProcessStatus enum to contain all of the values that a kernel process seems to be able of reporting with regards to state.
* / / / / / / Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / / / / / | | | | | | | | | | | | | | | | | | This should help diagnose crashes easier and prevent many users thinking that a game is still running when in fact it's just an audio thread still running(this is typically not killed when svcBreak is hit since the game expects us to do this)
* | | | | | Merge pull request #1409 from DarkLordZach/key-derivationbunnei2018-10-1310-74/+1663
|\ \ \ \ \ \ | | | | | | | | | | | | | | crypto: Add support for full key derivation
| * | | | | | partition_data_manager: Rename system files for hekateZach Hilman2018-10-076-195/+247
| | | | | | | | | | | | | | | | | | | | | | | | | | | | x
| * | | | | | qt: Add rederive keyset menu optionZach Hilman2018-10-073-49/+89
| | | | | | |
| * | | | | | qt: Add key derivation progress bar on initial setupZach Hilman2018-10-071-0/+52
| | | | | | |
| * | | | | | crypto: Add PartitionDataManagerZach Hilman2018-10-073-0/+692
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps track of system files for key derivation
| * | | | | | key_manager: Add support for loading keys from partition dataZach Hilman2018-10-072-0/+88
| | | | | | |
| * | | | | | key_manager: Add ETicket key derivationZach Hilman2018-10-073-2/+277
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Derives titlekeys
| * | | | | | key_manager: Add base key derivationZach Hilman2018-10-072-4/+220
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Derives master keys, game encryption keys, and package1/2 keys
| * | | | | | key_manager: Add BIS key getterZach Hilman2018-10-072-2/+19
| | | | | | |
| * | | | | | key_manager: Add support for more keysZach Hilman2018-10-072-3/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | TSEC, SBK, BIS, and other Sources for proper derivation
| * | | | | | key_manager: Add keyblob supportZach Hilman2018-10-072-0/+14
| | | | | | |
| * | | | | | key_manager: Add support for crypto revisions past 04Zach Hilman2018-10-071-43/+63
| | | | | | |
| * | | | | | key_manager: Add support for comments in keyfilesZach Hilman2018-10-071-0/+3
| | | | | | |
| * | | | | | vfs: Move forward declarations to separate fileZach Hilman2018-10-072-9/+22
| | | | | | |
| * | | | | | key_manager: Add support for console-specific keyfileZach Hilman2018-10-072-3/+13
| | | | | | |
| * | | | | | key_manager: Rename KEK to KekZach Hilman2018-10-072-8/+9
| | | | | | |
* | | | | | | Merge pull request #1483 from lioncash/codesetbunnei2018-10-137-83/+45
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/process: Make CodeSet a regular non-inherited object
| * | | | | | | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-127-83/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These only exist to ferry data into a Process instance and end up going out of scope quite early. Because of this, we can just make it a plain struct for holding things and just std::move it into the relevant function. There's no need to make this inherit from the kernel's Object type.
* | | | | | | | Merge pull request #1484 from FernandoS27/calculate-sizebunnei2018-10-132-0/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implemented helper function to correctly calculate a texture's size
| * | | | | | | | Implemented helper function to correctly calculate a texture's sizeFernandoS272018-10-122-0/+22
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemory
| * | | | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixed incorrect types for svcBreak
| * | | | | | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| | | | | | | |
| * | | | | | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | signal_debugger seems like a more fitting name
| * | | | | | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | svcBreak reason should be a u32, not a u64.
* | | | | | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Passing an invalid nmap handle to Remap should throw an error
| * | | | | | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| | | | | | | |
| * | | | | | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Added error for invalid nmap handles
* | | | | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | thread: Remove unnecessary memset from ResetThreadContext()
| * | | | | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Regular value initialization is adequate here for zeroing out data. It also has the benefit of not invoking undefined behavior if a non-trivial type is ever added to the struct for whatever reason.
* | | | | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Added error codes for nvmap
| * | | | | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| | | | | | |
| * | | | | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ / / / /
* | | | | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | HwOpus, Implemented DecodeInterleavedWithPerformance
| * | | | | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / / / / | | | | | | | | | | | | | | | | | | Used by sonic ages
* | | | | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemory
| * | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This adds the missing address range checking that the service functions do before attempting to map or unmap memory. Given that both service functions perform the same set of checks in the same order, we can wrap these into a function and just call it from both functions, which deduplicates a little bit of code.
* | | | | | Merge pull request #1476 from bunnei/fix-unmap-flushbunnei2018-10-111-3/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvhost_as_gpu: Flush/invalidate CPU VAddr on UnmapBuffer.
| * | | | | | nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
| | |/ / / / | |/| | | |
* / | | | | gl_shader_decompiler: Implement VMADReinUsesLisp2018-10-112-0/+118
|/ / / / /
* | | | | Merge pull request #1458 from FernandoS27/fix-render-target-block-settingsbunnei2018-10-115-18/+81
|\ \ \ \ \ | |/ / / / |/| | | | Fixed block height settings for RenderTargets and Depth Buffers
| * | | | Add memory Layout to Render Targets and Depth BuffersFernandoS272018-10-103-21/+33
| | | | |
| * | | | Fixed block height settings for RenderTargets and Depth Buffers, and added block width and block depthFernandoS272018-10-105-12/+63
| | | | |
* | | | | Merge pull request #1460 from FernandoS27/scissor_testbunnei2018-10-103-1/+36
|\ \ \ \ \ | | | | | | | | | | | | Implemented Scissor Testing
| * | | | | Implement Scissor TestFernandoS272018-10-091-4/+9
| | | | | |
| * | | | | Assert Scissor testsFernandoS272018-10-093-1/+31
| |/ / / /
* | | | | Merge pull request #1425 from ReinUsesLisp/geometry-shadersbunnei2018-10-1011-120/+543
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement geometry shaders
| * | | | | gl_shader_decompiler: Move position varying location from 15 to 0 and apply an offsetReinUsesLisp2018-10-071-6/+10
| | | | | |
| * | | | | gl_shader_decompiler: Implement geometry shadersReinUsesLisp2018-10-0710-107/+522
| | | | | |
| * | | | | video_core: Allow LabelGLObject to use extra info on any objectReinUsesLisp2018-10-071-10/+14
| | |_|/ / | |/| | |
* | | | | kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-1010-39/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no real need to use a shared pointer in these cases, and only makes object management more fragile in terms of how easy it would be to introduce cycles. Instead, just do the simple thing of using a regular pointer. Much of this is just a hold-over from citra anyways. It also doesn't make sense from a behavioral point of view for a process' thread to prolong the lifetime of the process itself (the process is supposed to own the thread, not the other way around).
* | | | | Merge pull request #1461 from lioncash/warnbunnei2018-10-101-3/+3
|\ \ \ \ \ | | | | | | | | | | | | ips_layer: Silence truncation and conversion warnings
| * | | | | ips_layer: Silence truncation and conversion warningsLioncash2018-10-091-3/+3
| | |/ / / | |/| | | | | | | | | | | | | Makes type conversions explicit to avoid compiler warnings.
* | | | | Merge pull request #1464 from lioncash/uniquebunnei2018-10-107-21/+18
|\ \ \ \ \ | |_|_|/ / |/| | | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptr
| * | | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptrLioncash2018-10-097-21/+18
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Neither of these functions require the use of shared ownership of the returned pointer. This makes it more difficult to create reference cycles with, and makes the interface more generic, as std::shared_ptr instances can be created from a std::unique_ptr, but the vice-versa isn't possible. This also alters relevant functions to take NCA arguments by const reference rather than a const reference to a std::shared_ptr. These functions don't alter the ownership of the memory used by the NCA instance, so we can make the interface more generic by not assuming anything about the type of smart pointer the NCA is contained within and make it the caller's responsibility to ensure the supplied NCA is valid.
* | | | Merge pull request #1466 from lioncash/unusedbunnei2018-10-101-7/+3
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Remove unused variables in TMML's implementation
| * | | | gl_shader_decompiler: Remove unused variables in TMML's implementationLioncash2018-10-091-7/+3
| |/ / / | | | | | | | | | | | | | | | | Given "y" isn't always used, but "x" is, we can rearrange this to avoid unused variable warnings by changing the names of op_a and op_b
* | | | Merge pull request #1463 from FearlessTobi/port-4310bunnei2018-10-104-10/+131
|\ \ \ \ | | | | | | | | | | Port citra-emu/citra#4310: "Handle touch input"
| * | | | implemented touch in Qt and SDLNeatNit2018-10-094-10/+131
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | change TouchToPixelPos to return std::pair<int, int> static_cast (SDL) various minor style and code improvements style - PascalCase for function names made touch events private const pointer arg in touch events make TouchToPixelPos a const member function did I do this right? braces on barely-multiline if remove question comment (confirmed in Discord) fixed consts remove unused parameter from TouchEndEvent DRY - High-DPI scaled touch put in separate function also fixes a bug where if you start touching (with either mouse or touchscreen) and drag the mouse to the LEFT of the emulator window, the touch point jumps to the RIGHT side of the touchscreen; draggin to above the window would make it jump to the bottom. implicit conversion from QPoint to QPointF, apparently I have no idea what const even means but I'll put it here anyway remove unused or used-once variables make touch scaling functions const, and put their implementations together removed unused FingerID parameters QTouchEvent forward declaration; add comment to TouchBegin that was lost in an edit better DRY in SDL To do -> TODO(NeatNit) remove unused include
* | | | Merge pull request #1459 from ogniK5377/breakbunnei2018-10-091-5/+20
|\ \ \ \ | | | | | | | | | | svcBreak, Signalling to the debugger should not kill execution
| * | | | Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
| | | | |
| * | | | Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
| | | | |
| * | | | svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
| | | | | | | | | | | | | | | | | | | | When loading NROs, svcBreak is called to signal to the debugger that a new "module" is loaded. As no debugger is technically attached we shouldn't be killing the programs execution.
* | | | | Merge pull request #1465 from lioncash/telemetrybunnei2018-10-092-7/+9
|\ \ \ \ \ | | | | | | | | | | | | telemetry_session: Minor miscellaneous changes
| * | | | | telemetry_session: Remove doxygen comment for a non-existent parameterLioncash2018-10-091-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | There's no "func" parameter, so this can just be removed.
| * | | | | telemetry_session: Add missing includesLioncash2018-10-092-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents potential compilation issues in the future by including missing headers for certain functions and types.
| * | | | | telemetry_session: Remove unimplemented FinalizeAsyncJob prototypeLioncash2018-10-091-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | This isn't implemented anywhere, so it can just be removed.
| * | | | | telemetry_session: Use a std::array in GenerateTelemetryId()Lioncash2018-10-091-2/+4
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | We don't need to potentially heap-allocate a std::string instance here, given the data is known ahead of time. We can just place it within an array and pass this to the mbedtls functions.
* | | | | Merge pull request #1462 from lioncash/movebunnei2018-10-092-20/+60
|\ \ \ \ \ | | | | | | | | | | | | ips_layer: Minor miscellaneous changes
| * | | | | ips_layer: Avoid constructing std::vector instances where not necessaryLioncash2018-10-091-6/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just compare the existing std::vector instance with a constexpr std::array containing the desired match. This is lighter resource-wise, as we don't need to allocate on the heap.
| * | | | | ips_layer: Remove unnecessary explicit std::pair constructor in std::arrayLioncash2018-10-091-5/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the layout of the array consistent, by making all elements match, instead of special-casing the first one.
| * | | | | ips_layer: Add missing includesLioncash2018-10-092-7/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds missing includes to prevent potential compilation issues in the future. Also moves the definition of a struct into the cpp file, so that some includes don't need to be introduced within the header.
| * | | | | ips_layer: std::move data within PatchIPS() and Apply()Lioncash2018-10-091-2/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | We don't need to make a copy of the read data, so we can std::move it into the make_shared call here.
* | | | | Merge pull request #1455 from ogniK5377/smo-softlockfixbunnei2018-10-092-15/+123
|\ \ \ \ \ | |/ / / / |/| | | | Fixed smo softlock due to incorrect effect state updating
| * | | | EffectOutStatus padding is now in hexDavid Marcec2018-10-091-1/+1
| | | | |
| * | | | Fixups for softlockDavid Marcec2018-10-072-6/+7
| | | | |
| * | | | Fixed missing returnDavid Marcec2018-10-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Softlock explanation: after effects are initialized in smo, nothing actually changes the state. It expects the state to always be initialized. With the previous testing, updating the states much like how we handle the memory pools continue to have the softlock(which is why I said it probably wasn't effects) after further examination it seems like effects need to be initialized but the state remains unchanged until further notice. For now, assertions are added for the aux buffers to see if they update, unable to check as I haven't gotten smo to actually update them yet.
| * | | | Fixed smo softlockDavid Marcec2018-10-072-13/+120
| | | | |
* | | | | Merge pull request #1423 from DarkLordZach/romfs-file-extsbunnei2018-10-085-10/+38
|\ \ \ \ \ | | | | | | | | | | | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFS
| * | | | | patch_manager: Avoid romfs_ext requirement for patchingZach Hilman2018-10-041-4/+1
| | | | | |
| * | | | | fsmitm_romfsbuild: Extract stubs and IPS to romfs_ext dirZach Hilman2018-10-045-21/+38
| | | | | |
| * | | | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFSZach Hilman2018-10-041-0/+14
| | | | | |
* | | | | | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-086-23/+323
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | ips_layer: Add support for IPSwitch executable patches
| * | | | | ips_layer: Fix inaccuracies with comments and flagsZach Hilman2018-10-043-16/+51
| | | | | | | | | | | | | | | | | | Specifically bugs/crashes that arise when putting them in positions that are legal but not typical, such as midline, between patch data, or between patch records.
| * | | | | ips_layer: Deduplicate resource usageZach Hilman2018-10-045-33/+39
| | | | | |
| * | | | | ips_layer: Add support for escape sequences and midline commentsZach Hilman2018-10-043-8/+41
| | | | | | | | | | | | | | | | | | | | | | | | More accurately follows IPSwitch specification.
| * | | | | patch_manager: Add support for IPSwitch format patchesZach Hilman2018-10-041-22/+56
| | | | | |
| * | | | | ips_layer: Add IPSwitchCompiler to process IPSwitch formatZach Hilman2018-10-042-0/+168
| | | | | |
| * | | | | hex_util: Add HexVectorToString and HexStringToVectorZach Hilman2018-10-042-0/+24
| |/ / / / | | | | | | | | | | | | | | | Converts between bytes and strings when the size is not known at compile time.
* | | | | Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ \ \ \ \ | | | | | | | | | | | | Fixed assertion due to CountAddOnContent & Casting warnings
| * | | | | Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | Word count should be 3 since we're pushing a result code and a u32. Also fixed up compiler warnings due to casting
* | | | | Merge pull request #1457 from ogniK5377/unmap-bufferbunnei2018-10-081-1/+6
|\ \ \ \ \ | | | | | | | | | | | | Unmapping an unmapped buffer should succeed
| * | | | | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
| |/ / / / | | | | | | | | | | | | | | | Hardware tests show that trying to unmap an unmapped buffer already should always succeed. Hardware test was tested up to 32 iterations of attempting to unmap
* | | | | nso/nro: Use default allocation size for arg_dataZach Hilman2018-10-074-14/+20
| | | | |
* | | | | cmd: Support passing game arguments from command lineZach Hilman2018-10-074-10/+14
| | | | | | | | | | | | | | | | | | | | Uses -p (--program) and following string as args.
* | | | | qt: Add UI option to configure argumentsZach Hilman2018-10-073-0/+27
| | | | |
* | | | | settings: Add program_args string settingZach Hilman2018-10-071-0/+1
| | | | |
* | | | | nso/nro: Add NSO arguments structure to data sectionZach Hilman2018-10-074-3/+38
|/ / / / | | | | | | | | | | | | Only added if arguments string is non-empty and a pass is requested by loader.
* | | | Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-0716-21/+143
|\ \ \ \ | | | | | | | | | | loader: Add support for packed updates
| * | | | romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-0510-9/+38
| | | | |
| * | | | patch_manager: Add support for NSP packed updatesZach Hilman2018-10-052-3/+10
| | | | | | | | | | | | | | | | | | | | Reads as Update (NSP) in add-ons
| * | | | game_list: Add XCI update versioning to game listZach Hilman2018-10-051-4/+8
| | | | |
| * | | | patch_manager: Add support for packed updatesZach Hilman2018-10-054-5/+18
| | | | | | | | | | | | | | | | | | | | Will prefer any installed update over the packed version.
| * | | | loader: Add getter for packed updateZach Hilman2018-10-056-3/+58
| | | | | | | | | | | | | | | | | | | | Reads the update included with the game if it has one and adds the new ErrorNoPackedUpdate status.
| * | | | loader: Add ReadRomFSIVFCOffset to NSP, XCI, and NAX loadersZach Hilman2018-10-056-6/+20
| |/ / / | | | | | | | | | | | | Fixes errors with certain updates
* | | | Merge pull request #1446 from bunnei/fast_fermi_copybunnei2018-10-0710-40/+121
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement accelerated Fermi2D copies.
| * | | | yuzu/yuzu_cmd: Add checks for required extension ARB_copy_image.bunnei2018-10-062-0/+4
| | | | |
| * | | | fermi_2d: Implement simple copies with AccelerateSurfaceCopy.bunnei2018-10-063-24/+36
| | | | |
| * | | | gl_rasterizer: Add rasterizer cache code to handle accerated fermi copies.bunnei2018-10-065-16/+60
| | | | |
| * | | | gl_rasterizer_cache: Implement a simpler surface copy using glCopyImageSubData.bunnei2018-10-061-0/+21
| | |/ / | |/| |
* | | | Merge pull request #1437 from FernandoS27/tex-mode2bunnei2018-10-076-69/+265
|\ \ \ \ | | | | | | | | | | Implemented Depth Compare, Shadow Samplers and Texture Processing Modes for TEXS and TLDS
| * | | | Implemented Depth Compare and Shadow SamplersFernandoS272018-10-066-65/+224
| | | | |
| * | | | Implemented Texture Processing Modes in TEXS and TLDSFernandoS272018-10-031-5/+42
| | | | |
* | | | | Merge pull request #1453 from FearlessTobi/port-4311bunnei2018-10-071-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Port citra-emu/citra#4311: "Remove "#" in the version number"
| * | | | | Remove "#" in the version numberfearlessTobi2018-10-061-1/+1
| | |/ / / | |/| | | | | | | | | | | | | So that people can stop using it in issue/pr comments and randomly link some other issue/pr unintentionally.
* | | | | Merge pull request #1451 from FearlessTobi/port-4140bunnei2018-10-075-19/+119
|\ \ \ \ \ | |_|_|_|/ |/| | | | Port citra-emu/citra#4140: "misc input tab improvements"
| * | | | citra_qt/configuration: misc input tab improvementszhupengfei2018-10-065-19/+119
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added a context menu on the buttons including Clear & Restore Default * Allow clearing (unsetting) inputs. Added a Clear All button * Allow restoring a single input to default (instead of all)
* | | | Merge pull request #1448 from ogniK5377/frontend-accessbunnei2018-10-074-0/+26
|\ \ \ \ | | | | | | | | | | Ported #4296 from citra
| * | | | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| | | | |
| * | | | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
| | | | | | | | | | | | | | | | | | | | This will allow us to easily remove the use of "NFC" in "System"
* | | | | Merge pull request #1454 from ReinUsesLisp/fixup-drawMat M2018-10-071-0/+1
|\ \ \ \ \ | |_|/ / / |/| | | | gl_rasterizer: Fixup undefined behaviour in SetupDraw
| * | | | gl_rasterizer: Fixup undefined behaviour in SetupDrawReinUsesLisp2018-10-071-0/+1
| | | | |
* | | | | qt: Update telemetry linksLioncash2018-10-062-2/+2
| | | | | | | | | | | | | | | | | | | | These were pointing to a non-existent webpage.
* | | | | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-0636-35/+1552
|\ \ \ \ \ | |_|/ / / |/| | | | Port web_service from Citra
| * | | | Review comments - part 5fearlessTobi2018-10-024-8/+7
| | | | |
| * | | | Review comments -part 4fearlessTobi2018-10-023-2/+7
| | | | |
| * | | | Review comments - part 3fearlessTobi2018-10-026-25/+7
| | | | |
| * | | | web_backend: protect jwt cache with a mutexWeiyi Wang2018-10-022-1/+4
| | | | |
| * | | | Address more review commentsfearlessTobi2018-10-021-1/+1
| | | | |
| * | | | Address a bunch of review commentsfearlessTobi2018-10-0211-19/+27
| | | | |
| * | | | Port web_service from CitrafearlessTobi2018-10-0237-34/+1554
| | |/ / | |/| |
* | | | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | This was the result of a typo accidentally introduced in e51d715700a35a8f14e5b804b6f7553c9a40888b. This restores the previous correct behavior. The behavior with the reference was incorrect and would cause some games to fail to boot.
* | | Merge pull request #1440 from lioncash/arraybunnei2018-10-063-5/+10
|\ \ \ | | | | | | | | ui_settings: Place definition of the theme array within the cpp file
| * | | ui_settings: Place definition of the theme array within the cpp fileLioncash2018-10-043-5/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Placing the array wholesale into the header places a copy of the whole array into every translation unit that uses the data, which is wasteful. Particularly given that this array is referenced from three different translation units. This also changes the array to contain pairs of const char*, rather than QString instances. This way, the string data is able to be fixed into the read-only segment of the program, as well as eliminate static constructors/heap allocation immediately on program start.
* | | | Merge pull request #1438 from ReinUsesLisp/quadsbunnei2018-10-068-46/+236
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement quads topology
| * | | | gl_rasterizer: Implement quads topologyReinUsesLisp2018-10-048-46/+236
| | | | |
* | | | | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Conceptually, it doesn't make sense for a thread to be able to persist the lifetime of a scheduler. A scheduler should be taking care of the threads; the threads should not be taking care of the scheduler. If the threads outlive the scheduler (or we simply don't actually terminate/shutdown the threads), then it should be considered a bug that we need to fix. Attributing this to balika011, as they opened #1317 to attempt to fix this in a similar way, but my refactoring of the kernel code caused quite a few conflicts.
* | | | | Merge pull request #1439 from lioncash/threadbunnei2018-10-0515-227/+418
|\ \ \ \ \ | | | | | | | | | | | | kernel/thread: Make all instance variables private
| * | | | | kernel/thread: Make all instance variables privateLioncash2018-10-0415-227/+418
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of the member variables of the thread class aren't even used outside of the class itself, so there's no need to make those variables public. This change follows in the steps of the previous changes that made other kernel types' members private. The main motivation behind this is that the Thread class will likely change in the future as emulation becomes more accurate, and letting random bits of the emulator access data members of the Thread class directly makes it a pain to shuffle around and/or modify internals. Having all data members public like this also makes it difficult to reason about certain bits of behavior without first verifying what parts of the core actually use them. Everything being public also generally follows the tendency for changes to be introduced in completely different translation units that would otherwise be better introduced as an addition to the Thread class' public interface.
* | | | | Merge pull request #1442 from lioncash/formatbunnei2018-10-051-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()
| * | | | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()Lioncash2018-10-051-1/+1
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | operator+ for std::string creates an entirely new string, which is kind of unnecessary here if we just want to append a null terminator to the existing one. Reduces the total amount of potential allocations that need to be done in the logging path.
* | | | Merge pull request #1415 from DarkLordZach/ipsbunnei2018-10-049-40/+258
|\ \ \ \ | | | | | | | | | | file_sys: Add support for loading IPS patches
| * | | | nso: Optimize loading of IPS patchesZach Hilman2018-10-025-51/+43
| | | | | | | | | | | | | | | | | | | | Avoid resource-heavy classes and remove quasi-duplicated code.
| * | | | deconstructed_rom_directory: Force NSO loader to patch NSOsZach Hilman2018-10-011-1/+3
| | | | |
| * | | | nso: Add framework to support patching of uncompressed NSOsZach Hilman2018-10-012-2/+17
| | | | |
| * | | | patch_manager: Add PatchNSO functionZach Hilman2018-10-013-0/+104
| | | | | | | | | | | | | | | | | | | | While PatchExeFS operated on the entire directory, this function operates on the uncompressed NSO. Avoids copying decompression code to PatchManager.
| * | | | patch_manager: Use strings for patch type instead of enumZach Hilman2018-10-013-33/+36
| | | | |
| * | | | file_sys: Implement function to apply IPS patchesZach Hilman2018-10-012-0/+103
| | | | |
| * | | | nso: Replace NSOHeader padding bytes with build IDZach Hilman2018-10-011-2/+1
| | |_|/ | |/| |
* | | | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ \ \ | | | | | | | | | | aoc_u: Fix edge case with DLC that causes breaks
| * | | | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| |/ / / | | | | | | | | | | | | In some games (Splatoon 2 and Splatoon 2 Splatfest World Premiere, notably), pass offset=0 and count=2047 into the ListAddOnContent method which should return all DLCs for the current title. The (presumably) intended behavior is to successfully return a empty array but because of a < v. <= in an if statement, a failure error code was returned causing these games to svcBreak. This fixes that if statement.
* | | | Merge pull request #1428 from lioncash/qtbunnei2018-10-041-21/+23
|\ \ \ \ | | | | | | | | | | configure_graphics: Make functions internally linked where applicable
| * | | | configure_graphics: Make functions internally linked where applicableLioncash2018-10-031-21/+23
| | |/ / | |/| | | | | | | | | | | | | | These aren't used outside of this translation unit, so they can be internally linked.
* | | | Merge pull request #1431 from lioncash/audiobunnei2018-10-042-16/+34
|\ \ \ \ | | | | | | | | | | configure_audio: Minor cleanup-related changes
| * | | | configure_audio: Move combo box index setting to their own functionsLioncash2018-10-032-11/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the individual behaviors in their own functions, and cleanly separate. We can also do a little better by converting the relevant IDs within the core to a QString only once, instead of converting every string into a std::string.
| * | | | configure_audio: Use QString::fromStdString() for converting audio device namesLioncash2018-10-031-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | This ensures that the proper codec will always be used no matter what. It also avoids relying on ASCII conversions.
| * | | | configure_audio: Add disambiguation comment for the volume percentage stringLioncash2018-10-032-4/+8
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | Disambiguates what the string represents to help translators more easily understand what it is that they're translating. While we're at it, we can move the code to its own function, so that we don't need to specify the same string twice.
* | | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \ \ | | | | | | | | | | services/fsp_srv: Amend service function table
| * | | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| |/ / / | | | | | | | | | | | | | | | | Adds new functions that have been given names to the table. Information is based off what is provided on Switchbrew.
* | | | Merge pull request #1429 from lioncash/translatebunnei2018-10-041-3/+3
|\ \ \ \ | | | | | | | | | | configure_input: Make analog mapping strings translatable
| * | | | configure_input: Make analog mapping strings translatableLioncash2018-10-031-3/+3
| |/ / / | | | | | | | | | | | | | | | | These strings are user-facing, so they should be specified as translatable with tr().
* | | | Merge pull request #1436 from lioncash/viewbunnei2018-10-042-73/+101
|\ \ \ \ | | | | | | | | | | submission_package: Cleanup and bug fixes
| * | | | submission_package: Avoid dangling std::string_view within SetTicketKeys()Lioncash2018-10-031-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | GetName() returns a std::string by value, not by reference, so after the std::string_view is constructed, it's not well defined to actually execute any member functions of std::string_view that attempt to access the data, as the std::string has already been destroyed. Instead, we can just use a std::string and erase the last four characters.
| * | | | submission_package: Correct location of null check within SetTicketKeys()Lioncash2018-10-031-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | If a ticket file was ever a null pointer, we'd cause a null pointer dereference, as we were calling GetExtension() on the pointer instance.
| * | | | submission_package: Use std::string's rfind() when looking for the extension in InitializeExeFSAndRomFS()Lioncash2018-10-031-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When searching for a file extension, it's generally preferable to begin the search at the end of the string rather than the beginning, as the whole string isn't going to be walked just to check for something at the end of it.
| * | | | submission_package: Ensure the 'extracted' member variable is always initializedLioncash2018-10-032-3/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If an error occurs when constructing the PartitionFilesystem instance, the constructor would be exited early, which wouldn't initialize the extracted data member, making it possible for other code to perform an uninitialized read by calling the public IsExtractedType() member function. This prevents that.
| * | | | submission_package: Move ExeFS and RomFS initialization to its own functionLioncash2018-10-032-10/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other two bits of factored out code, this can also be put within its own function. We can also modify the code so that it accepts a const reference to a std::vector of files, this way, we can deduplicate the file retrieval. Now the constructor for NSP isn't a combination of multiple behaviors in one spot. It's nice and separate.
| * | | | submission_package: Move NCA reading code to its own functionLioncash2018-10-032-43/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This too, is completely separate behavior from what is in the constructor, so we can move this to its own isolated function to keep everything self-contained.
| * | | | submission_package: Move ticket key setting to its own functionLioncash2018-10-031-21/+28
| | | | | | | | | | | | | | | | | | | | | | | | | This behavior is entirely independent of the surrounding code, so it can be put in its own function to keep the behavior separate.
| * | | | submission_package: Invert conditionals within NSP's constructor to reduce nestingLioncash2018-10-031-45/+49
| |/ / / | | | | | | | | | | | | We can use early continues here to reduce the amount of nesting.
* | | | Merge pull request #1432 from lioncash/lblbunnei2018-10-041-19/+19
|\ \ \ \ | | | | | | | | | | service/lbl: Update service function table
| * | | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| | |/ / | |/| | | | | | | | | | | | | | Amends the lbl service table to include new names of functions that were added to Switchbrew.
* | | | Merge pull request #1426 from FearlessTobi/port-4253bunnei2018-10-043-150/+7
|\ \ \ \ | | | | | | | | | | Port citra-emu/citra#4253: "common/string_util cleanup"
| * | | | string_util: unify UTF8<->UTF16 conversion to codecvtWeiyi Wang2018-10-021-109/+6
| | | | |
| * | | | string_util: remove TString conversion for windowsWeiyi Wang2018-10-022-19/+1
| | | | | | | | | | | | | | | | | | | | First of all they are foundamentally broken. As our convention is that std::string is always UTF-8, these functions assume that the multi-byte character version of TString (std::string) from windows is also in UTF-8, which is almost always wrong. We are not going to build multi-byte character build, and even if we do, this dirty work should be handled by frontend framework early.
| * | | | string_util: remove ShiftJIS/CP1252 conversion functionWeiyi Wang2018-10-022-22/+0
| |/ / / | | | | | | | | | | | | We always use unicode internally. Any dirty work of conversion with other codec should be handled by frontend framework (Qt). Further more, ShiftJIS/CP1252 are not special (they are not code set used by 3ds, or any guest/host dependencies we have), so there is no reason to specifically include them
* | | | Merge pull request #1435 from lioncash/xcibunnei2018-10-041-1/+3
|\ \ \ \ | |/ / / |/| | | card_image: Ensure program_nca_status is always initialized
| * | | card_image: Ensure program_nca_status is always initializedLioncash2018-10-031-1/+3
| |/ / | | | | | | | | | | | | | | | If any of the error paths before the NCA retrieval are taken, it'll result in program_nca_status being left in an inconsistent state. So we initialize it by default with a value indicating an error.
* | | Merge pull request #1407 from DarkLordZach/dlcbunnei2018-10-015-34/+145
|\ \ \ | |_|/ |/| | aoc_u: Implement functions and add support for DLC loading
| * | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-012-21/+28
| | |
| * | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-013-5/+8
| | | | | | | | | Command #5
| * | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
| | | | | | | | | | | | Commands #2, #3, and #7
| * | romfs_factory: Read from all locations with StorageId NoneZach Hilman2018-10-011-26/+25
| | | | | | | | | | | | Previous behavior was to assert. Seems to mirror expected game behavior.
| * | patch_manager: Add DLC recognition to PatchManagerZach Hilman2018-10-012-0/+27
| | |
* | | gl_rasterizer: Fixup unassigned point sizesReinUsesLisp2018-10-011-1/+4
| |/ |/|
* | Merge pull request #1330 from raven02/tldsbunnei2018-10-011-7/+15
|\ \ | | | | | | TLDS: Add 1D sampler
| * | Fix trailing whitespaceraven022018-09-301-1/+4
| | |
| * | Merge branch 'master' into tldsraven022018-09-19164-1068/+1657
| |\ \
| * | | Add 1D sampler for TLDS - TexelFetch (Mario Rabbids)raven022018-09-171-7/+12
| | | |
* | | | Merge pull request #1322 from bunnei/tex-cubemapbunnei2018-10-015-129/+355
|\ \ \ \ | | | | | | | | | | gl_rasterizer_cache: Implement cubemap textures.
| * | | | gl_rasterizer_cache: Fixes to how we do render to cubemap.bunnei2018-09-302-32/+5
| | | | | | | | | | | | | | | | | | | | - Fixes issues with Splatoon 2.
| * | | | gl_rasterizer_cache: Add check for array rendering to cubemap texture.bunnei2018-09-301-0/+8
| | | | |
| * | | | gl_rasterizer_cache: Implement render to cubemap.bunnei2018-09-303-119/+218
| | | | |
| * | | | gl_shader_decompiler: TEXS: Implement TextureType::TextureCube.bunnei2018-09-301-0/+8
| | | | |
| * | | | gl_rasterizer_cache: Add support for SurfaceTarget::TextureCubemap.bunnei2018-09-302-1/+36
| | | | |
| * | | | gl_rasterizer_cache: Implement LoadGLBuffer for Texture2DArray.bunnei2018-09-301-0/+8
| | | | |
| * | | | gl_rasterizer_cache: Update BlitTextures to support non-Texture2D ColorTexture surfaces.bunnei2018-09-301-23/+88
| | | | |
| * | | | gl_rasterizer_cache: Track texture target and depth in the cache.bunnei2018-09-301-2/+3
| | | | |
| * | | | gl_rasterizer_cache: Workaround for Texture2D -> Texture2DArray scenario.bunnei2018-09-303-6/+21
| | | | |
| * | | | gl_rasterizer_cache: Keep track of surface 2D size separately from total size.bunnei2018-09-302-32/+46
| | | | |
* | | | | Merge pull request #1403 from DarkLordZach/install-sysnandbunnei2018-10-011-4/+14
|\ \ \ \ \ | |_|_|_|/ |/| | | | qt: Install System TitleTypes to System NAND
| * | | | qt: Install System TitleTypes to System NANDZach Hilman2018-09-271-4/+14
| | | | | | | | | | | | | | | Fixes an issue where installed system archive NCAs would be installed to user NAND and not recognized by games.
* | | | | Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\ \ \ \ \ | | | | | | | | | | | | Implement ISystemDisplayService::GetDisplayMode
| * | | | | Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
| | | | | |
* | | | | | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that we have all of the rearranging and proper structure sizes in place, it's fairly trivial to implement svcGetThreadContext(). In the 64-bit case we can more or less just write out the context as is, minus some minor value sanitizing. In the 32-bit case we'll need to clear out the registers that wouldn't normally be accessible from a 32-bit AArch32 exectuable (or process).
* | | | | | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be necessary for the implementation of svcGetThreadContext(), as the kernel checks whether or not the process that owns the thread that has it context being retrieved is a 64-bit or 32-bit process. If the process is 32-bit, then the upper 15 general-purpose registers and upper 16 vector registers are cleared to zero (as AArch32 only has 15 GPRs and 16 128-bit vector registers. not 31 general-purpose registers and 32 128-bit vector registers like AArch64).
* | | | | | kernel/process: Make data member variables privateLioncash2018-09-3018-75/+120
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the public interface consistent in terms of how accesses are done on a process object. It also makes it slightly nicer to reason about the logic of the process class, as we don't want to expose everything to external code.
* | | | | | arm_interface: Add missing fpsr/tpidr members to the ThreadContext structLioncash2018-09-303-5/+15
| |_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Internally within the kernel, it also includes a member variable for the floating-point status register, and TPIDR, so we should do the same here to match it. While we're at it, also fix up the size of the struct and add a static assertion to ensure it always stays the correct size.
* | | | | loader: Make the Load() function take a process as a regular reference, not a SharedPtrLioncash2018-09-2918-42/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A process should never require being reference counted in this situation. If the handle to a process is freed before this function is called, it's definitely a bug with our lifetime management, so we can put the requirement in place for the API that the process must be a valid instance.
* | | | | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \ \ \ \ | | | | | | | | | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()
| * | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | boost::static_pointer_cast for boost::intrusive_ptr (what SharedPtr is), takes its parameter by const reference. Given that, it means that this std::move doesn't actually do anything other than obscure what the function's actual behavior is, so we can remove this. To clarify, this would only do something if the parameter was either taking its argument by value, by non-const ref, or by rvalue-reference.
* | | | | | Merge pull request #1411 from ReinUsesLisp/point-sizebunnei2018-09-295-1/+27
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: Implement point_size and add point state sync
| * | | | | | video_core: Implement point_size and add point state syncReinUsesLisp2018-09-285-1/+27
| | | | | | |
* | | | | | | Merge pull request #1406 from ReinUsesLisp/multibind-samplersbunnei2018-09-295-8/+25
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_state: Pack sampler bindings into a single ARB_multi_bind
| * | | | | | | gl_state: Pack sampler bindings into a single ARB_multi_bindReinUsesLisp2018-09-285-8/+25
| | | | | | | |
* | | | | | | | Merge pull request #1395 from lioncash/vmbunnei2018-09-2918-160/+418
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | process/vm_manager: Initial modifications to load NPDM metadata
| * | | | | | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-2511-75/+60
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The locations of these can actually vary depending on the address space layout, so we shouldn't be using these when determining where to map memory or be using them as offsets for calculations. This keeps all the memory ranges flexible and malleable based off of the virtual memory manager instance state.
| * | | | | | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, these were reporting hardcoded values, but given the regions can change depending on the requested address spaces, these need to report the values that the memory manager contains.
| * | | | | | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-256-22/+61
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given games can also request a 32-bit or 39-bit address space, we shouldn't be hardcoding the address space range as 36-bit.
| * | | | | | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-2410-38/+259
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than hard-code the address range to be 36-bit, we can derive the parameters from supplied NPDM metadata if the supplied exectuable supports it. This is the bare minimum necessary for this to be possible. The following commits will rework the memory code further to adjust to this.
* | | | | | | | Merge pull request #1360 from FearlessTobi/port-3979bunnei2018-09-273-35/+51
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Port citra-emu/citra#3979 game_list: move SearchField to game_list_p.h and fix untranslated text
| * | | | | | | | game_list: move SearchField to game_list_p.h and fix untranslated textzhupengfei2018-09-213-35/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | I have tested and made sure the text is translatable, but this would require a translation update to take effect.
* | | | | | | | | Merge pull request #1394 from lioncash/streambunnei2018-09-275-12/+12
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | stream: Preserve enum class type in GetState()
| * | | | | | | | stream: Preserve enum class type in GetState()Lioncash2018-09-245-12/+12
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Preserves the meaning/type-safetiness of the stream state instead of making it an opaque u32. This makes it usable for other things outside of the service HLE context.
* | | | | | | | Merge pull request #1389 from PhiBabin/valgrindMat M2018-09-271-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | FPCR register was uninitialized at start up
| * | | | | | | | FPCR register was uninitialized at start upPhilippe Babin2018-09-231-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #1377 from FernandoS27/faster-swizzlebunnei2018-09-271-51/+66
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Improved Fast Swizzle and Legacy Swizzle
| * | | | | | | | | Reverse stride align restriction on FastSwizzle due to lost performanceFernandoS272018-09-211-3/+2
| | | | | | | | | |
| * | | | | | | | | Join both Swizzle methods within one interface functionFernandoS272018-09-211-11/+19
| | | | | | | | | |
| * | | | | | | | | Standarized Legacy Swizzle to look alike FastSwizzle and use a Swizzling Table insteadFernandoS272018-09-211-42/+38
| | | | | | | | | |
| * | | | | | | | | Remove same output bpp restriction on FastSwizzleFernandoS272018-09-211-4/+5
| | | | | | | | | |
| * | | | | | | | | Improved Legacy Swizzler to be better documented and work betterFernandoS272018-09-211-15/+21
| | | | | | | | | |
| * | | | | | | | | Improved fast swizzle and removed restrictions to itFernandoS272018-09-211-7/+12
| | | | | | | | | |
* | | | | | | | | | fsmitm_romfsbuild: std::move std::vector instances in Build()Lioncash2018-09-261-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids making copies of large std::vector instances where it's trivially avoidable to do so.
* | | | | | | | | | fsmitm_romfsbuild: Replace manual value aligning with Common::AlignUp()Lioncash2018-09-261-12/+11
| |_|_|_|/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Theres no need to do explicit bitwise arithmetic here, when we have a function that does this with a more descriptive name.
* | | | | | | | | Merge pull request #1399 from lioncash/schedbunnei2018-09-264-14/+14
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | kernel/scheduler: Take ARM_Interface instances by reference
| * | | | | | | | | core_cpu: Make arm_interface instances a std::unique_ptrLioncash2018-09-252-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only exposed by reference, so we can just make it a unique pointer to get rid of the need to also use reference counting for the pointer.
| * | | | | | | | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-253-10/+10
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It doesn't make sense to allow a scheduler to be constructed around a null pointer.
* | | | | | | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | service: Add missing headers inclusions where applicable
| * | | | | | | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of a few indirect inclusions.
* | | | | | | | | | Merge pull request #1402 from ReinUsesLisp/assertsbunnei2018-09-265-3/+92
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | video_core: Add asserts for CS, TFB and alpha testing
| * | | | | | | | | | video_core: Add asserts for CS, TFB and alpha testingReinUsesLisp2018-09-265-3/+92
| | |_|_|_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Add asserts for compute shader dispatching, transform feedback being enabled and alpha testing. These have in common that they'll probably break rendering without logging.
* | | | | | | | | | patch_manager: Invert conditionals within ApplyLayeredFS()Lioncash2018-09-261-27/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to nest code quite a bit by early-exiting in error cases.
* | | | | | | | | | vfs_vector: Amend initializer list order in VectorVfsFile's constructor initializer listLioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Orders the initializer list members to be in the same order that they would be initialized in. Avoids compiler warnings.
* | | | | | | | | | fsmitm_romfsbuild: Avoid type truncation warningsLioncash2018-09-261-7/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Cast where explicitly necessary and in other cases we can simply modify the algorithm to accomodate larger data.
* | | | | | | | | | fsmitm_romfsbuild: Remove unnecessary constructors and initializers for RomFSBuildFileContext and RomFSBuildDirectoryContextLioncash2018-09-261-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need to duplicate in-class initializers with a constructor initializer list. std::strings also initialize to empty by default.
* | | | | | | | | | fsmitm_romfsbuild: Remove unnecessary loops in Build()Lioncash2018-09-261-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The std::vector instances are already initially allocated with all entries having these values, there's no need to loop through and fill them with it again when they aren't modified.
* | | | | | | | | | fsmitm_romfsbuild: Make auto variable into a std::size_t variable within Build()Lioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | auto x = 0; auto-deduces x to be an int. This is undesirable when working with unsigned values. It also causes sign conversion warnings. Instead, we can make it a proper unsigned value with the correct width that the following expressions operate on.
* | | | | | | | | | yuzu/main: Resolve precedence bug within CalculateRomFSEntrySize()Lioncash2018-09-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ternary operators have a lower precedence than arithmetic operators, so what was actually occurring here is "return (out + full) ? x : y" which most definitely isn't intended, given we calculate out recursively above. We were essentially doing a lot of work for nothing.
* | | | | | | | | | yuzu/main: Move functions stored into static std::function instances out of OnGameListDumpRomFS()Lioncash2018-09-261-42/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This can cause warnings about static constructors, and is also not ideal performance-wise due to the indirection through std::function. This also keeps the behavior itself separate from the surrounding code, which can make it nicer to read, due to the size of the code.
* | | | | | | | | | vfs/etc: Append std:: to size_t usagesLioncash2018-09-267-29/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we just recently had a patch backport this from citra, let's try and keep the convention uniform.
* | | | | | | | | | vfs_concat/vfs_layered: Remove friend declarations from ConcatenatedVfsFileLioncash2018-09-268-61/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are only added to the class to allow those functions to access the private constructor, it's a better approach to just make them static functions in the interface, to make the dependency explicit.
* | | | | | | | | | vfs_static: Remove template byte parameter from StaticVfsFileLioncash2018-09-254-42/+42
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This converts it into a regular constructor parameter. There's no need to make this a template parameter on the class when it functions perfectly well as a constructor argument. This also reduces the amount of code bloat produced by the compiler, as it doesn't need to generate the same code for multiple different instantiations of the same class type, but with a different fill value.
* | | | | | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-2531-36/+1203
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | file_sys: Add support for LayeredFS mods
| * | | | | | | | fsmitm: Cleanup and modernize fsmitm portZach Hilman2018-09-2422-378/+378
| | | | | | | | |
| * | | | | | | | qt: Add UI elements for LayeredFS and related toolsZach Hilman2018-09-226-5/+162
| | | | | | | | |
| * | | | | | | | romfs: Implement CreateRomFSZach Hilman2018-09-222-4/+25
| | | | | | | | |
| * | | | | | | | file_sys: Port Atmosphere-NX fs_mitm implementationZach Hilman2018-09-222-0/+474
| | | | | | | | |
| * | | | | | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| | | | | | | | |
| * | | | | | | | bis_factory: Add mod directory VFS getterZach Hilman2018-09-223-3/+18
| | | | | | | | |
| * | | | | | | | patch_manager: Add LayeredFS mods supportZach Hilman2018-09-222-1/+44
| | | | | | | | |
| * | | | | | | | vfs_concat: Rewrite and fix ConcatenatedVfsFileZach Hilman2018-09-222-14/+59
| | | | | | | | |
| * | | | | | | | vfs_layered: Add LayeredVfsDirectoryZach Hilman2018-09-222-0/+178
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reads multiple dirs through as if a waterfall.
| * | | | | | | | vfs_vector: Add VectorVfsFileZach Hilman2018-09-222-0/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Maps a vector into the VFS interface.
| * | | | | | | | vfs_static: Add StaticVfsFileZach Hilman2018-09-222-0/+78
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Always returns the template argument byte for all reads. Doesn't support writes.
| * | | | | | | | vfs: Add and rewite VfsRawCopy functionsZach Hilman2018-09-222-6/+36
| | | | | | | | |
| * | | | | | | | vfs: Add GetEntries methodZach Hilman2018-09-224-0/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Maps name string to directory or file.
| * | | | | | | | common_paths: Add Load and Dump dirsZach Hilman2018-09-223-0/+6
| | | | | | | | |
* | | | | | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | svc: Updated svc names
| * | | | | | | | | svc: Updated svc namestech4me2018-09-241-7/+7
| | | | | | | | | |
* | | | | | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented fatal:u properly fatal:u now is properly implemented with all the ipc cmds. Error reports/Crash reports are also now implemented for fatal:u. Crash reports save to yuzu/logs/crash_reports/ The register dump is currently known as sysmodules send all zeros. If there are any non zero values for the "registers" or the unknown values, let me know! * Fatal:U fixups * Made fatal:u execution break more clear * Fatal fixups
* | | | | | | | | | Stubbed IRS (#1349)David2018-09-244-18/+169
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubbed IRS Currently we have no ideal way of implementing IRS. For the time being we should have the functions stubbed until we come up with a way to emulate IRS properly. * Added IRS to logging backend * Forward declared shared memory for irs
* | | | | | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | | Corrected SSL::SetInterfaceVersion
| * | | | | | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
| | |_|_|_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | Should be a single u32
* | | | | | | | | Added glObjectLabels for renderdoc for textures and shader programs (#1384)David2018-09-234-0/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added glObjectLabels for renderdoc for textures and shader programs * Changed hardcoded "Texture" name to reflect the texture type instead * Removed string initialize
* | | | | | | | | Merge pull request #1387 from FearlessTobi/port-4245bunnei2018-09-231-8/+0
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Port citra-emu/citra#4245: "common/thread: remove YieldCPU()"
| * | | | | | | | | common/thread: remove YieldCPU()Weiyi Wang2018-09-221-8/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | simply use the standard library yield()
* | | | | | | | | | Merge pull request #1391 from ogniK5377/GetAudioRendererStatebunnei2018-09-235-1/+21
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Added audren:u#GetAudioRendererState
| * | | | | | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-235-1/+21
| | |_|_|_|/ / / / / | |/| | | | | | | |
* / | | | | | | | | correct BC6Hgreggameplayer2018-09-231-2/+2
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1378 from lioncash/threadbunnei2018-09-235-100/+145
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | process: Make a few member variables private where applicable
| * | | | | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reduces the use of Process class members externally and keeps most code related to tearing down a process with the rest of the process code.
| * | | | | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows making several members of the process class private, it also avoids going through Core::CurrentProcess() just to retrieve the owning process.
* | | | | | | | Merge pull request #1380 from lioncash/constbunnei2018-09-221-8/+19
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | shader_bytecode: Make operator== and operator!= of IpaMode const qualified
| * | | | | | | | shader_bytecode: Lay out the Ipa-related enums betterLioncash2018-09-211-2/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is more consistent with the surrounding enums.
| * | | | | | | | shader_bytecode: Make operator== and operator!= of IpaMode const qualifiedLioncash2018-09-211-6/+7
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't affect the state of the struct and can be const member functions.
* | | | | | | | Merge pull request #1382 from lioncash/incbunnei2018-09-222-4/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_state: Remove unused type alias
| * | | | | | | | gl_state: Remove unused type aliasLioncash2018-09-222-4/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't used anywhere within the header, so we can remove it, along with the include that was previously necessary. This also uncovers an indirect include in the cpp file for the assertion macros.
* | | | | | | | Merge pull request #1376 from Subv/timestretch_tracebunnei2018-09-221-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Logging: Change the TimeStretch::Process log from debug to trace level.
| * | | | | | | | Logging: Change the TimeStretch::Process log from debug to trace level.Subv2018-09-211-1/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This function is called too many times and makes the debug logging basically unusable due to the spam.
* | | | | | | | Merge pull request #1381 from valentinvanelslande/patch-1bunnei2018-09-221-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | yuzu_cmd: fix sd card directory set to nand directory
| * | | | | | | | Update config.cppValentin Vanelslande2018-09-211-1/+1
| | |_|_|_|/ / / | |/| | | | | |
* / | | | | | | game_list: Add Qt SmoothTransformation to picture scalingZach Hilman2018-09-221-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1379 from lioncash/bitwisebunnei2018-09-211-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | gl_stream_buffer: Fix use of bitwise OR instead of logical OR in Map()
| * | | | | | gl_stream_buffer: Fix use of bitwise OR instead of logical OR in Map()Lioncash2018-09-211-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was very likely intended to be a logical OR based off the conditioning and testing of inversion in one case. Even if this was intentional, this is the kind of non-obvious thing one should be clarifying with a comment.
* | | | | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added support for uncompressed NSOs * Moved compressed section check to NsoHeader
* | | | | | Merge pull request #1337 from DarkLordZach/create-fs-cmdbunnei2018-09-211-1/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu-cmd: Add filesystem service initializer call
| * | | | | | yuzu-cmd: Add call to CreateFactoriesZach Hilman2018-09-191-1/+3
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | Ensures all relevant filesystem objects are initialized and eliminates a crash related to the RegisteredCache.
* | | | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()
| * | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The owning process of a thread is required to exist before the thread, so we can enforce this API-wise by using a reference. We can also avoid the reliance on the system instance by using that parameter to access the page table that needs to be set.
* | | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-215-1/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | arm_interface: Replace kernel vm_manager include with a forward declaration
| * | | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-215-1/+11
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids an unnecessary inclusion and also uncovers three places where indirect inclusions were relied upon, which allows us to also resolve those.
* | | | | | Merge pull request #1375 from Subv/gl_clearbunnei2018-09-211-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | RasterizerGL: Use the correct framebuffer when clearing via the CLEAR_BUFFERS register.
| * | | | | | RasterizerGL: Use the correct framebuffer when clearing via the CLEAR_BUFFERS register.Subv2018-09-211-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were clearing the default backbuffer framebuffer. Found thanks to a Piglit test :)
* | | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \ \ | | | | | | | | | | | | | | file-sys: Default heavy-weight class destructors in the cpp file
| * | | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Several classes have a lot of non-trivial members within them, or don't but likely should have the destructor defaulted in the cpp file for future-proofing/being more friendly to forward declarations. Leaving the destructor unspecified allows the compiler to inline the destruction code all over the place, which is generally undesirable from a code bloat perspective.
* | | | | | Merge pull request #1367 from lioncash/pluralbunnei2018-09-211-9/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | game_list: Handle plurals within setFilterResult() better
| * | | | | | game_list: Handle plurals within setFilterResult() betterLioncash2018-09-201-9/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Qt provides an overload of tr() that operates on quantities in relation to pluralization. This also allows the translation to adapt based on the target language rules better. For example, the previous code would result in an incorrect translation for the French language (which doesn't use the pluralized version of "result" in the case of a total of zero. While in English it's correct to use the pluralized version of "result", that is, "results" --- For example: English: "0 results" French: "0 résultat" (uses the singular form) In French, the noun being counted is singular if the quantity is 0 or 1. In English, on the other hand, if the noun being counted has a quantity of 0 or N > 1, then the noun is pluralized. --- For another example in a language that has different counting methods than the above, consider English and Irish. Irish has a special form of of a grammatical number called a dual. Which alters how a word is written when N of something is 2. This won't appear in this case with a direct number "2", but it would change if we ever used "Two" to refer to two of something. For example: English: "Zero results" Irish: "Toradh ar bith" English: "One result" Irish: "Toradh amháin" English: "Two results" Irish: "Dhá thorthaí" <- Dual case Which is an important distinction to make between singular and plural, because in other situations, "two" on its own would be written as "dó" in Irish. There's also a few other cases where the order the words are placed *and* whether or not the plural or singular variant of the word is used *and* whether or not the word is placed after or between a set of numbers can vary. Counting in Irish also differs depending on whether or not you're counting things (like above) or counting people, in which case an entirely different set of numbers are used. It's not important for this case, but it's provided as an example as to why one should never assume the placement of values in text will be like that of English or other languages. Some languages have very different ways to represent counting, and breaking up the translated string like this isn't advisable because it makes it extremely difficult to get right depending on what language a translator is translating text into due to the ambiguity of the strings being presented for translation. In this case a translator would see three fragmented strings on Transifex (and not necessarily grouped beside one another, but even then, it would still be annoying to decipher): - "of" - "result" - "results" There is no way a translator is going to know what those sets of words are actually used for unless they look at the code to see what is being done with them (which they shouldn't have to do).
* | | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | Added IRequest::Submit
| * | | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| | | | | | |
| * | | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes updated versions of SMO. Currently unable to test as I don't have an updated version
* | | | | | | Merge pull request #1352 from lioncash/sharingbunnei2018-09-211-3/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharing
| * | | | | | | ring_buffer: Use std::atomic_size_t in a static assertLioncash2018-09-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to repeat "std::" twice
| * | | | | | | ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharingLioncash2018-09-191-2/+10
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | MSVC 19.11 (A.K.A. VS 15.3)'s C++ standard library implements P0154R1 (http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2016/p0154r1.html) which defines two new constants within the <new> header, std::hardware_destructive_interference_size and std::hardware_constructive_interference_size. std::hardware_destructive_interference_size defines the minimum recommended offset between two concurrently-accessed objects to avoid performance degradation due to contention introduced by the implementation (with the lower-bound being at least alignof(max_align_t)). In other words, the minimum offset between objects necessary to avoid false-sharing. std::hardware_constructive_interference_size on the other hand defines the maximum recommended size of contiguous memory occupied by two objects accessed wth temporal locality by concurrent threads (also defined to be at least alignof(max_align_t)). In other words the maximum size to promote true-sharing. So we can simply use this facility to determine the ideal alignment size. Unfortunately, only MSVC supports this right now, so we need to enclose it within an ifdef for the time being.
* | | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
| |_|_|/ / / |/| | | | | | | | | | | | | | | | | Even though setting this value to 3 is more correct. We break more games than we fix due to missing implementations. We should keep this as 0 for the time being
* | | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Correct endianness of BRK
| * | | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-201-0/+12
|\ \ \ \ \ \ | |/ / / / / |/| | | | | externals: Update dynarmic to 171d116
| * | | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| | | | | |
| * | | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| | |/ / / | |/| | |
* | | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \ \ | | | | | | | | | | | | savedata_factory: Add TemporaryStorage SaveDataType
| * | | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ / | |/| | | | | | | | Seems to be used by NSO NES Emulator
* | | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \ \ | | | | | | | | | | | | control_metadata: Move language name array definition to the cpp file
| * | | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need to indent the code here, given the if case contains a return statement at the end of it.
| * | | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This was used in two different translation units (deconstructed_rom_directory and patch_manager). This means we'd be pointlessly duplicating the whole array twice due to it being defined within the header.
* | | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \ \ | | | | | | | | | | | | xts_archive/nax: Minor interface changes
| * | | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These variables aren't used, which still has an impact, as std::vector cannot be optimized away by the compiler (it's constructor and destructor are both non-trivial), so this was just wasting memory.
| * | | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | std::shared_ptr isn't strictly necessary here and is only ever used in contexts where the object doesn't depend on being shared. This also makes the interface more flexible, as it's possible to create a std::shared_ptr from a std::unique_ptr (std::shared_ptr has a constructor that accepts a std::unique_ptr), but not the other way around.
| * | | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | An instance of the NAX apploader already has an existing NAX instance in memory. Calling directly into IdentifyType() directly would re-parse the whole file again into yet another NAX instance, only to toss it away again. This gets rid of unnecessary/redundant file parsing and allocations.
| * | | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AsNCA() allocates an NCA instance every time it's called. In the current manner it's used, it's quite inefficient as it's making a redundant allocation. We can just amend the order of the conditionals to make it easier to just call it once.
| * | | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Ensures that the member always has a deterministic value.
| * | | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | Orders the initializer list in the same order the members would be initialized. Avoids compiler warnings.
* | | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
| | | | |
* | | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / / / | | | | | | | | | | | | Needed because of the recent nim fixes
* | | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Reworked incorrect nifm stubs Need confirmation on `CreateTemporaryNetworkProfile`, unsure which game uses it but according to reversing. It should return a uuid which we currently don't do. Any 0 client id is considered an invalid client id. GetRequestState 0 is considered invalid. * Fixups for nifm
* | | | Merge pull request #1356 from degasus/hotfixbunnei2018-09-191-6/+7
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Fix StartAddress handling with indexed draw calls.
| * | | | gl_rasterizer: Fix StartAddress handling with indexed draw calls.Markus Wick2018-09-191-6/+7
| | |/ / | |/| | | | | | | | | | | | | | We uploaded the wrong data before. So the offset on the host GPU pointer may work for the first vertices, the last ones run out bounds. Let's just offset the upload instead.
* | | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ \ | | | | | | | | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevision
| * | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ / / | | | | | | | | | | | | With these, `Nintendo Entertainment System - Nintendo Switch Online` loads
* | | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
| | | |
* | | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / / | | | | | | | | | Due to keeping the code style consistent in the yuzu codebase. `rb = rp.MakeBuilder(...)` was replaced with `rb{ctx, ...}`
* | | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ \ | | | | | | | | Implemented IProfile::GetImageSize
| * | | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
| | | |
* | | | Merge pull request #1319 from lioncash/audiobunnei2018-09-195-43/+59
|\ \ \ \ | | | | | | | | | | audio_core: Replace includes with forward declarations where applicable.
| * | | | time_stretch: Remove unused <array> includeLioncash2018-09-171-1/+0
| | | | | | | | | | | | | | | | | | | | This isn't used within this header and isn't necessary.
| * | | | stream: Replace includes with forward declarations where applicableLioncash2018-09-172-3/+7
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids propagating includes in headers where it's not necessary to do so.
| * | | | audio_renderer: Replace includes with forward declarations where applicableLioncash2018-09-172-39/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids including unnecessary headers within the audio_renderer.h header, lessening the likelihood of needing to rebuild source files including this header if they ever change. Given std::vector allows forward declaring contained types, we can move VoiceState to the cpp file and hide the implementation entirely.
* | | | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ \ \ | | | | | | | | | | | | Implemented GetDefaultDisplayResolution
| * | | | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| | |/ / / | |/| | |
* | | | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \ \ \ | | | | | | | | | | | | core/core_cpu: Replace exclusive monitor include with forward declaration
| * | | | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| | |/ / / | |/| | | | | | | | | | | | | | | | | | We don't need to include this as a dependency within the header. A regular forward declaration will suffice here.
* | | | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \ \ \ | | | | | | | | | | | | svc_wrap: Convert the PARAM macro into a function
| * | | | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | This can just be a regular function, getting rid of the need to also explicitly undef the define at the end of the file. Given FuncReturn() was already converted into a function, it's #undef can also be removed.
* | | | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ \ \ | | | | | | | | | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensor
| * | | | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| | | | | |
| * | | | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| | | | | |
| * | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1342 from lioncash/truncbunnei2018-09-191-4/+4
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Avoid truncation warnings within LD_A and ST_A code
| * | | | | gl_shader_decompiler: Avoid truncation warnings within LD_A and ST_A codeLioncash2018-09-181-4/+4
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | These are internally stored as u64 values, so using u32 here causes truncation warnings. Instead, we can just use u64 and preserve the bit width.
* | | | | Merge pull request #1279 from FernandoS27/csetpbunnei2018-09-192-21/+133
|\ \ \ \ \ | | | | | | | | | | | | shader_decompiler: Implemented (Partialy) Control Codes and CSETP
| * | | | | Implemented Internal FlagsFernandoS272018-09-181-13/+35
| | | | | |
| * | | | | Implemented I2I.CC on the NEU control code, used by SMOFernandoS272018-09-172-14/+18
| | | | | |
| * | | | | Implemented CSETPFernandoS272018-09-172-14/+49
| | | | | |
| * | | | | Implemented Control CodesFernandoS272018-09-172-0/+51
| |/ / / /
* | | | | Merge pull request #1299 from FernandoS27/texture-sanatizebunnei2018-09-192-3/+192
|\ \ \ \ \ | | | | | | | | | | | | shader_decompiler: Asserts for Texture Instructions
| * | | | | Added asserts for texture misc modes to texture instructionsFernandoS272018-09-171-2/+45
| | | | | |
| * | | | | Added texture misc modes to texture instructionsFernandoS272018-09-171-1/+147
| |/ / / /
* | | | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-193-3/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fix bug where default username value for yuzu_cmd create an userprofile with uninitialize data as username * Fix format * Apply code review changes * Remove nullptr check
* | | | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \ \ \ | | | | | | | | | | | | kernel/svc: Handle invalid address cases within svcArbitrateLock() and svcArbitrateUnlock()
| * | | | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have a ResultCode constant for the case of an invalid address, so we can just use it instead of re-rolling that ResultCode type.
| * | | | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel does the equivalent of the following check before proceeding: if (address + 0x8000000000 < 0x7FFFE00000) { return ERR_INVALID_MEMORY_STATE; } which is essentially what our IsKernelVirtualAddress() function does. So we should also be checking for this. The kernel also checks if the given input addresses are 4-byte aligned, however our Mutex::TryAcquire() and Mutex::Release() functions already handle this, so we don't need to add code for this case.
* | | | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \ \ \ | | | | | | | | | | | | arm_interface: Remove ARM11-isms from the CPU interface
| * | | | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This modifies the CPU interface to more accurately match an AArch64-supporting CPU as opposed to an ARM11 one. Two of the methods don't even make sense to keep around for this interface, as Adv Simd is used, rather than the VFP in the primary execution state. This is essentially a modernization change that should have occurred from the get-go.
* | | | | Merge pull request #1345 from lioncash/writebunnei2018-09-181-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | | arm_dynarmic: Correct ExclusiveWrite128()'s operation
| * | | | arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | Previously the second half of the value being written would overwrite the first half. Thankfully this wasn't a bug that was being encountered, as the function is currently unused.
* | | | Merge pull request #1290 from FernandoS27/shader-headerbunnei2018-09-183-24/+111
|\ \ \ \ | |/ / / |/| | | Implemented (Partialy) Shader Header
| * | | Replace old FragmentHeader for the new HeaderFernandoS272018-09-112-31/+18
| | | |
| * | | Implemented (Partialy) Shader HeaderFernandoS272018-09-113-2/+102
| | | |
* | | | Merge pull request #1311 from FernandoS27/fast-swizzlebunnei2018-09-171-2/+49
|\ \ \ \ | | | | | | | | | | Optimized Texture Swizzling
| * | | | Optimized Texture SwizzlingFernandoS272018-09-141-2/+49
| | | | |
* | | | | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ \ \ \ | | | | | | | | | | | | service/vi: Replace includes with forward declarations where applicable
| * | | | | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
| | | | | |
* | | | | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/errors: Amend error code for ERR_NOT_FOUND
| * | | | | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | This is the value returned by the kernel for svcConnectToNamedPort() if the named port cannot be found.
* | | | | | Merge pull request #1314 from lioncash/castbunnei2018-09-171-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | audio_core/time_stretch: Silence truncation warnings in Process()
| * | | | | | audio_core/time_stretch: Silence truncation warnings in Process()Lioncash2018-09-141-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | The SoundTouch API only accepts uint amount of samples.
* | | | | | Merge pull request #1316 from lioncash/shadowbunnei2018-09-171-2/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Get rid of variable shadowing within LEA instructions
| * | | | | | gl_shader_decompiler: Get rid of variable shadowing within LEA instructionsLioncash2018-09-141-2/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | These variables are already defined within an outer scope.
* | | | | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | services/sm: Amend error code constants
| * | | | | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Courtesy of @ogniK5377. This also moves them into the cpp file and limits the visibility to where they're directly used. It also gets rid of unused or duplicate error codes.
* | | | | | Merge pull request #1321 from lioncash/audio-shadowbunnei2018-09-171-4/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | cubeb_sink: Get rid of variable shadowing within CubebSink's constructor
| * | | | | | cubeb_sink: Get rid of variable shadowing within CubebSink's constructorLioncash2018-09-141-4/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | The parameter of the lambda was shadowing the variable that was being assigned to.
* | | | | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/svc: Handle a few error cases within memory-related functions
| * | | | | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel caps the size limit of shared memory to 8589930496 bytes (or (1GB - 512 bytes) * 8), so approximately 8GB, where every GB has a 512 byte sector taken off of it. It also ensures the shared memory is created with either read or read/write permissions for both permission types passed in, allowing the remote permissions to also be set as "don't care".
| * | | | | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Part of the checking done by the kernel is to check if the given address and size are 4KB aligned, as well as checking if the size isn't zero. It also only allows mapping shared memory as readable or read/write, but nothing else, and so we shouldn't allow mapping as anything else either.
| * | | | | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The kernel checks if the addresses and given size is 4KB aligned before continuing onwards to map the memory.
| * | | | | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | The kernel checks if the given size is a multiple of 2MB and <= to 4GB before going ahead and attempting to allocate that much memory.
* | | | | | Merge pull request #1320 from lioncash/namebunnei2018-09-171-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | cubeb_sink: Correct context name in ListCubebSinkDevices()
| * | | | | | cubeb_sink: Correct context name in ListCubebSinkDevices()Lioncash2018-09-141-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | This ain't Citra.
* | | | | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #4192 from Citra: "svc: change unknown to thread in CreateThread"
| * | | | | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1327 from FearlessTobi/port-4171bunnei2018-09-172-16/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #4171 from Citra: "Tests: Remove glad test OS X work-around"
| * | | | | | Tests: Remove glad test OS X work-aroundYuri Kunde Schlesner2018-09-152-16/+0
| |/ / / / /
* | | | | | Merge pull request #1326 from FearlessTobi/port-4182bunnei2018-09-17146-751/+780
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #4182 from Citra: "Prefix all size_t with std::"
| * | | | | | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-15146-751/+780
| |/ / / / /
* | | | | | Merge pull request #1329 from raven02/bgr5a1ubunnei2018-09-172-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement RenderTargetFormat::BGR5A1_UNORM
| * | | | | | Implement RenderTargetFormat::BGR5A1_UNORM (Pokken Tournament DX)raven022018-09-152-0/+4
| |/ / / / /
* | | | | | Merge pull request #1335 from lioncash/copybunnei2018-09-171-5/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | game_list_p: Take map iterator contents by const reference
| * | | | | | game_list_p: Amend typo in GameListItemCompat's constructor parameterLioncash2018-09-171-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds a missing 'i' character that was missing in compatibility.
| * | | | | | game_list_p: Take map iterator contents by const referenceLioncash2018-09-171-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | We don't need to copy the whole struct in this instance, we can just utilize a reference instead.
* | | | | | Merge pull request #1336 from lioncash/antialiasbunnei2018-09-171-1/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu/util: Antialias game list compatibility pixmaps
| * | | | | | yuzu/util: Antialias game list compatibility pixmapsLioncash2018-09-171-1/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We pass a hint to the QPainter instance that we want anti-aliasing on the compatibility icons, which prevents the circles from looking fairly jagged, and actually makes them look circular.
* | | | | / Implement ASTC_2D_8X8 (Bayonetta 2)raven022018-09-163-6/+20
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #1273 from Subv/ld_sizesbunnei2018-09-152-7/+58
|\ \ \ \ \ | | | | | | | | | | | | Shaders: Implemented multiple-word loads and stores to and from attribute memory.
| * | | | | Shaders: Implemented multiple-word loads and stores to and from attribute memory.Subv2018-09-152-7/+58
| | |/ / / | |/| | | | | | | | | | | | | This seems to be an optimization performed by nouveau.
* | | | | Merge pull request #1271 from Subv/kepler_enginebunnei2018-09-156-0/+146
|\ \ \ \ \ | |/ / / / |/| | | | GPU: Basic implementation of the Kepler Inline Memory engine (p2mf).
| * | | | GPU: Basic implementation of the Kepler Inline Memory engine (p2mf).Subv2018-09-126-0/+146
| | | | | | | | | | | | | | | | | | | | This engine writes data from a FIFO register into the configured address.
* | | | | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-145-38/+39
|\ \ \ \ \ | | | | | | | | | | | | kernel/thread: Include thread-related enums within the kernel namespace
| * | | | | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-135-38/+39
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | Previously, these were sitting outside of the Kernel namespace, which doesn't really make sense, given they're related to the Thread class which is within the Kernel namespace.
* | | | | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ \ \ \ | | | | | | | | | | | | service: Use nested namespace specifiers where applicable
| * | | | | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | There were a few places where nested namespace specifiers weren't being used where they could be within the service code. This amends that to make the namespacing a tiny bit more compact.
* | | | | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ \ \ \ | |/ / / / |/| | | | services/pl_u: Add missing Korean font to the fallback case for shared fonts
| * | | | services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
| | | | | | | | | | | | | | | | | | | | Previously this wasn't using the Korean font at all.
* | | | | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
| | | | |
* | | | | Use ARB_multi_bind for uniform buffers (#1287)ReinUsesLisp2018-09-134-3/+27
|/ / / / | | | | | | | | | | | | | | | | | | | | * gl_rasterizer: use ARB_multi_bind for uniform buffers * address feedback
* | | | Merge pull request #1298 from lioncash/viewbunnei2018-09-132-2/+4
|\ \ \ \ | | | | | | | | | | audio_core/sink_details: Change std::string parameter into std::string_view
| * | | | audio_core/sink_details: Change std::string parameter into std::string_viewLioncash2018-09-122-2/+4
| | |_|/ | |/| | | | | | | | | | | | | | The given string is only ever used for lookup and comparison, so we can just utilize a non-owning view to string data here
* | | | Merge pull request #1302 from lioncash/configbunnei2018-09-132-36/+74
|\ \ \ \ | | | | | | | | | | yuzu/configure_gamelist: Mark combo-box strings as translatable
| * | | | yuzu/configure_gamelist: Make combo box strings translatableLioncash2018-09-122-21/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these are shown to the user, they should be translatable. While we're at it, also set up the dialog to automatically retranslate the dialog along with the combo boxes if it receives a LanguageChange event.
| * | | | yuzu/configure_gamelist: Use std::array instead of std::vector for translatable stringsLioncash2018-09-121-6/+9
| | | | | | | | | | | | | | | | | | | | | | | | | We don't need to use an allocating container for these, given we know the fixed amount of strings being used. This is just a waste of memory.
| * | | | yuzu/configure_gamelist: Move combo box initializtion to their own functionsLioncash2018-09-122-23/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the individual initialization of the combo boxes logically separate. We also shouldn't be dumping this sort of thing in the constructor directly.
* | | | | Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-1318-49/+456
|\ \ \ \ \ | | | | | | | | | | | | audio_core: Add audio stretching support
| * | | | | audio_core: Flush stream when not playing anythingMerryMage2018-09-126-0/+23
| | | | | |
| * | | | | cubeb_sink: Downsample arbitrary number of channelsMerryMage2018-09-091-10/+9
| | | | | |
| * | | | | cubeb_sink: Perform audio stretchingMerryMage2018-09-083-24/+26
| | | | | |
| * | | | | audio_core: Add audio stretcherMerryMage2018-09-083-0/+101
| | | | | |
| * | | | | cubeb_sink: Hold last available value instead of writing zerosMerryMage2018-09-081-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | This reduces clicking in output audio should we underrun.
| * | | | | cubeb_sink: Use RingBufferMerryMage2018-09-081-40/+26
| | | | | |
| * | | | | common: Implement a ring bufferMerryMage2018-09-084-0/+243
| | | | | |
| * | | | | Add audio stretching supportfearlessTobi2018-09-0812-0/+43
| | | | | |
* | | | | | gl_rasterizer_cache: B5G6R5U should use GL_RGB8 as an internal format.bunnei2018-09-131-1/+1
| |_|_|_|/ |/| | | | | | | | | | | | | | - Fixes a regression with Sonic Mania with ARB_texture_storage.
* | | | | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \ \ \ \ | | | | | | | | | | | | pl_u: Eliminate mutable file-scope state
| * | | | | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | Converts the PL_U internals to use the PImpl idiom and makes the state part of the Impl struct, eliminating mutable global/file state.
* | | | | Merge pull request #1263 from FernandoS27/tex-modebunnei2018-09-122-1/+43
|\ \ \ \ \ | |_|_|_|/ |/| | | | shader_decompiler: Implemented (Partially) Texture Processing Modes
| * | | | Implemented Texture Processing ModesFernandoS272018-09-122-1/+43
| |/ / /
* | | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \ \ | | | | | | | | | | kernel/errors: Amend invalid thread priority and invalid processor ID error codes
| * | | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| | | | | | | | | | | | | | | | | | | | This is what the kernel does for an out-of-range processor ID.
| * | | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
| | | | |
* | | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While unlikely, it does avoid constructing a std::string and unnecessarily calling into the memory code if a game or executable decides to be really silly about their logging.
* | | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
|/ / / / | | | | | | | | | | | | This should be a u64 to represent size.
* | | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \ \ | | | | | | | | | | service/prepo: Move class into the cpp file
| * | | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ / / | | | | | | | | | | | | | | | | | | | | This doesn't need to be exposed within the header and be kept in the translation unit, eliminating the need to include anything within the header.
* | | | Merge pull request #1301 from lioncash/qtbunnei2018-09-121-4/+4
|\ \ \ \ | |_|_|/ |/| | | game_list: Resolve variable shadowing within LoadCompatibilityList()
| * | | game_list: Resolve variable shadowing within LoadCompatibilityList()Lioncash2018-09-121-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | "value" is already a used variable name within the outermost ranged-for loop, so this variable was shadowing the outer one. This isn't a bug, but it will get rid of a -Wshadow warning.
| * | | game_list: Use QJsonValueRef() within LoadCompatibilityList()Lioncash2018-09-121-2/+2
| |/ / | | | | | | | | | This way, we aren't constructing unnecessary QJsonValue instances.
* | | Merge pull request #1300 from lioncash/audiobunnei2018-09-127-17/+34
|\ \ \ | | | | | | | | service/audio: Replace includes with forward declarations where applicable
| * | | service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
| |/ / | | | | | | | | | | | | A few headers were including other headers when a forward declaration can be used instead, allowing the include to be moved to the cpp file.
* | | Merge pull request #1278 from tech4me/bg-color-fixbunnei2018-09-126-0/+46
|\ \ \ | | | | | | | | Port Citra #4047 & #4052: add change background color support
| * | | Port Citra #4047 & #4052: add change background color supporttech4me2018-09-096-0/+46
| | | |
* | | | Merge pull request #1295 from bunnei/accurate-copiesbunnei2018-09-122-18/+12
|\ \ \ \ | | | | | | | | | | gl_rasterizer_cache: Improve accuracy of caching and copies.
| * | | | gl_rasterizer_cache: Always blit on recreate, regardless of format.bunnei2018-09-121-6/+10
| | | | | | | | | | | | | | | | | | | | - Fixes several rendering issues with Super Mario Odyssey.
| * | | | gl_shader_cache: Remove cache_width/cache_height.bunnei2018-09-122-12/+2
| | |/ / | |/| | | | | | | | | | | | | | - This was once an optimization, but we no longer need it with the cache reserve. - This is also inaccurate.
* | | | Merge pull request #1294 from degasus/optimizationsbunnei2018-09-123-11/+12
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Use ARB_texture_storage.
| * | | | gl_rasterizer: Use ARB_texture_storage.Markus Wick2018-09-113-11/+12
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | It allows us to use texture views and it reduces the overhead within the GPU driver. But it disallows us to reallocate the texture, but we don't do so anyways. In the end, it is the new way to allocate textures, so there is no need to use the old way.
* | | | Implemented LEA and PSETFernandoS272018-09-111-0/+91
| | | |
* | | | Implemented encodings for LEA and PSETFernandoS272018-09-111-0/+64
|/ / /
* | | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \ \ | | | | | | | | hle/service: Default constructors and destructors in the cpp file where applicable
| * | | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a destructor isn't defaulted into a cpp file, it can cause the use of forward declarations to seemingly fail to compile for non-obvious reasons. It also allows inlining of the construction/destruction logic all over the place where a constructor or destructor is invoked, which can lead to code bloat. This isn't so much a worry here, given the services won't be created and destroyed frequently. The cause of the above mentioned non-obvious errors can be demonstrated as follows: ------- Demonstrative example, if you know how the described error happens, skip forwards ------- Assume we have the following in the header, which we'll call "thing.h": \#include <memory> // Forward declaration. For example purposes, assume the definition // of Object is in some header named "object.h" class Object; class Thing { public: // assume no constructors or destructors are specified here, // or the constructors/destructors are defined as: // // Thing() = default; // ~Thing() = default; // // ... Some interface member functions would be defined here private: std::shared_ptr<Object> obj; }; If this header is included in a cpp file, (which we'll call "main.cpp"), this will result in a compilation error, because even though no destructor is specified, the destructor will still need to be generated by the compiler because std::shared_ptr's destructor is *not* trivial (in other words, it does something other than nothing), as std::shared_ptr's destructor needs to do two things: 1. Decrement the shared reference count of the object being pointed to, and if the reference count decrements to zero, 2. Free the Object instance's memory (aka deallocate the memory it's pointing to). And so the compiler generates the code for the destructor doing this inside main.cpp. Now, keep in mind, the Object forward declaration is not a complete type. All it does is tell the compiler "a type named Object exists" and allows us to use the name in certain situations to avoid a header dependency. So the compiler needs to generate destruction code for Object, but the compiler doesn't know *how* to destruct it. A forward declaration doesn't tell the compiler anything about Object's constructor or destructor. So, the compiler will issue an error in this case because it's undefined behavior to try and deallocate (or construct) an incomplete type and std::shared_ptr and std::unique_ptr make sure this isn't the case internally. Now, if we had defaulted the destructor in "thing.cpp", where we also include "object.h", this would never be an issue, as the destructor would only have its code generated in one place, and it would be in a place where the full class definition of Object would be visible to the compiler. ---------------------- End example ---------------------------- Given these service classes are more than certainly going to change in the future, this defaults the constructors and destructors into the relevant cpp files to make the construction and destruction of all of the services consistent and unlikely to run into cases where forward declarations are indirectly causing compilation errors. It also has the plus of avoiding the need to rebuild several services if destruction logic changes, since it would only be necessary to recompile the single cpp file.
* | | | Merge pull request #1292 from ogniK5377/renderdoc-fixbunnei2018-09-112-2/+9
|\ \ \ \ | | | | | | | | | | Fixed renderdoc input/output textures not working due to multiple render targets
| * | | | Fixed renderdoc input/output textures not working due to render targetsDavid Marcec2018-09-112-2/+9
| |/ / /
* / / / externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This places the font data within cpp files, which mitigates the possibility of the font data being duplicated within the binary if it's referred to in more than one translation unit in the future. It also stores the data within a std::array, which is more flexible when it comes to operating with the standard library. Furthermore, it makes the data arrays const. This is what we want, as it allows the compiler to store the data within the read-only segment. As it is, having several large sections of mutable data like this just leaves spots in memory that we can accidentally write to (via accidental overruns, what have you) and actually have it work. This ensures the font data remains the same no matter what.
* | | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-112-2/+26
| | | | | | | | | | | | | | | | | | * Add open-source shared fonts * Address review comments
* | | Port #4141 from citra: Joystick hotplug support (#1275)Tobias2018-09-117-101/+339
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Joystick hotplug support (#4141) * use SDL_PollEvent instead of SDL_JoystickUpdate Register hot plugged controller by GUID if they were configured in a previous session * Move SDL_PollEvent into its own thread * Don't store SDLJoystick pointer in Input Device; Get pointer on each GetStatus call * Fix that joystick_list gets cleared after SDL_Quit * Add VirtualJoystick for InputDevices thats never nullptr * fixup! Add VirtualJoystick for InputDevices thats never nullptr * fixup! fixup! Add VirtualJoystick for InputDevices thats never nullptr * Remove SDL_GameController, make SDL_Joystick* unique_ptr * fixup! Remove SDL_GameController, make SDL_Joystick* unique_ptr * Adressed feedback; fixed handling of same guid reconnects * fixup! Adressed feedback; fixed handling of same guid reconnects * merge the two joystick_lists into one * make SDLJoystick a member of VirtualJoystick * fixup! make SDLJoystick a member of VirtualJoystick * fixup! make SDLJoystick a member of VirtualJoystick * fixup! fixup! make SDLJoystick a member of VirtualJoystick * SDLJoystick: Addressed review comments * Address one missed review comment
* | | Merge pull request #1286 from bunnei/multi-clearbunnei2018-09-112-50/+66
|\ \ \ | | | | | | | | gl_rasterizer: Implement clear for non-zero render targets.
| * | | gl_rasterizer: Implement clear for non-zero render targets.bunnei2018-09-102-50/+66
| | | | | | | | | | | | | | | | - Several misc. changes to ConfigureFramebuffers in support of this.
* | | | Merge pull request #1285 from bunnei/depth-fixbunnei2018-09-111-6/+22
|\ \ \ \ | | | | | | | | | | gl_rasterizer_cache: Only use depth for applicable texture formats.
| * | | | gl_rasterizer_cache: Only use depth for applicable texture formats.bunnei2018-09-101-6/+22
| |/ / / | | | | | | | | | | | | - Fixes an issue with Octopath Traveler leaving stale data here.
* | | | Merge pull request #1284 from bunnei/bgra8_srgbbunnei2018-09-113-0/+4
|\ \ \ \ | | | | | | | | | | gl_rasterizer_cache: Implement RenderTargetFormat::BGRA8_SRGB.
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat::BGRA8_SRGB.bunnei2018-09-103-0/+4
| |/ / / | | | | | | | | | | | | - Used by Octopath Traveler (with multiple render targets).
* | | | Merge pull request #1288 from MysticExile/remove-multicoreJames Rowe2018-09-112-10/+0
|\ \ \ \ | | | | | | | | | | Remove the multi-core option from the UI
| * | | | Remove multicore configure_general.uiMysticExile2018-09-101-7/+0
| | | | |
| * | | | remove multicore in configure_general.cppMysticExile2018-09-101-3/+0
| |/ / /
* | | | video_core: Refactor command_processor.Markus Wick2018-09-102-44/+42
| | | | | | | | | | | | | | | | Inline the WriteReg helper as it is called ~20k times per frame.
* | | | video_core: Move command buffer loop.Markus Wick2018-09-105-77/+84
| | | | | | | | | | | | | | | | This moves the hot loop into video_core. This refactoring shall reduce the CPU overhead of calling ProcessCommandList.
* | | | rasterizer: Drop unused handler.Markus Wick2018-09-104-8/+0
|/ / / | | | | | | | | | | | | | | | | | | | | | This virtual function is called in a very hot spot, and it does nothing. If this kind of feature is required, please be more specific and add callbacks in the switch statement within Maxwell3D::WriteReg. There is no point in having another switch statement within the rasterizer.
* | | gl_rasterizer: Implement multiple color attachments.bunnei2018-09-105-132/+95
| | |
* | | Merge pull request #1258 from tgsm/fix-sdl-loggingbunnei2018-09-101-2/+3
|\ \ \ | | | | | | | | yuzu-cmd: fix SDL logging
| * | | yuzu-cmd: fix SDL loggingtgsm2018-09-081-2/+3
| | | |
* | | | Merge pull request #1282 from lioncash/compatbunnei2018-09-1010-33/+56
|\ \ \ \ | | | | | | | | | | yuzu: Move compatibility list specifics to their own source files
| * | | | game_list: Make CompatibilityList parameter of NavigateToGamedbEntryRequested() a const referenceLioncash2018-09-103-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | The compatibility list isn't modified within any of the slots connected to this signal, so we can make it const to enforce immutability.
| * | | | yuzu: Move compatibility list specifics to their own source filesLioncash2018-09-1010-33/+54
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | Lets us keep the generic portions of the compatibility list code together, and allows us to introduce a type alias that makes it so we don't need to type out a very long type declaration anymore, making the immediate readability of some code better.
* | | | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \ \ \ | | | | | | | | | | hid: Implement ReloadInputDevices
| * | | | hid: Implement ReloadInputDevicesfearlessTobi2018-09-092-4/+6
| |/ / /
* | | | Merge pull request #1283 from lioncash/unusedbunnei2018-09-101-2/+0
|\ \ \ \ | | | | | | | | | | service: Remove unused g_kernel_named_ports variable
| * | | | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
| | | | | | | | | | | | | | | | | | | | | | | | | With the named port functionality all migrated over to the kernel, there's no need to keep this around anymore.
* | | | | Merge pull request #1268 from FernandoS27/tmmlbunnei2018-09-102-5/+67
|\ \ \ \ \ | |/ / / / |/| | | | shader_decompiler: Implemented TMML
| * | | | Implemented TMMLFernandoS272018-09-102-5/+67
| | | | |
* | | | | Merge pull request #1272 from Subv/dma_2dbunnei2018-09-101-2/+10
|\ \ \ \ \ | | | | | | | | | | | | GPU/DMA: Partially implemented the 'enable_2d' bit in the DMA engine.
| * | | | | GPU/DMA: Partially implemented the 'enable_2d' bit in the DMA engine.Subv2018-09-081-2/+10
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | When not set, this tells the GPU to only use the X size when performing a DMA copy. This is only implemented for linear->linear and tiled->tiled copies. Conversion copies still retain the assert. This bit is unset by some games for various purposes, and by nouveau when copying the vertex buffers.
* | | | | Merge pull request #1280 from zero334/improvementsbunnei2018-09-105-89/+101
|\ \ \ \ \ | |_|/ / / |/| | | | video_core: fixed arithmetic overflow warnings & improved code style
| * | | | video_core: fixed arithmetic overflow warnings & improved code stylePatrick Elsässer2018-09-095-89/+101
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | - Fixed all warnings, for renderer_opengl items, which were indicating a possible incorrect behavior from integral promotion rules and types larger than those in which arithmetic is typically performed. - Added const for variables where possible and meaningful. - Added constexpr where possible.
* | | | Implemented TXQ dimension query type, used by SMO.FernandoS272018-09-092-1/+36
| | | |
* | | | Change name of TEXQ to TXQ, in order to match NVIDIA's namingFernandoS272018-09-091-2/+2
|/ / /
* | | Merge pull request #1256 from bunnei/tex-target-supportbunnei2018-09-0811-229/+422
|\ \ \ | | | | | | | | Initial support for non-2D textures
| * | | gl_rasterizer_cache: Improve accuracy of RecreateSurface for non-2D textures.bunnei2018-09-082-27/+45
| | | |
| * | | maxwell_3d: Remove assert that no longer applies.bunnei2018-09-081-4/+0
| | | |
| * | | gl_rasterizer_cache: Partially implement several non-2D texture types.bunnei2018-09-081-30/+111
| | | |
| * | | gl_shader_decompiler: Partially implement several non-2D texture types (Subv).bunnei2018-09-082-32/+143
| | | |
| * | | gl_rasterizer: Implement texture wrap mode p.bunnei2018-09-082-2/+8
| | | |
| * | | gl_rasterizer_cache: Track texture depth.bunnei2018-09-083-4/+15
| | | |
| * | | gl_rasterizer_cache: Remove impl. of FlushGLBuffer.bunnei2018-09-081-34/+1
| | | | | | | | | | | | | | | | - Will not work for non-2d textures, and was not used anyways.
| * | | gl_rasterizer_cache: Keep track of texture type per surface.bunnei2018-09-083-32/+84
| | | |
| * | | gl_rasterizer_cache: Remove unused DownloadGLTexture.bunnei2018-09-082-51/+0
| | | |
| * | | gl_state: Keep track of texture target.bunnei2018-09-085-26/+28
| | | |
* | | | Merge pull request #1265 from zhaowenlan1779/patch-1bunnei2018-09-081-2/+2
|\ \ \ \ | | | | | | | | | | yuzu: fix title bar display
| * | | | yuzu: fix title bar displayPengfei Zhu2018-09-081-2/+2
| | |/ / | |/| | | | | | Previously the version number got hidden after starting a game.
* / | | audio_renderer: Rename AudioOut instance to audio_outMerryMage2018-09-082-7/+7
|/ / /
* | | Merge pull request #1246 from degasus/instanced_renderingbunnei2018-09-083-21/+29
|\ \ \ | | | | | | | | gl_rasterizer: Use baseInstance instead of moving the buffer points.
| * | | gl_rasterizer: Use baseInstance instead of moving the buffer points.bunnei2018-09-083-21/+29
| | |/ | |/| | | | | | | | | | | | | | | | This hopefully helps our cache not to redundant upload the vertex buffer. # Conflicts: # src/video_core/renderer_opengl/gl_rasterizer.cpp
* | | Merge pull request #1259 from lioncash/relocatebunnei2018-09-085-286/+324
|\ \ \ | |/ / |/| | yuzu: Move GameListWorker to its own source files
| * | yuzu: Move GameListWorker to its own source filesLioncash2018-09-075-286/+324
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This has gotten sufficiently large enough to warrant moving it to its own source files. Especially given it dumps the file_sys headers around code that doesn't use it for the most part. This'll also make it easier to introduce a type alias for the compatibility list, so a large unordered_map type declaration doesn't need to be specified all the time (we don't want to propagate the game_list_p.h include via the main game_list.h header).
* | | video_core: Arithmetic overflow warning fix for gl_rasterizer (#1262)Patrick Elsässer2018-09-081-12/+14
| |/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | * video_core: Arithmetic overflow fix for gl_rasterizer - Fixed warnings, which were indicating incorrect behavior from integral promotion rules and types larger than those in which arithmetic is typically performed. - Added const for variables where possible and meaningful. * Changed the casts from C to C++ style Changed the C-style casts to C++ casts as proposed. Took also care about signed / unsigned behaviour.
* | Merge pull request #1257 from lioncash/processbunnei2018-09-084-5/+34
|\ \ | |/ |/| core: Migrate current_process pointer to the kernel
| * core: Migrate current_process pointer to the kernelLioncash2018-09-074-5/+34
| | | | | | | | | | | | | | | | | | | | Given we now have the kernel as a class, it doesn't make sense to keep the current process pointer within the System class, as processes are related to the kernel. This also gets rid of a subtle case where memory wouldn't be freed on core shutdown, as the current_process pointer would never be reset, causing the pointed to contents to continue to live.
* | For SDL FrontendCaptV0rt3x2018-09-071-2/+2
| |
* | Better Title Bar DisplayCaptV0rt3x2018-09-075-8/+28
|/
* Merge pull request #1250 from lioncash/file-sysbunnei2018-09-074-4/+16
|\ | | | | file_sys/{nca_patch, patch_manager}: Amend unnecessary/missing includes.
| * file_sys/nca_patch: Amend constructor initializer list orderLioncash2018-09-061-2/+2
| | | | | | | | | | | | Orders the elements in the initializer list in the order they're specified in the class. This prevents compiler warnings about initialization order.
| * file_sys/nca_patch: Remove unnecessary includesLioncash2018-09-062-2/+9
| | | | | | | | | | romfs.h doesn't need to be included in the header, the only real dependency here is common's swap.h that needs to be included.
| * file_sys/patch_manager: Add missing includesLioncash2018-09-062-0/+5
| | | | | | | | These includes were previously being satisfied indirectly.
* | Merge pull request #1249 from FearlessTobi/disable-vsyncbunnei2018-09-072-0/+2
|\ \ | | | | | | frontend: Set swap interval to 0
| * | frontend: Set swap interval to 0fearlessTobi2018-09-062-0/+2
| | |
* | | Merge pull request #1251 from lioncash/core-incbunnei2018-09-075-2/+5
|\ \ \ | | | | | | | | core/core: Remove unnecessary sm/controller include
| * | | core/core: Remove unnecessary sm/controller includeLioncash2018-09-065-2/+5
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | The only reason this include was necessary, was because the constructor wasn't defaulted in the cpp file and the compiler would inline it wherever it was used. However, given Controller is forward declared, all those inlined constructors would see an incomplete type, causing a compilation failure. So, we just place the constructor in the cpp file, where it can see the complete type definition, allowing us to remove this include.
* | | Merge pull request #1252 from lioncash/headerbunnei2018-09-071-0/+1
|\ \ \ | | | | | | | | video_core/CMakeLists: Add missing gl_buffer_cache.h
| * | | video_core/CMakeLists: Add missing gl_buffer_cache.hLioncash2018-09-061-0/+1
| |/ / | | | | | | | | | | | | Without this, the header file won't show up by default within IDEs such as Visual Studio.
* | | Merge pull request #1253 from lioncash/explicitbunnei2018-09-072-8/+10
|\ \ \ | | | | | | | | video_core/gl_buffer_cache: Minor tidying changes
| * | | gl_buffer_cache: Default initialize member variablesLioncash2018-09-061-3/+3
| | | | | | | | | | | | | | | | Ensures that the cache always has a deterministic initial state.
| * | | gl_buffer_cache: Make GetHandle() a const member functionLioncash2018-09-062-2/+2
| | | | | | | | | | | | | | | | | | | | GetHandle() internally calls GetHandle() on the stream_buffer instance, which is a const member function, so this can be made const as well.
| * | | gl_buffer_cache: Remove unnecessary includesLioncash2018-09-062-2/+4
| | | |
| * | | gl_buffer_cache: Make constructor explicitLioncash2018-09-061-1/+1
| |/ / | | | | | | | | | Implicit conversions during construction isn't desirable here.
* | | Merge pull request #1255 from bunnei/minor-optbunnei2018-09-071-4/+2
|\ \ \ | | | | | | | | gl_rasterizer: Call state.Apply only once on SetupShaders.
| * | | gl_rasterizer: Call state.Apply only once on SetupShaders.bunnei2018-09-061-4/+2
| |/ /
* / / gl_shader_decompiler: Implement saturate mode for IPA.bunnei2018-09-061-1/+5
|/ /
* / gl_shader_gen: Initialize position.Markus Wick2018-09-061-0/+1
|/ | | | | IMO the old code is fine, but nvidia raises shader compiler warnings. Trivial fix through...
* Merge pull request #1243 from degasus/VAO_cachebunnei2018-09-063-53/+60
|\ | | | | gl_rasterizer: Implement a VAO cache.
| * gl_rasterizer: Implement a VAO cache.Markus Wick2018-09-053-53/+60
| | | | | | | | | | | | This patch caches VAO objects instead of re-emiting all pointers per draw call. Configuring this pointers is known as a fast task, but it yields too many GL calls. So for better performance, just bind the VAO instead of 16 pointers.
* | Merge pull request #1244 from FernandoS27/ipabunnei2018-09-062-47/+98
|\ \ | | | | | | shader_decompiler: Implemented IPA Properly (Stage 1)
| * | Implemented IPA ProperlyFernandoS272018-09-062-47/+98
| | |
* | | Merge pull request #1242 from lioncash/file-sysbunnei2018-09-062-8/+17
|\ \ \ | | | | | | | | file_sys/submission_package: Replace includes with forward declarations where applicable
| * | | file_sys/submission_package: Correct constructor initialization list orderLioncash2018-09-051-2/+2
| | | | | | | | | | | | | | | | | | | | Orders the elements in the sequence to match the order in which they'll actually be initialized in.
| * | | file_sys/submission_package: Replace includes with forward declarations where applicableLioncash2018-09-052-6/+15
| | |/ | |/|
* | | Merge pull request #1179 from DarkLordZach/bktrbunnei2018-09-0632-101/+1132
|\ \ \ | | | | | | | | file_sys: Add support for BKTR format (Game Updates)
| * | | bktr: Fix bucket overlap errorZach Hilman2018-09-048-9/+11
| | | |
| * | | drd: Parse title ID from program metadataZach Hilman2018-09-042-4/+29
| | | |
| * | | patch_manager: Centralize Control-type NCA parsingZach Hilman2018-09-046-80/+89
| | | |
| * | | nsp: Fix error masking issue with XCI filesZach Hilman2018-09-043-6/+13
| | | | | | | | | | | | | | | | Now display correct error instead of catch-all MissingProgramNCA
| * | | game_list: Fix version display on non-NAND titlesZach Hilman2018-09-044-30/+52
| | | |
| * | | bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
| | | |
| * | | game_list: Use friendly game versionsZach Hilman2018-09-041-13/+32
| | | | | | | | | | | | | | | | Mainly, from control.nacp metadata instead of cnmt metadata
| * | | bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
| | | | | | | | | | | | | | | | Fixes base game read errors
| * | | bktr: Fix missing includes and optimize styleZach Hilman2018-09-0412-103/+109
| | | |
| * | | main: Make game updates installableZach Hilman2018-09-041-1/+5
| | | |
| * | | game_list: Display patch names and versions on listZach Hilman2018-09-042-0/+27
| | | |
| * | | loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
| | | |
| * | | loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
| | | |
| * | | patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
| | | |
| * | | file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
| | | | | | | | | | | | | | | | Right now only includes Updates, but should eventually contain all of the other patches we need.
| * | | file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
| | | |
| * | | content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
| | | |
| * | | registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
| | | | | | | | | | | | | | | | Aggregates multiple caches into one interface
| * | | game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-043-5/+3
| | | | | | | | | | | | | | | | Reduces code
| * | | aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
| | | | | | | | | | | | | | | | Issues with block size are fixed by making all reads minimum length of 0x10
* | | | gl_rasterizer: Skip TODO log.Markus Wick2018-09-051-1/+1
| |/ / |/| | | | | | | | | | | | | | | | | This is called ~3k times per frame in SMO ingame. My laptop spends ~3ms per frame on allocating and freeing this string. Let's just stop printing this kind of redundant information.
* | | renderer_opengl: Implement a buffer cache.Markus Wick2018-09-055-86/+182
| |/ |/| | | | | | | | | | | | | | | The idea of this cache is to avoid redundant uploads. So we are going to cache the uploaded buffers within the stream_buffer and just reuse the old pointers. The next step is to implement a VBO cache on GPU memory, but for now, I want to check the overhead of the cache management. Fetching the buffer over PCI-E should be quite fast.
* | Merge pull request #1240 from degasus/optimizationsbunnei2018-09-054-15/+23
|\ \ | |/ |/| gl_shader_cache: Use an u32 for the binding point cache.
| * gl_shader_cache: Use an u32 for the binding point cache.Markus Wick2018-09-044-15/+23
| | | | | | | | | | | | | | The std::string generation with its malloc and free requirement was a noticeable overhead. Also switch to an ordered_map to avoid the std::hash call. As those maps usually have a size of two elements, the lookup time shall not matter.
* | main: Only show DRD deprecation warning onceZach Hilman2018-09-047-6/+19
| |
* | control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
| |
* | card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
| |
* | qt: Add deprecation warnings for DRD formatZach Hilman2018-09-041-0/+10
| |
* | registration: Fix NSP installation errorsZach Hilman2018-09-041-1/+1
| |
* | nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
| |
* | qt: Add UI support for NSP filesZach Hilman2018-09-043-2/+7
| |
* | registration: Add support for installing NSP filesZach Hilman2018-09-043-16/+34
| |
* | loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
| |
* | card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
| | | | | | | | Eliminated duplicate code and adds support for Rev1+ carts
* | file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
| |
* | drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
| | | | | | | | Previously only loaded from control metadata
* | loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
| |
* | key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
|/
* Merge pull request #1238 from lioncash/explicitbunnei2018-09-043-8/+8
|\ | | | | common/logging: Minor changes
| * common/logging: Amend documentation commentsLioncash2018-09-042-6/+6
| | | | | | | | | | | | | | Multi-line doc comments still need the '<' after the ///, otherwise it's treated as a regular comment and makes the original doc comment broken in viewers, IDEs, etc. While we're at it, also fix some typos in the comments.
| * common/logging/filter: Replace C-style case with C++ static_castLioncash2018-09-041-1/+1
| |
| * common/logging/filter: Make constructor explicitLioncash2018-09-041-1/+1
| | | | | | | | Implicit conversions aren't desirable here.
* | Merge pull request #1237 from degasus/optimizationsbunnei2018-09-044-7/+7
|\ \ | | | | | | Optimizations
| * | core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
| | | | | | | | | | | | This helper is called very often. The memory ownership shall not be transfered, so just return the raw pointer.
| * | command_processor: Use std::array for bound_engines.Markus Wick2018-09-042-4/+4
| |/ | | | | | | | | subchannel is a 3 bit field. So there must not be more than 8 bound engines. And using a hashmap for up to 8 values is a bit overpowered.
* | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-046-0/+79
|\ \ | | | | | | file_sys: Allow for custom NAND/SD directories
| * | qt: Add message about not moving contents on dir changeZach Hilman2018-09-042-6/+23
| | |
| * | qt: Add UI options to change NAND/SD dirsZach Hilman2018-09-043-0/+36
| | |
| * | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-043-0/+26
| | |
* | | Merge pull request #1232 from lioncash/copybunnei2018-09-041-1/+1
|\ \ \ | | | | | | | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()
| * | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()Lioncash2018-09-021-1/+1
| |/ / | | | | | | | | | | | | Using the getter function intended for external code here makes an unnecessary copy of the already-accessible used_shaders vector.
* | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0422-27/+64
|\ \ \ | | | | | | | | file_sys: Replace includes with forward declarations where applicable
| * | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0422-27/+64
| | |/ | |/| | | | | | | | | | Cuts down on include dependencies, resulting in less files that need to be rebuilt when certain things are changed.
* | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-044-5/+21
|\ \ \ | | | | | | | | Update microprofile scopes.
| * | | Update microprofile scopes.Markus Wick2018-09-044-5/+21
| |/ / | | | | | | | | | | | | | | | Blame the subsystems which deserve the blame :) The updated list is not complete, just the ones I've spotted on random sampling the stack trace.
* | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ | |/ / |/| | ssl: Move SSL class to cpp file
| * | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
| | | | | | | | | | | | | | | | | | This isn't required to be visible to anything outside of the main source file, and will eliminate needing to rebuild anything else including the header if the SSL class needs to be changed in the future.
* | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \ | | | | | | | | service: Migrate global named port map to the KernelCore class
| * | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ | |/| | | | | | | | | | | | | Now that we have a class representing the kernel in some capacity, we now have a place to put the named port map, so we move it over and get rid of another piece of global state within the core.
* / | vfs_real: Forward declare IOFileLioncash2018-09-0213-15/+45
|/ / | | | | | | | | | | Eliminates the need to rebuild some source files if the file_util header ever changes. This also uncovered some indirect inclusions, which have also been fixed.
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-023-4/+33
|\ \ | | | | | | filesystem/maxwell_3d: Various changes to boot Project Octopath Traveller
| * | maxwell_3d: Use CoreTiming for query timestampZach Hilman2018-09-011-2/+3
| | |
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| | |
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* | Merge pull request #1215 from ogniK5377/texs-nodep-assertbunnei2018-09-022-0/+3
|\ \ | | | | | | Added assert for TEXS nodep
| * | Added assert for TEXS nodepDavid Marcec2018-09-012-0/+3
| |/
* | Merge pull request #1220 from FearlessTobi/extensions-qolbunnei2018-09-022-8/+10
|\ \ | | | | | | yuzu: Display the unsupported GL extensions in the popup
| * | citra_qt: Display the unsupported GL extensions in the popupfearlessTobi2018-09-012-8/+10
| |/
* | Merge pull request #1214 from ogniK5377/ipa-assertbunnei2018-09-022-6/+13
|\ \ | | | | | | Added better asserts to IPA, Renamed IPA modes to match mesa
| * | Added better asserts to IPA, Renamed IPA modes to match mesaDavid Marcec2018-09-012-6/+13
| |/ | | | | | | | | | | | | | | | | | | IpaMode is changed to IpaInterpMode IpaMode is suppose to be 2 bits not 3 Added IpaSampleMode Added Saturate Renamed modes based on https://github.com/mesa3d/mesa/blob/d27c7918916cdc8092959124955f887592e37d72/src/gallium/drivers/nouveau/codegen/nv50_ir_emit_gm107.cpp#L2530
* | Merge pull request #1216 from ogniK5377/ffma-assertbunnei2018-09-022-0/+9
|\ \ | | | | | | Added FFMA asserts and missing fields
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| | | | | | | | | | | | Saturate already implemented
| * | Changed tab5980_0 default from 0 -> 1David Marcec2018-09-011-2/+2
| | |
| * | Added FFMA assertsDavid Marcec2018-09-012-0/+11
| |/
* | Merge pull request #1218 from ogniK5377/fmul-assertbunnei2018-09-022-0/+13
|\ \ | | | | | | Added FMUL asserts
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| | | | | | | | | | | | Unneeded as we already implement it
| * | Added FMUL assertsDavid Marcec2018-09-012-0/+15
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/ | | | | We don't need to do the lookup if the path is considered empty currently.
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-3129-66/+185
| | | | | | | | | | | The follow-up to e2457418dae19b889b2ad85255bb95d4cd0e4bff, which replaces most of the includes in the core header with forward declarations. This makes it so that if any of the headers the core header was previously including change, then no one will need to rebuild the bulk of the core, due to core.h being quite a prevalent inclusion. This should make turnaround for changes much faster for developers.
* gl_rasterizer_cache: Use accurate framebuffer setting for accurate copies.bunnei2018-08-312-73/+54
|
* gl_rasterizer_cache: Also use reserve cache for RecreateSurface.bunnei2018-08-312-24/+18
|
* rasterizer_cache: Use boost::interval_map for a more accurate cache.bunnei2018-08-311-33/+45
|
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-3111-138/+70
|
* gl_rasterizer: Fix issues with the rasterizer cache.bunnei2018-08-314-46/+57
| | | | | - Use a single cached page map. - Fix calculation of ending page.
* Implement BC6H_UF16 & BC6H_SF16 (#1092)greggameplayer2018-08-313-31/+55
| | | | | | | | | * Implement BC6H_UF16 & BC6H_SF16 Require by ARMS * correct coding style * correct coding style part 2
* Merge pull request #1204 from lioncash/pimplbunnei2018-08-315-279/+387
|\ | | | | core: Make the main System class use the PImpl idiom
| * core: Make the main System class use the PImpl idiomLioncash2018-08-315-279/+387
| | | | | | | | | | | | | | | | | | | | | | | | | | core.h is kind of a massive header in terms what it includes within itself. It includes VFS utilities, kernel headers, file_sys header, ARM-related headers, etc. This means that changing anything in the headers included by core.h essentially requires you to rebuild almost all of core. Instead, we can modify the System class to use the PImpl idiom, which allows us to move all of those headers to the cpp file and forward declare the bulk of the types that would otherwise be included, reducing compile times. This change specifically only performs the PImpl portion.
* | Merge pull request #1207 from degasus/hotfixbunnei2018-08-311-1/+1
|\ \ | | | | | | Report correct shader size.
| * | Report correct shader size.Markus Wick2018-08-311-1/+1
| | | | | | | | | | | | | | | Seems like this was an oversee in regards to 1fd979f50a9f4c21fa8cafba7268d959e3076924 It changed GLShader::ProgramCode to a std::vector, so sizeof is wrong.
* | | Added predicate comparison GreaterEqualWithNanHexagon122018-08-312-3/+4
|/ /
* | Merge pull request #1195 from FearlessTobi/port-gamelist-compatbunnei2018-08-318-3/+174
|\ \ | | | | | | yuzu: Show game compatibility in the game list (PR ported from Citra)
| * | Show game compatibility within yuzufearlessTobi2018-08-298-3/+174
| | |
* | | gl_shader_decompiler: Implement POPC (#1203)Laku2018-08-312-0/+19
| | | | | | | | | | | | | | | | | | * Implement POPC * implement invert
* | | Merge pull request #1200 from bunnei/improve-ipabunnei2018-08-302-1/+39
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.
| * | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.bunnei2018-08-292-1/+39
| | |
* | | Merge pull request #1198 from lioncash/kernelbunnei2018-08-3054-442/+671
|\ \ \ | | | | | | | | kernel: Eliminate kernel global state
| * | | kernel: Eliminate kernel global stateLioncash2018-08-2954-442/+671
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As means to pave the way for getting rid of global state within core, This eliminates kernel global state by removing all globals. Instead this introduces a KernelCore class which acts as a kernel instance. This instance lives in the System class, which keeps its lifetime contained to the lifetime of the System class. This also forces the kernel types to actually interact with the main kernel instance itself instead of having transient kernel state placed all over several translation units, keeping everything together. It also has a nice consequence of making dependencies much more explicit. This also makes our initialization a tad bit more correct. Previously we were creating a kernel process before the actual kernel was initialized, which doesn't really make much sense. The KernelCore class itself follows the PImpl idiom, which allows keeping all the implementation details sealed away from everything else, which forces the use of the exposed API and allows us to avoid any unnecessary inclusions within the main kernel header.
* / / Shaders: Implemented IADD3tech4me2018-08-292-1/+84
|/ /
* | Merge pull request #1193 from lioncash/privbunnei2018-08-287-26/+40
|\ \ | | | | | | gpu: Make memory_manager private
| * | gpu: Make memory_manager privateLioncash2018-08-287-26/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the class interface consistent and provides accessors for obtaining a reference to the memory manager instance. Given we also return references, this makes our more flimsy uses of const apparent, given const doesn't propagate through pointers in the way one would typically expect. This makes our mutable state more apparent in some places.
* | | Merge pull request #1192 from lioncash/unusedbunnei2018-08-281-2/+0
|\ \ \ | | | | | | | | gl_rasterizer: Remove unused variables
| * | | gl_rasterizer: Remove unused variablesLioncash2018-08-281-2/+0
| |/ /
* | | Merge pull request #1191 from lioncash/noexceptbunnei2018-08-281-1/+1
|\ \ \ | | | | | | | | hle/result: Make ResultVal's move constructor as noexcept
| * | | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many containers within the standard library provide different behaviors based on whether or not a move constructor/assignment operator can be guaranteed not to throw or not. Notably, implementations will generally use std::move_if_noexcept (or an internal implementation of it) to provide strong exception guarantees. If a move constructor potentially throws (in other words, is not noexcept), then certain behaviors will create copies, rather than moving the values. For example, consider std::vector. When a std::vector calls resize(), there are two ways the elements can be relocated to the new block of memory (if a reallocation happens), by copy, or by moving the existing elements into the new block of memory. If a type does not have a guarantee that it will not throw in the move constructor, a copy will happen. However, if it can be guaranteed that the move constructor won't throw, then the elements will be moved. This just allows ResultVal to be moved instead of copied all the time if ever used in conjunction with containers for whatever reason.
* | | Merge pull request #1194 from lioncash/allocbunnei2018-08-281-2/+1
|\ \ \ | |_|/ |/| | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()
| * | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()Lioncash2018-08-281-2/+1
| |/ | | | | | | | | | | | | | | Given std::vector is a type with a non-trivial destructor, this variable cannot be optimized away by the compiler, even if unused. Because of that, something that was intended to be fairly lightweight, was actually allocating 32KB and deallocating it at the end of the function.
* / Fix two stupid errors made in #1141fearlessTobi2018-08-282-1/+2
|/
* Merge pull request #1165 from bunnei/shader-cachebunnei2018-08-2812-417/+387
|\ | | | | renderer_opengl: Implement a new shader cache.
| * renderer_opengl: Implement a new shader cache.bunnei2018-08-289-285/+250
| |
| * gl_rasterizer_cache: Update to use RasterizerCache base class.bunnei2018-08-283-132/+20
| |
| * video_core: Add RasterizerCache class for common cache management code.bunnei2018-08-282-0/+117
| |
* | yuzu: Fix stick UI direction orderfearlessTobi2018-08-281-2/+2
| |
* | Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\ \ | |/ |/| kernel/error: Amend several error codes
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| | | | | | | | | | | | We can make this error code an alias of the resource limit exceeded error code, allowing us to get rid of the lingering 3DS error code of the same type.
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| | | | | | | | | | We can treat this as an alias of TooLarge for documentation purposes. This also lets us get rid of another lingering 3DS-related error code.
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| | | | | | | | | | This replaces the lingering 3DS constant with the proper one, and utilizes it within HandleTable's Create() member function.
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| |
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
| |
* | Merge pull request #1169 from Lakumakkara/selbunnei2018-08-281-1/+1
|\ \ | | | | | | shader_bytecode: fix SEL_IMM bitstring
| * | fix SEL_IMM bitstringLaku2018-08-241-1/+1
| | |
* | | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \ \ | | | | | | | | vfs_real: Remove unused variable in CreateDirectoryRelative()
| * | | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
| | | |
* | | | Merge pull request #1170 from lioncash/retbunnei2018-08-281-1/+1
|\ \ \ \ | | | | | | | | | | file_util: Correct return value in early exit of ReadFileToString()
| * | | | file_util: Correct return value in early exit of ReadFileToString()Lioncash2018-08-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | While still essentially being zero, we should be returning a numeric value here, not a boolean typed value.
* | | | | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \ \ \ \ | | | | | | | | | | | | core: Namespace all code in the arm subdirectory under the Core namespace
| * | | | | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
| |/ / / / | | | | | | | | | | | | | | | Gets all of these types and interfaces out of the global namespace.
* | | | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \ \ \ | | | | | | | | | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()
| * | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ / / | |/| | | | | | | | | | | | | Prevents compiler warnings.
* | | | | Merge pull request #1128 from DarkLordZach/malformed-hex-crashbunnei2018-08-271-5/+17
|\ \ \ \ \ | | | | | | | | | | | | hex_util: Replace logic_errors with LOG_CRITICAL
| * | | | | hex_util: Replace logic_errors with LOG_CRITICALZach Hilman2018-08-231-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | Makes it so malformed hex strings do not crash the entire program.
* | | | | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Return process title ID if queried in GetInfo()
| * | | | | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have the variable itself set up to perform this task, so we can just return its value from the currently executing process instead of always stubbing it to zero.
* | | | | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-275-27/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | debug_utils: Minor individual interface changes
| * | | | | | | debug_utils: Remove unused includesLioncash2018-08-255-24/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Quite a bit of these aren't necessary directly within the debug_utils header and can be removed or included where actually necessary.
| * | | | | | | debug_utils: Make BreakpointObserver class' constructor explicitLioncash2018-08-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids implicit conversions.
| * | | | | | | debug_utils: Initialize active_breakpoint member of DebugContextLioncash2018-08-251-2/+2
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Ensures that all class members are initialized.
* | | | | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | PL:U Added SharedFonts loading via TTF
| * | | | | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| | | | | | | |
| * | | | | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | By having the following TTF files in your yuzu sysdata directory. You can load sharedfonts via TTF files. FontStandard.ttf FontChineseSimplified.ttf FontExtendedChineseSimplified.ttf FontChineseTraditional.ttf FontKorean.ttf FontNintendoExtended.ttf FontNintendoExtended2.ttf
* | | | | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid: Move core include to cpp file
| * | | | | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't required to be in the header. Instead, directly include what this header needs and move it to the cpp file where it belongs.
* | | | | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: Remove always true conditionals in Load()
| * | | | | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These conditions are always true, since the outer conditional already checks for these conditions.
* | | | | / / / set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
| |_|_|_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rightnow, in games use GetAvailableLanguageCodes(), there is a WriteBuffer() with size larger than the buffer_size. (Core Critical core\hle\kernel\hle_ipc.cpp:WriteBuffer:296: size (0000000000000088) is greater than buffer_size (0000000000000078)) 0x88 = 17(languages) * 8 0x78 = 15(languages) * 8 GetAvailableLanguageCodes() can only support 15 languages. After firmware 4.0.0 there are 17 supported language instead of 15, to enable this GetAvailableLanguageCodes2() need to be used. So GetAvailableLanguageCodes() will be caped at 15 languages. Reference: http://switchbrew.org/index.php/Settings_services
* | | | | | | Merge pull request #1173 from lioncash/batchbunnei2018-08-251-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()
| * | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()Lioncash2018-08-251-4/+4
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | The start and finish events should likely not be right after one another like this, otherwise the batch will appear to complete immediately
* | | | | | | Merge pull request #1167 from lioncash/assertbunnei2018-08-251-1/+2
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()
| * | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()Lioncash2018-08-241-1/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Previously the assert would always be hit, since it was the equivalent of: array == nullptr, which is never true.
* | | | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | filesystem: Fix typo in log message
| * | | | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ / / /
* | | | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2531-97/+821
|\ \ \ \ \ | | | | | | | | | | | | file_sys: Add support for NAX archives
| * | | | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| | | | | |
| * | | | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| | | | | |
| * | | | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | This is needed because the title IDs of update NCAs will not use the update title ID. The only sure way to tell is to look for a partition with BKTR crypto.
| * | | | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| | | | | |
| * | | | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | On call to WriteKeyToFile, so that the autogenerated file can be written.
| * | | | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| | | | | |
| * | | | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| | | | | |
| * | | | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| | | | | | | | | | | | | | | | | | | | | | | | Stored in a separate file than manual keys.
| * | | | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| | | | | |
| * | | | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| | | | | | | | | | | | | | | | | | | | | | | | Should make key gets marginally faster.
| * | | | | game_list: Add SD registration loading to game listZach Hilman2018-08-232-12/+12
| | | | | |
| * | | | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| | | | | |
| * | | | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | Returns the file before calling parser on it.
| * | | | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| | | | | |
| * | | | | qt: Make default row data title name and title idZach Hilman2018-08-231-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | Helps with installed games by making the title not a hexadecimal id string, instead the name.
| * | | | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| | | | | |
| * | | | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-233-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | Allows frontend to create registration caches for use before a game has booted.
| * | | | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| | | | | |
| * | | | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| | | | | |
| * | | | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| | | | | |
| * | | | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| | | | | |
| * | | | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | XTS with Nintendo Tweak will fail mysteriously if the sector size is not 0x4000. Upgrade the critical log to an assert to prevent undefined behavior.
| * | | | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | Fixes a bug where data lengths of less than size 0x10 will fail or have misleading return values.
| * | | | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | Prevents NCA-related errors from being masked into MissingProgramNCA or MissingKeyFile
* | | | | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-242-0/+18
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | qt: Add filename and title id to window title while running
| * | | | | qt: Add filename and title id to window title while runningZach Hilman2018-08-232-0/+18
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1164 from tech4me/decode_iadd3bunnei2018-08-241-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | | Shaders: Added decodings for IADD3 instructions
| * | | | Shaders: Added decodings for IADD3 instructionstech4me2018-08-231-0/+6
| |/ / /
* | | | Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" (#1142)Tobias2018-08-241-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | * Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" * Fix compilation
* | | | Added GetBootMode (#1107)David2018-08-244-3/+25
|/ / / | | | | | | | | | | | | | | | | | | | | | * Added GetBootMode Used by homebrew * Added enum for GetBootMode
* | | Merge pull request #1160 from bunnei/surface-reservebunnei2018-08-232-17/+91
|\ \ \ | | | | | | | | gl_rasterizer_cache: Several improvements
| * | | gl_rasterizer_cache: Blit when possible on RecreateSurface.bunnei2018-08-231-5/+12
| | | |
| * | | gl_rasterizer_cache: Reserve surfaces that have already been created for later use.bunnei2018-08-232-3/+61
| | | |
| * | | gl_rasterizer_cache: Remove assert for RecreateSurface type.bunnei2018-08-231-1/+0
| | | |
| * | | gl_rasterizer_cache: Implement compressed texture copies.bunnei2018-08-231-8/+18
| |/ /
* | | gl_rasterizer: Implement stencil test.bunnei2018-08-233-4/+58
| | | | | | | | | | | | - Used by Splatoon 2.
* | | gl_rasterizer: Implement partial color clear and stencil clear.bunnei2018-08-231-12/+42
| | |
* | | maxwell_3d: Update to include additional stencil registers.bunnei2018-08-231-20/+50
| | |
* | | gl_state: Update to handle stencil front/back face separately.bunnei2018-08-232-33/+38
|/ /
* | Merge pull request #1157 from lioncash/vecbunnei2018-08-232-11/+16
|\ \ | | | | | | gl_shader_gen: Use a std::vector to represent program code instead of std::array
| * | gl_shader_gen: Make ShaderSetup's constructor explicitLioncash2018-08-221-1/+1
| | | | | | | | | | | | Prevents implicit conversions.
| * | gl_shader_gen: Use a std::vector to represent program code instead of std::arrayLioncash2018-08-222-11/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While convenient as a std::array, it's also quite a large set of data as well (32KB). It being an array also means data cannot be std::moved. Any situation where the code is being set or relocated means that a full copy of that 32KB data must be done. If we use a std::vector we do need to allocate on the heap, however, it does allow us to std::move the data we have within the std::vector into another std::vector instance, eliminating the need to always copy the program data (as std::move in this case would just transfer the pointers and bare necessities over to the new vector instance).
* | | Merge pull request #1156 from Lakumakkara/lop3bunnei2018-08-232-0/+60
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Implement LOP3
| * | more fixesLaku2018-08-221-6/+7
| | |
| * | fixesLaku2018-08-221-6/+12
| | |
| * | remove debug loggingLaku2018-08-221-2/+0
| | |
| * | implement lop3Laku2018-08-222-0/+55
| | |
* | | Swap "Plus" with "Minus" on the controller GUI (#1150)literalmente-game2018-08-231-8/+8
| | | | | | | | | | | | | | | * Swap "Plus" with "Minus" on the controller GUI Major fix /s
* | | Merge pull request #1137 from lioncash/namespacebunnei2018-08-2321-23/+70
|\ \ \ | |_|/ |/| | renderer_opengl: Namespace OpenGL code
| * | renderer_opengl: Namespace OpenGL codeLioncash2018-08-2221-23/+70
| |/ | | | | | | | | | | | | Namespaces all OpenGL code under the OpenGL namespace. Prevents polluting the global namespace and allows clear distinction between other renderers' code in the future.
* / config: Fixed icon size get set to 0tech4me2018-08-221-1/+1
|/
* Merge pull request #1136 from tech4me/masterbunnei2018-08-226-11/+45
|\ | | | | qt/main: Port part of citra(#3411), open savedata works
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-216-11/+45
| |
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-2210-25/+94
|\ \ | | | | | | Port #3353 from Citra: "citra-qt: Add customizable speed limit target "
| * | Port #3353 from CitrafearlessTobi2018-08-2110-25/+94
| | |
* | | Merge pull request #1154 from OatmealDome/topology-linesbunnei2018-08-221-0/+2
|\ \ \ | | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::Lines
| * | | maxwell_to_gl: Implement PrimitiveTopology::LinesOatmealDome2018-08-221-0/+2
| | | | | | | | | | | | Used by Splatoon 2's debug menu.
* | | | Merge pull request #1141 from FearlessTobi/port-3902bunnei2018-08-222-0/+18
|\ \ \ \ | | | | | | | | | | Port #3902 from Citra: "Add restart hotkey & menu option"
| * | | | Port #3902 from Citra: "Add restart hotkey & menu option"fearlessTobi2018-08-212-0/+18
| | |_|/ | |/| |
* | | | Merge pull request #1124 from Subv/logic_opsbunnei2018-08-226-7/+108
|\ \ \ \ | |_|/ / |/| | | GPU: Implemented logic ops.
| * | | GPU: Implemented the logic op functionality of the GPU.Subv2018-08-213-0/+61
| | | | | | | | | | | | | | | | This will ASSERT if blending is enabled at the same time as logic ops.
| * | | GLState: Allow enabling/disabling GL_COLOR_LOGIC_OP independently from blending.Subv2018-08-212-6/+19
| | | |
| * | | GPU: Added registers for the logicop functionality.Subv2018-08-211-1/+28
| | |/ | |/|
* | | Merge pull request #1147 from lioncash/warnbunnei2018-08-221-1/+1
|\ \ \ | | | | | | | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instance
| * | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instanceLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous form of initializing done here is a C-ism, an empty set of braces is sufficient for initializing (and doesn't potentially cause missing brace warnings, given the first member of the struct is a COORD struct).
* | | | Merge pull request #1151 from bunnei/revert-4a2ee191bunnei2018-08-222-153/+31
|\ \ \ \ | | | | | | | | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS …"
| * | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions."bunnei2018-08-222-153/+31
| | | | | | | | | | | | | | | | | | | | | | | | | - This reverts commit 3ef4b3d4b445960576f10d1ba6521580d03e3da8. - This commit had broken a lot of games. We really should do a full implementation of this in one change.
* | | | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
| | | | | | | | | | | | | | | | | | | | Should fix any compile errors
* | | | | PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added bfttf loading We can now load system bfttf fonts from system archives AND shared memory dumps. This allows people who have installed their system nand dumps to yuzu to automatically get shared font support. We also now don't hard code the offsets or the sizes of the shared fonts and it's all calculated for us now. * Addressed plu fixups * Style changes for plu * Fixed logic error for plu and added more error checks.
* | | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \ \ | | | | | | | | | | vfs: Replace mode.h include with forward declarations where applicable
| * | | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
| |/ / / | | | | | | | | | | | | | | | | Avoids the need to rebuild these source files if the mode header changes.
* | | | Merge pull request #1146 from lioncash/ambunnei2018-08-221-3/+4
|\ \ \ \ | | | | | | | | | | am: Utilize std::array within PopLaunchParameter()
| * | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
| |/ / / | | | | | | | | | | | | | | | | | | | | Gets rid of the potential for C array-to-pointer decay, and also makes pointer arithmetic to get the end of the copy range unnecessary. We can just use std::array's begin() and end() member functions.
* | | | Merge pull request #1148 from lioncash/audio-warnbunnei2018-08-211-1/+1
|\ \ \ \ | | | | | | | | | | audio_core/filter: Add explicit cast to assignment in Process()
| * | | | audio_core/filter: Add explicit cast to assignment in Process()Lioncash2018-08-211-1/+1
| |/ / / | | | | | | | | | | | | | | | | Previously this would cause warnings about implicit conversions to s16 from a double
* / / / shader_bytecode: Parenthesize conditional expression within GetTextureType()Lioncash2018-08-211-1/+1
|/ / / | | | | | | | | | Resolves a -Wlogical-op-parentheses warning.
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \ | | | | | | | | sdmc_factory: Remove unnecessary core include
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/| | | | | | | | | | This doesn't require the central core header to be included, it just needs the vfs headers.
* | | Merge pull request #1139 from lioncash/bitfieldbunnei2018-08-211-2/+1
|\ \ \ | | | | | | | | bit_field: Convert ToBool() into explicit operator bool
| * | | bit_field: Convert ToBool() into explicit operator boolLioncash2018-08-211-2/+1
| |/ / | | | | | | | | | Gets rid of a TODO that is long overdue.
* | | Merge pull request #1140 from FearlessTobi/port-4056bunnei2018-08-212-0/+14
|\ \ \ | | | | | | | | Port #4056 from Citra: "Add Clear Recent Files menu action"
| * | | Port #4056 from Citra: "Add Clear Recent Files menu action"fearlessTobi2018-08-212-0/+14
| |/ /
* / / perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ / | | | | | | | | | | | | | | | | | | 25us is far too small, and would result in std::this_thread::sleep_for being called with this as a maximum value. This means that a guest application that produces frames instantly would only be limited to 40 kHz. 25ms is a more appropriate value, as it allows for a 60 Hz refresh rate while providing enough slack in the negative region.
* | Merge pull request #1123 from lioncash/screenbunnei2018-08-217-30/+25
|\ \ | | | | | | rasterizer_interface: Remove renderer-specific ScreenInfo type from AccelerateDraw() in RasterizerInterface
| * | rasterizer_interface: Remove ScreenInfo from AccelerateDraw()'s signatureLioncash2018-08-215-17/+14
| | | | | | | | | | | | | | | | | | This is an OpenGL renderer-specific data type. Given that, this type shouldn't be used within the base interface for the rasterizer. Instead, we can pass this information to the rasterizer via reference.
| * | renderer_base: Make creation of the rasterizer, the responsibility of the renderers themselvesLioncash2018-08-214-14/+12
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we use a base-class type within the renderer for the rasterizer (RasterizerInterface), we want to allow renderers to perform more complex initialization if they need to do such a thing. This makes it important to reserve type information. Given the OpenGL renderer is quite simple settings-wise, this is just a simple shuffling of the initialization code. For something like Vulkan however this might involve doing something like: // Initialize and call rasterizer-specific function that requires // the full type of the instance created. auto raster = std::make_unique<VulkanRasterizer>(some, params); raster->CallSomeVulkanRasterizerSpecificFunction(); // Assign to base class variable rasterizer = std::move(raster)
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-2111-8/+40
|\ \ | | | | | | romfs_factory, service/filesystem: Use forward declarations where applicable
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-219-5/+28
| | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to rebuild multiple source files if the filesystem code headers change. This also gets rid of a few instances of indirect inclusions being relied upon
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
| | | | | | | | | | | | | | | | | | Avoids the need to rebuild whatever includes the romfs factory header if the loader header ever changes. We also don't need to include the main core header. We can instead include the headers we specifically need.
* | | Merge pull request #1132 from Subv/gl_FragDepthbunnei2018-08-211-1/+6
|\ \ \ | | | | | | | | Shaders: Implement depth writing in fragment shaders.
| * | | Shaders: Implement depth writing in fragment shaders.Subv2018-08-211-1/+6
| | | | | | | | | | | | | | | | We'll write <last color output reg + 2> to gl_FragDepth.
* | | | Merge pull request #1134 from lioncash/logbunnei2018-08-211-1/+1
|\ \ \ \ | | | | | | | | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logs
| * | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logsLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | LOG_TRACE is only enabled on debug builds which can be quite slow when trying to debug graphics issues. Instead we can log the messages to the debug log, which is available on both release and debug builds.
* | | | | Merge pull request #1121 from Subv/tex_reinterpretbunnei2018-08-214-16/+70
|\ \ \ \ \ | |/ / / / |/| | | | Rasterizer: Use PBOs to reinterpret texture formats when games re-use the same memory.
| * | | | Rasterizer: Reinterpret the raw texture bytes instead of blitting (and thus doing format conversion) to a new texture when a game requests an old texture address with a different format.Subv2018-08-201-3/+49
| | | | |
| * | | | Rasterizer: Don't attempt to copy over the old texture's data when doing a format reinterpretation if we're only going to clear the framebuffer.Subv2018-08-204-13/+21
| | |_|/ | |/| |
* | | | Merge pull request #1133 from lioncash/guardbunnei2018-08-211-0/+2
|\ \ \ \ | |_|/ / |/| | | gl_stream_buffer: Add missing header guard
| * | | gl_stream_buffer: Add missing header guardLioncash2018-08-211-0/+2
| | | | | | | | | | | | | | | | | | | | Prevents potential compilation errors from occuring due to multiple inclusions
* | | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \ \ | | | | | | | | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()
| * | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these functions aren't intended to be used frequently, there's no need to keep the std::string instances allocated for the whole lifetime of the program. It's just a waste of memory.
* | | | | Merge pull request #1131 from bunnei/impl-tex3d-texcubebunnei2018-08-212-2/+21
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement TextureCube/Texture3D for TEX/TEXS.
| * | | | | shader_bytecode: Replace some UNIMPLEMENTED logs.bunnei2018-08-211-2/+6
| | | | | |
| * | | | | gl_shader_decompiler: Implement Texture3D for TEXS.bunnei2018-08-211-0/+7
| | | | | |
| * | | | | gl_shader_decompiler: Implement TextureCube for TEX.bunnei2018-08-211-0/+8
| | | | | |
* | | | | | Merge pull request #1106 from Subv/multiple_rendertargetsbunnei2018-08-212-6/+45
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.
| * | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.Subv2018-08-212-6/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were only writing to the first render target before. Note that this is only the GLSL side of the implementation, supporting multiple render targets requires more changes in the OpenGL renderer. Dual Source blending is not implemented and stuff that uses it might not work at all.
* | | | | | Merge pull request #1130 from Subv/tex_2dbunnei2018-08-211-6/+15
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Shaders: Fixed texture coordinates in TEX with Texture2D
| * | | | | Shaders: Fixed the coords in TEX with Texture2D.Subv2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The X and Y coordinates should be in gpr8 and gpr8+1, respectively. This fixes the cutscene rendering in Sonic Mania.
| * | | | | Shaders: Log and crash when using an unimplemented texture type in a texture sampling instruction.Subv2018-08-211-5/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ \ | |_|_|_|/ |/| | | | acc/profile_manager: General cleanup
| * | | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| | | | | | | | | | | | | | | | | | | | This is only used in a shared_ptr, so we can forward declare it.
| * | | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We have an overload of WriteBuffer that accepts containers that satisfy the ContiguousContainer concept, which std::array does, so we only need to pass in the array itself.
| * | | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | Arranges them in the order the members would be initialized
| * | | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| | | | | | | | | | | | | | | | | | | | This is no longer used, so it can be removed.
| * | | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | Makes it a little bit more self-documenting.
| * | | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Given the source and destination types are the same std::array type, we can simply use regular assignment to perform the same behavior.
| * | | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to repeatedly specify the whole array type in multiple places.
| * | | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ProfileInfo is quite a large struct in terms of data, and we don't need to perform a copy in these instances, so we can just pass constant references instead.
| * | | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify the passed in array, so this can be a const reference.
| * | | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | This can just be constexpr like the others
| * | | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use the constructor initializer list and just compare the contained u128's together instead of comparing each element individually. Ditto for comparing against an invalid UUID.
| * | | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | | This avoids needing to dump the contents of <random> into other files that include the profile manager header.
| * | | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |_|/ | |/| | | | | | | | | | | | | | | | | | Moving a const reference isn't possible, so this just results in a copy (and given ProfileInfo is composed of trivial types and aggregates, a move wouldn't really do anything).
* | | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ \ | |_|/ / |/| | | filesystem: Add support for loading of system archives
| * | | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| | | |
| * | | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
| | |/ | |/|
* | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-213-62/+84
|\ \ \ | |_|/ |/| | common/telemetry: Migrate core-independent info gathering to common
| * | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-153-62/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously core itself was the library containing the code to gather common information (build info, CPU info, and OS info), however all of this isn't core-dependent and can be moved to the common code and use the common interfaces. We can then just call those functions from the core instead. This will allow replacing our CPU detection with Xbyak's which has better detection facilities than ours. It also keeps more architecture-dependent code in common instead of core.
* | | Merge pull request #1104 from Subv/instanced_arraysbunnei2018-08-202-4/+30
|\ \ \ | | | | | | | | GLRasterizer: Implemented instanced vertex arrays.
| * | | GLRasterizer: Implemented instanced vertex arrays.Subv2018-08-182-4/+30
| | |/ | |/| | | | | | | Before each draw call, for every enabled vertex array configured as instanced, we take the current instance id and divide it by its configured divisor, then we multiply that by the corresponding stride and increment the start address by the resulting amount. This way we can simulate the vertex array being incremented once per instance without actually using OpenGL's instancing functions.
* | | Merge pull request #1115 from Subv/texs_maskbunnei2018-08-201-18/+18
|\ \ \ | | | | | | | | Shaders/TEXS: Write to the correct output register when swizzling.
| * | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-201-18/+18
| | | | | | | | | | | | | | | | Previously we could end up with a TEXS that didn't write any outputs, this was wrong.
* | | | Merge pull request #1112 from Subv/sampler_typesbunnei2018-08-203-33/+250
|\ \ \ \ | | | | | | | | | | Shaders: Use the correct shader type when sampling textures.
| * | | | Shader: Implemented the TLD4 and TLD4S opcodes using GLSL's textureGather.Subv2018-08-191-0/+51
| | | | | | | | | | | | | | | | | | | | It is unknown how TLD4S determines the sampler type, more research is needed.
| * | | | Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions.Subv2018-08-192-29/+127
| | | | | | | | | | | | | | | | | | | | Different sampler types have their parameters in different registers.
| * | | | Shader: Added bitfields for the texture type of the various sampling instructions.Subv2018-08-191-1/+65
| | | | |
| * | | | Shaders: Added decodings for TLD4 and TLD4SSubv2018-08-191-3/+7
| | | | |
* | | | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \ \ \ | | | | | | | | | | | | Added CheckFreeCommunicationPermission
| * | | | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ / / | |/| | | | | | | | | | | | | This fixes save files not loading in splatoon 2
* | | | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ \ \ | | | | | | | | | | | | New account backend to allow for future extended support
| * | | | | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| | | | | |
| * | | | | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| | | | | |
| * | | | | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| | | | | |
| * | | | | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| | | | | |
| * | | | | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| | | | | |
| * | | | | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| | | | | |
| * | | | | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| | | | | |
| * | | | | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| | | | | |
| * | | | | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| | | | | |
| * | | | | If statement style changeDavid Marcec2018-08-111-11/+19
| | | | | |
| * | | | | Second round of account changesDavid Marcec2018-08-113-18/+21
| | | | | |
| * | | | | First round of account changesDavid Marcec2018-08-113-49/+55
| | | | | |
| * | | | | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| | | | | |
| * | | | | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1176-634/+1562
| |\ \ \ \ \
| * | | | | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| | | | | | |
| * | | | | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| | | | | | |
| * | | | | | Open first user addedDavid Marcec2018-08-081-1/+3
| | | | | | |
| * | | | | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit verified working on puyo
| * | | | | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| | | | | | |
| * | | | | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| | | | | | |
| * | | | | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
| | | | | | |
* | | | | | | Merge pull request #1120 from ogniK5377/rgba8-uintbunnei2018-08-204-45/+58
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implemented RGBA8_UINT
| * | | | | | | Implemented RGBA8_UINTDavid Marcec2018-08-204-45/+58
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | Needed by kirby
* / | | | | | game_list: Avoid uninitialized variables when retrieving program IDLioncash2018-08-201-2/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially leaving this variable uninitialized based off the loader failing to retrieve the ID value.
* | | | | | Merge pull request #1089 from Subv/neg_bitsbunnei2018-08-192-16/+38
|\ \ \ \ \ \ | | | | | | | | | | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.
| * | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.Subv2018-08-182-16/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We should definitely audit our shader generator for more errors like this.
* | | | | | | Merge pull request #1105 from Subv/convert_negbunnei2018-08-191-2/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.
| * | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.Subv2018-08-181-2/+0
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1113 from Subv/texs_maskbunnei2018-08-191-6/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.
| * | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-191-6/+11
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | Previously we could end up with a TEXS that didn't write any outputs, this was wrong.
* | | | | | | Merge pull request #1102 from ogniK5377/mirror-clamp-edgebunnei2018-08-193-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Added WrapMode MirrorOnceClampToEdge
| * | | | | | | Added check to see if ARB_texture_mirror_clamp_to_edge is supportedDavid Marcec2018-08-192-0/+4
| | | | | | | |
| * | | | | | | Added WrapMode MirrorOnceClampToEdgeDavid Marcec2018-08-181-0/+2
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Used by splatoon 2
* | | | | | | Merge pull request #1101 from Subv/ssy_stackbunnei2018-08-191-3/+36
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.
| * | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.Subv2018-08-181-3/+36
| |/ / / / / | | | | | | | | | | | | | | | | | | The SSY instruction pushes an address into the stack, and the SYNC instruction pops it. The current stack depth is 20, we should figure out if this is enough or not.
* | | | | | Merge pull request #1109 from Subv/ldg_decodebunnei2018-08-191-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Shaders: Added decodings for the LDG and STG instructions.
| * | | | | | Shaders: Added decodings for the LDG and STG instructions.Subv2018-08-191-0/+4
| |/ / / / /
* | | | | | Merge pull request #1108 from Subv/front_facingbunnei2018-08-192-0/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).
| * | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).Subv2018-08-192-0/+7
| |/ / / / /
* / / / / / Shader: Implemented the predicate and mode arguments of LOP.Subv2018-08-182-11/+39
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | The mode can be used to set the predicate to true depending on the result of the logic operation. In some cases, this means discarding the result (writing it to register 0xFF (Zero)). This is used by Super Mario Odyssey.
* | | | | Added predcondition GreaterThanWithNanDavid Marcec2018-08-182-5/+8
| | | | |
* | | | | Merge pull request #1096 from bunnei/supported-blitsbunnei2018-08-181-2/+0
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Remove asserts for supported blits.
| * | | | | gl_rasterizer_cache: Remove asserts for supported blits.bunnei2018-08-171-2/+0
| | | | | |
* | | | | | Merge pull request #1097 from bunnei/gl-criticalbunnei2018-08-171-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_opengl: Treat OpenGL errors as critical.
| * | | | | | renderer_opengl: Treat OpenGL errors as critical.bunnei2018-08-171-1/+1
| |/ / / / /
* | | | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
| | | | | | | | | | | | | | | | | | * Used by Mario Tennis Aces
* | | | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Delete System copy/move constructors and assignment operators
| * | | | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents potentially making copies or doing silly things by accident with the System instance, particularly given our current core is designed (unfortunately) around one instantiable instance. This will prevent the accidental case of: auto instance = System::Instance(); being compiled without warning when it's supposed to be: auto& instance = System::Instance();
* | | | | | | Merge pull request #1091 from lioncash/warningbunnei2018-08-171-78/+83
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt/main: Get rid of compilation warnings
| * | | | | | | qt/main: Unindent code in OnMenuInstallToNAND()Lioncash2018-08-161-70/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can change this into an early-return if the filename is empty. There's no need to include all of the code within the if statement.
| * | | | | | | qt/main: Make installation dialog text within OnMenuInstallToNAND() translatableLioncash2018-08-161-14/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is user-facing text, so it should be marked as translatable by Qt.
| * | | | | | | qt/main: Get rid of compilation warningsLioncash2018-08-161-4/+8
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of truncation warnings about conversion to int. While we're at it, we can also de-hardcode the buffer size being used.
* | | | | | | Merge pull request #1093 from greggameplayer/GetDefaultDisplayResolutionChangeEventbunnei2018-08-172-1/+13
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Implement GetDefaultDisplayResolutionChangeEvent
| * | | | | | correct coding stylegreggameplayer2018-08-161-1/+1
| | | | | | |
| * | | | | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Require by Toki Tori and Toki Tori 2+
* | | | | | | Merge pull request #1019 from Subv/vertex_divisorbunnei2018-08-177-5/+28
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Rasterizer: Manually implemented instanced rendering.
| * | | | | | | Rasterizer: Implemented instanced rendering.Subv2018-08-157-5/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We keep track of the current instance and update an uniform in the shaders to let them know which instance they are. Instanced vertex arrays are not yet implemented.
* | | | | | | | Merge pull request #1087 from MerryMage/dynarmicbunnei2018-08-171-0/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | dynarmic: Update to 550d662
| * | | | | | | | dynarmic: Update to 550d662MerryMage2018-08-161-0/+3
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 550d662 load_store_exclusive: Define s == t state to be Constraint_NONE 0b69381 A64/translate: Allow for unpredictable behaviour to be defined 6d236d4 system: Implement MRS CNTFRQ_EL0 6cbb6fb A32/testenv: Add missing headers 6729328 externals: Update xbyak to v5.67 1812bd2 Squashed 'externals/xbyak/' changes from 2794cde7..671fc805 9a95802 externals: Document subtrees 714a840 A64: Implement SQ{ADD, SUB}, and UQ{ADD, SUB}'s vector variants 8cab459 A64: Implement UQADD/UQSUB's scalar variants 18a8151 ir: Add opcodes for unsigned saturating add and subtract a5660ee x64/reg_alloc: Use type alias for array returned by GetArgumentInfo() 29489b5 ir/value: Use type alias CoprocessorInfo for std::array<u8, 8> e23ba26 status_register_access: Add support for bits 0 and 1 of mask to MSR 55190bd fuzz_with_unicorn: Split utility functions into fuzz_util 23b049d A32/translate/load_store: Correct detection of writeback 7ec9f15 A32/translate: Add TranslateSingleInstruction efeecb4 A32/ir_emitter: Bug fix: IREmitter::ExceptionRaised using incorrect opcode 08d1d19 A32/decoders: Split instruction list into include file 2d929cc tests: Refactor unicorn_emu to allow for A32 unicorn f672368 microinstruction: Improve assert messages 7ebff50 emit_x64_vector: EmitVectorNarrow16: AVX512 implementation edce230 emit_x64_vector: EmitVectorNarrow32: prefer pblendw to loading constant
* | | | | | | | Merge pull request #1084 from bunnei/depthbunnei2018-08-172-16/+26
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | gl_rasterizer_cache: Treat Depth formats differently from DepthStencil.
| * | | | | | | gl_rasterizer_cache: Treat Depth formats differently from DepthStencil.bunnei2018-08-162-16/+26
| | | | | | | |
* | | | | | | | Merge pull request #1085 from lioncash/namespacebunnei2018-08-164-12/+22
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | common: Namespace hex_util.h/.cpp
| * | | | | | | common: Namespace hex_util.h/.cppLioncash2018-08-164-12/+22
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | It's in the common code, so it should be under the Common namespace like everything else.
* | | | | | | Merge pull request #1075 from lioncash/includebunnei2018-08-164-35/+22
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | loader/{nca, xci}: Remove unnecessary includes and unused member variables
| * | | | | | loader/nca: Remove unnecessary includes and member variablesLioncash2018-08-152-20/+11
| | | | | | |
| * | | | | | loader/xci: Remove unnecessary includes and member variablesLioncash2018-08-152-15/+11
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of these aren't necessary and will cause this file to be required to be recompiled whenever any changes to those files are made, which lengthens compile times for no reason. This also removes an unused metadata variable from AppLoader_XCI
* | | | | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-1634-80/+1437
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys: Add support for registration format
| * | | | | | registration: Various style and documentation improvementsZach Hilman2018-08-123-18/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix logic in RealVfsFilesystem Create methods Remove magic numbers Fix regex errors
| * | | | | | registration: Add support for force overwrite of installedZach Hilman2018-08-124-53/+106
| | | | | | |
| * | | | | | game_list: Split game list scans to multiple functionsZach Hilman2018-08-122-9/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary rebuilds of control data on every layer of recursion in AddFstEntriesToGameList
| * | | | | | vfs_real: Add CreateFullPath to Create* operationsZach Hilman2018-08-122-13/+6
| | | | | | |
| * | | | | | control_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-2/+1
| | | | | | |
| * | | | | | romfs: Remove cyclic shared_ptr leak in romfs codeZach Hilman2018-08-123-8/+8
| | | | | | |
| * | | | | | registration: Update documentation and styleZach Hilman2018-08-125-42/+69
| | | | | | |
| * | | | | | nca_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-3/+2
| | | | | | |
| * | | | | | bis_factory: Create NAND dirs if they don't existZach Hilman2018-08-121-2/+9
| | | | | | |
| * | | | | | qt: Use custom RawCopy with progress bar for installsZach Hilman2018-08-121-2/+28
| | | | | | |
| * | | | | | registration: Take RawCopy function as parameterZach Hilman2018-08-122-10/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of defaulting to VfsRawCopy
| * | | | | | game_list: Populate control data from installed NANDZach Hilman2018-08-122-31/+35
| | | | | | |
| * | | | | | registered_cache: Fix missing reading from yuzu_metaZach Hilman2018-08-121-7/+16
| | | | | | |
| * | | | | | file_sys: Comply to style guidelinesZach Hilman2018-08-128-47/+60
| | | | | | |
| * | | | | | qt: Add 'Install to NAND' option to menuZach Hilman2018-08-125-1/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prompts for title type on NCA files.
| * | | | | | game_list: Modify game list to scan installed titlesZach Hilman2018-08-121-0/+45
| | | | | | |
| * | | | | | file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Manages NAND NCA get and install.
| * | | | | | file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
| | | | | | |
| * | | | | | card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
| | | | | | |
| * | | | | | vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes bugs with calling CreateFile when the immediate directory does not exist.
| * | | | | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| | | | | | |
| * | | | | | bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates and stores RegisteredCaches for user and system NAND, as creation of a RegisteredCache is expensive.
| * | | | | | loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | i.e. Load the concatenated 00+01 if 01 exists as well. Needed for split NAND NCAs.
| * | | | | | loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed to avoid mismatch filetype warnings on split NAND NCAs
| * | | | | | vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
| | | | | | |
| * | | | | | crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Move to hex_util.h in common
| * | | | | | file_util: Add getter for NAND registration directoryZach Hilman2018-08-122-0/+8
| | | | | | |
| * | | | | | common: Move hex string processing to separate fileZach Hilman2018-08-123-0/+64
| | | | | | |
* | | | | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | lm: Handle threads and modules within the logger
| * | | | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using LOG_TRACE here isn't a good idea because LOG_TRACE is only enabled when yuzu is compiled in debug mode. Debug mode is also quite slow, and so we're potentially throwing away logging messages that can provide value when trying to boot games.
| * | | | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The thread field serves to indicate which thread a log is related to and provides the length of the thread's name, so we can print that out, ditto for modules. Now we can know what threads are potentially spawning off logging messages (for example Lydie & Suelle bounces between MainThread and LoadingThread when initializing the game).
* | | | | | | Merge pull request #1079 from lioncash/fmtbunnei2018-08-165-14/+18
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | loader: Make ResultStatus directly compatible with fmt
| * | | | | | | loader: Make ResultStatus directly compatible with fmtLioncash2018-08-155-14/+18
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can make the enum class type compatible with fmt by providing an overload of operator<<. While we're at it, perform proper bounds checking. If something exceeds the array, it should be a hard fail, because it's, without a doubt, a programmer error in this case.
* | | | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-163-1/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafe
| * | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-133-1/+12
| | | | | | | |
* | | | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSize
| * | | | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | This should be returning a u16 according to Switch Brew.
* | | | | | | | Merge pull request #1083 from Subv/conv_negbunnei2018-08-161-13/+53
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Shaders: Implemented I2F_C and F2I_C, along with the negation bits of the conversion instructions.
| * | | | | | | | Shader/Conversion: Implemented the negate bit in F2F and I2I instructions.Subv2018-08-151-4/+12
| | | | | | | | |
| * | | | | | | | Shader/I2F: Implemented the negate I2F_C instruction variant.Subv2018-08-151-7/+23
| | | | | | | | |
| * | | | | | | | Shader/F2I: Implemented the negate bit in the I2F instructionSubv2018-08-151-0/+4
| | | | | | | | |
| * | | | | | | | Shader/F2I: Implemented the F2I_C instruction variant.Subv2018-08-151-2/+10
| | | | | | | | |
| * | | | | | | | Shader/F2I: Implemented the negate bit in the F2I instruction.Subv2018-08-151-0/+4
| | | | | | | | |
* | | | | | | | | Merge pull request #1081 from lioncash/convertbunnei2018-08-153-3/+8
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | kernel/server_session: Add IsSession() member function
| * | | | | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows querying the inverse of IsDomain() to make things more readable. This will likely also be usable in the event of implementing ConvertDomainToSession().
* | | | | | | | Merge pull request #1077 from bunnei/rgba16ubunnei2018-08-151-1/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Add RGBA16U to PixelFormatFromTextureFormat.
| * | | | | | | | gl_rasterizer_cache: Add RGBA16U to PixelFormatFromTextureFormat.bunnei2018-08-151-1/+9
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* / | | | | | | gl_rasterizer_cache: Cleanup some PixelFormat names and logging.bunnei2018-08-152-41/+71
|/ / / / / / /
* | | | | | | Merge pull request #1069 from bunnei/vtx-szbunnei2018-08-151-5/+20
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_to_gl: Properly handle UnsignedInt/SignedInt sizes.
| * | | | | | | maxwell_to_gl: Properly handle UnsignedInt/SignedInt sizes.bunnei2018-08-151-5/+20
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1070 from bunnei/cbuf-szbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer: Fix upload size for constant buffers.
| * | | | | | | gl_rasterizer: Fix upload size for constant buffers.bunnei2018-08-151-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1071 from bunnei/fix-ldcbunnei2018-08-151-13/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Several fixes for indirect constant buffer loads.
| * | | | | | | gl_shader_decompiler: Several fixes for indirect constant buffer loads.bunnei2018-08-151-13/+22
| |/ / / / / /
* | | | | | | Merge pull request #1068 from bunnei/g8r8sbunnei2018-08-152-34/+49
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | gl_rasterizer_cache: Implement G8R8S format.
| * | | | | | gl_rasterizer_cache: Implement G8R8S format.bunnei2018-08-152-34/+49
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | Merge pull request #1067 from lioncash/initbunnei2018-08-151-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | emu_window: Ensure WindowConfig members are always initialized
| * | | | | | emu_window: Ensure WindowConfig members are always initializedLioncash2018-08-151-3/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Previously we weren't always initializing all members of the struct. Prevents potentially wonky behavior from occurring.
* | | | | | Merge pull request #1073 from lioncash/3dsbunnei2018-08-156-17/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | loader: Remove address mapping remnants from citra
| * | | | | | loader: Remove address mapping remnants from citraLioncash2018-08-156-17/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | These mappings are leftovers from citra and don't apply to the Switch.
* | | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/svc: Log svcBreak parameters
| * | | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given if we hit here all is lost, we should probably be logging the break reason code and associated information to distinguish between the causes.
* | | | | | Merge pull request #1063 from lioncash/inlinebunnei2018-08-152-15/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/xbyak_abi: Mark defined functions in header as inline
| * | | | | | common/xbyak_abi: Mark defined functions in header as inlineLioncash2018-08-151-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potential One Definition Rule violations when these are used in the future.
| * | | | | | common/xbyak: Use nested namespace specifiers where applicableLioncash2018-08-152-8/+4
| |/ / / / /
* | | | | | Implement Z16_UNORM in PixelFormatFromTextureFormat functiongreggameplayer2018-08-151-0/+2
| | | | | | | | | | | | | | | | | | Require by Zelda Breath Of The Wild
* | | | | | Merge pull request #1054 from zhaowenlan1779/misc-fixupbunnei2018-08-151-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/misc: use windows.h
| * | | | | | common/misc: use windows.hZhu PengFei2018-08-131-1/+1
| | | | | | | | | | | | | | | | | | | | | linux-mingw does not really like this.
* | | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | mm_u: Move interface class into the cpp file
| * | | | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures both variants go through the same interface, and while we're at it, add Finalize to provide the inverse of Initialize for consistency.
| * | | | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now if changes are ever made to the behavior of the class, it doesn't involve rebuilding everything that includes the mm_u header.
* | | | | | | | common: Remove unused old breakpoint source filesLioncash2018-08-153-141/+0
| |_|/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These currently aren't used and contain commented out source code that corresponds to Dolphin's JIT. Given our CPU code is organized quite differently, we shouldn't be keeping this around (at the moment it just adds to compile times marginally).
* | | | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | audout_u: Correct IAudioOut initializer list order
| * | | | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Orders elements in the precise order they'll be initialized.
* | | | | | | Merge pull request #1058 from greggameplayer/BC7U_Fixbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix BC7U
| * | | | | | | Fix BC7Ugreggameplayer2018-08-141-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #1050 from bunnei/rgba16-unormbunnei2018-08-144-37/+48
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UNORM.
| * | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UNORM.bunnei2018-08-144-37/+48
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | logging/backend: Use const reference to refer to log filterLioncash2018-08-141-2/+3
| |/ / / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The filter is returned via const reference, so this was making a pointless copy of the entire filter every time a message was being pushed into the logger instance.
* | | | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-146-0/+148
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Added missing channel devices
| * | | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| | | | | | |
| * | | | | | Added missing channel devicesDavid Marcec2018-08-135-0/+144
| | | | | | |
* | | | | | | Merge pull request #1052 from ogniK5377/xenobunnei2018-08-134-7/+45
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement RG32UI and R32UI
| * | | | | | | Implement RG32UI and R32UIDavid Marcec2018-08-134-7/+45
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | Needed for xenoblade
* | | | | | | Merge pull request #1033 from MerryMage/interpbunnei2018-08-137-3/+267
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | audio_core: Interpolate
| * | | | | | | audio_renderer: samples_remaining counts frames, not samplesMerryMage2018-08-131-1/+1
| | | | | | | |
| * | | | | | | audio_core: InterpolateMerryMage2018-08-135-0/+121
| | | | | | | |
| * | | | | | | audio_core: Implement low-pass filterMerryMage2018-08-133-2/+145
| | | | | | | |
* | | | | | | | Merge pull request #1053 from MerryMage/rm-IsExecutingbunnei2018-08-131-3/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | arm_dynarmic: Remove IsExecuting check from PrepareReschedule
| * | | | | | | | arm_dynarmic: Remove IsExecuting check from PrepareRescheduleMerryMage2018-08-131-3/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | No longer required. HaltExecution is a no-op if it is not currently executing.
* | | | | | | | Merge pull request #1049 from bunnei/vtx-size-8Mat M2018-08-131-0/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8.
| * | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8.bunnei2018-08-131-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | Merge pull request #1032 from lioncash/sanitizebunnei2018-08-131-10/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()
| * | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()Lioncash2018-08-121-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously these were being unused (or partially unused). While we're at it, use better naming to make it visibly obvious which variant of the path is being used.
* | | | | | | | | Merge pull request #1031 from lioncash/verbositybunnei2018-08-132-7/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | card_image: Simplify return statement of GetSubdirectories()
| * | | | | | | | | card_image: Use type aliases to shorten definitionsLioncash2018-08-122-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We have the aliases, so we may as well use 'em.
| * | | | | | | | | card_image: Simplify return statement of GetSubdirectories()Lioncash2018-08-121-1/+1
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to write out the construction long-form, we can just let the language itself work it out off the return type.
* | | | | | | | | Merge pull request #1048 from lioncash/atomicbunnei2018-08-132-8/+9
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | kernel/object: Tighten object against data races
| * | | | | | | | kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Despite being covered by a global mutex, we should still ensure that the class handles its reference counts properly. This avoids potential shenanigans when it comes to data races. Given this is the root object that drives quite a bit of the kernel object hierarchy, ensuring we always have the correct behavior (and no races) is a good thing.
* | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UINT.bunnei2018-08-134-34/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1045 from bunnei/rg8-unormbunnei2018-08-134-26/+61
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | renderer_opengl: Implement RenderTargetFormat::RG8_UNORM.
| * | | | | | | | renderer_opengl: Implement RenderTargetFormat::RG8_UNORM.bunnei2018-08-134-26/+61
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* / / / / / / / maxwell_to_gl: Implement PrimitiveTopology::LineStrip.bunnei2018-08-131-0/+2
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | Merge pull request #1043 from Subv/timingbunnei2018-08-133-2/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Use an approximated amortized amount of ticks when advancing timing.
| * | | | | | | CPU/Timing: Use an approximated amortized amount of ticks when advancing timing.Subv2018-08-132-1/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We divide the number of ticks to add by the number of cores (4) to obtain a more or less rough estimate of the actual number of ticks added. This assumes that all 4 cores are doing similar work. Previously we were adding ~4 times the number of ticks, thus making the games think that time was going way too fast. This lets us bypass certain hangs in some games like Breath of the Wild. We should modify our CoreTiming to support multiple cores (both running in a single thread, and in multiple host threads).
| * | | | | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current core may have nothing to do with the core where the new thread was scheduled to run. In case it's the same core, then the following PrepareReshedule call will take care of that.
* | | | | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-133-7/+7
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | scheduler: Make HaveReadyThreads() a const member function
| * | | | | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't modify instance state, so the const qualifier can be added to it.
| * | | | | | | | thread_queue_list: Make contains() and get_first() const member functionsLioncash2018-08-121-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't directly modify the contained data.
| * | | | | | | | thread_queue_list: Convert typedef to a type aliasLioncash2018-08-121-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-134-5/+13
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed a bunch of race conditions when running in multicore mode.
| * | | | | | | | Core/HLE: Make the 'reschedule_pending' flag atomic.Subv2018-08-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread may write to this variable while the core in question is in the middle of checking for a reschedule request.
| * | | | | | | | CPU/HLE: Lock the HLE mutex before performing a reschedule.Subv2018-08-131-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of an SVC, thus altering the state of the schedulers.
| * | | | | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of a reschedule, thus altering the state of the schedulers.
| * | | | | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-132-4/+4
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | WakeAfterDelay might be called from any host thread, so err on the side of caution and use the thread-safe CoreTiming::ScheduleEventThreadsafe. Note that CoreTiming is still far from thread-safe, there may be more things we have to work on for it to be up to par with what we want.
* | | | | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.
| * | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Exit from AddMutexWaiter early if the thread is already waiting for a mutex owned by the owner thread. This accounts for the possibility of a thread that is waiting on a condition variable being awakened twice in a row. Also added more validation asserts. This should fix one of the random crashes in Breath Of The Wild.
* | | | | | | | Merge pull request #1040 from bunnei/xmadbunnei2018-08-132-4/+120
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement XMAD instruction.
| * | | | | | | | gl_shader_decompiler: Implement XMAD instruction.bunnei2018-08-132-4/+120
| | | | | | | | |
* | | | | | | | | vfs: Make VfsFilesystem constructor explicitLioncash2018-08-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it consistent with the other VFS interfaces and prevents implicit construction.
* | | | | | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-124-10/+16
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | struct should be used when the data type is very simple or otherwise has no invariants associated with it. Given these are used to form a hierarchy, class should be used instead.
* | | | | | | | Merge pull request #1025 from ogniK5377/bad-castbunnei2018-08-124-4/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed invalid cast in loader
| * | | | | | | | made ResultStatus a u16David Marcec2018-08-123-3/+3
| | | | | | | | |
| * | | | | | | | Fixed invalid cast in loaderDavid Marcec2018-08-121-1/+1
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | GetMessageForResultStatus takes a u16, not a size_t.
* | | | | | | | Merge pull request #1038 from MerryMage/lock-cubebbunnei2018-08-121-0/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | cubeb_sink: Protect queue with a mutex
| * | | | | | | | cubeb_sink: Protect queue with a mutexMerryMage2018-08-121-0/+6
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | GetAudioDeviceServiceWithRevisionInfo (Used by Bloodstained: Curse of the Moon)
| * | | | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | As we're not handling any anything about the revision data for GetAudioDeviceServiceWithRevisionInfo, it's currently marked as stubbed. However for games this shouldn't affect the result. Proper revision info would be more for homebrew.
* | | | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-123-6/+42
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCount
| * | | | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-122-5/+3
| | | | | | | |
| * | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-123-6/+44
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | GetAudioRendererSampleRate is set as a "STUB" as a game could check if the sample rate it sent and the sample rate it wants don't match. Just a thought of something which could happen so keeping it as stub for the mean time
* | | | | | | Merge pull request #1034 from lioncash/hidbunnei2018-08-121-5/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid: Stub DisconnectNpad()
| * | | | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents clang-format from butchering them.
| * | | | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | This is required by ARMS.
* | | | | | | gl_rasterizer: Use a shared helper to upload from CPU memory.Markus Wick2018-08-122-28/+33
| | | | | | |
* | | | | | | gl_state: Don't track constant buffer mappings.Markus Wick2018-08-123-41/+3
| | | | | | |
* | | | | | | gl_rasterizer: Use the stream buffer for constant buffers.Markus Wick2018-08-124-29/+32
| | | | | | |
* | | | | | | gl_rasterizer: Use the streaming buffer itself for the constant buffer.Markus Wick2018-08-122-33/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Don't emut copies, especially not for data, which is used once. They just end in a huge GPU overhead.
* | | | | | | gl_rasterizer: Use a helper for aligning the buffer.Markus Wick2018-08-122-15/+22
| | | | | | |
* | | | | | | Update the stream_buffer helper from Citra.Markus Wick2018-08-124-184/+98
| |_|/ / / / |/| | | | | | | | | | | | | | | | | Please see https://github.com/citra-emu/citra/pull/3666 for more details.
* | | | | | gl_shader_decompiler: Fix SetOutputAttributeToRegister empty check.bunnei2018-08-121-2/+2
|/ / / / /
* | | | | Merge pull request #1026 from ogniK5377/retro-city-rampagebunnei2018-08-121-1/+8
|\ \ \ \ \ | | | | | | | | | | | | Stub UpdateUserPresence
| * | | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
| |/ / / / | | | | | | | | | | | | | | | Needed for Retro City Rampage to go in game
* / / / / gl_shader_decompiler: Fix GLSL compiler error with KIL instruction.bunnei2018-08-121-0/+8
|/ / / /
* | | | Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\ \ \ \ | | | | | | | | | | Several Friend service fixes
| * | | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| | | | | | | | | | | | | | | | | | | | - Used by Splatoon 2.
| * | | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| | | | |
| * | | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
| | | | |
* | | | | Merge pull request #1020 from lioncash/namespacebunnei2018-08-1214-22/+44
|\ \ \ \ \ | | | | | | | | | | | | core: Namespace EmuWindow
| * | | | | core: Namespace EmuWindowLioncash2018-08-1214-22/+44
| |/ / / / | | | | | | | | | | | | | | | Gets the class out of the global namespace.
* | | | | Merge pull request #1021 from lioncash/warnbunnei2018-08-121-1/+1
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Silence implicit truncation warning in SetupShaders()
| * | | | | gl_rasterizer: Silence implicit truncation warning in SetupShaders()Lioncash2018-08-121-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Previously this would warn of truncating a std::size_t to a u32. This is safe because we'll obviously never have more than UINT32_MAX amount of uniform buffers.
* | | | | Merge pull request #1024 from Subv/blend_glbunnei2018-08-122-0/+40
|\ \ \ \ \ | | | | | | | | | | | | GPU/Maxwell3D: Implemented an alternative set of blend factors.
| * | | | | GPU/Maxwell3D: Implemented an alternative set of blend factors.Subv2018-08-122-0/+40
| |/ / / / | | | | | | | | | | | | | | | These are used by nouveau and some games like SMO.
* | | | | Merge pull request #1023 from Subv/invalid_attribsbunnei2018-08-122-1/+11
|\ \ \ \ \ | | | | | | | | | | | | RasterizerGL: Ignore invalid/unset vertex attributes.
| * | | | | RasterizerGL: Ignore invalid/unset vertex attributes.Subv2018-08-122-1/+11
| |/ / / / | | | | | | | | | | | | | | | This should make the es2gears example not crash anymore.
* / / / / Implement R8_UINT RenderTargetFormat & PixelFormat (#1014)greggameplayer2018-08-124-55/+74
|/ / / / | | | | | | | | | | | | - Used by Go Vacation
* | | | Merge pull request #1010 from bunnei/unk-vert-attrib-shaderbunnei2018-08-122-10/+11
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Improve handling of unknown input/output attributes.
| * | | | gl_shader_decompiler: Improve handling of unknown input/output attributes.bunnei2018-08-122-10/+11
| | | | |
* | | | | Merge pull request #1009 from bunnei/rg8-rgba8-snormbunnei2018-08-124-64/+93
|\ \ \ \ \ | | | | | | | | | | | | Implement render target formats RGBA8_SNORM and RG8_SNORM.
| * | | | | gl_rasterizer: Implement render target format RG8_SNORM.bunnei2018-08-124-8/+18
| | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
| * | | | | gl_rasterizer: Implement render target format RGBA8_SNORM.bunnei2018-08-124-64/+83
| |/ / / / | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1217-179/+248
|\ \ \ \ \ | | | | | | | | | | | | loader: Add more descriptive errors
| * | | | | game_list: Reorder error checksZach Hilman2018-08-101-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | clang-format fix
| * | | | | loader: Add more descriptive errorsZach Hilman2018-08-1017-179/+249
| | | | | | | | | | | | | | | | | | Full list of new errors and descriptions in core/loader/loader.h
* | | | | | Merge pull request #1018 from Subv/ssy_syncbunnei2018-08-122-8/+38
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | GPU/Shader: Implemented SSY and SYNC as a set_target/jump pair.
| * | | | | GPU/Shader: Don't predicate instructions that don't have a predicate field (SSY).Subv2018-08-112-2/+13
| | | | | |
| * | | | | GPU/Shaders: Implemented SSY and SYNC as a way to modify control flow during shader execution.Subv2018-08-111-6/+25
| | | | | | | | | | | | | | | | | | | | | | | | SSY sets the target label to jump to when the SYNC instruction is executed.
* | | | | | Merge pull request #1016 from lioncash/videobunnei2018-08-118-35/+44
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: Get rid of global variable g_toggle_framelimit_enabled
| * | | | | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-118-30/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we make a struct for renderer settings and allow the renderer to update all of these settings, getting rid of the need for global-scoped variables. This also uncovered a few indirect inclusions for certain headers, which this commit also fixes.
| * | | | | | renderer_base: Remove unused kFramebuffer enumerationLioncash2018-08-111-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is entirely unused and can be removed.
| * | | | | | video_core: Remove unused Renderer enumerationLioncash2018-08-111-2/+0
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | Currently we only have an OpenGL renderer, so this is unused in code (and occupies the Renderer identifier in the VideoCore namespace).
* | | | | | Merge pull request #1003 from lioncash/varbunnei2018-08-112-4/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: Use variable template variants of type_traits interfaces where applicable
| * | | | | | video_core: Use variable template variants of type_traits interfaces where applicableLioncash2018-08-102-4/+2
| | | | | | |
* | | | | | | Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats and more (R16_UNORM needed by Fate Extella) (#848)greggameplayer2018-08-114-19/+92
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats Do a separate function in order to get Bytes Per Pixel of DepthFormat Apply the new function in gpu.h delete unneeded white space * correct merging error
* | | | | | qt/game_list: Resolve truncation warning within GameListItemPath's constructorLioncash2018-08-111-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | Silences a warning about truncating from size_t to u32
* | | | | | gt/game_list: Use std::array in GameListItemPath's data() functionLioncash2018-08-111-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to use a heap-allocated std::vector here, given we explicitly know the bounds.
* | | | | | qt/game_list: Remove redundant base class constructor from initializer listLioncash2018-08-111-3/+1
| |/ / / / |/| | | | | | | | | | | | | | This is called automatically anyways.
* | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-101-0/+1
| | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_32_32_32.bunnei2018-08-101-0/+2
| | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | Merge pull request #1004 from lioncash/unusedbunnei2018-08-103-8/+6
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()
| * | | | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()Lioncash2018-08-103-8/+6
| |/ / / /
* | | | | Merge pull request #1008 from yuzu-emu/revert-697-disable-depth-cullbunnei2018-08-101-3/+1
|\ \ \ \ \ | | | | | | | | | | | | Revert "gl_state: Temporarily disable culling and depth test."
| * | | | | Revert "gl_state: Temporarily disable culling and depth test."bunnei2018-08-101-3/+1
| | |/ / / | |/| | |
* / | | | textures: Refactor out for Texture/Depth FormatFromPixelFormat.bunnei2018-08-105-181/+31
|/ / / /
* | | | Merge pull request #995 from bunnei/gl-buff-boundsbunnei2018-08-101-10/+12
|\ \ \ \ | |/ / / |/| | | gl_rasterizer_cache: Add bounds checking for gl_buffer copies.
| * | | gl_rasterizer_cache: Add bounds checking for gl_buffer copies.bunnei2018-08-101-10/+12
| | | |
* | | | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \ \ \ | | | | | | | | | | core: Make function reference parameters const where applicable
| * | | | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is simply copied by value, so there's no need to make it a modifiable reference. While we're at it, make the names of the parameters match its definition.
| * | | | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't modify anything within the reference Thread instance.
* | | | | Merge pull request #989 from lioncash/logbunnei2018-08-102-0/+16
|\ \ \ \ \ | | | | | | | | | | | | common/logging: Add missing service log categories
| * | | | | common/logging: Add missing service log categoriesLioncash2018-08-082-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | These weren't added when the services were introduced.
* | | | | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing last
| * | | | | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given elements inserted into a vector are zeroed out, we can just copy MAX_LEN - 1 elements and the data will already be properly null terminated.
| * | | | | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current way were doing it would require copying a 768 character buffer (part of the Entry struct) to the new element in the vector. Given it's a plain array, std::move won't eliminate that. Instead, we can emplace an instance directly into the destination buffer and then fill it out, avoiding the need to perform any unnecessary copies. Given this is done in a loop, we can request the destination to allocate all of the necessary memory ahead of time, avoiding the need to potentially keep reallocating over and over on every few insertions into the vector.
* | | | | | Merge pull request #1001 from lioncash/reservebunnei2018-08-101-0/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()
| * | | | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()Lioncash2018-08-091-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially perfoming multiple reallocations when we know the total amount of memory we need beforehand.
* | | | | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1021-129/+602
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | vfs: Add VfsFilesystem and fix RealVfs* implementations
| * | | | | | vfs: Fix documentationZach Hilman2018-08-092-2/+4
| | | | | | |
| * | | | | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-092-4/+5
| | | | | | |
| * | | | | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-094-24/+37
| | | | | | |
| * | | | | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| | | | | | |
| * | | | | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| | | | | | |
| * | | | | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| | | | | | |
| * | | | | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-0912-22/+52
| | | | | | |
| * | | | | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| | | | | | |
| * | | | | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| | | | | | |
| * | | | | | file_util: Add platform-specific slash option to SanitizePathZach Hilman2018-08-092-5/+16
| | | | | | |
| * | | | | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| | | | | | |
| * | | | | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
| | | | | | |
* | | | | | | Merge pull request #991 from bunnei/ignore-macbunnei2018-08-101-4/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_3d: Ignore macros that have not been uploaded yet.
| * | | | | | | maxwell_3d: Ignore macros that have not been uploaded yet.bunnei2018-08-091-4/+9
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
* | | | | | | Implement SNORM for BC5/DXN2 (#998)Khangaroo2018-08-102-38/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement BC5/DXN2 (#996) - Used by Kirby Star Allies. * Implement BC5/DXN2 SNORM UNORM for Kirby Star Allies SNORM for Super Mario Odyssey
* | | | | | | gl_rasterizer_cache: Avoid iterator invalidation issues within InvalidateRegion()Lioncash2018-08-091-2/+4
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | A range-based for loop can't be used when the container being iterated is also being erased from.
* | | | | | Merge pull request #992 from bunnei/declr-predbunnei2018-08-091-4/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Declare predicates on use.
| * | | | | | gl_shader_decompiler: Declare predicates on use.bunnei2018-08-091-4/+5
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (when going in game).
* | | | | | Merge pull request #994 from lioncash/constbunnei2018-08-091-7/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: Use std::vector::assign vs resize() then copy for the non-tiled case
| * | | | | | gl_rasterizer_cache: Invert conditional in LoadGLBuffer()Lioncash2018-08-091-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's generally easier to follow code using conditionals that operate in terms of the true case followed by the false case (no chance of overlooking the exclamation mark).
| * | | | | | gl_rasterizer_cache: Use std::vector::assign in LoadGLBuffer() for the non-tiled caseLioncash2018-08-091-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | resize() causes the vector to expand and zero out the added members to the vector, however we can avoid this zeroing by using assign(). Given we have the pointer to the data we want to copy, we can calculate the end pointer and directly copy the range of data without the need to perform the resize() beforehand.
| * | | | | | gl_rasterizer_cache: Make pointer const in LoadGLBuffer()Lioncash2018-08-091-1/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | This is only ever read from, so we can make the data it's pointing to const.
* | | | | | Merge pull request #993 from bunnei/smo-vtx-ptsbunnei2018-08-091-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement VertexAttribute::Size::Size_16_16_16_16 and PrimitiveTopology::Points.
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_16_16_16_16.bunnei2018-08-091-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
| * | | | | | maxwell_to_gl: Implement PrimitiveTopology::Points.bunnei2018-08-091-0/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
* | | | | | Merge pull request #984 from bunnei/rt-nonebunnei2018-08-091-0/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: Do not render when no render target is configured.
| * | | | | | gl_rasterizer: Do not render when no render target is configured.bunnei2018-08-091-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | Implement BC5/DXN2 (#996)Khangaroo2018-08-093-33/+45
| | | | | | | | | | | | | | | | | | | | | - Used by Kirby Star Allies.
* | | | | | | Merge pull request #988 from lioncash/colorbunnei2018-08-091-19/+31
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/color: Minor cleanup
| * | | | | | | common/color: Remove unnecessary const qualifiers on return typesLioncash2018-08-081-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are just superfluous and not necessesary
| * | | | | | | common/color: Get rid of undefined behaviorLioncash2018-08-081-12/+24
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of type punning via reinterpret_cast within functions. Instead, we use memcpy to transfer the contents across types.
* | | | | | | Merge pull request #977 from bunnei/bgr565bunnei2018-08-092-0/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.
| * | | | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.bunnei2018-08-082-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | | Merge pull request #987 from lioncash/vecbunnei2018-08-091-3/+3
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | vector_math: Use variable template version of is_signed in Vec classes
| * | | | | | | vector_math: Use variable template version of is_signed in Vec classesLioncash2018-08-081-3/+3
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Same behavior, less code
* | | | | | | Merge pull request #982 from bunnei/stub-unk-63bunnei2018-08-092-0/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Stub input attribute Unknown_63.
| * | | | | | | gl_shader_decompiler: Stub input attribute Unknown_63.bunnei2018-08-082-0/+9
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | Service/Account: stub LoadImage function
| * | | | | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #976 from bunnei/shader-immbunnei2018-08-092-11/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Let OpenGL interpret floats.
| * | | | | | gl_shader_decompiler: Let OpenGL interpret floats.bunnei2018-08-082-11/+6
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | - Accuracy is lost in translation to string, e.g. with NaN. - Needed for Super Mario Odyssey.
* | | | | | Merge pull request #981 from bunnei/cbuf-corruptbunnei2018-08-094-3/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | maxwell_3d: Use correct const buffer size and check bounds.
| * | | | | | maxwell_3d: Use correct const buffer size and check bounds.bunnei2018-08-084-3/+12
| |/ / / / / | | | | | | | | | | | | | | | | | | - Fixes mem corruption with Super Mario Odyssey and Pokkén Tournament DX.
* | | | | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.
| * | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| |/ / / /
* | | | | Merge pull request #985 from bunnei/rt-r11g11b10bunnei2018-08-091-0/+1
|\ \ \ \ \ | | | | | | | | | | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.
| * | | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.bunnei2018-08-081-0/+1
| |/ / / / | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | Merge pull request #979 from bunnei/vtx88bunnei2018-08-091-0/+1
|\ \ \ \ \ | | | | | | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.
| * | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-081-0/+1
| |/ / / /
* | | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ \ | | | | | | | | | | | | am: Stub SetScreenShotImageOrientation.
| * | | | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / / / | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | Merge pull request #980 from bunnei/fix-logsbunnei2018-08-082-2/+2
|\ \ \ \ \ | |_|_|/ / |/| | | | renderer_opengl: Use trace log in a few places.
| * | | | renderer_opengl: Use trace log in a few places.bunnei2018-08-082-2/+2
| |/ / /
* | | | Merge pull request #966 from lioncash/modernizebunnei2018-08-085-11/+11
|\ \ \ \ | | | | | | | | | | common: Convert type traits templates over to variable template versions where applicable
| * | | | common: Convert type traits templates over to variable template versions where applicableLioncash2018-08-085-11/+11
| |/ / / | | | | | | | | | | | | Uses the C++17 inline variable variants
* | | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0823-21/+484
|\ \ \ \ | | | | | | | | | | Add Icons and Metadata Support
| * | | | configure_gamelist: Use explicit QVariant constructorZach Hilman2018-08-071-2/+4
| | | | |
| * | | | loader: Add icon and title support to XCIZach Hilman2018-08-077-5/+46
| | | | |
| * | | | Use const where applicableZach Hilman2018-08-074-7/+7
| | | | |
| * | | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-0718-19/+439
| | | | |
* | | | | Merge pull request #968 from lioncash/vecbunnei2018-08-081-180/+182
|\ \ \ \ \ | | | | | | | | | | | | vector_math: Minor cleanups
| * | | | | vector_math: Remove unimplemented function prototypesLioncash2018-08-081-23/+0
| | | | | |
| * | | | | vector_math: Make functions constexpr where applicableLioncash2018-08-081-154/+179
| | | | | |
| * | | | | vector_math: Convert typedefs to type aliasesLioncash2018-08-081-3/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ \ | |_|_|/ / |/| | | | nvdrv: Get rid of global std::weak_ptr
| * | | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| |/ / / | | | | | | | | | | | | | | | | Rather than use global state, we can simply pass the instance into the NVFlinger instance directly.
* | | | Merge pull request #972 from lioncash/catchbunnei2018-08-084-4/+4
|\ \ \ \ | | | | | | | | | | externals: Update catch to 2.3.0
| * | | | externals: Update catch to 2.3.0Lioncash2018-08-084-4/+4
| |/ / / | | | | | | | | | | | | Updates the library from 2.2.3 to 2.3.0
* | | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \ \ | | | | | | | | | | hle: Remove unused romfs.cpp/.h
| * | | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| |/ / / | | | | | | | | | | | | These files are no longer used, so we can get rid of them.
* | | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \ \ | | | | | | | | | | acc: Add missing function table entries for GetUserCount
| * | | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | Given this is stubbed within the common module in 5ac7b84, it should be added to the other relevant tables as well.
* | | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / / /
* | | | acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
| | | | | | | | | | | | - Used by Pokken Tournament DX.
* | | | Merge pull request #967 from lioncash/signbunnei2018-08-081-4/+8
|\ \ \ \ | |/ / / |/| | | file_util: Avoid sign-conversions in WriteArray() and ReadArray()
| * | | file_util: Avoid sign-conversions in WriteArray() and ReadArray()Lioncash2018-08-071-4/+8
| | | | | | | | | | | | | | | | Prevents compiler warnings.
* | | | Merge pull request #964 from Hexagon12/lower-logsbunnei2018-08-081-4/+4
|\ \ \ \ | | | | | | | | | | Lowered down the logging for command processor methods
| * | | | Lowered down the logging for methodsHexagon122018-08-071-4/+4
| | | | |
* | | | | Fixed the sRGB pixel format (#963)Hexagon122018-08-081-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Changed the sRGB pixel format return * Add a message about SRGBA -> RGBA conversion
* | | | | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \ \ \ \ | | | | | | | | | | | | content_archive: Add support for titlekey cryptography
| * | | | | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
| | | | | |
* | | | | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvflinger: Correct typo in name of composition event
| * | | | | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info array
| * | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | Updated based off the information on Switch Brew.
* | | | | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/apm: Add the apm:sys service
| * | | | | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton of the apm:sys service based off the information on Switch Brew.
* | | | | | Merge pull request #950 from lioncash/hotkeybunnei2018-08-078-119/+159
|\ \ \ \ \ \ | | | | | | | | | | | | | | qt/hotkey: Get rid of global hotkey map instance
| * | | | | | qt/hotkey: Get rid of global hotkey map instanceLioncash2018-08-078-119/+159
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we make a proper registry class and house it within the main window, then pass it to whatever needs access to the loaded hotkeys. This way, we avoid a global variable, and don't need to initialize a std::map instance before the program can do anything.
* | | | | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvflinger: Use std::string_view in OpenDisplay()
| * | | | | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| | | | | | |
| * | | | | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to use a std::string here, given all that's done is comparing the character sequence against another. This allows passing regular const char* without needing to heap allocate.
* | | | | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()
| * | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | Updates the ID of these based off the information on Switch Brew.
* | | | | | Merge pull request #959 from KAMiKAZOW/cubeb-compilationbunnei2018-08-071-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | Make building cubeb optional
| * | | | | | Make building cubeb optionalKAMiKAZOW2018-08-071-2/+2
| |/ / / / /
* | | | | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | nvdrv: Get rid of indirect inclusions
| * | | | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The only reason this wasn't a compilation error is because we use little-endian systems.
| * | | | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ / / /
* | | | | Merge pull request #952 from lioncash/usbbunnei2018-08-076-0/+259
|\ \ \ \ \ | | | | | | | | | | | | service: Add usb services
| * | | | | service: Add usb servicesLioncash2018-08-076-0/+259
| |/ / / / | | | | | | | | | | | | | | | Adds basic skeleton for the usb services based off the information provided by Switch Brew.
* | | | | Merge pull request #949 from lioncash/privbunnei2018-08-073-7/+21
|\ \ \ \ \ | | | | | | | | | | | | client_port: Make all data members private
| * | | | | client_port: Make all data members privateLioncash2018-08-073-7/+21
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These members don't need to be entirely exposed, we can instead expose an API to operate on them without directly needing to mutate them We can also guard against overflow/API misuse this way as well, given active_sessions is an unsigned value.
* / / / / loader: Fix scope error in DeconstructedRomDirectoryZach Hilman2018-08-071-1/+1
|/ / / /
* | | | Merge pull request #931 from DarkLordZach/nca-as-drdbunnei2018-08-074-37/+24
|\ \ \ \ | | | | | | | | | | loader: Make AppLoader_NCA rely on directory loading code
| * | | | loader: Make AppLoader_NCA rely on directory loading codeZach Hilman2018-08-064-37/+24
| | |_|/ | |/| | | | | | Eliminates duplicate code shared between their Load methods, after all the only difference is how the romfs is handled.
* | | | Merge pull request #947 from lioncash/encodingbunnei2018-08-071-13/+17
|\ \ \ \ | | | | | | | | | | game_list: Use QString::fromStdString() where applicable instead of c_str()
| * | | | game_list: Remove unnecessary conversion to std::string in ValidateEntry()Lioncash2018-08-061-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | | We can just use the file interfaces that Qt provides to prevent needing to convert to std::string.
| * | | | game_list: Use QString::fromStdString() where applicable instead of c_str()Lioncash2018-08-061-5/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The codec used by Qt for const char* and std::string don't necessarily have to be the same depending on locale. Therefore, we should be using the correct functions to do the conversions.
* | | | | GDBStub works with both Unicorn and Dynarmic now (#941)Hedges2018-08-075-9/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GDBStub works with both Unicorn and Dynarmic now * Tidy up
* | | | | Merge pull request #943 from lioncash/declbunnei2018-08-071-7/+7
|\ \ \ \ \ | | | | | | | | | | | | game_list: Join declarations and assignments in onTextChanged()
| * | | | | game_list: Join declarations and assignments in onTextChanged()Lioncash2018-08-061-7/+7
| |/ / / / | | | | | | | | | | | | | | | There's no need to keep these separate from one another.
* | | | | Merge pull request #946 from lioncash/compressbunnei2018-08-071-10/+8
|\ \ \ \ \ | | | | | | | | | | | | qt/main: Collapse if statement in UpdateRecentFiles()
| * | | | | qt/main: Avoid sign conversions in UpdateRecentFiles()Lioncash2018-08-061-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was intermixing signed and unsigned values when they could all just be signed.
| * | | | | qt/main: Collapse if statement in UpdateRecentFiles()Lioncash2018-08-061-6/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | Given the function accepts a boolean, we don't need to use an if statement here and repeat ourselves.
* | | | | Merge pull request #944 from lioncash/menubunnei2018-08-071-2/+8
|\ \ \ \ \ | | | | | | | | | | | | qt: Don't show error dialog when canceling the Load Folder dialog
| * | | | | qt: Don't show error dialog when canceling the Load Folder dialogLioncash2018-08-061-2/+8
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, when canceling out of the Load Folder dialog, a user would get an error dialog about the selected folder not containing a main file, however, by canceling out of the dialog, no selection was actually made.
* | | | | Merge pull request #942 from lioncash/defaultbunnei2018-08-0714-24/+26
|\ \ \ \ \ | | | | | | | | | | | | qt: Minor cleanup-related changes
| * | | | | qt/game_list_p: Remove redundant base class constructor invocationsLioncash2018-08-061-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These occur automatically without the need to call them. While we're at it, also std::move the QString instance into its member variable.
| * | | | | qt: Add missing override specifiers where applicableLioncash2018-08-065-7/+9
| | | | | |
| * | | | | qt: Default destructors where applicableLioncash2018-08-069-16/+15
| |/ / / / | | | | | | | | | | | | | | | | | | | | Makes code consistent with our style of defaulting special member functions where applicable.
* | | | | Merge pull request #940 from lioncash/privatebunnei2018-08-072-5/+9
|\ \ \ \ \ | | | | | | | | | | | | kernel/event: Make data members private
| * | | | | kernel/event: Make data members privateLioncash2018-08-062-5/+9
| |/ / / / | | | | | | | | | | | | | | | | | | | | Instead we can simply provide accessors to the required data instead of giving external read/write access to the variables directly.
* | | | | Merge pull request #936 from bunnei/avoid-copiesbunnei2018-08-073-6/+21
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Avoid superfluous surface copies.
| * | | | | maxwell_3d: Remove outdated assert.bunnei2018-08-061-2/+0
| | | | | |
| * | | | | gl_rasterizer_cache: Avoid superfluous surface copies.bunnei2018-08-062-4/+21
| | | | | |
* | | | | | Merge pull request #934 from lioncash/chronobunnei2018-08-074-16/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | core_timing: Make GetGlobalTimeUs() return std::chrono::microseconds
| * | | | | | perf_stats: Correct literal used for MAX_LAG_TIME_USLioncash2018-08-061-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ms is shorthand for milliseconds, not microseconds, and given there's no comment indicating that this was intentional, it probably wasn't.
| * | | | | | core_timing: Make GetGlobalTimeUs() return std::chrono::microsecondsLioncash2018-08-064-14/+14
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | Enforces the time unit being returned and also allows using the standard time utilities to manipulate it.
* | | | | | qt/main: Better file-existence checking within OnMenuRecentFile() and UpdateUITheme()Lioncash2018-08-061-8/+6
| |_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In OnMenuRecentFile() we don't need to construct a QFileInfo instance just to check if a file exists, we can just use the static member function to do that (which Qt's documentation also notes as quicker than constructing an instance). In UpdateUITheme(), we just want to try and open the file and check the success of that operation. Technically speaking, between the existence check and the open call, the file can be deleted or moved, but still appear to succeed in code. i.e. 1. Existence check -> Returns true 2. File is moved/deleted 3. Open is called, the return value of which isn't checked 4. Nonsense behavior This way we combine the existence check and the open into one.
* | | | | Merge pull request #933 from lioncash/memorybunnei2018-08-061-12/+11
|\ \ \ \ \ | | | | | | | | | | | | memory: Correct prototype of ZeroBlock
| * | | | | memory: Make prototype parameter names match their definitionsLioncash2018-08-061-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | Keeps the code consistent.
| * | | | | memory: Correct prototype of ZeroBlockLioncash2018-08-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the prototype wasn't matching the definition, which has a Processor parameter before the destination address.
| * | | | | memory: Remove unnecessary const qualifiers in prototypesLioncash2018-08-061-9/+8
| |/ / / / | | | | | | | | | | | | | | | | | | | | These aren't necessary, as value-wise const only matters in the definition.
* | / / / Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
| |/ / / |/| | |
* | | | Merge pull request #932 from lioncash/funcbunnei2018-08-062-9/+9
|\ \ \ \ | | | | | | | | | | core_timing: Use transparent functors where applicable
| * | | | core_timing: Convert typedef into a type aliasLioncash2018-08-061-4/+4
| | | | | | | | | | | | | | | | | | | | Makes the alias a little more readable from left-to-right.
| * | | | core_timing: Use transparent functors where applicableLioncash2018-08-061-5/+5
| |/ / / | | | | | | | | | | | | | | | | | | | | Gets rid of the need to hardcode the type in multiple places. This will now be deduced automatically, based off the elements in the container being provided to the algorithm.
* | | | Merge pull request #929 from lioncash/addrbunnei2018-08-062-83/+89
|\ \ \ \ | | | | | | | | | | gdbstub: Minor changes
| * | | | gdbstub: Use type alias for breakpoint mapsLioncash2018-08-051-37/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than having to type out the full std::map type signature, we can just use a straightforward alias. While we're at it, rename GetBreakpointList to GetBreakpointMap, which makes the name more accurate. We can also get rid of unnecessary u64 static_casts, since VAddr is an alias for a u64.
| * | | | gdbstub: Move all file-static variables into the GDBStub namespaceLioncash2018-08-051-35/+36
| | | | | | | | | | | | | | | | | | | | | | | | | Keeps everything under the same namespace. While we're at it, enclose them all within an inner anonymous namespace.
| * | | | gdbstub: Replace PAddr alias with VAddrLioncash2018-08-052-14/+14
| | | | | | | | | | | | | | | | | | | | In all cases, a virtual address is being passed in, not a physical one.
* | | | | Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ \ \ \ \ | | | | | | | | | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()
| * | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| |/ / / / | | | | | | | | | | | | | | | | | | | | In all cases the vector being supplied is empty, so we can just return by value in these instances.
* | | | | Merge pull request #925 from bunnei/audrenbunnei2018-08-0619-294/+652
|\ \ \ \ \ | |_|/ / / |/| | | | Implement audren audio output
| * | | | audio_core: Implement audren_u audio playback.bunnei2018-08-055-218/+451
| | | | |
| * | | | audio_core: Use s16 where possible for audio samples.bunnei2018-08-059-36/+27
| | | | |
| * | | | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-055-11/+126
| | | | |
| * | | | cubeb_sink: Support variable sample_rate and num_channels.bunnei2018-08-041-15/+25
| | | | |
| * | | | audio_core: Sinks need unique names as well.bunnei2018-08-045-9/+14
| | | | |
| * | | | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-045-10/+14
| | |/ / | |/| |
* | | | Merge pull request #927 from bunnei/fix-texsbunnei2018-08-051-2/+5
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Fix TEXS mask and dest.
| * | | | gl_shader_decompiler: Fix TEXS mask and dest.bunnei2018-08-051-2/+5
| | |/ / | |/| |
* | | | Merge pull request #912 from lioncash/global-varbunnei2018-08-0519-80/+110
|\ \ \ \ | |/ / / |/| | | video_core: Eliminate the g_renderer global variable
| * | | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-045-11/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | All calling code assumes that the rasterizer will be in a valid state, which is a totally fine assumption. The only way the rasterizer wouldn't be is if initialization is done incorrectly or fails, which is checked against in System::Init().
| * | | video_core: Eliminate the g_renderer global variableLioncash2018-08-0419-74/+100
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We move the initialization of the renderer to the core class, while keeping the creation of it and any other specifics in video_core. This way we can ensure that the renderer is initialized and doesn't give unfettered access to the renderer. This also makes dependencies on types more explicit. For example, the GPU class doesn't need to depend on the existence of a renderer, it only needs to care about whether or not it has a rasterizer, but since it was accessing the global variable, it was also making the renderer a part of its dependency chain. By adjusting the interface, we can get rid of this dependency.
* | | | Merge pull request #926 from ogniK5377/vertex-attrib-formatbunnei2018-08-051-2/+8
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Fix glVertexAttribFormat for integers
| * | | | added braces for conditionsDavid Marcec2018-08-051-2/+3
| | | | |
| * | | | fix the attrib format for intsDavid Marcec2018-08-051-2/+7
| | |/ / | |/| |
* | | | Merge pull request #924 from lioncash/arpbunnei2018-08-056-0/+97
|\ \ \ \ | | | | | | | | | | service: Add arp services
| * | | | service: Add arp servicesLioncash2018-08-056-0/+97
| |/ / / | | | | | | | | | | | | | | | | Adds the basic skeleton of the arp services based off the information provided by Switch Brew.
* | | | Merge pull request #921 from lioncash/viewbunnei2018-08-055-35/+35
|\ \ \ \ | | | | | | | | | | core/crypto: Minor changes
| * | | | aes_util: Add static assertion to Transcode() and XTSTranscode() to ensure well-defined behaviorLioncash2018-08-041-0/+4
| | | | | | | | | | | | | | | | | | | | These functions should only be given trivially-copyable types.
| * | | | aes_util: Make CalculateNintendoTweak() an internally linked functionLioncash2018-08-042-12/+10
| | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't directly depend on class state, so it can be hidden entirely from the interface in the cpp file.
| * | | | aes_util: Make Transcode() a const member functionLioncash2018-08-042-8/+9
| | | | | | | | | | | | | | | | | | | | This doesn't modify member state, so it can be made const.
| * | | | core/crypto: Remove unnecessary includesLioncash2018-08-044-5/+5
| | | | |
| * | | | key_manager: Use regular std::string instead of std::string_viewLioncash2018-08-042-10/+7
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | The benefit of std::string_view comes from the idea of avoiding copies (essentially acting as a non-owning view), however if we're just going to copy into a local variable immediately, there's not much benefit gained here.
* / / / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ / / | | | | | | | | | | | | These don't do anything within .cpp files (we don't include cpp files, so...)
* | | Merge pull request #849 from DarkLordZach/xcibunnei2018-08-0436-78/+1395
|\ \ \ | | | | | | | | XCI and Encrypted NCA Support
| * | | Add missing parameter to files.push_back()Zach Hilman2018-08-011-5/+5
| | | |
| * | | Fix merge conflicts with opus and update docsZach Hilman2018-08-014-6/+8
| | | |
| * | | Use more descriptive error codes and messagesZach Hilman2018-08-019-34/+101
| | | |
| * | | Use static const instead of const staticZach Hilman2018-08-011-2/+2
| | | |
| * | | Use ErrorEncrypted where applicable and fix no keys crashZach Hilman2018-08-014-17/+37
| | | |
| * | | Add missing includes and use const where applicableZach Hilman2018-08-0111-24/+40
| | | |
| * | | Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-015-7/+23
| | | |
| * | | Use SHGetKnownFolderPath instead of SHGetFolderPathAZach Hilman2018-08-011-3/+4
| | | |
| * | | Make XCI comply to review and style guidelinesZach Hilman2018-08-0116-482/+223
| | | |
| * | | Extract mbedtls to cpp fileZach Hilman2018-08-015-87/+127
| | | |
| * | | Add missing string.h includeZach Hilman2018-08-011-0/+1
| | | |
| * | | Update mbedtls and fix compile errorZach Hilman2018-08-011-0/+1
| | | |
| * | | Remove files that are not usedZach Hilman2018-08-0133-43/+1455
| | | |
* | | | Merge pull request #919 from lioncash/signbunnei2018-08-041-8/+9
|\ \ \ \ | |_|/ / |/| | | gl_shader_manager: Amend sign differences in an assertion comparison in SetShaderUniformBlockBinding()
| * | | gl_shader_manager: Invert conditional in SetShaderUniformBlockBinding()Lioncash2018-08-041-7/+9
| | | | | | | | | | | | | | | | | | | | This lets us indent the majority of the code and places the error case first.
| * | | gl_shader_manager: Amend sign differences in an assertion comparison in SetShaderUniformBlockBinding()Lioncash2018-08-041-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures both operands have the same sign in the comparison. While we're at it, we can get rid of the redundant casting of ub_size to an int. This type will always be trivial and alias a built-in type (not doing so would break backwards compatibility at a standard level).
* | | | Merge pull request #911 from lioncash/prototypebunnei2018-08-041-3/+0
|\ \ \ \ | | | | | | | | | | video_core: Remove unimplemented Start() function prototype
| * | | | video_core: Remove unimplemented Start() function prototypeLioncash2018-08-031-3/+0
| | | | | | | | | | | | | | | | | | | | Given this has no definition, we can just remove it entirely.
* | | | | Merge pull request #913 from lioncash/unused-funcbunnei2018-08-041-16/+0
|\ \ \ \ \ | | | | | | | | | | | | memory: Remove unused GetSpecialHandlers() function
| * | | | | memory: Remove unused GetSpecialHandlers() functionLioncash2018-08-031-16/+0
| | |/ / / | |/| | | | | | | | | | | | | This is just unused code, so we may as well get rid of it.
* | | | | Merge pull request #914 from lioncash/codesetbunnei2018-08-045-20/+41
|\ \ \ \ \ | | | | | | | | | | | | kernel/process: Use accessors instead of class members for referencing segment array
| * | | | | kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| | | | | |
| * | | | | kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-035-20/+40
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using member variables for referencing the segments array increases the size of the class in memory for little benefit. The same behavior can be achieved through the use of accessors that just return the relevant segment.
* | | | | Merge pull request #917 from lioncash/crashbunnei2018-08-043-13/+38
|\ \ \ \ \ | | | | | | | | | | | | kernel/thread: Fix potential crashes introduced in 26de4bb5
| * | | | | kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | This amends cases where crashes can occur that were missed due to the odd way the previous code was set up (using 3DS memory regions that don't exist).
* | | | | Merge pull request #910 from lioncash/unusedbunnei2018-08-031-2/+0
|\ \ \ \ \ | |/ / / / |/| | | | gl_shader_decompiler: Remove unused variable in GenerateDeclarations()
| * | | | gl_shader_decompiler: Remove unused variable in GenerateDeclarations()Lioncash2018-08-031-2/+0
| |/ / / | | | | | | | | | | | | | | | | This variable was being incremented, but we were never actually using it.
* | | | Merge pull request #908 from lioncash/memorybunnei2018-08-0316-559/+29
|\ \ \ \ | | | | | | | | | | core/memory: Get rid of 3DS leftovers
| * | | | core/memory: Get rid of 3DS leftoversLioncash2018-08-0316-559/+29
| | | | | | | | | | | | | | | | | | | | Removes leftover code from citra that isn't needed.
* | | | | gl_shader_manager: Make ProgramManager's GetCurrentProgramStage() a const member functionLioncash2018-08-031-1/+1
| |/ / / |/| | | | | | | | | | | This function doesn't modify class state, so it can be made const.
* | | | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-039-8/+95
| | | |
* | | | Merge pull request #895 from lioncash/sinkbunnei2018-08-031-5/+8
|\ \ \ \ | | | | | | | | | | sink_details: std::move std::function instances
| * | | | sink_details: Deduplicate long std::function repetitionLioncash2018-08-021-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | We can just use type aliases to avoid needing to write the same long type twice
| * | | | sink_details: std::move std::function instancesLioncash2018-08-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | Given std::function is allowed to potentially allocate, these should be std::move'd to prevent potential reallocation (should that ever happen).
* | | | | Merge pull request #898 from lioncash/migbunnei2018-08-036-0/+55
|\ \ \ \ \ | | | | | | | | | | | | service: Add migration services
| * | | | | service: Add migration servicesLioncash2018-08-026-0/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the mig:usr service based off information provided by Switch Brew.
* | | | | | Merge pull request #900 from lioncash/initbunnei2018-08-031-5/+5
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | math_util: Always initialize members of Rectangle
| * | | | | math_util: Always initialize members of RectangleLioncash2018-08-021-5/+5
| |/ / / / | | | | | | | | | | | | | | | Prevents potentially using the members uninitialized.
* | | | | Merge pull request #892 from lioncash/globalbunnei2018-08-0313-64/+54
|\ \ \ \ \ | | | | | | | | | | | | video_core: Make global EmuWindow instance part of the base renderer …
| * | | | | video_core: Make global EmuWindow instance part of the base renderer classLioncash2018-08-0213-64/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the global a member of the RendererBase class. We also change this to be a reference. Passing any form of null pointer to these functions is incorrect entirely, especially given the code itself assumes that the pointer would always be in a valid state. This also makes it easier to follow the lifecycle of instances being used, as we explicitly interact the renderer with the rasterizer, rather than it just operating on a global pointer.
* | | | | | Merge pull request #894 from lioncash/objectbunnei2018-08-0344-156/+186
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel: Move object class to its own source files
| * | | | | | kernel: Move object class to its own source filesLioncash2018-08-0244-156/+186
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | General moving to keep kernel object types separate from the direct kernel code. Also essentially a preliminary cleanup before eliminating global kernel state in the kernel code.
* | | | | | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/thread: Minor changes
| * | | | | | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids using a u32 to compare against a range of size_t, which can be a source of warnings. While we're at it, compress a std::tie into a structured binding.
| * | | | | | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function only reads the data being referenced, it doesn't modify it, so we can turn the reference into a const reference.
| * | | | | | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | This function isn't used outside of this translation unit, so we can make it internally linked.
* | | | | | Merge pull request #906 from lioncash/overridebunnei2018-08-033-19/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | input_common: minor changes
| * | | | | | input_common: Use std::move where applicableLioncash2018-08-032-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary atomic reference count increments and decrements
| * | | | | | input_common: Add missing override specifiersLioncash2018-08-033-14/+2
| |/ / / / /
* | | | | | Merge pull request #907 from lioncash/slotbunnei2018-08-037-46/+49
|\ \ \ \ \ \ | | | | | | | | | | | | | | yuzu: Use Qt 5 signal/slots where applicable
| * | | | | | yuzu: Use Qt 5 signal/slots where applicableLioncash2018-08-037-46/+49
| |/ / / / / | | | | | | | | | | | | | | | | | | Makes the signal/slot connections type-safe instead of string-based.
* | | | | | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/vm_manager: Minor changes
| * | | | | | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| | | | | | |
| * | | | | | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes our immutable state explicit.
| * | | | | | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | These two variables correspond to address ranges.
* | | | | | Merge pull request #903 from lioncash/copybunnei2018-08-031-3/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | vfs_vector: Minor changes
| * | | | | | vfs_vector: Remove unused variable in FindAndRemoveVectorElement()Lioncash2018-08-021-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This wasn't being used for anything, so it can be removed.
| * | | | | | vfs_vector: Avoid unnecessary copies where applicableLioncash2018-08-021-2/+5
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | The lambda elements should be taken by const reference here, and we can move the virtual directory passed to ReplaceFileWithSubdirectory()
* | | | | | Merge pull request #901 from lioncash/refbunnei2018-08-031-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_manager: Take ShaderSetup instances by const reference in UseProgrammableVertexShader() and UseProgrammableFragmentShader()
| * | | | | | gl_shader_manager: Take ShaderSetup instances by const reference in UseProgrammableVertexShader() and UseProgrammableFragmentShader()Lioncash2018-08-021-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids performing unnecessary copies of 65560 byte sized ShaderSetup instances, considering it's only used as part of lookup and not modified. Given the parameters were already const, it's likely taking these parameters by reference was intended but the ampersand was forgotten.
* | | | | | Merge pull request #899 from lioncash/unusedbunnei2018-08-027-334/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | hw: Remove unused files
| * | | | | | hw: Remove unused filesLioncash2018-08-027-334/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | None of these files are used in any meaningful way. They're just leftovers from citra. Also has the benefit of getting rid of an unused global variable.
* | | | | | Merge pull request #902 from lioncash/arraybunnei2018-08-021-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_state: Make texture_units a std::array
| * | | | | | gl_state: Make texture_units a std::arrayLioncash2018-08-021-2/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | Gets rid of the use of a raw C array.
* | | | | | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/ns: Add missing ns services
| * | | | | | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements the basic skeleton of ns:am2, ns:ec, ns:rid, ns:rt, ns:su, ns:vm, and ns:web based off the information provided by Switch Brew and SwIPC.
* | | | | | Implement RGB32F PixelFormat (#886) (used by Go Vacation)greggameplayer2018-08-023-9/+23
| | | | | |
* | | | | | Merge pull request #893 from lioncash/pscbunnei2018-08-026-1/+99
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | service: Add the psc services
| * | | | | logging/log: Remove incorrect description in PCV doc commentLioncash2018-08-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | PCV isn't the parental control service.
| * | | | | service: Add psc servicesLioncash2018-08-026-0/+98
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Adds the basic skeleton for the psc services based off the information provided by Switch Brew.
* / | | | audio_out: Use Buffer::Tag alias in GetTagsAndReleaseBuffers()'s prototypeLioncash2018-08-022-2/+2
|/ / / / | | | | | | | | | | | | | | | | This makes the Buffer::Tag usage consistent with the Stream class's prototype of GetTagsAndReleaseBuffers().
* | | | Merge pull request #888 from lioncash/capsbunnei2018-08-026-0/+173
|\ \ \ \ | | | | | | | | | | service: Add capture services
| * | | | service: Add capture servicesLioncash2018-08-016-0/+173
| |/ / / | | | | | | | | | | | | | | | | Adds the basic skeleton for the capture services based off information provided by Switch Brew.
* | | | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ \ \ | | | | | | | | | | lm: Amend name of ILogger
| * | | | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ / / | | | | | | | | | | | | | | | | Previously this was being registered with the name "Logger". While we're at it, also change the name of the class to match it.
* | | | Merge pull request #889 from lioncash/fspbunnei2018-08-026-0/+89
|\ \ \ \ | | | | | | | | | | service/filesystem: Add fsp:ldr and fsp:pr services
| * | | | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-016-0/+89
| |/ / / | | | | | | | | | | | | | | | | Adds the basic skeleton for the remaining fsp services based off information provided by Switch Brew.
* / / / service: Add bpc and pcv servicesLioncash2018-08-018-0/+183
|/ / / | | | | | | | | | | | | Adds the basic skeleton for the remaining pcv-related services based off information on Switch Brew.
* | | Implement R32_FLOAT RenderTargetFormatUnknown2018-08-013-0/+5
| | |
* | | Merge pull request #882 from lioncash/unusedbunnei2018-08-011-6/+0
|\ \ \ | |/ / |/| | kernel/thread: Remove unimplemented function prototype
| * | kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
| | | | | | | | | | | | | | | Given there's no implementation, we may as well remove the code entirely.
* | | Merge pull request #871 from bunnei/audio-configbunnei2018-08-0112-21/+330
|\ \ \ | |/ / |/| | audio_core: Add configuration settings.
| * | audio_core: Add configuration settings.bunnei2018-08-0112-21/+330
| | |
* | | Merge pull request #877 from lioncash/removebunnei2018-08-016-104/+0
|\ \ \ | | | | | | | | kernel: Remove unused object_address_table.cpp/.h
| * | | kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-316-104/+0
| | | | | | | | | | | | | | | | | | | | | | | | These source files were entirely unused throughout the rest of the codebase. This also has the benefit of getting rid of a global variable as well.
* | | | Merge pull request #880 from lioncash/audiobunnei2018-08-0114-2/+289
|\ \ \ \ | |_|/ / |/| | | service/audio: Add missing services
| * | | service/audio: Add missing servicesLioncash2018-08-0114-2/+289
| | | | | | | | | | | | | | | | | | | | Adds the missing audctl service, as well as the :a and :d services for audin, audout, audrec, and audren.
* | | | Merge pull request #876 from lioncash/includebunnei2018-08-0123-28/+47
|\ \ \ \ | | | | | | | | | | kernel: Remove unnecessary includes
| * | | | kernel: Remove unnecessary includesLioncash2018-07-3123-28/+47
| | |/ / | |/| | | | | | | | | | | | | | Removes unnecessary direct dependencies in some headers and also gets rid of indirect dependencies that were being relied on to be included.
* | | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ \ | |_|/ / |/| | | audout_u: Remove std::move in OpenAudioOutImpl()
| * | | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the code was using the values from params further below after it was std::moved. Thankfully, given AudoutParams is a trivially copyable struct, the values would have simply been copied in this instance and not invalidated to garbage values.
* | | | Merge pull request #864 from FearlessTobi/port-3973bunnei2018-07-311-2/+30
|\ \ \ \ | | | | | | | | | | Port #3973 from Citra: "Remove polymorphism issue"
| * | | | remove polymorphism issueB3n302018-07-291-2/+30
| | | | |
* | | | | Merge pull request #869 from Subv/ubsanbunnei2018-07-314-8/+23
|\ \ \ \ \ | | | | | | | | | | | | Corrected a few error cases detected by asan/ubsan
| * | | | | MacroInterpreter: Avoid left shifting negative values.Subv2018-07-312-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | The branch target is signed, so multiply by 4 instead of left shifting by 2
| * | | | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| | | | | |
| * | | | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
| | | | | | | | | | | | | | | | | | | | | | | | Passing nullptr to memcpy is undefined behavior.
* | | | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-316-0/+96
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Add fgm services
| * | | | | | service: Add fgm servicesLioncash2018-07-316-0/+96
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the fgm services based off the information provided by Switch Brew.
* | | | | | Merge pull request #874 from lioncash/ambunnei2018-07-318-0/+156
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | service/am: Add missing am services
| * | | | | service/am: Add missing am servicesLioncash2018-07-318-0/+156
| |/ / / / | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for missing am services idle:sys, omm, and spsm based off the information provided by Switch Brew.
* | | | | Merge pull request #870 from lioncash/initbunnei2018-07-311-9/+7
|\ \ \ \ \ | | | | | | | | | | | | arm_dynarmic: Correct initializer list order
| * | | | | arm_dynarmic: Make SetTlsAddress() prototype and definition consistentLioncash2018-07-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Makes the definition use the same type aliases as in its prototype.
| * | | | | arm_dynarmic: Remove unnecessary qualifying of ThreadContextLioncash2018-07-311-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the ARM_Dynarmic class inherits from ARM_Interface, we don't need to qualify here.
| * | | | | arm_dynarmic: Correct initializer list orderLioncash2018-07-311-5/+3
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends the initializer list to be in the same order that each variable would be initialized in. We also do this to ensure we don't use a bogus uninitialized instance of the exclusive monitor within MakeJit() We can also remove the jit member from the initializer list as this is initialized by PageTableChanged()
* / / / / service: Add the pcie serviceLioncash2018-07-316-0/+85
|/ / / / | | | | | | | | | | | | | | | | Adds the basic skeleton of the pcie service based off information on Switch Brew.
* | | | Merge pull request #855 from bunnei/cubebbunnei2018-07-3117-39/+462
|\ \ \ \ | | | | | | | | | | Audio output backend based on cubeb
| * | | | audio_core: Implement Sink and SinkStream interfaces with cubeb.bunnei2018-07-318-6/+261
| | | | |
| * | | | audio_core: Add interfaces for Sink and SinkStream.bunnei2018-07-316-0/+163
| | | | |
| * | | | audio_core: Misc. improvements to stream/buffer/audio_out.bunnei2018-07-315-20/+32
| | | | |
| * | | | audio_core: Move to audout_u impl.bunnei2018-07-314-13/+6
| | | | | | | | | | | | | | | | | | | | - This is necessary so streams are created on the same thread.
* | | | | Port #3758 from Citra (#852): Add missing std::string import in text_formatterTobias2018-07-311-0/+1
|/ / / /
* | | | Implemented various hwopus functions (#853)David2018-07-313-6/+132
| | | |
* | | | Merge pull request #861 from FearlessTobi/port-3972bunnei2018-07-302-81/+31
|\ \ \ \ | | | | | | | | | | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"
| * | | | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"zhupengfei2018-07-292-81/+31
| | |/ / | |/| |
* | | | Merge pull request #862 from FearlessTobi/port-3997bunnei2018-07-301-3/+5
|\ \ \ \ | | | | | | | | | | Port #3997 from Citra: "common/string_utils: replace boost::transform with std counterpart"
| * | | | common/string_utils: replace boost::transform with std counterpartzhupengfei2018-07-291-3/+5
| |/ / / | | | | | | | | | | | | Note: according to cppreference it is necessary to convert char to unsigned char when using std::tolower and std::toupper, otherwise the behaviour would be undefined.
* | | | Merge pull request #859 from FearlessTobi/port-3837bunnei2018-07-302-3/+4
|\ \ \ \ | | | | | | | | | | Port #3837 from Citra: "citra-qt: Add build date in about dialog"
| * | | | Port #3837 from Citra: "Add build date in about dialog"fearlessTobi2018-07-292-3/+4
| |/ / /
* | | | Port #3769 from Citra: "Update Dark theme to latest version"Tobias2018-07-301-1/+1
| | | |
* | | | Merge pull request #858 from lioncash/castbunnei2018-07-301-3/+2
|\ \ \ \ | | | | | | | | | | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()
| * | | | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()Lioncash2018-07-291-3/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | We shouldn't be upcasting our file instances. Given a PartitionFilesystem is currently designed to accept any arbitrary VfsFile instances, casting to a more specific type than that is just bad design, and shows an interface design issue.
* | | | Merge pull request #860 from FearlessTobi/port-3911bunnei2018-07-305-6/+3
|\ \ \ \ | | | | | | | | | | Port #3911 from Citra: "citra-qt: optimize settings application"
| * | | | Port #3911 from Citra: "Optimize settings application"fearlessTobi2018-07-295-6/+3
| |/ / /
* | | | Merge pull request #863 from FearlessTobi/port-3913bunnei2018-07-301-1/+0
|\ \ \ \ | | | | | | | | | | Port #3913 from Citra: "citra_qt: Remove obsolete application attribute"
| * | | | Port #3913 from Citra: "citra_qt: Remove obsolete application attribute"fearlessTobi2018-07-291-1/+0
| |/ / /
* | | | Merge pull request #865 from FearlessTobi/port-3732bunnei2018-07-302-4/+2
|\ \ \ \ | | | | | | | | | | Port #3732 from Citra: "common: Fix compilation on ARM"
| * | | | Port #3732 from Citra: "common: Fix compilation on ARM"Cameron Cawley2018-07-292-4/+2
| |/ / /
* | | | Merge pull request #857 from lioncash/wlanbunnei2018-07-306-1/+194
|\ \ \ \ | | | | | | | | | | service: Add wlan services
| * | | | service: Add wlan servicesLioncash2018-07-296-1/+194
| |/ / / | | | | | | | | | | | | | | | | Adds the basic skeleton for the wlan services based off the information on Switch Brew.
* | | | Merge pull request #856 from lioncash/btmbunnei2018-07-306-0/+142
|\ \ \ \ | | | | | | | | | | service: Add btm services
| * | | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| | | | | | | | | | | | | | | | | | | | Based off information on SwIPC and Switch Brew.
| * | | | service: Add btm servicesLioncash2018-07-296-0/+108
| |/ / / | | | | | | | | | | | | | | | | Adds the skeleton for the btm services based off the information on Switch Brew.
* / / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ / / | | | | | | | | | | | | | | | * Added some HID commands * Addressed comments
* | | Merge pull request #847 from lioncash/ncmbunnei2018-07-286-0/+80
|\ \ \ | | | | | | | | service: Add ncm services
| * | | service: Add ncm servicesLioncash2018-07-276-0/+80
| | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the ncm services based off information on Switch Brew.
* | | | Merge pull request #846 from lioncash/miibunnei2018-07-286-0/+128
|\ \ \ \ | | | | | | | | | | service: Add mii services
| * | | | service: Add mii servicesLioncash2018-07-276-0/+128
| | |_|/ | |/| | | | | | | | | | | | | | Adds the skeleton for the mii services based off information provided by Switch Brew
* | | | Merge pull request #842 from bunnei/audio-corebunnei2018-07-2812-94/+459
|\ \ \ \ | | | | | | | | | | Initial implementation of Audio Core
| * | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| | | | |
| * | | | core: Add AudioCore to global state.bunnei2018-07-282-0/+9
| | | | |
| * | | | audio_core: Add initial code for keeping track of audout state.bunnei2018-07-288-1/+336
| | |/ / | |/| |
* / | | RomFS ExtractionZach Hilman2018-07-2812-20/+351
|/ / /
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-276-0/+243
|\ \ \ | | | | | | | | service: Add nfc services
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| | | | | | | | | | | | | | | | These simply return the respective interface.
| * | | service: Add nfc servicesLioncash2018-07-276-0/+204
| |/ / | | | | | | | | | | | | Adds the skeleton of the nfc service based off the information provided on Switch Brew.
* | | Merge pull request #839 from FearlessTobi/actually-port-3594bunnei2018-07-271-0/+16
|\ \ \ | | | | | | | | Port #3594 from Citra: "citra_qt: Add Continue/Pause & Toggle Speed Limit hotkeys"
| * | | Port #3594 from CitrafearlessTobi2018-07-261-0/+16
| | |/ | |/|
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-276-0/+111
|\ \ \ | | | | | | | | service: Add the lbl service
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-273-3/+37
| | | | | | | | | | | | | | | | | | | | Implements these functions according to the information available on Switch Brew.
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| | |/ | |/| | | | | | | | | | Adds the skeleton of the lbl service based off the information provided by Switch Brew.
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| | service: Add the btdrv service
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
| | | | | | | | | | | | Adds the skeleton for the btdrv service based off the information provided by Switch Brew
* | | Merge pull request #837 from lioncash/privbunnei2018-07-272-8/+20
|\ \ \ | | | | | | | | kernel/timer: Make data members private where applicable
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-262-8/+20
| | | | | | | | | | | | | | | | | | | | Instead, we can just expose functions that return the queryable state instead of letting anything modify it.
* | | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
| | | |
* | | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
| | | |
* | | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
| |/ / |/| |
* | | Merge pull request #836 from FearlessTobi/port-3594bunnei2018-07-262-0/+4
|\ \ \ | | | | | | | | Port #3665 from Citra: "frontend: Log Citra version"
| * | | Port #3665 from CitrafearlessTobi2018-07-262-0/+4
| | |/ | |/|
* | | Merge pull request #835 from FearlessTobi/port-minor-prsbunnei2018-07-261-1/+1
|\ \ \ | | | | | | | | Port #3641 and #3702 from Citra (Small changes to default_ini and gitignore)
| * | | Port #3641 from CitrafearlessTobi2018-07-261-1/+1
| |/ /
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \ | | | | | | | | service: Add the grc:c service
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| | |/ | |/| | | | | | | | | | Adds the basic skeleton for the grc:c service based off the information provided by Switch Brew.
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \ | | | | | | | | service: Add the nim services
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ / | | | | | | | | | | | | Adds the skeleton for the nim services based off information from Switch Brew.
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-266-0/+164
|\ \ \ | | | | | | | | service: Add ldn services
| * | | service: Add ldn servicesLioncash2018-07-266-0/+164
| |/ / | | | | | | | | | Adds ldn services based off information provided by Switch Brew.
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \ | | | | | | | | service/sockets: Add missing socket services
| * | | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| | | |
| * | | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/ /
* | | Merge pull request #808 from lioncash/mem-dedupbunnei2018-07-261-14/+22
|\ \ \ | | | | | | | | video_core/memory_manager: Avoid repeated unnecessary page slot lookups
| * | | video_core/memory_manager: Replace a loop with std::array's fill() function in PageSlot()Lioncash2018-07-241-3/+1
| | | | | | | | | | | | | | | | | | | | We already have a function that does what this code was doing, so let's use that instead.
| * | | video_core/memory_manager: Avoid repeated unnecessary page slot lookupsLioncash2018-07-241-11/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to keep calling the same function over and over again in a loop, especially when the behavior is slightly non-trivial. We can just keep a reference to the looked up location and do all the checking and assignments based off it instead.
* | | | GPU: Allow using R16F as a render target format.Subv2018-07-262-1/+4
| |_|/ |/| |
* | | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ \ | | | | | | | | service/lm: Minor changes
| * | | lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| | | | | | | | | | | | | | | | | | | | This isn't used directly outside of this translation unit, so we can hide it from external use.
| * | | lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| | | | | | | | | | | | | | | | Amends these to match the information on Switch Brew.
| * | | lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
| | | |
* | | | Merge pull request #825 from greggameplayer/R16_G16bunnei2018-07-264-19/+100
|\ \ \ \ | |_|_|/ |/| | | Implement R16_G16
| * | | Implement R16_G16Unknown2018-07-264-19/+100
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | correct trailing white spaces Delete tabs correct placement Add RG16F & RG16UI & RG16I & RG16S PixelFormats Return correct data according to changes done previously correct PixelFormat declaration correct coding style error correct coding style error part 2 correct RG16S Declaration error correct alignment
* | | | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \ \ \ | | | | | | | | | | service: Add ldr services
| * | | | service: Add ldr servicesLioncash2018-07-264-0/+101
| | | | | | | | | | | | | | | | | | | | | | | | | Adds the skeleton for the ldr-related services based off the information provided on Switch Brew.
* | | | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \ \ \ | | | | | | | | | | | | service: Add erpt and eupld services
| * | | | | service: Add eupld servicesLioncash2018-07-264-0/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the skeleton for the eupld services based off information on Switch Brew.
| * | | | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | Adds the basic skeleton of the erpt service based off information on Switch Brew.
* | | | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ \ \ | |_|/ / / |/| | | | service/nifm: Deduplicate interface code
| * | | | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
| | | | | | | | | | | | | | | | | | | | | | | | | Rather than having the same code for each nifm service variant, we can centralize it on one class and get rid of a bit of extra code.
* | | | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ \ \ | | | | | | | | | | | | service/nvdrv: Minor changes
| * | | | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids copies from being made, since the string is only ever used for lookup, the data is never transfered anywhere. Ideally, we'd use a std::string_view here, but devices is a std::unordered_map, not a std::map, so we can't use heterogenous lookup here.
| * | | | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary reference count increments and decrements. In one case, we don't need to make a shared_ptr copy at all, just to call a member function.
* | | | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ \ \ | |_|/ / / |/| | | | service: Add pm services
| * | | | service: Add pm servicesLioncash2018-07-254-0/+90
| |/ / / | | | | | | | | | | | | | | | | Adds the skeleton for the process management services based off information on Switch Brew.
* | | | Merge pull request #820 from lioncash/esMat M2018-07-264-0/+77
|\ \ \ \ | | | | | | | | | | service: Add the es service
| * | | | service: Add the es serviceLioncash2018-07-254-0/+77
| |/ / / | | | | | | | | | | | | | | | | Adds the skeleton for the ETicket service based off the information on Switch Brew
* | | | Merge pull request #821 from lioncash/waitMat M2018-07-261-0/+4
|\ \ \ \ | |_|/ / |/| | | wait_tree: Add missing switch case for WaitTreeThread::GetText()
| * | | wait_tree: Add missing switch case for WaitTreeThread::GetText()Lioncash2018-07-251-0/+4
| |/ / | | | | | | | | | We were missing the enum entry for WaitIPC
* | | Merge pull request #819 from Subv/srgbbunnei2018-07-252-9/+17
|\ \ \ | |/ / |/| | GPU: Use the right texture format for sRGBA framebuffers.
| * | GPU: Use the right texture format for sRGBA framebuffers.Subv2018-07-252-9/+17
| | |
* | | Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\ \ \ | | | | | | | | time: Add the time:a service
| * | | time: Add the time:a serviceLioncash2018-07-253-10/+11
| | | | | | | | | | | | | | | | Given we already have time:s and time:u, we should also have time:a
| * | | time: Simplify interface creationLioncash2018-07-246-64/+15
| | | | | | | | | | | | | | | | We can use one instance of the interface instead of duplicating code.
* | | | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \ \ \ | | | | | | | | | | svc: Log parameters in SetMemoryAttribute()
| * | | | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
| | |_|/ | |/| | | | | | | | | | Provides slightly more context than only logging out the address value.
* | | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \ \ | | | | | | | | | | core_timing: Split off utility functions into core_timing_util
| * | | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| | | | |
| * | | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
| | | | |
* | | | | Merge pull request #802 from lioncash/unreachbunnei2018-07-251-0/+3
|\ \ \ \ \ | | | | | | | | | | | | wait_tree: Silence warning about all code paths not returning a value
| * | | | | wait_tree: Silence warning about all code paths not returning a valueLioncash2018-07-241-0/+3
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | If code execution hits this spot, something has gone very wrong, so mark the path as unreachable. This silences a warning on MSVC.
* | | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \ \ | | | | | | | | | | | | set_sys: Implement SetColorSetId()
| * | | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| | | | | |
| * | | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| |/ / / /
* | | | / GPU: Allow the use of Z24S8 as a texture format.Subv2018-07-251-0/+4
| |_|_|/ |/| | |
* | | | Merge pull request #816 from Subv/z32_s8bunnei2018-07-254-1/+16
|\ \ \ \ | | | | | | | | | | GPU: Implemented the Z32_S8_X24 depth buffer format.
| * | | | GPU: Implemented the Z32_S8_X24 depth buffer format.Subv2018-07-254-1/+16
| | | | |
* | | | | Merge pull request #815 from Subv/z32f_texbunnei2018-07-251-0/+4
|\ \ \ \ \ | | | | | | | | | | | | GPU: Allow using Z32 as a texture format.
| * | | | | GPU: Allow using Z32 as a texture format.Subv2018-07-251-0/+4
| |/ / / /
* | | | | Merge pull request #814 from Subv/rt_r8bunnei2018-07-252-0/+4
|\ \ \ \ \ | | | | | | | | | | | | GPU: Allow the usage of R8 as a render target format.
| * | | | | GPU: Allow the usage of R8 as a render target format.Subv2018-07-252-0/+4
| |/ / / /
* | | | | Merge pull request #809 from lioncash/rasterizerbunnei2018-07-252-16/+13
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Minor cleanup
| * | | | | gl_rasterizer: Replace magic number with GL_INVALID_INDEX in SetupConstBuffers()Lioncash2018-07-241-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just the named constant that OpenGL provides, so we can use that instead of using a literal -1
| * | | | | gl_rasterizer: Use std::string_view instead of std::string when checking for extensionsLioncash2018-07-241-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can avoid heap allocations here by just using a std::string_view instead of performing unnecessary copying of the string data.
| * | | | | gl_rasterizer: Use in-class member initializers where applicableLioncash2018-07-242-12/+5
| | |_|_|/ | |/| | | | | | | | | | | | | We can just assign to the members directly in these cases.
* | | | | Merge pull request #811 from Subv/code_address_assertbunnei2018-07-251-8/+0
|\ \ \ \ \ | |_|/ / / |/| | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.
| * | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.Subv2018-07-241-8/+0
| |/ / / | | | | | | | | | | | | Games usually just leave it at 0 but nouveau sets it to something else. This already works fine, the assert is useless.
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \ | | | | | | | | | | friend: Deduplicate interfaces
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Given we already have friend:a and friend:u, we should add the remaining services as well.
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| | | | |
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| |/ / /
* | | | Merge pull request #810 from Subv/r16bunnei2018-07-253-5/+32
|\ \ \ \ | | | | | | | | | | GPU: Implemented the R16 and R16F texture formats.
| * | | | GPU: Implemented the R16 and R16F texture formats.Subv2018-07-243-5/+32
| |/ / /
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \ | | | | | | | | | | svc: Resolve sign comparison warnings in WaitSynchronization()
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / / | | | | | | | | | | | | | | | | The loop's induction variable was signed, but we were comparing against an unsigned variable.
* / / / deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \ | | | | | | | | arm_dynarmic: Make MakeJit() a const member function
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ / | | | | | | | | | | | | This functions doesn't modify instance state, so it can be a made a const member function.
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \ | | | | | | | | core: Make converting constructors explicit where applicable
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ / | | | | | | | | | | | | Avoids unwanted implicit conversions. Thankfully, given the large amount of cleanup in past PRs, only this tiny amount is left over to cover.
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \ | | | | | | | | apm/interface: Remove redundant declaration of InstallInterfaces()
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ / | | | | | | | | | This is already declared in apm/apm.h
* | | Merge pull request #799 from Subv/tex_r32fbunnei2018-07-243-6/+19
|\ \ \ | | | | | | | | GPU: Implement texture format R32F.
| * | | GPU: Implement texture format R32F.Subv2018-07-243-6/+19
| | | |
* | | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ \ | | | | | | | | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by reference
| * | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | The pointed to thread's members are simply observed in this case, so we don't need to copy it here.
* | | | | Merge pull request #796 from bunnei/gl-uintbunnei2018-07-241-0/+3
|\ \ \ \ \ | | | | | | | | | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.
| * | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.bunnei2018-07-241-0/+3
| | | | | |
* | | | | | Merge pull request #789 from bunnei/tex-wrap-borderbunnei2018-07-244-11/+13
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.
| * | | | | gl_rasterizer: Implement texture border color.bunnei2018-07-243-11/+11
| | | | | |
| * | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.bunnei2018-07-241-0/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ \ \ | | | | | | | | | | | | ipc_helpers: Make member variables of ResponseBuilder private
| * | | | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| | | | | |
| * | | | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| | |_|/ / | |/| | | | | | | | | | | | | These aren't used externally at all, so they can be made private.
* | | | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ \ \ | |_|/ / / |/| | | | partition_filesystem: Use std::move where applicable
| * | | | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids copying a std::string instance and avoids unnecessary atomic reference count incrementing and decrementing.
* | | | | Merge pull request #791 from bunnei/rg32f-rgba32f-bgra8bunnei2018-07-245-12/+70
|\ \ \ \ \ | |_|_|/ / |/| | | | gl_rasterizer_cache: Implement formats BGRA8_UNORM/RGBA32_FLOAT/RG32_FLOAT
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RG32_FLOAT.bunnei2018-07-245-7/+25
| | | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RGBA32_FLOAT.bunnei2018-07-242-10/+34
| | | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat BGRA8_UNORM.bunnei2018-07-244-8/+22
| | | | |
| * | | | gl_rasterizer_cache: Add missing log statements.bunnei2018-07-241-0/+2
| | | | |
* | | | | Merge pull request #792 from lioncash/retvalbunnei2018-07-241-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()
| * | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()Lioncash2018-07-241-2/+2
| | |_|/ | |/| | | | | | | | | | This should be returning void, not a std::string
* | | | Merge pull request #790 from bunnei/shader-print-instrbunnei2018-07-241-1/+2
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Print instruction value in shader comments.
| * | | | gl_shader_decompiler: Print instruction value in shader comments.bunnei2018-07-241-1/+2
| | |/ / | |/| |
* | | | Merge pull request #788 from bunnei/shader-check-zerobunnei2018-07-241-0/+6
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.
| * | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.bunnei2018-07-241-0/+6
| |/ / /
* | / / VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-245-37/+75
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Regression and Mode Fixes * Review Fixes * string_view correction * Add operator& for FileSys::Mode * Return std::string from SanitizePath * Farming Simulator Fix * Use != With mode operator&
* | | Merge pull request #787 from bunnei/tldsbunnei2018-07-241-29/+43
|\ \ \ | | | | | | | | gl_shader_decompiler: Implement shader instruction TLDS.
| * | | gl_shader_decompiler: Implement shader instruction TLDS.bunnei2018-07-241-29/+43
| | | |
* | | | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \ \ \ | | | | | | | | | | exclusive_monitor: Use consistent type alias for u64
| * | | | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| | |_|/ | |/| | | | | | | | | | | | | | Uses the same type aliases we use for virtual addresses, and converts one lingering usage of std::array<uint64_t, 2> to u128 for consistency.
* | | | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \ \ \ | | | | | | | | | | loader: Minor cleanup
| * | | | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/ / / | | | | | | | | | | | | | | | | | | | | RealVfsFile inherits from VfsFile, the instance from std::make_shared is already compatible with the function argument type, making the copy constructor call unnecessary.
* | | | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \ \ \ | | | | | | | | | | linker: Remove unused parameter from WriteRelocations()
| * | | | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/ / / | | | | | | | | | | | | | | | | is_jump_relocation is never used within the function, so we can just remove it.
* | | | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \ \ \ | |_|/ / |/| | | loader/nro: Minor changes
| * | | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| | | | | | | | | | | | | | | | | | | | It's sufficient to use a forward declaration instead of a direct inclusion here.
| * | | nro: Make bracing consistentLioncash2018-07-231-10/+24
| | | | | | | | | | | | | | | | | | | | Makes the code more uniform, and also braces cases where the body of an unbraced conditional travels more than one line.
| * | | nro: Make constructor explicitLioncash2018-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | Makes it consistent with the other Apploader constructors, and prevents implicit conversions.
| * | | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/ / | | | | | | | | | This isn't used anywhere in the header.
* | | Merge pull request #781 from lioncash/declbunnei2018-07-241-5/+5
|\ \ \ | | | | | | | | gl_shader_decompiler: Simplify GetCommonDeclarations()
| * | | gl_shader_decompiler: Simplify GetCommonDeclarations()Lioncash2018-07-231-5/+5
| | |/ | |/|
* | | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \ \ | | | | | | | | vi: Minor changes
| * | | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | It's undefined behavior to memcpy an object that isn't considered trivially copyable, so put a compile-time check in to make sure this doesn't occur.
| * | | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| |/ / | | | | | | | | | | | | | | | | | | Allows avoiding unnecessary copies of the vector depending on the calling code. While we're at it, remove a redundant no-parameter base constructor call
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| | hle: Remove unused config_mem and shared_page source files
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| | | | | | | | | | | | | | | This is just an unused hold-over from citra, so we can get rid of this to trim off an exposed global, among other things.
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/ | | | | | | This is a holdover from citra that's essentially unused.
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \ | | | | | | NRO Assets and NACP File Format
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
| | | | | | | | | | | | | | | | | | Cleanup Review fixes
* | | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
| |/ |/| | | | | Forgot to include this in 22f448b6327044076959e338811ee576f3dcf093
* | Merge pull request #775 from lioncash/strbunnei2018-07-232-30/+32
|\ \ | | | | | | string_util: Minor changes
| * | string_util: Get rid of separate resize() in CPToUTF16(), UTF16ToUTF8(), CodeToUTF8() and UTF8ToUTF16()Lioncash2018-07-221-20/+22
| | | | | | | | | | | | | | | | | | | | | | | | There's no need to perform the resize separately here, since the constructor allows presizing the buffer. Also move the empty string check before the construction of the string to make the early out more straightforward.
| * | string_util: Use emplace_back() in SplitString() instead of push_back()Lioncash2018-07-221-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is equivalent to doing: push_back(std::string("")); which is likely not to cause issues, assuming a decent std::string implementation with small-string optimizations implemented in its design, however it's still a little unnecessary to copy that buffer regardless. Instead, we can use emplace_back() to directly construct the empty string within the std::vector instance, eliminating any possible overhead from the copy.
| * | string_util: Remove unnecessary std::string instance in TabsToSpaces()Lioncash2018-07-222-8/+7
| | | | | | | | | | | | | | | | | | We can just use the variant of std::string's replace() function that can replace an occurrence with N copies of the same character, eliminating the need to allocate a std::string containing a buffer of spaces.
* | | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ \ | |_|/ |/| | set: Amend return value of GetAvailableLanguageCodes()
| * | set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| | | | | | | | | | | | This just returns the size of the language code buffer.
| * | set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| |/ | | | | | | The return code should be 32-bit in size.
* | Merge pull request #769 from bunnei/shader-mask-fixesbunnei2018-07-231-5/+9
|\ \ | | | | | | shader_bytecode: Implement other TEXS masks.
| * | shader_bytecode: Implement other TEXS masks.bunnei2018-07-221-5/+9
| | |
* | | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ \ | |_|/ |/| | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.
| * | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
| | |
* | | Merge pull request #773 from Subv/gl_ext_checkbunnei2018-07-222-2/+24
|\ \ \ | | | | | | | | Frontend: Check for more required OpenGL extensions during startup.
| * | | Frontend: Check for more required OpenGL extensions during startup.Subv2018-07-222-2/+24
| |/ /
* | | Merge pull request #768 from lioncash/string-viewbunnei2018-07-2210-133/+213
|\ \ \ | | | | | | | | file_util, vfs: Use std::string_view where applicable
| * | | vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ReplaceFileWithSubdirectory() takes a VirtualFile and a VirtualDir, but it was being passed a string as one of its arguments. The only reason this never caused issues is because this template isn't instantiated anywhere yet. This corrects an issue before it occurs.
| * | | file_util, vfs: Use std::string_view where applicableLioncash2018-07-2210-131/+208
| | | | | | | | | | | | | | | | | | | | Avoids unnecessary construction of std::string instances where applicable.
* | | | Merge pull request #770 from lioncash/constructbunnei2018-07-221-4/+8
|\ \ \ \ | |_|/ / |/| | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()
| * | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()Lioncash2018-07-221-4/+8
| | |/ | |/| | | | | | | | | | | | | We don't need to toss away the Subroutine instance after the find() call and reconstruct another instance with the same data right after it. Particularly give Subroutine contains a std::set.
* / | Implement exclusive monitorMerryMage2018-07-229-13/+160
|/ /
* | Merge pull request #765 from lioncash/filebunnei2018-07-221-24/+14
|\ \ | | | | | | file_util: Remove goto usages from Copy()
| * | file_util: Remove goto usages from Copy()Lioncash2018-07-221-24/+14
| | | | | | | | | | | | | | | | | | We can just leverage std::unique_ptr to automatically close these for us in error cases instead of jumping to the end of the function to call fclose on them.
* | | Merge pull request #767 from bunnei/shader-cleanupbunnei2018-07-221-78/+15
|\ \ \ | | | | | | | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.
| * | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.bunnei2018-07-221-78/+15
| | | |
* | | | Merge pull request #766 from bunnei/shader-selbunnei2018-07-222-0/+20
|\ \ \ \ | |_|_|/ |/| | | gl_shader_decompiler: Implement SEL instruction.
| * | | gl_shader_decompiler: Implement SEL instruction.bunnei2018-07-222-0/+20
| |/ /
* | | Merge pull request #764 from lioncash/movebunnei2018-07-225-19/+19
|\ \ \ | |/ / |/| | file_util: Minor changes to ScanDirectoryTree() and ForeachDirectoryEntry()
| * | file_util: Use a u64 to represent number of entriesLioncash2018-07-225-18/+18
| | | | | | | | | | | | | | | This avoids a truncating cast on size. I doubt we'd ever traverse a directory this large, however we also shouldn't truncate sizes away.
| * | file_util: std::move FST entries in ScanDirectoryTree()Lioncash2018-07-221-1/+1
| |/ | | | | | | Avoids unnecessary copies when building up the FST entries.
* | gl_rasterizer_cache: Blit surfaces on recreation instead of flush and load.bunnei2018-07-222-2/+86
| |
* | gl_rasterizer_cache: Use GPUVAddr as cache key, not parameter set.bunnei2018-07-223-57/+46
| |
* | gl_rasterizer_cache: Use zeta_width and zeta_height registers for depth buffer.bunnei2018-07-222-11/+11
| |
* | gl_rasterizer: Use zeta_enable register to enable depth buffer.bunnei2018-07-221-2/+2
| |
* | maxwell_3d: Add depth buffer enable, width, and height registers.bunnei2018-07-221-2/+14
|/
* Merge pull request #759 from lioncash/redundantbunnei2018-07-221-2/+1
|\ | | | | file_util: Remove redundant duplicate return in GetPathWithoutTop()
| * file_util: Remove explicit type from std::min() in GetPathWithoutTop()Lioncash2018-07-211-1/+1
| | | | | | | | | | Given both operands are the same type, there won't be an issue with overload selection that requires making this explicit.
| * file_util: Remove redundant duplicate return in GetPathWithoutTop()Lioncash2018-07-211-1/+0
| |
* | Merge pull request #748 from lioncash/namespacebunnei2018-07-2211-48/+24
|\ \ | | | | | | video_core: Use nested namespaces where applicable
| * | video_core: Use nested namespaces where applicableLioncash2018-07-2111-48/+24
| | | | | | | | | | | | Compresses a few namespace specifiers to be more compact.
* | | Merge pull request #758 from lioncash/syncbunnei2018-07-222-86/+0
|\ \ \ | | | | | | | | common: Remove synchronized_wrapper.h
| * | | common: Remove synchronized_wrapper.hLioncash2018-07-212-86/+0
| | | | | | | | | | | | | | | | This is entirely unused in the codebase.
* | | | Merge pull request #760 from lioncash/pathbunnei2018-07-2211-73/+85
|\ \ \ \ | | | | | | | | | | file_util: Use an enum class for GetUserPath()
| * | | | file_util: Use an enum class for GetUserPath()Lioncash2018-07-2111-73/+85
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of using an unsigned int as a parameter and expecting a user to always pass in the correct values, we can just convert the enum into an enum class and use that type as the parameter type instead, which makes the interface more type safe. We also get rid of the bookkeeping "NUM_" element in the enum by just using an unordered map. This function is generally low-frequency in terms of calls (and I'd hope so, considering otherwise would mean we're slamming the disk with IO all the time) so I'd consider this acceptable in this case.
* / | | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ / / | | | | | | | | | | | | This behaves quite similarly to the SubmitGPFIFO command. Referenced from Ryujinx. Many thanks to @gdkchan for investigating this!
* | | Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\ \ \ | | | | | | | | partition_filesystem, vfs_real: Minor changes
| * | | vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| | | | | | | | | | | | | | | | | | | | We already return by value, so we don't explicitly need to make the copy.
| * | | partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| | | |
| * | | partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| | | | | | | | | | | | | | | | Avoids unnecessary atomic increment and decrement operations.
| * | | partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
| | | | | | | | | | | | | | | | This is a little bit more self-documenting on what is being done here.
* | | | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \ \ \ | |_|/ / |/| | | arm_interface: Remove unused tls_address member of ThreadContext
| * | | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
| | | | | | | | | | | | | | | | | | | | Currently, the TLS address is set within the scheduler, making this member unused.
* | | | Merge pull request #746 from lioncash/testsbunnei2018-07-212-4/+12
|\ \ \ \ | | | | | | | | | | tests/arm_test_common: Minor changes
| * | | | arm_test_common: Get rid of truncation warningsLioncash2018-07-201-2/+5
| | | | | | | | | | | | | | | | | | | | Explicitly cast the value to a u8 to show that this is intentional.
| * | | | arm_test_common: Make file static variable a member variable of the testing environmentLioncash2018-07-202-2/+5
| | | | | | | | | | | | | | | | | | | | Gets rid of file-static behavior.
| * | | | arm_test_common: Add missing header guardLioncash2018-07-201-0/+2
| | |_|/ | |/| |
* | | | Merge pull request #747 from lioncash/unimplementedbunnei2018-07-212-3/+3
|\ \ \ \ | | | | | | | | | | gl_shader_manager: Remove unimplemented function prototype
| * | | | gl_shader_manager: Replace unimplemented function prototypeLioncash2018-07-212-3/+3
| |/ / / | | | | | | | | | | | | This was just a linker error waiting to happen.
* | | | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \ \ \ | | | | | | | | | | file_sys/errors: Remove redundant object constructor calls
| * | | | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| | |_|/ | |/| | | | | | | | | | | | | | Given we're already constructing the error code, we don't need to call the constructor inside of it.
* | | | Merge pull request #749 from lioncash/consistencybunnei2018-07-214-14/+17
|\ \ \ \ | | | | | | | | | | gpu: Rename Get3DEngine() to Maxwell3D()
| * | | | gpu: Rename Get3DEngine() to Maxwell3D()Lioncash2018-07-214-14/+17
| | |_|/ | |/| | | | | | | | | | This makes it match its const qualified equivalent.
* | | | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \ \ \ | | | | | | | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch
| * | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
| | | | | | | | | | | | | | | | | | | | Note that there's currently a dynarmic bug preventing this register from being written.
* | | | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \ \ \ | | | | | | | | | | | | vfs: Minor changes
| * | | | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can simply use std::clamp() here, instead of using an equivalent with std::max() and std::min().
| * | | | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the data is intended to be directly written, there's no need to take the std::vector by value and copy the data.
| * | | | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| | | | | | | | | | | | | | | | | | | | | | | | Provides the same behavior, but with less writing
| * | | | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | These functions don't modify the data being pointed to, so these can be pointers to const data
* | | | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ \ \ | |/ / / / |/| | | | Loader: Only print the module names and addresses if they actually exist.
| * | | | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/ / /
* | | | Merge pull request #743 from lioncash/viewbunnei2018-07-214-57/+56
|\ \ \ \ | | | | | | | | | | logging: Use std::string_view where applicable
| * | | | logging/filter: Use std::string_view in ParseFilterString()Lioncash2018-07-202-41/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows avoiding constructing std::string instances, since this only reads an arbitrary sequence of characters. We can also make ParseFilterRule() internal, since it doesn't depend on any private instance state of Filter
| * | | | logging/backend: Add missing standard includesLioncash2018-07-202-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | A few inclusions were being satisfied indirectly. To prevent breakages in the future, include these directly.
| * | | | logging/backend: Use std::string_view in RemoveBackend() and GetBackend()Lioncash2018-07-202-12/+13
| | |_|/ | |/| | | | | | | | | | | | | | | | | | These can just use a view to a string since its only comparing against two names in both cases for matches. This avoids constructing std::string instances where they aren't necessary.
* | | | Merge pull request #745 from lioncash/packagebunnei2018-07-212-9/+12
|\ \ \ \ | |_|_|/ |/| | | param_package: Minor changes
| * | | param_package: Take std::string by value in string-based Set() functionLioncash2018-07-202-4/+6
| | | | | | | | | | | | | | | | | | | | Allows avoiding string copies by letting the strings be moved into the function calls.
| * | | param_package: Use std::unordered_map's insert_or_assign instead of map indexingLioncash2018-07-201-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This avoids a redundant std::string construction if a key doesn't exist in the map already. e.g. data[key] requires constructing a new default instance of the value in the map (but this is wasteful, since we're already setting something into the map over top of it).
| * | | param_package: Get rid of file-static std::string constructionLioncash2018-07-201-3/+4
| |/ / | | | | | | | | | Avoids potential dynamic allocation occuring during program launch
* | | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \ \ | | | | | | | | apm: Improve stub for GetPerformanceConfiguration.
| * | | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
| |/ /
* / / ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows pushing strongly-typed enum members without the need to always cast them at the call sites. Note that we *only* allow strongly-typed enums in this case. The reason for this is that strongly typed enums have a guaranteed defined size, so the size of the data being pushed is always deterministic. With regular enums this can be a little more error-prone, so we disallow them. This function simply uses the underlying type of the enum to determine the size of the data. For example, if an enum is defined as: enum class SomeEnum : u16 { SomeEntry }; if PushEnum(SomeEnum::SomeEntry); is called, then it will push a u16-size amount of data.
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \ | | | | | | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/ | | | | | | | | | | And make IManagerForApplication::CheckAvailability always return false. Returning a bogus id from GetAccountId causes games to crash on boot. We should investigate this with a hwtest and either stub it properly or implement it.
* | Merge pull request #738 from lioncash/signbunnei2018-07-201-16/+20
|\ \ | | | | | | gl_state: Get rid of mismatched sign conversions in Apply()
| * | gl_state: Make references const where applicable in Apply()Lioncash2018-07-201-2/+3
| | |
| * | gl_state: Get rid of mismatched sign conversionsLioncash2018-07-201-14/+17
| | | | | | | | | | | | | | | While we're at it, amend the loop variable type to be the same width as that returned by the .size() call.
* | | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \ \ | | | | | | | | filesys/loader: std::move VirtualFile instances in constructors where applicable
| * | | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| | | | | | | | | | | | | | | | This avoids unnecessary atomic reference count increments and decrements
| * | | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
| |/ / | | | | | | | | | | | | Avoids potentially unnecessary atomic reference count incrementing and decrementing, as well as string copying.
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \ | | | | | | | | audout_u/audren_u: Ensure null terminators are written out in ListAudioOutsImpl(), ListAudioDeviceName(), and GetActiveAudioDeviceName()
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| | | | | | | | | | | | | | | | | | | | std::string doesn't include the null-terminator in its data() + size() range. This ensures that the null-terminator will also be written to the buffer
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ / | | | | | | | | | | | | | | | Uses a type that doesn't potentially dynamically allocate, and ensures that the name of the interface is properly null-terminated when writing it to the buffer.
* | | Merge pull request #735 from lioncash/video-unusedbunnei2018-07-201-2/+0
|\ \ \ | | | | | | | | maxwell_3d: Remove unused variable within GetStageTextures()
| * | | maxwell_3d: Remove unused variable within GetStageTextures()Lioncash2018-07-201-2/+0
| |/ /
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-2010-93/+92
|\ \ \ | | | | | | | | thread: Convert ThreadStatus into an enum class
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-2010-93/+92
| |/ / | | | | | | | | | | | | Makes the thread status strongly typed, so implicit conversions can't happen. It also makes it easier to catch mistakes at compile time.
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ / | | | | | | | | | | | | This should be returned here, otherwise pfs_dirs is effectively only ever added to, but never read.
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \ | | | | | | | | nso: Minor changes
| * | | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| | | |
| * | | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/ /
* | | Merge pull request #731 from lioncash/shadowbunnei2018-07-201-6/+4
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Eliminate variable and declaration shadowing
| * | gl_shader_decompiler: Eliminate variable and declaration shadowingLioncash2018-07-201-6/+4
| |/ | | | | | | | | Ensures that no identifiers are being hidden, which also reduces compiler warnings.
* | Merge pull request #730 from lioncash/stringbunnei2018-07-201-2/+2
|\ \ | | | | | | gl_shader_decompiler: Remove unnecessary const from return values
| * | gl_shader_decompiler: Remove unnecessary const from return valuesLioncash2018-07-201-2/+2
| |/ | | | | | | | | This adds nothing from a behavioral point of view, and can inhibit the move constructor/RVO
* / pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/ | | | With the new overload, we can simply pass the container directly.
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\ | | | | hle_ipc: Introduce generic WriteBuffer overload for multiple container types
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This introduces a slightly more generic variant of WriteBuffer(). Notably, this variant doesn't constrain the arguments to only accepting std::vector instances. It accepts whatever adheres to the ContiguousContainer concept in the C++ standard library. This essentially means, std::array, std::string, and std::vector can be used directly with this interface. The interface no longer forces you to solely use containers that dynamically allocate. To ensure our overloads play nice with one another, we only enable the container-based WriteBuffer if the argument is not a pointer, otherwise we fall back to the pointer-based one.
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \ | | | | | | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/ | | | | | | | | This WriteBuffer overload expects its size argument to be in bytes, not elements.
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \ | | | | | | HLE/ACC: Change the default user id and small improvements to the way we handle profiles
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| | | | | | | | | | | | | | | The default username for now is "yuzu". We should eventually allow the creation of users in the emulator and have the ability to modify their parameters.
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
| | | | | | | | | | | | In IApplicationFunctions::PopLaunchParameter we tell the games that they were launched as user id 1.
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \ | | | | | | | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ / | | | | | | | | | We only emulate a single user id for now.
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/| | | | | | | This can just use the fmt specifiers and be type-agnostic.
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \ | | | | | | | | gdbstub: Get rid of a few signed/unsigned comparisons
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
| | | | | | | | | | | | | | | | Ensures both operands in comparisons are the same signedness.
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \ | | | | | | | | | | hid: Resolve a signed/unsigned comparison warning
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Modernizes the loops themselves while also getting rid of a signed/unsigned comparison in a loop condition.
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / / | | | | | | | | | | | | Gets rid of the use of a magic constant
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \ | | | | | | | | | | svc: Correct always true assertion case in SetThreadCoreMask
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The reason this would never be true is that ideal_processor is a u8 and THREADPROCESSORID_DEFAULT is an s32. In this case, it boils down to how arithmetic conversions are performed before performing the comparison. If an unsigned value has a lesser conversion rank (aka smaller size) than the signed type being compared, then the unsigned value is promoted to the signed value (i.e. u8 -> s32 happens before the comparison). No sign-extension occurs here either. An alternative phrasing: Say we have a variable named core and it's given a value of -2. u8 core = -2; This becomes 254 due to the lack of sign. During integral promotion to the signed type, this still remains as 254, and therefore the condition will always be true, because no matter what value the u8 is given it will never be -2 in terms of 32 bits. Now, if one type was a s32 and one was a u32, this would be entirely different, since they have the same bit width (and the signed type would be converted to unsigned instead of the other way around) but would still have its representation preserved in terms of bits, allowing the comparison to be false in some cases, as opposed to being true all the time. --- We also get rid of two signed/unsigned comparison warnings while we're at it.
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \ | | | | | | | | | | | | loader: Amend Doxygen comments
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / / | | | | | | | | | | | | | | | These weren't adjusted when VFS was introduced
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \ | | | | | | | | | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic value
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We should always assume the filesystem is volatile and check each IO operation. While we're at it reorganize checks so that early-out errors are near one another.
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle/service: Make constructors explicit where applicable
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit construction and makes these lingering non-explicit constructors consistent with the rest of the other classes in services.
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvflinger: Emplace Display instances directly
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use emplace_back to construct the Display instances directly, instead of constructing them separately and copying them, avoiding the need to copy std::string and std::vector instances that are part of the Display struct.
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | nvdrv: Take std::string by const reference in GetDevice()
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | This is only ever used as a lookup into the device map, so we don't need to take the std::string instance by value here.
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | Filesystem: Return EntryType::Directory for the root directory.
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
| | | | | | | | | | | | | | | | | | | | It is unknown if this is correct behavior, but it makes sense and fixes a regression with Stardew Valley.
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \ | | | | | | | | | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloads
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the buffer_index parameter was unused, causing all writes to use the buffer index of zero, which is not necessarily what is wanted all the time. Thankfully, all current usages don't use a buffer index other than zero, so this just prevents a bug before it has a chance to spring.
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | fsp_srv: Misc individual changes
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can avoid constructing a std::vector here by simply passing a pointer to the original data and the size of the copy we wish to perform to the backend's Write() function instead, avoiding copying the data where it's otherwise not needed.
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were using a second std::vector as a buffer to convert another std::vector's data into a byte sequence, however we can just use pointers to the original data and use them directly with WriteBuffer, which avoids copying the data at all into a separate std::vector. We simply cast the pointers to u8* (which is allowed by the standard, given std::uint8_t is an alias for unsigned char on platforms that we support).
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | Gets rid of relying on indirect inclusions.
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| | | | | |
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were just copying the data whole-sale, even if the length was less than the total data size. This effectively makes the actual_data vector useless, which is likely not intended. Instead, amend this to only copy the given length amount of data. At the same time, we can avoid zeroing out the data before using it by passing iterators to the constructor instead of a size.
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \ | | | | | | | | | | | | filesystem: Minor changes
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary atomic reference count incrementing and decrementing
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is simply a basic value check as opposed to potentially doing string based operations (unlikely, but still, avoiding it is free).
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / / | | | | | | | | | | | | | | | This was just an artifact missed during PR review.
* | | | | Merge pull request #711 from lioncash/swapbunnei2018-07-191-50/+50
|\ \ \ \ \ | | | | | | | | | | | | common/swap: Minor changes
| * | | | | common/swap: Remove unnecessary const on return value of swap()Lioncash2018-07-191-1/+1
| | | | | |
| * | | | | common/swap: Use static_cast where applicableLioncash2018-07-191-16/+16
| | | | | |
| * | | | | common/swap: Use using aliases where applicableLioncash2018-07-191-33/+33
| |/ / / /
* | | | | Merge pull request #710 from lioncash/unusedbunnei2018-07-191-38/+0
|\ \ \ \ \ | | | | | | | | | | | | common/common_funcs: Remove unused rotation functions
| * | | | | common/common_funcs: Remove unused rotation functionsLioncash2018-07-191-38/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are unused and essentially don't provide much benefit either. If we ever need rotation functions, these can be introduced in a way that they don't sit in a common_* header and require a bunch of ifdefing to simply be available
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | loader/{nro, nso}: Resolve compilation warnings
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| | | | |
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| | | | | | | | | | | | | | | | | | | | We can just initialize these vectors directly via their constructor.
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| | | | |
* | | | | Merge pull request #709 from lioncash/thread-localbunnei2018-07-192-12/+8
|\ \ \ \ \ | | | | | | | | | | | | common/misc: Deduplicate code in GetLastErrorMsg()
| * | | | | common/misc: Deduplicate code in GetLastErrorMsg()Lioncash2018-07-192-12/+8
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Android and macOS have supported thread_local for quite a while, but most importantly is that we don't even really need it. Instead of using a thread-local buffer, we can just return a non-static buffer as a std::string, avoiding the need for that quality entirely.
* | | | | Merge pull request #705 from lioncash/string-refbunnei2018-07-192-2/+2
|\ \ \ \ \ | | | | | | | | | | | | file_util: return string by const reference for GetExeDirectory()
| * | | | | file_util: return string by const reference for GetExeDirectory()Lioncash2018-07-192-2/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | This disallows modifying the internal string buffer (which shouldn't be modified anyhow).
* | | | | Merge pull request #704 from lioncash/stringbunnei2018-07-192-15/+0
|\ \ \ \ \ | | | | | | | | | | | | string_util: Remove AsciiToHex()
| * | | | | string_util: Remove AsciiToHex()Lioncash2018-07-192-15/+0
| | | | | | | | | | | | | | | | | | | | | | | | Easy TODO
* | | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member function
| * | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | This function doesn't alter class state.
* | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initialized
| * | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously is_hfs and pfs_header members wouldn't be initialized in the constructor, as they were stored in locals instead. This would result in things like GetName() and PrintDebugInfo() behaving incorrectly. While we're at it, initialize the members to deterministic values as well, in case loading ever fails.
* | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ | |_|_|_|/ |/| | | | content_archive: Minor changes
| * | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | There's no need to take this by value when it's possible to avoid unnecessary copies entirely like this.
| * | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| | | | |
| * | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / / | | | | | | | | | | | | | | | | Gets rid of unnecessary atomic reference count incrementing and decrementing.
* | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \ | | | | | | | | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()
| * | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ / / | | | | | | | | | | | | We can just use a generic lambda to avoid writing the same thing twice.
* | | | Merge pull request #697 from bunnei/disable-depth-cullbunnei2018-07-191-1/+3
|\ \ \ \ | |_|/ / |/| | | gl_state: Temporarily disable culling and depth test.
| * | | gl_state: Temporarily disable culling and depth test.bunnei2018-07-191-1/+3
| | |/ | |/|
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \ | | | | | | | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This was introduced within 4f81bc4e1bd12e4df7410c6790ba818d8dbba9c0, and considering there's no comment indicating that this is intentional, this is very likely a bug.
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|_|/ |/| | | core/memory, core/hle/kernel: Use std::move where applicable
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
| | | | | | | | | | | | | | | | Avoids pointless copies
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \ | | | | | | | | | | service/prepo: Add missing header guard
| * | | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ / | |/| |
* | | | Merge pull request #686 from lioncash/fmtbunnei2018-07-191-1/+1
|\ \ \ \ | |_|_|/ |/| | | externals: update fmt to version 5.1.0
| * | | externals: update fmt to version 5.1.0Lioncash2018-07-181-1/+1
| | |/ | |/| | | | | | | Previously, we were on 4.1.0, which was a major version behind.
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \ | | | | | | | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| |/ / | | | | | | | | | | | | Without these, this would perform concatenation, which is definitely not what we want here.
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \ | | | | | | | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-196-22/+26
|\ \ \ | | | | | | | | core: Don't construct instance of Core::System, just to access its live instance
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | This makes it a compilation error to construct additional instances of the System class directly, preventing accidental wasteful constructions over and over.
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-195-22/+22
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | This would result in a lot of allocations and related object construction, just to toss it all away immediately after the call. These are definitely not intentional, and it was intended that all of these should have been accessing the static function GetInstance() through the name itself, not constructed instances.
* | | Merge pull request #680 from bunnei/fix-swizzbunnei2018-07-191-1/+4
|\ \ \ | | | | | | | | decoders: Fix calc of swizzle image_width_in_gobs.
| * | | decoders: Fix calc of swizzle image_width_in_gobs.bunnei2018-07-191-1/+4
| | | |
* | | | Merge pull request #684 from lioncash/nonmemberbunnei2018-07-192-2/+1
|\ \ \ \ | |/ / / |/| | | game_list: Make ContainsAllWords an internally linked non-member function
| * | | game_list: Make ContainsAllWords an internally linked non-member functionLioncash2018-07-182-2/+1
| |/ / | | | | | | | | | | | | This function actually depends on no internal class state, so it doesn't even need to be a part of the class interface.
* | / Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1954-1959/+1926
| |/ |/| | | | | | | | | | | | | | | | | * Virtual Filesystem * Fix delete bug and documentate * Review fixes + other stuff * Fix puyo regression
* | Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
| |
* | Single touch supportZach Hilman2018-07-181-4/+19
|/
* Merge pull request #681 from lioncash/constbunnei2018-07-182-5/+7
|\ | | | | game_list: Make containsAllWords a const member function
| * game_list: Upper-case containsAllWords to ContainsAllWords()Lioncash2018-07-182-3/+3
| | | | | | | | | | This makes it consistent with most of the other private utility functions.
| * game_list: Make containsAllWords a const member functionLioncash2018-07-182-4/+6
| | | | | | | | | | | | This doesn't actually modify the internal class state, so it can be a const member function. While we're at it, amend the function to take its arguments by const reference.
* | Merge pull request #682 from lioncash/telemetrybunnei2018-07-181-20/+7
|\ \ | | | | | | Telemetry: Minor changes
| * | telemetry: Remove unnecessary Field constructorLioncash2018-07-181-4/+1
| | | | | | | | | | | | | | | We can just take the value parameter by value which allows both moving into it, and copies at the same time, depending on the calling code.
| * | telemetry: Make operator== and operator!= const member functions of FieldLioncash2018-07-181-2/+2
| | | | | | | | | | | | | | | | | | | | | These operators don't modify internal class state, so they can be made const member functions. While we're at it, drop the unnecessary inline keywords. Member functions that are defined in the class declaration are already inline by default.
| * | telemetry: Default copy/move constructors and assignment operatorsLioncash2018-07-181-14/+4
| |/ | | | | | | | | | | This provides the equivalent behavior, but without as much boilerplate. While we're at it, explicitly default the move constructor, since we have a move-assignment operator defined.
* | Merge pull request #679 from lioncash/ctorbunnei2018-07-181-4/+1
|\ \ | | | | | | game_list: Remove unnecessary QString initialization in KeyReleaseEater
| * | game_list: Remove unnecessary QString initialization in KeyReleaseEaterLioncash2018-07-181-4/+1
| |/ | | | | | | | | | | QString initializes to an empty string by default, so this does nothing meaningful. While we're at it, use a constructor initializer list for initializing the gamelist member variable.
* | Merge pull request #678 from lioncash/astcbunnei2018-07-181-78/+60
|\ \ | | | | | | astc: Minor changes
| * | astc: Initialize vector size directly in DecompressLioncash2018-07-181-2/+1
| | | | | | | | | | | | There's no need to perform a separate resize.
| * | astc: Mark functions as internally linked where applicableLioncash2018-07-181-17/+20
| | |
| * | astc: const-correctness changes where applicableLioncash2018-07-181-14/+13
| | | | | | | | | | | | | | | A few member functions didn't actually modify class state, so these can be amended as necessary.
| * | astc: Delete Bits' copy contstructor and assignment operatorLioncash2018-07-181-8/+6
| | | | | | | | | | | | | | | This also potentially avoids warnings, considering the copy assignment operator is supposed to have a return value.
| * | astc: In-class initialize member variables where appropriateLioncash2018-07-181-39/+22
| |/
* | settings: Turn docked mode off by default.bunnei2018-07-183-3/+3
| |
* | vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
| |
* | vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
| |
* | vi: Partially implement buffer crop parameters.bunnei2018-07-189-14/+46
|/
* Merge pull request #675 from Subv/stencilbunnei2018-07-181-2/+25
|\ | | | | GPU: Added register definitions for the stencil parameters.
| * GPU: Added register definitions for the stencil parameters.Subv2018-07-171-2/+25
| |
* | General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
| |
* | Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\ \ | | | | | | scheduler: Clear exclusive state when switching contexts
| * | scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
| | |
* | | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \ \ | |_|/ |/| | svc:: Fix bug in svcWaitForAddress
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* / nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* Merge pull request #668 from jroweboy/controller-lagbunnei2018-07-151-3/+3
|\ | | | | HID: Update controllers less often
| * HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
| |
* | Merge pull request #664 from jroweboy/logging-stuffbunnei2018-07-153-4/+17
|\ \ | |/ |/| Minor logging improvements
| * Logging: Dump all logs in the queue on close in debug modeJames Rowe2018-07-153-1/+12
| |
| * Logging: Don't lock the queue for the duration of the writeJames Rowe2018-07-141-3/+5
| |
* | gl_rasterizer_cache: Implement texture format G8R8.bunnei2018-07-153-9/+40
| |
* | Merge pull request #665 from bunnei/fix-z24-s8bunnei2018-07-151-1/+2
|\ \ | | | | | | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.
| * | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.bunnei2018-07-151-1/+2
| | |
* | | gl_rasterizer_cache: Implement depth format Z16_UNORM.bunnei2018-07-153-1/+15
|/ /
* | Merge pull request #598 from bunnei/makedonecurrentbunnei2018-07-156-2/+39
|\ \ | | | | | | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.
| * | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.bunnei2018-07-146-2/+39
| | |
* | | Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\ \ \ | | | | | | | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC
| * | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
| | | |
* | | | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \ \ \ | | | | | | | | | | FileSys: Append the requested path to the filesystem base path in DeleteFile
| * | | | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/ / / | | | | | | | | | | | | We were trying to delete things in the current directory instead of the actual filesystem directory. This may fix some savedata issues in some games.
* / / / No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/ / /
* / / GPU: Always enable the depth write when clearing the depth buffer.Subv2018-07-141-3/+8
|/ / | | | | | | The GPU ignores that register when clearing, but OpenGL obeys the glDepthMask parameter, so we set the depth mask to GL_TRUE when clearing the depth buffer. It will be restored to the correct value automatically on the next draw call.
* | Merge pull request #657 from bunnei/dual-vsbunnei2018-07-137-89/+149
|\ \ | | | | | | gl_shader_gen: Implement dual vertex shader mode.
| * | gl_rasterizer: Fix check for if a shader stage is enabled.bunnei2018-07-133-35/+11
| | |
| * | gl_shader_gen: Implement dual vertex shader mode.bunnei2018-07-135-55/+139
| | | | | | | | | | | | - When VertexA shader stage is enabled, we combine with VertexB program to make a single Vertex Shader stage.
* | | More improvements to GDBStub (#653)Hedges2018-07-138-50/+173
|/ / | | | | | | | | | | | | | | | | | | | | * More improvements to GDBStub - Debugging of threads should work correctly with source and assembly level stepping and modifying registers and memory, meaning threads and callstacks are fully clickable in VS. - List of modules is available to the client, with assumption that .nro and .nso are backed up by an .elf with symbols, while deconstructed ROMs keep N names. - Initial support for floating point registers. * Tidy up as requested in PR feedback * Tidy up as requested in PR feedback
* | Merge pull request #656 from ogniK5377/audren-mem-initbunnei2018-07-131-3/+3
|\ \ | | | | | | Initialized memory for RequestUpdateAudioRenderer and fixed MemoryPoolSection to be more accurate
| * | We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
| | |
| * | initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
| | |
* | | Merge pull request #655 from bunnei/pred-lt-nanbunnei2018-07-132-5/+7
|\ \ \ | | | | | | | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.
| * | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.bunnei2018-07-132-5/+7
| |/ /
* / / gl_shader_decompiler: Use FlowCondition field in EXIT instruction.bunnei2018-07-132-8/+34
|/ /
* | Merge pull request #652 from Subv/fadd32iSebastian Valle2018-07-132-0/+32
|\ \ | | | | | | GPU: Implement the FADD32I shader instruction.
| * | GPU: Implement the FADD32I shader instruction.Subv2018-07-122-0/+32
| | |
* | | Merge pull request #651 from Subv/ffma_decodebunnei2018-07-121-1/+1
|\ \ \ | | | | | | | | GPU: Corrected the decoding of FFMA for immediate operands.
| * | | GPU: Corrected the decoding of FFMA for immediate operands.Subv2018-07-121-1/+1
| |/ /
* | | Port #3335 and #3373 from Citra: "Small SDL fixes" and "Print the actual error preventing SDL from working" (#637)Tobias2018-07-122-6/+4
| | | | | | | | | | | | | | | | | | * Port #3335 and #3373 from Citra * Fixup: Use the new logging placeholders
* | | Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ \ \ | | | | | | | | Let games/application know that we're offline
| * | | Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
| | | | | | | | | | | | | | | | Since we have no socket implementation we should be returning 0 to indicate we're currently offline.
* | | | Merge pull request #649 from ogniK5377/audout-autobunnei2018-07-122-14/+14
|\ \ \ \ | |_|_|/ |/| | | Audout "Auto" functions
| * | | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
| |/ / | | | | | | | | | Audout autos are identical to their counterpart except for the buffer type which yuzu already handles for us.
* | | yuzu - Fix duplicate logsJames Rowe2018-07-122-2/+7
| | |
* | | yuzu-cmd Apply the filter string from settingsJames Rowe2018-07-121-2/+1
|/ /
* | Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\ \ | | | | | | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.
| * | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
| | |
* | | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
| | | | | | | | | | | | - This fixes user input in SMO.
* | | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \ \ | | | | | | | | NvOsGetConfigU32 production impl
| * | | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
| | | | | | | | | | | | | | | | | | | | Settings are only used when RMOS_SET_PRODUCTION_MODE is set to 0. If production mode is set, the error code 0x30006 is returned instead
* | | | Merge pull request #633 from FearlessTobi/port-definesbunnei2018-07-103-7/+7
|\ \ \ \ | | | | | | | | | | Port #3579 from Citra: Clean up architecture-specific defines
| * | | | Port #3579 from CitrafearlessTobi2018-07-073-7/+7
| | |_|/ | |/| |
* | | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ \ | |_|/ / |/| | | savedata_factory: Always create a save directory for games.
| * | | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
| | | |
* | | | Merge pull request #635 from FearlessTobi/port-crashfixbunnei2018-07-101-1/+1
|\ \ \ \ | | | | | | | | | | Port #3474 from Citra: Do not crash on unimplemented code in debug build
| * | | | Port #3474 from CitrafearlessTobi2018-07-071-1/+1
| | |/ / | |/| |
* | | | Merge pull request #634 from FearlessTobi/port-viewport-fixbunnei2018-07-101-6/+7
|\ \ \ \ | | | | | | | | | | Port #3505 from Citra: Fix QGLWidget viewport resize on macOS
| * | | | Port #3505 from CItrafearlessTobi2018-07-071-6/+7
| |/ / /
* | | | Merge pull request #640 from bunnei/flip-tris-viewportbunnei2018-07-091-1/+4
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.
| * | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.bunnei2018-07-081-1/+4
| | |/ / | |/| | | | | | | | | | - Fixes a regression with Binding of Isaac.
* / | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ / /
* | | Merge pull request #625 from Subv/imnmxbunnei2018-07-082-3/+31
|\ \ \ | | | | | | | | GPU: Implemented the IMNMX shader instruction.
| * | | GPU: Implemented the IMNMX shader instruction.Subv2018-07-042-3/+31
| | | | | | | | | | | | | | | | It's similar to the FMNMX instruction but it works on integers.
* | | | Merge pull request #627 from Subv/bc7ubunnei2018-07-083-7/+21
|\ \ \ \ | | | | | | | | | | GPU: Implemented the BC7U texture format.
| * | | | GPU: Implemented the BC7U texture format.Subv2018-07-073-7/+21
| | |/ / | |/| | | | | | | | | | Note: Our version of glad exports GL_COMPRESSED_RGBA_BPTC_UNORM as GL_COMPRESSED_RGBA_BPTC_UNORM_ARB, maybe it's time we update it.
* / | | Revert "Virtual Filesystem (#597)"bunnei2018-07-0845-1784/+1676
|/ / / | | | | | | | | | This reverts commit 77c684c1140f6bf3fb7d4560d06d2efb1a2ee5e2.
* | | Merge pull request #630 from FearlessTobi/remove-citra-referencesbunnei2018-07-063-3/+3
|\ \ \ | | | | | | | | Remove some references to Citra
| * | | Remove some references to CitrafearlessTobi2018-07-063-3/+3
| | | |
* | | | Virtual Filesystem (#597)Zach Hilman2018-07-0645-1676/+1784
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add VfsFile and VfsDirectory classes * Finish abstract Vfs classes * Implement RealVfsFile (computer fs backend) * Finish RealVfsFile and RealVfsDirectory * Finished OffsetVfsFile * More changes * Fix import paths * Major refactor * Remove double const * Use experimental/filesystem or filesystem depending on compiler * Port partition_filesystem * More changes * More Overhaul * FSP_SRV fixes * Fixes and testing * Try to get filesystem to compile * Filesystem on linux * Remove std::filesystem and document/test * Compile fixes * Missing include * Bug fixes * Fixes * Rename v_file and v_dir * clang-format fix * Rename NGLOG_* to LOG_* * Most review changes * Fix TODO * Guess 'main' to be Directory by filename
* | | Merge pull request #629 from Subv/depth_testbunnei2018-07-052-9/+29
|\ \ \ | | | | | | | | GPU: Allow using the old NV04 values for the depth test function.
| * | | GPU: Allow using the old NV04 values for the depth test function.Subv2018-07-052-9/+29
| | | | | | | | | | | | | | | | | | | | | | | | These seem to be just a valid as the GL token values. Thanks @ReinUsesLisp This restores graphical output to Disgaea 5
* | | | Merge pull request #626 from Subv/shader_syncbunnei2018-07-052-0/+12
|\ \ \ \ | |/ / / |/| | | GPU: Stub the shader SYNC and DEPBAR instructions.
| * | | GPU: Stub the shader SYNC and DEPBAR instructions.Subv2018-07-042-0/+12
| |/ / | | | | | | | | | It is unknown at this moment if we actually need to do something with these instructions or if the GLSL compiler takes care of that for us.
* | | Merge pull request #624 from Subv/f2f_roundbunnei2018-07-051-0/+3
|\ \ \ | | | | | | | | GPU: Implemented the F2F 'round' rounding mode.
| * | | GPU: Implemented the F2F 'round' rounding mode.Subv2018-07-041-0/+3
| |/ / | | | | | | | | | It's implemented via the GLSL 'roundEven()' function.
* | | Merge pull request #623 from Subv/vertex_typesbunnei2018-07-051-0/+8
|\ \ \ | | | | | | | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types
| * | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types.Subv2018-07-041-0/+8
| |/ / | | | | | | | | | Both signed and unsigned variants.
* | | Merge pull request #622 from Subv/unused_texbunnei2018-07-052-2/+5
|\ \ \ | | | | | | | | GPU: Ignore unused textures and corrected the TEX shader instruction decoding.
| * | | GPU: Ignore textures that the GLSL compiler deemed unused when binding textures to the shaders.Subv2018-07-041-1/+4
| | | |
| * | | GPU: Corrected the decoding for the TEX shader instruction.Subv2018-07-041-1/+1
| |/ /
* | | Merge pull request #621 from Subv/psetp_bunnei2018-07-052-0/+43
|\ \ \ | | | | | | | | GPU: Implemented the PSETP shader instruction.
| * | | GPU: Implemented the PSETP shader instruction.Subv2018-07-042-0/+43
| |/ / | | | | | | | | | It's similar to the isetp and fsetp instructions but it works on predicates instead.
* | | Merge pull request #620 from Subv/depth_z32fbunnei2018-07-053-2/+15
|\ \ \ | | | | | | | | GPU: Implemented the 32 bit float depth buffer format.
| * | | GPU: Implemented the 32 bit float depth buffer format.Subv2018-07-043-2/+15
| |/ /
* / / GPU: Flip the triangle front face winding if the GPU is configured to not flip the triangles.Subv2018-07-042-3/+29
|/ / | | | | | | | | | | OpenGL's default behavior is already correct when the GPU is configured to flip the triangles. This fixes 1-2 Switch's splash screen.
* | GPU: Only configure the used framebuffers during clear.Subv2018-07-044-17/+48
| | | | | | | | Don't try to configure the color buffer if it is not being cleared, it may not be completely valid at this point.
* | Merge pull request #609 from Subv/clear_buffersbunnei2018-07-045-16/+105
|\ \ | | | | | | GPU: Implemented the CLEAR_BUFFERS register.
| * | GPU: Factor out the framebuffer configuration code for both Clear and Draw commands.Subv2018-07-032-72/+39
| | |
| * | GPU: Support clears that don't clear the color buffer.Subv2018-07-032-6/+17
| | |
| * | GPU: Bind and clear the render target when the CLEAR_BUFFERS register is written to.Subv2018-07-034-0/+86
| | |
| * | GPU: Added registers for the CLEAR_BUFFERS and CLEAR_COLOR methods.Subv2018-07-031-2/+27
| | |
* | | gl_rasterizer_cache: Implement PixelFormat S8Z24.bunnei2018-07-033-11/+83
| | |
* | | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
| | | | | | | | | | | | | | | | | | | | | | | | * voice section updating * fixed slight offset miscalculation * fixed overflow
* | | Merge pull request #607 from jroweboy/loggingbunnei2018-07-03116-887/+1261
|\ \ \ | | | | | | | | Logging - Customizable backends
| * | | Fix build and address review feedbackbunnei2018-07-032-4/+5
| | | |
| * | | Add configurable logging backendsJames Rowe2018-07-0314-22/+408
| | | |
| * | | Update clang formatJames Rowe2018-07-0337-154/+141
| | | |
| * | | Rename logging macro back to LOG_*James Rowe2018-07-03105-730/+730
| |/ /
* | | Merge pull request #612 from bunnei/fix-cullbunnei2018-07-031-2/+5
|\ \ \ | | | | | | | | gl_rasterizer: Only set cull mode and front face if enabled.
| * | | gl_rasterizer: Only set cull mode and front face if enabled.bunnei2018-07-031-2/+5
| |/ /
* | | Merge pull request #611 from Subv/enabled_depth_testbunnei2018-07-032-9/+13
|\ \ \ | | | | | | | | GPU: Don't try to parse the depth test function if the depth test is disabled and use only the least significant 3 bits in the depth test func
| * | | GPU: Use only the least significant 3 bits when reading the depth test func.Subv2018-07-031-9/+9
| | | | | | | | | | | | | | | | Some games set the full GL define value here (including nouveau), but others just seem to set those last 3 bits.
| * | | GPU: Don't try to parse the depth test function if the depth test is disabled.Subv2018-07-031-0/+4
| |/ /
* | | Merge pull request #610 from Subv/mufu_8bunnei2018-07-032-0/+5
|\ \ \ | |/ / |/| | GPU: Implemented MUFU suboperation 8, sqrt.
| * | GPU: Implemented MUFU suboperation 8, sqrt.Subv2018-07-032-0/+5
| | |
* | | Merge pull request #608 from Subv/depthbunnei2018-07-039-32/+246
|\ \ \ | | | | | | | | GPU: Implemented the depth buffer and depth test + culling
| * | | GPU: Set up the culling configuration on each draw.Subv2018-07-031-6/+8
| | | |
| * | | GPU: Set up the depth test state on every draw.Subv2018-07-022-0/+14
| | | |
| * | | MaxwellToGL: Added conversion functions for depth test and cull mode.Subv2018-07-021-0/+50
| | | |
| * | | GPU: Added registers for depth test and cull mode.Subv2018-07-021-3/+51
| | | |
| * | | GPU: Implemented the Z24S8 depth format and load the depth framebuffer.Subv2018-07-027-24/+124
| |/ /
* | | Merge pull request #606 from Subv/base_vertexSebastian Valle2018-07-022-8/+15
|\ \ \ | | | | | | | | GPU: Fixed the index offset and implement BaseVertex when doing indexed rendering.
| * | | GPU: Implement offsetted rendering when using non-indexed drawing.Subv2018-07-021-1/+1
| | | |
| * | | GPU: Fixed the index offset rendering, and implemented the base vertex functionality.Subv2018-07-021-6/+8
| | | | | | | | | | | | | | | | This fixes Stardew Valley.
| * | | GPU: Added register definitions for the vertex buffer base element.Subv2018-07-021-1/+6
| |/ /
* | | Merge pull request #603 from Subv/nvmap_freeSebastian Valle2018-07-023-4/+16
|\ \ \ | | | | | | | | GPU: Remove unmapped surfaces from the rasterizer cache and fix our nvmap::Free behavior.
| * | | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| | | |
| * | | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
| | | | | | | | | | | | | | | | This behavior is confirmed by reverse engineering.
* | | | Merge pull request #605 from Subv/dma_copySebastian Valle2018-07-021-1/+5
|\ \ \ \ | | | | | | | | | | GPU: Directly copy the pixels when performing a same-layout DMA.
| * | | | GPU: Directly copy the pixels when performing a same-layout DMA.Subv2018-07-021-1/+5
| |/ / /
* | | | Merge pull request #604 from Subv/invalid_texturesbunnei2018-07-023-3/+12
|\ \ \ \ | |_|/ / |/| | | GPU: Ignore invalid and disabled textures when drawing.
| * | | GPU: Ignore disabled textures and textures with an invalid address.Subv2018-07-022-1/+10
| | | |
| * | | GPU: Allow GpuToCpuAddress to return boost::none for unmapped addresses.Subv2018-07-021-2/+2
| |/ /
* | | Merge pull request #602 from Subv/mufu_subopbunnei2018-07-012-6/+1
|\ \ \ | | | | | | | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.
| * | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.Subv2018-06-302-6/+1
| |/ /
* | | Merge pull request #601 from Subv/rgba32_uibunnei2018-07-014-25/+48
|\ \ \ | | | | | | | | GPU: Implement the RGBA32_UINT rendertarget format.
| * | | GPU: Implemented the RGBA32_UINT rendertarget format.Subv2018-06-304-9/+28
| | | |
| * | | GLCache: Specify the component type along the texture type in the format tuple.Subv2018-06-301-17/+21
| |/ /
* / / gl_shader_decompiler: Implement predicate NotEqualWithNan.bunnei2018-06-302-17/+24
|/ /
* | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-2915-1454/+425
|\ \ | | | | | | Rewrite the OpenGL rasterizer cache
| * | gl_rasterizer_cache: Only dereference color_surface/depth_surface if valid.bunnei2018-06-291-2/+6
| | |
| * | gl_rasterizer_cache: Implement caching for texture and framebuffer surfaces.bunnei2018-06-273-16/+168
| | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Improved cache management based on Citra's implementation. gl_surface_cache: Add some docstrings.
| * | gl_rasterizer_cache: Various fixes for ASTC handling.bunnei2018-06-272-35/+39
| | |
| * | gl_rasterizer_cache: Use SurfaceParams as a key for surface caching.bunnei2018-06-272-43/+72
| | |
| * | maxwell_3d: Add a struct for RenderTargetConfig.bunnei2018-06-271-17/+19
| | |
| * | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-277-0/+21
| | |
| * | gl_rasterizer: Implement AccelerateDisplay to forward textures to framebuffers.bunnei2018-06-276-8/+62
| | |
| * | gl_rasterizer_cache: Cache size_in_bytes as a const per surface.bunnei2018-06-272-9/+13
| | |
| * | gl_rasterizer_cache: Refactor to make SurfaceParams members const.bunnei2018-06-272-52/+37
| | |
| * | gl_rasterizer_cache: Remove Citra's rasterizer cache, always load/flush surfaces.bunnei2018-06-274-1494/+210
| | |
* | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \ | | | | | | | | Service/Audio: add hwopus service, stub GetWorkBufferSize function
| * | | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
| | | |
* | | | gl_shader_decompiler: Add a return path for unknown instructions.bunnei2018-06-271-0/+1
| |/ / |/| |
* | | gl_rasterizer: Workaround for when exceeding max UBO size.bunnei2018-06-272-1/+7
| | |
* | | Merge pull request #593 from bunnei/fix-swizzlebunnei2018-06-275-12/+20
|\ \ \ | | | | | | | | gl_state: Fix state management for texture swizzle.
| * | | gl_state: Fix state management for texture swizzle.bunnei2018-06-265-12/+20
| | | |
* | | | Merge pull request #592 from bunnei/cleanup-gl-statebunnei2018-06-272-94/+0
|\ \ \ \ | | | | | | | | | | gl_state: Remove unused state management from 3DS.
| * | | | gl_state: Remove unused state management from 3DS.bunnei2018-06-262-94/+0
| |/ / /
* / / / gl_rasterizer_cache: Fix inverted B5G6R5 format.bunnei2018-06-261-1/+1
|/ / /
* | | yuzu: Remove SSBOs check from Qt frontend.bunnei2018-06-261-2/+0
| | |
* | | Merge pull request #554 from Subv/constbuffer_ubobunnei2018-06-264-18/+39
|\ \ \ | | | | | | | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.
| * | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.Subv2018-06-104-18/+39
| | | | | | | | | | | | | | | | This should help a bit with GPU performance once we're GPU-bound.
* | | | Merge pull request #589 from mailwl/fix-crashbunnei2018-06-261-2/+4
|\ \ \ \ | | | | | | | | | | Fix crash at exit
| * | | | Fix crash at exitmailwl2018-06-251-2/+4
| | |/ / | |/| |
* / | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / / | | | | | | | | | | | | | | | | | | | | | * We should be returning our revision instead of what is requested. Hardware test on a 5.1.0 console * Added sysversion comment
* | | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader According to game symbols(SMO), there's references to UpdateDataHeader which seems to be what AudioRendererResponse actually is * oops * AudioRendererParameters should be AudioRendererParameter according to SMO
* | | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
| | | | | | | | | | | | | | | * Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly This fixes RequestUpdateAudioRenderer deadlocks in games like Puyo Puyo Tetris and games which require a proper section size in games such as Retro City Rampage. This fixes causes various games to start rendering or trying to render
* | | Merge pull request #579 from SciresM/masterbunnei2018-06-2212-9/+312
|\ \ \ | | | | | | | | svc: Fully implement svcSignalToAddress and svcWaitForAddress
| * | | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| | | |
| * | | Add additional missing format.Michael Scire2018-06-222-21/+27
| | | |
| * | | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| | | |
| * | | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| | | |
| * | | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| | | |
| * | | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| | | |
| * | | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-215-11/+111
| | | |
| * | | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-215-6/+71
| | | |
| * | | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
| | | |
* | | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
| | | | | | | | | | | | | | | | prevent yuzu crash, if games, like Axiom Verge, trying to read 0 bytes from file
* | | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \ \ | | | | | | | | | | Service/Audio: update audren:u service
| * | | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ / /
* / / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-2110-16/+453
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Start to add NCA support in loader * More nca stuff * More changes to nca.cpp * Now identifies decrypted NCA cont. * Game list fixes and more structs and stuff * More updates to Nca class * Now reads ExeFs (i think) * ACTUALLY LOADS EXEFS! * RomFS loads and games execute * Cleanup and Finalize * plumbing, cleanup and testing * fix some things that i didnt think of before * Preliminary Review Changes * Review changes for bunnei and subv
* | | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-2012-22/+24
| | |
* | | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement GetAvailableLanguageCodes2 * Revert "Implement GetAvailableLanguageCodes2" This reverts commit caadd9eea3497ae2a13382aecb8ca29e1c02c5af. * Implement GetAvailableLanguageCodes2 * Implement GetAvailableLanguageCodes2
* | | Merge pull request #574 from Subv/shader_abs_negbunnei2018-06-191-7/+14
|\ \ \ | | | | | | | | GPU: Perform negation after absolute value in the float shader instructions.
| * | | GPU: Perform negation after absolute value in the float shader instructions.Subv2018-06-191-7/+14
| | | |
* | | | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \ \ \ | | | | | | | | | | Avoid initializing single-joycon layouts with handheld controller
| * | | | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| | | | |
| * | | | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| | | | |
| * | | | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
| | | | |
* | | | | GPU: Don't mark uniform buffers and registers as used for instructions which don't have them.Subv2018-06-192-14/+18
| |/ / / |/| | | | | | | | | | | | | | | Like the MOV32I and FMUL32I instructions. This fixes a potential crash when using these instructions.
* | | | Merge pull request #570 from bunnei/astcbunnei2018-06-196-1/+1709
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.
| * | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.bunnei2018-06-186-1/+1709
| | | | |
* | | | | Merge pull request #562 from DarkLordZach/extracted-ncas-uibunnei2018-06-184-3/+50
|\ \ \ \ \ | | | | | | | | | | | | Add UI support for extracted NCA folders
| * | | | | Bug fixes, testing, and review changesZach Hilman2018-06-142-7/+20
| | | | | |
| * | | | | Add 'Load Folder' menu optionZach Hilman2018-06-143-0/+17
| | | | | |
| * | | | | Add support for main files in file pickerZach Hilman2018-06-141-0/+2
| | | | | |
| * | | | | Recognize main files in game listZach Hilman2018-06-141-2/+17
| | |/ / / | |/| | |
* | | | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ \ \ | | | | | | | | | | | | svc: Add a stub for UserExceptionContextAddr.
| * | | | | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
| | | | | |
* | | | | | Merge pull request #571 from Armada651/loose-blendbunnei2018-06-181-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | gl_rasterizer: Get loose on independent blending.
| * | | | | gl_rasterizer: Get loose on independent blending.Jules Blok2018-06-181-1/+1
| | | | | |
* | | | | | gl_rasterizer_cache: Loosen things up a bit.bunnei2018-06-181-26/+8
| | | | | |
* | | | | | gl_shader_decompiler: Implement LOP instructions.bunnei2018-06-172-6/+42
| | | | | |
* | | | | | gl_shader_decompiler: Refactor LOP32I instruction a bit in support of LOP.bunnei2018-06-172-57/+42
|/ / / / /
* | | | | gl_shader_decompiler: Implement integer size conversions for I2I/I2F/F2I.bunnei2018-06-162-14/+43
| | | | |
* | | | | Merge pull request #564 from bunnei/lop32i_passbbunnei2018-06-161-6/+12
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.
| * | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.bunnei2018-06-161-6/+12
| | |/ / / | |/| | |
* / | | | gl_shader_gen: Set position.w to 1.bunnei2018-06-161-0/+4
|/ / / /
* | | | Merge pull request #560 from Subv/crash_widgetbunnei2018-06-136-292/+0
|\ \ \ \ | | | | | | | | | | Qt: Removed the Registers widget.
| * | | | Qt: Removed the Registers widget.Subv2018-06-136-292/+0
| | |_|/ | |/| | | | | | | | | | It was crashing and nobody actually uses this.
* | | | Merge pull request #556 from Subv/dma_enginebunnei2018-06-127-1/+237
|\ \ \ \ | | | | | | | | | | GPU: Partially implemented the Maxwell DMA engine.
| * | | | GPU: Partially implemented the Maxwell DMA engine.Subv2018-06-127-1/+237
| | | | | | | | | | | | | | | | | | | | Only tiled->linear and linear->tiled copies that aren't offsetted are supported for now. Queries are not supported. Swizzled copies are not supported.
* | | | | Merge pull request #558 from Subv/iadd32ibunnei2018-06-122-2/+31
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the iadd32i shader instruction.
| * | | | | GPU: Implemented the iadd32i shader instruction.Subv2018-06-122-2/+31
| | |/ / / | |/| | |
* | | | | Merge pull request #557 from shinyquagsire23/libnx-hid-fixbunnei2018-06-122-2/+3
|\ \ \ \ \ | | | | | | | | | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTO
| * | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ / / /
* / / / / gl_shader_decompiler: Implement saturate for float instructions.bunnei2018-06-122-39/+32
|/ / / /
* / / / GPU: Convert the gl_InstanceId and gl_VertexID variables to floats when reading from them.Subv2018-06-101-1/+1
|/ / / | | | | | | | | | This corrects the invalid position values in some games when doing attribute-less rendering.
* | | GPU: Implement the iset family of shader instructions.Subv2018-06-092-2/+46
| | |
* | | GPU: Added decodings for the ISET family of instructions.Subv2018-06-091-0/+7
| |/ |/|
* | Merge pull request #550 from Subv/ssybunnei2018-06-092-0/+7
|\ \ | | | | | | GPU: Stub the SSY shader instruction.
| * | GPU: Stub the SSY shader instruction.Subv2018-06-092-0/+7
| | | | | | | | | | | | This instruction tells the GPU where the flow reconverges in a non-uniform control flow scenario, we can ignore this when generating GLSL code.
* | | Merge pull request #551 from bunnei/shrbunnei2018-06-092-0/+17
|\ \ \ | | | | | | | | gl_shader_decompiler: Implement SHR instruction.
| * | | gl_shader_decompiler: Implement SHR instruction.bunnei2018-06-092-0/+17
| |/ /
* | | gl_shader_decompiler: Implement IADD instruction.bunnei2018-06-092-11/+37
| | |
* | | gl_shader_decompiler: Add missing asserts for saturate_a instructions.bunnei2018-06-092-8/+18
|/ /
* | Merge pull request #533 from mailwl/array-to-bufferbunnei2018-06-093-22/+15
|\ \ | | | | | | Common/string_util: add StringFromBuffer() function
| * | Common/string_util: add StringFromBuffer functionmailwl2018-06-073-22/+15
| | | | | | | | | | | | convert input buffer (std::vector<u8>) to string, stripping zero chars
* | | GPU: Synchronize the blend state on every draw call.Subv2018-06-092-16/+20
| | | | | | | | | | | | | | | | | | Only independent blending on render target 0 is implemented for now. This fixes the elongated squids in Splatoon 2's boot screen.
* | | GPU: Added registers for normal and independent blending.Subv2018-06-092-31/+27
| | |
* | | Merge pull request #547 from Subv/compressed_alignmentbunnei2018-06-081-2/+7
|\ \ \ | | | | | | | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.
| * | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.Subv2018-06-081-2/+7
| | | | | | | | | | | | | | | | This fixes issues with retrieving non-block-aligned tiled compressed textures from the cache.
* | | | Rasterizer: Flush the written region when writing shader uniform data before copying it to the uniform buffers.Subv2018-06-081-0/+3
|/ / / | | | | | | | | | This fixes the flip_viewport uniform having invalid values when drawing.
* | | Merge pull request #543 from Subv/uniformsbunnei2018-06-071-3/+4
|\ \ \ | |/ / |/| | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.
| * | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.Subv2018-06-071-3/+4
| | | | | | | | | | | | This should fix the bug with the vs_config UBO being uninitialized during shader execution.
* | | Merge pull request #522 from mailwl/mm-ubunnei2018-06-076-0/+85
|\ \ \ | | | | | | | | Service/MM: add service and stub some functions
| * | | Remove unused header filesmailwl2018-06-061-2/+0
| | | |
| * | | Small fixesmailwl2018-06-052-6/+8
| | | |
| * | | Service/MM: add service and stub some functionsmailwl2018-06-056-0/+85
| | | |
* | | | Merge pull request #542 from bunnei/bfe_immbunnei2018-06-072-7/+44
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Implement BFE_IMM instruction.
| * | | | gl_shader_decompiler: Implement BFE_IMM instruction.bunnei2018-06-072-7/+44
| | | | |
* | | | | Merge pull request #541 from Subv/blittexturesbunnei2018-06-071-56/+9
|\ \ \ \ \ | |/ / / / |/| | | | GLCache: Fixed copying compressed textures in the rasterizer cache.
| * | | | GLCache: Use the full uncompressed size when blitting from one texture to another.Subv2018-06-071-3/+6
| | | | | | | | | | | | | | | | | | | | This avoids the problem of only copying a tiny piece of the textures when they are compressed.
| * | | | GLCache: Simplify the logic to copy from one texture to another in BlitTextures.Subv2018-06-071-53/+3
| | |/ / | |/| | | | | | | | | | | | | | | | | | We now use glCopyImageSubData, this should avoid errors with trying to attach a compressed texture as a framebuffer's color attachment and then blitting to it. Maybe in the future we can change this to glCopyTextureSubImage which only requires GL_ARB_direct_state_access.
* | | | Merge pull request #539 from bunnei/f2f-roundingbunnei2018-06-072-10/+35
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: F2F: Implement rounding modes.
| * | | | gl_shader_decompiler: F2F: Implement rounding modes.bunnei2018-06-072-10/+35
| | | | |
* | | | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \ \ \ | |/ / / / |/| | | | Service/nfp:user : stub some functions.
| * | | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| | | | |
| * | | | Correct function resultsmailwl2018-06-041-4/+16
| | | | |
| * | | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
| | | | | | | | | | | | | | | | | | | | Used by Zelda: BoTW
* | | | | Merge pull request #537 from bunnei/misc-shaderbunnei2018-06-072-8/+24
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Additional decodings, remove unused stuff from TEX
| * | | | | gl_shader_decompiler: Remove some attribute stuff that has nothing to do with TEX/TEXS.bunnei2018-06-071-8/+4
| | | | | |
| * | | | | shader_bytecode: Add instruction decodings for BFE, IMNMX, and XMAD.bunnei2018-06-071-0/+20
| | |/ / / | |/| | |
* | | | | Merge pull request #535 from Subv/gpu_swizzlebunnei2018-06-076-0/+65
|\ \ \ \ \ | | | | | | | | | | | | GPU: Support changing the texture swizzles for Maxwell textures.
| * | | | | GPU: Support changing the texture swizzles for Maxwell textures.Subv2018-06-073-0/+45
| | | | | |
| * | | | | GLState: Support changing the GL_TEXTURE_SWIZZLE parameter of each texture unit.Subv2018-06-073-0/+20
| |/ / / /
* / / / / gl_shader_decompiler: Implement ISETP_IMM instruction.bunnei2018-06-071-8/+9
|/ / / /
* | | | Merge pull request #534 from Subv/multitexturingbunnei2018-06-079-69/+172
|\ \ \ \ | | | | | | | | | | GPU: Implement sampling multiple textures in the generated glsl shaders.
| * | | | GPU: Implement sampling multiple textures in the generated glsl shaders.Subv2018-06-069-69/+172
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All tested games that use a single texture show no regression. Only Texture2D textures are supported right now, each shader gets its own "tex_fs/vs/gs" sampler array to maintain independent textures between shader stages, the textures themselves are reused if possible.
* | | | | gl_shader_decompiler: Implement LD_C instruction.bunnei2018-06-072-0/+43
| | | | |
* | | | | gl_shader_gen: Add uniform handling for indirect const buffer access.bunnei2018-06-073-4/+40
| | | | |
* | | | | gl_shader_decompiler: Refactor uniform handling to allow different decodings.bunnei2018-06-062-26/+29
|/ / / /
* | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add IoctlCommands with their params in nvidia_ctrl_gpu.h * add function related to the changes done previously * fix clang-format * delete trailing whitespace * correct mistake
* | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \ | | | | | | | | | | Stub SetConnectionConfirmationOption, GetPseudoDeviceId
| * | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| | | | |
| * | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| | | | |
* | | | | Merge pull request #531 from bunnei/fix-shlSebastian Valle2018-06-061-1/+1
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.
| * | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.bunnei2018-06-061-1/+1
| |/ / / /
* | | | | Merge pull request #530 from bunnei/wrap-mirrorSebastian Valle2018-06-061-0/+2
|\ \ \ \ \ | | | | | | | | | | | | maxwell_to_gl: Implement WrapMode Mirror.
| * | | | | maxwell_to_gl: Implement WrapMode Mirror.bunnei2018-06-061-0/+2
| |/ / / /
* | | | | Merge pull request #527 from Subv/rgba32f_texcopybunnei2018-06-062-0/+5
|\ \ \ \ \ | | | | | | | | | | | | GPU: Allow the usage of RGBA32_FLOAT and RGBA16_FLOAT in the texture copy engine.
| * | | | | GPU: Allow the usage of RGBA16_FLOAT in the texture copy engine.Subv2018-06-061-0/+2
| | | | | |
| * | | | | GPU: Allow the usage of RGBA32_FLOAT in the texture copy engine.Subv2018-06-062-0/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #528 from Subv/rg11b10fbunnei2018-06-064-12/+31
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.
| * | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.Subv2018-06-064-11/+30
| | | | | |
| * | | | | GPU: Fixed the compression factor for RGBA16F textures.Subv2018-06-061-1/+1
| |/ / / / | | | | | | | | | | | | | | | They're not compressed.
* | / / / GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
| |/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GDB Stub should work now. * Applied clang-format. * Replaced htonll with swap64. * Tidy up.
* | | | Merge pull request #516 from Subv/f2i_rbunnei2018-06-062-7/+64
|\ \ \ \ | | | | | | | | | | GPU: Implemented the F2I_R shader instruction.
| * | | | GPU: Implemented the F2I_R shader instruction.Subv2018-06-052-7/+64
| | | | |
* | | | | Merge pull request #521 from Subv/brabunnei2018-06-051-4/+5
|\ \ \ \ \ | | | | | | | | | | | | GPU: Corrected the branch targets for the shader bra instruction.
| * | | | | GPU: Corrected the branch targets for the shader bra instruction.Subv2018-06-051-4/+5
| | |/ / / | |/| | |
* | | | | Merge pull request #520 from bunnei/shader-shlbunnei2018-06-052-15/+48
|\ \ \ \ \ | |/ / / / |/| | | | gl_shader_decompiler: Implement SHL instruction.
| * | | | gl_shader_decompiler: Fix typo with ISCADD instruction.bunnei2018-06-051-1/+1
| | | | |
| * | | | gl_shader_decompiler: Implement SHL instruction.bunnei2018-06-052-14/+47
| | | | |
* | | | | Merge pull request #518 from Subv/incomplete_shadersbunnei2018-06-051-5/+16
|\ \ \ \ \ | |/ / / / |/| | | | GPU: Implemented predicated exit instructions in the shader programs.
| * | | | GPU: Implement predicated exit instructions in the shader programs.Subv2018-06-051-4/+6
| | | | |
| * | | | GPU: Take into account predicated exits when performing shader control flow analysis.Subv2018-06-051-1/+10
| | | | |
* | | | | gl_shader_decompiler: Implement PredCondition::NotEqual.bunnei2018-06-051-3/+3
| | | | |
* | | | | GPU: Implement the ISCADD shader instructions.Subv2018-06-052-0/+40
| | | | |
* | | | | GPU: Added decodings for the ISCADD instructions.Subv2018-06-051-0/+7
| |/ / / |/| | |
* | | | Merge pull request #514 from Subv/lop32ibunnei2018-06-052-1/+58
|\ \ \ \ | | | | | | | | | | GPU: Implemented the LOP32I instruction.
| * | | | GPU: Implemented the LOP32I instruction.Subv2018-06-042-1/+58
| | |/ / | |/| |
* | | | Merge pull request #510 from Subv/isetpbunnei2018-06-052-6/+63
|\ \ \ \ | | | | | | | | | | GPU: Implemented the ISETP_R and ISETP_C instructions
| * | | | GPU: Use explicit types when retrieving the uniform values for fsetp/fset and isetp instead of the type of an invalid output register.Subv2018-06-041-9/+18
| | | | |
| * | | | GPU: Implemented the ISETP_R and ISETP_C shader instructions.Subv2018-06-042-0/+48
| | | | |
* | | | | Merge pull request #512 from Subv/fsetbunnei2018-06-052-4/+19
|\ \ \ \ \ | |_|_|/ / |/| | | | GPU: Corrected the FSET and I2F instructions.
| * | | | GPU: Use the bf bit in FSET to determine whether to write 0xFFFFFFFF or 1.0f.Subv2018-06-042-2/+7
| | | | |
| * | | | GPU: Corrected the I2F_R implementation.Subv2018-06-041-2/+12
| | |/ / | |/| |
* | | | Merge pull request #501 from Subv/shader_brabunnei2018-06-052-1/+45
|\ \ \ \ | | | | | | | | | | GPU: Partially implemented the bra shader instruction
| * | | | GPU: Partially implemented the shader BRA instruction.Subv2018-06-042-1/+43
| | | | |
| * | | | GPU: Added decoding for the BRA instruction.Subv2018-06-041-0/+2
| | |/ / | |/| |
* | | | Merge pull request #515 from Subv/viewport_fixbunnei2018-06-052-14/+30
|\ \ \ \ | | | | | | | | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.
| * | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.Subv2018-06-042-14/+30
| | |/ / | |/| | | | | | | | | | This is how nouveau calculates the viewport width and height. For some reason some games set 0xFFFF in the VIEWPORT_HORIZ and VIEWPORT_VERT registers, maybe those are a misnomer and actually refer to something else?
* | | | Merge pull request #490 from BreadFish64/extension-checkbunnei2018-06-044-0/+53
|\ \ \ \ | | | | | | | | | | Add checks for OpenGL extension support
| * | | | sdl: add check for GL extension supportBreadFish642018-06-042-0/+26
| | | | |
| * | | | qt: add check for GL extension supportBreadFish642018-06-042-0/+27
| | | | |
* | | | | Merge pull request #513 from Subv/cache_alignmentbunnei2018-06-041-1/+2
|\ \ \ \ \ | | | | | | | | | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.
| * | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.Subv2018-06-041-1/+2
| | |/ / / | |/| | |
* | | | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add some IoctlCommand with their params to nvhost_gpu * fix clang-format * delete trailing whitespace * fix some clang-format * delete one other trailing whitespace * last clang-format fix
* | | | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
| | | | |
* | | | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
| | | | |
* | | | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/ / / /
* | | | Merge pull request #499 from bunnei/am-stuffbunnei2018-06-042-66/+105
|\ \ \ \ | |_|/ / |/| | | am: Implement CreateStorage, PushInData, etc.
| * | | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
| | | |
| * | | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
| | | |
| * | | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
| | | |
| * | | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
| | | |
* | | | Merge pull request #500 from Subv/long_queriesbunnei2018-06-041-9/+24
|\ \ \ \ | | | | | | | | | | GPU: Partial implementation of long GPU queries.
| * | | | GPU: Partial implementation of long GPU queries.Subv2018-06-041-9/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Long queries write a 128-bit result value to memory, which consists of a 64 bit query value and a 64 bit timestamp. In this implementation, only select=Zero of the Crop unit is implemented, this writes the query sequence as a 64 bit value, and a 0u64 value for the timestamp, since we emulate an infinitely fast GPU. This specific type was hwtested, but more rigorous tests should be performed in the future for the other types.
* | | | | gl_shader_decompiler: Implement TEXS component mask.bunnei2018-06-032-9/+26
| |/ / / |/| | |
* | | | Merge pull request #494 from bunnei/shader-texbunnei2018-06-032-2/+58
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Implement TEX, fixes for TEXS.
| * | | | gl_shader_decompiler: Implement TEX instruction.bunnei2018-06-012-1/+36
| | | | |
| * | | | gl_shader_decompiler: Support multi-destination for TEXS.bunnei2018-06-012-2/+23
| | | | |
* | | | | Merge pull request #495 from bunnei/improve-rrobunnei2018-06-032-9/+18
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement RRO as a register move.
| * | | | | gl_shader_decompiler: Implement RRO as a register move.bunnei2018-06-032-9/+18
| |/ / / /
* | | | | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \ \ \ \ | | | | | | | | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' device
| * | | | | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
| | | | | |
* | | | | | Merge pull request #496 from Subv/waitprocesswidekey_timeoutbunnei2018-06-031-2/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.
| * | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
| | |_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This situation may happen like so: Thread 1 with low priority calls WaitProcessWideKey with timeout. Thread 2 with high priority calls WaitProcessWideKey without timeout. Thread 3 calls SignalProcessWideKey - Thread 2 acquires the lock and awakens. - Thread 1 can't acquire the lock and is put to sleep with the lock owner being Thread 2. Thread 1's timeout expires, with the lock owner still being set to Thread 2.
* / | | | | GPU: Implemented the DXN1 (BC4) texture format.Subv2018-06-023-3/+16
|/ / / / /
* | / / / Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
| |/ / / |/| | |
* | | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \ \ | | | | | | | | | | Kernel/SVC: Corrected the behavior of svcSetThreadCoreMask for core values -2 and -3.
| * | | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| | | | |
| * | | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| | | | | | | | | | | | | | | | | | | | Also added some proper error handling.
| * | | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
| | | | |
* | | | | gl_rasterizer_cache: Assert that component type is UNorm or format is RGBA16F.bunnei2018-05-311-1/+2
| | | | |
* | | | | gl_rasterizer_cache: Implement PixelFormat RGBA16F.bunnei2018-05-313-6/+22
| | | | |
* | | | | Merge pull request #489 from Subv/vertexidbunnei2018-05-302-1/+11
|\ \ \ \ \ | | | | | | | | | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.
| * | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.Subv2018-05-302-1/+11
| |/ / / /
* | | / / add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
| |_|/ / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add some CommandType * add some hid FunctionInfo * add some other HID FunctionInfo * delete non useful comments
* | | | Merge pull request #483 from bunnei/sonicSebastian Valle2018-05-305-10/+35
|\ \ \ \ | |_|/ / |/| | | Several GPU fixes to boot Sonic Mania
| * | | gl_shader_decompiler: F2F_R instruction: Implement abs.bunnei2018-05-301-1/+7
| | | |
| * | | gl_shader_decompiler: Partially implement F2F_R instruction.bunnei2018-05-302-4/+9
| | | |
| * | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| | | |
| * | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
| | | |
| * | | gl_rasterize_cache: Invert order of tex format RGB565.bunnei2018-05-301-1/+1
| |/ /
* / / GPU: Implemented the R8 texture format (0x1D)Subv2018-05-303-5/+18
|/ /
* | Merge pull request #480 from mailwl/bcatbunnei2018-05-308-0/+120
|\ \ | | | | | | Service/BCAT: add module and services
| * | Service/BCAT: add module and servicesmailwl2018-05-288-0/+120
| | |
* | | add all the known TextureFormat (#474)greggameplayer2018-05-291-2/+71
|/ /
* | Merge pull request #472 from bunnei/greater-equalbunnei2018-05-271-4/+3
|\ \ | | | | | | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.
| * | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.bunnei2018-05-261-4/+3
| | |
* | | Merge pull request #476 from Subv/a1bgr5bunnei2018-05-274-5/+21
|\ \ \ | | | | | | | | GPU: Implemented the A1B5G5R5 texture format (0x14)
| * | | GPU: Implemented the A1B5G5R5 texture format (0x14)Subv2018-05-274-5/+21
| |/ /
* | | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \ \ | | | | | | | | NvOsGetConfigU32 should return null instead of 0 for default output value
| * | | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| |/ /
* | | Merge pull request #473 from bunnei/get-display-versionbunnei2018-05-272-1/+10
|\ \ \ | | | | | | | | am: Stub IApplicationFunctions GetDisplayVersion.
| * | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
| |/ /
* / / shader_bytecode: Implement other variants of FMNMX.bunnei2018-05-262-4/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
| | | | | | | | | | | | | | | | | | | | | | | | * add some InfoType * correct OpenApplicationProxy cmd number * add IDisplayController functions * fix clang-format * add more system languages
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \ | | | | | | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUT
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
| | | | | | | | | | | | Used in Nintendo Labo ToyCon 1&2
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetAudioRendererWorkBufferSize impl Impl of GetAudioRendererWorkBufferSize based on RE, if this can be cleaned up, please contribute! * Naming conventions * Removed unneeded placeholder * lioncache changes * fixed const * switched to Common::AlignUp
* | | Merge pull request #468 from Subv/compound_predsbunnei2018-05-261-46/+66
|\ \ \ | | | | | | | | Shader: Implemented compound predicates in the fset and fsetp instructions
| * | | Shader: Implemented compound predicates in fset.Subv2018-05-251-28/+12
| | | | | | | | | | | | | | | | | | | | | | | | You can specify a predicate in the fset instruction: Result = ((Value1 Comp Value2) OP P0) ? 1.0 : 0.0;
| * | | Shader: Implemented compound predicates in fsetp.Subv2018-05-251-19/+55
| |/ / | | | | | | | | | | | | | | | | | | You can specify three predicates in an fsetp instruction: P1 = (Value1 Comp Value2) OP P0; P2 = !(Value1 Comp Value2) OP P0;
* | | Merge pull request #469 from Subv/channel_rebindbunnei2018-05-261-1/+0
|\ \ \ | | | | | | | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.
| * | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.Subv2018-05-251-1/+0
| |/ /
* / / Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ / | | | | We have no clue on what this actually does yet so stubbing it since it's just input only should be fine for now
* | yuzu_cmd: Fix project for latest msvc.bunnei2018-05-241-14/+12
| |
* | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
| | | | | | | | Games such as SMO deadlock if we have more than 2 layouts
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \ | | | | | | Add & correct some error modules
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
| | |
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \ | | | | | | | | Add ioctl commands with their params and size check
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| | | | | | | | | | | | according to the changes made previously
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| | | |
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| | |
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| | |
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
| | |
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE struct + 4 seems to be hard coded at 0 and struct + 0 seems to be ignored? * IocGetWaitbase -> IocChannelGetWaitbaseCommand * Added super late fixes
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-216-1/+118
|\ \ \ | | | | | | | | Implemented nvhost-as-gpu's UnmapBuffer and nvmap's Free ioctls.
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| | | | | | | | | | | | | | | | It releases a reference to an nvmap object
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-204-0/+70
| |/ / | | | | | | | | | It removes a mapping previously created with the MapBufferEx ioctl.
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add unknown function at the number command 2 * correct audout:u commands numbers * correct audrec:u cmd number & add Unknown function * correct IAudioDevice command numbers * correct codecctl cmd numbers & rename the 8 function * correct place of unknown function & fix clang-format
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \ | | | | | | | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ / | | | | | | | | | A thread may own multiple mutexes at the same time, and only release one of them while other threads are waiting for the other mutexes.
* | | Merge pull request #458 from Subv/fmnmxbunnei2018-05-212-6/+26
|\ \ \ | | | | | | | | Shaders: Implemented the FMNMX shader instruction.
| * | | Shaders: Implemented the FMNMX shader instruction.Subv2018-05-212-6/+26
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \ | | | | | | | | Properly rename functions of Fatal Module & add ThrowFatal to this module
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| | | |
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| | | |
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #453 from Subv/thread_callstackSebastian Valle2018-05-212-0/+37
|\ \ \ | | | | | | | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget
| * | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget.Subv2018-05-192-0/+37
| |/ /
* | | Merge pull request #452 from Subv/psetpSebastian Valle2018-05-211-0/+3
|\ \ \ | | | | | | | | ShadersDecompiler: Added decoding for the PSETP instruction.
| * | | ShadersDecompiler: Added decoding for the PSETP instruction.Subv2018-05-191-0/+3
| |/ /
* | | Merge pull request #451 from Subv/gl_array_sizeSebastian Valle2018-05-212-13/+3
|\ \ \ | | | | | | | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.
| * | | GLRenderer: Remove unused hw_vao_enabled_attributes variable.Subv2018-05-192-4/+0
| | | |
| * | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.Subv2018-05-192-9/+3
| |/ / | | | | | | | | | The stream buffer is where all the vertex data is copied, some games require this to be much bigger than the 4 MB we used to have.
* | | Merge pull request #450 from Subv/shader_link_errorSebastian Valle2018-05-201-0/+27
|\ \ \ | | | | | | | | GLRenderer: Log the shader source code when program linking fails.
| * | | GLRenderer: Log the shader source code when program linking fails.Subv2018-05-191-0/+27
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \ | | | | | | | | Added IPC RequestWithContext & ControlWithContext
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
| | | | | | | | | | | | * Add and correct some Error Modules
* | | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1124-189/+613
|\ \ | | | | | | Initial support for multi-core
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| | |
| * | thread: Rename mask to affinity_masks.bunnei2018-05-114-5/+6
| | |
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| | |
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| | |
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| | |
| * | wait_tree: Add ideal core and affinity mask.bunnei2018-05-111-0/+2
| | |
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| | |
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| | |
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| | |
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| | |
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| | |
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| | |
| * | wait_tree: Show all threads on all schedulers.bunnei2018-05-111-6/+14
| | |
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-1110-17/+56
| | |
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| | |
| * | core: Implement multicore support.bunnei2018-05-1113-78/+113
| | |
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| | |
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
| | |
* | | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
| | | | | | | | | | | | | | | | | | | | * Stubs for QLaunch * Wiped unrelated stuff * Addressed comment * Dropped GetPopFromGeneralChannelEvent
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * hid: Update mouse/keyboard state * hid: Working analog sticks * hid: Nits * hid: Nits * hid: Update mystery sections * hid: Tweaks
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \ | | | | | | memory_hook: Default virtual destructor in the cpp file
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
| | | | | | | | | | | | | | | Prevents creating multiple copies of the vtable in every translation unit that uses the class. Also silences a -Wweak-vtables warning
* | | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ / | | | | | | | | Avoids propagating logging macros and facilities to files that may not need them. This also allows hiding an internal constant.
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0229-104/+105
|\ \ | | | | | | general: Make formatting of logged hex values more straightforward
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0229-104/+105
| | | | | | | | | | | | | | | | | | This makes the formatting expectations more obvious (e.g. any zero padding specified is padding that's entirely dedicated to the value being printed, not any pretty-printing that also gets tacked on).
* | | Merge pull request #430 from lioncash/vecbunnei2018-05-021-9/+9
|\ \ \ | | | | | | | | vector_math: Ensure members are always initialized
| * | | vector_math: Ensure members are always initializedLioncash2018-05-021-9/+9
| |/ / | | | | | | | | | Ensures that values are always in a well-defined state.
* / / ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ / | | | | | | - This can be used for domain objects as inputs to service functions.
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \ | | | | | | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
| | |
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetSharedFontInOrderOfPriority * Update pl_u.cpp * Ability to use ReadBuffer and WriteBuffer with different buffer indexes, fixed up GetSharedFontInOrderOfPriority * switched to NGLOG * Update pl_u.cpp * Update pl_u.cpp * language_code is actually language code and not index * u32->u64 * final cleanups
* | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
| | | | | | | | All of these variables and functions are related to timings and should be within the namespace.
* | Merge pull request #424 from lioncash/stringbunnei2018-04-308-99/+19
|\ \ | | | | | | string_util: Remove StringFromFormat() and related functions
| * | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-308-99/+19
| | | | | | | | | | | | Given we utilize fmt, we don't need to provide our own functions for formatting anymore
* | | Merge pull request #422 from bunnei/shader-movbunnei2018-04-304-0/+30
|\ \ \ | | | | | | | | Shader instructions MOV_C, MOV_R, and several minor GPU things
| * | | maxwell_3d: Reset vertex counts after drawing.bunnei2018-04-291-0/+10
| | | |
| * | | gl_shader_decompiler: Implement MOV_R.bunnei2018-04-291-1/+2
| | | |
| * | | maxwell_to_gl: Implement type SignedNorm, Size_8_8_8_8.bunnei2018-04-291-0/+12
| | | |
| * | | shader_bytecode: Add decoding for FMNMX instruction.bunnei2018-04-291-0/+2
| | | |
| * | | gl_shader_decompiler: Implement MOV_C.bunnei2018-04-291-0/+5
| | | |
* | | | file_util: Make move constructor/assignment operator and related functions noexceptLioncash2018-04-302-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Without this, it's possible to get compilation failures in the (rare) scenario where a container is used to store a bunch of live IOFile instances, as they may be using std::move_if_noexcept under the hood. Given these definitely don't throw exceptions this is also not incorrect to add either.
* | | | file_util: Add static assertions to ReadBytes() and WriteBytes()Lioncash2018-04-301-2/+6
| |/ / |/| | | | | | | | | | | | | | Ensure that the actual types being passed in are trivially copyable. The internal call to ReadArray() and WriteArray() will always succeed, since they're passed a pointer to char* which is always trivially copyable.
* | | Shaders: Implemented predicate condition 3 (LessEqual) in the fset and fsetp instructions.Subv2018-04-291-0/+7
|/ /
* | Merge pull request #416 from bunnei/shader-ints-p3bunnei2018-04-292-114/+206
|\ \ | | | | | | gl_shader_decompiler: Implement MOV32I, partially implement I2I, I2F
| * | gl_shader_decompiler: Partially implement I2I_R, and I2F_R.bunnei2018-04-292-8/+34
| | |
| * | gl_shader_decompiler: More cleanups, etc. with how we handle register types.bunnei2018-04-291-44/+120
| | |
| * | GLSLRegister: Simplify register declarations, etc.bunnei2018-04-291-63/+31
| | |
| * | shader_bytecode: Add decodings for i2i instructions.bunnei2018-04-291-3/+20
| | |
| * | gl_shader_decompiler: Implement MOV32_IMM instruction.bunnei2018-04-292-2/+7
| | |
* | | Merge pull request #417 from bunnei/lang-codesbunnei2018-04-293-8/+49
|\ \ \ | | | | | | | | set/am: Fix code for getting language codes
| * | | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
| | | |
| * | | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
| |/ /
* / / fermi_2d: Fix surface copy block height.bunnei2018-04-292-2/+7
|/ /
* | file_util: Remove compiler version checks around is_trivially_copyable()Lioncash2018-04-281-8/+0
| | | | | | | | | | | | The minimum clang/GCC versions we support already support this. We can also remove is_standard_layout(), as fread and fwrite only require the type to be trivially copyable.
* | log: Remove old logging macros and functionsLioncash2018-04-272-54/+1
| | | | | | | | Now that the old macros are no longer used, we can remove all functionality related to them.
* | Merge pull request #408 from bunnei/shader-ints-p2bunnei2018-04-271-154/+262
|\ \ | | | | | | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.
| * | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.bunnei2018-04-271-154/+262
| | |
* | | renderer_opengl: Replace usages of LOG_GENERIC with fmt-capable equivalentsLioncash2018-04-271-6/+7
| | |
* | | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
|/ /
* | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2717-39/+39
| |
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2713-13/+140
|\ \ | | | | | | Implemented some useful interfaces needed for games.
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-274-5/+5
| | |
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-26110-2244/+1811
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-263-13/+3
| | | |
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-2310-25/+64
| | | |
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| | | |
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
| | | |
* | | | Merge pull request #406 from lioncash/frontendbunnei2018-04-275-27/+26
|\ \ \ \ | | | | | | | | | | frontends: Move logging macros over to new fmt-capable ones
| * | | | frontends: Move logging macros over to new fmt-capable onesLioncash2018-04-275-27/+26
| | | | |
* | | | | Merge pull request #407 from lioncash/commonbunnei2018-04-274-67/+67
|\ \ \ \ \ | | | | | | | | | | | | common: Move logging macros over to new fmt-capable macros where applicable
| * | | | | common: Move logging macros over to new fmt-capable macros where applicableLioncash2018-04-274-67/+67
| |/ / / /
* / / / / input_common: Move old logging macros over to fmt-capable onesLioncash2018-04-271-3/+3
|/ / / /
* | | | Merge pull request #402 from lioncash/corebunnei2018-04-276-28/+28
|\ \ \ \ | | | | | | | | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalents
| * | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | LOG_GENERIC usages will be amended in a follow-up to keep API changes separate from interface changes, as it will require removing a parameter from the relevant function in the VMManager class.
* | | | | Merge pull request #399 from bunnei/shader-intsbunnei2018-04-272-9/+120
|\ \ \ \ \ | |_|_|/ / |/| | | | Shader decompiler prep for integer instructions
| * | | | gl_shader_decompiler: Boilerplate for handling integer instructions.bunnei2018-04-262-6/+111
| | | | |
| * | | | gl_shader_decompiler: Move color output to EXIT instruction.bunnei2018-04-261-6/+12
| |/ / /
* / / / common: Remove chunk_file.h and linear_disk_cache.hLioncash2018-04-263-792/+0
|/ / / | | | | | | | | | These are unused (and given chunk_file references Dolphin's >SVN< I doubt they were going to be used).
* | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
| | |
* | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
| | |
* | | Merge pull request #396 from Subv/shader_opsbunnei2018-04-262-9/+89
|\ \ \ | | | | | | | | Shaders: Implemented the FSET instruction.
| * | | Shaders: Added bit decodings for the I2I instruction.Subv2018-04-251-0/+6
| | | |
| * | | Shaders: Implemented the FSET instruction.Subv2018-04-251-0/+53
| | | | | | | | | | | | | | | | This instruction is similar to the FSETP instruction, but it doesn't set a predicate, it sets the destination register to 1.0 if the condition holds, and 0 otherwise.
| * | | Shaders: Added decodings for the FSET instructions.Subv2018-04-252-9/+30
| | | |
* | | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \ \ | | | | | | | | | | kernel: Migrate logging macros to fmt-compatible ones
| * | | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| | | | | | | | | | | | | | | | | | | | Functions don't need to be terminated by semicolons.
| * | | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
| | | | |
* | | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-2610-52/+203
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partially implemented the 2D surface copy engine
| * | | | | GPU: Partially implemented the Fermi2D surface copy operation.Subv2018-04-252-0/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The hardware allows for some rather complicated operations to be performed on the data during the copy, this is not implemented. Only same-format same-size raw copies are implemented for now.
| * | | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
| | | | | |
| * | | | | GPU: Make the Textures::CopySwizzledData function accessible from the outside of the file.Subv2018-04-252-3/+6
| | | | | |
| * | | | | GPU: Added a function to retrieve the bytes per pixel of the render target formats.Subv2018-04-252-0/+15
| | | | | |
| * | | | | GPU: Added surface copy registers to Fermi2DSubv2018-04-251-1/+57
| | | | | |
| * | | | | GPU: Added boilerplate code for the Fermi2D engineSubv2018-04-253-3/+34
| | | | | |
| * | | | | GPU: Reduce the number of registers of Maxwell3D to 0xE00.Subv2018-04-252-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | The rest are just macro shim registers.
| * | | | | GPU: Move the Maxwell3D macro uploading code to the inside of the Maxwell3D processor.Subv2018-04-254-40/+23
| | | | | | | | | | | | | | | | | | | | | | | | It doesn't belong in the PFIFO handler.
| * | | | | GPU: Corrected the upper bound of the PFIFO method ids in the command processor.Subv2018-04-251-1/+1
| | | | | |
* | | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | file-sys: Move logging macros over to the new fmt-capable ones
| * | | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Lessens the amount to read and gets rid of the PRIX64 macro, allowing us to use a single string for the whole path, making it easier to read.
| * | | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \ \ | | | | | | | | | | | | Service/PCTL: convert to module, add services, stub
| * | | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / / / | | | | | | | | | | | | | | | PCTL::CreateServiceWithoutInitialize and IParentalControlService::Initialize, required by Kirby Star Allies
* | | | | Merge pull request #397 from lioncash/corebunnei2018-04-251-24/+26
|\ \ \ \ \ | |_|/ / / |/| | | | core/memory: Move logging macros over to the new fmt-capable ones
| * | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
| | | | | | | | | | | | | | | | | | | | Addresses are 64-bit, these formatting specifiers are simply holdovers from citra. Adjust them to be the correct width.
| * | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
| |/ / / | | | | | | | | | | | | While we're at it, correct addresses to print all 64 bits where applicable, which were holdovers from citra.
* / / / video-core: Move logging macros over to new fmt-capable onesLioncash2018-04-255-18/+20
|/ / /
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-2514-175/+334
|\ \ \ | | | | | | | | Refactor rasterizer cache
| * | | renderer_opengl: Use correct byte order for framebuffer pixel format ABGR8.bunnei2018-04-251-2/+1
| | | |
| * | | gl_rasterizer_cache: Use CHAR_BIT for bpp conversions instead of 8.bunnei2018-04-252-4/+4
| | | |
| * | | gl_rasterizer_cache: Use GPU PAGE_BITS/SIZE, not CPU.bunnei2018-04-251-5/+5
| | | |
| * | | gl_rasterizer_cache: Use new logger.bunnei2018-04-251-4/+4
| | | |
| * | | gl_rasterizer_cache: Add a function for finding framebuffer GPU address.bunnei2018-04-253-0/+31
| | | |
| * | | gl_rasterizer_cache: Handle compressed texture sizes.bunnei2018-04-252-24/+65
| | | |
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-2510-67/+122
| | | |
| * | | memory_manager: Add implement CpuToGpuAddress.bunnei2018-04-242-0/+27
| | | |
| * | | memory_manager: Make GpuToCpuAddress return an optional.bunnei2018-04-247-28/+37
| | | |
| * | | memory_manager: Use GPUVAdddr, not PAddr, for GPU addresses.bunnei2018-04-247-60/+57
| | | |
* | | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | Merge pull request #386 from Subv/gpu_querybunnei2018-04-242-2/+53
|\ \ \ | | | | | | | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.
| * | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.Subv2018-04-242-2/+53
| | | | | | | | | | | | | | | | | | | | This is based on research from nouveau. Many things are currently unknown and will require hwtests in the future. This commit also stubs QueryMode::Write2 to do the same as Write. Nouveau code treats them interchangeably, it is currently unknown what the difference is.
* | | | Merge pull request #392 from lioncash/logbunnei2018-04-2438-297/+298
|\ \ \ \ | | | | | | | | | | service: Move logging macros over to the new fmt-compatible ones
| * | | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| | | | |
| * | | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| | | | |
| * | | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| | | | |
| * | | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | | | |
| * | | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| | | | |
| * | | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| | | | |
| * | | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| | | | |
| * | | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| | | | |
| * | | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| | | | |
| * | | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | | | |
| * | | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| | | | |
| * | | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | | | |
| * | | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| | | | |
| * | | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| | | | |
| * | | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | | | |
| * | | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| | | | |
| * | | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | | | |
| * | | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | | | |
| * | | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| | | | |
| * | | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
| | | | |
* | | | | renderer_opengl: Silence a -Wdangling-else warning in DrawScreenTriangles()Lioncash2018-04-241-1/+2
|/ / / /
* | | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
| | | |
* | | | Merge pull request #379 from Subv/multi_buffersbunnei2018-04-243-43/+89
|\ \ \ \ | | | | | | | | | | GPU: Support multiple enabled vertex arrays.
| * | | | GPU: Support multiple enabled vertex arrays.Subv2018-04-233-43/+89
| |/ / / | | | | | | | | | | | | | | | | | | | | The vertex arrays will be copied to the stream buffer one after the other, and the attributes will be set using the ARB_vertex_attrib_binding extension. yuzu now thus requires OpenGL 4.3 or the ARB_vertex_attrib_binding extension.
* | | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2316-525/+285
|\ \ \ \ | | | | | | | | | | Kernel: Reworked the new kernel synchronization primitives.
| * | | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Verified with a hwtest and implemented based on reverse engineering. Thread A's priority will get bumped to the highest priority among all the threads that are waiting for a mutex that A holds. Once A releases the mutex and ownership is transferred to B, A's priority will return to normal and B's priority will be bumped.
| * | | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| | | | |
| * | | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-215-90/+55
| | | | |
| * | | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| | | | |
| * | | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| | | | |
| * | | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| | | | | | | | | | | | | | | | | | | | They work in tandem with guest code to provide synchronization primitives along with svcArbitrateLock/Unlock
| * | | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Switch mutexes are no longer kernel objects, they are managed in userland and only use the kernel to handle the contention case. Mutex addresses store a special flag value (0x40000000) to notify the guest code that there are still some threads waiting for the mutex to be released. This flag is updated when a thread calls ArbitrateUnlock. TODO: * Fix svcWaitProcessWideKey * Fix svcSignalProcessWideKey * Remove the Mutex class.
* | | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \ \ | | | | | | | | | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.
| * | | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | Also added a consistency check and a comment for the case when the object id is different than its handle. The real nvservices doesn't make a distinction between ids and handles, each object gets an unique handle which doubles as its id.
| * | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / / | |/| | | | | | | | | | | | | It takes a previously-reserved (AllocateSpace) GPU memory address and maps it to the address of the nvmap object passed to Remap.
* | | | | Merge pull request #385 from Subv/unimpl_ioctlsbunnei2018-04-235-5/+5
|\ \ \ \ \ | | | | | | | | | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.
| * | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ / / /
* | | | | Merge pull request #383 from Subv/gpu_mmubunnei2018-04-232-34/+25
|\ \ \ \ \ | | | | | | | | | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 pagetable bits.
| * | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 page table bits.Subv2018-04-232-34/+25
| |/ / / / | | | | | | | | | | | | | | | Also removed some dead code and added memory map consistency asserts.
* | | / / GPU: Implement the RGB10_A2 RenderTarget format, it will use the same format as the A2BGR10 texture format.Subv2018-04-232-0/+4
| |_|/ / |/| | |
* | | | GPU: Implement the A2BGR10 texture format.Subv2018-04-224-6/+18
|/ / /
* | | Merge pull request #377 from adityaruplaha/sdl2-fullscreenbunnei2018-04-213-4/+40
|\ \ \ | | | | | | | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)
| * | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)adityaruplaha2018-04-213-4/+40
| | | |
* | | | Merge pull request #376 from bunnei/shader-decoderbunnei2018-04-212-210/+249
|\ \ \ \ | | | | | | | | | | Shader opcode decoding
| * | | | gl_shader_decompiler: Skip RRO instruction.bunnei2018-04-211-0/+4
| | | | |
| * | | | gl_shader_decompiler: Cleanup error logging.bunnei2018-04-211-14/+6
| | | | |
| * | | | shader_bytecode: Add several more instruction decodings.bunnei2018-04-211-5/+52
| | | | |
| * | | | shader_bytecode: Decode instructions based on bit strings.bunnei2018-04-212-205/+201
| | | | |
* | | | | Merge pull request #375 from lioncash/headerbunnei2018-04-214-11/+0
|\ \ \ \ \ | |/ / / / |/| | | | opengl: Remove unnecessary header inclusions
| * | | | opengl: Remove unnecessary header inclusionsLioncash2018-04-214-11/+0
| | | | |
* | | | | Merge pull request #369 from Subv/shader_instr2bunnei2018-04-212-4/+179
|\ \ \ \ \ | | | | | | | | | | | | ShaderGen: Implemented fsetp/kil and predicated instruction execution.
| * | | | | ShaderGen: Implemented the KIL instruction, which is equivalent to 'discard'.Subv2018-04-211-1/+7
| | | | | |
| * | | | | ShaderGen: Implemented predicated instruction execution.Subv2018-04-212-1/+40
| | | | | | | | | | | | | | | | | | | | | | | | Each predicated instruction will be wrapped in an `if (predicate) { instruction_body; }` in the GLSL, where `predicate` is one of the predicate boolean variables previously set by fsetp.
| * | | | | ShaderGen: Implemented the fsetp instruction.Subv2018-04-212-3/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Predicate variables are now added to the generated shader code in the form of 'pX' where X is the predicate id. These predicate variables are initialized to false on shader startup and are set via the fsetp instructions. TODO: * Not all the comparison types are implemented. * Only the single-predicate version is implemented.
| * | | | | ShaderGen: Register id 255 is special and is hardcoded to return 0 (SR_ZERO).Subv2018-04-202-0/+5
| | | | | |
| * | | | | ShaderGen: Ignore the 'sched' instruction when generating shaders.Subv2018-04-201-0/+16
| | |_|/ / | |/| | | | | | | | | | | | | The 'sched' instruction has a very convoluted encoding, but fortunately it seems to only appear on a fixed interval (once every 4 instructions).
* | | | | Merge pull request #374 from lioncash/noexceptbunnei2018-04-211-20/+19
|\ \ \ \ \ | | | | | | | | | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operators
| * | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operatorsLioncash2018-04-211-20/+19
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Standard library containers may use std::move_if_noexcept to perform move operations. If a move cannot be performed under these circumstances, then a copy is attempted. Given we only intend for these types to be move-only this can be somewhat problematic. By defining these to be noexcept we prevent cases where copies may be attempted.
* | | | | Merge pull request #373 from lioncash/enum2bunnei2018-04-211-4/+9
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Make MatchFlags an enum class
| * | | | | gl_rasterizer_cache: Make MatchFlags an enum classLioncash2018-04-211-4/+9
| |/ / / / | | | | | | | | | | | | | | | Prevents implicit conversions and scope pollution.
* | | | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \ \ \ | | | | | | | | | | | | resource_limit: Make ResourceTypes an enum class
| * | | | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
| |/ / / / | | | | | | | | | | | | | | | Prevents enum identifiers from leaking into the surrounding scope.
* / / / / core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / / / | | | | | | | | | | | | | | | | Converts the service manager from a global into an instance-based variable.
* | | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ \ | |/ / / |/| | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution output
| * | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
| | | | | | | | | | | | | | | | | | | | both SetLayerVisibility() functions used in Lego games, GetDisplayResolution() fixed according switchbrew.org
* | | | Merge pull request #367 from lioncash/clampbunnei2018-04-205-24/+22
|\ \ \ \ | | | | | | | | | | math_util: Remove the Clamp() function
| * | | | math_util: Remove the Clamp() functionLioncash2018-04-205-24/+22
| | | | | | | | | | | | | | | | | | | | | | | | | C++17 adds clamp() to the standard library, so we can remove ours in favor of it.
* | | | | Merge pull request #361 from lioncash/commonbunnei2018-04-201-18/+12
|\ \ \ \ \ | | | | | | | | | | | | common_types: Minor changes
| * | | | | common_types: Convert typedefs to using aliasesLioncash2018-04-201-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | May as well while we're making changes to this file.
| * | | | | common_types: Remove unnecessary check for whether or not__func__ is definedLioncash2018-04-201-6/+0
| |/ / / / | | | | | | | | | | | | | | | VS has supported this for quite a while.
* | | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \ \ | | | | | | | | | | | | service: Use nested namespace specifiers where applicable
| * | | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| |/ / / / | | | | | | | | | | | | | | | Tidies up namespace declarations
* | | | | Merge pull request #364 from lioncash/thread-localbunnei2018-04-201-19/+0
|\ \ \ \ \ | | | | | | | | | | | | common/thread: Remove unnecessary feature checking for thread_local
| * | | | | common/thread: Remove unnecessary feature checking for thread_localLioncash2018-04-201-19/+0
| |/ / / / | | | | | | | | | | | | | | | Every compiler we require already supports it.
* | | | | Merge pull request #362 from lioncash/snprintfbunnei2018-04-201-5/+0
|\ \ \ \ \ | | | | | | | | | | | | common_funcs: Remove check for VS versions that we don't even support
| * | | | | common_funcs: Remove check for VS versions that we don't even supportLioncash2018-04-201-5/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | We don't support any VS versions that don't already have snprintf in the standard library implementation.
* | | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-203-5/+4
|\ \ \ \ \ | | | | | | | | | | | | common_funcs: Remove ARRAY_SIZE macro
| * | | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-203-5/+4
| |/ / / / | | | | | | | | | | | | | | | C++17 has non-member size() which we can just call where necessary.
* | | | | Merge pull request #366 from lioncash/vecbunnei2018-04-201-30/+0
|\ \ \ \ \ | | | | | | | | | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]
| * | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]Lioncash2018-04-201-30/+0
| | | | | | | | | | | | | | | | | | | | | | | | These are all unused and the Write() ones should arguably not even be in the interface. There are better ways to provide this if we ever need it (like iterators).
* | | | | | Merge pull request #365 from lioncash/codeblockbunnei2018-04-202-86/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | common: Remove code_block.h
| * | | | | | common: Remove code_block.hLioncash2018-04-202-86/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | We use dynarmic, so this is unued. Anything else we need will likely use Xbyak, so this header isn't necessary any more.
* | | | | | Merge pull request #357 from lioncash/guardbunnei2018-04-202-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | renderer_opengl: Add missing header guards
| * | | | | | renderer_opengl: Add missing header guardsLioncash2018-04-202-0/+4
| |/ / / / /
* | | | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | disk_filesystem: Minor changes
| * | | | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| | | | | | |
| * | | | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| | | | | | |
| * | | | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / / / /
* / / / / / vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / / / /
* | | | | Merge pull request #356 from lioncash/shaderbunnei2018-04-201-12/+30
|\ \ \ \ \ | |/ / / / |/| | | | glsl_shader_decompiler: Minor API changes to ShaderWriter
| * | | | glsl_shader_decompiler: Use std::string_view instead of std::string for AddLine()Lioncash2018-04-201-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to take ownership of the string data being given to it, considering all we do is append the characters to the internal string instance. Instead, use a string view to simply reference the string data without any potential heap allocation. Now anything that is a raw const char* won't need to be converted to a std::string before appending.
| * | | | glsl_shader_decompiler: Add AddNewLine() function to ShaderWriterLioncash2018-04-201-6/+12
| | | | | | | | | | | | | | | | | | | | Avoids constructing a std::string just to append a newline character
| * | | | glsl_shader_decompiler: Add char overload for ShaderWriter's AddLine()Lioncash2018-04-201-4/+11
| | | | | | | | | | | | | | | | | | | | Avoids constructing a std::string just to append a character.
| * | | | glsl_shader_decompiler: Append indentation without constructing a separate std::stringLioncash2018-04-201-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | The interface of std::string already lets us append N copies of a character to an existing string.
* | | | | Merge pull request #355 from Subv/shader_instrbunnei2018-04-202-11/+39
|\ \ \ \ \ | |/ / / / |/| | | | ShaderGen: Fixed TEXS overriding its own texcoords and implemented fmul32i
| * | | | ShaderGen: Implemented the fmul32i shader instruction.Subv2018-04-192-9/+30
| | | | |
| * | | | ShaderGen: Fixed a case where the TEXS instruction would use the same registers for the input and the output.Subv2018-04-191-2/+9
| | | | | | | | | | | | | | | | | | | | It will now save the coords before writing the outputs in a subscope.
* | | | | Implement Pull #3528 from citra: use nvidia graphics automatically on laptops with optimus (with AMD support) (#271)N00byKing2018-04-192-0/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Port 3528: use nvidia graphics automatically on laptops with optimus * Force dedicated AMD Card for switchable Graphics * Ran clang-format
* | | | | Merge pull request #352 from bunnei/fix-microprofileJames Rowe2018-04-191-0/+3
|\ \ \ \ \ | |/ / / / |/| | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.
| * | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
| | | | |
* | | | | GPU: Add support for the DXT23 and DXT45 compressed texture formats.Subv2018-04-193-28/+35
| | | | |
* | | | | Merge pull request #351 from Subv/tex_formatsbunnei2018-04-194-8/+28
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the B5G6R5 format.
| * | | | | GPU: Implemented the B5G6R5 format.Subv2018-04-194-8/+28
| | | | | |
* | | | | | gl_shader_gen: Support vertical/horizontal viewport flipping. (#347)bunnei2018-04-184-5/+29
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | * gl_shader_gen: Support vertical/horizontal viewport flipping. * fixup! gl_shader_gen: Support vertical/horizontal viewport flipping.
* | | | | GLCache: Added boilerplate code to make supporting configurable texture component types.Subv2018-04-183-9/+69
| | | | | | | | | | | | | | | | | | | | For now only the UNORM type is supported.
* | | | | GLCache: Unify texture and framebuffer formats when converting to OpenGL.Subv2018-04-182-26/+13
| | | | |
* | | | | GPU: Texture format 8 and framebuffer format 0xD5 are actually ABGR8.Subv2018-04-182-10/+10
| | | | |
* | | | | GPU: Pitch textures are now supported, don't assert when encountering them.Subv2018-04-181-2/+3
| | | | |
* | | | | GLCache: Take into account the texture's block height when caching and unswizzling.Subv2018-04-183-43/+43
| | | | |
* | | | | GLCache: Added a function to convert cached PixelFormats back to texture formats.Subv2018-04-181-0/+12
| | | | | | | | | | | | | | | | | | | | TODO: The way we handle cached formats must change, framebuffer and texture formats are too different to keep them in the same place.
* | | | | GPU: Allow using a configurable block height when unswizzling textures.Subv2018-04-184-7/+23
| | | | |
* | | | | GPU/TIC: Added the pitch and block height fields to the TIC structure.Subv2018-04-181-1/+16
|/ / / /
* | | | Merge pull request #346 from bunnei/misc-gpu-improvementsbunnei2018-04-184-2/+11
|\ \ \ \ | | | | | | | | | | Misc gpu improvements
| * | | | gl_rasterizer_cache: Add missing LOG statements.bunnei2018-04-181-0/+3
| | | | |
| * | | | texture: Add missing formats.bunnei2018-04-181-1/+3
| | | | |
| * | | | gpu: Add several framebuffer formats to RenderTargetFormat.bunnei2018-04-181-0/+3
| | | | |
| * | | | maxwell3d: Allow Texture2DNoMipmap as Texture2D.bunnei2018-04-181-1/+2
| | | | |
* | | | | Merge pull request #344 from bunnei/shader-decompiler-p2bunnei2018-04-184-73/+180
|\ \ \ \ \ | | | | | | | | | | | | Shader decompiler changes part 2
| * | | | | shader_bytecode: Make ctor's constexpr and explicit.bunnei2018-04-181-7/+7
| | | | | |
| * | | | | bit_field: Remove is_pod check, add is_trivially_copyable_v.bunnei2018-04-181-6/+1
| | | | | |
| * | | | | gl_shader_decompiler: Fix warnings with MarkAsUsed.bunnei2018-04-171-1/+2
| | | | | |
| * | | | | gl_shader_decompiler: Cleanup logging, updating to NGLOG_*.bunnei2018-04-171-24/+22
| | | | | |
| * | | | | gl_shader_decompiler: Implement several MUFU subops and abs_d.bunnei2018-04-171-7/+21
| | | | | |
| * | | | | gl_shader_decompiler: Fix swizzle in GetRegister.bunnei2018-04-171-1/+1
| | | | | |
| * | | | | gl_shader_decompiler: Implement FMUL/FADD/FFMA immediate instructions.bunnei2018-04-172-12/+53
| | | | | |
| * | | | | gl_shader_decompiler: Allow vertex position to be used in fragment shader.bunnei2018-04-172-16/+18
| | | | | |
| * | | | | gl_shader_decompiler: Implement IPA instruction.bunnei2018-04-171-0/+11
| | | | | |
| * | | | | gl_shader_decompiler: Add support for TEXS instruction.bunnei2018-04-172-12/+43
| | | | | |
| * | | | | gl_shader_decompiler: Use fragment output color for GPR 0-3.bunnei2018-04-171-0/+5
| | | | | |
| * | | | | gl_shader_decompiler: Partially implement MUFU.bunnei2018-04-171-2/+11
| |/ / / /
* / / / / renderer_opengl: Implement BlendEquation and BlendFunc.bunnei2018-04-186-7/+140
|/ / / /
* | | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ \ | |/ / / |/| | | file_sys: Add HFS/PFS helper component
| * | | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| | | |
| * | | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| | | |
| * | | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
| | | |
* | | | Merge pull request #343 from Subv/tex_wrap_4bunnei2018-04-171-0/+7
|\ \ \ \ | | | | | | | | | | GPU: Implement some wrap modes
| * | | | MaxwellToGL: Implemented tex wrap mode 1 (Wrap, GL_REPEAT).Subv2018-04-171-0/+2
| | | | |
| * | | | MaxwellToGL: Added a TODO and partial implementation of maxwell wrap mode 4 (Clamp, GL_CLAMP).Subv2018-04-171-0/+5
| |/ / / | | | | | | | | | | | | This clamp mode was removed from OpenGL as of 3.1, we can emulate it by using GL_CLAMP_TO_BORDER to get the border color of the texture, and then manually sampling the edge to mix them in the fragment shader.
* | | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated ACC with more service names * Updated SVC with more service names * Updated set with more service names * Updated sockets with more service names * Updated SPL with more service names * Updated time with more service names * Updated vi with more service names
* | | | gl_rendering: Use NGLOG* for changed code.bunnei2018-04-172-10/+11
| | | |
* | | | gl_rasterizer: Implement indexed vertex mode.bunnei2018-04-175-23/+92
|/ / /
* | | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \ \ | | | | | | | | pl_u: Use empty shared font if none is available.
| * | | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
| | | | | | | | | | | | | | | | - Makes games work in lieu of shared_font.bin.
* | | | Merge pull request #337 from Subv/used_buffersbunnei2018-04-155-12/+59
|\ \ \ \ | | | | | | | | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl
| * | | | GPU: Use the same buffer names in the generated GLSL and the buffer uploading code.Subv2018-04-154-17/+24
| | | | |
| * | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl.Subv2018-04-153-7/+47
| | | | | | | | | | | | | | | | | | | | The bindpoints will now be dynamically calculated based on the number of buffers used by the previous shader stage.
* | | | | Merge pull request #335 from bunnei/delete-filebunnei2018-04-156-9/+27
|\ \ \ \ \ | |/ / / / |/| | | | fsp_srv: Implement DeleteFile.
| * | | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
| |/ / / | | | | | | | | | | | | - Used by Binding of Isaac.
* | | | GPU: Don't use GetPointer when uploading the constbuffer data to the GPU.Subv2018-04-151-3/+4
| | | |
* | | | GPU: Use the buffer hints from the shader decompiler to upload only the necessary const buffers for each shader stage.Subv2018-04-153-31/+41
|/ / /
* | | shaders: Expose hints about used const buffers.bunnei2018-04-155-31/+146
| | |
* | | GPU: Upload the entirety of each constbuffer for each shader stage as SSBOs.Subv2018-04-154-14/+48
| | | | | | | | | | | | We're going to need the shader generator to give us a mapping of the actual used const buffers to properly bind them to the shader.
* | | GPU: Allow configuring ssbos in the opengl state manager.Subv2018-04-154-0/+30
| | |
* | | GPU: Added a function to determine whether a shader stage is enabled or not.Subv2018-04-153-3/+27
| | |
* | | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \ \ | | | | | | | | vm_manager: Increase GetTotalMemoryUsage value.
| * | | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
| |/ / | | | | | | | | | - Gets Binding of Isaac running.
* | | Merge pull request #327 from adityaruplaha/fullscreen-fixbunnei2018-04-151-2/+4
|\ \ \ | | | | | | | | Fix the stuck in fullscreen bug
| * | | Fix the stuck in fullscreen bug (Original PR: citra-emu/citra#3611)adityaruplaha2018-04-141-2/+4
| |/ /
* | | Merge pull request #331 from bunnei/fsp-flushbunnei2018-04-151-1/+9
|\ \ \ | | | | | | | | fsp_srv: Implement IFile::Flush.
| * | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
| |/ /
* | | shaders: Add NumTextureSamplers const, remove unused #pragma.bunnei2018-04-154-4/+5
| | |
* | | shaders: Address PR review feedback.bunnei2018-04-142-7/+9
| | |
* | | gl_shader_decompiler: Cleanup log statements.bunnei2018-04-141-15/+15
| | |
* | | shaders: Fix GCC and clang build issues.bunnei2018-04-143-5/+5
| | |
* | | gl_shader_decompiler: Implement negate, abs, etc. and lots of cleanup.bunnei2018-04-142-40/+96
| | |
* | | shader_bytecode: Add FSETP and KIL to GetInfo.bunnei2018-04-141-0/+3
| | |
* | | shader_bytecode: Add SubOp decoding.bunnei2018-04-141-0/+10
| | |
* | | gl_shader_decompiler: Add shader stage hint.bunnei2018-04-142-5/+12
| | |
* | | renderer_opengl: Fix Morton copy byteswap, etc.bunnei2018-04-142-6/+6
| | |
* | | gl_shader_manager: Implement SetShaderSamplerBindings.bunnei2018-04-141-0/+8
| | |
* | | gl_rasterizer: Generate shaders and upload uniforms.bunnei2018-04-142-32/+77
| | |
* | | gl_shader_decompiler: Basic impl. for very simple vertex shaders.bunnei2018-04-142-16/+311
| | | | | | | | | | | | - Tested with Puyo Puyo Tetris and Cave Story+
* | | gl_shader_manager: Cleanup and consolidate uniform handling.bunnei2018-04-142-26/+24
| | |
* | | maxwell_3d: Make memory_manager public.bunnei2018-04-141-2/+1
| | |
* | | maxwell_3d: Fix shader_config decodings.bunnei2018-04-141-6/+3
| | |
* | | gl_rasterizer: Use shader program manager, remove test shader.bunnei2018-04-142-196/+31
| | |
* | | renderer_opengl: Add gl_shader_manager class.bunnei2018-04-143-0/+209
| | |
* | | maxwell_to_gl: Add a few types, etc.bunnei2018-04-141-0/+10
| | |
* | | gl_shader_gen: Add hashable setup/config structs.bunnei2018-04-142-29/+50
| | |
* | | gl_shader_util: Add missing includes.bunnei2018-04-141-0/+2
| | |
* | | common: Port cityhash code from Citra.bunnei2018-04-145-147/+502
| | |
* | | renderer_opengl: Use OGLProgram instead of OGLShader.bunnei2018-04-146-6/+6
| | |
* | | gl_shader_util: Grab latest upstream.bunnei2018-04-142-149/+74
| | |
* | | gl_resource_manager: Grab latest upstream.bunnei2018-04-141-30/+86
| | |
* | | gl_shader_decompiler: Add skeleton code from Citra for shader analysis.bunnei2018-04-142-44/+142
| | |
* | | shader_bytecode: Add initial module for shader decoding.bunnei2018-04-142-0/+298
| | |
* | | bit_field: Make all methods constexpr.bunnei2018-04-141-5/+5
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \ | | | | | | Service/HID: Stubbed out GetPlayerLedPattern
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
| | |
* | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/ /
* | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \ | | | | | | Various service name fixes - part 1
| * | Various fixes and clangHexagon122018-04-116-115/+108
| | |
| * | Decimal changeHexagon122018-04-101-4/+4
| | |
| * | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| | |
| * | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| | |
| * | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| | |
| * | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| | |
| * | Updated hid with more service names.Hexagon122018-04-101-0/+50
| | |
| * | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| | |
| * | Updated the unknown nameHexagon122018-04-101-1/+1
| | |
| * | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| | |
| * | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| | |
| * | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| | |
| * | Updated audren with more service names.Hexagon122018-04-101-10/+14
| | |
| * | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| | |
| * | Updated audout with more service names.Hexagon122018-04-101-13/+16
| | |
| * | Updated audin with more service names.Hexagon122018-04-101-9/+16
| | |
| * | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| | |
| * | Updated AM with more service names.Hexagon122018-04-101-2/+82
| | |
* | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
| | |
* | | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Merge pull request #314 from jroweboy/tegra-progress-3bbunnei2018-04-089-173/+274
|\ \ | | | | | | GPU: Bind uploaded textures when drawing (Rebased)
| * | Fix clang format issuesJames Rowe2018-04-071-1/+1
| | |
| * | GPU: Assert when finding a texture with a format type other than UNORM.Subv2018-04-072-4/+16
| | |
| * | GL: Set up the textures used for each draw call.Subv2018-04-072-2/+39
| | | | | | | | | | | | | | | Each Maxwell shader stage can have an arbitrary number of textures, but we're limited to a certain number in OpenGL. We try to only use the minimum amount of host textures by not keeping a 1:1 relation between guest texture ids and host texture ids, ie, guest texture id 8 can be host texture id 0 if it's the only texture used in the guest shader program. This mapping will have to be passed to the shader decompiler so it can rewrite the texture accesses.
| * | GL: Bind the textures to the shaders used for drawing.Subv2018-04-071-2/+11
| | |
| * | GLCache: Specialize the MortonCopy function for the DXT1 texture format.Subv2018-04-071-1/+15
| | | | | | | | | | | | It will now use the UnswizzleTexture function instead of the MortonCopyPixels128, which doesn't seem to work for textures.
| * | GLCache: Implemented GetTextureSurface.Subv2018-04-071-3/+28
| | |
| * | GLCache: Support uploading compressed textures to the GPU.Subv2018-04-071-5/+17
| | | | | | | | | | | | Compressed texture formats like DXT1, DXT2, DXT3, etc will use this to ease the load on the CPU.
| * | GL: Remove remaining references to 3DS-specific pixel formatsSubv2018-04-071-83/+22
| | |
| * | RasterizerCache: Remove 3DS-specific pixel formats.Subv2018-04-072-71/+32
| | | | | | | | | | | | We're only left with RGB8 and DXT1 for now. More will be added as they are needed.
| * | GL: Create the sampler objects when starting up the GL rasterizer.Subv2018-04-071-0/+6
| | |
| * | GL: Ported the SamplerInfo struct from citra.Subv2018-04-072-1/+59
| | |
| * | GL: Rename PicaTexture to MaxwellTexture.Subv2018-04-072-2/+2
| | |
| * | GL: Added functions to convert Maxwell tex filters and wrap modes to OpenGL.Subv2018-04-071-0/+23
| | |
| * | Textures: Added a helper function to know if a texture is blocklinear or pitch.Subv2018-04-071-0/+5
| | |
* | | Merge pull request #315 from jroweboy/spelling-fixbunnei2018-04-072-3/+3
|\ \ \ | | | | | | | | Fix spelling of Initialize
| * | | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
| |/ /
* / / Prevent crash from uninitialized telemetryJames Rowe2018-04-071-2/+1
|/ /
* | Merge pull request #310 from N00byKing/patch-1bunnei2018-04-065-10/+10
|\ \ | | | | | | Update multiple comments from citra to yuzu
| * | rasterizer_interface.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| | |
| * | default_ini.h: Update from citra to yuzuN00byKing2018-04-041-1/+1
| | |
| * | gl_rasterizer_cache.cpp: Update from citra to yuzuN00byKing2018-04-041-1/+1
| | |
| * | gl_rasterizer_cache.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| | |
| * | renderer_opengl.h: Update from citra to yuzuN00byKing2018-04-041-2/+2
| | |
* | | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-065-1/+17
| | | | | | | | | | | | | | | | | | * core, main.h: Abort on 32Bit ROMs * main.cpp: Fix Grammar
* | | Update fmtlib to fix msvc warningsJames Rowe2018-04-062-5/+8
|/ / | | | | | | | | | | Additionally, when updating fmtlib, there was a change in fmtlib broke how the old logging macro was overloaded, so this works around that by just naming the fmtlib macro impl something different
* | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
| |
* | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
| |
* | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
| |
* | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
| |
* | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
| |
* | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
| |
* | service: Add friend:u interface.bunnei2018-04-034-0/+41
| |
* | logging: Change FmtLogMessage to use variadic template instead of FMT_VARIADICDaniel Lim Wee Soong2018-04-032-5/+11
| | | | | | | | Due to premature merging of #262 I think the build may be failing right now. Should merge this ASAP to fix it.
* | Merge pull request #262 from daniellimws/fmtlib-macrosbunnei2018-04-0311-68/+112
|\ \ | | | | | | Logging: Add fmtlib-based macros
| * | Remove dependency chronoDaniel Lim Wee Soong2018-03-221-1/+0
| | | | | | | | | | | | | | | | | | Earlier chrono was included but after some code changed it was no longer needed Forgot to remove it so I'm removing it now
| * | Change "yuzu starting..." to be logged with the new macroDaniel Lim Wee Soong2018-03-221-1/+1
| | | | | | | | | | | | Just as a proof that it works
| * | Logging: Create logging macros based on fmtlibDaniel Lim Wee Soong2018-03-2210-67/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | Add a new set of logging macros based on fmtlib Similar but not exactly the same as https://github.com/citra-emu/citra/pull/3533 Citra currently uses a different version of fmt, which does not support FMT_VARIADIC so make_args is used instead. On the other hand, yuzu uses fmt 4.1.0 which doesn't have make_args yet so FMT_VARIADIC is used.
* | | Merge pull request #267 from N00byKing/patch-1bunnei2018-04-032-14/+14
|\ \ \ | | | | | | | | Update Dialog from citra to yuzu
| * | | yuzu.cpp: Update Link from citra to yuzuN00byKing2018-03-261-1/+1
| | | |
| * | | main.cpp: Replace Citra with yuzu Wiki LinksN00byKing2018-03-251-4/+4
| | | |
| * | | main.cpp: Update Dialog from citra to yuzuN00byKing2018-03-251-11/+11
| | | |
* | | | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-034-10/+10
|\ \ \ \ | | | | | | | | | | Change Telemetry Names to yuzu and remove links to citra
| * | | | telemetry.h: Reword comment from citra to yuzuN00byKing2018-03-271-1/+1
| | | | |
| * | | | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| | | | |
| * | | | Remove Links to citra ServicesN00byKing2018-03-271-2/+2
| | | | |
| * | | | Change Telemetry Names to yuzuN00byKing2018-03-272-5/+5
| | | | |
* | | | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-032-7/+19
|\ \ \ \ \ | | | | | | | | | | | | Fix build on OpenBSD
| * | | | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Versions prior to this didn't compile on OpenBSD due to unconditional use of the non-standard strtod_l() function. The fmt::MemoryWriter API has been removed in the intervening versions, so replace its use with fmt::memory_buffer and fmt::format_to. The library also no longer provides the fmt::fmt ALIAS, so define it in externals/CMakeLists.txt.
| * | | | | common: fix swap functions on Bitrig and OpenBSDDaniel Lim Wee Soong2018-04-021-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | swap{16,32,64} are defined as macros on the two, but client code tries to invoke them as Common::swap{16,32,64}, which naturally doesn't work. This hack redefines the macros as inline functions in the Common namespace: the bodies of the functions are the same as the original macros, but relying on OS-specific implementation details like this is of course brittle.
* | | | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / / / /
* | | | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \ \ \ | | | | | | | | | | | | hid: Write empty touch screen state.
| * | | | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
| | | | | |
* | | | | | Merge pull request #296 from bunnei/misc-mem-fsp-fixesbunnei2018-04-0210-16/+49
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fix stack region, implement FSP GetSize/SetSize, and some stubs
| * | | | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
| | | | | | |
| * | | | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| | | | | | |
| * | | | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
| | | | | | |
| * | | | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
| | | | | | |
| * | | | | | memory: Fix stack region.bunnei2018-03-316-10/+12
| |/ / / / /
* | | | | | Merge pull request #288 from Subv/macro_interpreterbunnei2018-04-025-121/+444
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GPU: Implemented a gpu macro interpreter
| * | | | | GPU: Use the MacroInterpreter class to execute the GPU macros instead of HLEing them.Subv2018-04-012-121/+13
| | | | | |
| * | | | | GPU: Implemented a gpu macro interpreter.Subv2018-04-015-0/+431
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Ryujinx macro interpreter and envydis were used as reference. Macros are programs that are uploaded by the games during boot and can later be called by writing to their method id in a GPU command buffer.
* | | | | | Merge pull request #293 from N00byKing/drkthmbunnei2018-03-317-0/+79
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add Dark Theme (And Theming in General + Icon Theming)
| * | | | | | Port citra-emu/citra#3610 to yuzuN00byKing2018-03-302-3/+7
| | | | | | |
| * | | | | | Remove whitespacesN00byKing2018-03-301-1/+1
| | | | | | |
| * | | | | | Add Dark theme, Icon themingN00byKing2018-03-307-0/+75
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | configure_general.ui: Add UI Option for Themes config.cpp: Save Theme Settings
* | | | | | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
| | | | | | |
* | | | | | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
| | | | | | |
* | | | | | | service: Add NFP module interface.bunnei2018-03-308-0/+101
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | service: Initialize NFP service. Log: Add NFP service as a log subtype.
* / / / / / result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
|/ / / / / | | | | | | | | | | | | | | | Avoids doing work that doesn't need to be done.
* | | | | Merge pull request #286 from N00byKing/citratoyuzuagainbunnei2018-03-281-5/+2
|\ \ \ \ \ | | | | | | | | | | | | main.h: Add pragma once, remove ifndef
| * | | | | main.h: Add pragma once, remove ifndefN00byKing2018-03-271-5/+2
| | | | | |
* | | | | | Merge pull request #284 from bunnei/docked-configbunnei2018-03-279-61/+88
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Add config for "Docked" mode and various settings cleanup
| * | | | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
| | | | | |
| * | | | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-278-46/+33
| | | | | |
| * | | | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-277-14/+14
| | | | | |
| * | | | | configure_general: Cleanup naming.bunnei2018-03-271-14/+14
| | | | | |
| * | | | | qt: Add config option for is_docked.bunnei2018-03-272-0/+23
| | | | | |
| * | | | | config: Add setting for whether the system is docked or not.bunnei2018-03-275-2/+24
| | | | | |
* | | | | | Merge pull request #282 from N00byKing/patch-2bunnei2018-03-273-3/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Change comments from citra to yuzu
| * | | | | log.h: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| | | | | |
| * | | | | file_util.h: Update Comment from citra to yuzuN00byKing2018-03-261-1/+1
| | | | | |
| * | | | | cpu_detect.cpp: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| |/ / / /
* | | | | renderer_opengl: Use better naming for DrawScreens and DrawSingleScreen.bunnei2018-03-272-8/+8
| | | | |
* | | | | graphics_surface: Remove superfluous cast.bunnei2018-03-271-2/+1
| | | | |
* | | | | gl_rasterizer: Move code to bind framebuffer surfaces before draw to its own function.bunnei2018-03-272-22/+31
| | | | |
* | | | | gl_rasterizer: Add a SyncViewport method.bunnei2018-03-273-18/+30
| | | | |
* | | | | gl_rasterizer: Move PrimitiveTopology check to MaxwellToGL.bunnei2018-03-272-11/+12
| | | | |
* | | | | graphics_surface: Fix merge conflicts.bunnei2018-03-272-3/+4
| | | | |
* | | | | gl_rasterizer: Use ReadBlock instead of GetPointer for SetupVertexArray.bunnei2018-03-271-1/+1
| | | | |
* | | | | gl_rasterizer: Normalize vertex array data as appropriate.bunnei2018-03-272-1/+5
| | | | |
* | | | | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
| | | | |
* | | | | maxwel_to_gl: Fix string formatting in log statements.bunnei2018-03-271-2/+2
| | | | |
* | | | | rasterizer: Rename DrawTriangles to DrawArrays.bunnei2018-03-273-5/+5
| | | | |
* | | | | gl_rasterizer: Use passthrough shader for SetupVertexShader.bunnei2018-03-271-1/+2
| | | | |
* | | | | renderer_opengl: Logging, etc. cleanup.bunnei2018-03-276-33/+34
| | | | |
* | | | | renderer_opengl: Remove framebuffer RasterizerFlushVirtualRegion hack.bunnei2018-03-271-5/+0
| | | | |
* | | | | gl_rasterizer_cache: Implement UpdatePagesCachedCount.bunnei2018-03-272-8/+37
| | | | |
* | | | | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
| | | | |
* | | | | gl_rasterizer: Implement SetupVertexArray.bunnei2018-03-271-20/+38
| | | | |
* | | | | gl_rasterizer_cache: Fix an ASSERT_MSG.bunnei2018-03-271-1/+1
| | | | |
* | | | | maxwell_to_gl: Add module and function for decoding VertexType.bunnei2018-03-272-0/+41
| | | | |
* | | | | maxwell_3d: Use names that match envytools for VertexType.bunnei2018-03-271-8/+8
| | | | |
* | | | | maxwell_3d: Add VertexAttribute struct and cleanup.bunnei2018-03-271-121/+160
| | | | |
* | | | | gl_rasterizer: Use 32 texture units instead of 3.bunnei2018-03-273-2/+3
| | | | |
* | | | | gl_rasterizer: Implement DrawTriangles.bunnei2018-03-271-1/+194
| | | | |
* | | | | Maxwell3D: Call AccelerateDrawBatch on DrawArrays.bunnei2018-03-271-1/+8
| | | | |
* | | | | gl_rasterizer: Implement AnalyzeVertexArray.bunnei2018-03-272-1/+56
| | | | |
* | | | | gl_rasterizer_cache: MortonCopy Switch-style.bunnei2018-03-271-72/+32
| | | | |
* | | | | gl_rasterizer_cache: Implement GetFramebufferSurfaces.bunnei2018-03-272-4/+104
| | | | |
* | | | | maxwell: Add RenderTargetFormat enum.bunnei2018-03-272-4/+5
| | | | |
* | | | | renderer_opengl: Only draw the screen if a framebuffer is specified.bunnei2018-03-271-6/+7
| | | | |
* | | | | GPU: Load the sampler info (TSC) when retrieving active textures.Subv2018-03-262-21/+67
| | | | |
* | | | | GPU: Added the TSC structure. It contains information about the sampler.Subv2018-03-261-0/+50
| | | | |
* | | | | GPU: Added more fields to the TIC structure.Subv2018-03-261-4/+30
|/ / / /
* | | | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \ \ \ | | | | | | | | | | Minor changes to VI, PL, HID, and AUDREN
| * | | | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| | | | |
| * | | | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| | | | |
| * | | | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
| | | | |
* | | | | Merge pull request #273 from Subv/texturesbunnei2018-03-2521-10/+1464
|\ \ \ \ \ | | | | | | | | | | | | GPU: Added code to unswizzle textures and ported the surface viewer from citra
| * | | | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-257-19/+40
| | | | | |
| * | | | | GPU: Added a function to retrieve the active textures for a shader stage.Subv2018-03-242-50/+59
| | | | | | | | | | | | | | | | | | | | | | | | TODO: A shader may not use all of these textures at the same time, shader analysis should be performed to determine which textures are actually sampled.
| * | | | | Frontend: Updated the surface view debug widget to work with Maxwell surfaces.Subv2018-03-243-19/+38
| | | | | |
| * | | | | Frontend: Allow opening the Surface View widget in the Qt frontend.Subv2018-03-242-0/+8
| | | | | |
| * | | | | GPU: Implement the Incoming/FinishedPrimitiveBatch debug breakpoints.Subv2018-03-241-0/+7
| | | | | |
| * | | | | GPU: Implement the MaxwellCommandLoaded/Processed debug breakpoints.Subv2018-03-241-0/+10
| | | | | |
| * | | | | Frontend: Ported the GPU breakpoints and surface viewer widgets from citra.Subv2018-03-2415-4/+1155
| | | | | |
| * | | | | GPU: Added a method to unswizzle a texture without decoding it.Subv2018-03-244-5/+95
| | | | | | | | | | | | | | | | | | | | | | | | Allow unswizzling of DXT1 textures.
| * | | | | GPU: Preliminary work for texture decoding.Subv2018-03-245-0/+139
| |/ / / /
* / / / / Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-258-32/+96
|/ / / /
* | | | arm_dynarmic: Fix timingMerryMage2018-03-241-7/+3
| | | |
* | | | GPU: Added viewport registers to Maxwell3D's reg structure.Subv2018-03-241-1/+18
| | | |
* | | | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-2417-296/+591
|\ \ \ \ | | | | | | | | | | Tegra progress 2
| * | | | gl_rasterizer: Fake render in green, because it's cooler.bunnei2018-03-241-1/+1
| | | | |
| * | | | gl_rasterizer: Log warning instead of sync'ing unimplemented funcs.bunnei2018-03-241-7/+1
| | | | |
| * | | | gl_rasterizer_cache: Add missing include for vm_manager.bunnei2018-03-231-0/+1
| | | | |
| * | | | renderer_opengl: Only invalidate the framebuffer region, not flush.bunnei2018-03-231-4/+3
| | | | |
| * | | | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-232-12/+12
| | | | |
| * | | | memory: Fix typo in RasterizerFlushVirtualRegion.bunnei2018-03-231-3/+3
| | | | |
| * | | | RasterizerCacheOpenGL: FlushAll should flush full memory region.bunnei2018-03-231-1/+1
| | | | |
| * | | | memory: RasterizerFlushVirtualRegion should also check process image region.bunnei2018-03-231-0/+1
| | | | |
| * | | | rasterizer: Flush and invalidate regions should be 64-bit.bunnei2018-03-235-12/+12
| | | | |
| * | | | renderer_opengl: Add framebuffer_transform_flags member variable.bunnei2018-03-231-2/+2
| | | | |
| * | | | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-234-6/+23
| | | | |
| * | | | renderer_opengl: Use accelerated framebuffer load with LoadFBToScreenInfo.bunnei2018-03-231-31/+25
| | | | |
| * | | | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| | | | | | | | | | | | | | | | | | | | - Workaround for texture forwarding until we have a better place.
| * | | | gl_rasterizer: Implement AccelerateDisplay method from Citra.bunnei2018-03-232-2/+44
| | | | |
| * | | | LoadGLBuffer: Use bytes_per_pixel, not bits.bunnei2018-03-231-1/+2
| | | | |
| * | | | memory: Port RasterizerFlushVirtualRegion from Citra.bunnei2018-03-232-1/+58
| | | | |
| * | | | gl_rasterizer_cache: LoadGLBuffer should do a morton copy.bunnei2018-03-231-16/+5
| | | | |
| * | | | video_core: Move MortonCopyPixels128 to utils header.bunnei2018-03-232-111/+113
| | | | |
| * | | | video_core: Remove usage of PAddr and replace with VAddr.bunnei2018-03-235-39/+39
| | | | |
| * | | | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-238-69/+77
| | | | |
| * | | | gl_rasterizer: Replace a bunch of UNIMPLEMENTED with ASSERT.bunnei2018-03-232-20/+20
| | | | |
| * | | | gl_rasterizer: Add a simple passthrough shader in lieu of shader generation.bunnei2018-03-232-5/+68
| | | | |
| * | | | gpu: Expose Maxwell3D engine.bunnei2018-03-231-0/+4
| | | | |
| * | | | maxwell_3d: Add some format decodings and string helper functions.bunnei2018-03-231-3/+107
| | | | |
| * | | | renderer: Create rasterizer and cleanup.bunnei2018-03-234-4/+16
| | | | |
* | | | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-2412-48/+329
|\ \ \ \ \ | | | | | | | | | | | | FS: Implemented access to the SD card
| * | | | | FS: Move the file open mode calculation to a separate function.Subv2018-03-231-7/+14
| | | | | |
| * | | | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-216-7/+29
| | | | | |
| * | | | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | Note that the filter parameter is not yet implemented.
| * | | | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| | | | | |
| * | | | | FS: Implement DiskFileSystem's OpenDirectory interface.Subv2018-03-205-6/+19
| | | | | |
| * | | | | FS: Implement DiskFileSystem::GetEntryType for existing files/directories.Subv2018-03-201-2/+4
| | | | | |
| * | | | | FS: Updated the Directory Entry structure to match the Switch.Subv2018-03-205-30/+84
| | | | | |
| * | | | | FS: Support the file Append open mode.Subv2018-03-202-2/+23
| | | | | |
| * | | | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| | | | | |
| * | | | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-205-0/+79
| | | | | |
* | | | | | Merge pull request #268 from mailwl/sslbunnei2018-03-236-0/+45
|\ \ \ \ \ \ | | | | | | | | | | | | | | Service/SSL: add ssl service
| * | | | | | Service/SSL: add ssl servicemailwl2018-03-236-0/+45
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #270 from N00byKing/patch-2bunnei2018-03-231-4/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | Remove Option for N/3DS from default.ini
| * | | | | | Remove Option for N/3DS from default.iniN00byKing2018-03-231-4/+0
| |/ / / / /
* / / / / / CITRA_ICON -> YUZU_ICONN00byKing2018-03-231-1/+1
|/ / / / /
* | | | | yuzu_cmd: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
| | | | |
* | | | | default_ini: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
| | | | |
* | | | | Remove more N3DS ReferencesN00byKing2018-03-222-20/+0
| | | | |
* | | | | Service/spl: add module and servicesmailwl2018-03-2210-0/+176
| |/ / / |/| | |
* | | | Merge pull request #258 from Subv/gpu_attribsbunnei2018-03-221-3/+27
|\ \ \ \ | | | | | | | | | | GPU: Added vertex attrib format and triangle topology registers
| * | | | GPU: Added vertex attribute format registers.Subv2018-03-211-1/+14
| | | | |
| * | | | GPU: Added registers for the number of vertices to render.Subv2018-03-211-2/+13
| | | | |
* | | | | CMake: Set EMU_ARCH_BITS in CMakeLists.txtN00byKing2018-03-213-36/+0
| | | | |
* | | | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
|/ / / /
* | | | Merge pull request #254 from bunnei/port-citra-rendererbunnei2018-03-2118-101/+2905
|\ \ \ \ | | | | | | | | | | Port Citra OpenGL rasterizer code
| * | | | renderer_gl: Port boilerplate rasterizer code over from Citra.bunnei2018-03-205-1/+495
| | | | |
| * | | | gl_shader_util: Sync latest version with Citra.bunnei2018-03-203-46/+116
| | | | |
| * | | | renderer_gl: Port over gl_shader_gen module from Citra.bunnei2018-03-203-0/+88
| | | | |
| * | | | renderer_gl: Port over gl_shader_decompiler module from Citra.bunnei2018-03-203-0/+87
| | | | |
| * | | | renderer_gl: Port over gl_rasterizer_cache module from Citra.bunnei2018-03-203-0/+1714
| | | | |
| * | | | gl_resource_manager: Sync latest version with Citra.bunnei2018-03-201-8/+77
| | | | |
| * | | | renderer_gl: Port over gl_stream_buffer module from Citra.bunnei2018-03-203-0/+218
| | | | |
| * | | | gl_state: Sync latest version with Citra.bunnei2018-03-202-47/+111
| | | | |
* | | | | Service: add fatal:u, fatal:p servicesmailwl2018-03-2010-0/+146
| | | | |
* | | | | Merge pull request #253 from Subv/rt_depthMat M2018-03-201-1/+48
|\ \ \ \ \ | |/ / / / |/| | | | GPU: Added registers for color and Z buffers.
| * | | | GPU: Added Z buffer registers to Maxwell3D's reg structure.Subv2018-03-191-1/+17
| | | | |
| * | | | GPU: Added the render target (RT) registers to Maxwell3D's reg structure.Subv2018-03-191-1/+32
| |/ / /
* | | | Clang FixesN00byKing2018-03-195-9/+11
| | | |
* | | | oopsN00byKing2018-03-191-3/+3
| | | |
* | | | More Warning cleanupsN00byKing2018-03-193-3/+3
| | | |
* | | | Clean Warnings (?)N00byKing2018-03-1915-20/+20
|/ / /
* | | GPU: Added the TSC registers to the Maxwell3D register structure.Subv2018-03-191-1/+15
| | |
* | | GPU: Added the TIC registers to the Maxwell3D register structure.Subv2018-03-191-1/+16
| | |
* | | Merge pull request #193 from N00byKing/3184_2_robotic_boogaloobunnei2018-03-197-41/+41
|\ \ \ | | | | | | | | Implement Pull #3184 from citra: core/arm: Improve timing accuracy before service calls in JIT (Rebased)
| * | | Implements citra-emu/citra#3184N00byKing2018-02-257-41/+41
| | | |
* | | | Merge pull request #250 from bunnei/buffer-dequeue-waitbunnei2018-03-1910-51/+128
|\ \ \ \ | | | | | | | | | | vi: TransactParcel DequeueBuffer should wait current thread
| * | | | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
| | | | |
| * | | | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
| | | | |
| * | | | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
| | | | |
| * | | | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
| | | | |
| * | | | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-194-23/+9
| | | | |
* | | | | GPU: Implement macro 0xE1A BindTextureInfoBuffer in HLE.Subv2018-03-192-1/+29
|/ / / / | | | | | | | | | | | | This macro simply sets the current CB_ADDRESS to the texture buffer address for the input shader stage.
* | | | GPU: Implement the BindStorageBuffer macro method in HLE.Subv2018-03-182-1/+36
| | | | | | | | | | | | | | | | | | | | | | | | This macro binds the SSBO Info Buffer as the current ConstBuffer. This buffer is usually bound to c0 during shader execution. Games seem to use this macro instead of directly writing the address for some reason.
* | | | GPU: Handle writes to the CB_DATA method.Subv2018-03-182-0/+39
| | | | | | | | | | | | | | | | | | | | | | | | Writing to this method will cause the written value to be stored in the currently-set ConstBuffer plus CB_POS. This method is usually used to upload uniforms or other shader-visible data.
* | | | GPU: Move the GPU's class constructor and destructors to a cpp file.Subv2018-03-183-10/+30
| | | | | | | | | | | | | | | | This should reduce recompile times when editing the Maxwell3D register structure.
* | | | GPU: Store uploaded GPU macros and keep track of the number of method parameters.Subv2018-03-184-27/+74
| | | |
* | | | GPU: Macros are specific to the Maxwell3D engine, so handle them internally.Subv2018-03-188-63/+55
| | | |
* | | | GPU: Renamed ShaderType to ShaderStage as that is less confusing.Subv2018-03-182-19/+19
| | | |
* | | | GPU: Store shader constbuffer bindings in the GPU state.Subv2018-03-182-5/+61
| | | |
* | | | GPU: Corrected some register offsets and removed superfluous macro registers.Subv2018-03-181-9/+3
| | | |
* | | | GPU: Make the SetShader macro call do the same as the real macro's code.Subv2018-03-182-3/+44
| | | | | | | | | | | | | | | | | | | | | | | | It'll now set the CB_SIZE, CB_ADDRESS and CB_BIND registers when it's called. Presumably this SetShader function is binding the constant shader uniforms to buffer 1 (c1[]).
* | | | GPU: Corrected the parameter documentation for the SetShader macro call.Subv2018-03-172-11/+12
| | | | | | | | | | | | | | | | | | | | | | | | Register 0xE24 is actually a macro that sets some shader parameters in the register structure. Macros are uploaded to the GPU at startup and have their own ISA, we'll probably write an interpreter for this in the future.
* | | | Merge pull request #242 from Subv/set_shaderbunnei2018-03-172-4/+38
|\ \ \ \ | | | | | | | | | | GPU: Handle the SetShader method call (0xE24) and store the shader config.
| * | | | GPU: Handle the SetShader method call (0xE24) and store the shader config.Subv2018-03-172-4/+38
| | | | |
* | | | | GPU: Added the vertex array registers.Subv2018-03-171-2/+33
|/ / / /
* | | | Merge pull request #241 from Subv/gpu_method_callbunnei2018-03-179-8/+97
|\ \ \ \ | | | | | | | | | | GPU: Process command mode 5 (IncreaseOnce) differently from other commands
| * | | | GPU: Process command mode 5 (IncreaseOnce) differently from other commands.Subv2018-03-179-8/+97
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Accumulate all arguments before calling the desired method. Note: Maybe we should do the same for the NonIncreasing mode?
* | | | | Merge pull request #239 from Subv/shadersbunnei2018-03-172-2/+63
|\ \ \ \ \ | | | | | | | | | | | | GPU: Added some shader-related registers.
| * | | | | GPU: Assert that we get a 0 CODE_ADDRESS register in the 3D engine.Subv2018-03-171-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | Shader address calculation depends on this value to some extent, we do not currently know what it being 0 entails.
| * | | | | GPU: Added Maxwell registers for Shader Program control.Subv2018-03-171-2/+55
| |/ / / /
* | | | | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
| | | | |
* | | | | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
| | | | |
* | | | | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
| | | | |
* | | | | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-166-2/+18
| | | | |
* | | | | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
| | | | |
* | | | | kernel: Move stack region outside of application heap.bunnei2018-03-166-11/+6
| | | | |
* | | | | memory: Add regions for map region, "new" map region, etc.bunnei2018-03-161-19/+29
| | | | |
* | | | | process: Fix stack memory state.bunnei2018-03-161-2/+4
| | | | |
* | | | | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
| | | | |
* | | | | IGeneralService: fix function listmailwl2018-03-161-2/+3
| | | | |
* | | | | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
| | | | |
* | | | | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
|/ / / /
* | | | core: Move process creation out of global state.bunnei2018-03-1422-72/+87
| | | |
* | | | Merge pull request #213 from Hexagon12/dynarmic-defaultbunnei2018-03-081-1/+1
|\ \ \ \ | | | | | | | | | | Make Dynarmic the default CPU core
| * | | | pls, that was easyHexagon122018-02-141-1/+1
| |/ / /
* | | | GPU: Intercept writes to the VERTEX_END_GL register.Subv2018-03-052-1/+18
| | | | | | | | | | | | | | | | | | | | | | | | This is the register that gets written after a game calls DrawArrays(). We should collect all GPU state and draw using our graphics API here.
* | | | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-0412-43/+91
|\ \ \ \ | | | | | | | | | | FS: Make EnsureSaveData create the save data if it doesn't already exist.
| * | | | FS: Use the correct error code when trying to open files that don't exist.Subv2018-03-042-26/+6
| | | | |
| * | | | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| | | | |
| * | | | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-048-17/+70
| | | | |
* | | | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ / / /
* | | | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ \ \ | | | | | | | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called
| * | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | This prevents a thread starvation issue in Puyo Puyo Tetris. We should hwtest this behavior and figure out where exactly this event is signaled.
* | | | | Service/Set: add more servicesmailwl2018-03-0312-10/+348
|/ / / /
* | | | Merge pull request #216 from Subv/savedatabunnei2018-03-0222-44/+546
|\ \ \ \ | | | | | | | | | | Implemented the SaveData archive and MountSaveData.
| * | | | SaveData: Use the current titleid when opening the savedata archive.Subv2018-03-021-2/+3
| | | | |
| * | | | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-029-26/+25
| | | | | | | | | | | | | | | | | | | | There may be many CodeSets per Process, so it's wasteful and overcomplicated to store the program id in each of them.
| * | | | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| | | | |
| * | | | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-0210-16/+329
| | | | |
| * | | | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| | |_|/ | |/| |
* / | | thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/ / /
* | | Removes the use of QKeySequence::Cancel (#186)Vishal Sharma2018-02-271-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | * Removes the use of QKeySequence::Cancel to remove issues while running make * Corrects characters in a line for travis failure * Corrects space in a line for travis failure
* | | Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ \ \ | |_|/ |/| | IPC: add domain header to response if only it exists in request
| * | Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| | |
| * | Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| | |
| * | IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
| | |
* | | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ \ | | | | | | | | UnmapSharedMemory
| * | | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| | | |
| * | | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | C++11 requires spaces on the Identifier Add inttypes include clang
* | | | file_sys: Style tweaksshinyquagsire232018-02-262-11/+5
| | | | | | | | | | | | | | | | Asdf
* | | | loader: Check error on NPDM load, use TID for CodeSetshinyquagsire232018-02-253-6/+10
| | | |
* | | | loader: Use NPDM information when loading NSOsshinyquagsire232018-02-252-4/+15
| | | |
* | | | file_sys: Add support for parsing NPDM filesshinyquagsire232018-02-253-0/+276
| | | |
* | | | Merge pull request #212 from mailwl/stubsbunnei2018-02-2410-9/+112
|\ \ \ \ | | | | | | | | | | Stub some functions
| * | | | Stub more functionsmailwl2018-02-227-8/+90
| | | | |
| * | | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-225-1/+22
| |/ / /
* | | | Merge pull request #217 from shinyquagsire23/time-s-missingbunnei2018-02-231-0/+4
|\ \ \ \ | | | | | | | | | | time: Add missing time:s functions, used for libnx
| * | | | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
| |/ / /
* | | | Merge pull request #210 from MerryMage/f/dynarmic/sysregbunnei2018-02-232-2/+33
|\ \ \ \ | |/ / / |/| | | arm_dynarmic: Implement system registers and provide more hooks
| * | | dynarmic: Update to 6b4c6b0MerryMage2018-02-211-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 6b4c6b0 impl: Update PC when raising exception 7a1313a A64: Implement FDIV (vector) b2d781d system: Raise exception for YIELD, WFE, WFI, SEV, SEVL b277bf5 Correct FPSR and FPCR 7673933 A64: Implement USHL 8d0e558 A64: Implement UCVTF (vector, integer), scalar variant da9a4f8 A64: Partially implement FCVTZU (scalar, fixed-point) and FCVTZS (scalar, fixed-point) 7479684 A64: Implement system register TPIDR_EL0 0fd75fd A64: Implement system registers FPCR and FPSR 31e370c A64: Implement system register CNTPCT_EL0 9a88fd3 A64: Implement system register CTR_EL0 1d16896 A64: Implement NEG (vector) 3184edf IR: Add IR instruction ZeroVector 31f8fbc emit_x64_floating_point: Add maybe_unused to preprocess parameter 567eb1a A64: Implement FMINNM (scalar) c6d8fa1 A64: Implement FMAXNM (scalar) 616056d constant_pool: Add frame parameter a3747cb A64: Implement ADDP (scalar) 5cd5d9f reg_alloc: Only exchange GPRs dd0452a A64: Implement DUP (element), scalar variant e5732ea emit_x64_floating_point: Correct FP{Max,Min}{32,64} implementations for -0/+0 40eb9c3 A64: Implement FMAX (scalar), FMIN (scalar) 7cef39b fuzz_with_unicorn: QEMU's implementation of FCVT is incorrect 826dce2 travis: Switch unicorn repository 9605f28 a64/config: Allow NaN emulation accuracy to be set e9435bc a64_emit_x64: Add conf to A64EmitContext 30b596d fuzz_with_unicorn: Explicitly test floating point instructions be292a8 A64: Implement FSQRT (scalar) 3c42d48 backend_x64: Accurately handle NaNs 4aefed0 fuzz_with_unicorn: Print AArch64 disassembly
| * | | arm_dynarmic: LOG_INFO on unicorn fallbackMerryMage2018-02-211-0/+4
| | | |
| * | | memory: LOG_ERROR when falling off end of page tableMerryMage2018-02-211-0/+11
| |/ /
* | | Merge pull request #211 from shinyquagsire23/time_localbunnei2018-02-223-0/+9
|\ \ \ | | | | | | | | time: Add GetStandardLocalSystemClock, used by libnx
| * | | time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
| |/ /
* / / core: Fix scheduler-shutdown related crashMerryMage2018-02-211-5/+9
|/ /
* | Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-204-2/+28
|\ \ | | | | | | Service/AOC: stub ListAddOnContent function
| * | Service/AOC: stub ListAddOnContent functionmailwl2018-02-204-2/+28
| | |
* | | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
| | |
* | | service: Add Friend service interface.bunnei2018-02-196-0/+100
| | |
* | | logging: Add category for Friend service.bunnei2018-02-192-0/+2
|/ /
* | Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-1911-379/+239
|\ \ | | | | | | Scheduler cleanup
| * | scheduler: Cleanup based on PR feedback.bunnei2018-02-193-5/+4
| | |
| * | kernel: Use Scheduler class for threading.bunnei2018-02-186-174/+26
| | |
| * | kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-183-0/+210
| | |
| * | core: Use shared_ptr for cpu_core.bunnei2018-02-182-6/+4
| | |
| * | kernel: Remove unused address_arbiter code.bunnei2018-02-185-199/+0
| | |
* | | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ / | | | | | | | | The values are still unknown and the function is still considered a stub. Puyo Puyo Tetris now tries to call fsp-srv:MountSaveData.
* | Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ \ | | | | | | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.
| * | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
| | | | | | | | | | | | | | | | | | | | | | | | Ported from citra PR #3091 The delay specified here is from a Nintendo 3DS, and should be measured in a Nintendo Switch. This change is enough to prevent Puyo Puyo Tetris's main thread starvation.
* | | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ \ | |/ / |/| | Make the fence handling in Vi a little less of a hack.
| * | nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| | | | | | | | | | | | Games like Puyo Puyo Tetris and BOTW seem to depend on the buffer always having the same handle
| * | Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| | |
| * | Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| | |
| * | Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| | | | | | | | | | | | This may break libnx homebrew due to a bug in libnx but is required by official games since they always assume that the buffer will be there.
| * | nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| | |
| * | Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| | |
| * | Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| | |
| * | Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| | |
| * | Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
| | |
* | | Service/hid: stub some functionsmailwl2018-02-164-1/+98
| | |
* | | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
| | |
* | | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-156-0/+182
| | |
* | | log: Add logging category for NS services.bunnei2018-02-152-0/+2
| | |
* | | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/ /
* | Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ \ | | | | | | Refactor IPC buffer descriptor interface
| * | hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| | |
| * | hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| | |
| * | service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| | |
| * | audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| | |
| * | vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| | |
| * | nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| | |
| * | vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| | |
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| | |
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| | |
| * | vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
| | |
* | | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
| |/ |/|
* | Merge pull request #190 from bunnei/fix-qt-waittreebunnei2018-02-141-1/+1
|\ \ | | | | | | debugger: Fix wait_tree crash.
| * | debugger: Fix wait_tree crash.bunnei2018-02-141-1/+1
| |/
* | Merge pull request #191 from lioncash/logbunnei2018-02-1412-57/+82
|\ \ | | | | | | core: Silence formatting specifier warnings
| * | memory: Silence formatting sepecifier warningsLioncash2018-02-141-21/+30
| | |
| * | nso: Silence formatting specifier warningsLioncash2018-02-141-2/+4
| | |
| * | deconstructed_rom_directory: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| | |
| * | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| | |
| * | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| | |
| * | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
| | |
| * | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
| | |
| * | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| | |
| * | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| | |
| * | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
| | |
| * | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| | |
| * | gdbstub: Silence formatting specifier warningsLioncash2018-02-141-6/+9
| |/
* / maxwell_3d: Make constructor explicitLioncash2018-02-141-1/+1
|/
* Merge pull request #187 from Subv/maxwell3d_querybunnei2018-02-143-3/+95
|\ | | | | GPU: Partially implemented the QUERY_* registers in the Maxwell3D engine.
| * GPU: Partially implemented the QUERY_* registers in the Maxwell3D engine.Subv2018-02-123-3/+95
| | | | | | | | Only QueryMode::Write is supported at the moment.
* | audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
| | | | | | | | | | | | * audren_u: Schedule reoccuring event. * audren_u: Stub GetAudioRenderersProcessMasterVolume, and misc. changes.
* | Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\ \ | | | | | | VI cleanup and add a hack for booting games
| * | vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| | |
| * | vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| | |
| * | TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
| | |
* | | Merge pull request #184 from mailwl/lmbunnei2018-02-131-20/+49
|\ \ \ | |/ / |/| | Service/lm: add support to multiline logs
| * | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
| | |
* | | arm_dynarmic: Support direct page table accessMerryMage2018-02-122-10/+19
|/ /
* | Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\ \ | | | | | | Stub RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer
| * | Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
| | |
* | | Merge pull request #178 from Subv/command_buffersbunnei2018-02-1220-23/+364
|\ \ \ | |/ / |/| / | |/ GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-1220-76/+125
| | | | | | | | Also moved the GPU MemoryManager class to video_core since it makes more sense for it to be there.
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-1212-3/+285
| |
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
| |
* | renderer_opengl: Support framebuffer flip vertical.bunnei2018-02-123-5/+13
| |
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
| |
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
|
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-105-58/+102
|
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
|
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
|
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
| | | | - Another fix for libnx.
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
|
* Merge pull request #171 from bunnei/libnx-fixesbunnei2018-02-096-9/+38
|\ | | | | Various fixes for libnx, etc.
| * nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
| |
| * IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
| |
| * nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
| |
| * acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
| |
* | dynarmic: Update to 41ae12263MerryMage2018-02-092-31/+45
|/ | | | Changes: Primarily implementing more A64 instructions
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
|
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-083-0/+162
|
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
|
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
|
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
|
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
|
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\ | | | | Stubs for HID, AM, and a mutex fix
| * mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| |
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| |
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
| |
* | Extra nvdrv support (#162)David2018-02-0617-37/+765
|/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * FinishInitalize needed for 3.0.1+ games * nvdrv:s and nvdrv:t both use NVDRV * Most settings return 0 on hardware, disabled NV_MEMORY_PROFILER for now. NVN_THROUGH_OPENGL & NVRM_GPU_PREVENT_USE are a few interesting settings to look at. Carefully choosing settings can help with drawing graphics later on * Initial /dev/nvhost-gpu support * ZCullBind * Stubbed SetErrorNotifier * Fixed SetErrorNotifier log, Added SetChannelPriority * Allocate GPFIFO Ex2, Allocate Obj Ctx, Submit GPFIFO * oops * Fixed up naming/structs/enums. Used vector instead of array for "gpfifo_entry" * Added missing fixes * /dev/nvhost-ctrl-gpu * unneeded struct * Forgot u32 in enum class * Automatic descriptor swapping for ioctls, fixed nvgpu_gpu_get_tpc_masks_args being incorrect size * nvdrv#QueryEvent * Renamed logs for nvdrv * Refactor ioctl so nv_result isn't needed * /dev/nvhost-as-gpu * Fixed Log service naming, CtxObjects now u32, renamed all structs, added static_asserts to structs, used INSERT_PADDING_WORDS instead of u32s * nvdevices now uses "Ioctl" union, * IoctlGpfifoEntry now uses bit field * final changes
* Merge pull request #164 from ogniK5377/libnx_sm_fixbunnei2018-02-051-0/+2
|\ | | | | Don't call UNIMPLEMENTED for 'empty services', just return error code
| * Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
| |
* | Changed .istorage to .romfsDavid Marcec2018-02-052-5/+5
|/
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
|
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
| | | | - This gets BOTW booting.
* logger: Add Time service logging category.bunnei2018-02-053-10/+12
|
* logger: Add SET service logging category.bunnei2018-02-053-16/+12
|
* logger: Add PCTL service logging category.bunnei2018-02-053-1/+3
|
* logger: Add LM service logging category.bunnei2018-02-053-2/+4
|
* logger: Add APM service logging category.bunnei2018-02-053-2/+5
|
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
|
* logger: Add NIFM service logging category.bunnei2018-02-056-11/+13
|
* logger: Add VI service logging category.bunnei2018-02-056-21/+22
|
* hid: Stub out several functions.bunnei2018-02-051-1/+39
|
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
|
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
|
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
|
* logger: Add AM service logging category.bunnei2018-02-045-42/+44
|
* logger: Add "account" service logging category.bunnei2018-02-043-8/+10
|
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
|
* Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\ | | | | Several SVC fixes and improvements
| * GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| |
| * WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| |
| * svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| |
| * ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
| |
* | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\ | | | | controller: DuplicateSession should return a ClientSession.
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
| |
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-0310-0/+378
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-027-379/+571
| | | | | | * Add AppletAE, step 1: move common interfaces to am.h * Add AppletAE, step 2
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\ | | | | vi::CreateStrayLayer : add padding to request
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
| |
* | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-026-0/+128
|\ \ | | | | | | Services/vi: add vi:s and vi:u services
| * | Services/vi: add vi:s and vi:u servicesmailwl2018-02-026-0/+128
| |/
* | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ | |/ |/| shared_memory: Only mark addresses as invalid if they are within the heap
| * shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
| |
* | [WIP] sfdnsres: stub (#146)mailwl2018-01-305-2/+52
|/ | | sfdnsres: Add several stubs
* Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-2711-441/+273
|\ | | | | memory: Replace all memory hooking with Special regions
| * memory: Replace all memory hooking with Special regionsMerryMage2018-01-2711-441/+273
| |
* | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
| |
* | audout_u: Various cleanups.bunnei2018-01-251-29/+17
| |
* | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
| |
* | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
| |
* | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
| |
* | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
| |
* | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
| |
* | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
| |
* | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
| |
* | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-2510-169/+2
| |
* | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
| |
* | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-254-14/+168
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * audout:u OpenAudioOut implementation and IAudioOut cmd 1,2,3,4,5 implementation * using an enum for audio_out_state as well as changing its initialize to member initializer list * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * added missing Audio loggin subclass, minor fixes, clang comment breakline * Solving backend logging conflict * minor fix * Fixed duplicated Service NVDRV in backend.cpp, my bad
* | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
| |
* | logging: add missing NVDRV subclass to macro listRozlette2018-01-241-0/+1
| |
* | Correct SpellingN00byKing2018-01-231-2/+2
| |
* | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \ | | | | | | IPC: Don't create unnecessary ports when returning sub interfaces.
| * | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| | |
| * | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| | |
| * | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| | |
| * | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| | |
| * | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
| | |
* | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ | |/ / |/| | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the default display.
| * | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| | | | | | | | | | | | This function is used by libnx to obtain a new layer.
| * | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| | | | | | | | | | | | It'll be needed when we implement CreateManagedDisplayLayer.
| * | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
| | | | | | | | | | | | It is now created during Service initialization and passed to all the services that need it.
* | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ | |/ / |/| | Stub OpenAudioOut and fix a issue with HID IAppletResource
| * | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
| | |
* | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-229-363/+452
|/ /
* | Added stubs for audio services. (#116)st4rk2018-01-2212-5/+309
| | | | | | | | | | | | * stubs for audout:u, audin:u, audrec:u, audren:u, codecctl and decoding tables with nullptr for future implementations * fixing the changes requested (remove private, explicit)
* | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \ | | | | | | nvmap: Make IoctlCommands an enum class
| * | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| | | | | | | | | | | | This macro resolves to an empty macro in release builds.
| * | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
| | | | | | | | | | | | Prevents the enum values from polluting the surrounding scope
* | | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-219-5/+163
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid * used clang-format-3.9 instead * lowercase pid * Moved nvmemp handlers to cpp * Removed unnecessary logging for NvOsGetConfigU32. Cleaned up log and changed to LOG_DEBUG * using std::arrays instead of c arrays * nvhost get config now uses std::array completely * added pid logging back * updated cmakelist * missing includes * added array, removed memcpy * clang-format6.0
* | | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ \ | | | | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.
| * | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| | |/ | |/|
* | | file_sys: Clang format fixes.bunnei2018-01-213-4/+4
| | |
* | | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
| | |
* | | deconstructed_rom_directory: Implement istorage loading for RomFS.bunnei2018-01-212-2/+71
| | |
* | | filesystem: Implement basic IStorage functionality.David Marcec2018-01-216-0/+258
| | |
* | | file_sys: Cleanup to better match Switch file system constructs.bunnei2018-01-2110-63/+136
| | | | | | | | | | | | file_sys: Add factory class for RomFS file system.
* | | file_sys: Remove disk_archive, savedata_archive, and title_metadata.bunnei2018-01-217-835/+0
| | |
* | | archive_backend: Minor changes to match Switch IFileSystem.bunnei2018-01-215-26/+26
| | |
* | | file_sys: Repurpose 3DS IVFC code for Switch ROMFS.bunnei2018-01-213-51/+43
| |/ |/|
* | Merge pull request #129 from Rozelette/masterbunnei2018-01-211-113/+155
|\ \ | | | | | | gdbstub: Update registers and sizes for aarch64
| * | gdbstub: Update registers and sizes for aarch64Rozlette2018-01-211-113/+155
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gets gdbstub working at least to the point where clients can communicate with it. What works: - Reading/writing GPRegs - Reading/writing memory - Interrupting the emulated program and continuing What does NOT work: - Breakpoints. Sizes have been updated to u64, but support will need to be added in the interpreter for them to work. - VRegs. Mostly because my gdb was having issues with 128-bit regs for some reason. However, the current u128 representation is a bit awkward to use and should probably be updated first.
* / Fix spelling error in CMakeListsMatthew Brener2018-01-211-1/+1
|/ | | Minor spelling error of its --> it's
* Merge pull request #72 from N00byKing/patch-2bunnei2018-01-211-1/+0
|\ | | | | Implement Pull #3275 from citra: core: Don't Shutdown before we've even Init-ed
| * Update core.cppN00byKing2018-01-171-1/+0
| |
* | Merge pull request #92 from gdkchan/nro_refactorbunnei2018-01-211-2/+2
|\ \ | | | | | | Fix NRO entry point
| * | Fix NRO Entry Pointgdkchan2018-01-181-2/+2
| | |
* | | Merge pull request #122 from tgsm/time-remove-pragmabunnei2018-01-212-4/+0
|\ \ \ | | | | | | | | service/time: remove accidental #pragmas
| * | | service/time: remove accidental #pragmastgsm2018-01-212-4/+0
| | | |
* | | | loader: Minor style fix in deconstructed_rom_directoryRozlette2018-01-211-1/+0
|/ / /
* | | Merge pull request #117 from jroweboy/clang-formatbunnei2018-01-2174-117/+207
|\ \ \ | | | | | | | | Clang format as a build target
| * | | Format: Run the new clang format on everythingJames Rowe2018-01-2174-117/+207
| | | |
* | | | Merge pull request #120 from Rozelette/masterbunnei2018-01-201-0/+3
|\ \ \ \ | | | | | | | | | | memory: Return false for large VAddr in IsValidVirtualAddress
| * | | | memory: Return false for large VAddr in IsValidVirtualAddressRozlette2018-01-201-0/+3
| |/ / /
* | | | loader: Clean up ctors and includes.bunnei2018-01-2010-18/+22
| | | |
* | | | loader: Add DeconstructedRomDirectory for game dumps.bunnei2018-01-205-0/+156
| | | |
* | | | loader: Refactor to also pass filepath into IdentifyType.bunnei2018-01-208-19/+19
| | | |
* | | | nso: Remove code specific to directory loading.bunnei2018-01-202-17/+6
|/ / /
* | | Port citra #3352 to yuzu (#103)River City Ransomware2018-01-203-4/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Port citra #3352 to yuzu This change allows non x86_64 architectures to compile yuzu by skipping the building of dynarmic * Fixed clang-format errors * fixes more clang-format errors
* | | Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added svcCreateSharedMemory * Services which are not implemented now throw UNIMPLEMENTED() * clang-format * changed perms to u32 * removed camelcase
* | | Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-206-21/+22
| | | | | | | | | | | | | | | | | | | | | | | | * Fixes some cast warnings, partially fixes citra #3064 * Converted casts to uint32_t to u32 * Ran clang-format
* | | Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ \ \ | | | | | | | | ISelfController: Stub LockExit and UnlockExit
| * | | ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
| | | |
* | | | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-198-0/+161
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubs for various acc:u0 funcs needed * Stub for GetDesiredLanguage in IApplicationFunctions * Add set service + stubs needed for games * Fix formatting * Implement IProfile, IManagerForApplication, return bool in CheckAvailability, style fixes * Remove IProfile::Get(needs more research), fix IPC response sizes
* | | Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ \ \ | | | | | | | | Fix svcGetInfo for libnx
| * | | nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| | | |
| * | | svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| | | |
| * | | svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
| | | |
* | | | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ \ \ | | | | | | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.
| * | | | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
| | | | |
* | | | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
| | | | |
* | | | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ / / /
* / / / Fix dispdrv typogdkchan2018-01-191-1/+1
|/ / /
* | | Merge pull request #100 from Rozelette/masterbunnei2018-01-197-32/+113
|\ \ \ | | | | | | | | time: Refactor time:* to use a single shared module
| * | | time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| | | |
| * | | time: Refactor time:* to use a single shared moduleRozlette2018-01-187-26/+107
| | | |
* | | | Merge pull request #104 from RiverCityRansomware/resizedConfigWindowbunnei2018-01-191-1/+1
|\ \ \ \ | | | | | | | | | | Port citra #3336
| * | | | Port citra #3336 - Resizes the configuration window to not be so stretched outRiver City Ransomware2018-01-181-1/+1
| | |/ / | |/| |
* | | | qt: Migrate to Qt 5 signal/slot connection syntax where applicableLioncash2018-01-195-31/+31
| | | |
* | | | ui: Rename almost all classes in configuration_input.ui (#99)Evgeni Danailov2018-01-181-66/+66
|/ / / | | | | | | | | | | | | | | | * Rename verticalLayout_25 to verticalLayout_23. * Rename almost all classes.
* | | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stub PopLaunchParameter and implement Buffer C Descriptors reading * Address PR feedback * Ensure we push a u64 not a size_t * Fix formatting
* | | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-187-0/+159
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * run clang-format (2)
* | | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ \ | |/ / |/| | lm: Minor logging fix to skip a byte.
| * | lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
| | |
* | | Merge pull request #84 from lioncash/cmakebunnei2018-01-187-360/+338
|\ \ \ | | | | | | | | CMakeLists: Derive the source directory grouping from targets themselves
| * | | CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-187-360/+338
| | | | | | | | | | | | | | | | | | | | Removes the need to store to separate SRC and HEADER variables, and then construct the target in most cases.
* | | | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ \ \ | | | | | | | | | | svc: Minor clarity changes
| * | | | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| | | | | | | | | | | | | | | | | | | | Makes the codebase a little more consistent with regards to available documentation. Also amends the duplicate case where there was a similar entry at 0x72 named ConnectToPort.
| * | | | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| |/ / / | | | | | | | | | | | | Makes the table match SwitchBrew for these entries
* | | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ \ | | | | | | | | | | vi: Minor clean up/correctness changes
| * | | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ / /
* | | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ \ | | | | | | | | | | vi: Copy data directly into the std::vector within Parcel's ReadBlock function
| * | | | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ / / | | | | | | | | | | | | | | | | Previously this would unnecessarily zero-initialize the vector before copying the actual data into the vector instance.
* | | | Merge pull request #88 from lioncash/includebunnei2018-01-181-0/+1
|\ \ \ \ | | | | | | | | | | hotkeys: Add missing <QTreeWidgetItem> include
| * | | | hotkeys: Add missing <QTreeWidgetItem> includeLioncash2018-01-181-0/+1
| |/ / /
* | | | Merge pull request #87 from lioncash/overridebunnei2018-01-181-1/+1
|\ \ \ \ | | | | | | | | | | game_list: Add missing override specifier for KeyReleaseEater's eventFilter function
| * | | | game_list: Add missing override specifier for KeyReleaseEater's eventFilter functionLioncash2018-01-181-1/+1
| |/ / /
* | | | Merge pull request #86 from lioncash/doxygenbunnei2018-01-181-2/+2
|\ \ \ \ | | | | | | | | | | game_list: Amend doxygen parameter identifiers
| * | | | game_list: Amend doxygen parameter identifiers for containsAllWords()Lioncash2018-01-181-2/+2
| |/ / /
* | | | Merge pull request #85 from lioncash/warnbunnei2018-01-181-2/+2
|\ \ \ \ | |_|/ / |/| | | telemetry: Silence initialization order warnings
| * | | telemetry: Silence initialization order warningsLioncash2018-01-181-2/+2
| |/ /
* | | controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
| | |
* | | Merge pull request #83 from lioncash/pessimizing-movebunnei2018-01-181-1/+1
|\ \ \ | | | | | | | | input_common/sdl: Silence a -Wpessimizing-move warning
| * | | input_common/sdl: Silence a -Wpessimizing-move warningLioncash2018-01-181-1/+1
| |/ /
* | | Merge pull request #81 from lioncash/qt-bootmgrbunnei2018-01-182-7/+6
|\ \ \ | | | | | | | | bootmanager: Minor tidiness/correctness changes
| * | | bootmanager: Minor tidiness/correctness changesLioncash2018-01-182-7/+6
| |/ / | | | | | | | | | Moved over from #3266 in citra.
* | | Merge pull request #80 from gdkchan/nro_fixbunnei2018-01-181-20/+9
|\ \ \ | |/ / |/| | Fix NRO loading
| * | Fix NRO loadinggdkchan2018-01-181-20/+9
| | |
* | | Merge pull request #73 from N00byKing/3093bunnei2018-01-182-0/+2
|\ \ \ | |/ / |/| | Implement Pull #3093 from citra: Added missing headers to CMakeLists.txt and fixed includes.
| * | Update CMakeLists.txtN00byKing2018-01-171-0/+1
| | |
| * | Update title_metadata.hN00byKing2018-01-171-0/+1
| | |
* | | Merge pull request #76 from Rozelette/masterbunnei2018-01-175-85/+164
|\ \ \ | | | | | | | | TIME: consolidate time:* interfaces, stub functions and structs
| * | | TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-175-85/+164
| | | |
* | | | Implement Pull #3306 from citra: citra_qt: Drop Qt 5 version checks in code (#41)N00byKing2018-01-171-13/+1
| | | | | | | | | | | | | | | | | | | | | | | | * Update bootmanager.cpp * This *should* fix the clang error
* | | | Remove relocation on NSO/NROgdkchan2018-01-173-19/+2
|/ / /
* | | Merge pull request #42 from N00byKing/3295bunnei2018-01-171-5/+1
|\ \ \ | | | | | | | | Implement Pull #3295 from citra: citra_qt: CMakeLists: Drop leftover handling code for Qt 4 UI files
| * | | Update CMakeLists.txtN00byKing2018-01-161-5/+1
| |/ /
* | | Merge pull request #57 from nkatz565/fix-trbunnei2018-01-171-1/+2
|\ \ \ | | | | | | | | Fix non translated string (same as Citra PR 2949)
| * | | Fixed formattingnoah katz2018-01-171-2/+2
| | | |
| * | | Fix non translated string (same as Citra PR 2949)noah katz2018-01-171-1/+1
| | | |
* | | | Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ \ \ \ | | | | | | | | | | hid: Adjust timing based on actual hardware
| * | | | hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
| | | | |
* | | | | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ \ \ \ | | | | | | | | | | | | nvdrv: stubbed Close(cmd 2)
| * | | | | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
| | | | | |
* | | | | | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #71 from N00byKing/patch-1bunnei2018-01-171-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3109 from citra: sdl2 default ini: fix framelimit
| * | | | | Update default_ini.hN00byKing2018-01-171-2/+2
| |/ / / /
* | | | | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-175-4/+38
|\ \ \ \ \ | |/ / / / |/| | | | Implement IPC domain command CloseVirtualHandle
| * | | | hle_ipc: Clang format.bunnei2018-01-171-2/+3
| | | | |
| * | | | ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
| | | | |
| * | | | loggin: Add IPC logging category.bunnei2018-01-172-1/+3
| | | | |
* | | | | Fix gdbstub typo, fixes Citra #3318River City Ransomware2018-01-171-1/+1
| |/ / / |/| | | | | | | Core::System().GetInstance().IsPoweredOn() -> Core::System::GetInstance().IsPoweredOn()
* | | | Merge pull request #60 from jroweboy/game-framebunnei2018-01-172-1/+4
|\ \ \ \ | |/ / / |/| | | UI: Fix frame rate perf stats
| * | | UI: Fix frame rate perf statsJames Rowe2018-01-172-1/+4
| | | | | | | | | | | | | | | | Adds in a missing EndGameFrame when nvdrv swaps buffers
* | | | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ \ \ | |/ / / |/| | | hid: Write to all layouts, implement circular buffers, set up controller metadata.
| * | | hid: clang-formatshinyquagsire232018-01-171-3/+3
| | | |
| * | | hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| | | |
| * | | hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
| | | |
* | | | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-176-0/+86
| | | |
* | | | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
| | | |
* | | | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-174-16/+18
| | | |
* | | | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
| | | |
* | | | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
| | | |
* | | | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
| | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/hle/service/am/applet_oe.cpp # src/core/hle/service/apm/apm.cpp
* | | | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
| | | |
* | | | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
| | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/hle/kernel/svc.cpp
* | | | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
| | | |
* | | | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
| | | |
* | | | Merge pull request #52 from ogniK5377/fspbunnei2018-01-176-5/+90
|\ \ \ \ | | | | | | | | | | added more svcGetInfo pairs for 3.0.0+ support, Changed HEAP_SIZE and TLS_AREA_VADDR. changed mem usage & heap usage stub added, ISelfController, IApplication function stubs. Added SetThreadCoreMask
| * | | | Update memory.hDavid2018-01-171-2/+2
| | | | |
| * | | | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| | | | |
| * | | | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| | | | |
| * | | | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| | | | |
| * | | | Increased heap size and changed tls area vaddrDavid Marcec2018-01-161-2/+2
| | |/ / | |/| |
* | | | Merge pull request #45 from FearlessTobi/patch-1bunnei2018-01-161-6/+6
|\ \ \ \ | | | | | | | | | | Implement Pull #3030 from Citra: Rename derivative class name
| * | | | Implement Pull #3030 from CitraTobias2018-01-161-6/+6
| |/ / / | | | | | | | | citra-qt: Rename derivative class name
* | | | Merge pull request #43 from N00byKing/3052bunnei2018-01-161-1/+1
|\ \ \ \ | | | | | | | | | | Implement Pull #3052 from citra: Correct spelling of searchfield in comment
| * | | | Update game_list.cppN00byKing2018-01-161-1/+1
| | |_|/ | |/| |
* | | | Merge pull request #53 from nkatz565/nk-fixlabelsbunnei2018-01-161-25/+52
|\ \ \ \ | | | | | | | | | | Implement Pull #3240 from Citra: Add button labels for sdl joystick mappings
| * | | | Use static functions instead of lambdasmuemart2018-01-161-49/+46
| | | | |
| * | | | Add translation support for button labelsmuemart2018-01-161-14/+15
| | | | |
| * | | | Add button labels for sdl joystick mappingsmuemart2018-01-161-17/+46
| | |/ / | |/| |
* | | | Merge pull request #44 from Rozelette/masterbunnei2018-01-161-3/+7
|\ \ \ \ | | | | | | | | | | nso: Modify .bss size calculation logic
| * | | | nso: Modify .bss size calculation logicRozlette2018-01-161-3/+7
| | |/ / | |/| |
* | | | clang-formatMerryMage2018-01-1625-63/+54
| |/ / |/| |
* | | Merge pull request #31 from jroweboy/fix-deploybunnei2018-01-161-1/+1
|\ \ \ | |/ / |/| | Build/Deploy Updates to Setup Nightly Builds
| * | Build: Automagically handle unicornJames Rowe2018-01-161-1/+1
| | | | | | | | | | | | | | | | | | | | | On MSVC if unicorn isn't found, fallback to bundled unicorn On everything else, fallback to building unicorn in externals Also fixes loading unicorn in msvc
| * | Build: Add unicorn as a submodule and build it if neededJames Rowe2018-01-161-1/+1
| |/ | | | | | | | | | | | | Adds a cmake custom target that will build unicorn on first compile and uses this in the build scripts as well. Updates Appveyor and Travis build scripts to work with the new unicorn build, and updates the paths to all of the different artifacts.
* | Implement Pull #3333 from citra: citra_qt: Pause emulation on CoreError (#39)N00byKing2018-01-162-0/+2
| |
* | Merge pull request #24 from nkatz565/nk-inputsbunnei2018-01-167-191/+524
|\ \ | | | | | | Adding meumart's Citra SDL Joystick support. Citra PR #3116
| * | Adding meumart's Citra SDL Joystick support. Citra PR #3116muemart2018-01-167-191/+524
| | |
* | | Merge citra-emu PR#3159 by FearlessTobi(citra-qt : Fix a bug in our fullscreen implementation)goaaats2018-01-162-15/+31
| | |
* | | Merge citra-emu PR#3001 by Styleoshin(citra-qt : Adding fullscreen mode)goaaats2018-01-165-1/+57
| |/ |/|
* | nso: Load subsdk4 if available.bunnei2018-01-151-1/+1
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
|
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
|
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
|
* settings: Fix button mappings array to have correct entries.bunnei2018-01-151-2/+6
|
* Merge pull request #20 from Andrix44/fixesbunnei2018-01-154-70/+8
|\ | | | | Various fixes
| * Clanggit rebase -i fixesunknown2018-01-151-10/+2
| |
| * Clang formatunknown2018-01-152-4/+10
| |
| * Change default log level to infounknown2018-01-151-1/+1
| |
| * Update the internal resolution settingsunknown2018-01-153-67/+7
| |
* | Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-157-115/+688
|\ \ | |/ |/| HID Sharedmem Impl Start
| * yuzu_cmd: Fix default ini, add screenshot buttonshinyquagsire232018-01-151-1/+2
| |
| * hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| |
| * hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| |
| * configure_input: update w/ Switch buttonsshinyquagsire232018-01-153-90/+221
| |
| * settings: Screenshot buttonshinyquagsire232018-01-151-0/+2
| |
| * yuzu_cmd: fix default inishinyquagsire232018-01-151-9/+17
| |
| * settings: adjust button configs for Switch controllersshinyquagsire232018-01-151-17/+50
| |
| * hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
| |
* | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/
* Merge pull request #14 from ogniK5377/masterbunnei2018-01-151-1/+1
|\ | | | | Changed ICommonStateGetter::ReceiveMessage to allow further execution in games
| * Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
| |
* | renderer_gl: Clear screen to black before rendering framebuffer.bunnei2018-01-152-5/+8
|/
* renderer: Render previous frame when no new one is available.bunnei2018-01-154-17/+22
|
* lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
|
* time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-156-1/+121
|
* audio: Add files to CMake.bunnei2018-01-152-1/+4
|
* hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
|
* audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
|
* hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
|
* qt: Update about dialog to show license for GPLv2 only.bunnei2018-01-141-1/+1
| | | | Fixes #6.
* shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
|
* svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
|
* kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
|
* Remove Surface Viewer stubJannik Vogel2018-01-143-13/+0
|
* Merge pull request #4 from spycrab/aboutdialogbunnei2018-01-146-3/+245
|\ | | | | Implement "About" dialog
| * Implement "About" dialogspycrab2018-01-146-3/+245
| |
* | Add missing FileType declarations in GuessFromExtension and GetFileTypeStringThog2018-01-141-0/+8
|/
* yuzu qt copy windows deps renamedJames Rowe2018-01-141-2/+2
|
* Minor cleanupMerryMage2018-01-147-18/+18
|
* macOS: Update Info.plistMerryMage2018-01-141-34/+34
|
* Add new icons and fix up the linux paths for installJames Rowe2018-01-131-3/+1
|
* Update dynarmic to bc73004MerryMage2018-01-131-12/+17
| | | | | | | | | | | | | | | | | | bc73004 a64_merge_interpret_blocks: Remove debug output 4e656ed tests/A64: Randomize PSTATE.<NZCV> fd9530b A64: Optimization: Merge interpret blocks 3c9eb04 testenv: Use format constants 324f3fc tests/A64: Unicorn interface fixes 98ecbe7 tests/A64: Fuzz against unicorn b1d38e7 tests/A64: Move TestEnvironment to own header 5218ad9 A64/data_processing_pcrel: bug: ADR{,P} instructions sign extend their immediate b1a8c39 A64/data_processing_addsub: bug: {ADD,SUB}S (extended register) instructions write to ZR when d = 31 64827fb a64_emit_x64: bug: A64CallSupervisor trampled callee-save registers 1bfa04d emit_x64: bug: OP m/r64, imm32 form instructions sign-extend their immediate on x64 edadeea A64 inferface: Use two argument static_assert 9ab1304 A64: Add ExceptionRaised IR instruction 6843eed Update readme 7438d07 A64/translate: Add TranslateSingleInstruction function
* Fix build on macOS and linuxMerryMage2018-01-134-6/+7
|
* arm_unicorn: Log unmapped memory access address.bunnei2018-01-131-1/+1
|
* config: Default log filter to trace.bunnei2018-01-133-3/+3
|
* yuzu: Update license text to be consistent across project.bunnei2018-01-1361-61/+61
|
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-134-53/+1
|
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-1317-485/+69
|
* Get yuzu sdl to start compilingJames Rowe2018-01-135-12/+12
|
* Remove gpu debugger and get yuzu qt to compileJames Rowe2018-01-1346-3245/+47
|
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-1377-16444/+4
|
* Massive removal of unused modulesJames Rowe2018-01-13120-5227/+21
|
* config: Default CPU core to Unicorn.bunnei2018-01-133-3/+3
|
* core: Gut out cryptop, since it doesn't compile with C++17.bunnei2018-01-134-126/+7
|
* configuration: Add cpu_core configuration optionMerryMage2018-01-128-16/+40
|
* arm_dynarmic: Implement coreMerryMage2018-01-128-65/+166
|
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
|
* renderer_opengl: Fix LOG_TRACE in LoadFBToScreenInfo.bunnei2018-01-121-1/+1
|
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
|
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
|
* core: Fix recent GCC build breaks.bunnei2018-01-122-2/+4
|
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
|
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
|
* renderer_opengl: Support rendering Switch framebuffer.bunnei2018-01-113-138/+83
|
* render_base: Add a struct describing framebuffer metadata.bunnei2018-01-111-0/+26
|
* renderer_opengl: Add MortonCopyPixels function for Switch framebuffer.bunnei2018-01-111-0/+111
|
* renderer_opengl: Update DrawScreens for Switch.bunnei2018-01-112-23/+11
|
* CMakeLists: Add framebuffer_layout.cpp.bunnei2018-01-111-0/+1
|
* frontend: Update for undocked Switch screen layout.bunnei2018-01-118-279/+43
|
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1111-166/+430
|
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
| | | | This prevents missing frames if the vblank fires between the DequeueBuffer and Wait(vsync) calls
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
|
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
| | | | | | NVFlinger will call into the nvdisp_disp0 device to perform screen flips, bypassing the ioctl interface. We now have the address of the framebuffer to draw, we just need to actually put it on the screen.
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
| | | | | | Don't try to draw buffers that the guest application is using, only queued buffers are eligible for drawing. Drawing actual pixels is still not implemented.
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
|
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
|
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
|
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
|
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-116-0/+726
| | | | The homebrew display test application now properly writes graphics data to the graphics buffer but we still don't have a way to compose the display layers.
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
|
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
|
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
|
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
|
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-105-16/+28
|
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
|
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
|
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
|
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
|
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
|
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-0911-171/+180
|
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
|
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-094-21/+18
| | | | | | Also properly keep track of data in guest memory, this fixes managing the semaphore from userland. It was found that Semaphores are actually Condition Variables, with Release(1) and Release(-1) being equivalent to notify_one and notify_all. We should change the name of the class to reflect this.
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-094-67/+63
|
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
|
* fix macos buildMerryMage2018-01-092-5/+5
|
* core_timing: Use 1.020GHz for core clock rate.bunnei2018-01-091-5/+3
|
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-0912-557/+638
| | | | * CoreTiming: New CoreTiming; Add Test for CoreTiming
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
|
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
|
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
|
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
|
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
|
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
|
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
| | | | They should have 32 bits of padding after the error code now.
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
|
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
|
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
| | | | Popping objects from the buffer is still not implemented.
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
| | | | Service code now doesn't have to deal with this.
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
| | | | Domain object ids are always stored immediately after the raw data.
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
|
* audio: Log dropping frames as trace to reduce spam.bunnei2018-01-071-1/+1
|
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
|
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
|
* nso: Always load the filepath specified by the user.bunnei2018-01-071-1/+3
|
* core_timing: Increase clock speed for Switch docked.bunnei2018-01-073-3/+3
|
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
|
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
|
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
|
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
|
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
|
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
|
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
|
* cmake: Don't compile Dynarmic as it's unused.bunnei2018-01-041-1/+1
|
* core: Increase tight_loop 100x for speed.bunnei2018-01-041-1/+1
|
* citra_qt: Remove VFP registers, since this isn't used anyways and caused an assert.bunnei2018-01-041-4/+0
|
* arm_unicorn: Load/release unicorn DLL.bunnei2018-01-041-0/+16
|
* externals: Use unicorn DLL instead of static lib.bunnei2018-01-042-0/+4
|
* unicorn: Use for arm interface on Windows.bunnei2018-01-044-9/+242
|
* arm_dynarmic: More cleanup.bunnei2018-01-041-6/+0
|
* core: Remove unicorn_dynload.bunnei2018-01-041-2/+0
|
* arm_dynarmic: Gut interface until dynarmic is ready for general use.bunnei2018-01-042-142/+44
|
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-0337-28101/+23
|
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
|
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
|
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
|
* hle: Move SVC code to kernel namespace.bunnei2018-01-034-134/+121
|
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
|
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
|
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
|
* cmake: Add missing object_address_table.bunnei2018-01-011-0/+2
|
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-018-26/+26
|
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
| | | | - This does not matter until we implement other kernel objects, mutexes use svcLockMutex for waiting.
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
|
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
|
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
|
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
|
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
| | | | This is kinda crufty, but we need it for now to update guest state variables.
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
|
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
|
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
|
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
|
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
|
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
|
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
|
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
|
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
|
* svc: Minor cleanups.bunnei2017-12-301-8/+9
|
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
|
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
|
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
|
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
|
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
|
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
|
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
|
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
|
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
|
* service: Add empty interface for pctl:a.bunnei2017-12-296-0/+90
|
* kernel: Add basic support for Domain object.bunnei2017-12-295-4/+112
|
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-294-10/+41
|
* svc: Implement MapMemory.bunnei2017-12-293-4/+17
|
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
|
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
|
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
|
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
|
* service: Add empty interface for aoc:u.bunnei2017-12-284-0/+44
|
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
|
* hle: Use Switch formatted result codes.bunnei2017-11-018-346/+110
|
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
|
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-2310-89/+89
|
* nso: Load more common submodules.bunnei2017-10-231-15/+11
|
* memory: Support 32-bit paging, move heap address space up.bunnei2017-10-232-3/+3
|
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
|
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
|
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
|
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
|
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
|
* memory: Print addresses as 64-bit.bunnei2017-10-191-2/+2
|
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
|
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
|
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
|
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-1511-885/+18
|
* hle: Add service stubs for apm and appletOE.bunnei2017-10-1510-2/+136
|
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1521-859/+574
|
* nso: Add a log for loading submodules.bunnei2017-10-141-0/+1
|
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
|
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
|
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
|
* Remove more 3DS-specific code.bunnei2017-10-135-48/+3
|
* Remove more 3DS-specific code.bunnei2017-10-137-1414/+2
|
* Remove more 3DS-specific code.bunnei2017-10-133-55/+0
|
* Remove lots more 3DS-specific code.bunnei2017-10-1350-6976/+8
|
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10200-22393/+2
|
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-10209-2333/+20476
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/CMakeLists.txt # src/core/arm/dynarmic/arm_dynarmic.cpp # src/core/arm/dyncom/arm_dyncom.cpp # src/core/hle/kernel/process.cpp # src/core/hle/kernel/thread.cpp # src/core/hle/kernel/thread.h # src/core/hle/kernel/vm_manager.cpp # src/core/loader/3dsx.cpp # src/core/loader/elf.cpp # src/core/loader/ncch.cpp # src/core/memory.cpp # src/core/memory.h # src/core/memory_setup.h
| * Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| |
| * Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-083-63/+61
| |\ | | | | | | Remove more usages of GetPointer.
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | |
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | |
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | |
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| | |
| | * Memory: Remove all GetPointer usages from the GDB stub.Subv2017-10-041-8/+12
| | |
| * | Merge pull request #2975 from shinyquagsire23/archive-ncch-container-and-overrideSebastian Valle2017-10-067-78/+581
| |\ \ | | | | | | | | file_sys/archive_ncch: use NCCHs/.apps instead of .romfs files, NCCH section override
| | * | file_sys, loader: add support for reading TMDs to determine app pathsshinyquagsire232017-10-012-5/+27
| | | |
| | * | file_sys: add class for Title Metadata (TMD)shinyquagsire232017-10-013-0/+338
| | | |
| | * | file_sys/ncch_container: add RomFS, ExeFS override to allow for backward compatibility with existing .romfs system archive dumpsshinyquagsire232017-10-012-69/+206
| | | |
| | * | file_sys/archive_ncch: use NCCHContainer instead of loading .romfs filesshinyquagsire232017-10-011-6/+12
| | | |
| * | | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \ \ | | | | | | | | | | HLE/APT: Always set up the APT parameter when starting a library applet.
| | * | | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only use the HLE interface if an HLE applet with the desired id was started. This commit reorganizes the APT code surrounding parameter creation and delivery to make it easier to support LLE applets in the future. As future work, the HLE applet interface can be reworked to utilize the same facilities as the LLE interface.
| * | | | Extracted the attribute setup and draw commands into their own functionsHuw Pascoe2017-10-041-217/+222
| | | | |
| * | | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ \ | | |_|_|/ | |/| | | SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it
| | * | | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| | | |/ | | |/| | | | | | | | | Also reference the right offset into the backing block for the requested address.
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-014-22/+61
| |\ \ \ | | | | | | | | | | Memory: Add overloads for ReadBlock and WriteBlock that operate on a specific process.
| | * | | Memory: Make WriteBlock take a Process parameter on which to operateSubv2017-10-012-10/+19
| | | | |
| | * | | Memory: Make ReadBlock take a Process parameter on which to operateSubv2017-10-012-12/+30
| | | | |
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| | | | |
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | | Services/NIM: Implement CheckForSysUpdateEvent.
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | Implementation verified by reverse engineering. This lets the Home Menu boot without crashing on startup.
| * | | | Moved down_count to CoreTimingHuw Pascoe2017-09-309-43/+33
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| | | | | | | | | | | | Services/UDS: Handle the rest of the connection sequence.
| * | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \ | | | | | | | | | | Implement PrepareToStartNewestHomeMenu and fixed an APT regression.
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | | | | | | | | | | | | | | | | | | | | | | | | As per 3dbrew: "During Home Menu start-up it uses APT:PrepareToStartNewestHomeMenu. If that doesn't return an error(normally NS returns 0xC8A0CFFC for that), Home Menu starts a hardware reboot with APT:StartNewestHomeMenu etc. "
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/| | | | | | | | | | | | | We need to know what is being run so we can set the APT parameter destination AppId correctly. Delaying the preparation of the parameter until we know which AppId is running lets us support booting both the Home Menu and normal game Applications.
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| | | | | | | | | | | | | | | | | | | | | | | | This change makes for a clearer (less confusing) path of execution in the scheduler, now the code to execute when a thread awakes is closer to the code that puts the thread to sleep (WaitSynch1, WaitSynchN). It also allows us to implement the special wake up behavior of ReplyAndReceive without hacking up WaitObject::WakeupAllWaitingThreads. If savestates are desired in the future, we can change this implementation to one similar to the CoreTiming event system, where we first register the callback functions at startup and assign their identifiers to the Thread callback variable instead of directly assigning a lambda to the wake up callback variable.
| * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3032-91/+97
| | | |
| * | | Merge pull request #2961 from Subv/load_titlesbunnei2017-09-2917-70/+157
| |\ \ \ | | |/ / | |/| | Loaders: Don't automatically set the current process every time we load an application.
| | * | Loaders: Don't automatically set the current process every time we load an application.Subv2017-09-278-37/+40
| | | | | | | | | | | | | | | | The loaders will now just create a Kernel::Process, construct it and return it to the caller, which is responsible for setting it as the current process and configuring the global page table.
| | * | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| | | | | | | | | | | | | | | | Don't automatically assume that Thread::Create will only be called when the parent process is currently scheduled. This assumption will be broken when applets or system modules are loaded.
| | * | Tests: Added Memory::IsValidVirtualAddress tests.Subv2017-09-272-0/+57
| | | |
| | * | Tests: Fixed ARM VFP testsSubv2017-09-271-9/+13
| | | |
| | * | Memory: Allow IsValidVirtualAddress to be called with a specific process parameter.Subv2017-09-272-7/+25
| | | | | | | | | | | | | | | | There is still an overload of IsValidVirtualAddress that only takes the VAddr and will default to the current process.
| * | | Merge pull request #2907 from Subv/warnings3Sebastian Valle2017-09-272-5/+9
| |\ \ \ | | | | | | | | | | Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.
| | * | | Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.Subv2017-09-272-5/+9
| | | | | | | | | | | | | | | | | | | | | | | | | It is unlikely we will ever use this without first doing a Cast to a signed type. Fixes 9 "unary minus operator applied to unsigned type, result still unsigned" warnings on MSVC2017.3
| * | | | Merge pull request #2954 from Subv/cache_unmapped_memJames Rowe2017-09-271-1/+16
| |\ \ \ \ | | |_|/ / | |/| | | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions
| | * | | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions.Subv2017-09-261-1/+16
| | | |/ | | |/| | | | | | | | | | | | | | | | | Not all physical regions need to be mapped into the address space of every process, for example, system modules do not have a VRAM mapping. This fixes a crash when loading applets and system modules.
| * | | Merge pull request #2958 from Subv/audio_buffer_datatypeMerry2017-09-265-7/+9
| |\ \ \ | | | | | | | | | | Audio: Use std::deque instead of std::vector for the audio buffer type (StereoBuffer16)
| | * | | Audio: Use std::deque instead of std::vector for the audio buffer type (StereoBuffer16).Subv2017-09-265-7/+9
| | | |/ | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current code inserts and deletes elements from the beginning of the audio buffer, which is very inefficient in an std::vector. Profiling was done using VisualStudio2017's Performance Analyzer in Super Mario 3D Land. Before this change: AudioInterp::Linear had 14.14% of the runtime (inclusive) and most of that time was spent in std::vector's insert implementation. After this change: AudioInterp::Linear has 0.36% of the runtime (inclusive)
| * / | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-256-18/+65
| |/ / | | | | | | | | | | | | | | | | | | | | | The loaders now register each loaded ROM with the SelfNCCH factory, which keeps the data around for the duration of the emulation session. When opening the SelfNCCH archive, the factory queries the current program's programid and uses that as a key to the map that contains the NCCHData structure (RomFS, Icon, Banner, etc). 3dsx files do not have a programid and will use a default of 0 for this value, thus, only 1 3dsx file with RomFS is loadable at the same time.
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-2512-27/+56
| |\ \ | | | | | | | | Switchable Page Tables
| | * | ARM_Interface: Implement PageTableChangedMerryMage2017-09-256-6/+39
| | | |
| | * | memory: Remove GetCurrentPageTablePointersMerryMage2017-09-242-10/+0
| | | |
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-247-13/+19
| | | | | | | | | | | | | | | | Don't expose Memory::current_page_table as a global.
| * | | Merge pull request #2951 from huwpascoe/perf-4B3n302017-09-251-10/+4
| |\ \ \ | | | | | | | | | | Optimized Morton
| | * | | Optimized MortonHuw Pascoe2017-09-241-10/+4
| | |/ /
| * | | Merge pull request #2949 from wwylele/fix-trB3n302017-09-253-21/+22
| |\ \ \ | | | | | | | | | | citra-qt: fix some untranslated strings
| | * | | citra-qt: fix some untranslated stringswwylele2017-09-243-21/+22
| | |/ /
| * | | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \ \ | | | | | | | | | | HLE/SRV: Implemented RegisterService.
| | * | | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | | |/ | | |/| | | | | | | | | Now system modules can do more than just crash immediately on startup.
| * | | Loader/NCCH: Add support for loading application updates (#2927)Max Thomas2017-09-258-439/+670
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * loader/ncch: split NCCH parsing into its own file * loader/ncch: add support for loading update NCCHs from the SD card * loader/ncch: fix formatting * file_sys/ncch_container: Return a value for OpenFile * loader/ncch: cleanup, always instantiate overlay_ncch to base_ncch * file_sys/ncch_container: better encryption checks, allow non-app NCCHs to load properly and for the existence of NCCH structures to be checked * file_sys/ncch_container: pass filepath as a const reference
| * | | Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Added a function to generate the EAPoL-Start packet body. * Services/UDS: Added filter for beacons. * Services/UDS: Lock a mutex when accessing connection_status from both the emulation and network thread. * Services/UDS: Handle the Association Response frame and respond with the EAPoL-Start frame. * fixup: make use of current_node, changed received_beacons into a list, mutex and assert corrections * fixup: fix damn clang-format
| * | | Optimized Float<M,E> multiplicationHuw Pascoe2017-09-251-11/+7
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Before: ucomiss xmm1, xmm1 jp .L9 pxor xmm2, xmm2 mov edx, 1 ucomiss xmm0, xmm2 setp al cmovne eax, edx test al, al jne .L9 .L3: movaps xmm0, xmm2 ret .L9: ucomiss xmm0, xmm0 jp .L10 pxor xmm2, xmm2 mov edx, 1 ucomiss xmm1, xmm2 setp al cmovne eax, edx test al, al je .L3 After: movaps xmm2, xmm1 mulss xmm2, xmm0 ucomiss xmm2, xmm2 jnp .L3 ucomiss xmm1, xmm0 jnp .L11 .L3: movaps xmm0, xmm2 ret .L11: pxor xmm2, xmm2 jmp .L3
| * | Merge pull request #2921 from jroweboy/batch-fix-2James Rowe2017-09-241-12/+17
| |\ \ | | |/ | |/| GPU: Add draw for immediate and batch modes
| | * Remove pipeline.gpu_mode and fix minor issuesJames Rowe2017-09-231-12/+2
| | |
| | * GPU: Add draw for immediate and batch modesJames Rowe2017-09-111-2/+17
| | | | | | | | | | | | | | | | | | | | | | | | PR #1461 introduced a regression where some games would change configuration even while in the poorly named "drawing" mode, which broke the heuristic citra was using to determine when to draw the batch. This change adds back in a draw call for batching, and also adds in a draw call in immediate mode each time it adds a triangle.
| * | Merge pull request #2928 from huwpascoe/masterYuri Kunde Schlesner2017-09-221-7/+18
| |\ \ | | | | | | | | Fixed framebuffer warning
| | * | Fixed framebuffer warningHuw Pascoe2017-09-171-7/+18
| | | |
| * | | Merge pull request #2933 from huwpascoe/perf-1bunnei2017-09-191-1/+2
| |\ \ \ | | | | | | | | | | Improved performance of FromAttributeBuffer
| | * | | Improved performance of FromAttributeBufferHuw Pascoe2017-09-171-1/+2
| | |/ / | | | | | | | | | | | | | | | | | | | | | | | | Ternary operator is optimized by the compiler whereas std::min() is meant to return a value. I've noticed a 5%-10% emulation speed increase.
| * / / WebService: Verify username and token (#2930)B3n302017-09-1915-38/+316
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | * WebService: Verify username and token; Log errors in PostJson * Fixup: added docstrings to the functions * Webservice: Added Icons to the verification, imrpved error detection in cpr, fixup nits * fixup: fmt warning
| * | Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-167-42/+77
| |\ \ | | | | | | | | Services/NS: Port ns:s to the new service framework.
| | * | Services/NS: Port ns:s to the new service framework.Subv2017-09-167-42/+77
| | | |
| * | | Merge pull request #2900 from wwylele/clip-2Yuri Kunde Schlesner2017-09-165-46/+116
| |\ \ \ | | | | | | | | | | PICA: implement custom clip plane
| | * | | SwRasterizer/Clipper: flip the sign convention to match PICA and OpenGLwwylele2017-08-251-9/+9
| | | | |
| | * | | gl_rasterizer: implement custom clip planewwylele2017-08-253-34/+83
| | | | |
| | * | | SwRasterizer: implement custom clip planewwylele2017-08-242-4/+25
| | | | |
| * | | | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-1514-123/+191
| |\ \ \ \ | | | | | | | | | | | | Kernel/Memory: Give each process its own page table and allow switching the current page table upon reschedule
| | * | | | CPU/Dynarmic: Disable the fast page-table access in dynarmic until it supports switching page tables at runtime.Subv2017-09-151-1/+3
| | | | | |
| | * | | | Tests/VFP: Use a standalone pagetable for the TestEnvironment memory operations.Subv2017-09-151-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | This fixes building the tests
| | * | | | Kernel/Memory: Make IsValidPhysicalAddress not go through the current process' virtual memory mapping.Subv2017-09-151-2/+1
| | | | | |
| | * | | | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | We were unnecessarily clearing the cache when going from Process A -> Idle -> Process A, this caused extreme performance regressions.
| | * | | | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-154-30/+69
| | | | | |
| | * | | | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | | | | |
| | * | | | Kernel/Memory: Give each Process its own page table.Subv2017-09-109-87/+93
| | | | | | | | | | | | | | | | | | | | | | | | The loader is in charge of setting the newly created process's page table as the main one during the loading process.
| * | | | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \ \ \ | | |_|_|_|/ | |/| | | | APT: load different shared font depending on the region
| | * | | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| | | | | |
| * | | | | Merge pull request #2865 from wwylele/gs++bunnei2017-09-0815-37/+594
| |\ \ \ \ \ | | | | | | | | | | | | | | PICA: implemented geometry shader
| | * | | | | pica/command_processor: build geometry pipeline and run geometry shaderwwylele2017-08-196-28/+383
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The geometry pipeline manages data transfer between VS, GS and primitive assembler. It has known four modes: - no GS mode: sends VS output directly to the primitive assembler (what citra currently does) - GS mode 0: sends VS output to GS input registers, and sends GS output to primitive assembler - GS mode 1: sends VS output to GS uniform registers, and sends GS output to primitive assembler. It also takes an index from the index buffer at the beginning of each primitive for determine the primitive size. - GS mode 2: similar to mode 1, but doesn't take the index and uses a fixed primitive size. hwtest shows that immediate mode also supports GS (at least for mode 0), so the geometry pipeline gets refactored into its own class for supporting both drawing mode. In the immediate mode, some games don't set the pipeline registers to a valid value until the first attribute input, so a geometry pipeline reset flag is set in `pipeline.vs_default_attributes_setup.index` trigger, and the actual pipeline reconfigure is triggered in the first attribute input. In the normal drawing mode with index buffer, the vertex cache is a little bit modified to support the geometry pipeline. Instead of OutputVertex, it now holds AttributeBuffer, which is the input to the geometry pipeline. The AttributeBuffer->OutputVertex conversion is done inside the pipeline vertex handler. The actual hardware vertex cache is believed to be implemented in a similar way (because this is the only way that makes sense). Both geometry pipeline and GS unit rely on states preservation across drawing call, so they are put into the global state. In the future, the other three vertex shader units should be also placed in the global state, and a scheduler should be implemented on top of the four units. Note that the current gs_unit already allows running VS on it in the future.
| | * | | | | pica/shader/jit: implement SETEMIT and EMITwwylele2017-08-192-2/+49
| | | | | | |
| | * | | | | pica/primitive_assembly: Handle winding for GS primitivewwylele2017-08-192-3/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | hwtest shows that, although GS always emit a group of three vertices as one primitive, it still respects to the topology type, as if the three vertices are input into the primitive assembler independently and sequentially. It is also shown that the winding flag in SETEMIT only takes effect for Shader topology type, which is believed to be the actual difference between List and Shader (hence removed the TODO). However, only Shader topology type is observed in official games when GS is in use, so the other mode seems to be just unintended usage.
| | * | | | | correct constnesswwylele2017-08-192-2/+4
| | | | | | |
| | * | | | | pica/shader/interpreter: implement SETEMIT and EMITwwylele2017-08-191-0/+16
| | | | | | |
| | * | | | | pica/shader: extend UnitState for GSwwylele2017-08-192-0/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Among four shader units in pica, a special unit can be configured to run both VS and GS program. GSUnitState represents this unit, which extends UnitState (which represents the other three normal units) with extra state for primitive emitting. It uses lots of raw pointers to represent internal structure in order to keep it standard layout type for JIT to access. This unit doesn't handle triangle winding (inverting) itself; instead, it calls a WindingSetter handler. This will be explained in the following commits
| | * | | | | pica/regs: layout geometry shader configuration regswwylele2017-08-102-2/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | All the register meanings are derived from ctrulib (3dbrew is outdated for most of them)
| * | | | | | Merge pull request #2914 from wwylele/fresnel-fixbunnei2017-09-052-7/+9
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | pica/lighting: only apply Fresnel factor for the last light
| | * | | | | | pica/lighting: only apply Fresnel factor for the last lightwwylele2017-09-032-7/+9
| | | | | | | |
| * | | | | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-057-53/+289
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Services/UDS: Handle beacon frames and the basic AP connection sequence frames.
| | * | | | | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | | | | | | | |
| | * | | | | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There is currently no stage tracking, a client is considered "Connected" when it receives the EAPoL Logoff packet from the server, this is not yet implemented.
| | * | | | | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | | | | | | | |
| | * | | | | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-275-11/+144
| | | | | | | | |
| * | | | | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| | | | | | | | |
| * | | | | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| | | | | | | | |
| * | | | | | | | Fix icon for citra qtJames Rowe2017-09-031-1/+3
| | | | | | | | |
| * | | | | | | | Add manifestDaMan2017-09-032-0/+16
| | |_|_|/ / / / | |/| | | | | |
| * | | | | | | Merge pull request #2909 from wwylele/telemetry-gasbunnei2017-08-311-0/+6
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | video_core: report telemetry for gas mode
| | * | | | | | | video_core: report telemetry for gas modewwylele2017-08-311-0/+6
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Merge pull request #2858 from MerryMage/interp-on-a-frame-basisbunnei2017-08-313-88/+74
| |\ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | | interpolate: Interpolate on a frame-by-frame basis
| | * | | | | | interpolate: Interpolate on a frame-by-frame basisMerryMage2017-08-283-88/+74
| | | | | | | |
| * | | | | | | Merge pull request #2891 from wwylele/sw-bumpbunnei2017-08-314-10/+40
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | SwRasterizer/Lighting: implement bump mapping
| | * | | | | | | gl_rasterizer/lighting: more accurate CP formulawwylele2017-08-221-2/+2
| | | | | | | | |
| | * | | | | | | SwRasterizer/Lighting: implement LUT input CPwwylele2017-08-221-0/+11
| | | | | | | | |
| | * | | | | | | SwRasterizer/Lighting: implement bump mappingwwylele2017-08-223-8/+27
| | | | | | | | |
| * | | | | | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-298-43/+87
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Refactor touch input into a TouchDevice
| | * | | | | | | | EmuWindow: refactor touch input into a TouchDevicewwylele2017-08-245-39/+72
| | | | | | | | | |
| | * | | | | | | | HID: use TouchDevice for touch padwwylele2017-08-243-4/+15
| | | |_|_|_|_|/ / | | |/| | | | | |
| * | | | | | | | Merge pull request #2905 from danzel/fix-2902Sebastian Valle2017-08-294-5/+5
| |\ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|/ | |/| | | | | | | Use recursive_mutex instead of mutex to fix #2902
| | * | | | | | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-294-5/+5
| | |/ / / / / /
| * | | | | | | Merge pull request #2892 from Subv/warnings2Weiyi Wang2017-08-283-6/+10
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Warnings: Fixed a few missing-return warnings in video_core.
| | * | | | | | | Warnings: Fixed a few missing-return warnings in video_core.Subv2017-08-263-6/+10
| | | |/ / / / / | | |/| | | | |
| * | | | | | | web_backend: Fix CPR bug where Winsock is not properly initializing.bunnei2017-08-271-15/+27
| | | | | | | |
| * | | | | | | web_backend: Fix asynchronous JSON post by spawning new thread.bunnei2017-08-261-9/+18
| | | | | | | |
| * | | | | | | web_services: Refactor to remove dependency on Core.bunnei2017-08-265-20/+35
| | | | | | | |
| * | | | | | | qt: Add an option to view/regenerate telemetry ID.bunnei2017-08-264-7/+40
| | | | | | | |
| * | | | | | | default_ini: Use correct telemetry endpoint URL.bunnei2017-08-261-1/+1
| | | | | | | |
| * | | | | | | # This is a combination of 2 commits.bunnei2017-08-261-3/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # This is the 1st commit message: qt: Add web configuration tab. # The commit message #2 will be skipped: # fixup! qt: Add web configuration tab.
| * | | | | | | qt: Add web configuration tab.bunnei2017-08-266-2/+217
| | | | | | | |
| * | | | | | | web_backend: User config for username and token, support anonymous post.bunnei2017-08-262-40/+17
| | | | | | | |
| * | | | | | | telemetry: Log frontend type.bunnei2017-08-262-0/+4
| | | | | | | |
| * | | | | | | settings: Add enable_telemetry, citra_username, and citra_token.bunnei2017-08-264-0/+20
| | | | | | | |
| * | | | | | | telemetry_session: Log telemetry ID.bunnei2017-08-261-0/+36
| | | | | | | |
| * | | | | | | citra_qt: Show one-time callout messages to user.bunnei2017-08-264-0/+50
| | | | | | | |
| * | | | | | | SidebySide Layout (#2859)ThaMighty902017-08-256-7/+61
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * added a SidebySide Layout * Reworked, so both screen have the same height and cleaned up screen translates. * added the option in the UI, hope this is the right way to do it. formated framebuffer_layout.cpp * delete the x64 files * deleted ui_configure_graphics.h * added Option for the Layout in the xml * got rid of SIDE_BY_SIDE_ASPECT_RATIO because it was useless. pulled translate into variables * changed shift variables to u32 and moved them in their respective branch. remove notr="true" for the Screen layout drop down * reworked intends :). changed function description for SideFrameLayout * some description reworking
| * | | | | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-246-4/+46
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).
| | * | | | | | Kernel/Memory: Acquire the global HLE lock when a memory read/write operation falls outside of the fast path, for it might perform an MMIO operation.Subv2017-08-221-1/+8
| | | | | | | |
| | * | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-225-3/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This mutex is acquired in SVC::CallSVC, ie, as soon as the guest application enters the HLE kernel, and should be acquired by the aforementioned threads before modifying kernel structures.
| * | | | | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.
| | * | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| | | |/ / / / / | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is necessary for loading multiple processes at the same time. The main thread will be automatically scheduled when necessary once the scheduler runs.
| * | | | | | | Merge pull request #2888 from Subv/warningsJames Rowe2017-08-2211-17/+22
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed some warnings in the core project.
| | * | | | | | | GPU/Warnings: Explicitly cast the screen refresh ticks to u64.Subv2017-08-211-1/+1
| | | | | | | | |
| | * | | | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-213-2/+7
| | | | | | | | |
| | * | | | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| | | | | | | | |
| | * | | | | | | CPU/Dynarmic: Fixed a warning when incrementing the number of ticks in ExecuteInstructions.Subv2017-08-211-1/+1
| | | | | | | | |
| | * | | | | | | Dyncom: Use size_t instead of int to store the instruction offsets in the instruction cache.Subv2017-08-212-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes a few warnings.
| | * | | | | | | Dyncom: Fixed a conversion warning when decoding thumb instructions.Subv2017-08-211-1/+1
| | |/ / / / / /
| * | | | | | | motion_emu: fix initialization orderwwylele2017-08-221-1/+4
| | | | | | | |
| * | | | | | | swrasterizer: remove invalid TODOwwylele2017-08-211-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is called in clipping, before the pespective divide, and is not used in later rasterization. Thus it doesn't need perspective correction.
| * | | | | | | swrasterizer/clipper: remove tested TODOwwylele2017-08-211-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | hwtested. Current implementation is the correct behavior
| * | | | | | | gl_shader_gen: simplify and clarify the depth transformation between vertex shader and fragment shaderwwylele2017-08-211-2/+5
| | | | | | | |
| * | | | | | | gl_rasterizer: add clipping plane z<=0 defined in PICAwwylele2017-08-214-0/+21
| |/ / / / / /
| * | | | | | Merge pull request #2872 from wwylele/sw-geo-factorYuri Kunde Schlesner2017-08-211-4/+16
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | SwRasterizer/Lighting: implement geometric factor
| | * | | | | | SwRasterizer/Lighting: implement geometric factorwwylele2017-08-111-4/+16
| | | | | | | |
| * | | | | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-2020-277/+302
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Refactor MotionEmu into a InputDevice
| | * | | | | | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | | | | | | | |
| | * | | | | | | motion_emu: no need to include thread in headerwwylele2017-08-192-2/+7
| | | | | | | | |
| | * | | | | | | move MotionEmu from core/frontend to input_common as a InputDevicewwylele2017-08-1117-244/+221
| | | | | | | | |
| | * | | | | | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-113-5/+48
| | | | | | | | |
| * | | | | | | | Merge pull request #2871 from wwylele/sw-spotlightJames Rowe2017-08-201-3/+19
| |\ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|/ | |/| | | | | | | SwRasterizer/Lighting: implement spot light
| | * | | | | | | SwRasterizer/Lighting: implement spot lightwwylele2017-08-111-3/+19
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Added missing parts in libnetwork (#2838)B3n302017-08-199-37/+310
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Network: Set and send the game information over enet Added Callbacks for RoomMember and GetMemberList to Room in preparation for web_services.
| * | | | | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | dsp_dsp: Remove size assertion in LoadComponent
| | * | | | | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| | | | | | | | |
| * | | | | | | | Fix Spelling/English mistakesDave Leaver2017-08-131-1/+1
| | | | | | | | |
| * | | | | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System)
| | * | | | | | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | | | | | | | | |
| | * | | | | | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | This gives each applet type its own set of events as per the real NS module.
| * | | / / / / / gl_shader_gen: don't call SampleTexture when bump map is not usedwwylele2017-08-111-4/+5
| | |_|/ / / / / | |/| | | | | |
| * | | | | | | Merge pull request #2874 from danzel/spelling-1Weiyi Wang2017-08-112-4/+4
| |\ \ \ \ \ \ \ | | |_|/ / / / / | |/| | | | | | Fix some spelling mistakes
| | * | | | | | Fix some spelling mistakesdanzel2017-08-112-4/+4
| | | |_|_|_|/ | | |/| | | |
| * | | | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | HID: zero unused PadState bits
| | * | | | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | | |/ / / / | | |/| | | |
| * | | | | | SwRasterizer/Lighting: use make_tuple instead of constructorwwylele2017-08-101-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | implicit tuple constructor is a c++17 thing, which is not supported by some not-so-old libraries. Play safe for now
| * | | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-091-1/+1
| |\ \ \ \ \ | | | | | | | | | | | | | | Update CryptoPP (byte ambiguity)
| | * | | | | Update cryptoppJames2017-08-081-1/+1
| | |/ / / /
| * | | | | Merge pull request #2822 from wwylele/sw_lighting-2Weiyi Wang2017-08-098-9/+315
| |\ \ \ \ \ | | | | | | | | | | | | | | Implement fragment lighting in the sw renderer (take 2)
| | * | | | | SwRasterizer/Lighting: shorten file namewwylele2017-08-034-4/+4
| | | | | | |
| | * | | | | SwRasterizer/Lighting: move to its own filewwylele2017-08-024-240/+271
| | | | | | |
| | * | | | | SwRasterizer/Lighting: reduce confusionwwylele2017-08-021-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: move quaternion normalization to the callerwwylele2017-08-021-3/+3
| | | | | | |
| | * | | | | SwRasterizer/Lighting: dist atten lut input need to be clampwwylele2017-07-111-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: unify float suffixwwylele2017-07-111-11/+13
| | | | | | |
| | * | | | | SwRasterizer/Lighting: get rid of nested returnwwylele2017-07-111-10/+11
| | | | | | |
| | * | | | | SwRasterizer/Lighting: refactor GetLutValue into a function.wwylele2017-07-111-83/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | merging similar pattern. Also makes the code more similar to the gl one
| | * | | | | SwRasterizer: only interpolate quat and view when lighting is enabledwwylele2017-07-111-14/+14
| | | | | | |
| | * | | | | vector_math: remove dead template parameterwwylele2017-07-111-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: pass lighting state as parameterwwylele2017-07-111-13/+13
| | | | | | |
| | * | | | | vector_math: remove broken SFINAE stuffwwylele2017-07-111-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | this was originally added to eliminate warnings on MSVC, but it doesn't work for custom types.
| | * | | | | SwRasterizer/Lighting: Move the clamp highlight calculation to the end of the per-light loop body.Subv2017-07-111-17/+17
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Move the lighting enable check outside the ComputeFragmentsColors function.Subv2017-07-111-7/+6
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Do not use global registers state in ComputeFragmentsColors.Subv2017-07-111-3/+3
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Do not use global state in LookupLightingLut.Subv2017-07-112-13/+22
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Fixed a bug where the distance attenuation bias was being set to the dist atten scale.Subv2017-07-111-3/+2
| | | | | | |
| | * | | | | SwRasterizer: Fixed a few conversion warnings and moved per-light values into the per-light loop.Subv2017-07-111-5/+6
| | | | | | |
| | * | | | | SwRasterizer: Run clang-formatSubv2017-07-111-45/+83
| | | | | | |
| | * | | | | SwRasterizer: Flip the vertex quaternions before clipping (if necessary).Subv2017-07-113-21/+16
| | | | | | |
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-111-6/+7
| | | | | | |
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-112-33/+48
| | | | | | |
| | * | | | | SwRasterizer: Fixed the lighting lut lookup function.Subv2017-07-111-2/+4
| | | | | | |
| | * | | | | SwRasterizer: Calculate fresnel for fragment lighting.Subv2017-07-111-1/+25
| | | | | | |
| | * | | | | SwRasterizer: Calculate specular_1 for fragment lighting.Subv2017-07-111-3/+59
| | | | | | |
| | * | | | | SwRasterizer: Calculate specular_0 for fragment lighting.Subv2017-07-111-13/+94
| | | | | | |
| | * | | | | SwRasterizer: Implement primary fragment color.Subv2017-07-111-4/+113
| | | | | | |
| * | | | | | Merge pull request #2856 from wwylele/shader-shareWeiyi Wang2017-08-092-26/+45
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | pica: upload shared shader code & swizzle to both unit
| | * | | | | | pica: upload shared shader code to both unitwwylele2017-08-072-26/+45
| | | | | | | |
| * | | | | | | Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| | |_|/ / / / | |/| | | | |
| * | | | | | Quickfix typo in OpenGL 3.3 error messageAndrea Pascal2017-08-051-1/+1
| | | | | | | | | | | | | | | | | | | | | User pointed out on the Discord server that "nothave" is erroneously concatenated. Added a space to prevent it.
| * | | | | | telemetry: Add field for OsPlatform.bunnei2017-08-041-0/+9
| | | | | | |
| * | | | | | telemetry: Add field for BuildName.bunnei2017-08-041-0/+1
| | | | | | |
| * | | | | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| | | | | | |
| * | | | | | telemetry_session: Log BuildDate and ProgramName fields.bunnei2017-08-041-0/+7
| | | | | | |
| * | | | | | common: Add build timestamp to scm_rev.bunnei2017-08-042-0/+3
| | | | | | |
| * | | | | | core: Expose AppLoader as a public interface.bunnei2017-08-041-4/+5
| | | | | | |
| * | | | | | loader: Expose program title.bunnei2017-08-043-12/+31
| | |_|_|/ / | |/| | | |
| * | | | | Handle invalid filenames when renaming files/directoriesJames2017-07-312-4/+78
| |/ / / /
| * | | | Merge pull request #2848 from wwylele/shader-loop-fixWeiyi Wang2017-07-291-1/+1
| |\ \ \ \ | | | | | | | | | | | | pica/shader_interpreter: fix off-by-one in LOOP
| | * | | | pica/shader_interpreter: fix off-by-one in LOOPwwylele2017-07-271-1/+1
| | | | | |
| * | | | | Merge pull request #2679 from MerryMage/interp-testsbunnei2017-07-275-0/+13716
| |\ \ \ \ \ | | | | | | | | | | | | | | DynCom VFP tests
| | * | | | | tests: Add tests for vaddMerryMage2017-07-235-2/+13510
| | | | | | |
| | * | | | | tests: Arm testing frameworkMerryMage2017-07-233-0/+208
| | |/ / / /
| * | | | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \ \ \ | | | | | | | | | | | | | | Services/APT: Corrected the behavior of the Receive/Send/Glance/CancelParameter functions
| | * | | | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | | | | | |
| | * | | | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | | | | | |
| | * | | | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | | | | | |
| | * | | | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | | | | | |
| | * | | | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | | | | | |
| | * | | | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | | |_|/ / | | |/| | |
| * | | | | Merge pull request #2837 from wwylele/shader-debugger-fixbunnei2017-07-261-23/+18
| |\ \ \ \ \ | | | | | | | | | | | | | | Misc shader debugger fixes
| | * | | | | debugger/shader: display LOOPwwylele2017-07-201-1/+3
| | | | | | |
| | * | | | | debugger/shader: print the invert flag for JMPUwwylele2017-07-201-0/+4
| | | | | | |
| | * | | | | debugger/shader: fix address register for reverted arithmetic opwwylele2017-07-201-20/+9
| | | | | | |
| | * | | | | debugger/shader: fix inverted uniform flow controlwwylele2017-07-201-2/+2
| | | | | | |
| * | | | | | Network: Moved NintendoOUI initalization to RoomMember constructorB3n302017-07-262-3/+4
| | |_|/ / / | |/| | | |
* | | | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-108-58/+40
| | | | | |
* | | | | | loader: Add support for NRO, as well as various fixes and shared linker.bunnei2017-10-069-146/+434
| | | | | |
* | | | | | nso: Fixes to support homebrew NSOs without a MOD header.bunnei2017-10-042-17/+23
| | | | | |
* | | | | | arm_interface: Set TLS address for dynarmic core.bunnei2017-09-305-0/+32
| | | | | |
* | | | | | nso: Refactor and allocate .bss section.bunnei2017-09-309-132/+162
| | | | | |
* | | | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
| | | | | |
* | | | | | loader: Add support for loading an NSO.bunnei2017-09-305-0/+342
| | | | | |
* | | | | | externals: Add lz4.bunnei2017-09-301-1/+1
| | | | | |
* | | | | | memory: Log with 64-bit values.bunnei2017-09-301-8/+8
| | | | | |
* | | | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
| | | | | |
* | | | | | core: Various changes to support 64-bit addressing.bunnei2017-09-305-54/+54
| | | | | |
* | | | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-309-80/+113
| | | | | |
* | | | | | elf: Check if machine is ARM.bunnei2017-09-301-2/+9
|/ / / / /
* | | | | Merge pull request #2816 from wwylele/proctex-lutlutlutSebastian Valle2017-07-235-70/+80
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: use texture buffer for proctex LUT
| * | | | | gl_rasterizer: use texture buffer for proctex LUTwwylele2017-07-015-70/+80
| | | | | |
* | | | | | Merge pull request #2834 from wwylele/depth-enable-fixSebastian Valle2017-07-231-4/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: fix using_depth_fb
| * | | | | | gl_rasterizer_cache: depth write is disabled if allow_depth_stencil_write is falsewwylele2017-06-101-4/+5
| | | | | | |
* | | | | | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-226-68/+113
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | Add address conversion functions returning optional, Add function to flush virtual region from rasterizer cache
| * | | | | | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-224-47/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is slightly more ergonomic to use, correctly handles virtual regions which are disjoint in physical addressing space, and checks only regions which can be cached by the rasterizer.
| * | | | | | Memory: Add TryVirtualToPhysicalAddress, returning a boost::optionalYuri Kunde Schlesner2017-06-222-7/+23
| | | | | | |
| * | | | | | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-224-14/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | And fix a few places in the code to take advantage of that.
* | | | | | | telemetry: Log performance, configuration, and system data.bunnei2017-07-185-18/+96
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #2804 from Kloen/themingbunnei2017-07-187-2/+73
|\ \ \ \ \ \ | | | | | | | | | | | | | | citra-qt: UI Themes
| * | | | | | citra-qt: Add option to configure the UI themeKloen2017-06-242-0/+37
| | | | | | |
| * | | | | | citra-qt: load ui theme at startup and config change.Kloen2017-06-242-0/+22
| | | | | | |
| * | | | | | citra-qt: Add Dark theme from https://github.com/ColinDuquesnoy/QDarkStyleSheetKloen2017-06-241-2/+5
| | | | | | |
| * | | | | | citra-qt: add new uisetting->themeKloen2017-06-242-0/+9
| | | | | | |
* | | | | | | Merge pull request #2818 from B3n30/networkWeiyi Wang2017-07-179-21/+1206
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Enable data transfer over ENet
| * | | | | | | Network: Changed timeout for receiving packets to 100msB3n302017-07-165-43/+50
| | | | | | | |
| * | | | | | | Network: Propagate Room closing to connected membersB3n302017-07-163-3/+28
| | | | | | | |
| * | | | | | | Network: Made send async in RoomMemberB3n302017-07-164-25/+70
| | | | | | | |
| * | | | | | | Network: Send the game titleB3n302017-07-166-114/+185
| | | | | | | |
| * | | | | | | Network: Enable sending and receiving chat messagesB3n302017-07-163-0/+79
| | | | | | | |
| * | | | | | | Network: Handle the disconnect of a clientB3n302017-07-161-1/+18
| | | | | | | |
| * | | | | | | Network: Enable to send WifiPacketsB3n302017-07-163-1/+82
| | | | | | | |
| * | | | | | | Network: Init Network in SDL and QTB3n302017-07-162-1/+5
| | | | | | | |
| * | | | | | | Network: Send JoinRequest and handle the answer in RoomMemberB3n302017-07-162-2/+125
| | | | | | | |
| * | | | | | | Network: Handle join request in RoomB3n302017-07-162-1/+205
| | | | | | | |
| * | | | | | | Network: Added Packet class for serializationB3n302017-07-163-0/+423
| | | | | | | |
| * | | | | | | Network: Threads for Room and RoomMemberB3n302017-07-164-13/+119
| | | | | | | |
* | | | | | | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
| | | | | | | |
* | | | | | | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-165-22/+264
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | load shared font from system archive
| * | | | | | | apt: load shared font from system archivewwylele2017-06-264-20/+260
| | | | | | | |
| * | | | | | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| | |/ / / / / | |/| | | | |
* | | | | | | web_backend: Specify api-version on JSON post.bunnei2017-07-121-1/+3
| | | | | | |
* | | | | | | web_service: Add CMake flag to enable.bunnei2017-07-123-4/+15
| | | | | | |
* | | | | | | telemetry_session: Use TelemetryJson to submit real telemetry.bunnei2017-07-123-5/+3
| | | | | | |
* | | | | | | web_service: Implement JSON serialization of telemetry data.bunnei2017-07-122-0/+125
| | | | | | |
* | | | | | | web_backend: Add initial interface to POST data to Citra Web Services.bunnei2017-07-122-0/+63
| | | | | | |
* | | | | | | web_service: Add skeleton project.bunnei2017-07-107-1/+52
| | | | | | |
* | | | | | | settings: Add telemetry endpoint URL.bunnei2017-07-104-0/+23
| | | | | | |
* | | | | | | logging: Add WebService as a log cateogry.bunnei2017-07-102-1/+3
| |_|_|_|/ / |/| | | | |
* | | | | | Merge pull request #2815 from mailwl/bosspSebastian Valle2017-07-081-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Service/boss:P: Add some functions to FunctionTable
| * | | | | | Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2797 from yuriks/cached-vma-free-crashbunnei2017-07-081-5/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | Memory: Fix crash when unmapping a VMA covering cached surfaces
| * | | | | | Memory: Fix crash when unmapping a VMA covering cached surfacesYuri Kunde Schlesner2017-06-221-5/+20
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Unmapping pages tries to flush any cached GPU surfaces touching that region. When a cached page is invalidated, GetPointerFromVMA() is used to restore the original pagetable pointer. However, since that VMA has already been deleted, this hits an UNREACHABLE case in that function. Now when this happens, just set the page type to Unmapped and continue, which arrives at the correct end result.
* | | | | | Implement basic virtual Room support based on enet (#2803)B3n302017-07-0712-1/+357
| |_|_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added support for network with ENet lib, connecting is possible, but data can't be sent, yet. * fixup! Added support for network with ENet lib, * fixup! CLang * fixup! Added support for network with ENet lib, * fixup! Added support for network with ENet lib, * fixup! Clang format * More fixups! * Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Clang again * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes
* | | | | Remove unnecessary WIN32_LEAN_AND_MEAN macro definitionKloen2017-06-301-1/+0
| |/ / / |/| | |
* | | | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \ \ \ | | | | | | | | | | Kernel/SVC: Partially implemented svcReplyAndReceive
| * | | | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| | | | |
| * | | | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| | | | |
| * | | | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It behaves mostly as WaitSynchronizationN with wait_all = false, except for IPC buffer translation. The target thread of an IPC response will now wake up when responding. IPC buffer translation is currently not implemented. Error passing back to svcSendSyncRequest is currently not implemented.
| * | | | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
| | | | |
* | | | | Merge pull request #2809 from wwylele/texture-copy-fixYuri Kunde Schlesner2017-06-292-19/+24
|\ \ \ \ \ | | | | | | | | | | | | gpu: fix edge cases for TextureCopy
| * | | | | gpu: add comments for TextureCopywwylele2017-06-292-8/+8
| | | | | |
| * | | | | gpu: fix edge cases for TextureCopywwylele2017-06-271-18/+23
| | | | | |
* | | | | | Merge pull request #2800 from wwylele/fog-lutlutlutYuri Kunde Schlesner2017-06-297-31/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: use texture buffer for fog LUT
| * | | | | | gl_rasterizer: use texture buffer for fog LUTwwylele2017-06-227-29/+32
| | | | | | |
| * | | | | | gl_rasterizer: create the texture before applying the statewwylele2017-06-221-2/+2
| | |_|/ / / | |/| | | | | | | | | | | | | | | | this is a rebasing error from #2792. It doesn't affect much though, because the later more Apply() call fixes/hides it
* | | | | | configure_debug: Add label warning that CPU JIT needs to be disabled for gdbstub to workMerryMage2017-06-281-0/+7
| |/ / / / |/| | | |
* | | | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-275-1/+436
|\ \ \ \ \ | | | | | | | | | | | | Services/UDS: Stub SendTo to generate the unencrypted data frames with the right headers
| * | | | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| | | | | |
| * | | | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-262-4/+3
| | | | | |
| * | | | | UDS: Run clang-format.Subv2017-06-263-51/+55
| | | | | |
| * | | | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| | | | | | | | | | | | | | | | | | | | | | | | The responsibility of encryption and encapsulation into an 802.11 MAC frame will fall into the callers of GenerateDataPayload.
| * | | | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | It is likely that these 4 bytes are actually a different header, part of some protocol that encapsulates the SecureData protocol.
| * | | | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| | | | | |
| * | | | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-154-1/+261
| | |/ / / | |/| | |
* | | | | Set global definition WIN32_LEAN_AND_MEAN (#2807)B3n302017-06-251-0/+3
| | | | | | | | | | | | | | | Set definition WIN32_LEAN_AND_MEAN to avoid windows.h including a lot of libs that are usually not used.
* | | | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
| | | | |
* | | | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
| | | | | | | | | | | | | | | | | | | | The return parameters were flipped.
* | | | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
| |_|/ / |/| | |
* | | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \ \ | | | | | | | | | | Kernel: Implement CreateSession SVC
| * | | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ / | |/| |
* | | | Merge pull request #2795 from chris062689/masterbunnei2017-06-232-6/+6
|\ \ \ \ | | | | | | | | | | Change default UI background from white to black.
| * | | | Changing default values for bg_red, bg_green, and bg_blue from 1.0 to 0.0.chris0626892017-06-212-6/+6
| | | | |
* | | | | Merge pull request #2796 from yuriks/hle-null-handlesbunnei2017-06-232-8/+36
|\ \ \ \ \ | |_|/ / / |/| | | | Kernel/IPC: Support translation of null handles
| * | | | Kernel: Fix typo in test nameYuri Kunde Schlesner2017-06-221-1/+1
| | | | |
| * | | | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-212-7/+35
| | | | | | | | | | | | | | | | | | | | | | | | | Missed this in my first implementation. Thanks to @wwylele for pointing out that this was missing.
* | | | | Merge pull request #2792 from wwylele/lutlutlutYuri Kunde Schlesner2017-06-217-151/+175
|\ \ \ \ \ | |/ / / / |/| | | | gl_rasterizer: fix lighting LUT interpolation
| * | | | gl_state: reset 1d textureswwylele2017-06-211-0/+14
| | | | |
| * | | | gl_rasterizer: fix glGetUniformLocation typewwylele2017-06-211-8/+8
| | | | |
| * | | | gl_rasterizer: manage texture ids in one placewwylele2017-06-213-31/+55
| | | | |
| * | | | gl_rasterizer/lighting: fix LUT interpolationwwylele2017-06-217-116/+102
| | | | |
* | | | | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-212-1/+5
|\ \ \ \ \ | |_|/ / / |/| | | | Trivial no-op additions
| * | | | Memory: Add enum definitions for the n3DS FCRAM sizeYuri Kunde Schlesner2017-06-211-1/+3
| | | | |
| * | | | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/ / /
* | | | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \ \ \ | | | | | | | | | | Remove ResultVal::MoveFrom
| * | | | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| | | | | | | | | | | | | | | | | | | | | | | | | Replace it with std::move(result_val).Unwrap(), or Foo().Unwrap() in case you already have an rvalue.
| * | | | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/ / /
* | | | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \ \ \ | | | | | | | | | | UDS: Added a hook for updating the connection status when a client connects to the network.
| * | | | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| | |/ / | |/| |
* | | | Kernel/IPC: Add tests for HLERequestContext buffer translationYuri Kunde Schlesner2017-06-192-2/+196
| | | |
* | | | Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
| |/ / |/| |
* | | Merge pull request #2776 from wwylele/geo-factorYuri Kunde Schlesner2017-06-183-7/+26
|\ \ \ | | | | | | | | Fragment lighting: implement geometric factor
| * | | gl_rasterizer/lighting: use the formula from the paper for germetic factorwwylele2017-06-181-8/+8
| | | |
| * | | gl_rasterizer/lighting: implement geometric factorwwylele2017-06-153-1/+20
| | | |
* | | | Stop using reserved operator names (and/or/xor) with XbyakYuri Kunde Schlesner2017-06-171-13/+13
|/ / / | | | | | | | | | Also has the Dynarmic upgrade with the same change
* | | Merge pull request #2762 from wwylele/light-cp-tangentYuri Kunde Schlesner2017-06-152-10/+38
|\ \ \ | | | | | | | | Fragment lighting: implement lut input 5 (CP) and tangent mapping
| * | | gl_rasterizer/lighting: Implement tangent mappingwwylele2017-06-111-7/+12
| | | |
| * | | gl_rasterizer/lighting: implement lut input 5 (CP)wwylele2017-06-112-3/+26
| | | |
* | | | Merge pull request #2743 from wwylele/wrap-fixYuri Kunde Schlesner2017-06-144-12/+48
|\ \ \ \ | |_|/ / |/| | | pica/rasterizer: implement/stub texture wrap mode 4-7
| * | | pica/rasterizer: implement/stub texture wrap mode 4-7wwylele2017-06-044-12/+48
| | | |
* | | | Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. This lets the application know that the host was successfully added to the session. * Services/UDS: Reset the connection status when destroying the network * Services/UDS: Reset the connection status's bitmask of changed nodes after reporting it to the game.
* | | | Merge pull request #2767 from yuriks/quaternion-flip-commentYuri Kunde Schlesner2017-06-131-8/+11
|\ \ \ \ | | | | | | | | | | OpenGL: Update comment on AreQuaternionsOpposite with new information
| * | | | OpenGL: Update comment on AreQuaternionsOpposite with new informationYuri Kunde Schlesner2017-06-101-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While debugging the software renderer implementation, it was noticed that this is actually exactly what the hardware does, upgrading the status of this "hack" to being a proper implementation. And there was much rejoicing.
* | | | | Merge pull request #2774 from yuriks/hle-handlesYuri Kunde Schlesner2017-06-126-69/+360
|\ \ \ \ \ | |_|_|/ / |/| | | | Add basic support for IPC translation for HLE services
| * | | | Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
| | | | |
| * | | | Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces the necessary allocation to max(in_handles, out_handles) rather than (in_handles + out_handles).
| * | | | Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
| | | | |
| * | | | Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
| | | | |
| * | | | IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
| | | | | | | | | | | | | | | | | | | | | | | | | These use the context functions to create and look-up handles for the user.
| * | | | IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
| | | | |
| * | | | Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
| | | | |
| * | | | ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
| |/ / / | | | | | | | | | | | | | | | | | | | | Copy the IPC command buffer to/from the request context before/after the handler is invoked. This is part of a move away from using global data for handling IPC requests.
* | | | Merge pull request #2727 from wwylele/spot-lightSebastian Valle2017-06-115-28/+128
|\ \ \ \ | |/ / / |/| | | Fragment lighting: implement spot light
| * | | gl_rasterizer: implement spot lightwwylele2017-05-301-6/+24
| | | |
| * | | gl_rasterizer: sync spot light statuswwylele2017-05-304-2/+61
| | | |
| * | | pica: prepare registers for spotlightwwylele2017-05-301-20/+43
| | | |
* | | | Remove unused import in break_points.cpp (#2763)Kloen Lansfiel2017-06-091-1/+0
| | | |
* | | | Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-099-64/+355
|\ \ \ \ | | | | | | | | | | New service framework
| * | | | Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| | | | |
| * | | | Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| | | | |
| * | | | Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-085-4/+269
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The old "Interface" class had a few problems such as using free functions (Which didn't allow you to write the service handler as if it were a regular class.) which weren't very extensible. (Only received one parameter with a pointer to the Interface object.) The new ServiceFramework aims to solve these problems by working with member functions and passing a generic context struct as parameter. This struct can be extended in the future without having to update all existing service implementations.
| * | | | Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
| | | | |
* | | | | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-083-2/+2
| | | | |
* | | | | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
| |_|_|/ |/| | | | | | | | | | | Fixes #2760
* | | | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ \ \ | |/ / / |/| | | Services/UDS: Implement DecryptBeaconData.
| * | | Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
| | | | | | | | | | | | | | | | This function decrypts the encrypted data tags contained in the 802.11 beacon frames.
* | | | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0632-12/+80
| | | | | | | | | | | | | | | | | | | | This has a huge fallout in terms of needing to fix other files because all service implementations included that file.
* | | | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-066-24/+147
| | | | | | | | | | | | | | | | Also enhances the GetServiceHandle implementation to be more accurate.
* | | | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
| | | | | | | | | | | | | | | | | | | | An Event was used way back then when we didn't have proper working semaphores. Our Semaphore implementation is good enough now.
* | | | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-064-9/+10
| | | | | | | | | | | | | | | | | | | | This will contain the implementation of the sm (Service Manager) system module.
* | | | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
| | | | | | | | | | | | | | | | | | | | | | | | This allows attaching a HLE handle to a ServerPort at any point after it is created, allowing port/session creation to be generic between HLE and regular services.
* | | | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
| | | |
* | | | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0614-73/+100
| | | | | | | | | | | | | | | | | | | | Most of the code that works with this is or will be in the kernel, so it's a more appropriate place for it to be.
* | | | Edit Citra URLs (#2728)Alex Touchet2017-06-031-1/+1
| | | |
* | | | Remove unused imports in game_list_p.hKloen2017-06-031-2/+0
| | | |
* | | | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-037-29/+32
| | | | | | | | | | | | | | | | | | | | - Deleted GetStatus() because it wasn't used anywhere outside of Core::System. - Fixed design flaw where the message bar status could be set despite the game being stopped.
* | | | Fixed wiki URLs.TheKoopaKingdom2017-06-031-6/+8
| | | |
* | | | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-032-4/+3
| | | |
* | | | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-032-53/+37
| | | |
* | | | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-039-35/+70
| | | |
* | | | Optimized messages that were repetitive and added ability for core errors to specify more details optionally.TheKoopaKingdom2017-06-035-39/+70
| | | |
* | | | Added message to status bar to show core errors ignored by the user.TheKoopaKingdom2017-06-032-1/+11
| | | |
* | | | Made some changes from review comments:TheKoopaKingdom2017-06-0310-53/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Made LoadKernelSystemMode return a pair consisting of a system mode and a result code (Could use review). - Deleted ErrorOpenGL error code in favor of just having ErrorVideoCore. - Made dialog messages more clear. - Compared archive ID in fs_user.cpp to ArchiveIdCode::NCCH as opposed to hex magic. - Cleaned up some other stuff.
* | | | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-039-26/+121
| | | |
* | | | Fixed encrypted ROM error messages.TheKoopaKingdom2017-06-033-9/+19
| | | |
* | | | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \ \ \ | | | | | | | | | | CAM: use IPCHelper
| * | | | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| | | | |
| * | | | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| | | | |
| * | | | cam: use IPCHelperwwylele2017-05-241-278/+238
| | | | |
* | | | | Merge pull request #2739 from yuriks/kernel-reorgbunnei2017-06-0127-344/+430
|\ \ \ \ \ | | | | | | | | | | | | Split-up kernel.h
| * | | | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3018-203/+242
| | | | | |
| * | | | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3015-135/+178
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that HandleTable doesn't directly depend on WaitObject anymore, this can be separated from the main kernel.h header.
| * | | | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't necessary anymore since plain Get works correctly for WaitObjects.
| * | | | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| | |/ / / | |/| | |
* | | | | Merge pull request #2721 from wwylele/texture-cubebunnei2017-05-302-3/+77
|\ \ \ \ \ | |_|_|_|/ |/| | | | swrasterizer: implemented TextureCube
| * | | | swrasterizer: implement TextureCubewwylele2017-05-291-2/+51
| | | | |
| * | | | pica: add registers for texture cubewwylele2017-05-291-1/+26
| | | | |
* | | | | Merge pull request #2734 from yuriks/cmake-imported-libsYuri Kunde Schlesner2017-05-308-24/+12
|\ \ \ \ \ | |_|/ / / |/| | | | CMake: Use CMake target properties for all libraries
| * | | | CMake: Create an INTERFACE target for CatchYuri Kunde Schlesner2017-05-281-4/+2
| | | | |
| * | | | CMake: Create INTERFACE targets for microprofile and nihstroYuri Kunde Schlesner2017-05-283-3/+3
| | | | |
| * | | | CMake: Remove unnecessary include_directories for dynarmicYuri Kunde Schlesner2017-05-281-3/+0
| | | | | | | | | | | | | | | | | | | | Dynarmic already adds the correct include paths to the library target.
| * | | | CMake: Add cryptopp include path to target propertyYuri Kunde Schlesner2017-05-281-1/+0
| | | | |
| * | | | CMake: Add SoundTouch include path to target propertyYuri Kunde Schlesner2017-05-281-2/+0
| | | | |
| * | | | CMake: Define an interface target for SDL2 definitionsYuri Kunde Schlesner2017-05-283-8/+4
| | | | |
| * | | | CMake: Remove CITRA_QT_LIBS varYuri Kunde Schlesner2017-05-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | This used to be required to support both Qt4 and Qt5, but we dropped Qt4 so it's not needed anymore.
| * | | | CMake: Stop using FindOpenGL, which seems to not be required anymoreYuri Kunde Schlesner2017-05-282-2/+2
| | | | |
| * | | | CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-283-2/+3
| | | | |
| * | | | CMake: Use IMPORTED target for libpngYuri Kunde Schlesner2017-05-281-3/+2
| | | | |
* | | | | Merge pull request #2729 from yuriks/quaternion-fixYuri Kunde Schlesner2017-05-281-3/+5
|\ \ \ \ \ | |/ / / / |/| | | | OpenGL: Improve accuracy of quaternion interpolation
| * | | | OpenGL: Improve accuracy of quaternion interpolationYuri Kunde Schlesner2017-05-271-3/+5
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | Current order of operations (rotate then normalize) seems to produce a lot more distortion than normalizing and then rotating. This makes Citra results match pretty closesly with hardware, and indicates that hardware may also be using lerp instead of slerp to interpolate the quaternions.
* | | | CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-288-23/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Modules didn't correctly define their dependencies before, which relied on the frontends implicitly including every module for linking to succeed. Also changed every target_link_libraries call to specify visibility of dependencies to avoid leaking definitions to dependents when not necessary.
* | | | Citra: Convert include into forward declarationYuri Kunde Schlesner2017-05-282-2/+6
| | | |
* | | | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-284-4/+0
| | | |
* | | | Move screen size constants from video_core to coreYuri Kunde Schlesner2017-05-289-51/+63
| | | | | | | | | | | | | | | | | | | | video_core didn't even properly use them, and they were the source of many otherwise-unnecessary dependencies from core to video_core.
* | | | OpenGL: Remove unused RendererOpenGL fieldsYuri Kunde Schlesner2017-05-282-11/+2
| | | |
* | | | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-284-4/+4
| | | |
* | | | Common: Fix some out-of-style includesYuri Kunde Schlesner2017-05-283-5/+5
| | | |
* | | | Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-285-4/+4
| |/ / |/| | | | | | | | | | | | | | This removes a dependency inversion between core and common. It's also the proper place for the file since it makes screen layout decisions specific to the 3DS.
* | | Merge pull request #2725 from wwylele/texture-samplerYuri Kunde Schlesner2017-05-271-40/+39
|\ \ \ | | | | | | | | gl_shader: refactor texture sampler into its own function
| * | | gl_shader: refactor texture sampler into its own functionwwylele2017-05-271-40/+39
| |/ /
* | | Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-2633-300/+385
|\ \ \ | |/ / |/| | Decentralize ResultCode
| * | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| | |
| * | Common: Clean up meta-template logic in BitFieldYuri Kunde Schlesner2017-05-251-3/+3
| | |
| * | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2523-132/+178
| | |
| * | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
| | |
| * | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-2510-105/+115
| | |
| * | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | It is now known that result code description vary depending on the module, and so they're best defined on a per-module basis. To support this, allow passing in an arbitrary integer instead of limiting to the ones in the ErrorDescription enum. These will be gradually migrated to their individual users, but a few will be kept as "common" codes shared by all modules.
| * | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-252-41/+57
| | |
* | | Merge pull request #2697 from wwylele/proctexYuri Kunde Schlesner2017-05-2515-11/+1048
|\ \ \ | | | | | | | | Implemented Procedural Texture (Texture Unit 3)
| * | | gl_rasterizer: implement procedural texturewwylele2017-05-206-7/+600
| | | |
| * | | pica/swrasterizer: implement procedural texturewwylele2017-05-209-4/+448
| | | |
* | | | telemetry: Log a few simple data fields throughout core.bunnei2017-05-253-1/+22
| | | |
* | | | core: Keep track of telemetry for the current emulation session.bunnei2017-05-255-0/+83
| | | |
* | | | common: Add a generic interface for logging telemetry fields.bunnei2017-05-253-0/+238
| |_|/ |/| |
* | | Merge pull request #2692 from Subv/vfp_ftzSebastian Valle2017-05-222-0/+26
|\ \ \ | |_|/ |/| | Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.
| * | fixup! Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-222-4/+0
| | |
| * | Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-082-0/+30
| | | | | | | | | | | | Inputs are still not flushed to 0 if they are denormals.
* | | Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-228-51/+84
|\ \ \ | | | | | | | | Kernel: Properly update port counters on session disconnection.
| * | | Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| | | | | | | | | | | | | | | | It is not meant to be used by anything other than CreateSessionPair.
| * | | Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| | | |
| * | | Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-158-32/+86
| | | | | | | | | | | | | | | | Reduce the associated port's connection count when a ServerSession is destroyed.
* | | | Merge pull request #2694 from Subv/vfp_vsub_ftzMerry2017-05-221-2/+12
|\ \ \ \ | | | | | | | | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.
| * | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.Subv2017-05-141-2/+12
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were letting vadd flush the value to positive 0, but there are cases where this behavior is wrong, for example, vsub: -0 - +0 = -0 vadd: -0 + +0 = +0 Now we'll flush the value to +0 inside vsub, and then negate it.
* | | | swrasterizer: add missing tc0_w and fragment lighting attribute processingwwylele2017-05-212-5/+8
| | | |
* | | | Merge pull request #2661 from Subv/uds5bunnei2017-05-195-33/+602
|\ \ \ \ | | | | | | | | | | Services/UDS: Generate 802.11 beacon frames when a network is open.
| * | | | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| | | | |
| * | | | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| | | | | | | | | | | | | | | | | | | | | | | | | This allows the applications to retrieve 802.11 beacon frames from nearby UDS networks. Note that the networks are still not announced anywhere.
| * | | | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-155-7/+537
| | | | |
* | | | | Merge pull request #2710 from emmauss/ptm_ipcbunnei2017-05-193-31/+45
|\ \ \ \ \ | | | | | | | | | | | | use IPCHelper for PTM services
| * | | | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
| | | | | |
* | | | | | pica: use correct register value for shader bool_uniformswwylele2017-05-171-2/+2
|/ / / / / | | | | | | | | | | | | | | | variable value is not masked. the masked and combined register value should be used instead
* | | | | Merge pull request #2703 from wwylele/pica-reg-reviseYuri Kunde Schlesner2017-05-164-17/+25
|\ \ \ \ \ | | | | | | | | | | | | pica: correct bit field length for some registers
| * | | | | pica: correct bit field length for some registerswwylele2017-05-164-17/+25
| | | | | |
* | | | | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-1411-80/+157
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel: Map special regions according to ExHeader
| * | | | | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-105-52/+105
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This replaces the hardcoded VRAM/DSP mappings with ones made based on the ExHeader ARM11 Kernel caps list. While this has no visible effect for most applications (since they use a standard set of mappings) it does improve support for system modules and n3DS exclusives.
| * | | | | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-105-32/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Also move address space mapping out of video_core.
| * | | | | | Memory: Add constants for the n3DS additional RAMYuri Kunde Schlesner2017-05-102-2/+16
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | This is 4MB of extra, separate memory that was added on the New 3DS.
* | | | | | Merge pull request #2695 from JayFoxRox/gs-regsWeiyi Wang2017-05-126-70/+171
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Prepare Pica registers for Geometry Shaders
| * | | | | Pica: Write GS registersJannik Vogel2017-05-121-0/+52
| | | | | | | | | | | | | | | | | | | | | | | | This adds the handlers for the geometry shader register writes which will call the functions from the previous commit to update registers for the GS.
| * | | | | Pica: Write shader registers in functionsJannik Vogel2017-05-121-57/+103
| | | | | | | | | | | | | | | | | | | | | | | | The commit after this one adds GS register writes, so this moves the VS handlers into functions so they can be re-used and extended more easily.
| * | | | | Pica: Set program code / swizzle data limit to 4096Jannik Vogel2017-05-115-13/+16
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | One of the later commits will enable writing to GS regs. It turns out that on startup, most games will write 4096 GS program words. The current limit of 1024 would hence result in 3072 (4096 - 1024) error messages: ``` HW.GPU <Error> video_core/shader/shader.cpp:WriteProgramCode:229: Invalid GS program offset 1024 ``` New constants have been introduced to represent these limits. The swizzle data size has also been raised. This matches the given field sizes of [GPUREG_SH_OPDESCS_INDEX](https://3dbrew.org/wiki/GPU/Internal_Registers#GPUREG_SH_OPDESCS_INDEX) and [GPUREG_SH_CODETRANSFER_INDEX](https://www.3dbrew.org/wiki/GPU/Internal_Registers#GPUREG_SH_CODETRANSFER_INDEX) (12 bit = [0; 4095]).
* | | | | Merge pull request #2669 from jroweboy/async_file_watcherYuri Kunde Schlesner2017-05-113-46/+35
|\ \ \ \ \ | | | | | | | | | | | | Frontend: Prevent FileSystemWatcher from blocking UI thread
| * | | | | Frontend: Prevent FileSystemWatcher from blocking UI threadJames Rowe2017-05-103-46/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of tying the QFileSystemWatcher to the GameList and updating in the UI thread, this change moves it to the worker thread. Since it gets deleted and recreated as part of the worker thread, this prevents it from ever getting used from multiple threads (which is why it was originally done on the UI thread)
* | | | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-109-24/+208
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | ir: implement new 3ds HID via ir:rst
| * | | | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| | | | | |
| * | | | | ir: implement new 3ds HID via ir:rstwwylele2017-05-049-24/+207
| | | | | |
* | | | | | Merge pull request #2696 from Subv/vfp_revertYuri Kunde Schlesner2017-05-093-59/+30
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Dyncom/VFP: Revert edf30d8 and fix the FPSCR getting invalid values.
| * | | | | Dyncom/VFP: Strip the VFP_NAN_FLAG sentinel value when setting vfp exceptions.Subv2017-05-092-2/+2
| | | | | |
| * | | | | Revert "Remove `exceptions` parameter from `normaliseround` VFP functions"Subv2017-05-093-57/+28
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit edf30d84cc0e8299d61c98f5bb40a6428d1576bc. Conflicts: src/core/arm/skyeye_common/vfp/vfp_helper.h src/core/arm/skyeye_common/vfp/vfpdouble.cpp src/core/arm/skyeye_common/vfp/vfpsingle.cpp
* | | | | Dyncom: Remove disassembler codeYuri Kunde Schlesner2017-05-084-1589/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Had licensing issue around it, in addition to several bugs. Closes #1632, #1280
* | | | | Dyncom: Tweak types and log formattingYuri Kunde Schlesner2017-05-083-8/+10
| | | | |
* | | | | Remove unused symbols codeYuri Kunde Schlesner2017-05-086-124/+0
| | | | |
* | | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-085-55/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This was now mostly unused except by thread creation, which used a symbol of the entrypoint, if available, to name the thread.
* | | | | citra-qt: Remove callstack widgetYuri Kunde Schlesner2017-05-086-168/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Appears to be currently broken, and given the complexity of doing this for ARM code without debugging information, should probably be left to an external tool or library. Use the GDB stub instead. Closes #586
* | | | | citra-qt: Remove disassembler widgetYuri Kunde Schlesner2017-05-086-448/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It has performance problems, a very misleading UI, and is broken in general. It has essentially been superceded by the GDB stub, but if we wanted a built-in disassembler in the future it'd essentially need to be rewritten from scratch anyway. Closes #427, #1480
* | | | Merge pull request #2682 from nicoboss/filterYuri Kunde Schlesner2017-05-072-30/+35
|\ \ \ \ | | | | | | | | | | citra-qt: game list search function fixed minor mistakes
| * | | | Don’t focus the search field if the game is emptyNico Bosshard2017-05-061-3/+6
| | | | |
| * | | | Fixed some more typosNico Bosshard2017-05-032-4/+4
| | | | |
| * | | | citra-qt: game list search function fixed minor mistakesNico Bosshard2017-05-021-24/+26
| | | | |
* | | | | Merge pull request #2686 from wwylele/tex-coord-regYuri Kunde Schlesner2017-05-066-10/+32
|\ \ \ \ \ | | | | | | | | | | | | pica: use correct coordinates for texture 2
| * | | | | pica: shader_dirty if texture2 coord changedwwylele2017-05-055-7/+12
| | | | | |
| * | | | | pica: use correct coordinates for texture 2wwylele2017-05-034-5/+22
| |/ / / /
* | / / / Create a random console_unique_id (#2668)B3n302017-05-065-7/+123
| |/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Create a random console_id when config save_file is created Added button in system config to refresh the console unique id * Moved the connect for the button from .ui file to constructor of ConfigureSystem * Added warning and info dialog Fixup: Make use of qt5 style connects, renamed the refresh button, removed some duplicate code, changed random device and moved all to the generate function * Changed the random generator to reflect what a real 3DS stores as console unique id Fixup: Changed the warning message * Fixup: Set and Create * Fixup: Added console id label, therfore removed second message box * Fixup: fixed the endianess * Fixup: more endianness fixes * Fixup: Endianness the 3rd
* | | | Merge pull request #2606 from wwylele/irbunnei2017-05-047-51/+762
|\ \ \ \ | |/ / / |/| | | ir: implement circle pad pro
| * | | ir: implement circle pad prowwylele2017-05-036-44/+761
| | | |
| * | | qt: enable config for circle pad prowwylele2017-04-091-7/+1
| | | |
* | | | citra-qt: game list search function (#2673)Nico Bosshard2017-04-307-19/+299
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * citra-qt: game list search function * Empty search field during game list refresh * Code improvements * Code formatting * Autofocus search field * JayFoxRox's recommendations * lioncash's review
* | | | Merge pull request #2671 from wwylele/dot3-rgbabunnei2017-04-214-22/+39
|\ \ \ \ | | | | | | | | | | rasterizer: implement combiner operation 7 (Dot3_RGBA)
| * | | | gl_shader_gen: remove TODO about Lerp behaviour verification. The implementation is verified against hardwarewwylele2017-04-201-2/+0
| | | | |
| * | | | rasterizer: implement combiner operation 7 (Dot3_RGBA)wwylele2017-04-194-20/+39
| | |_|/ | |/| |
* | | | Merge pull request #2666 from yuriks/gl-cleanupsYuri Kunde Schlesner2017-04-205-214/+215
|\ \ \ \ | | | | | | | | | | PicaShaderConfig cleanups
| * | | | OpenGL: Pass Pica regs via parameterYuri Kunde Schlesner2017-04-173-7/+5
| | | | |
| * | | | OpenGL: Move PicaShaderConfig to gl_shader_gen.hYuri Kunde Schlesner2017-04-174-202/+206
| | | | | | | | | | | | | | | | | | | | Also move the implementation of CurrentConfig to the cpp file.
| * | | | OpenGL: Move Attributes enum to a more appropriate fileYuri Kunde Schlesner2017-04-173-12/+11
| |/ / /
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \ | | | | | | | | | | ldr_ro: use IPC helper
| * | | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| | |/ / | |/| |
* | | | input_common/sdl: add support for binding button to axiswwylele2017-04-172-4/+59
| |/ / |/| |
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | | | | | | | | dsp_dsp: Messages are modified by service before being sent to DSP
| * | | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
| | | |
* | | | Better looking status bar under Linux Ubuntu (#2662)Cereal-Killa2017-04-131-0/+1
| |_|/ |/| | | | | | | | | | | * Remove borders from status bar items On Ubuntu the status bar didn't look as good as on Windows due to some border being drawn around each status bar cell.
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | | | | | | | | Services/UDS: Initial support for hosting local-wlan networks.
| * | | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| | | |
| * | | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| | | |
| * | | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| | | |
| * | | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| | | |
| * | | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| | | |
| * | | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| | | | | | | | | | | | | | | | It will be needed when generating the beacon frames.
| * | | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
| | | | | | | | | | | | | | | | Currently it will let games create a network as hosts, but will not broadcast it anywhere and will not allow clients to connect.
* | | | Pica/Regs: Correct bit width for blend-equationsJannik Vogel2017-04-081-2/+2
| |_|/ |/| |
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \ | | | | | | | | IpcHelper enhancement and APT refactor
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| | | |
| * | | address more commentsLectem2017-03-191-20/+20
| | | |
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| | | |
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| | | |
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| | | |
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| | | |
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
| | | |
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \ | | | | | | | | | | shared_page: stub battery state
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
| | | | |
* | | | | citra-qt: Move config dialog code to its own directoryLioncash2017-04-0425-41/+41
| | | | |
* | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
| | | | |
* | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
| | | | |
* | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
| | | | |
* | | | | Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-229-13/+104
|\ \ \ \ \ | |/ / / / |/| | | | Add custom layout settings.
| * | | | Add custom layout settings.SonofUgly2017-02-239-13/+104
| | | | |
* | | | | Merge pull request #2630 from wwylele/qt-focus-loss-2bunnei2017-03-205-3/+18
|\ \ \ \ \ | | | | | | | | | | | | Qt: Release all pressed buttons when window focus is lost [rebased]
| * | | | | citra-qt: remove dead codewwylele2017-03-173-5/+0
| | | | | |
| * | | | | citra-qt: release all buttons when render window focus is lostwwylele2017-03-174-0/+20
| | |/ / / | |/| | | | | | | | | | | | | credit to @Hawkheart for the original idea
* / | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / / /
* | | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-1740-574/+1244
|\ \ \ \ | | | | | | | | | | Refactor input emulation & add SDL gamepad support
| * | | | qt/config_input: don't connect for null buttonwwylele2017-03-021-4/+7
| | | | |
| * | | | citra: update default ini with new input systemwwylele2017-03-011-28/+41
| | | | |
| * | | | Input: remove unused stuff & clean upwwylele2017-03-019-412/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 1. removed zl, zr and c-stick from HID::PadState. They are handled by IR, not HID 2. removed button handling in EmuWindow 3. removed key_map 4. cleanup #include
| * | | | Qt: rework input configuration for new input systemwwylele2017-03-012-68/+144
| | | | |
| * | | | InputCommon: add SDL joystick supportwwylele2017-03-014-0/+241
| | | | |
| * | | | InputCommon: add AnalogFromButtonwwylele2017-03-018-0/+162
| | | | |
| * | | | InputCommon: add Keyboardwwylele2017-03-0117-85/+254
| | | | |
| * | | | HID: use AnalogDevicewwylele2017-03-013-2/+30
| | | | |
| * | | | HID: use ButtonDevicewwylele2017-03-015-1/+100
| | | | |
| * | | | Input: add device and factory templatewwylele2017-03-014-0/+100
| | | | |
| * | | | Common: add ParamPackagewwylele2017-03-015-0/+188
| | |/ / | |/| |
* | | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-177-17/+20
|\ \ \ \ | | | | | | | | | | Reduce host file name and path logging
| * | | | file_util: Log when using local user directorywwylele2017-03-111-0/+2
| | | | |
| * | | | file_sys: lower log level for setting host pathwwylele2017-03-084-4/+4
| | | | |
| * | | | file_util: lower logging level for harmless caseswwylele2017-03-081-9/+7
| | | | |
| * | | | loader/ncch: less verbose log for loading game list. only log program ID when bootingwwylele2017-03-081-3/+6
| | | | |
| * | | | loader: lower file name logging levelwwylele2017-03-081-1/+1
| |/ / /
* | | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \ \ | | | | | | | | | | Refined thread launch on syscore error messages
| * | | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| |/ / /
* | | | Merge pull request #2625 from wwylele/hash-console-uniquebunnei2017-03-161-7/+24
|\ \ \ \ | | | | | | | | | | cfg: correctly implement GenHashConsoleUnique
| * | | | cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
| |/ / /
* / / / common/cpu_detect: Add missing include and fix namespace scopeYuri Kunde Schlesner2017-03-131-5/+7
|/ / /
* | | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
| | |
* | | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ \ | | | | | | | | IR: separate functions of each port to their own files
| * | | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
| | | |
* | | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
| | | |
* | | | Doxygen: Amend minor issues (#2593)Mat M2017-02-2718-23/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects a few issues with regards to Doxygen documentation, for example: - Incorrect parameter referencing. - Missing @param tags. - Typos in @param tags. and a few minor other issues.
* | | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-2728-449/+321
|\ \ \ \ | |/ / / |/| | | Replace built-in Profiler with indicators in status bar
| * | | PerfStats: Re-order and document members betterYuri Kunde Schlesner2017-02-272-5/+14
| | | |
| * | | Qt: Tweak status bar stylingYuri Kunde Schlesner2017-02-271-0/+2
| | | |
| * | | Qt: Increase status bar update interval to 2 secondsYuri Kunde Schlesner2017-02-271-1/+1
| | | |
| * | | Core: Re-write frame limiterYuri Kunde Schlesner2017-02-275-42/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now based on std::chrono, and also works in terms of emulated time instead of frames, so we can in the future frame-limit even when the display is disabled, etc. The frame limiter can also be enabled along with v-sync now, which should be useful for those with displays running at more than 60 Hz.
| * | | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-277-16/+25
| | | | | | | | | | | | | | | | More ergonomic to use and will be required for upcoming changes.
| * | | Qt: Add tooltips to status bar displaysYuri Kunde Schlesner2017-02-271-0/+7
| | | |
| * | | Qt: Don't show fractional figures in the status barYuri Kunde Schlesner2017-02-271-2/+2
| | | | | | | | | | | | | | | | | | | | They're not very important and this makes the display changes less often, making it less distracting.
| * | | Remove built-in (non-Microprofile) profilerYuri Kunde Schlesner2017-02-279-382/+2
| | | |
| * | | PerfStats: Add method to get the instantaneous time ratioYuri Kunde Schlesner2017-02-273-7/+22
| | | |
| * | | Add performance statistics to status barYuri Kunde Schlesner2017-02-2711-3/+159
| | | |
| * | | SynchronizedWrapper: Add Lock convenience methodYuri Kunde Schlesner2017-02-271-18/+25
| | | |
| * | | Qt: Add (empty) status barYuri Kunde Schlesner2017-02-276-1/+35
| | | |
| * | | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-274-1/+3
| | | |
* | | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-2516-6/+567
|\ \ \ \ | | | | | | | | | | APT: implemented Wrap and Unwrap
| * | | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| | | | |
| * | | | HW: add AES engine & implement AES-CCMwwylele2017-02-2111-0/+418
| | | | |
* | | | | Merge pull request #2421 from Subv/timersYuri Kunde Schlesner2017-02-253-16/+36
|\ \ \ \ \ | | | | | | | | | | | | Timers: Immediately signal the timer if it was started with an initial value of 0
| * | | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
| | | | | |
| * | | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
| | | | | |
* | | | | | Use QFileSystemWatcher to reload the game list when a change is detected. (#2555)James Rowe2017-02-232-1/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added a refresh game directory option to the file menu * Make the game list watcher recursive and have it start watching from the initial load * Rework game list watcher to be thread safe * Fix code style issues
* | | | | | Merge pull request #2441 from jroweboy/titlebarbunnei2017-02-236-5/+32
|\ \ \ \ \ \ | | | | | | | | | | | | | | Gui: Change title bar to include build name
| * | | | | | Gui: Change title bar to include build nameJames Rowe2017-02-236-5/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nightly builds now have "Citra Nightly" in the titlebar Bleeding edge builds now have "Citra Bleeding Edge" in the titlebar
* | | | | | | [UI] Modify recursive scanning label (#2589)Anthony2017-02-231-1/+1
|/ / / / / /
* | | | | | Merge pull request #2585 from MerryMage/sxtb16-sxtab16bunnei2017-02-201-4/+4
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | dyncom: Correct SXTAB16 and SXTB16
| * | | | | dyncom: Correct SXTAB16 and SXTB16MerryMage2017-02-181-4/+4
| | | | | |
* | | | | | Merge pull request #2580 from yuriks/qt-cleanup2Yuri Kunde Schlesner2017-02-194-96/+83
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Qt cleanups 2
| * | | | | Qt: Move some connections from .ui file to codeYuri Kunde Schlesner2017-02-182-38/+3
| | | | | |
| * | | | | Qt: Reorganize connection of menu eventsYuri Kunde Schlesner2017-02-182-13/+23
| | | | | |
| * | | | | Qt: Re-organize setup of debugging widgetsYuri Kunde Schlesner2017-02-184-39/+51
| | | | | |
| * | | | | Qt: Fix action name to match conventionsYuri Kunde Schlesner2017-02-182-6/+6
| | | | | |
* | | | | | OpenGL: Check if uniform block exists before updating it (#2581)Jannik Vogel2017-02-181-29/+30
|/ / / / /
* | | | | Qt: Make IsSingleFileDropEvent staticYuri Kunde Schlesner2017-02-181-1/+1
| | | | |
* | | | | Qt: Allow any file extension in Open dialogYuri Kunde Schlesner2017-02-181-2/+3
| | | | |
* | | | | Qt: Remove orpahned function declarationYuri Kunde Schlesner2017-02-181-6/+0
| | | | |
* | | | | Qt: Remove unnecessary std::string usageYuri Kunde Schlesner2017-02-182-14/+15
| | | | |
* | | | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
| | | | | | | | | | | | | | | Fixes #2556
* | | | | added drag n drop featurenoah the goodra2017-02-162-1/+41
| | | | |
* | | | | Merge pull request #2571 from wwylele/missing-fileMat M2017-02-151-0/+1
|\ \ \ \ \ | | | | | | | | | | | | core: add missing errors.h in CMakeLists.txt
| * | | | | core: add missing errors.h in CMakeLists.txtwwylele2017-02-151-0/+1
| | | | | |
* | | | | | video_core: remove #pragma once in cpp file (#2570)Weiyi Wang2017-02-152-4/+0
|/ / / / /
* | | | | Merge pull request #2566 from yuriks/file-extension-suffixWeiyi Wang2017-02-141-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Qt/GameList: Use suffix() to parse the file extension
| * | | | | Qt/GameList: Use suffix() to parse the file extensionYuri Kunde Schlesner2017-02-141-1/+1
| | |/ / / | |/| | | | | | | | | | | | | | | | | | completeSuffix returns everything after the first period, which means that a file such as `foo.bar.3ds` would not get recognized.
* | | | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
| | | | | | | | | | | | | | | Fixes #2567
* | | | | applied the change suggested by @wwylelenoah the goodra2017-02-141-0/+1
| | | | |
* | | | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
| | | | |
* | | | | turned clang format back onnoah the goodra2017-02-141-1/+1
| | | | |
* | | | | added http service enum to the log.h filenoah the goodra2017-02-141-0/+1
|/ / / /
* | | | Merge pull request #2562 from yuriks/pica-refactor3Yuri Kunde Schlesner2017-02-1312-563/+661
|\ \ \ \ | | | | | | | | | | Re-organize software rasterizer code
| * | | | SWRasterizer: Move more framebuffer functions to fileYuri Kunde Schlesner2017-02-133-100/+105
| | | | |
| * | | | SWRasterizer: Move texturing functions to their own fileYuri Kunde Schlesner2017-02-134-210/+259
| | | | |
| * | | | SWRasterizer: Convert large no-capture lambdas to standalone functionsYuri Kunde Schlesner2017-02-131-315/+310
| | | | |
| * | | | SWRasterizer: Move framebuffer operation functions to their own fileYuri Kunde Schlesner2017-02-134-236/+285
| | | | |
| * | | | VideoCore: Move software rasterizer files to sub-directoryYuri Kunde Schlesner2017-02-138-12/+12
| | | | |
* | | | | Core: add cryptopp library (#2412)Weiyi Wang2017-02-131-1/+2
| | | | |
* | | | | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-139-60/+295
|\ \ \ \ \ | |/ / / / |/| | | | file_sys: change RomFS archive to Self NCCH archive
| * | | | loader: use self NCCH archivewwylele2017-02-136-90/+7
| | | | |
| * | | | file_sys: add Self NCCH archivewwylele2017-02-135-0/+318
| |/ / /
* | | | video_core/shader: Document sanitized MUL operationYuri Kunde Schlesner2017-02-121-0/+8
| | | |
* | | | Merge pull request #2550 from yuriks/pica-refactor2Yuri Kunde Schlesner2017-02-1219-140/+133
|\ \ \ \ | | | | | | | | | | Small VideoCore cleanups