summaryrefslogtreecommitdiffstats
path: root/src/core (follow)
Commit message (Expand)AuthorAgeFilesLines
* hle: ipc_helpers: Update IPC response generation for TIPC.bunnei2021-05-112-19/+39
* Merge pull request #6291 from lioncash/kern-shadowbunnei2021-05-1040-140/+138
|\
| * kernel: Eliminate variable shadowingLioncash2021-05-0840-140/+138
* | kernel: Delete unused filesgerman772021-05-092-151/+0
|/
* Merge pull request #6266 from bunnei/kautoobject-refactorbunnei2021-05-08170-2799/+4752
|\
| * hle: kernel: KPageTable: CanContain should not be constexpr.bunnei2021-05-062-2/+2
| * hle: kernel: Move slab resource counts to Kernel.bunnei2021-05-064-33/+52
| * fixup! hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-061-2/+2
| * fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| * fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| * kernel: svc: Remove unused RetrieveResourceLimitValue function.bunnei2021-05-061-32/+0
| * hle: kernel: Fix un/sign mismatch errors with NUM_CPU_CORES.bunnei2021-05-061-3/+3
| * fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-6/+2
| * fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-0/+3
| * fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-7/+0
| * fixup! hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-062-2/+2
| * fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-061-12/+12
| * fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-063-22/+28
| * fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-60/+58
| * fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-11/+9
| * fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-9/+2
| * fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-46/+46
| * fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-8/+8
| * common: Rename NON_COPYABLE/NON_MOVABLE with YUZU_ prefix.bunnei2021-05-064-9/+9
| * fixup! hle: kernel: Rename Process to KProcess.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * fixup! hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-061-3/+3
| * hle: kernel: svc: ConnectToNamedPort: Use KHandleTable::Reserve.bunnei2021-05-061-3/+8
| * hle: kernel: Migrate to KHandleTable.bunnei2021-05-0620-377/+498
| * hle: kernel: KClassToken: Ensure class tokens are correct.bunnei2021-05-061-1/+127
| * hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-0610-95/+210
| * hle: kernel: Rename Process to KProcess.bunnei2021-05-0676-240/+242
| * hle: kernel: Remove deprecated Object class.bunnei2021-05-0637-407/+15
| * hle: kernel: Do not shutdown twice on emulator close.bunnei2021-05-061-3/+1
| * hle: kernel: Cleanup shutdown of persistent kernel objects.bunnei2021-05-061-14/+12
| * hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-0622-166/+444
| * hle: kernel: Migrate KServerPort to KAutoObject.bunnei2021-05-068-52/+67
| * hle: kernel: Migrate KClientPort to KAutoObject.bunnei2021-05-0618-63/+92
| * hle: kernel: HandleTable: Remove deprecated APIs.bunnei2021-05-065-106/+23
| * hle: kernel: Migrate KResourceLimit to KAutoObject.bunnei2021-05-0613-122/+197
| * hle: kernel: svc: Migrate WaitSynchronization.bunnei2021-05-062-47/+78
| * hle: kernel: svc: Use new handle table API for Process.bunnei2021-05-062-16/+17
| * hle: kernel: Migrate KTransferMemory to KAutoObject.bunnei2021-05-0612-68/+209
| * hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-0631-356/+412
| * hle: kernel: svc: Migrate GetThreadContext, GetThreadCoreMask.bunnei2021-05-061-2/+59
| * hle: kernel: svc: Migrate GetProcessId, CancelSynchronization, SetThreadActivity.bunnei2021-05-061-13/+67
| * hle: kernel: KThread: Remove incorrect resource release.bunnei2021-05-061-2/+1
| * hle: kernel: svc_results: Update naming..bunnei2021-05-068-42/+43
| * hle: kernel: KThread: Add missing resource hint release.bunnei2021-05-061-1/+1
| * hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-0635-200/+215
| * hle: ipc_helpers: Add methods for copy/move references.bunnei2021-05-061-2/+24
| * hle: kernel: Move slab heaps to their own container.bunnei2021-05-062-10/+16
| * hle: kernel: Refactor several threads/events/sharedmemory to use slab heaps.bunnei2021-05-0611-59/+53
| * hle: kernel: Move slab heap management to KernelCore.bunnei2021-05-067-64/+106
| * hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-0620-0/+55
| * hle: kernel: Use unique_ptr for suspend and dummy threads.bunnei2021-05-061-8/+8
| * hle: kernel: Migrate KEvent to KAutoObject.bunnei2021-05-0637-266/+269
| * hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-0616-114/+128
| * hle: kernel: Migrate KProcess to KAutoObject.bunnei2021-05-0613-57/+79
| * hle: kernel: Refactor IPC interfaces to not use std::shared_ptr.bunnei2021-05-0628-59/+65
| * hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-0617-289/+444
| * hle: kernel: svc: Migrate GetThreadPriority, StartThread, and ExitThread.bunnei2021-05-061-21/+12
| * hle: kernel: svc: Migrate CreateThread.bunnei2021-05-061-14/+21
| * hle: kernel: Migrate idle threads.bunnei2021-05-062-13/+9
| * hle: kernel: Migrate KThread to KAutoObject.bunnei2021-05-062-109/+91
| * hle: kernel: Add initial impl. of slab setup.bunnei2021-05-063-0/+227
| * hle: kernel: Refactor out various KThread std::shared_ptr usage.bunnei2021-05-0610-58/+30
| * core: Defer CoreTiming initialization.bunnei2021-05-061-1/+1
| * core: memory: Add a work-around to allocate and access kernel memory regions by vaddr.bunnei2021-05-063-1/+46
| * hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-062-0/+234
| * hle: kernel: Add initial impl. of KSlabAllocated.bunnei2021-05-062-0/+153
| * hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-063-0/+109
| * hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-063-0/+306
* | Merge pull request #6287 from lioncash/ldr-copybunnei2021-05-071-5/+3
|\ \ | |/ |/|
| * ldr: Simplify memory copy within LoadNro()Lioncash2021-05-071-5/+3
* | Merge pull request #6279 from ogniK5377/nvhost-profbunnei2021-05-061-3/+14
|\ \ | |/ |/|
| * Update src/core/hle/service/nvdrv/interface.cppbunnei2021-05-061-1/+1
| * nvdrv: /dev/nvhost-prof-gpu for productionChloe Marcec2021-05-031-3/+14
* | service: Remove unused class variablesLioncash2021-05-053-7/+4
* | service: Resolve cases of member field shadowingLioncash2021-05-0460-117/+119
* | Merge pull request #6278 from lioncash/misc-shadowbunnei2021-05-0410-25/+27
|\ \ | |/ |/|
| * core: Resolve misc cases of variable shadowingLioncash2021-05-0310-25/+27
* | hid: Fix touch not initializing properly if disabledgerman772021-05-032-2/+10
|/
* Merge pull request #6269 from lioncash/file-shadowbunnei2021-05-0321-114/+132
|\
| * file_sys: Resolve cases of variable shadowingLioncash2021-05-0221-114/+132
* | Merge pull request #6265 from Morph1984/snap-save-fixbunnei2021-05-022-2/+8
|\ \ | |/ |/|
| * service: filesystem: Return proper error codes for CreateFileMorph2021-05-012-2/+8
* | Disable touch if setting is not enabledgerman772021-05-012-2/+2
|/
* Merge pull request #6257 from Morph1984/fix-use-after-free-webappletbunnei2021-04-302-6/+7
|\
| * applets/web: Fix a use-after-free when passing in the URL stringMorph2021-04-282-6/+7
* | Merge pull request #6226 from german77/sevensixbunnei2021-04-309-15/+212
|\ \ | |/ |/|
| * address commentsgerman772021-04-272-5/+5
| * hid: Implement SevenSixAxis and ConsoleSixAxisSensorgerman772021-04-249-15/+212
* | loader: Resolve instances of variable shadowingLioncash2021-04-2719-169/+257
* | service: Eliminate cases of member shadowingLioncash2021-04-2615-76/+81
* | nvhost_vic: Fix device closureameerj2021-04-252-10/+8
* | Merge pull request #6234 from Morph1984/stub-amMat M2021-04-242-1/+10
|\ \
| * | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabledMorph2021-04-242-1/+10
* | | Merge pull request #6235 from german77/ectx_awMat M2021-04-244-0/+49
|\ \ \
| * | | glue: Add ectx:aw placeholdergerman772021-04-244-0/+49
| | |/ | |/|
* | | Merge pull request #6230 from Morph1984/default-resource-sizebunnei2021-04-243-4/+8
|\ \ \
| * | | program_metadata: Set a default resource size when a NPDM is not presentMorph2021-04-233-4/+8
* | | | Merge pull request #6227 from lioncash/metabunnei2021-04-241-0/+6
|\ \ \ \
| * | | | program_metadata: Explicitly specify copy/move functionsLioncash2021-04-231-0/+6
* | | | | Merge pull request #6228 from lioncash/semibunnei2021-04-241-6/+7
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | lm: Make use of insert_or_assign() in Log()Lioncash2021-04-231-1/+1
| * | | | lm: Prevent redundant map lookups in Log()Lioncash2021-04-231-4/+5
| * | | | lm: Resolve -Wextra-semi warningLioncash2021-04-231-1/+1
| |/ / /
* | | | Merge pull request #6229 from lioncash/unused-varbunnei2021-04-242-6/+0
|\ \ \ \
| * | | | acc/lbl: Remove unused variablesLioncash2021-04-232-6/+0
| |/ / /
* | | | Merge pull request #6231 from lioncash/aesbunnei2021-04-232-9/+5
|\ \ \ \ | |_|/ / |/| | |
| * | | aes_util: Make use of std::spanLioncash2021-04-232-9/+5
| |/ /
* | | Merge pull request #6232 from lioncash/alias2bunnei2021-04-232-24/+27
|\ \ \ | |_|/ |/| |
| * | emu_window: Return pair from ClipToTouchScreen() instead of tupleLioncash2021-04-232-5/+8
| * | emu_window: unsigned -> u32Lioncash2021-04-232-21/+21
| |/
* / service: hid: Get transfer memory for InitializeSevenSixAxisSensorMorph2021-04-221-1/+38
|/
* Merge pull request #6214 from Morph1984/time-fix-kirby-clashbunnei2021-04-211-3/+5
|\
| * time: Write buffer before pushing RESULT_SUCCESS in GetClockSnapshotMorph2021-04-191-1/+2
| * time: Fix GetClockSnapshotFromSystemClockContextMorph2021-04-191-2/+3
* | Merge pull request #6217 from Morph1984/consistent-writebuffersbunnei2021-04-203-5/+12
|\ \
| * | general: Write buffers before pushing raw argumentsMorph2021-04-193-5/+12
| |/
* | Merge pull request #6215 from lioncash/duplicatebunnei2021-04-202-2/+1
|\ \
| * | npad: Remove duplicated class member variableLioncash2021-04-192-2/+1
| |/
* | arp: Use type alias for issue functionLioncash2021-04-191-4/+4
* | arp: Prevent uninitialized read of launch member variableLioncash2021-04-191-1/+1
|/
* applets: Send focus state change message on applet state changeMorph2021-04-1710-22/+56
* applets: Make the applet mode a protected property of AppletMorph2021-04-1714-22/+20
* Merge pull request #6125 from ogniK5377/nvdec-close-devbunnei2021-04-171-6/+4
|\
| * nvdrv: Cleanup CDMA Processor on device closureChloe Marcec2021-03-301-6/+4
* | input_interpreter: Fix button hold being interpreted incorrectly on initMorph2021-04-152-1/+17
* | applets/swkbd: Implement the Default Software Keyboard frontendMorph2021-04-152-2/+236
* | applets/swkbd: Implement the Normal and Inline Software Keyboard AppletMorph2021-04-154-13/+1488
* | ILibraryAppletCreator: Implement CreateHandleStorageMorph2021-04-152-6/+64
* | hle_ipc: Add helper functions to get copy/move handlesMorph2021-04-152-2/+16
* | ILibraryAppletAccessor: Demote from ERROR to DEBUG for null storage logsMorph2021-04-151-2/+2
* | applets: Pass in the LibraryAppletMode each applet's constructorMorph2021-04-1513-33/+58
* | applets: Remove the previous software keyboard applet implementationMorph2021-04-154-280/+7
* | Merge pull request #6196 from bunnei/asserts-settingbunnei2021-04-1545-461/+53
|\ \
| * | common: Move settings to common from core.bunnei2021-04-1545-462/+53
| * | core: settings: Add setting for debug assertions and disable by default.bunnei2021-04-151-0/+1
* | | k_resource_limit: Minor cleanup of member variables/headersameerj2021-04-144-21/+13
* | | Merge pull request #6185 from ameerj/process-reslimitbunnei2021-04-142-38/+27
|\ \ \ | |/ / |/| |
| * | kernel/process: Replace process resource limit instance with the kernel's resource limitameerj2021-04-122-38/+27
* | | k_thread: Remove [[nodiscard]] attribute from ClearWaitCancelled()Lioncash2021-04-121-1/+1
* | | Merge pull request #6135 from Morph1984/borderless-windowed-fullscreenbunnei2021-04-121-0/+1
|\ \ \ | |/ / |/| |
| * | configure_graphics: Add Borderless Windowed fullscreen modeMorph2021-04-061-0/+1
* | | Merge pull request #6170 from Morph1984/more-time-fixesbunnei2021-04-116-21/+38
|\ \ \
| * | | service: time: Setup the network clock with the local clock contextMorph2021-04-086-21/+38
* | | | Merge pull request #6167 from Morph1984/time-fixbunnei2021-04-111-3/+8
|\ \ \ \
| * | | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUserMorph2021-04-081-3/+8
* | | | | Merge pull request #6112 from ogniK5377/pctlbunnei2021-04-116-31/+254
|\ \ \ \ \
| * | | | | Addressed issuesChloe Marcec2021-03-302-21/+22
| * | | | | pctl: Rework how pctl works to be more accurateChloe Marcec2021-03-266-31/+253
* | | | | | Merge pull request #6172 from degasus/cmake_opusbunnei2021-04-101-1/+1
|\ \ \ \ \ \
| * | | | | | externals: Search for shared opus installation.Markus Wick2021-04-081-1/+1
* | | | | | | Merge pull request #6099 from bunnei/derive-membunnei2021-04-1024-173/+2095
|\ \ \ \ \ \ \
| * | | | | | | hle: kernel: Breakup InitializeMemoryLayout.bunnei2021-03-241-3/+7
| * | | | | | | hle: kernel: k_memory_region_type: Minor code cleanup.bunnei2021-03-241-13/+12
| * | | | | | | hle: kernel: k_memory_region: Minor code cleanup.bunnei2021-03-241-7/+5
| * | | | | | | hle: kernel: k_memory_layout: Use pair instead of tuple.bunnei2021-03-241-2/+4
| * | | | | | | hle: kernel: k_system_control: Remove unnecessary inline.bunnei2021-03-241-4/+4
| * | | | | | | common: common_sizes: Move sizes to the Common namespace.bunnei2021-03-244-45/+46
| * | | | | | | hle: kernel: Merge KMemoryRegionAttr and KMemoryRegionType.bunnei2021-03-212-11/+9
| * | | | | | | hle: kernel: Remove unused variable.bunnei2021-03-211-1/+0
| * | | | | | | hle: kernel: k_memory_region_type: Remove extra ".bunnei2021-03-211-1/+1
| * | | | | | | hle: kernel: k_memory_layout: Move KMemoryRegionAllocator out of global.bunnei2021-03-213-35/+47
| * | | | | | | hle: kernel: k_memory_layout: Derive memory regions based on board layout.bunnei2021-03-216-56/+1033
| * | | | | | | common: common_sizes: Move Invalid to Size_* prefix and add missing values.bunnei2021-03-211-14/+14
| * | | | | | | hle: kernel: k_memory_region: Refactor to simplify code.bunnei2021-03-212-83/+89
| * | | | | | | hle: kernel: board: k_system_control: Extend to include memory region sizes.bunnei2021-03-212-1/+125
| * | | | | | | hle: kernel: board: Add secure_monitor module.bunnei2021-03-212-0/+27
| * | | | | | | common: Move common sizes to their own header for code reuse.bunnei2021-03-211-13/+1
| * | | | | | | hle: kernel: k_address_space_info: Cleanup.bunnei2021-03-211-9/+9
| * | | | | | | hle: kernel: Add k_trace module.bunnei2021-03-212-0/+13
| * | | | | | | hle: kernel: KSystemControl: Update to reflect board-specific behavior.bunnei2021-03-214-10/+41
| * | | | | | | hle: kernel: KMemoryManager: Add CalculateManagementOverheadSize.bunnei2021-03-212-0/+26
| * | | | | | | hle: kernel: KMemoryManager: Add aliases.bunnei2021-03-211-0/+4
| * | | | | | | hle: kernel: Add architecture and board specific memory regions.bunnei2021-03-212-0/+72
| * | | | | | | hle: kernel: KMemoryRegion: Derive region values.bunnei2021-03-211-0/+327
| * | | | | | | hle: kernel: Migrate some code from Common::SpinLock to KSpinLock.bunnei2021-03-215-25/+25
| * | | | | | | hle: kernel: Add initial KMemoryRegionType module.bunnei2021-03-213-18/+41
| * | | | | | | hle: kernel: Move KMemoryRegion to its own module and update.bunnei2021-03-214-31/+322
* | | | | | | | Merge pull request #6171 from german77/servicesbunnei2021-04-1030-97/+137
|\ \ \ \ \ \ \ \
| * | | | | | | | wlan: Update to 12.xgerman772021-04-091-0/+7
| * | | | | | | | usb: Use proper namesgerman772021-04-091-21/+21
| * | | | | | | | ITimeZoneService: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | spl: Update to 12.xgerman772021-04-091-0/+3
| * | | | | | | | sfdnsres: Use proper namesgerman772021-04-091-2/+2
| * | | | | | | | nsd: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | ethc: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | sm: Use proper names, update to 12.xgerman772021-04-091-4/+5
| * | | | | | | | set_sys: Update to 12.xgerman772021-04-091-0/+6
| * | | | | | | | pctl_module: Update to 12.xgerman772021-04-091-0/+3
| * | | | | | | | pcie: Use proper namesgerman772021-04-091-1/+1
| * | | | | | | | olsc: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | pl_u: Update to 12.xgerman772021-04-091-0/+4
| * | | | | | | | ldr: Use proper namesgerman772021-04-091-16/+16
| * | | | | | | | arp: Use proper names, update to 12.xgerman772021-04-092-3/+10
| * | | | | | | | caps_u: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | caps_a: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | | | bpc: Use proper namesgerman772021-04-091-2/+2
| * | | | | | | | bcat_module: Update to 12.xgerman772021-04-091-0/+2
| * | | | | | | | codecctl: Use proper namesgerman772021-04-091-13/+13
| * | | | | | | | audren_u: Use proper namesgerman772021-04-092-4/+4
| * | | | | | | | audren_a: Use proper namesgerman772021-04-091-6/+6
| * | | | | | | | audrec_u: Use proper names, update to 12.xgerman772021-04-091-3/+4
| * | | | | | | | audrec_a: Use proper namesgerman772021-04-091-2/+2
| * | | | | | | | audout_u: Use proper namesgerman772021-04-091-3/+3
| * | | | | | | | audout_a: Use proper namesgerman772021-04-091-6/+6
| * | | | | | | | audin_u: Use proper namesgerman772021-04-091-7/+7
| * | | | | | | | audin_a: Use proper namesgerman772021-04-091-4/+4
* | | | | | | | | Merge pull request #6156 from lioncash/lock-discardbunnei2021-04-103-9/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Amend bizarre clang-format suggestionsLioncash2021-04-073-5/+5
| * | | | | | | | | k_scoped_scheduler_lock_and_sleep: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| * | | | | | | | | k_scoped_lock: delete copy and move assignment operatorsLioncash2021-04-071-2/+5
| * | | | | | | | | k_scoped_lock: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| * | | | | | | | | k_scheduler: Mark KScopedSchedulerLock as [[nodiscard]]Lioncash2021-04-071-1/+1
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #6113 from german77/playhistorybunnei2021-04-101-1/+13
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Friend: Stub GetPlayHistoryRegistrationKeygerman772021-03-271-1/+13
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6158 from german77/hidServiceTablesbunnei2021-04-102-0/+85
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hid: Update service function tablesgerman772021-04-072-0/+85
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6162 from degasus/no_spin_loopsbunnei2021-04-091-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core/gpu_thread: Implement a ShutDown method.Markus Wick2021-04-071-1/+1
* | | | | | | | | | ns: Update to 12.xMorph2021-04-091-3/+38
* | | | | | | | | | aoc_u: Update to 12.xMorph2021-04-091-0/+2
* | | | | | | | | | nim: Update to 12.xMorph2021-04-091-44/+55
* | | | | | | | | | npns: Update to 12.xMorph2021-04-091-0/+3
* | | | | | | | | | bgtc: Update to 12.x and implement OpenTaskServiceMorph2021-04-092-1/+34
* | | | | | | | | | vi: Update to 12.xMorph2021-04-091-0/+8
* | | | | | | | | | erpt: Update to 12.xMorph2021-04-091-1/+6
* | | | | | | | | | btm: Update to 12.xMorph2021-04-091-0/+1
* | | | | | | | | | btdrv: Update to 12.xMorph2021-04-091-0/+19
* | | | | | | | | | Merge pull request #6168 from Morph1984/stub-SetNpadAnalogStickUseCenterClampbunnei2021-04-094-1/+29
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service: hid: Stub SetAnalogStickUseCenterClampMorph2021-04-084-1/+29
| | |_|_|_|_|_|_|/ / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6155 from ameerj/kernel-12-rescntbunnei2021-04-091-2/+2
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | kernel: Increase event and session countsameerj2021-04-071-2/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #6157 from Morph1984/am-update-12.xbunnei2021-04-091-0/+22
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | ISelfController: Update to 11.xMorph2021-04-071-0/+1
| * | | | | | | | | IApplicationFunctions: Update to 11.xMorph2021-04-071-0/+6
| * | | | | | | | | IDebugFunctions: Update to 12.xMorph2021-04-071-0/+2
| * | | | | | | | | ICommonStateGetter: Update to 12.xMorph2021-04-071-0/+9
| * | | | | | | | | IGlobalStateController: Update to 12.xMorph2021-04-071-0/+1
| * | | | | | | | | IHomeMenuFunctions: Update to 12.xMorph2021-04-071-0/+3
| |/ / / / / / / /
* | | | | | | | | Merge pull request #6062 from ameerj/auto-stubbunnei2021-04-092-0/+7
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | configuration: Add auto stub toggle that resets on bootameerj2021-03-302-4/+7
| * | | | | | | | service: Auto stub fallbackameerj2021-03-301-0/+4
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #6145 from lat9nq/nvhost_empty_memcpybunnei2021-04-081-6/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | nvhost_nvdec_common: Avoid memcpy with null pointerslat9nq2021-04-051-6/+11
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #6154 from lioncash/svcrange2bunnei2021-04-081-0/+132
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | svc: Expand SVC tablesLioncash2021-04-071-0/+132
| |/ / / / / /
* | | | | | | Merge pull request #6160 from Morph1984/fs-update-12.xbunnei2021-04-082-6/+15
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | IFile: Update to 12.xMorph2021-04-071-3/+7
| * | | | | | fsp-srv: Update to 12.xMorph2021-04-072-3/+8
| |/ / / / /
* | | | | | Merge pull request #6143 from lat9nq/nvhost_null_memcpybunnei2021-04-081-1/+7
|\ \ \ \ \ \
| * | | | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpylat9nq2021-04-051-1/+7
| |/ / / / /
* | | | | | Merge pull request #6159 from Morph1984/acc-update-12.xbunnei2021-04-073-36/+45
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | dauth_o: Update to 11.xMorph2021-04-071-6/+11
| * | | | | acc_u1: Update to 12.xMorph2021-04-071-13/+15
| * | | | | acc_su: Update to 12.xMorph2021-04-071-17/+19
| |/ / / /
* | | | | Merge pull request #6153 from lioncash/svcrangebunnei2021-04-072-6/+1
|\ \ \ \ \
| * | | | | process_capability: Handle extended SVC rangeLioncash2021-04-072-6/+1
| |/ / / /
* / / / / hwopus: Update to 12.xMorph2021-04-071-0/+4
|/ / / /
* | | | Merge pull request #6132 from MerryMage/code_sizebunnei2021-04-032-0/+8
|\ \ \ \
| * | | | arm_dynarmic: Increase size of code cacheMerryMage2021-04-022-0/+8
* | | | | Merge pull request #6131 from german77/rightjoyconSLSRMorph2021-04-021-2/+6
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | HID: Fix SL and SR buttons for right joycongerman772021-04-021-2/+6
| | |/ / | |/| |
* | | | Merge pull request #6106 from MerryMage/nullptr-jitbunnei2021-04-014-53/+26
|\ \ \ \
| * | | | arm_dynarmic: Always have a 'valid' jit instanceMerryMage2021-03-244-53/+26
* | | | | ISelfController: Stub SetAlbumImageTakenNotificationEnabledMorph2021-03-302-1/+17
| |_|/ / |/| | |
* | | | Merge pull request #6109 from german77/gestureIDbunnei2021-03-302-3/+13
|\ \ \ \
| * | | | HID: Initialize correctly the gesture finger_id and filter invalid resultsNarr the Reg2021-03-262-3/+13
| | |/ / | |/| |
* | | | Merge pull request #6102 from ogniK5377/fd-passbunnei2021-03-2920-78/+161
|\ \ \ \
| * | | | nvdrv: Pass device fd and handle device create methods for device opening and closingChloe Marcec2021-03-2520-78/+161
| |/ / /
* | | | Merge pull request #6115 from bunnei/fix-kernel-initbunnei2021-03-281-1/+1
|\ \ \ \
| * | | | hle: kernel: Initialize preemption task after schedulers.bunnei2021-03-271-1/+1
| |/ / /
* / / / service: friend: Change logging class from ACC to FriendMorph2021-03-271-11/+12
|/ / /
* | | Merge pull request #6101 from ogniK5377/alloc-as-exbunnei2021-03-252-27/+49
|\ \ \ | |/ / |/| |
| * | nvdrv: Change InitializeEx to AllocAsExChloe Marcec2021-03-222-27/+49
| |/
* / core: arm_dynarmic: Ensure JIT state is saved/restored on page table changes.bunnei2021-03-212-0/+10
|/
* Merge pull request #6052 from Morph1984/vi-getindirectlayerimagemapbunnei2021-03-201-1/+27
|\
| * IApplicationDisplayService: Stub GetIndirectLayerImageMapMorph2021-03-171-1/+27
* | Merge pull request #6056 from zkitX/spl-updatesbunnei2021-03-183-9/+178
|\ \ | |/ |/|
| * Fix casing on DeallocateAesKeySlotzkitx2021-03-111-3/+3
| * Update SPL to fit N's service refactor (4.0.0+) which split into new services.zkitx2021-03-113-9/+178
* | Merge pull request #6070 from Morph1984/sysver-11.0.1bunnei2021-03-171-5/+5
|\ \
| * | system_version: Update to 11.0.1Morph2021-03-141-5/+5
* | | bsd: Avoid writing empty buffersMorph2021-03-161-2/+6
* | | Merge pull request #6069 from Morph1984/ngWordbunnei2021-03-151-2/+2
|\ \ \ | |/ / |/| |
| * | system_archive: Update NgWord archive versionMorph2021-03-141-2/+2
* | | Merge pull request #6054 from Morph1984/time-GetClockSnapshotbunnei2021-03-141-0/+2
|\ \ \ | |/ / |/| |
| * | time: Assign the current time point to the ClockSnapshotMorph2021-03-101-0/+2
| |/
* / time: Fix CalculateSpanBetween implementationMorph2021-03-101-3/+9
|/
* common: Fiber: use a reference for YieldTo.bunnei2021-03-072-12/+7
* hle: kernel: KThread: Rework dummy threads & fix memory leak.bunnei2021-03-066-36/+65
* Revert "core: Switch to unique_ptr for usage of Common::Fiber."bunnei2021-03-067-31/+29
* Merge pull request #6034 from Morph1984/mbedtlsbunnei2021-03-061-2/+0
|\
| * aes_util: Remove malformed mbedtls_cipher_finish function callMorph2021-03-051-2/+0
* | Merge pull request #6006 from bunnei/fiber-unique-ptrbunnei2021-03-057-29/+31
|\ \ | |/ |/|
| * core: Switch to unique_ptr for usage of Common::Fiber.bunnei2021-02-277-29/+31
* | Merge pull request #5815 from comex/net-error-reformbunnei2021-03-032-95/+84
|\ \
| * | [network] Error handling reformcomex2021-02-282-95/+84
* | | core: Shutdown: Move kernel cleanup to later in shutdown.bunnei2021-03-021-12/+1
|/ /
* | Merge pull request #6007 from bunnei/ldn-errorbunnei2021-02-281-1/+1
|\ \
| * | core: hle: ldn: Error out on call to Initialization.bunnei2021-02-271-1/+1
| |/
* | Merge pull request #5276 from german77/gesturesMorph2021-02-282-11/+240
|\ \ | |/ |/|
| * Implements touch, pan, pinch and rotation gesturesgerman2021-02-282-11/+240
* | Merge pull request #5953 from bunnei/memory-refactor-1bunnei2021-02-2752-1211/+1433
|\ \
| * | hle: kernel: Migrate PageHeap/PageTable to KPageHeap/KPageTable.bunnei2021-02-1923-146/+130
| * | hle: kernel: Migrate MemoryManager to KMemoryManager.bunnei2021-02-198-47/+48
| * | hle: kernel: Migrate PageLinkedList to KPageLinkedList.bunnei2021-02-198-38/+41
| * | hle: kernel: Migrate to KMemoryBlock, KMemoryBlockManager, and others.bunnei2021-02-1918-476/+479
| * | hle: kernel: Migrate SlabHeap to KSlabHeap.bunnei2021-02-194-22/+21
| * | hle: kernel: Migrate MemoryLayout to KMemoryLayout.bunnei2021-02-195-31/+30
| * | hle: kernel: Migrate AddressSpaceInfo to KAddressSpaceInfo.bunnei2021-02-194-59/+54
| * | hle: kernel: memory_manager: Rename AllocateContinuous to AllocateContinuous.bunnei2021-02-192-4/+28
| * | hle: kernel: KSystemControl does not belong in Memory namespace.bunnei2021-02-197-31/+38
| * | hle: kernel: memory: PageHeap: Migrate to KPageBitmap class.bunnei2021-02-194-197/+23
| * | hle: kernel: Add KPageBitmap class.bunnei2021-02-192-0/+280
| * | hle: kernel: system_control: Add function GenerateRandomU64.bunnei2021-02-192-3/+5
| * | hle: kernel: Add KSpinLock implementation.bunnei2021-02-193-0/+89
| * | core: memory: Add templated GetPointer methods.bunnei2021-02-191-0/+10
| * | hle: kernel: Rename SharedMemory to KSharedMemory.bunnei2021-02-1913-54/+54
* | | Merge pull request #5944 from Morph1984/gc-vibrationsbunnei2021-02-272-3/+130
|\ \ \
| * | | hid: Implement GameCube Controller VibrationsMorph2021-02-212-3/+130
* | | | acc: Stub GetNintendoAccountUserResourceCacheForApplicationMorph2021-02-211-1/+17
|/ / /
* / / kernel: Fix resource release exception on exitameerj2021-02-214-2/+16
|/ /
* | Merge pull request #4973 from ameerj/nvdec-optbunnei2021-02-192-3/+7
|\ \
| * | Address PR feedbackameerj2021-02-132-4/+2
| * | nvdec cleanupameerj2021-02-131-1/+7
* | | core: core_timing_util: Optimize core timing math.bunnei2021-02-153-98/+48
* | | Merge pull request #5939 from Morph1984/web_typesLC2021-02-151-0/+1
|\ \ \
| * | | core/CMakeLists: Add web_types.hMorph2021-02-151-0/+1
* | | | Merge pull request #4940 from german77/nativeGCbunnei2021-02-153-1/+89
|\ \ \ \ | |/ / / |/| | |
| * | | hid: Implement GC controllergerman2021-02-083-1/+89
| | |/ | |/|
* | | hle: service: ldn: IUserLocalCommunicationService: Improve the stub.bunnei2021-02-141-5/+29
* | | hle: service: ldn: IUserLocalCommunicationService: Indicate that LDN is disabled.bunnei2021-02-143-3/+19
* | | hle: service: am: IStorageAccessor: Fix out of bounds error handling.bunnei2021-02-141-6/+7
| |/ |/|
* | kernel: More accurately reserve and release resourcesameerj2021-02-136-14/+42
* | kernel: KScopedReservation implementationameerj2021-02-136-26/+152
* | kernel: Unify result codes (#5890)Chloe2021-02-1321-256/+223
* | Merge pull request #5902 from lioncash/core-warnbunnei2021-02-123-4/+7
|\ \
| * | bsd: Remove usage of optional emplace() with no argumentsLioncash2021-02-091-2/+4
| * | am/controller: Remove [[fallthrough]] from unreachable pathLioncash2021-02-091-1/+2
| * | nfp: Correct uninitialized size being used within GetTagInfo()Lioncash2021-02-091-1/+1
| |/
* | Merge pull request #5869 from german77/mousePanningbunnei2021-02-111-2/+3
|\ \
| * | Add mouse panninggerman2021-02-081-2/+3
* | | software_keyboard: Implement Finalize request commandMorph2021-02-111-0/+4
* | | core: Add -fsized-dealloction as a Clang flaglat9nq2021-02-101-0/+2
* | | Merge pull request #5892 from german77/backupbunnei2021-02-091-1/+12
|\ \ \
| * | | olsc: Stub GetSaveDataBackupSettinggerman2021-02-081-1/+12
* | | | Merge pull request #5868 from german77/HandheldFixbunnei2021-02-081-0/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | Prevent over scheduling audio events and terminate properly the motion update eventgerman2021-02-021-0/+1
* | | | Merge pull request #5339 from german77/interactivebunnei2021-02-081-0/+11
|\ \ \ \ | |_|/ / |/| | |
| * | | Make settings controller image change with controller inputgerman2021-02-061-0/+11
* | | | Merge pull request #5872 from lioncash/svc-errorChloe2021-02-081-59/+188
|\ \ \ \
| * | | | svc: Provide more detailed error logs for svc functionsLioncash2021-02-061-59/+188
* | | | | Merge pull request #5887 from ogniK5377/lm-fixbunnei2021-02-071-7/+9
|\ \ \ \ \
| * | | | | lm: Fix ReadLeb128Chloe Marcec2021-02-071-7/+9
| | |_|_|/ | |/| | |
* | | | | Merge pull request #5878 from aleasto/masterMorph2021-02-071-2/+7
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | pl_u: Fix read out of boundsAlessandro Astone2021-02-061-2/+7
* | | | | Merge pull request #5871 from lioncash/address-arbbunnei2021-02-061-54/+30
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | k_address_arbiter: Unfold R_UNLESS macrosLioncash2021-02-061-5/+8
| * | | | k_address_arbiter: Remove unnecessary usages of std::addressofLioncash2021-02-061-10/+10
| * | | | k_address_arbiter: Remove dead codeLioncash2021-02-061-40/+13
| | |/ / | |/| |
* | | | Merge pull request #5326 from german77/hidUpdate1bunnei2021-02-0610-168/+406
|\ \ \ \ | |/ / / |/| | |
| * | | Add footer types and address commentsgerman2021-02-047-58/+106
| * | | Fix npad struct to match switchbrewgerman2021-02-043-105/+134
| * | | Adds missing controller types and propertiesgerman2021-02-049-30/+191
* | | | Merge pull request #5862 from bunnei/keventbunnei2021-02-0660-563/+726
|\ \ \ \
| * | | | hle: kernel: Drop R_UNLESS_NOLOG in favor of expanded if-statement.bunnei2021-02-052-3/+11
| * | | | hle: kernel: KAddressArbiter: Remove noisy error log.bunnei2021-02-051-1/+1
| * | | | hle: kernel: svc: Cleanup KEvent/KReadableEvent/KWritableEvent SVCs.bunnei2021-02-055-69/+89
| * | | | hle: kernel: Reimplement KReadableEvent and KWritableEvent.bunnei2021-02-0538-298/+341
| * | | | hle: kernel: Implement KEvent.bunnei2021-02-053-0/+91
| * | | | hle: kernel: KAddressArbiter: Use R_UNLESS_NOLOG where applicable.bunnei2021-02-051-1/+1
| * | | | hle: kernel: Rename WritableEvent to KWritableEvent.bunnei2021-02-0544-101/+101
| * | | | hle: kernel: Rename ReadableEvent to KReadableEvent.bunnei2021-02-0540-76/+77
* | | | | Merge pull request #5875 from lioncash/identifierbunnei2021-02-061-9/+9
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | k_priority_queue: Unfold several declval usagesLioncash2021-02-041-5/+5
| * | | | k_priority_queue: Simplify affinity mask type aliasLioncash2021-02-041-2/+2
| * | | | k_priority_queue: Resolved reserved identifierLioncash2021-02-041-2/+2
| |/ / /
* | | | Merge pull request #5867 from Morph1984/am-GetHealthWarningDisappearedSystemEventbunnei2021-02-052-1/+14
|\ \ \ \ | |_|/ / |/| | |
| * | | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEventMorph2021-02-022-1/+14
* | | | Merge pull request #5876 from lioncash/truncationbunnei2021-02-041-1/+1
|\ \ \ \
| * | | | k_affinity_mask: Avoid implicit truncation to boolLioncash2021-02-041-1/+1
| | |/ / | |/| |
* / | | key_manager: Create the keys directory if it does not existMorph2021-02-041-0/+5
|/ / /
* | | Merge pull request #5848 from ogniK5377/k-resourcelimitbunnei2021-02-0313-230/+343
|\ \ \
| * | | Simplify limitableresource namesChloe Marcec2021-02-036-36/+29
| * | | Compile errorChloe Marcec2021-02-021-1/+1
| * | | Address issuesChloe Marcec2021-02-023-19/+15
| * | | fix compile errorChloe Marcec2021-01-301-1/+1
| * | | cleanup commentingChloe Marcec2021-01-301-2/+2
| * | | Drop m_ from lockChloe Marcec2021-01-302-9/+9
| * | | Move to GetGlobalTimeNs, fix GetTotalPhysicalMemoryAvailableChloe Marcec2021-01-303-9/+7
| * | | kernel: Rewrite resource limit to be more accurateChloe Marcec2021-01-3013-231/+357
* | | | Merge pull request #5842 from german77/userfixbunnei2021-02-031-2/+8
|\ \ \ \
| * | | | Fix user changing to 0 if validgerman2021-01-291-2/+8
* | | | | settings: Log the cache, config, and mod load directoriesMorph2021-02-021-0/+3
| |_|/ / |/| | |
* | | | Merge pull request #5861 from german77/HandheldFixbunnei2021-02-021-2/+11
|\ \ \ \ | | |_|/ | |/| |
| * | | Only update motion for npad and prevent over scheduling eventsgerman2021-02-011-2/+11
* | | | arm_dynarmic_32: Print out CPSR.T on exceptionMerryMage2021-02-012-2/+7
* | | | Merge pull request #5859 from Morph1984/nifmbunnei2021-02-011-2/+157
|\ \ \ \
| * | | | nifm: Stub GetCurrentIpConfigInfoMorph2021-01-311-1/+29
| * | | | nifm: Stub GetCurrentNetworkProfileMorph2021-01-311-1/+41
| * | | | nifm: Add several structsMorph2021-01-311-0/+87
* | | | | Merge pull request #5856 from Morph1984/nifm-fix-getappletinfo-stubAmeer J2021-02-011-1/+5
|\ \ \ \ \
| * | | | | nifm: Fix GetAppletInfo stubMorph2021-01-311-1/+5
* | | | | | Merge pull request #5858 from Morph1984/IsGamePlayRecordingSupported-stubbunnei2021-02-012-1/+12
|\ \ \ \ \ \
| * | | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupportedMorph2021-01-312-1/+12
* | | | | | | prepo: Stub GetTransmissionStatusMorph2021-01-311-1/+11
* | | | | | | prepo: Stub RequestImmediateTransmissionMorph2021-01-311-1/+8
| |_|/ / / / |/| | | | |
* | | | | | bsd: Fix EventFd stubMorph2021-01-311-3/+3
|/ / / / /
* | | | | Merge pull request #5855 from Morph1984/bsd-fix-getsockopt-stubbunnei2021-01-311-1/+5
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | bsd: Fix GetSockOpt stubMorph2021-01-311-1/+5
* | | | | Merge pull request #5851 from ameerj/pop-inv-stubMorph2021-01-312-1/+10
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | am: Stub TryPopFromFriendInvitationStorageChannelameerj2021-01-312-1/+10
| | |_|/ | |/| |
* / | | bsd: Stub EventFdameerj2021-01-312-1/+12
|/ / /
* | | Merge pull request #5779 from bunnei/kthread-rewritebunnei2021-01-3064-1909/+2933
|\ \ \
| * | | hle: kernel: KLightLock: Fix several bugs.bunnei2021-01-291-3/+3
| * | | arm: dynarmic: Reintroduce JIT checks on SaveContext/LoadContext.bunnei2021-01-292-0/+12
| * | | hle: kernel: KThread: Release thread resource on thread exit.bunnei2021-01-291-0/+1
| * | | yuzu: debugger: Ignore HLE threads.bunnei2021-01-292-7/+13
| * | | hle: kernel: process: Add state lock.bunnei2021-01-293-6/+15
| * | | hle: kernel: threading: Fix bug with host thread naming.bunnei2021-01-291-3/+2
| * | | hle: kernel: k_scheduler_lock: Cleanup.bunnei2021-01-291-3/+3
| * | | core: arm: Remove unnecessary JIT checks.bunnei2021-01-292-24/+0
| * | | hle: kernel: Allocate a dummy KThread for each host thread, and use it for scheduling.bunnei2021-01-297-41/+45
| * | | hle: kernel: k_scheduler: Use atomics for current_thread, etc.bunnei2021-01-292-26/+28
| * | | hle: kernel: k_scheduler: Fix for single core mode.bunnei2021-01-291-1/+2
| * | | kernel: Fix build errors.bunnei2021-01-292-4/+9
| * | | core: cpu_manager: Remove unused variable.bunnei2021-01-291-1/+0
| * | | hle: kernel: KScheduler: Introduce thread context_guard.bunnei2021-01-292-3/+16
| * | | hle: kernel: Recode implementation of KThread to be more accurate.bunnei2021-01-2913-769/+1554
| * | | kernel: svc_types: Add ThreadActivity.bunnei2021-01-291-0/+5
| * | | kernel: KSchedulerPriorityQueue: Lowest priority should be LowestThreadPriority.bunnei2021-01-291-1/+1
| * | | kernel: k_light_lock: Simplify EmuThreadHandle implementation.bunnei2021-01-295-51/+33
| * | | hle: kernel: TimeManager: Simplify to not rely on previous EmuThreadHandle implementation.bunnei2021-01-296-69/+25
| * | | core: hle: kernel: object: Implement Finalize() virtual method.bunnei2021-01-2915-6/+29
| * | | core: hle: kernel: svc_results: Populate with several missing error codes.bunnei2021-01-291-0/+3
| * | | core: hle: kernel: Implement KLightLock.bunnei2021-01-293-0/+173
| * | | core: hle: kernel: Implement KThreadQueue.bunnei2021-01-292-0/+82
| * | | hle: kernel: KThread: Clean up thread priorities.bunnei2021-01-299-75/+41
| * | | hle: kernel: KThread: Reorganize thread priority defaults.bunnei2021-01-299-31/+31
| * | | hle: kernel: KThread: Fix ThreadType definition.bunnei2021-01-295-11/+12
| * | | hle: kernel: Move single core "phantom mode" out of KThread.bunnei2021-01-294-16/+31
| * | | hle: kernel: KThread: Remove thread types that do not exist.bunnei2021-01-295-45/+28
| * | | arm: arm_dynarmic: Skip calls when JIT is invalid.bunnei2021-01-292-0/+24
| * | | core: hle: kernel: Rename Thread to KThread.bunnei2021-01-2943-255/+254
* | | | Merge pull request #5838 from german77/prepostubMorph2021-01-301-1/+10
|\ \ \ \
| * | | | Stub GetSystemSessionIdgerman2021-01-301-1/+10
| | |_|/ | |/| |
* | | | Merge pull request #5809 from ogniK5377/FlushAudioOutBuffersbunnei2021-01-291-1/+9
|\ \ \ \ | |_|/ / |/| | |
| * | | audout: FlushAudioOutBuffersChloe Marcec2021-01-241-1/+9
* | | | Merge pull request #5837 from german77/socketstubbunnei2021-01-292-1/+17
|\ \ \ \
| * | | | Stub GetSockOptgerman2021-01-282-1/+17
| | |/ / | |/| |
* | | | Merge pull request #5840 from Morph1984/prepo-fixLC2021-01-283-24/+70
|\ \ \ \
| * | | | prepo: Fix BufferDescriptorX invalid buffer errors and add "New" variants of SaveReportMorph2021-01-281-24/+42
| * | | | hle_ipc: Add Can(Read, Write)BufferMorph2021-01-282-0/+28
| |/ / /
* | | | hid: Add static_assert for Parameter sizeMorph2021-01-281-15/+19
* | | | npad: Remove unused device handle parameterMorph2021-01-273-11/+9
|/ / /
* | | Merge pull request #5812 from german77/StubSixaxisFusionbunnei2021-01-274-3/+104
|\ \ \
| * | | Stub Set/Get/Reset SixaxisSensorFusionParametersgerman2021-01-244-3/+104
| |/ /
* | | Merge pull request #5810 from ogniK5377/stereo-visionbunnei2021-01-273-7/+60
|\ \ \
| * | | hle: Implement remaining services for Stereo VisionChloe Marcec2021-01-243-7/+60
| |/ /
* | | Merge pull request #5824 from ogniK5377/IPsmSessionbunnei2021-01-261-1/+112
|\ \ \
| * | | Omit system referenceChloe Marcec2021-01-251-2/+1
| * | | psm: IPsmSessionChloe Marcec2021-01-251-2/+114
* | | | Merge pull request #5774 from ogniK5377/mii-raw-randombunnei2021-01-264-2274/+1657
|\ \ \ \
| * | | | mii: Fix BuildRandomStoreData & Cleanup raw_dataChloe Marcec2021-01-204-2274/+1657
* | | | | Merge pull request #5771 from ogniK5377/lm-reworkbunnei2021-01-258-345/+288
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Print Process ID and Thread ID as hexChloe Marcec2021-01-241-2/+2
| * | | | Clamp string reads to buffer sizeChloe Marcec2021-01-231-3/+5
| * | | | Mark DestinationToString as staticChloe Marcec2021-01-201-1/+1
| * | | | Mark LogPacketHeaderEntry hash as noexceptChloe Marcec2021-01-201-1/+1
| * | | | lm: Recode LM serviceChloe Marcec2021-01-208-345/+286
| |/ / /
* | | | Merge pull request #5799 from ogniK5377/event-register-unregisterbunnei2021-01-251-1/+7
|\ \ \ \
| * | | | Simplify conditionChloe Marcec2021-01-231-2/+1
| * | | | nvdrv: Unregister already registered eventsChloe Marcec2021-01-231-1/+8
* | | | | Merge pull request #5151 from comex/xx-vfsbunnei2021-01-241-4/+10
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | vfs_real: When moving files or directories, don't assume file opening will succeedcomex2021-01-231-4/+10
| |/ / /
* | | | Merge pull request #5806 from bunnei/am-stubbunnei2021-01-241-1/+8
|\ \ \ \ | |/ / / |/| | |
| * | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.bunnei2021-01-211-1/+8
| |/ /
* | | Merge pull request #5776 from ogniK5377/lblbunnei2021-01-231-22/+261
|\ \ \
| * | | lbl: Implement most of lblChloe Marcec2021-01-201-22/+261
| |/ /
* | | Merge pull request #5765 from ogniK5377/StoreSaveDataThumbnail-stubbunnei2021-01-235-6/+66
|\ \ \
| * | | acc: Stub StoreSaveDataThumbnailChloe Marcec2021-01-195-6/+66
| |/ /
* | | Merge pull request #5270 from german77/multiTouchbunnei2021-01-215-55/+167
|\ \ \ | |/ / |/| |
| * | Always initialize keyboard inputgerman2021-01-153-12/+8
| * | Add mutitouch support for touch screensgerman2021-01-154-42/+56
| * | Allow to return up to 16 touch inputs per enginegerman2021-01-154-61/+84
| * | Allow all touch inputs at the same time and remove config options that are not longer necesarygerman2021-01-152-11/+20
| * | Add multitouch supportgerman2021-01-152-23/+93
* | | npad: Add check for HANDHELD_INDEX in UpdateControllerAt()Morph2021-01-181-1/+1
* | | Merge pull request #5360 from ReinUsesLisp/enforce-memclass-accessbunnei2021-01-1714-181/+192
|\ \ \ | |_|/ |/| |
| * | core/cmake: Enforce Wclass-memaccessReinUsesLisp2021-01-151-0/+1
| * | core: Silence Wclass-memaccess warningsReinUsesLisp2021-01-1513-181/+191
* | | input_interpreter: Mark two member functions as constLioncash2021-01-161-4/+4
* | | input_interpreter: Add method to check for a button press stateMorph2021-01-162-0/+25
* | | Merge pull request #5358 from ReinUsesLisp/rename-insert-paddingLC2021-01-153-19/+19
|\| | | |/ |/|
| * common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINITReinUsesLisp2021-01-153-19/+19
* | common/bit_util: Replace CLZ/CTZ operations with standardized onesLioncash2021-01-154-8/+12
|/
* core/cmake: Remove Werror flags already defined code-base wideReinUsesLisp2021-01-151-2/+0
* hle: kernel: thread: Preserve thread wait reason for debugging only.bunnei2021-01-117-1/+34
* hle: kernel: k_scheduler_lock: Fix shadowing errors.bunnei2021-01-111-1/+1
* core: arm: arm_interface: Fix shadowing errors.bunnei2021-01-111-3/+4
* core: hle: Add missing calls to MicroProfileOnThreadExit.bunnei2021-01-112-0/+5
* core: hle: Integrate new KConditionVariable and KAddressArbiter implementations.bunnei2021-01-1114-1177/+503
* core: hle: kernel: Update KAddressArbiter.bunnei2021-01-113-0/+437
* core: hle: kernel: Update KConditionVariable.bunnei2021-01-114-0/+413
* core: hle: kernel: Begin moving common SVC defintions to its own header.bunnei2021-01-112-0/+14
* hle: kernel: Remove unnecessary AddressArbiter definition.bunnei2021-01-111-1/+0
* hle: kernel: k_scheduler: Cleanup OnThreadPriorityChanged.bunnei2021-01-112-6/+3
* hle: kernel: Rename thread "status" to "state".bunnei2021-01-111-2/+2
* hle: kernel: thread: Replace ThreadStatus/ThreadSchedStatus with a single ThreadState.bunnei2021-01-1111-127/+97
* core: hle: kernel: Add some useful functions for checking kernel addresses.bunnei2021-01-111-0/+19
* core: hle: kernel: svc_types: Add type definitions for KAddressArbiter.bunnei2021-01-111-0/+12
* core: hle: kernel: Update KSynchronizationObject.bunnei2021-01-1131-603/+379
* core: hle: kernel: Begin moving common SVC results to its own header.bunnei2021-01-112-0/+21
* hle: service: nfp: Remove incorrect signaling behavior in GetDeviceState.bunnei2021-01-111-6/+0
* Merge pull request #5312 from german77/overclockenabledbunnei2021-01-102-1/+10
|\
| * Stub IsCpuOverclockEnabledgerman2021-01-082-1/+10
* | file_sys/registered_cache: Silence virtual functions without override warningsReinUsesLisp2021-01-091-4/+4
* | core: Silence unhandled enum in switch warningsReinUsesLisp2021-01-092-10/+5
|/
* fix for nvdec disabled, cleanup host1xameerj2021-01-071-11/+14
* nvdec syncpt incorporationameerj2021-01-077-20/+43
* core: Enforce C4715 (not all control paths return a value)ReinUsesLisp2021-01-051-0/+2
* core: Silence warnings when compiling without assertsReinUsesLisp2021-01-055-8/+11
* buffer_queue: Protect queue_sequence list access with a mutexameerj2021-01-042-13/+21
* main: Resolve error string not displayingLioncash2021-01-032-0/+5
* Merge pull request #5278 from MerryMage/cpuopt_unsafe_inaccurate_nanbunnei2021-01-033-0/+7
|\
| * dynarmic: Add Unsafe_InaccurateNaN optimizationMerryMage2021-01-023-0/+7
* | hle: service: nvflinger: buffer_queue: Do not reset id/layer_id on Connect.bunnei2021-01-031-2/+0
* | general: Fix various spelling errorsMorph2021-01-026-20/+20
|/
* memory: Remove MemoryHookMerryMage2021-01-012-64/+0
* Merge pull request #5249 from ReinUsesLisp/lock-free-pagesbunnei2021-01-014-124/+67
|\
| * core/memory: Read and write page table atomicallyReinUsesLisp2020-12-304-124/+67
* | Merge pull request #5208 from bunnei/service-threadsbunnei2020-12-3148-677/+499
|\ \
| * | hle: kernel: service_thread: Make thread naming more consistent.bunnei2020-12-301-1/+1
| * | hle: kernel: Manage service threads on another thread.bunnei2020-12-301-9/+20
| * | hle: kernel: Manage host thread IDs using TLS.bunnei2020-12-301-46/+31
| * | hle: kernel: Move ServiceThread ownership to KernelCore.bunnei2020-12-294-5/+48
| * | hle: kernel: service_thread: Add thread name and take weak_ptr of ServerSession.bunnei2020-12-293-11/+22
| * | hle: service: Acquire and release a lock on requests.bunnei2020-12-295-25/+35
| * | core: Do not reset device_memory on shutdown.bunnei2020-12-291-1/+0
| * | core: hle: kernel: Clear process list on boot.bunnei2020-12-291-2/+2
| * | hle: service: vi: Refactor to grab buffer only once.bunnei2020-12-291-15/+4
| * | service: nvflinger: Improve synchronization for BufferQueue.bunnei2020-12-295-19/+72
| * | hle: service: Ensure system is powered on before writing IPC result.bunnei2020-12-291-1/+5
| * | core: kernel: Clear process list earlier.bunnei2020-12-291-2/+2
| * | core: settings: Untangle multicore from asynchronous GPU.bunnei2020-12-293-9/+1
| * | hle: kernel: hle_ipc: Remove SleepClientThread.bunnei2020-12-292-54/+0
| * | hle: service: bsd: Update to work with service threads, removing SleepClientThread.bunnei2020-12-294-250/+45
| * | hle: service: nvdrv: Revert #4981 to remove usage of SleepClientThread.bunnei2020-12-2923-211/+83
| * | hle: kernel: service_thread: Add parameter for thread pool size.bunnei2020-12-293-7/+7
| * | hle: service: nvflinger: Refactor locking and interfaces.bunnei2020-12-293-45/+31
| * | hle: service: vi: Remove usage of SleepClientThread.bunnei2020-12-291-34/+43
| * | core: hle: server_session: Use separate threads for each service connection.bunnei2020-12-296-23/+140
* | | service/pcie: Fix invalid initialization argumentReinUsesLisp2020-12-301-1/+1
* | | Merge pull request #5247 from comex/xx-conceptsbunnei2020-12-301-3/+5
|\ \ \
| * | | k_priority_queue: Fix concepts usecomex2020-12-291-3/+5
| |/ /
* | | Merge pull request #5246 from comex/xx-includebunnei2020-12-301-0/+1
|\ \ \ | |_|/ |/| |
| * | Add missing include of "core/hle/kernel/kernel.h"comex2020-12-291-0/+1
| |/
* / svc: demote SleepThread log to LOG_TRACEameerj2020-12-291-1/+1
|/
* core: memory: Ensure thread safe access when pages are rasterizer cached (#5206)bunnei2020-12-251-12/+40
* Merge pull request #5042 from Morph1984/project-aetherbunnei2020-12-2217-658/+842
|\
| * applets/web: Implement the online web browser appletMorph2020-12-184-3/+28
| * main, applets/web: Re-add progress dialog for RomFS extractionMorph2020-12-184-40/+52
| * pl_u, applets/web: Decrypt shared fonts to TTF filesMorph2020-12-183-18/+117
| * ns_vm: Stub NeedsUpdateVulnerabilityMorph2020-12-181-1/+10
| * frontend/input_interpreter: Add InputInterpreter APIMorph2020-12-183-0/+167
| * controllers/npad: Make press_state atomicMorph2020-12-182-2/+3
| * applets/web: Implement the default web browser applet frontendMorph2020-12-183-1/+24
| * applets/web: Implement the offline browser applet backendMorph2020-12-182-13/+143
| * applets/web: Initial implementation of the web browser appletMorph2020-12-183-2/+428
| * applets: Remove the previous web browser applet implementationMorph2020-12-188-745/+37
* | Merge pull request #5131 from bunnei/scheduler-rewritebunnei2020-12-2135-1465/+2111
|\ \
| * | hle: kernel: Process: Various style fixes based on code review feedback.bunnei2020-12-061-2/+2
| * | core: cpu_manager: Fix a typo in PreemptSingleCore, which broke many games.bunnei2020-12-061-21/+26
| * | hle: kernel: Thread: Various style fixes based on code review feedback.bunnei2020-12-061-22/+25
| * | hle: kernel: KScopedSchedulerLockAndSleep: Various style fixes based on code review feedback.bunnei2020-12-061-6/+6
| * | hle: kernel: KScopedLock: Various style fixes based on code review feedback.bunnei2020-12-061-6/+8
| * | hle: kernel: KAbstractSchedulerLock: Various style fixes based on code review feedback.bunnei2020-12-061-9/+7
| * | hle: kernel: KScheduler: Various style fixes based on code review feedback.bunnei2020-12-062-50/+41
| * | hle: kernel: KPriorityQueue: Various style fixes based on code review feedback.bunnei2020-12-061-29/+36
| * | hle: kernel: KAffinityMask: Various style fixes based on code review feedback.bunnei2020-12-061-17/+13
| * | hle: kernel: GlobalSchedulerContext: Various style fixes based on code review feedback.bunnei2020-12-062-5/+10
| * | hle: kernel: Use C++ style comments in KScheduler, etc.bunnei2020-12-064-152/+136
| * | kernel: KScopedSchedulerLockAndSleep: Remove unused ctor.bunnei2020-12-061-13/+7
| * | kernel: time_manager: Add missing lock guards.bunnei2020-12-061-3/+10
| * | hle: kernel: Migrate to KScopedSchedulerLock.bunnei2020-12-0615-48/+92
| * | hle: kernel: Separate KScopedSchedulerLockAndSleep from k_scheduler.bunnei2020-12-0611-69/+72
| * | hle: kernel: Separate KScheduler from GlobalSchedulerContext class.bunnei2020-12-065-118/+140
| * | hle: kernel: Rewrite scheduler implementation based on Mesopshere.bunnei2020-12-0625-1220/+1212
| * | hle: kernel: physical_core: Clear exclusive state after each run.bunnei2020-12-063-0/+7
| * | hle: kernel: Port KAbstractSchedulerLock from Mesosphere.bunnei2020-12-062-0/+77
| * | hle: kernel: svc: Remove reschedule on svcBreak.bunnei2020-12-061-5/+0
| * | hle: kernel: process: Add schedule count tracking, to be used for yield impl.bunnei2020-12-061-0/+13
| * | hle: kernel: svc: Remove unnecessary hack in svcSleep.bunnei2020-12-061-7/+0
| * | common: Port KPriorityQueue from Mesosphere.bunnei2020-12-062-0/+444
| * | hle: kernel: Port KAffinityMask from Mesosphere.bunnei2020-12-066-14/+78
* | | Merge pull request #5201 from ameerj/bufferq-refactorbunnei2020-12-213-70/+63
|\ \ \
| * | | buffer_queue: better use of std::arrayameerj2020-12-181-59/+46
| * | | Overwrite slots instead of queuing them, add disconnect signalameerj2020-12-173-27/+33
* | | | yuzu: Remove gdbstub configurationFearlessTobi2020-12-191-2/+0
| |_|/ |/| |
* | | system_archive: Add + and - buttons to the Nintendo Extended OSS fontMorph2020-12-182-315/+343
* | | system_archive: Update Nintendo Extended OSS fontMorph2020-12-172-182/+347
|/ /
* | Merge pull request #5190 from Morph1984/validate_device_handlebunnei2020-12-162-0/+45
|\ \
| * | controllers/npad: Validate device handles before useMorph2020-12-122-0/+45
* | | Merge pull request #5119 from Morph1984/fs-opendatastoragewithprogramindexbunnei2020-12-1510-10/+147
|\ \ \
| * | | fsp_srv: Implement OpenDataStorageWithProgramIndexMorph2020-12-086-1/+83
| * | | file_sys: Consolidate common Title ID operationsMorph2020-12-084-9/+64
* | | | Merge pull request #5168 from Morph1984/aoc-PurchaseEventManagerbunnei2020-12-152-2/+76
|\ \ \ \ | |_|/ / |/| | |
| * | | IPurchaseEventManager: Implement GetPurchasedEventReadableHandleMorph2020-12-081-1/+14
| * | | IPurchaseEventManager: Stub Set(Default)DeliveryTargetMorph2020-12-081-2/+27
| * | | aoc_u: Stub Create(Permanent)EcPurchasedEventManagerMorph2020-12-082-2/+38
| |/ /
* | | Merge pull request #5183 from lioncash/alias2bunnei2020-12-1228-136/+142
|\ \ \
| * | | vfs: Use existing type aliases consistentlyLioncash2020-12-1028-136/+142
* | | | Merge pull request #5187 from Morph1984/revert-stdfsbunnei2020-12-121-6/+2
|\ \ \ \
| * | | | Revert "Merge pull request #5176 from Morph1984/fix-createfile"Morph2020-12-121-6/+2
* | | | | Merge pull request #5172 from lioncash/svc-widebunnei2020-12-121-35/+25
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | svc: Remove unnecessary castsLioncash2020-12-081-35/+25
* | | | | Merge pull request #5123 from Morph1984/nim-IsLargeResourceAvailablebunnei2020-12-101-1/+13
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | nim: Stub IsLargeResourceAvailableMorph2020-12-041-1/+13
* | | | | vfs_real: Fix CreateFile for files without a file extensionMorph2020-12-091-2/+6
* | | | | Merge pull request #5142 from comex/xx-poll-eventsRodrigo Locatti2020-12-096-71/+82
|\ \ \ \ \
| * | | | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`comex2020-12-076-71/+82
* | | | | | Merge pull request #5166 from lioncash/log-castbunnei2020-12-0925-96/+90
|\ \ \ \ \ \
| * | | | | | core: Remove unnecessary enum casts in log callsLioncash2020-12-0825-96/+90
* | | | | | | Merge pull request #5135 from Morph1984/applets-shadowbunnei2020-12-091-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | applets: Resolve variable shadowingMorph2020-12-051-1/+1
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #5167 from lioncash/doc-memorybunnei2020-12-081-2/+0
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | memory: Resolve -Wdocumentation warning for Write()Lioncash2020-12-081-2/+0
| | |/ / / | |/| | |
* | | | | Merge pull request #5165 from lioncash/copy-controllerMorph2020-12-081-12/+11
|\ \ \ \ \
| * | | | | controller: Use std::move within ConvertToFrontendParameters()Lioncash2020-12-081-3/+3
| * | | | | controller: Avoid unnecessary copies in ConfigurationComplete()Lioncash2020-12-081-9/+8
| |/ / / /
* | | | | Merge pull request #5020 from german77/AnalogfromButtonFixMorph2020-12-081-0/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Disable analog joystick from buttons by defaultgerman2020-12-081-0/+2
* | | | | Merge pull request #5153 from comex/xx-unixbunnei2020-12-082-5/+5
|\ \ \ \ \
| * | | | | CMakeLists,network: Create YUZU_UNIX macro to replace __unix__comex2020-12-072-5/+5
| | |/ / / | |/| | |
* | | | | Merge pull request #5148 from comex/xx-unused-fieldsbunnei2020-12-072-3/+3
|\ \ \ \ \
| * | | | | core: Mark unused fields as [[maybe_unused]]comex2020-12-072-3/+3
| |/ / / /
* | | | | Merge pull request #5154 from comex/xx-ipcbunnei2020-12-072-34/+37
|\ \ \ \ \
| * | | | | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cppcomex2020-12-072-34/+37
| |/ / / /
* | | | | Merge pull request #5147 from comex/xx-purevirtLC2020-12-071-33/+0
|\ \ \ \ \
| * | | | | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclasscomex2020-12-071-33/+0
| |/ / / /
* | | | | Merge pull request #5150 from comex/xx-boxcatLC2020-12-071-1/+1
|\ \ \ \ \
| * | | | | boxcat: Avoid unnecessary object copycomex2020-12-071-1/+1
| |/ / / /
* | | | | Merge pull request #5136 from lioncash/video-shadow3LC2020-12-072-9/+9
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | video_core: Resolve more variable shadowing scenarios pt.3Lioncash2020-12-052-9/+9
| |/ / /
* / / / Fix "explicitly defaulted but implicitly deleted" warningcomex2020-12-071-1/+1
|/ / /
* | / system_version: Update to 11.0.0Chloe Marcec2020-12-051-6/+6
| |/ |/|
* | Merge pull request #4996 from bunnei/use-4jitsbunnei2020-12-0424-141/+194
|\ \
| * | kernel: scheduler: Minor cleanup to remove duplicated code.bunnei2020-11-292-46/+14
| * | kernel: time_manager: Protect access with a mutex.bunnei2020-11-292-1/+5
| * | hle: kernel: thread: Remove unused "Running" state.bunnei2020-11-292-6/+0
| * | core: arm: Implement InvalidateCacheRange for CPU cache invalidation.bunnei2020-11-2912-16/+56
| * | hle: kernel: time_manager: Avoid a crash on process exit.bunnei2020-11-291-1/+4
| * | hle: kernel: AddressArbiter: Remove unused code.bunnei2020-11-292-9/+0
| * | hle: kernel: SynchronizationObject: Use atomic_bool for is_signaled.bunnei2020-11-291-1/+2
| * | common: fiber: Use boost::context instead of native fibers on Windows.bunnei2020-11-291-1/+1
| * | hle: kernel: multicore: Replace n-JITs impl. with 4 JITs.bunnei2020-11-2915-72/+124
* | | Merge pull request #5000 from lioncash/audio-errorbunnei2020-12-032-5/+5
|\ \ \
| * | | audio_core: Make shadowing and unused parameters errorsLioncash2020-12-032-5/+5
* | | | Merge pull request #4937 from german77/multiUDPbunnei2020-12-011-3/+1
|\ \ \ \
| * | | | Add multiple udp server supportgerman2020-11-261-3/+1
* | | | | Merge pull request #4939 from german77/MouseInputbunnei2020-11-301-2/+7
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Implement full mouse supportgerman2020-11-261-2/+7
* | | | | Merge pull request #4998 from Morph1984/bioshock-patchbunnei2020-11-291-2/+4
|\ \ \ \ \
| * | | | | hid: Check if applet_resource exists in InitializeVibrationDeviceMorph2020-11-251-2/+4
| | |_|/ / | |/| | |
* | | | | Add missing types to NpadCommunicationModegerman2020-11-291-0/+2
* | | | | Merge pull request #5021 from german77/StubCommunicationModebunnei2020-11-294-2/+50
|\ \ \ \ \
| * | | | | Stub set and get NpadCommunicationModegerman2020-11-274-2/+50
| | |_|_|/ | |/| | |
* | | | | Merge pull request #5011 from lioncash/file-str2bunnei2020-11-281-12/+22
|\ \ \ \ \
| * | | | | core: Reduce string copies in GetGameFileFromPath()Lioncash2020-11-261-12/+22
| |/ / / /
* | | | | core: Eliminate remaining usages of the global system instanceLioncash2020-11-2712-1558/+16
* | | | | savedata_factory: Eliminate usage of the global system instanceLioncash2020-11-273-12/+20
* | | | | service: Eliminate usages of the global system instanceLioncash2020-11-27219-897/+1207
|/ / / /
* | | | Merge pull request #4975 from comex/invalid-syncpoint-idbunnei2020-11-261-2/+2
|\ \ \ \
| * | | | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint IDcomex2020-11-241-2/+2
* | | | | Merge pull request #4981 from ogniK5377/ioctl-ctrlbunnei2020-11-2624-91/+214
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | nvservices: Reintroducee IoctlCtrlChloe Marcec2020-11-2424-91/+214
* | | | | Merge pull request #4976 from comex/poll-eventsRodrigo Locatti2020-11-261-2/+2
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Overhaul EmuWindow::PollEvents to fix yuzu-cmd calling SDL_PollEvents off main threadcomex2020-11-231-2/+2
| | |/ / | |/| |
* | | | Merge pull request #4978 from bunnei/shutdown-crashbunnei2020-11-251-7/+17
|\ \ \ \
| * | | | core: cpu_manager: Fix shutdown crash when closing before emulation starts.bunnei2020-11-251-7/+17
* | | | | service: am: Implement ExecuteProgram and required stubs.bunnei2020-11-252-3/+34
* | | | | core: loader: Implement support for loading indexed programs.bunnei2020-11-2512-26/+74
|/ / / /
* | | | hle: services: Fix a crash with improper NVFlinger lifetime management. (#4977)bunnei2020-11-2417-100/+104
* | | | Merge pull request #4942 from lioncash/systemRodrigo Locatti2020-11-242-96/+81
|\ \ \ \
| * | | | core: Remove unused private Init function for the System classLioncash2020-11-182-16/+4
| * | | | core: Make use of [[nodiscard]] with the System classLioncash2020-11-182-81/+78
| | |_|/ | |/| |
* | | | Merge pull request #4972 from lioncash/unused4Rodrigo Locatti2020-11-241-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | svc: Remove unnecessary [[maybe_unused]] tagLioncash2020-11-231-1/+1
| |/ /
* | | Fix warnings in core/frontend/input.h with [[maybe_unused]]bunnei2020-11-241-1/+3
* | | Merge pull request #4927 from lioncash/input-errorbunnei2020-11-241-1/+1
|\ \ \ | |_|/ |/| |
| * | input_common: Treat warnings as errorsLioncash2020-11-221-1/+1
* | | Merge pull request #4451 from slashiee/extended-loggingbunnei2020-11-231-0/+1
|\ \ \ | |/ / |/| |
| * | logging/settings: Increase maximum log size to 100 MB and add extended logging optionM&M2020-08-251-0/+1
* | | Merge pull request #4944 from lioncash/system-rembunnei2020-11-2222-126/+209
|\ \ \
| * | | patch_manager: Remove usages of the global system instanceLioncash2020-11-1822-126/+209
| | |/ | |/|
* | | Merge pull request #4907 from ogniK5377/nvdrv-cleanupbunnei2020-11-2126-898/+1220
|\ \ \
| * | | Addressed issuesChloe Marcec2020-11-1010-17/+86
| * | | core: Make nvservices more standardizedChloe Marcec2020-11-1026-903/+1156
* | | | olsc: Move member initialization to after member functions.bunnei2020-11-201-2/+2
* | | | hle: service: Stub OLSC Initialize and SetSaveDataBackupSettingEnabled functions.bunnei2020-11-194-0/+89
| |/ / |/| |
* | | hid: Reimplement Begin/EndPermitVibrationSessionMorph2020-11-163-5/+17
* | | controllers/npad: Load input devices on initMorph2020-11-161-0/+2
* | | general: Fix compiler warnings on linux and miscellaneous changesMorph2020-11-162-8/+11
* | | controllers/npad: Remove the old vibration filterMorph2020-11-163-50/+64
* | | hid: Implement InitializeVibrationDevice and IsVibrationDeviceMountedMorph2020-11-163-12/+66
* | | input_common: Add VibrationDevice and VibrationDeviceFactoryMorph2020-11-164-33/+34
* | | configure_input: Add per-player vibrationMorph2020-11-162-2/+12
* | | settings: Remove global vibration strength modifierMorph2020-11-163-5/+1
* | | hid: Mark Begin/EndPermitVibrationSession as stubsMorph2020-11-163-18/+4
* | | controllers/npad: Send an empty vibration on destruction/deactivationMorph2020-11-163-22/+38
* | | hid: Stub IsVibrationDeviceMountedMorph2020-11-162-1/+23
* | | controllers/npad: Add heuristics to reduce rumble state changesMorph2020-11-162-6/+47
* | | configure_input: Hook up the vibration percentage spinboxMorph2020-11-163-1/+4
* | | controllers/npad: Stop games from vibrating incorrect controllersMorph2020-11-161-0/+10
* | | hid: Fix controller rumble based on new researchMorph2020-11-163-43/+69
* | | hid: Pop a struct of parameters instead of popping individual parametersMorph2020-11-161-103/+237
* | | hid: Reorder all HID commandsMorph2020-11-165-217/+232
* | | hid: Implement GetVibrationDeviceInfoMorph2020-11-162-3/+39
* | | hid: Stub InitializeVibrationDeviceMorph2020-11-161-3/+11
* | | controllers/npad: Rename NPadType to NpadStyleSetMorph2020-11-163-9/+9
* | | controllers/npad: Add DeviceHandle structMorph2020-11-161-27/+50
* | | settings: Preparation for per-game input settingsMorph2020-11-1611-41/+89
* | | controllers/npad: Connect a controller on init if none are connectedMorph2020-11-161-0/+13
* | | Merge pull request #4895 from Morph1984/cave-story-plus-applet-fixbunnei2020-11-132-26/+80
|\ \ \
| * | | applets: Rename LibraryAppletVersion to ControllerAppletVersionMorph2020-11-082-15/+15
| * | | applets/controller: Pop normal data for StrapGuide and FirmwareUpdateMorph2020-11-082-6/+19
| * | | applets/controller: Introduce additional checks for mode and callerMorph2020-11-082-5/+39
| * | | applets/controller: Add ControllerUpdateFirmwareArg structMorph2020-11-081-0/+7
* | | | Merge pull request #4901 from bunnei/caps-stubbunnei2020-11-102-9/+17
|\ \ \ \ | |_|/ / |/| | |
| * | | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.bunnei2020-11-072-9/+17
* | | | Merge pull request #4909 from lioncash/interruptRodrigo Locatti2020-11-091-2/+2
|\ \ \ \
| * | | | cpu_interrupt_handler: Mark move contructor/assignment as deletedLioncash2020-11-081-2/+2
| | |/ / | |/| |
* / | | ipc_helpers: Remove usage of the global system instanceLioncash2020-11-0816-7/+23
|/ / /
* | | Merge pull request #4903 from bunnei/remove-gpu-integritybunnei2020-11-081-1/+0
|\ \ \
| * | | video_core: dma_pusher: Remove integrity check on command lists.bunnei2020-11-071-1/+0
* | | | Merge pull request #4906 from lat9nq/log-cpu-accuracyLC2020-11-071-0/+1
|\ \ \ \ | |/ / / |/| | |
| * | | settings: log value of CPU_Accuracylat9nq2020-11-071-0/+1
| |/ /
* | | Merge pull request #4888 from lioncash/unicorn-removebunnei2020-11-078-412/+15
|\ \ \ | |/ / |/| |
| * | core: Remove usage of unicornLioncash2020-11-048-412/+15
* | | settings: Simplify initializer of resolution factorLioncash2020-11-061-1/+1
* | | Merge pull request #4889 from lioncash/setting-globalbunnei2020-11-052-10/+21
|\ \ \
| * | | core/settings: Move configuring_global behind an APILioncash2020-11-042-10/+21
| |/ /
* | | Merge pull request #4858 from lioncash/initializerbunnei2020-11-042-2/+14
|\ \ \
| * | | General: Resolve a few missing initializer warningsLioncash2020-10-302-2/+14
* | | | Merge pull request #4869 from bunnei/improve-gpu-syncChloe2020-11-0411-64/+299
|\ \ \ \ | |_|/ / |/| | |
| * | | fixup! hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-012-3/+11
| * | | core: Initialize GPU before services.bunnei2020-11-011-4/+6
| * | | hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-013-46/+106
| * | | service: hle: nvflinger: Fix potential shutdown crash when GPU is destroyed.bunnei2020-11-011-0/+4
| * | | hle service: nvdrv: nvhost_ctrl: Update to use SyncpointManager.bunnei2020-11-013-9/+31
| * | | hle service: nvdrv: Update to instantiate SyncpointManager.bunnei2020-11-012-5/+18
| * | | hle: service: nvdrv: Implement SyncpointManager, to manage syncpoints.bunnei2020-11-014-1/+127
* | | | Merge pull request #4878 from bunnei/unload-nrrbunnei2020-11-031-1/+15
|\ \ \ \ | |/ / / |/| | |
| * | | hle: service: ldr: Implement UnloadNrr.bunnei2020-10-311-1/+15
* | | | Rename to align with switchbrew and remove gpu function (#4714)Levi Behunin2020-11-012-16/+10
|/ / /
* | | video_core: unbreak -Werror in NVDEC with ClangJan Beich2020-10-301-1/+1
* | | kernel/process: Add missing <ctime> includeMorph2020-10-291-0/+1
* | | Merge pull request #4835 from lat9nq/rng-default-timebunnei2020-10-291-1/+1
|\ \ \ | |/ / |/| |
| * | kernel: Use the current time as the default RNG seedlat9nq2020-10-271-1/+1
* | | Merge pull request #4846 from lioncash/service-fnbunnei2020-10-285-1/+7
|\ \ \
| * | | service: Update function tablesLioncash2020-10-285-1/+7
* | | | hle/kernel: Remove unused registered_core_threads to fix data racesReinUsesLisp2020-10-271-5/+0
|/ / /
* | | Merge pull request #4729 from ameerj/nvdec-prodbunnei2020-10-2712-288/+475
|\ \ \
| * | | video_core: NVDEC Implementationameerj2020-10-2712-288/+475
| |/ /
* | | Merge pull request #4832 from bunnei/cpu-manager-microprofile-fixbunnei2020-10-271-0/+2
|\ \ \
| * | | core: cpu_manager: Add missing call to MicroProfileOnThreadExit().bunnei2020-10-271-0/+2
| |/ /
* | | Merge pull request #4833 from bunnei/timezonemanager-explicitbunnei2020-10-271-1/+1
|\ \ \
| * | | hle: services: TimeZoneContentManager: This can be made explicit.bunnei2020-10-271-1/+1
| |/ /
* | | Merge pull request #4834 from lioncash/copy-fnbunnei2020-10-272-3/+3
|\ \ \ | |/ / |/| |
| * | controller: Pass ControllerParameters by reference in ReconfigureControllers()Lioncash2020-10-272-3/+3
* | | Merge pull request #4828 from lioncash/lockguardRodrigo Locatti2020-10-251-1/+1
|\| |
| * | general: Use template deduction guides for lock_guardLioncash2020-10-251-1/+1
* | | Merge pull request #4792 from bunnei/rtc-fixbunnei2020-10-238-189/+324
|\ \ \ | |/ / |/| |
| * | service: time: Update current time with changes to RTC setting.bunnei2020-10-138-189/+324
* | | core: Fix clang build pt.3Lioncash2020-10-223-14/+4
* | | core: Fix clang build pt.2Lioncash2020-10-211-2/+5
* | | Revert "core: Fix clang build"bunnei2020-10-2183-667/+483
* | | kernel: Fix build with recent compiler flag changesLioncash2020-10-211-4/+8
* | | Merge pull request #4796 from lioncash/clangLC2020-10-2183-483/+667
|\ \ \
| * | | core: Fix clang buildLioncash2020-10-1883-483/+667
* | | | Merge pull request #4390 from ogniK5377/get-applet-inf-stubbunnei2020-10-211-1/+11
|\ \ \ \
| * | | | Added remaining paramsDavid Marcec2020-10-201-1/+4
| * | | | nifm: GetAppletInfo stubDavid Marcec2020-10-201-1/+8
* | | | | Merge pull request #4788 from ReinUsesLisp/lockfree-host-threadbunnei2020-10-201-28/+38
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | kernel: Implement host thread register methods without lockingReinUsesLisp2020-10-131-28/+38
* | | | | Merge pull request #4785 from Morph1984/fs-hadesbunnei2020-10-201-2/+3
|\ \ \ \ \
| * | | | | filesystem: Fix CreateDirectory and DeleteFileMorph2020-10-131-2/+3
| |/ / / /
* | | | | Merge pull request #4802 from lioncash/bcatbunnei2020-10-191-7/+7
|\ \ \ \ \
| * | | | | core: Add boxcat sources with target_sourcesLioncash2020-10-181-7/+7
* | | | | | Merge pull request #4783 from bunnei/nvdrv-freespacebunnei2020-10-182-0/+25
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.bunnei2020-10-132-0/+25
| | |_|/ / | |/| | |
* | | | | Merge pull request #4801 from lioncash/missing-boundbunnei2020-10-181-1/+1
|\ \ \ \ \
| * | | | | mii/manager: Make use of unused lower bound in GetRandomValue()Lioncash2020-10-171-1/+1
* | | | | | service: bcat: Check client connection before interacting with socket.bunnei2020-10-171-0/+10
|/ / / / /
* | | | | Merge pull request #4784 from bunnei/cancelbufferbunnei2020-10-163-14/+53
|\ \ \ \ \
| * | | | | hle: service: vi: Implement BufferQueue::CancelBuffer.bunnei2020-10-143-14/+53
| | |_|/ / | |/| | |
* / | | | service: acc: Stub IManagerForApplication::StoreOpenContext.bunnei2020-10-151-1/+7
|/ / / /
* | / / core/CMakeLists: Make some warnings errorsLioncash2020-10-1328-132/+133
| |/ / |/| |
* | | Merge pull request #3929 from FearlessTobi/ticket-keysbunnei2020-10-132-32/+30
|\ \ \ | |/ / |/| |
| * | file_sys/nsp: Make SetTicketKeys actually do somethingFearlessTobi2020-07-182-32/+30
* | | Merge pull request #4736 from Morph1984/home-button-input-protection-stubbunnei2020-10-074-2/+50
|\ \ \
| * | | hid: Stub HomeButtonInputProtection service commandsMorph2020-09-304-2/+50
* | | | Merge pull request #4710 from Morph1984/fix-integrated-updatesbunnei2020-10-071-3/+22
|\ \ \ \
| * | | | submission_package: Fix updates integrated into cartridge images.Morph2020-09-241-3/+22
* | | | | Merge pull request #4737 from Morph1984/setshimlibraryversion-stubbunnei2020-10-075-4/+38
|\ \ \ \ \
| * | | | | caps_c: Stub SetShimLibraryVersionMorph2020-09-302-1/+18
| * | | | | caps_u: Stub SetShimLibraryVersionMorph2020-09-302-2/+14
| * | | | | caps_su: Properly stub SetShimLibraryVersionMorph2020-09-301-1/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #4742 from german77/InputFilterbunnei2020-10-061-49/+58
|\ \ \ \ \
| * | | | | Only use inputs corresponding to controller typegerman2020-10-021-49/+58
* | | | | | Merge pull request #4734 from german77/motionfusionbunnei2020-10-022-1/+15
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Stubbed EnableSixAxisSensorFusiongerman2020-09-302-1/+15
* | | | | | Merge pull request #4291 from german77/ImplementControllerRumbleDavid2020-09-304-13/+25
|\ \ \ \ \ \
| * | | | | | First implementation of controller rumblegerman2020-09-294-13/+25
* | | | | | | Merge pull request #4726 from lioncash/appletDavid2020-09-304-6/+15
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | core: Mark GetInstance() as deprecatedLioncash2020-09-261-1/+1
| * | | | | | frontend/controller: Eliminate dependency on the global system instanceLioncash2020-09-263-5/+14
| |/ / / / /
* | | | | | Merge pull request #4705 from german77/SplitMotionPollerbunnei2020-09-305-76/+157
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Use different timing for motiongerman2020-09-245-76/+157
* | | | | | Merge pull request #1703 from DarkLordZach/nvdec-ioctlbunnei2020-09-304-3/+256
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | service: nvhost_vic: Ignore Submit commands.bunnei2020-06-052-1/+18
| * | | | | nvdrv: Stub nvdec/vic ioctls to bypass nvdec moviesZach Hilman2020-06-054-3/+239
* | | | | | Merge pull request #4717 from lioncash/debugLC2020-09-251-0/+17
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | service: Restore "unused" functionLioncash2020-09-251-0/+17
* | | | | | Merge pull request #4678 from Morph1984/LoadOpenContext-partial-implbunnei2020-09-243-1/+13
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | acc: Stub LoadOpenContextMorph2020-09-213-1/+13
* | | | | | memory: Resolve a -Wdocumentation warningLioncash2020-09-231-1/+1
| |/ / / / |/| | | |
* | | | | General: Make use of std::nullopt where applicableLioncash2020-09-2210-27/+31
* | | | | ips_layer: Eliminate a redundant copy in Parse()Lioncash2020-09-221-2/+4
* | | | | Merge pull request #4675 from Morph1984/fix-boot-multicontentbunnei2020-09-221-5/+5
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | submission_package: Account for multi-content NSPsMorph2020-09-181-5/+5
* | | | | Merge pull request #4683 from Morph1984/NpadHandheldActivationMode-implbunnei2020-09-203-5/+28
|\ \ \ \ \
| * | | | | hid: Implement Get/SetNpadHandheldActivationModeMorph2020-09-183-5/+28
| |/ / / /
* | | | | Merge pull request #4643 from FearlessTobi/decrease-pad-update-intervalbunnei2020-09-191-1/+1
|\ \ \ \ \
| * | | | | Test: Decrease pad_update_nsFearlessTobi2020-09-101-1/+1
* | | | | | am: Stub GetPreviousProgramIndexMorph2020-09-182-1/+11
* | | | | | Merge pull request #4670 from lioncash/initializerRodrigo Locatti2020-09-171-2/+2
|\ \ \ \ \ \
| * | | | | | arm_dynarmic_cp15: Initialize member variablesLioncash2020-09-171-2/+2
* | | | | | | Merge pull request #4665 from lioncash/sm-kernelRodrigo Locatti2020-09-173-9/+11
|\ \ \ \ \ \ \
| * | | | | | | service/sm: Slightly more efficient string name validationLioncash2020-09-171-2/+2
| * | | | | | | service/sm: Eliminate dependency on the global system instanceLioncash2020-09-173-7/+9
| |/ / / / / /
* | | | | | | Merge pull request #4666 from lioncash/unused-funcRodrigo Locatti2020-09-171-22/+0
|\ \ \ \ \ \ \
| * | | | | | | service: Remove unused funcationLioncash2020-09-171-22/+0
| |/ / / / / /
* | | | | | | Merge pull request #4671 from lioncash/nfp-copyRodrigo Locatti2020-09-171-10/+13
|\ \ \ \ \ \ \
| * | | | | | | nfp: Eliminate two unnecessary copiesLioncash2020-09-171-10/+13
| |/ / / / / /
* | | | | | | Merge pull request #4594 from german77/MotionHIDbunnei2020-09-176-19/+203
|\ \ \ \ \ \ \
| * | | | | | | configure_input: Hook up the motion button and checkboxMorph2020-09-052-1/+2
| * | | | | | | Add cemu hook changes related to PR #4609german2020-09-051-2/+1
| * | | | | | | Remove RealMotionDevicegerman2020-09-053-28/+16
| * | | | | | | controllers/npad: Simplify motion entry assignmentMorph2020-09-051-29/+18
| * | | | | | | Include HID and configuration changes related to motiongerman2020-09-055-15/+222
* | | | | | | | control_metadata: Resolve typo in Portuguese language nameLioncash2020-09-171-1/+1
| |/ / / / / / |/| | | | | |
* | | | | | | file_sys/romfs_factory: Eliminate usage of the global system accessorLioncash2020-09-175-34/+49
* | | | | | | file_sys/bis_factory: Eliminate usage of the global system accessorLioncash2020-09-175-11/+11
* | | | | | | loader/nso: Remove unnecessary [[maybe_unused]]Lioncash2020-09-171-2/+1
* | | | | | | core/loader: Remove dependencies on the global system instanceLioncash2020-09-1620-45/+85
* | | | | | | Merge pull request #4658 from lioncash/copy3Rodrigo Locatti2020-09-162-44/+43
|\ \ \ \ \ \ \
| * | | | | | | nca_patch: Significantly reduce the stack usage size within SearchBucketEntry()Lioncash2020-09-151-4/+4
| * | | | | | | nca_patch: Make SearchBucketEntry() internally linkedLioncash2020-09-152-44/+43
* | | | | | | | cheat_engine: Convert ExtractName into a non-template functionLioncash2020-09-151-19/+17
* | | | | | | | cheat_engine: Remove unnecessary system argument to CheatParser's Parse functionLioncash2020-09-153-15/+9
|/ / / / / / /
* | | | | | | patch_manager: Resolve implicit truncations in FormatTitleVersion()Lioncash2020-09-151-3/+4
* | | | | | | patch_manager: Make use of type aliasesLioncash2020-09-152-69/+79
* | | | | | | patch_manager: Make a few functions internally linkedLioncash2020-09-152-15/+12
* | | | | | | crypto/key_manager: Remove dependency on the global system accessorLioncash2020-09-142-5/+8
* | | | | | | kernel: Remove all dependencies on the global system instanceLioncash2020-09-145-11/+20
* | | | | | | Merge pull request #4636 from lioncash/kernel-hlebunnei2020-09-143-7/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | service: Remove two usages of the global system accessorLioncash2020-09-073-7/+5
* | | | | | | Merge pull request #4323 from ReinUsesLisp/no-spinbunnei2020-09-121-1/+1
|\ \ \ \ \ \ \
| * | | | | | | kernel/scheduler: Use std::mutex instead of spin lockReinUsesLisp2020-07-131-1/+1
* | | | | | | | Merge pull request #4634 from lioncash/blockingbunnei2020-09-123-19/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | bsd: Resolve unused value within SendToImplLioncash2020-09-071-0/+1
| * | | | | | | | bsd: Resolve sign comparison warningsLioncash2020-09-071-3/+3
| * | | | | | | | sockets_translate: Make use of designated initializersLioncash2020-09-071-12/+12
| * | | | | | | | blocking_worker: Make use of templated lambdaLioncash2020-09-071-3/+2
| * | | | | | | | blocking_worker: Resolve -Wdocumentation warningLioncash2020-09-071-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4310 from ogniK5377/apollo-1-prodbunnei2020-09-111-72/+77
|\ \ \ \ \ \ \ \
| * | | | | | | | audio_core: Apollo Part 1, AudioRenderer refactorDavid Marcec2020-07-251-72/+77
* | | | | | | | | Merge pull request #4597 from Morph1984/mjolnir-p2bunnei2020-09-119-131/+548
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | applets/controller: Resolve several compiler warningsMorph2020-09-041-1/+2
| * | | | | | | | Address feedbackMorph2020-09-043-0/+9
| * | | | | | | | applets/controller: Set min_players to have a minimum value of 1.Morph2020-09-041-1/+1
| * | | | | | | | applets/controller: Modify heuristic to account for certain gamesMorph2020-09-041-7/+12
| * | | | | | | | applets/controller: Implement fallback applet for the SDL frontendMorph2020-09-043-90/+34
| * | | | | | | | applets/controller: Implement "Explain Text"Morph2020-09-043-16/+29
| * | | | | | | | Project Mjölnir: Part 2 - Controller AppletMorph2020-09-049-42/+487
* | | | | | | | | Merge pull request #4633 from ReinUsesLisp/gpu-initRodrigo Locatti2020-09-101-1/+0
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | video_core: Remove all Core::System references in rendererReinUsesLisp2020-09-061-1/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #4397 from ReinUsesLisp/bsdbunnei2020-09-0610-56/+1387
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | service/bsd: Handle Poll with no entries accuratelyReinUsesLisp2020-07-281-0/+5
| * | | | | | | services/bsd: Implement most of bsd:sReinUsesLisp2020-07-285-55/+911
| * | | | | | | service/sockets: Add worker pool abstractionReinUsesLisp2020-07-281-0/+30
| * | | | | | | service/sockets: Add worker abstraction to execute blocking calls asynchronouslyReinUsesLisp2020-07-282-0/+133
| * | | | | | | service/sockets: Add translate functionsReinUsesLisp2020-07-283-0/+215
| * | | | | | | service/sockets: Add enumerations and structuresReinUsesLisp2020-07-282-0/+81
| * | | | | | | services/nifm: Implement GetCurrentIpAddressReinUsesLisp2020-07-281-1/+12
* | | | | | | | hid: Implement MergeSingleJoyasDualJoyMorph2020-09-043-5/+24
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #4590 from ReinUsesLisp/tsan-schedbunnei2020-09-031-2/+6
|\ \ \ \ \ \ \
| * | | | | | | hle/scheduler: Fix data race in is_context_switch_pendingReinUsesLisp2020-08-261-2/+6
* | | | | | | | file_sys/patch_manager: Add missing includeReinUsesLisp2020-09-031-0/+1
* | | | | | | | Merge pull request #4568 from lioncash/fspbunnei2020-09-031-3/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | fsp_srv: Resolve -Wunused-but-set-variable warningLioncash2020-08-231-1/+8
| * | | | | | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()Lioncash2020-08-231-2/+5
* | | | | | | | | Merge pull request #4564 from lioncash/file-includebunnei2020-09-0327-37/+66
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys: Replace inclusions with forward declarations where applicableLioncash2020-08-2327-37/+66
| |/ / / / / / / /
* | | | | | | | | Merge pull request #4382 from FearlessTobi/port-udp-configbunnei2020-09-014-3/+23
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Address second batch of reviewsFearlessTobi2020-08-301-0/+1
| * | | | | | | | | yuzu: Add motion and touch configurationFearlessTobi2020-08-293-3/+22
* | | | | | | | | | Merge pull request #4589 from ReinUsesLisp/tsan-hostbunnei2020-09-011-1/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | hle/kernel: Fix data race in GetCurrentHostThreadIDReinUsesLisp2020-08-261-1/+2
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4461 from comex/thread-namesLC2020-08-311-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Fix thread naming on Linux, which limits names to 15 bytes.comex2020-08-061-1/+1
* | | | | | | | | | Merge pull request #4586 from yuzu-emu/tsan-cpu-interruptbunnei2020-08-282-5/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | cpu_interrupt_handler: Misc style changesReinUsesLisp2020-08-262-5/+3
| * | | | | | | | | | cpu_interrupt_handler: Make is_interrupted an atomicReinUsesLisp2020-08-262-2/+3
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | controllers/npad: Fix inconsistencies with controller connection statusesMorph2020-08-261-1/+7
* | | | | | | | | | controllers/npad: Fix LibNX controller connection statusesMorph2020-08-261-1/+9
* | | | | | | | | | controllers/npad: Fix LedPattern for P1-4Morph2020-08-261-3/+3
* | | | | | | | | | Project Mjölnir: Part 1Morph2020-08-265-510/+117
|/ / / / / / / / /
* | | | | | | | | Merge pull request #4563 from lioncash/rcachebunnei2020-08-251-17/+16
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | |
| * | | | | | | | registered_cache: Make use of ends_with for string suffix checkingLioncash2020-08-231-2/+1
| * | | | | | | | registered_cache: Make use of designated initializersLioncash2020-08-231-15/+15
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4562 from lioncash/loopbunnei2020-08-241-16/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | cpu_manager: Make use of ranged for where applicableLioncash2020-08-231-16/+13
| |/ / / / / / /
* | | | | | | | Merge pull request #4561 from lioncash/key-constexprbunnei2020-08-242-75/+82
|\ \ \ \ \ \ \ \
| * | | | | | | | key_manager: Make data arrays constexprLioncash2020-08-232-75/+82
| |/ / / / / / /
* | | | | | | | Merge pull request #4549 from lioncash/filesbunnei2020-08-241-32/+48
|\ \ \ \ \ \ \ \
| * | | | | | | | vfs_real: Resolve sign conversion warningsLioncash2020-08-181-2/+2
| * | | | | | | | vfs_real: Avoid redundant map lookupsLioncash2020-08-181-30/+46
* | | | | | | | | Merge pull request #4560 from lioncash/convertbunnei2020-08-233-8/+6
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core_timing: Remove unused headerLioncash2020-08-233-2/+2
| * | | | | | | | | core_timing: Move clock initializer into constructor initializer listLioncash2020-08-231-4/+2
| * | | | | | | | | core_timing: Resolve sign conversion warningLioncash2020-08-231-2/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #4541 from MerryMage/yolobunnei2020-08-223-3/+29
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | dynarmic: Add unsafe optimizationsMerryMage2020-08-163-3/+29
* | | | | | | | | common/telemetry: Migrate namespace into the Common namespaceLioncash2020-08-183-8/+11
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #4535 from lioncash/fileutilbunnei2020-08-1820-320/+398
|\ \ \ \ \ \ \ \
| * | | | | | | | common/fileutil: Convert namespace to Common::FSLioncash2020-08-1620-320/+398
| |/ / / / / / /
* | | | | | | | Merge pull request #4494 from lioncash/transcodebunnei2020-08-172-3/+3
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | partition_data_manager: Eliminate magic valueLioncash2020-08-061-2/+2
| * | | | | | | aes_util: Make use of non-template variant of TranscodeLioncash2020-08-061-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #4526 from lioncash/core-semibunnei2020-08-153-7/+12
|\ \ \ \ \ \ \
| * | | | | | | core: Resolve several -Wextra-semi warningsLioncash2020-08-143-7/+12
* | | | | | | | Merge pull request #4527 from lioncash/pessimizing2bunnei2020-08-151-2/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | software_keyboard: Resolve a pessimizing move warningLioncash2020-08-141-2/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #4492 from lioncash/linkagebunnei2020-08-152-15/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | system_control: Make functions internally linked where applicableLioncash2020-08-052-15/+11
* | | | | | | | | Merge pull request #4463 from lioncash/lockdiscardbunnei2020-08-152-3/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | emu_window: Mark Scoped constructor and Acquire() as nodiscardLioncash2020-08-141-2/+2
| * | | | | | | | | kernel/scheduler: Mark SchedulerLock constructor as nodiscardLioncash2020-08-141-1/+1
| | |/ / / / / / / | |/| | | | | | |
* / | | | | | | | time_zone_content_manager: Collapse auto and default caseLioncash2020-08-141-3/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #4495 from lioncash/convRodrigo Locatti2020-08-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | cheat_engine: Resolve implicit bool->u64 conversionLioncash2020-08-061-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4511 from lioncash/build2LC2020-08-137-43/+52
|\ \ \ \ \ \ \ \
| * | | | | | | | General: Tidy up clang-format warnings part 2Lioncash2020-08-137-43/+52
* | | | | | | | | Merge pull request #4497 from lioncash/freezer-algbunnei2020-08-122-16/+22
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | freezer: Move entry finding to its own functionLioncash2020-08-062-12/+21
| * | | | | | | | freezer: Take address values by valueLioncash2020-08-061-3/+3
| * | | | | | | | freezer: Make use of std::erase_ifLioncash2020-08-061-4/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #4496 from lioncash/ce-desigbunnei2020-08-101-6/+18
|\ \ \ \ \ \ \ \
| * | | | | | | | cheat_engine: Make use of designated initializersLioncash2020-08-061-6/+18
| |/ / / / / / /
* | | | | | | | Merge pull request #4491 from lioncash/unused-varsbunnei2020-08-102-18/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel: Remove unused variablesLioncash2020-08-052-18/+11
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4488 from lioncash/filebunnei2020-08-094-41/+41
|\ \ \ \ \ \ \ \
| * | | | | | | | vfs_vector: Make creation of array vfs files less verboseLioncash2020-08-054-41/+41
* | | | | | | | | Merge pull request #4457 from ogniK5377/SetScreenShotPermissionbunnei2020-08-072-1/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | am: Unstub SetScreenShotPermissionDavid Marcec2020-07-312-1/+12
* | | | | | | | | | common/concepts: Rename IsBaseOf to DerivedFromLioncash2020-08-072-2/+2
* | | | | | | | | | Merge pull request #4483 from lioncash/constexpr-hexbunnei2020-08-072-98/+118
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | partition_data_manager: Update master key hashesLioncash2020-08-061-5/+5
| * | | | | | | | | | partition_data_manager: Make data arrays constexprLioncash2020-08-062-98/+118
* | | | | | | | | | | Merge pull request #4490 from lioncash/arbiterbunnei2020-08-072-2/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | scheduler: Resolve sign conversion warningLioncash2020-08-051-1/+2
| * | | | | | | | | | address_arbiter: Resolve sign conversion warningLioncash2020-08-051-1/+1
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4489 from lioncash/typesafebunnei2020-08-061-0/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | ipc_helpers: Only allow trivially copyable objects with PushRaw() and PopRaw()Lioncash2020-08-051-0/+4
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4484 from lioncash/aesutilbunnei2020-08-067-27/+36
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | aes_util: Allow SetIV to be non-allocatingLioncash2020-08-037-27/+36
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4475 from lioncash/bqueuebunnei2020-08-051-10/+11
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | buffer_queue: Make use of std::nulloptLioncash2020-08-031-5/+6
| * | | | | | | | | | buffer_queue: Make use of designated initializersLioncash2020-08-031-5/+5
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4444 from lioncash/volatilebunnei2020-08-051-6/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | common/atomic_ops: Don't cast away volatile from pointersLioncash2020-07-281-6/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #4466 from ogniK5377/loader-type-safebunnei2020-08-051-18/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | Place in anonymous namespaceDavid Marcec2020-08-031-0/+4
| * | | | | | | | loader: Make IdentifyFile typesafeDavid Marcec2020-08-031-20/+32
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4476 from lioncash/tzbunnei2020-08-051-17/+25
|\ \ \ \ \ \ \ \
| * | | | | | | | time_zone_binary: Make use of designated initializersLioncash2020-08-031-17/+25
| |/ / / / / / /
* | | | | | | | Merge pull request #4401 from ogniK5377/GetIndirectLayerImageRequiredMemoryInfobunnei2020-08-051-1/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfoDavid Marcec2020-07-211-1/+19
* | | | | | | | | Merge pull request #4430 from bunnei/new-gpu-vmmbunnei2020-08-054-93/+227
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Update src/core/hle/service/nvdrv/devices/nvmap.cppbunnei2020-07-281-1/+1
| * | | | | | | | | hle: nvdrv: Rewrite of GPU memory management.bunnei2020-07-264-93/+227
* | | | | | | | | | Merge pull request #4472 from lioncash/const-getbunnei2020-08-042-15/+16
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | perf_stats: Make use of designated initializersLioncash2020-08-031-6/+7
| * | | | | | | | | | perf_stats: Mark GetMeanFrametime() as constLioncash2020-08-032-9/+9
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4470 from lioncash/qualifierDavid2020-08-041-2/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | patch_manager: Resolve -Wignored-qualifier warningsLioncash2020-08-031-2/+2
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4481 from lioncash/cpp-depDavid2020-08-043-21/+21
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu: Resolve C++20 deprecation warnings related to lambda capturesLioncash2020-08-033-21/+21
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4474 from lioncash/hle-profileDavid2020-08-041-17/+26
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | profile_manager: Make use of std::nulloptLioncash2020-08-031-4/+4
| * | | | | | | | | | profile_manager: Make use of designated initializersLioncash2020-08-031-13/+22
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4473 from lioncash/cheat-desigbunnei2020-08-041-105/+121
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | dmnt_cheat_vm: Make use of designated initializersLioncash2020-08-031-105/+121
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #4456 from Morph1984/stub-really-long-fs-funcbunnei2020-08-047-63/+120
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | minor nitsMorph2020-07-311-1/+3
| * | | | | | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttributeMorph2020-07-302-23/+56
| * | | | | | | | | | fs: Rename SaveDataDescriptor to SaveDataAttributeMorph2020-07-305-41/+63
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4482 from lioncash/ldr-signbunnei2020-08-031-3/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service/ldr: Resolve sign mismatch warningsLioncash2020-08-031-3/+2
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4468 from lioncash/regcachebunnei2020-08-031-10/+15
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | registered_cache: Resolve -Wmaybe_uninitialized warningsLioncash2020-08-031-10/+15
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4471 from ogniK5377/sm-getservice-conceptbunnei2020-08-031-3/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | sm: Make use of IsBaseOf for GetServiceDavid Marcec2020-08-031-3/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #4467 from lioncash/modebunnei2020-08-032-18/+21
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | file_sys/mode: Make use of DECLARE_ENUM_FLAG_OPERATORS with ModeLioncash2020-08-032-18/+21
| |/ / / / / / / /
* | | | | | | | | ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer (#4465)David2020-08-039-30/+30
* | | | | | | | | Merge pull request #4439 from lioncash/cpuDavid2020-08-031-3/+3
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | cpu_manager: Remove redundant std::function declarationsLioncash2020-07-281-3/+3
* | | | | | | | | xts_archive: Check if the file is nullptr prior to parsingMorph2020-07-291-5/+9
* | | | | | | | | registered_cache: Add support for removing folder ncasMorph2020-07-292-53/+54
* | | | | | | | | Merge pull request #4442 from lioncash/devicemembunnei2020-07-283-11/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | device_memory: Remove unused system memberLioncash2020-07-283-11/+4
| |/ / / / / / / /
* | / / / / / / / configure_graphics: Remove Force 30 FPS modeMorph2020-07-282-2/+0
| |/ / / / / / / |/| | | | | | |
* | | | | | | | core_timing: Make use of uintptr_t to represent user_dataLioncash2020-07-2813-38/+46
|/ / / / / / /
* | | | | | | remove unused variable;CrazyMax2020-07-271-1/+0
* | | | | | | nvflinger: Mark interface functions with return values as [[nodiscard]]Lioncash2020-07-261-16/+14
* | | | | | | nvflinger: Use return value of Lock()Lioncash2020-07-263-4/+4
|/ / / / / /
* | | | | | Merge pull request #4350 from ogniK5377/hid-update-connectedbunnei2020-07-252-33/+37
|\ \ \ \ \ \
| * | | | | | hid: Only update keyboard & debug pad inputs if enabledDavid Marcec2020-07-162-33/+37
* | | | | | | Merge pull request #4380 from ogniK5377/swkbd-inline-1bunnei2020-07-252-13/+49
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | Address issuesDavid Marcec2020-07-201-2/+2
| * | | | | | swkbd: Return result for Calc request for inlined swkbdDavid Marcec2020-07-192-13/+49
* | | | | | | network: add missing include for BSDsJan Beich2020-07-231-0/+2
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #4306 from ReinUsesLisp/bsd-networkDavid2020-07-215-0/+840
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | core/network: Add network abstractionReinUsesLisp2020-07-195-0/+840
* | | | | | Merge pull request #4348 from lioncash/nanobunnei2020-07-1813-71/+80
|\ \ \ \ \ \
| * | | | | | core_timing: Remove unused data memberLioncash2020-07-161-2/+0
| * | | | | | core_timing: Make TimedCallback take std::chrono::nanosecondsLioncash2020-07-1613-44/+45
| * | | | | | core_timing: Make use of std::chrono with ScheduleEventLioncash2020-07-1610-32/+42
* | | | | | | Merge pull request #4345 from Morph1984/fix-createfilebunnei2020-07-181-0/+4
|\ \ \ \ \ \ \
| * | | | | | | Add comment to clarify the nullptr checkMorph2020-07-161-0/+1
| * | | | | | | filesystem: Create subdirectories prior to creating a fileMorph2020-07-161-0/+3
* | | | | | | | Merge pull request #4273 from ogniK5377/async-shaders-prodbunnei2020-07-183-0/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | Drop settings namespaceDavid Marcec2020-07-171-2/+1
| * | | | | | | | Rebase for per game settingsDavid Marcec2020-07-173-0/+6
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4365 from lioncash/miibunnei2020-07-181-53/+54
|\ \ \ \ \ \ \ \
| * | | | | | | | mii/manager: Make use of designated initializersLioncash2020-07-171-53/+54
* | | | | | | | | Merge pull request #4366 from lioncash/mii-signbunnei2020-07-181-3/+3
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | |
| * | | | | | | | mii/manager: Resolve sign mismatch warningsLioncash2020-07-171-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #4344 from VolcaEM/c3bunnei2020-07-172-1/+42
|\ \ \ \ \ \ \ \
| * | | | | | | | clang-formatVolcaEM2020-07-151-1/+2
| * | | | | | | | dmnt_cheat_vm: Implement opcode 0xC3 (ReadWriteStaticRegister)VolcaEM2020-07-152-1/+41
* | | | | | | | | Merge pull request #4309 from Morph1984/fix-romfs-bugbunnei2020-07-174-10/+10
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | fs: Fix RomFS building when zero byte files are presentMorph2020-07-124-10/+10
* | | | | | | | | Merge pull request #4347 from lioncash/loggingDavid2020-07-171-38/+39
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | settings: Resolve a sign conversion warning within GetTimeZoneString()Lioncash2020-07-151-5/+5
| * | | | | | | | | settings: Make use of std::string_view over std::string for loggingLioncash2020-07-151-33/+34
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #4371 from lioncash/cmake2David2020-07-171-0/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/CMakeLists: Add missing physical_memory.h header fileLioncash2020-07-171-0/+1
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #4357 from lioncash/unused4David2020-07-173-7/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel: Remove unused variablesLioncash2020-07-163-7/+2
* | | | | | | | | | Merge pull request #4358 from lioncash/unused5David2020-07-171-2/+0
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/thread: Remove unimplemented function prototypeLioncash2020-07-161-2/+0
| |/ / / / / / / / /
* | / / / / / / / / constants: Add missing <array> includeLioncash2020-07-171-0/+1
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #4292 from bunnei/mii-rewritebunnei2020-07-179-914/+3270
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle: service: mii: Rewrite service to properly support creation of random and default miis.bunnei2020-07-129-914/+3270
* | | | | | | | | | Merge pull request #4327 from lioncash/desig2Rodrigo Locatti2020-07-162-58/+38
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | address_space_info: Use type alias to simplify codeLioncash2020-07-131-14/+13
| * | | | | | | | | address_space_info: Make use of designated initializersLioncash2020-07-132-46/+27
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | kernel: Add missing includeLioncash2020-07-161-0/+1
* | | | | | | | | cpu_manager: Mark function getters as staticLioncash2020-07-164-10/+11
* | | | | | | | | cpu_manager: Remove unused preemption_count variableLioncash2020-07-161-1/+0
* | | | | | | | | cpu_manager: Add missing includesLioncash2020-07-161-0/+3
* | | | | | | | | Merge pull request #4337 from lat9nq/fix-per-game-asyncbunnei2020-07-162-0/+8
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | clang-formatlat9nq2020-07-141-2/+1
| * | | | | | | | | settings: Move settings sanitization to its own functionlat9nq2020-07-142-0/+9
| |/ / / / / / / /
* | | | | | | | | Merge pull request #4346 from lioncash/threadDavid2020-07-167-35/+26
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | |
| * | | | | | | | kernel/process: Move name and system context to the bottom of the member listLioncash2020-07-151-6/+6
| * | | | | | | | kernel/handle_table: Remove usages of the global system instanceLioncash2020-07-154-8/+15
| * | | | | | | | kernel/thread: Remove global GetCurrentThread()Lioncash2020-07-153-23/+7
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #4249 from Morph1984/delete-update-aoc-on-overwriteDavid2020-07-162-10/+92
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | Check for empty section0 and CNMT prior to installMorph2020-07-161-3/+19
| * | | | | | | clang formatMorph2020-07-151-3/+3
| * | | | | | | Use proper install result when overwriting filesMorph2020-07-151-1/+1
| * | | | | | | Remove global system instance and address feedbackMorph2020-07-152-14/+10
| * | | | | | | registered_cache: Remove previous update/dlc if it exists on installMorph2020-07-152-13/+83
| |/ / / / / /
* | | | | | | Merge pull request #4328 from lioncash/unused-var3bunnei2020-07-161-2/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | memory_layout: Remove unused data memberLioncash2020-07-131-2/+0
| |/ / / / /
* | | | | | Merge pull request #4294 from MerryMage/cpu-opt-settingsbunnei2020-07-143-11/+71
|\ \ \ \ \ \
| * | | | | | configure_cpu: Show/Hide debugging optionsMerryMage2020-07-113-46/+57
| * | | | | | configuration: Add settings to enable/disable specific CPU optimizationsMerryMage2020-07-113-11/+60
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #4282 from Morph1984/fs-sizebunnei2020-07-143-40/+16
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | bis_factory: Set User NAND free space to be 1 MiB less than total.Morph2020-07-101-1/+3
| * | | | | sdmc_factory: Set the SDMC total size to 1 TiBMorph2020-07-101-1/+3
| * | | | | bis_factory: Use hardware default NAND partition sizesMorph2020-07-101-10/+11
| * | | | | settings: Remove storage size optionsMorph2020-07-101-29/+0
* | | | | | Merge pull request #4265 from Morph1984/file-renameFernando Sahmkow2020-07-121-10/+17
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | vfs_real: Fix MoveFileMorph2020-07-101-10/+17
| |/ / / /
* | | | | Merge pull request #4275 from CrazyMax/desired_languagebunnei2020-07-121-1/+13
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | AM: fix GetDesiredLanguage:CrazyMax2020-07-081-1/+13
* | | | | Merge pull request #4203 from VolcaEM/servicesbunnei2020-07-1126-154/+282
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Rename two functions in NSVolcaEM2020-07-021-2/+2
| * | | | Rename GetApplicationArea2 to GetApplicationAreaSizeVolcaEM2020-07-021-2/+2
| * | | | Remove duplicate functionsVolcaEM2020-06-291-2/+0
| * | | | Use decimal instead of hexadecimalVolcaEM2020-06-291-3/+5
| * | | | Fix typoVolcaEM2020-06-291-1/+1
| * | | | Clang-formatVolcaEM2020-06-291-1/+1
| * | | | service: Update function tablesVolcaEM2020-06-2927-157/+285
* | | | | KeyManager: Prevent writing of invalid keysMorph2020-07-101-4/+8
| |_|/ / |/| | |
* | | | configuration: implement per-game configurations (#4098)lat9nq2020-07-1012-103/+190
* | | | Merge pull request #4248 from Morph1984/CreateManagedDisplaySeparableLayerbunnei2020-07-102-1/+20
|\ \ \ \
| * | | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayerMorph2020-07-052-1/+20
* | | | | Merge pull request #4202 from ReinUsesLisp/scoped-lockbunnei2020-07-092-15/+12
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | core_timing,scheduler: Use std::scoped_lock when possibleReinUsesLisp2020-06-292-15/+12
* | | | | Merge pull request #4243 from CrazyMax/display_versionbunnei2020-07-081-4/+16
|\ \ \ \ \
| * | | | | GetDisplayVersion should return a null-terminated version string.CrazyMax2020-07-071-4/+16
| | |/ / / | |/| | |
* | | | | Merge pull request #4245 from MerryMage/page-table-racebunnei2020-07-081-2/+5
|\ \ \ \ \
| * | | | | memory: Set page-table pointers before setting attribute = MemoryMerryMage2020-07-051-2/+5
| |/ / / /
* / / / / cpu_interrupt_handler: Remove #pragma once from .cpp fileMerryMage2020-07-071-2/+0
|/ / / /
* | | | Merge pull request #4218 from ogniK5377/opus-externalRodrigo Locatti2020-07-041-1/+1
|\ \ \ \
| * | | | externals: Track opus as submodule instead of using conanDavid Marcec2020-07-011-1/+1
* | | | | Merge pull request #3924 from ogniK5377/GetKeyCodeMapbunnei2020-07-032-2/+72
|\ \ \ \ \
| * | | | | Move GetKeyCodeMapImpl to an anonymous namespaceDavid Marcec2020-06-241-19/+19
| * | | | | Fixed logging outputDavid Marcec2020-06-241-1/+1
| * | | | | Implement GetKeyCodeMap & GetKeyCodeMap2David Marcec2020-06-242-2/+72
* | | | | | Merge pull request #4193 from ogniK5377/GetIndirectLayerConsumerHandle-stubbunnei2020-07-031-1/+13
|\ \ \ \ \ \
| * | | | | | am: Stub GetIndirectLayerConsumerHandleDavid Marcec2020-06-281-1/+13
* | | | | | | Merge pull request #4192 from ogniK5377/acc-ListOpenContextStoredUsers-stubbunnei2020-07-035-4/+14
|\ \ \ \ \ \ \
| * | | | | | | acc: ListOpenContextStoredUsers partial stubDavid Marcec2020-06-285-4/+14
| |/ / / / / /
* | | | | | | key_manager: Correct casing of instance()Lioncash2020-07-019-9/+9
* | | | | | | key_manager: Delete move operationsLioncash2020-07-011-0/+3
* | | | | | | key_manager: Make use of canonical deleted operator=Lioncash2020-07-011-2/+2
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #3967 from FearlessTobi/keys-singletonDavid2020-07-0112-20/+26
|\ \ \ \ \ \
| * | | | | | crypto: Make KeyManager a singleton classFearlessTobi2020-05-2012-20/+26
* | | | | | | Merge pull request #4153 from ogniK5377/prepo-multibufbunnei2020-07-011-1/+6
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | prepo: : Don't read extra buffer from report unless passedDavid Marcec2020-06-241-1/+6
* | | | | | | Merge pull request #3955 from FernandoS27/prometheus-2bbunnei2020-06-2879-1983/+3502
|\ \ \ \ \ \ \
| * | | | | | | Core/Common: Address Feedback.Fernando Sahmkow2020-06-2816-45/+44
| * | | | | | | NvFlinger: Clang Format.Fernando Sahmkow2020-06-271-1/+1
| * | | | | | | SVC: Implement 32-bits wrappers and update Dynarmic.Fernando Sahmkow2020-06-274-34/+282
| * | | | | | | SVC: Add GetCurrentProcessorNumber32, CreateTransferMemory32, SetMemoryAttribute32Fernando Sahmkow2020-06-272-6/+39
| * | | | | | | ARM: Update Dynarmic and Setup A32 according to latest interface.Fernando Sahmkow2020-06-278-93/+174
| * | | | | | | SVC: Add GetThreadPriority32 & SetThreadPriority32Fernando Sahmkow2020-06-272-2/+30
| * | | | | | | ArmDynarmic32: Setup CNTPCT correctlyFernando Sahmkow2020-06-271-1/+1
| * | | | | | | Audio: Correct buffer release for host timing.Fernando Sahmkow2020-06-271-0/+5
| * | | | | | | Common/Kernel: Corrections and small bug fixing.Fernando Sahmkow2020-06-271-2/+2
| * | | | | | | Services/NvFlinger: Do vSync in a sepparate thread on Multicore.Fernando Sahmkow2020-06-274-5/+69
| * | | | | | | ARMDynarmicInterface: Correct GCC Build Errors.Fernando Sahmkow2020-06-272-6/+6
| * | | | | | | Kernel: Correct Host Context on Threads and Scheduler.Fernando Sahmkow2020-06-274-11/+11
| * | | | | | | Clang Format.Fernando Sahmkow2020-06-277-18/+15
| * | | | | | | ARMInterface/Externals: Update dynarmic and fit to latest version.Fernando Sahmkow2020-06-271-7/+7
| * | | | | | | ARMInterface: Correct rebase errors.Fernando Sahmkow2020-06-273-5/+5
| * | | | | | | CoreTiming: Correct rebase bugs and other miscellaneous things.Fernando Sahmkow2020-06-271-0/+2
| * | | | | | | Core: Split Microprofile Dynarmic timing per CoreFernando Sahmkow2020-06-271-3/+12
| * | | | | | | General: Tune the priority of main emulation threads so they have higher priority than less important helper threads.Fernando Sahmkow2020-06-272-0/+2
| * | | | | | | Dynarmic Interface: don't clear cache if JIT has not been created.Fernando Sahmkow2020-06-272-0/+6
| * | | | | | | General: Correct rebase, sync gpu and context management.Fernando Sahmkow2020-06-273-18/+3
| * | | | | | | CoreTiming/CycleTimer: Correct Idling.Fernando Sahmkow2020-06-271-2/+5
| * | | | | | | SingleCore: Correct ticks reset to be on preemption.Fernando Sahmkow2020-06-271-1/+1
| * | | | | | | General: Cleanup legacy code.Fernando Sahmkow2020-06-2717-739/+6
| * | | | | | | Kernel/svcBreak: Implement CacheInvalidation for Singlecore and correct svcBreak.Fernando Sahmkow2020-06-272-3/+13
| * | | | | | | Bootmanager/CPU_Manager: Correct shader caches and sync GPU on OpenGL.Fernando Sahmkow2020-06-271-6/+9
| * | | | | | | HLE_IPC: Correct HLE Event behavior on timeout.Fernando Sahmkow2020-06-273-1/+19
| * | | | | | | SingleCore: Improve Cycle timing Behavior and replace mutex in global scheduler for spinlock.Fernando Sahmkow2020-06-273-2/+4
| * | | | | | | FrameLimiting: Enable frame limiting for single core.Fernando Sahmkow2020-06-272-1/+2
| * | | | | | | SingleCore: Use Cycle Timing instead of Host Timing.Fernando Sahmkow2020-06-2715-80/+152
| * | | | | | | Scheduler: Correct Reload/UnloadFernando Sahmkow2020-06-272-3/+5
| * | | | | | | Thread: Release the ARM Interface on exitting.Fernando Sahmkow2020-06-273-1/+8
| * | | | | | | General: Move ARM_Interface into Threads.Fernando Sahmkow2020-06-2718-170/+136
| * | | | | | | Core: Refactor ARM Interface.Fernando Sahmkow2020-06-2710-42/+69
| * | | | | | | X64 Clock: Reduce accuracy to be less or equal to guest accuracy.Fernando Sahmkow2020-06-271-0/+3
| * | | | | | | ARM/WaitTree: Better track the CallStack for each thread.Fernando Sahmkow2020-06-272-0/+60
| * | | | | | | SVC/ARM: Correct svcSendSyncRequest and cache ticks on arm interface.Fernando Sahmkow2020-06-273-5/+20
| * | | | | | | SingleCore: Move Host Timing from a sepparate thread to main cpu thread.Fernando Sahmkow2020-06-277-10/+48
| * | | | | | | GUI: Make multicore only work with Async and add GUI for multicore.Fernando Sahmkow2020-06-273-2/+34
| * | | | | | | ARM: Addapt to new Exclusive Monitor Interface.Fernando Sahmkow2020-06-275-31/+24
| * | | | | | | CPU_Manager: Correct stopping on SingleCore.Fernando Sahmkow2020-06-271-3/+8
| * | | | | | | Scheduler: Correct yielding interaction with SetThreadActivity.Fernando Sahmkow2020-06-271-0/+15
| * | | | | | | General: Fix microprofile on dynarmic/svc, fix wait tree showing which threads were running.Fernando Sahmkow2020-06-2710-11/+77
| * | | | | | | General: Fix Stop functionFernando Sahmkow2020-06-273-3/+21
| * | | | | | | Kernel: Rewind on SVC change.Fernando Sahmkow2020-06-273-5/+16
| * | | | | | | Kernel: Preempt Single core on redudant yields.Fernando Sahmkow2020-06-276-21/+42
| * | | | | | | CPU_Manager: Unload/Reload threads on preemption on SingleCoreFernando Sahmkow2020-06-274-7/+64
| * | | | | | | Synchronization: Correct wide Assertion.Fernando Sahmkow2020-06-271-2/+4
| * | | | | | | General: Initial Setup for Single Core.Fernando Sahmkow2020-06-276-34/+215
| * | | | | | | Scheduler: Set last running time on thread.Fernando Sahmkow2020-06-272-4/+2
| * | | | | | | Kernel: Corrections to TimeManager, Scheduler and Mutex.Fernando Sahmkow2020-06-273-5/+5
| * | | | | | | Kernel: Fixes, corrections and asserts to scheduler and different svcs.Fernando Sahmkow2020-06-278-38/+38
| * | | | | | | Scheduler: Correct yields.Fernando Sahmkow2020-06-272-7/+25
| * | | | | | | Mutex: Revert workaround due to poor exclusive memory.Fernando Sahmkow2020-06-271-9/+2
| * | | | | | | ARM/Memory: Correct Exclusive Monitor and Implement Exclusive Memory Writes.Fernando Sahmkow2020-06-279-24/+236
| * | | | | | | SVC: WaitSynchronization add Termination Pending Result.Fernando Sahmkow2020-06-272-1/+5
| * | | | | | | Scheduler: Remove arm_interface lock and a few corrections.Fernando Sahmkow2020-06-272-17/+3
| * | | | | | | SVC: Correct SetThreadActivity.Fernando Sahmkow2020-06-274-38/+59
| * | | | | | | SCC: Small corrections to CancelSynchronizationFernando Sahmkow2020-06-273-2/+14
| * | | | | | | Scheduler: Correct locking for hle threads.Fernando Sahmkow2020-06-271-1/+2
| * | | | | | | Scheduler: Fix HLE Threads on guardFernando Sahmkow2020-06-271-4/+6
| * | | | | | | Scheduler: Protect on closed threads.Fernando Sahmkow2020-06-271-7/+17
| * | | | | | | Scheduler: Correct assert.Fernando Sahmkow2020-06-271-4/+2
| * | | | | | | Core: Correct rebase.Fernando Sahmkow2020-06-272-18/+11
| * | | | | | | Scheduler: Release old thread fiber before trying to switch to the next thread fiber.Fernando Sahmkow2020-06-272-11/+35
| * | | | | | | NVDRV: Remove frame limiting as Host Timing already takes care.Fernando Sahmkow2020-06-271-1/+0
| * | | | | | | Mutex: Correct Result writting to clear exclusivity.Fernando Sahmkow2020-06-271-3/+11
| * | | | | | | SVC: Correct svcWaitForAddress and svcSignalToAddress.Fernando Sahmkow2020-06-274-68/+161
| * | | | | | | Scheduler: Correct Select Threads Step 2.Fernando Sahmkow2020-06-271-0/+1
| * | | | | | | Kernel: Corrections to Scheduling.Fernando Sahmkow2020-06-275-19/+23
| * | | | | | | Kernel: Correct Signal on Thread Death and Setup Sync Objects on Thread for DebuggingFernando Sahmkow2020-06-273-15/+17
| * | | | | | | Core: Correct HLE Event Callbacks and other issues.Fernando Sahmkow2020-06-275-37/+39
| * | | | | | | Process: Protect TLS region and Modules.Fernando Sahmkow2020-06-271-0/+4
| * | | | | | | General: Add AssertsFernando Sahmkow2020-06-274-0/+24
| * | | | | | | General: Add better safety for JIT use.Fernando Sahmkow2020-06-275-7/+39
| * | | | | | | SVC: Correct races on physical core switching.Fernando Sahmkow2020-06-272-10/+10
| * | | | | | | NVFlinger: Lock race condition between CPU, Host Timing, VSync.Fernando Sahmkow2020-06-273-0/+11
| * | | | | | | SVC: Add locks to the memory management.Fernando Sahmkow2020-06-271-0/+21
| * | | | | | | SVC: Correct WaitSynchronization, WaitProcessWideKey, SignalProcessWideKey.Fernando Sahmkow2020-06-279-33/+84
| * | | | | | | SVC: Cleanup old methods.Fernando Sahmkow2020-06-271-13/+9
| * | | | | | | CPU_Manager: Reconfigre guest threads for dynamrmic downsidesFernando Sahmkow2020-06-273-1/+7
| * | | | | | | SVC: Correct SendSyncRequest.Fernando Sahmkow2020-06-278-54/+116
| * | | | | | | SVC: Correct ArbitrateUnlockFernando Sahmkow2020-06-273-33/+37
| * | | | | | | SVC: Correct SignalEvent, ClearEvent, ResetSignal, WaitSynchronization, CancelSynchronization, ArbitrateLockFernando Sahmkow2020-06-278-90/+134
| * | | | | | | SVC: Remove global HLE Lock.Fernando Sahmkow2020-06-271-3/+0
| * | | | | | | SVC: Correct GetThreadPriority, SetThreadPriority, GetThreadCoreMask, SetThreadCoreMask, GetCurrentProcessorNumberFernando Sahmkow2020-06-275-15/+26
| * | | | | | | SVC: Correct CreateThread, StartThread, ExitThread, SleepThread.Fernando Sahmkow2020-06-273-37/+31
| * | | | | | | HostTiming: Pause the hardware clock on pause.Fernando Sahmkow2020-06-273-1/+8
| * | | | | | | General: Setup yuzu threads' microprofile, naming and registry.Fernando Sahmkow2020-06-272-3/+7
| * | | | | | | CPU_Manager: remove debugging code.Fernando Sahmkow2020-06-271-8/+4
| * | | | | | | General: Recover Prometheus project from harddrive failure Fernando Sahmkow2020-06-2748-696/+1216
| | |_|/ / / / | |/| | | | |
* | | | | | | ldr: Cleanup NRO & NRR structsDavid Marcec2020-06-281-8/+8
* | | | | | | Merge pull request #4026 from VolcaEM/ldrDavid2020-06-281-38/+73
|\ \ \ \ \ \ \
| * | | | | | | Move SHA256Hash to its original positionVolcaEM2020-06-181-2/+2
| * | | | | | | Remove unnecessary pragmasVolcaEM2020-06-161-8/+0
| * | | | | | | Revert IsValidNRO refactor but make it more readableVolcaEM2020-06-161-26/+13
| * | | | | | | Update assert stringVolcaEM2020-06-161-1/+1
| * | | | | | | Clang-format againVolcaEM2020-06-141-2/+2
| * | | | | | | Use consistent variable namesVolcaEM2020-06-141-4/+4
| * | | | | | | Clang-formatVolcaEM2020-06-141-1/+2
| * | | | | | | Make assert strings consistentVolcaEM2020-06-141-3/+3
| * | | | | | | Attempt to fix crashes in SSBU and refactor IsValidNROVolcaEM2020-06-141-36/+59
| * | | | | | | Address review commentsVolcaEM2020-06-021-4/+4
| * | | | | | | Add comment to nrr_kindVolcaEM2020-05-311-1/+1
| * | | | | | | ldr: Update NRR/NRO structs VolcaEM2020-05-311-40/+72
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #4184 from VolcaEM/patch-9David2020-06-281-0/+3
|\ \ \ \ \ \ \
| * | | | | | | Oops (fix typo)VolcaEM2020-06-271-1/+1
| * | | | | | | grc: Update function tableVolcaEM2020-06-271-0/+3
* | | | | | | | Merge pull request #4185 from VolcaEM/patch-10David2020-06-281-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | lbl: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #4186 from VolcaEM/patch-11David2020-06-281-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | ldn: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #4187 from VolcaEM/patch-12David2020-06-281-0/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | mig: Update function tableVolcaEM2020-06-271-0/+6
| |/ / / / / / /
* | | | | | | | Merge pull request #4188 from VolcaEM/patch-13David2020-06-281-16/+16
|\ \ \ \ \ \ \ \
| * | | | | | | | mm: Update function tableVolcaEM2020-06-271-16/+16
| |/ / / / / / /
* | | | | | | | Merge pull request #4189 from VolcaEM/patch-14David2020-06-281-10/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | ncm: Update function tableVolcaEM2020-06-271-10/+10
| |/ / / / / / /
* | | | | | | | Merge pull request #4190 from VolcaEM/patch-15David2020-06-281-3/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | nfc: Update function tableVolcaEM2020-06-271-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #4183 from VolcaEM/patch-8David2020-06-281-0/+6
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | friend: Update function tableVolcaEM2020-06-271-0/+6
| |/ / / / / /
* | | | | | | Merge pull request #3396 from FernandoS27/prometheus-1David2020-06-275-0/+386
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Host Timing: Correct clang format.Fernando Sahmkow2020-06-181-1/+0
| * | | | | | HostTiming: Correct rebase and implement AddTicks.Fernando Sahmkow2020-06-182-1/+19
| * | | | | | Core/HostTiming: Allow events to be advanced manually.Fernando Sahmkow2020-06-182-26/+41
| * | | | | | Common/Tests: Address FeedbackFernando Sahmkow2020-06-184-7/+19
| * | | | | | Common/Tests: Clang Format.Fernando Sahmkow2020-06-182-4/+6
| * | | | | | Common: Refactor & Document Wall clock.Fernando Sahmkow2020-06-181-2/+1
| * | | | | | Common: Implement WallClock Interface and implement a native clock for x64Fernando Sahmkow2020-06-182-14/+11
| * | | | | | Tests: Add base tests to host timingFernando Sahmkow2020-06-182-41/+90
| * | | | | | Core: Implement a Host Timer.Fernando Sahmkow2020-06-185-0/+295
* | | | | | | Merge pull request #4164 from Kewlan/mute-audio-hotkeybunnei2020-06-272-0/+10
|\ \ \ \ \ \ \
| * | | | | | | Add a "Mute Audio" hotkeyKewlan2020-06-262-0/+10
* | | | | | | | Merge pull request #4158 from Morph1984/capsbunnei2020-06-2714-57/+69
|\ \ \ \ \ \ \ \
| * | | | | | | | caps_u: Fix GetAlbumContentsFileListForApplication stubMorph2020-06-261-9/+15
| * | | | | | | | caps: Use enum classes and check struct sizes on compile timeMorph2020-06-261-34/+40
| * | | | | | | | caps: Update copyright headersMorph2020-06-2614-14/+14
* | | | | | | | | Merge pull request #4152 from ogniK5377/ipc-errbunnei2020-06-271-25/+22
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Mark invalid IPC buffers as ASSERT_OR_EXECUTE_MSGDavid Marcec2020-06-241-25/+22
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #4154 from ogniK5377/swkbd-nullptrbunnei2020-06-271-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Prevent nullptr dereference on swkbd error caseDavid Marcec2020-06-241-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #4178 from VolcaEM/patch-6David2020-06-271-4/+43
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Use better names for "Unknown"sVolcaEM2020-06-271-39/+39
| * | | | | | | | | Update function namesVolcaEM2020-06-271-4/+4
| * | | | | | | | | es: Update function tableVolcaEM2020-06-271-2/+41
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | btm: Give better names for unknown functionsDavid Marcec2020-06-271-5/+5
* | | | | | | | | btdrv: Update function table (#4174)VolcaEM2020-06-271-83/+84
* | | | | | | | | bpc: Update function tables (#4173)VolcaEM2020-06-271-7/+13
* | | | | | | | | bcat: Update function tables and add missing classes (#4172)VolcaEM2020-06-272-0/+5
* | | | | | | | | am: Update function tables and add missing classes (#4169)VolcaEM2020-06-273-17/+19
* | | | | | | | | aoc: Update function table (#4170)VolcaEM2020-06-271-0/+1
* | | | | | | | | Merge pull request #4177 from VolcaEM/patch-5LC2020-06-271-71/+76
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | btm: Update function tablesVolcaEM2020-06-271-71/+76
| |/ / / / / / / /
* / / / / / / / / eupld: Update function tableVolcaEM2020-06-271-0/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #4159 from ogniK5377/mem-manager-dumb-assertbunnei2020-06-261-1/+0
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | memory_manager: Remove useless assertionDavid Marcec2020-06-251-1/+0
| |/ / / / / /
* | | | | | | Merge pull request #4141 from Morph1984/SevenSixAxisSensorDavid2020-06-252-21/+85
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | hid: Stub a series of "SevenSixAxisSensor" service commandsMorph2020-06-242-21/+85
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #4138 from Morph1984/GyroscopeZeroDriftModebunnei2020-06-244-6/+56
|\ \ \ \ \ \
| * | | | | | hid: Implement Get/ResetGyroscopeZeroDriftModeMorph2020-06-214-6/+56
| |/ / / / /
* | | | | | Merge pull request #4128 from lioncash/move2bunnei2020-06-241-2/+2
|\ \ \ \ \ \
| * | | | | | software_keyboard: Eliminate trivial redundant copiesLioncash2020-06-201-2/+2
| | |/ / / / | |/| | | |
* | | | | | lm: Silence no return value warningMorph2020-06-231-1/+2
* | | | | | account: Update function tables and add missing classes (#4145)VolcaEM2020-06-225-42/+384
* | | | | | arm_dynarmic_64: Log the instruction when an exception is raisedMorph2020-06-221-2/+2
* | | | | | arm_dynarmic_32: Log under Core_ARM instead of HW_GPUMorph2020-06-221-1/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #4099 from MerryMage/macOS-buildbunnei2020-06-202-3/+3
|\ \ \ \ \
| * | | | | memory_manager: Explicitly specifcy std::min<size_t>MerryMage2020-06-181-2/+2
| * | | | | shared_font: Service::NS::EncryptSharedFont takes a size_t&MerryMage2020-06-181-1/+1
* | | | | | Merge pull request #4113 from ogniK5377/boxcat-disablebunnei2020-06-201-2/+2
|\ \ \ \ \ \
| * | | | | | Fix compilation when not building with boxcatDavid Marcec2020-06-191-2/+2
| | |/ / / / | |/| | | |
* / | | | | mii_model: Remove redundant std::moveMerryMage2020-06-191-1/+1
|/ / / / /
* / / / / arm_dynarmic_32: Fix implicit conversion error in SetTPIDR_EL0ReinUsesLisp2020-06-181-1/+1
|/ / / /
* | | | arm_dynarmic_cp15: Implement CNTPCTMerryMage2020-06-171-0/+13
* | | | arm_dynarmic_cp15: Update CP15MerryMage2020-06-174-142/+73
* | | | arm_dynarmic_32: InterpreterFallback should never happenMerryMage2020-06-171-2/+3
* | | | Merge pull request #3966 from Morph1984/hide-internal-resolution-uibunnei2020-06-161-1/+1
|\ \ \ \
| * | | | yuzu/frontend: Remove internal resolution optionMorph2020-06-061-1/+1
* | | | | Merge pull request #4070 from ogniK5377/GetTPCMasks-fixbunnei2020-06-152-21/+22
|\ \ \ \ \
| * | | | | nvdrv: Fix GetTPCMasks for ioctl3David Marcec2020-06-102-21/+22
| | |_|_|/ | |/| | |
* | | | | Merge pull request #4069 from ogniK5377/total-phys-membunnei2020-06-141-2/+4
|\ \ \ \ \
| * | | | | kernel: Account for system resource size for memory usageDavid Marcec2020-06-101-2/+4
| |/ / / /
* | | | | Merge pull request #4010 from ogniK5377/reserve-always-breakbunnei2020-06-131-5/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | kernel: ResourceLimit::Reserve remove useless while loopDavid Marcec2020-05-291-5/+1
| | |/ / | |/| |
* | | | Merge pull request #4044 from ogniK5377/handle-not-signalled-errbunnei2020-06-041-1/+1
|\ \ \ \
| * | | | Downgrade "handle not signaled" error to traceDavid Marcec2020-06-041-1/+1
| | |/ / | |/| |
* | | | Merge pull request #4009 from ogniK5377/macro-jit-prodbunnei2020-06-041-0/+1
|\ \ \ \ | |/ / / |/| | |
| * | | Implement macro JITDavid Marcec2020-05-301-0/+1
| |/ /
* | | Clang-formatVolcaEM2020-06-011-2/+1
* | | hid: Stub GetXpadIDsVolcaEM2020-06-012-1/+14
|/ /
* | Merge pull request #4002 from lat9nq/fix-nix-mod-directoriesbunnei2020-05-292-8/+31
|\ \
| * | Make copying directory string more conciselat9nq2020-05-281-2/+1
| * | Address requested changeslat9nq2020-05-282-4/+4
| * | *nix systems can read any-case patch directorieslat9nq2020-05-282-8/+32
* | | Merge pull request #3964 from ReinUsesLisp/arb-integrationbunnei2020-05-243-0/+3
|\ \ \
| * | | yuzu: Add frontend settings for assembly shadersReinUsesLisp2020-05-193-0/+3
* | | | clang-formatVolcaEM2020-05-211-1/+2
* | | | nifm: correct assert in CreateTemporaryNetworkProfileVolcaEM2020-05-211-1/+1
| |/ / |/| |
* | | Merge pull request #3946 from ogniK5377/sysverdat-10-0-2bunnei2020-05-211-7/+7
|\ \ \
| * | | file_sys: Update SystemVersion archive to version 10.0.2David Marcec2020-05-161-7/+7
* | | | Merge pull request #3926 from ogniK5377/keyboard-statesbunnei2020-05-191-3/+4
|\ \ \ \ | |_|/ / |/| | |
| * | | hid: Clear keyboard states & fix logic issueDavid Marcec2020-05-121-3/+4
* | | | Merge pull request #3665 from bunnei/device-savebunnei2020-05-165-4/+49
|\ \ \ \
| * | | | service: fsp_srv: Stub implementation of OpenMultiCommitManager.bunnei2020-05-112-1/+38
| * | | | file_sys: savefata_factory: Update to support DeviceSaveData.bunnei2020-05-111-3/+6
| * | | | file_sys: control_metadata: Expose device_save_data_size.bunnei2020-05-112-0/+5
| |/ / /
* | / / nv_flinger: Use enum for pixel format instead of u32David Marcec2020-05-162-3/+11
| |/ / |/| |
* | | frontend: Set minimum window size to 640x360 instead of 1280x720 (#3413)Morph2020-05-152-1/+6
* | | time_zone: Use std::chrono::seconds for strong typing.bunnei2020-05-131-1/+1
* | | hle: service: time_zone_manager: Use current time zone setting.bunnei2020-05-112-3/+32
* | | core: settings: Add a setting for time zone.bunnei2020-05-112-0/+20
* | | Stub SendKeyboardLockKeyEventDavid Marcec2020-05-112-1/+11
|/ /
* | Replace externals with Conan (#3735)James Rowe2020-05-083-4/+5
* | Merge pull request #3879 from lioncash/global2bunnei2020-05-083-10/+16
|\ \ | |/ |/|
| * hle_ipc: Eliminate core memory globalsLioncash2020-05-033-10/+16
* | Merge pull request #3881 from lioncash/mem-warningbunnei2020-05-0511-23/+11
|\ \
| * | kernel/memory: Remove #pragma once within cpp fileLioncash2020-05-031-2/+0
| * | kernel/memory: Remove unused includesLioncash2020-05-037-8/+1
| * | kernel/memory: Remove unused variables in memory_block_managerLioncash2020-05-031-3/+0
| * | kernel/memory: Make use of std::array consistently in address_space_infoLioncash2020-05-031-6/+6
| * | kernel/memory: Resolve -Wshadow warningsLioncash2020-05-031-4/+4
| |/
* | Merge pull request #3880 from lioncash/encodingbunnei2020-05-056-12/+12
|\ \
| * | kernel/memory: Amend potential encoding warningsLioncash2020-05-036-12/+12
| |/
* | Merge pull request #3843 from ogniK5377/GetPopFromGeneralChannelEventbunnei2020-05-043-4/+20
|\ \
| * | am: IHomeMenuFunctions:GetPopFromGeneralChannelEventDavid Marcec2020-05-013-4/+20
* | | Merge pull request #3822 from ogniK5377/GetAccountIdbunnei2020-05-041-5/+8
|\ \ \ | |_|/ |/| |
| * | acc: Return a unique value per account for GetAccountIdDavid Marcec2020-04-291-5/+8
* | | settings: Add anisotropic filtering level to the yuzu configuration log (#3875)Morph2020-05-031-0/+1
* | | Merge pull request #3871 from lioncash/semibunnei2020-05-031-4/+6
|\ \ \
| * | | readable_event: Remove unnecessary semicolon in Signal()Lioncash2020-05-021-4/+6
* | | | Merge pull request #3824 from ogniK5377/GetDisplayVersionbunnei2020-05-031-3/+14
|\ \ \ \ | |/ / / |/| | |
| * | | Update src/core/hle/service/am/am.cppbunnei2020-05-031-1/+1
| * | | am: Properly implement GetDisplayVersionDavid Marcec2020-04-291-3/+14
| |/ /
* | | Merge pull request #3811 from ogniK5377/audin-initbunnei2020-05-022-5/+94
|\ \ \
| * | | marked stubsDavid Marcec2020-04-281-4/+5
| * | | Audin:u ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecifiedDavid Marcec2020-04-282-5/+93
* | | | Merge pull request #3819 from ogniK5377/err-log2bunnei2020-05-027-0/+51
|\ \ \ \
| * | | | kernel: Don't fail silentlyDavid Marcec2020-04-297-0/+51
| | |/ / | |/| |
* | | | Merge pull request #3833 from qwell/caps_su-32-stubbunnei2020-05-022-1/+13
|\ \ \ \
| * | | | caps:su Stub out SetShimLibraryVersionJason Parker2020-04-302-1/+13
* | | | | Merge pull request #3821 from ogniK5377/InitializeApplicationInfo-fixbunnei2020-05-022-22/+15
|\ \ \ \ \
| * | | | | acc: Fix InitializeApplicationInfoDavid Marcec2020-04-292-22/+15
| | |/ / / | |/| | |
* | | | | Merge pull request #3812 from ogniK5377/lisst-qualified-usersbunnei2020-05-025-3/+15
|\ \ \ \ \
| * | | | | Updated comment to reflect ListQualifiedUsers betterDavid Marcec2020-04-281-1/+3
| * | | | | account: ListQualifiedUsersDavid Marcec2020-04-285-3/+13
| | |_|/ / | |/| | |
* | | | | nvdrv: Fix GetGpuTime stack corruptionDavid Marcec2020-05-011-2/+3
| |_|_|/ |/| | |
* | | | Merge pull request #3823 from ogniK5377/setvrmodeMat M2020-04-302-16/+6
|\ \ \ \
| * | | | am: IsVrModeEnabled & SetVrModeEnabled fixesDavid Marcec2020-04-292-16/+6
| | |/ / | |/| |
* | | | Merge pull request #3830 from ogniK5377/GetFriendInvitationStorageChannelEventMat M2020-04-302-1/+14
|\ \ \ \
| * | | | am: GetFriendInvitationStorageChannelEventDavid Marcec2020-04-302-1/+14
| |/ / /
* | | | Merge pull request #3835 from ogniK5377/GetFreeSpaceSize-GetTotalSpaceSizeMat M2020-04-301-2/+2
|\ \ \ \
| * | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSizeDavid Marcec2020-04-301-2/+2
| |/ / /
* | | | Merge pull request #3832 from ogniK5377/nim-eca-CreateServerInterfaceMat M2020-04-301-1/+69
|\ \ \ \
| * | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterfaceDavid Marcec2020-04-301-1/+69
| |/ / /
* | | | Merge pull request #3831 from ogniK5377/caps-su-namesMat M2020-04-301-0/+3
|\ \ \ \ | | |_|/ | |/| |
| * | | caps: Add missing service names to caps:suDavid Marcec2020-04-301-0/+3
| |/ /
* / / psm: Mark as debug instead of warningDavid Marcec2020-04-291-7/+14
|/ /
* | Merge pull request #3818 from ogniK5377/err-logMat M2020-04-294-3/+27
|\ \
| * | Don't fail silently for vi, sm, set and ns servicesDavid Marcec2020-04-294-3/+27
* | | Merge pull request #3783 from lioncash/pointerMat M2020-04-294-8/+15
|\ \ \ | |/ / |/| |
| * | physical_core: Make use of std::make_unique instead of std::make_shared in ctorLioncash2020-04-244-8/+15
* | | kernel: Bad GetInfo ids should not be marked as stubsDavid Marcec2020-04-281-2/+2
* | | style: Change AMs & Glues error codes to be dec instead of hexDavid Marcec2020-04-282-7/+7
| |/ |/|
* | Merge pull request #3785 from ogniK5377/set-buffer-count-unitbunnei2020-04-271-1/+9
|\ \
| * | vi: Don't let uninitialized data pass as a response for SetBufferCountDavid Marcec2020-04-241-1/+9
* | | Merge pull request #3797 from slashiee/hid-stubMat M2020-04-272-1/+13
|\ \ \
| * | | services: hid: Stub StopSevenSixAxisSensor.M&M2020-04-262-1/+13
* | | | Merge pull request #3742 from FernandoS27/command-listbunnei2020-04-271-0/+1
|\ \ \ \
| * | | | GPU: Add Fast GPU Time Option.Fernando Sahmkow2020-04-231-0/+1
* | | | | Merge pull request #3744 from lioncash/table2bunnei2020-04-2619-7/+108
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: Update function tablesLioncash2020-04-2019-7/+108
* | | | | Merge pull request #3780 from lioncash/processbunnei2020-04-251-2/+138
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | svc: Re-add MapProcessCodeMemory/UnmapProcessCodeMemoryLioncash2020-04-241-2/+138
| | |_|/ | |/| |
* | | | Merge pull request #3777 from lioncash/warnRodrigo Locatti2020-04-241-2/+2
|\ \ \ \
| * | | | page_table: Remove unused capturesLioncash2020-04-231-2/+2
| |/ / /
* | | | Merge pull request #3778 from lioncash/unused-varRodrigo Locatti2020-04-241-3/+0
|\ \ \ \
| * | | | svc: Remove unused variableLioncash2020-04-231-3/+0
| |/ / /
* / / / shared_memory: Amend doxygen referenceLioncash2020-04-242-5/+5
|/ / /
* | / kernel: memory: Improve implementation of device shared memory. (#3707)bunnei2020-04-235-3/+105
| |/ |/|
* | Merge pull request #3730 from lioncash/timebunnei2020-04-231-24/+26
|\ \
| * | service/time: Remove reliance on the global system accessorLioncash2020-04-191-24/+26
* | | Merge pull request #3697 from lioncash/declarationsbunnei2020-04-233-10/+5
|\ \ \
| * | | General: Resolve warnings related to missing declarationsLioncash2020-04-173-10/+5
* | | | Merge pull request #3677 from FernandoS27/better-syncbunnei2020-04-233-4/+33
|\ \ \ \
| * | | | Correct Linux Compile Error.Fernando Sahmkow2020-04-222-7/+10
| * | | | UI: Replasce accurate GPU option for GPU Accuracy LevelFernando Sahmkow2020-04-223-4/+30
* | | | | Merge pull request #3725 from MerryMage/fpcrbunnei2020-04-231-2/+1
|\ \ \ \ \
| * | | | | thread: FPCR.FZ is likely not 1MerryMage2020-04-191-2/+1
* | | | | | Merge pull request #3699 from FearlessTobi/port-5185bunnei2020-04-221-4/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gdbstub: Fix some gdbstub jankinessMerryMage2020-04-171-4/+3
* | | | | | Merge pull request #3745 from bunnei/fix-homebrew-loadbunnei2020-04-225-12/+35
|\ \ \ \ \ \
| * | | | | | loader: nro: Fix process initialization using ProgramMetadata default.bunnei2020-04-212-11/+14
| * | | | | | loader: elf: Fix process initialization using ProgramMetadata default.bunnei2020-04-211-0/+5
| * | | | | | file_sys: program_metadata: Add a helper function for generating reasonable default metadata.bunnei2020-04-212-1/+16
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #3698 from lioncash/warningbunnei2020-04-212-3/+4
|\ \ \ \ \ \
| * | | | | | key_manager: Resolve missing field initializer warningLioncash2020-04-171-1/+2
| * | | | | | time_zone_manager: Resolve sign conversion warningsLioncash2020-04-171-2/+2
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #3724 from bunnei/fix-unicornbunnei2020-04-211-0/+11
|\ \ \ \ \ \
| * | | | | | core: arm_unicorn: Fix interpret fallback by temporarily mapping instruction page.bunnei2020-04-191-0/+11
* | | | | | | audio_renderer: Preliminary BehaviorInfo (#3736)David2020-04-211-2/+7
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #3739 from MerryMage/disable_cpu_optMat M2020-04-202-2/+9
|\ \ \ \ \ \
| * | | | | | dynarmic: Add option to disable CPU JIT optimizationsMerryMage2020-04-202-2/+9
| | |_|_|_|/ | |/| | | |
* | | | | | npad: Lower log level for VibrateController to DebugFearlessTobi2020-04-201-1/+1
* | | | | | audren: Lower log level for RequestUpdateImpl to DebugFearlessTobi2020-04-201-1/+1
* | | | | | Merge pull request #3712 from lioncash/removebunnei2020-04-202-3/+0
|\ \ \ \ \ \
| * | | | | | service: Remove unused RequestParser instancesLioncash2020-04-182-3/+0
* | | | | | | Merge pull request #3709 from lioncash/ambunnei2020-04-201-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | am: Resolve ineffective movesLioncash2020-04-181-2/+2
| |/ / / / /
* | | | | | Merge pull request #3696 from lioncash/cast-sizebunnei2020-04-192-21/+23
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | hle_ipc: Remove std::size_t casts where applicableLioncash2020-04-172-21/+23
| | |/ / / | |/| | |
* | | | | Merge pull request #3710 from lioncash/nsobunnei2020-04-181-1/+1
|\ \ \ \ \
| * | | | | loader/nso: Resolve moves not occurring in DecompressSegmentLioncash2020-04-181-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #3715 from bunnei/fix-impl-fallthroughMat M2020-04-181-0/+2
|\ \ \ \ \
| * | | | | service: hid: npad: Fix implicit fallthrough errors.bunnei2020-04-181-0/+2
| |/ / / /
* | | | | Merge pull request #3713 from lioncash/timebunnei2020-04-185-4/+5
|\ \ \ \ \
| * | | | | time/system_clock_core: Remove unnecessary initializerLioncash2020-04-181-1/+1
| * | | | | service/time: Mark IsStandardNetworkSystemClockAccuracySufficient as constLioncash2020-04-181-1/+1
| * | | | | service/time: Add virtual destructors where applicableLioncash2020-04-183-2/+3
| |/ / / /
* / / / / memory/slab_heap: Make use of static_cast over reinterpret_castLioncash2020-04-181-2/+2
|/ / / /
* | | | core: hle: Address various feedback & code cleanup.bunnei2020-04-1711-251/+153
* | | | core: device_memory: Remove incorrect usage of constexpr.bunnei2020-04-171-2/+6
* | | | memory: Add copyright notice for Atmosphere where applicable.bunnei2020-04-176-0/+18
* | | | kernel: Remove old VMManager class.bunnei2020-04-173-1973/+0
* | | | loader: nso: Fix loader size and arguments.bunnei2020-04-173-25/+47
* | | | loader: elf/kip/nro: Updates for new VMM.bunnei2020-04-173-5/+7
* | | | service: ldr: Updates for new VMM.bunnei2020-04-171-150/+215
* | | | kernel: memory: page_table: Simplify GetPhysicalAddr impl.bunnei2020-04-174-19/+6
* | | | kernel: svc: Updates for new VMM.bunnei2020-04-171-488/+116
* | | | core: memory: Fix memory access on page boundaries.bunnei2020-04-171-6/+39
* | | | core: memory: Updates for new VMM.bunnei2020-04-172-114/+53
* | | | core: gdbstub: Updates for new VMM.bunnei2020-04-171-2/+2
* | | | core: reporter: Updates for new VMM.bunnei2020-04-171-3/+5
* | | | memory: cheat_engine: Updates for new VMM.bunnei2020-04-171-5/+8
* | | | kernel: process: Updates for new VMM.bunnei2020-04-172-79/+151
* | | | service: pl_u: Update for new shared memory layout.bunnei2020-04-171-7/+5
* | | | service: time: Update for new shared memory layout.bunnei2020-04-171-3/+2
* | | | service: hid: Update for new shared memory layout.bunnei2020-04-171-3/+2
* | | | service: irs: Update for new shared memory layout.bunnei2020-04-171-3/+3
* | | | kernel: resource_limit: Reserve physical memory.bunnei2020-04-171-1/+6
* | | | kernel: Initialize memory layout for new VMM.bunnei2020-04-172-0/+159
* | | | core: system: Rename GetDeviceManager -> DeviceManager.bunnei2020-04-173-7/+7
* | | | kernel: transfer_memory: Refactor for new VMM.bunnei2020-04-172-130/+16
* | | | core: Construct/Destruct DeviceMemory on Init/Shutdown.bunnei2020-04-171-4/+7
* | | | kernel: shared_memory: Refactor for new VMM.bunnei2020-04-172-220/+58
* | | | core: device_memory: Update to use VirtualBuffer class.bunnei2020-04-172-39/+12
* | | | kernel: errors: Add ERR_OUT_OF_RESOURCES.bunnei2020-04-171-0/+1
* | | | kernel: process_capability: Update to use Memory::PageTable.bunnei2020-04-172-23/+25
* | | | kernel: memory: Add PageTable class, to manage process address space.bunnei2020-04-173-0/+1510
* | | | kernel: memory: Add MemoryLayout class, to build physical memory layout.bunnei2020-04-172-0/+74
* | | | kernel: memory: Add MemoryManager class, to manage page heaps.bunnei2020-04-173-0/+276
* | | | kernel: memory: Add MemoryBlockManager class, to manage memory blocks.bunnei2020-04-173-0/+256
* | | | kernel: memory: Add PageHeap class, to manage a heap of pages.bunnei2020-04-173-0/+483
* | | | kernel: memory: Add PageLinkedList class, to manage a list of pages.bunnei2020-04-172-0/+94
* | | | kernel: memory: Add system_control code, which will be used for ASLR support.bunnei2020-04-173-0/+61
* | | | physical_memory: Add missing include for <vector>.bunnei2020-04-171-0/+2
* | | | kernel: memory: Add MemoryBlock class, for managing memory blocks and their state.bunnei2020-04-172-0/+316
* | | | kernel: memory: Add memory_types.h, for things that are commonly used in memory code.bunnei2020-04-172-0/+19
* | | | kernel: memory: Add SlabHeap class, for managing memory heaps.bunnei2020-04-172-0/+162
* | | | kernel: memory: Add AddressSpaceInfo class, for managing the memory address space.bunnei2020-04-173-0/+166
* | | | core: device_manager: Add a simple class to manage device RAM.bunnei2020-04-175-1/+118
* | | | dynarmic: Enable strict alignment checks.bunnei2020-04-171-1/+4
* | | | core: memory: Move to Core::Memory namespace.bunnei2020-04-1733-80/+81
* | | | core: kernel: Add svc_types header to include SVC-specific types.bunnei2020-04-173-0/+70
* | | | core: kernel: Move SVC to its own namesapce.bunnei2020-04-175-9/+9
* | | | kernel: resource_limit: Improvements to implementation.bunnei2020-04-172-12/+50
* | | | loader: nso: Fix loading of static objects to be properly sized and aligned.bunnei2020-04-171-19/+9
* | | | process: SetupMainThread: Zero out argument on process start.bunnei2020-04-171-0/+2
* | | | arm_interface: Ensure ThreadContext is zero'd out.bunnei2020-04-171-16/+16
| |/ / |/| |
* | | Merge pull request #3671 from lioncash/switchbunnei2020-04-171-0/+2
|\ \ \ | |/ / |/| |
| * | kernel/thread: Resolve -Wswitch warningsLioncash2020-04-151-0/+2
* | | Merge pull request #3673 from lioncash/extrabunnei2020-04-1713-43/+54
|\ \ \
| * | | CMakeLists: Specify -Wextra on linux buildsLioncash2020-04-1613-43/+54
* | | | externals: Move LibreSSL linking to httplib.Markus Wick2020-04-161-5/+2
* | | | Merge pull request #3659 from bunnei/time-calc-standard-userRodrigo Locatti2020-04-163-1/+25
|\ \ \ \ | |/ / / |/| | |
| * | | service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.bunnei2020-04-153-1/+25
| | |/ | |/|
* | | CMakeLists: Make -Wreorder a compile-time errorLioncash2020-04-151-1/+1
| |/ |/|
* | Merge pull request #3660 from bunnei/friend-blocked-usersZach Hilman2020-04-141-1/+10
|\ \
| * | service: friend: Stub IFriendService::GetBlockedUserListIds.bunnei2020-04-141-1/+10
| |/
* / file_sys: patch_manager: Return early when there are no layers to apply.bunnei2020-04-141-0/+6
|/
* Merge pull request #3606 from ReinUsesLisp/nvflingerbunnei2020-04-123-10/+44
|\
| * service/vi: Partially implement BufferQueue disconnectReinUsesLisp2020-04-103-10/+44
* | Merge pull request #3635 from FernandoS27/buffer-freeRodrigo Locatti2020-04-112-9/+33
|\ \
| * | Buffer queue: Correct behavior of free buffer.Fernando Sahmkow2020-04-102-9/+33
| |/
* | Merge pull request #3594 from ReinUsesLisp/vk-instancebunnei2020-04-111-5/+36
|\ \ | |/ |/|
| * yuzu: Drop SDL2 and Qt frontend Vulkan requirementsReinUsesLisp2020-04-071-5/+36
* | Merge pull request #3610 from FernandoS27/gpu-cachesRodrigo Locatti2020-04-092-6/+199
|\ \ | |/ |/|
| * Memory: Address Feedback.Fernando Sahmkow2020-04-081-0/+68
| * Buffer Cache: Use vAddr instead of physical memory.Fernando Sahmkow2020-04-062-0/+125
| * GPU: Setup Flush/Invalidate to use VAddr instead of CacheAddrFernando Sahmkow2020-04-061-6/+6
* | file_sys: fix LayeredFS error when loading some games made with… (#3602)enler2020-04-071-1/+2
|/
* Merge pull request #3563 from bunnei/fix-ldr-memstateFernando Sahmkow2020-04-031-5/+15
|\
| * services: ldr: Fix MemoryState for read/write regions of NROs.bunnei2020-03-261-5/+15
* | Merge pull request #3552 from jroweboy/single-contextRodrigo Locatti2020-04-025-75/+34
|\ \
| * | Address review and fix broken yuzu-tester buildJames Rowe2020-03-262-2/+4
| * | Frontend/GPU: Refactor context managementJames Rowe2020-03-255-75/+32
* | | capsrv: Split Capture services into individual files and stub GetAlbumContentsFileListForApplication (#3571)Morph2020-04-0115-151/+536
* | | Merge pull request #3568 from bunnei/time-calcspanbunnei2020-03-293-1/+31
|\ \ \
| * | | services: time: Implement CalculateSpanBetween.bunnei2020-03-273-1/+31
| | |/ | |/|
* | | Merge pull request #3562 from perillamint/vrsvcbunnei2020-03-282-3/+42
|\ \ \
| * | | am: Implement VR related APIsperillamint2020-03-272-3/+42
| |/ /
* / / services: hid: Stub InitializeSevenSixAxisSensor.bunnei2020-03-272-1/+9
|/ /
* | Merge pull request #3524 from FearlessTobi/port-5106bunnei2020-03-243-1/+17
|\ \ | |/ |/|
| * gdbstub: small logic bug fix with defer_startGauvain "GovanifY" Roussel-Tarbouriech2020-03-171-2/+4
| * gdbstub: Ensure gdbstub doesn't drop packets crucial to initializationGauvain "GovanifY" Roussel-Tarbouriech2020-03-173-2/+16
* | sm/controller: Increase PointerBufferSizeFearlessTobi2020-03-231-1/+1
* | Merge pull request #3477 from FearlessTobi/webapplet-shitbunnei2020-03-221-0/+6
|\ \
| * | core/web_browser: Allow WebApplet to exit gracefully when an error occursFearlessTobi2020-03-221-0/+6
* | | set: implement GetRegionCodeDan2020-03-194-1/+12
* | | Merge pull request #3527 from FearlessTobi/output-modebunnei2020-03-191-0/+1
|\ \ \
| * | | yuzu: Save sound output mode and set it to Stereo by defaultFearlessTobi2020-03-171-0/+1
| | |/ | |/|
* / | time_zone_content_manager: Fix out of bounds readReinUsesLisp2020-03-181-1/+1
|/ /
* | Merge pull request #3497 from FernandoS27/microprogfile-extendbunnei2020-03-121-2/+2
|\ \
| * | NVFlinger: Do the microprofile Flip after processing a valid frame.Fernando Sahmkow2020-03-121-2/+2
* | | framebuffer_layout.h: drop the use of enum for screen dimensions.Vitor Kiguchi2020-03-112-10/+10
|/ /
* | Merge pull request #3301 from ReinUsesLisp/state-trackerRodrigo Locatti2020-03-091-0/+1
|\ \
| * | video_core: Reintroduce dirty flags infrastructureReinUsesLisp2020-02-281-0/+1
| |/
* | Merge pull request #3452 from Morph1984/anisotropic-filteringbunnei2020-03-081-0/+1
|\ \
| * | Create an "Advanced" tab in the graphics configuration tab and add anisotropic filtering levels.Morph2020-02-281-0/+1
| |/
* | core: hle: Implement separate A32/A64 SVC interfaces.bunnei2020-03-032-107/+380
* | core: Implement separate A32/A64 ARM interfaces.bunnei2020-03-0320-120/+452
* | core: loader: Remove check for 32-bit.bunnei2020-03-031-6/+0
* | core: dynarmic: Add CP15 from Citra.bunnei2020-03-033-0/+234
* | Merge pull request #3464 from FernandoS27/jit-fixbunnei2020-03-032-4/+19
|\ \ | |/ |/|
| * ARM_Interface: Cache the JITs instead of deleting/recreating.Fernando Sahmkow2020-02-262-4/+19
* | Merge pull request #3430 from bunnei/split-presenterbunnei2020-02-2810-28/+32
|\ \
| * | renderer_opengl: Move Frame/FrameMailbox to OpenGL namespace.bunnei2020-02-271-41/+0
| * | core: frontend: Refactor scope_acquire_window_context to scope_acquire_context.bunnei2020-02-265-25/+28
| * | frontend: sdl2: emu_window: Implement separate presentation thread.bunnei2020-02-261-3/+0
| * | renderer_opengl: Add texture mailbox support for presenter thread.bunnei2020-02-261-0/+1
| * | core: frontend: emu_window: Add TextureMailbox class.bunnei2020-02-261-0/+41
| * | core: settings: Add setting to enable vsync, which is on by default.bunnei2020-02-263-0/+3
| |/
* | AM/ICommonStateGetter: Stub SetLcdBacklighOffEnabled (#3454)Morph2020-02-272-2/+14
* | Merge pull request #3431 from CJBok/npad-fixbunnei2020-02-261-5/+5
|\ \ | |/ |/|
| * analog_from_button get direction implementationCJBok2020-02-181-5/+5
* | Scheduler: Inline global scheduler in Scheduler Lock.Fernando Sahmkow2020-02-221-4/+2
* | Kernel: Correct pending feedback.Fernando Sahmkow2020-02-221-3/+4
* | System: Expose Host thread registering routines from kernel.Fernando Sahmkow2020-02-222-0/+14
* | Kernel: Address Feedback.Fernando Sahmkow2020-02-226-30/+47
* | Kernel: Implement Scheduler locksFernando Sahmkow2020-02-222-0/+89
* | Kernel: Implement Time Manager.Fernando Sahmkow2020-02-225-1/+98
* | Kernel: Rename ThreadCallbackHandleTable and Setup Thread Ids on Kernel.Fernando Sahmkow2020-02-225-24/+107
* | Kernel: Make global scheduler depend on KernelCoreFernando Sahmkow2020-02-224-8/+24
* | httplib compatibilityBrian Clinkenbeard2020-02-191-3/+4
|/
* Merge pull request #3412 from Morph1984/aspect-ratiobunnei2020-02-183-3/+34
|\
| * Add 4:3 aspect ratio and address feedbackMorph2020-02-142-10/+13
| * Address feedbackMorph2020-02-142-18/+26
| * Use enumeration instead of magic numbersMorph2020-02-142-5/+11
| * Add following aspect ratios: 16:9, 21:9, Stretch to WindowMorph2020-02-142-2/+16
* | Merge pull request #3420 from namkazt/master2bunnei2020-02-172-0/+20
|\ \
| * | nvhost_gpu: implement ChannelSetTimeslicenamkazy2020-02-162-0/+20
* | | IUserLocalCommunicationService: add function Initialize2Nguyen Dac Nam2020-02-161-1/+9
* | | HLE: correct function name of IUserLocalCommunicationServiceNguyen Dac Nam2020-02-161-1/+1
|/ /
* | Merge pull request #3401 from FernandoS27/synchronizationbunnei2020-02-1440-202/+402
|\ \
| * | Core: Correct compilition in GCCFernando Sahmkow2020-02-141-0/+2
| * | Core: Address FeedbackFernando Sahmkow2020-02-146-24/+50
| * | Core: Set all hardware emulation constants in a single file.Fernando Sahmkow2020-02-1217-53/+88
| * | Kernel: Refactor synchronization to better match REFernando Sahmkow2020-02-1123-80/+212
| * | Kernel: Change WaitObject to Synchronization object. In order to better reflect RE.Fernando Sahmkow2020-02-1120-73/+78
* | | Merge pull request #3400 from makigumo/patch-1bunnei2020-02-141-2/+4
|\ \ \ | |_|/ |/| |
| * | update hwopus DecodeInterleaved for FW 7.0.0+makigumo2020-02-111-2/+4
| |/
* | address_arbiter: Collapse loops in InsertThread() and RemoveThread()Lioncash2020-02-121-19/+17
* | address_arbiter: Simplify GetThreadsWaitingOnAddress()Lioncash2020-02-122-10/+9
* | Merge pull request #3403 from lioncash/debugbunnei2020-02-121-2/+2
|\ \
| * | bcat/backend: Make formatting of passphrase consistent in NullBackend::SetPassphrase()Lioncash2020-02-121-1/+1
| * | bcat/backend: Prevent fmt exception in debug log within NullBackend::Clear()Lioncash2020-02-121-1/+1
| |/
* / kernel/thread: Remove trivial usages of the global system accessorLioncash2020-02-121-2/+2
|/
* hle: services: Use std::shared_ptr instead of copy by value.bunnei2020-02-089-50/+52
* Merge pull request #3381 from bunnei/ipc-fixbunnei2020-02-072-23/+57
|\
| * services: prepo: Fix IPC interface with SaveReport/SaveReportWithUser.bunnei2020-02-061-15/+15
| * hle_ipc: Add error checking to read/write buffer access.bunnei2020-02-061-8/+42
* | kernel: transfer_memory: Properly reserve and reset memory region.bunnei2020-02-065-40/+116
* | wait_object: Make wait behavior only require one object to signal.Zach Hilman2020-02-061-11/+2
* | am: Correct IPC object count mismatch.bunnei2020-02-061-6/+4
* | services: am: Clear events on PopOutData and PopInteractiveOutData.bunnei2020-02-061-0/+2
* | am: Refactor IStorage interface.bunnei2020-02-067-43/+81
* | applets: software_keyboard: Signal state change on end of interactive session.bunnei2020-02-061-0/+1
* | applets: software_keyboard: Minor cleanup.bunnei2020-02-061-2/+2
|/
* Merge pull request #3337 from ReinUsesLisp/vulkan-stagedbunnei2020-02-034-2/+30
|\
| * yuzu: Implement Vulkan frontendReinUsesLisp2020-01-291-0/+7
| * settings: Add settings for graphics backendReinUsesLisp2020-01-292-1/+20
| * core: Only wait for idle on gpu_core when it was initializedReinUsesLisp2020-01-291-1/+3
* | Merge pull request #3284 from CJBok/hid-fixbunnei2020-02-012-13/+36
|\ \
| * | Moved analog direction logic to sdl_implCJBok2020-01-152-9/+32
| * | Corrected directional states sensitivityCJBok2020-01-141-9/+9
| * | hid: Fix analog sticks directional statesCJBok2020-01-091-12/+12
* | | Merge pull request #3364 from lioncash/threadbunnei2020-01-312-2/+4
|\ \ \
| * | | core/arm: Remove usage of global GetCurrentThread()Lioncash2020-01-312-2/+4
* | | | Merge pull request #3363 from lioncash/unique_ptrbunnei2020-01-314-17/+17
|\ \ \ \
| * | | | kernel/physical_core: Make use of std::unique_ptrLioncash2020-01-312-4/+10
| * | | | core/cpu_manager: Remove unused includesLioncash2020-01-311-2/+0
| * | | | kernel/physical_core: Remove unused kernel reference member variableLioncash2020-01-313-11/+7
| |/ / /
* / / / Revert "system_archive: Fix Korean and Chinese fonts"bunnei2020-01-315-880167/+27164
|/ / /
* | | Merge pull request #3353 from FernandoS27/ariesbunnei2020-01-3124-515/+541
|\ \ \
| * | | System: Address FeedbackFernando Sahmkow2020-01-2711-24/+30
| * | | System: Correct PrepareReschedule.Fernando Sahmkow2020-01-261-1/+1
| * | | Kernel: Remove a few global instances from the kernel.Fernando Sahmkow2020-01-262-2/+2
| * | | Core: Refactor CpuCoreManager to CpuManager and Cpu to Core Manager.Fernando Sahmkow2020-01-2615-128/+115
| * | | ArmInterface: Delegate Exclusive monitor factory to exclusive monitor interfasce.Fernando Sahmkow2020-01-263-16/+24
| * | | Core: Refactor CPU Management.Fernando Sahmkow2020-01-2510-224/+168
| * | | Kernel: Implement Physical Core.Fernando Sahmkow2020-01-242-0/+81
* | | | Merge pull request #3151 from FearlessTobi/fix-koreanbunnei2020-01-305-27164/+880167
|\ \ \ \ | |_|_|/ |/| | |
| * | | Disable clang-format for font filesFearlessTobi2020-01-243-0/+6
| * | | system_archive: Fix Chinese fontFearlessTobi2020-01-192-13582/+694524
| * | | system_archive: Fix Korean fontFearlessTobi2020-01-192-13582/+185637
* | | | bsd: Stub several more functions.bunnei2020-01-252-4/+48
* | | | Merge pull request #3340 from SciresM/pmdxbunnei2020-01-242-3/+10
|\ \ \ \ | |_|/ / |/| | |
| * | | loader: provide default arguments (zero byte) to NSOsMichael Scire2020-01-232-3/+10
* | | | Input: UDP Client to provide motion and touch controlsfearlessTobi2020-01-231-0/+3
* | | | service: time: Implement ToPosixTimeWithMyRule.bunnei2020-01-234-1/+34
|/ / /
* | | time: Fix month off-by-one error.bunnei2020-01-201-2/+2
* | | Merge pull request #3271 from bunnei/time-rewritebunnei2020-01-2043-534/+3665
|\ \ \ | |/ / |/| |
| * | service: time: Implement GetStandardLocalSystemClock.bunnei2020-01-053-1/+9
| * | time: Remove overflow error checking (currently breaks ADO builds).bunnei2020-01-042-18/+2
| * | service: time: Implement GetClockSnapshotFromSystemClockContext.bunnei2020-01-043-3/+27
| * | service: time: Implement IsStandardNetworkSystemClockAccuracySufficient.bunnei2020-01-045-1/+51
| * | system_archive: Add a basic HLE implementation for time zone binary.bunnei2020-01-044-1/+675
| * | service: time: Rewrite implementation of glue services.bunnei2020-01-0435-444/+2834
| * | core: Initialize several structs that make use of Common::UUID.bunnei2020-01-045-100/+101
* | | core/memory: Create a special MapMemoryRegion for physical memory.Markus Wick2020-01-184-4/+31
* | | core/hle: Simplify PhysicalMemory usage in vm_manager.Markus Wick2020-01-181-23/+11
* | | core/loaders: Simplify PhysicalMemory usage.Markus Wick2020-01-183-8/+12
* | | core/kernel: Fix GetTotalPhysicalMemoryUsed.Markus Wick2020-01-111-2/+2
| |/ |/|
* | Merge pull request #3272 from bunnei/vi-close-layerbunnei2020-01-075-11/+48
|\ \
| * | service: vi: Implement CloseLayer.bunnei2020-01-045-11/+48
| |/
* | Merge pull request #3261 from degasus/page_tablebunnei2020-01-062-9/+17
|\ \
| * | core/memory + arm/dynarmic: Use a global offset within our arm page table.Markus Wick2020-01-012-9/+17
* | | Merge pull request #3257 from degasus/no_busy_loopsbunnei2020-01-061-1/+1
|\ \ \
| * | | video_core: Block in WaitFence.Markus Wick2019-12-301-1/+1
| |/ /
* | | Merge pull request #2945 from FernandoS27/fix-bcatbunnei2020-01-051-3/+17
|\ \ \ | |_|/ |/| |
| * | nifm: Only return that there's an internet connection when there's a BCATServerFernando Sahmkow2019-11-071-3/+17
* | | Merge pull request #3247 from FernandoS27/remap-fixbunnei2020-01-032-3/+5
|\ \ \
| * | | NvServices: Correct Ioctl Remap.Fernando Sahmkow2019-12-252-3/+5
| | |/ | |/|
* / | yuzu: Remove Maxwell debuggerReinUsesLisp2020-01-032-14/+0
|/ /
* | Merge pull request #3214 from lioncash/svc-funcbunnei2019-12-132-9/+6
|\ \
| * | kernel/svc: Correct function signature of SignalProcessWideKeyLioncash2019-12-112-9/+6
* | | Kernel: Correct behavior of Address Arbiter threads. (#3165)Fernando Sahmkow2019-12-113-24/+67
|/ /
* | Merge pull request #3201 from lioncash/dumpbunnei2019-12-112-2/+24
|\ \
| * | kernel/svc: Provide implementations for svcDumpInfo/svcDumpInfoNewLioncash2019-12-082-2/+24
* | | kernel: Remove unnecessary includesLioncash2019-12-0815-11/+17
|/ /
* | CpuCore: Clear exclusive state after doing a run in dynarmic.Fernando Sahmkow2019-12-052-1/+2
* | telemetry_session: Report renderer backendReinUsesLisp2019-12-021-0/+1
* | telemetry_session: Use temporary to avoid writing the same enumReinUsesLisp2019-12-021-16/+11
* | kernel: Implement a more accurate IPC dispatch.bunnei2019-11-2819-167/+246
* | Merge pull request #3169 from lioncash/memorybunnei2019-11-2838-674/+1241
|\ \
| * | core/memory; Migrate over SetCurrentPageTable() to the Memory classLioncash2019-11-273-26/+34
| * | core/memory: Migrate over GetPointerFromVMA() to the Memory classLioncash2019-11-271-36/+36
| * | core/memory: Migrate over Write{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-2714-153/+298
| * | core/memory: Migrate over Read{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-2717-167/+292
| * | core/memory: Migrate over ZeroBlock() and CopyBlock() to the Memory classLioncash2019-11-272-91/+161
| * | core/memory: Migrate over RasterizerMarkRegionCached() to the Memory classLioncash2019-11-272-68/+77
| * | core/memory: Migrate over ReadCString() to the Memory classLioncash2019-11-273-18/+40
| * | core/memory: Migrate over GetPointer()Lioncash2019-11-273-18/+45
| * | core: Prepare various classes for memory read/write migrationLioncash2019-11-2717-41/+66
| * | core/memory: Move memory read/write implementation functions into an anonymous namespaceLioncash2019-11-271-97/+98
| * | core/memory: Migrate over address checking functions to the new Memory classLioncash2019-11-276-39/+70
| * | core/memory: Migrate over memory mapping functions to the new Memory classLioncash2019-11-275-121/+172
| * | core/memory: Introduce skeleton of Memory classLioncash2019-11-274-3/+56
* | | Merge pull request #3171 from lioncash/internal-linkbunnei2019-11-282-6/+5
|\ \ \
| * | | filesys/romfs: Remove unused includesLioncash2019-11-272-4/+2
| * | | filesys/romfs: Make ProcessFile and ProcessDirectory internally linkedLioncash2019-11-271-2/+3
* | | | patch_manager: Adds check for disabled cheats to prevent them from being enabled (#3178)Morph2019-11-281-5/+11
* | | | Merge pull request #3170 from lioncash/enumbunnei2019-11-282-3/+3
|\ \ \ \ | |_|/ / |/| | |
| * | | file_sys/directory: Make EntryType an enum classLioncash2019-11-272-3/+3
| |/ /
* / / core_timing: Use better reference tracking for EventType. (#3159)bunnei2019-11-2714-82/+71
|/ /
* | kernel: Fix reference management for client/server session.bunnei2019-11-263-20/+18
* | Merge pull request #3094 from lioncash/tablesbunnei2019-11-2533-7/+192
|\ \
| * | service: Update function tablesLioncash2019-11-1233-7/+192
| |/
* | kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. (#3154)bunnei2019-11-2570-364/+365
* | Update svc.cppbunnei2019-11-231-0/+1
* | svc: GetSystemTick should return cntpct_el0, not core ticks.bunnei2019-11-231-1/+3
* | Merge pull request #3114 from FernandoS27/cond-varbunnei2019-11-235-22/+74
|\ \
| * | Kernel: Optimize condition variable threads management.Fernando Sahmkow2019-11-214-24/+21
| * | Kernel: Correct SignalProcessWideKeyFernando Sahmkow2019-11-211-6/+2
| * | Kernel: Correct behavior of Condition Variables to be more similar to real hardware.Fernando Sahmkow2019-11-215-15/+74
* | | Merge pull request #3130 from FernandoS27/cancel-syncbunnei2019-11-233-2/+19
|\ \ \
| * | | Kernel: Correct Cancel Synchronization.Fernando Sahmkow2019-11-163-2/+19
* | | | Merge pull request #3112 from lioncash/skipbunnei2019-11-211-8/+16
|\ \ \ \
| * | | | service/am: Remove unnecessary Skip callsLioncash2019-11-141-8/+16
| |/ / /
* | | | Merge pull request #3111 from lioncash/querybunnei2019-11-212-5/+14
|\ \ \ \ | |_|/ / |/| | |
| * | | am: Stub QueryApplicationPlayStatisticsLioncash2019-11-142-5/+14
| |/ /
* | | Merge pull request #3091 from lioncash/core-conversionbunnei2019-11-1535-170/+182
|\ \ \ | |/ / |/| |
| * | externals: Update httplibLioncash2019-11-121-1/+1
| * | service: Resolve sign conversion errorsLioncash2019-11-1215-58/+55
| * | perf_stats: Resolve implicit int to double conversion errorLioncash2019-11-121-1/+1
| * | loader; Resolve sign conversion/truncation errorsLioncash2019-11-123-6/+6
| * | gdbstub: Resolve sign conversion errorsLioncash2019-11-121-1/+2
| * | kernel: Resolve sign conversion warningsLioncash2019-11-124-72/+60
| * | file_sys: Resolve sign conversion warningsLioncash2019-11-124-12/+10
| * | result: Add default error code for the ResultCode(-1) caseLioncash2019-11-121-1/+9
| * | crypto: Resolve sign-conversion warningsLioncash2019-11-122-11/+12
| * | result: Resolve sign-coversion warningsLioncash2019-11-121-1/+1
| * | arm_unicorn: Resolve sign conversion warningsLioncash2019-11-123-8/+10
| * | CMakeLists: Make most implicit type conversion warnings errors on MSVCLioncash2019-11-121-0/+17
| |/
* | Merge pull request #3089 from SciresM/play_statisticsbunnei2019-11-142-0/+10
|\ \
| * | Implement stub for QueryApplicationPlayStatisticsByUidMichael Scire2019-11-112-0/+10
| |/
* | Merge pull request #3093 from lioncash/mbedtlsbunnei2019-11-147-12/+12
|\ \
| * | core: Migrate off deprecated mbedtls functionsLioncash2019-11-127-12/+12
| |/
* | Merge pull request #3092 from lioncash/utilbunnei2019-11-141-11/+15
|\ \
| * | key_manager: Make use of IOFile in WriteKeyToFile()Lioncash2019-11-121-11/+15
| |/
* / xts_archive: Remove redundant std::string constructorLioncash2019-11-131-2/+1
|/
* Merge pull request #3062 from bunnei/event-improvebunnei2019-11-0623-87/+53
|\
| * kernel: readable_event: Signal only once.bunnei2019-11-031-2/+4
| * kernel: events: Remove ResetType::Automatic.bunnei2019-11-0323-84/+48
| * kernel: readable_event: Initialize members.bunnei2019-11-031-1/+1
* | Merge pull request #2859 from Morph1984/hidDavid2019-11-062-92/+126
|\ \
| * | hid: Stub SetNpadJoyAssignmentModeSingle and reorganize service commandsMorph2019-10-072-92/+126
* | | common_func: Use std::array for INSERT_PADDING_* macros.bunnei2019-11-045-38/+39
* | | core/am: Stub InitializeApplicationCopyrightFrameBuffer, SetApplicationCopyrightImage and SetApplicationCopyrightVisibilityFearlessTobi2019-11-032-3/+31
| |/ |/|
* | Merge pull request #3038 from lioncash/docsRodrigo Locatti2019-10-302-91/+73
|\ \
| * | scheduler: Mark parameter of AskForReselectionOrMarkRedundant() as constLioncash2019-10-282-5/+5
| * | scheduler: Silence sign conversion warningsLioncash2019-10-281-5/+5
| * | scheduler: Initialize class members directly where applicableLioncash2019-10-282-6/+4
| * | scheduler: Amend documentation commentsLioncash2019-10-282-75/+59
* | | Merge pull request #3007 from DarkLordZach/fsc-regressbunnei2019-10-301-0/+12
|\ \ \ | |/ / |/| |
| * | savedata_factory: Automatically create certain savedataZach Hilman2019-10-221-0/+12
* | | Merge pull request #2971 from FernandoS27/new-scheduler-v2David2019-10-2817-431/+1014
|\ \ \
| * | | Kernel Thread: Cleanup THREADPROCESSORID_DONT_UPDATE.Fernando Sahmkow2019-10-152-4/+1
| * | | Kernel: Address Feedback 2Fernando Sahmkow2019-10-152-9/+6
| * | | Kernel: Clang FormatFernando Sahmkow2019-10-152-5/+5
| * | | Kernel: Reverse global accessor removal.Fernando Sahmkow2019-10-154-23/+9
| * | | Kernel: Address Feedback.Fernando Sahmkow2019-10-156-67/+98
| * | | Kernel Scheduler: Make sure the global scheduler shutdowns correctly.Fernando Sahmkow2019-10-156-0/+24
| * | | Kernel_Thread: Eliminate most global accessors.Fernando Sahmkow2019-10-151-11/+11
| * | | KernelSVC: Assert that condition variable address is aligned to 4 bytes.Fernando Sahmkow2019-10-151-0/+4
| * | | Kernel: Correct Paused schedulingFernando Sahmkow2019-10-151-3/+1
| * | | Kernel: Corrections to Wait Objects clearing in which a thread could still be signalled after a timeout or a cancel.Fernando Sahmkow2019-10-153-3/+4
| * | | Kernel: Correct redundant yields to only advance time forward.Fernando Sahmkow2019-10-151-3/+5
| * | | Kernel: Corrections to ModifyByWaitingCountAndSignalToAddressIfEqualFernando Sahmkow2019-10-151-5/+13
| * | | Kernel: Correct Results in Condition Variables and MutexesFernando Sahmkow2019-10-153-24/+17
| * | | Kernel: Clang FormatFernando Sahmkow2019-10-152-2/+3
| * | | Kernel: Remove global system accessor from WaitObjectFernando Sahmkow2019-10-154-2/+17
| * | | Scheduler: Implement Yield Count and Core migration on Thread Preemption.Fernando Sahmkow2019-10-152-5/+85
| * | | Scheduler: Corrections to YieldAndBalanceLoad and Yield bombing protection.Fernando Sahmkow2019-10-152-8/+8
| * | | Kernel: Initial implementation of thread preemption.Fernando Sahmkow2019-10-153-0/+30
| * | | Scheduler: Add protections for Yield bombingFernando Sahmkow2019-10-155-24/+31
| * | | Kernel: Style and CorrectionsFernando Sahmkow2019-10-1512-96/+137
| * | | Correct PrepareRescheduleFernando Sahmkow2019-10-156-38/+29
| * | | Comment and reorganize the schedulerFernando Sahmkow2019-10-152-98/+104
| * | | Add PrepareReschedule where required.Fernando Sahmkow2019-10-153-16/+18
| * | | Correct compiling errors and addapt to the new interface.Fernando Sahmkow2019-10-152-23/+14
| * | | Correct Supervisor Calls to work with the new scheduler,Fernando Sahmkow2019-10-151-26/+41
| * | | Redesign CPU Cores to work with the new schedulerFernando Sahmkow2019-10-152-13/+12
| * | | Add interfacing to the Global SchedulerFernando Sahmkow2019-10-154-0/+34
| * | | Addapt thread class to the new SchedulerFernando Sahmkow2019-10-152-60/+237
| * | | Implement a new Core SchedulerFernando Sahmkow2019-10-152-258/+411
* | | | Merge pull request #2991 from lioncash/npadbunnei2019-10-232-51/+23
|\ \ \ \ | |_|/ / |/| | |
| * | | hid/npad: Fix incorrect connection boolean value in ConnectAllDisconnectedControllers()Lioncash2019-10-181-1/+1
| * | | hid/npad: Add missing break in default caseLioncash2019-10-181-0/+1
| * | | hid/npad: Replace std::for_each with ranged for loopsLioncash2019-10-181-13/+12
| * | | hid/npad: Remove redundant non-const variant of IsControllerSupported()Lioncash2019-10-182-34/+5
| * | | hid/npad: Move function declarationsLioncash2019-10-181-5/+6
* | | | core: Fix clang-format errors.bunnei2019-10-191-9/+10
* | | | Fix null pointer deref.Nicolae-Andrei Cociorba2019-10-181-10/+12
* | | | Merge pull request #2992 from lioncash/dmntbunnei2019-10-181-2/+2
|\ \ \ \
| * | | | dmnt_cheat_vm: Correct register Restore and ClearRegs behaviorLioncash2019-10-181-2/+2
| |/ / /
* | | | Merge pull request #2989 from lioncash/apmRodrigo Locatti2019-10-182-16/+36
|\ \ \ \
| * | | | apm/controller: Make SetPerformanceConfiguration() use an array of pairs over a mapLioncash2019-10-171-14/+34
| * | | | apm/controller: Make GetCurrentPerformanceMode() a const member functionLioncash2019-10-172-2/+2
| |/ / /
* | | | core/core: Resolve -Wreorder warningsLioncash2019-10-171-2/+2
* | | | core/memory/cheat_engine: Resolve -Wreorder warningsLioncash2019-10-171-4/+3
|/ / /
* | | Merge pull request #2912 from FernandoS27/async-fixesbunnei2019-10-166-28/+29
|\ \ \
| * | | NvFlinger: Remove leftover from corrections and clang format.Fernando Sahmkow2019-10-051-4/+0
| * | | Core: Wait for GPU to be idle before shutting down.Fernando Sahmkow2019-10-051-0/+2
| * | | Nvdrv: Correct Event setup in NvdrvFernando Sahmkow2019-10-052-23/+14
| * | | NVFlinger: Reverse the change that only signaled events on buffer acquire.Fernando Sahmkow2019-10-052-20/+1
| * | | Nvdrv: Do framelimiting only in the CPU ThreadFernando Sahmkow2019-10-051-0/+4
| * | | NvFlinger: Don't swap buffers if a frame is missing and always trigger event in sync gpu.Fernando Sahmkow2019-10-051-1/+3
| * | | GPU_Async: Correct fences, display events and more.Fernando Sahmkow2019-10-052-2/+21
| * | | Nvdrv: Correct Async regression and avoid signaling empty buffer vsyncsFernando Sahmkow2019-10-052-3/+9
* | | | Merge pull request #2972 from lioncash/systembunnei2019-10-159-33/+63
|\ \ \ \ | |_|/ / |/| | |
| * | | bcat: Remove use of global system accessorsLioncash2019-10-156-29/+55
| * | | nvflinger/buffer_queue: Remove use of a global system accessorLioncash2019-10-123-4/+8
* | | | Merge pull request #2965 from FernandoS27/fair-core-timingbunnei2019-10-156-38/+94
|\ \ \ \
| * | | | Core_Timing: Address Remaining feedback.Fernando Sahmkow2019-10-121-5/+4
| * | | | Core_Timing: Address Feedback and suppress warnings.Fernando Sahmkow2019-10-115-13/+12
| * | | | Core Timing: Correct Idle and remove lefting pragmaFernando Sahmkow2019-10-091-2/+1
| * | | | Core Timing: General corrections and added tests.Fernando Sahmkow2019-10-092-4/+12
| * | | | Core Timing: Rework Core Timing to run all cores evenly.Fernando Sahmkow2019-10-096-38/+89
| |/ / /
* | | | Merge pull request #2897 from DarkLordZach/oss-ext-fonts-1bunnei2019-10-1418-123/+73480
|\ \ \ \
| * | | | pl_u: Fix mismatched rebase size error in font encryptionZach Hilman2019-10-133-19/+17
| * | | | pl_u: Use kernel physical memoryZach Hilman2019-10-132-4/+8
| * | | | pl_u: Remove excess static qualifierZach Hilman2019-10-131-1/+1
| * | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-10-132-112/+48
| * | | | system_archive: Synthesize shared fonts system archivesZach Hilman2019-10-133-5/+101
| * | | | externals: Move OSS font data to file_sys in coreZach Hilman2019-10-1313-1/+73324
| |/ / /
* | | | Merge pull request #2930 from DarkLordZach/gamecard-partitionsbunnei2019-10-144-26/+128
|\ \ \ \ | |/ / / |/| | |
| * | | card_image: Implement system update commands in XCIZach Hilman2019-10-132-3/+37
| * | | card_image: Add accessors for raw partitions in XCIZach Hilman2019-09-232-0/+36
| * | | card_image: Lazily load partitions in XCIZach Hilman2019-09-232-26/+41
| * | | pfs: Provide accessors for file sizes and offsetsZach Hilman2019-09-232-0/+17
* | | | Merge pull request #2921 from FreddyFunk/compiler-warnings-corebunnei2019-10-091-6/+6
|\ \ \ \
| * | | | Services::ES fix casting warningsFreddyFunk2019-09-291-6/+6
| |/ / /
* | | | Merge pull request #2654 from DarkLordZach/lm-log-rewritebunnei2019-10-0910-159/+367
|\ \ \ \
| * | | | lm: Flush manager output on core shutdownZach Hilman2019-09-225-11/+15
| * | | | lm: Rename Initialize to Log and implement with manager/reporterZach Hilman2019-09-221-140/+22
| * | | | lm: Implement manager class to output to reporterZach Hilman2019-09-222-0/+233
| * | | | core: Add LM::Manager to systemZach Hilman2019-09-226-19/+39
| * | | | reporter: Add log output for packaged lm log dataZach Hilman2019-09-222-0/+69
| |/ / /
* | | / hid: Implement DeactivateNpadMorph2019-10-072-1/+13
| |_|/ |/| |
* | | Merge pull request #2951 from lioncash/globalZach Hilman2019-10-0718-65/+87
|\ \ \
| * | | core/core: Remove unused headerLioncash2019-10-061-1/+0
| * | | core: Remove Core::CurrentProcess()Lioncash2019-10-065-13/+11
| * | | hle/service: Replace global system instance calls with instance-based onesLioncash2019-10-0614-51/+76
* | | | bcat/module: Silence truncation warningsLioncash2019-10-061-3/+3
* | | | bcat: Take std::function instance by value in NullBackend's constructorLioncash2019-10-062-2/+2
* | | | bcat: In-class initialize ProgressServiceBackend's impl memberLioncash2019-10-062-2/+2
* | | | bcat: Make ProgressServiceBackend's constructor take a std::string_viewLioncash2019-10-062-3/+7
* | | | bcat: Make ProgressServiceBackend's GetEvent() constLioncash2019-10-062-2/+2
* | | | boxcat: Silence an unused variable warningLioncash2019-10-061-1/+2
|/ / /
* | | audio/audout_u: Change formatting for old clang-format versionsReinUsesLisp2019-10-051-1/+1
* | | service/nvdrv: Silence -WswitchReinUsesLisp2019-10-054-4/+10
* | | service/nfp: Silence -Wunused and -WswitchReinUsesLisp2019-10-051-4/+5
* | | service/hid: Silence -Wunused and -WswitchReinUsesLisp2019-10-0515-23/+18
* | | service/am: Silence -WreorderReinUsesLisp2019-10-051-2/+1
* | | service/hid: Remove unused system referenceReinUsesLisp2019-10-052-2/+1
* | | service/friend: Remove unused fieldReinUsesLisp2019-10-051-1/+0
* | | service/filesystem: Silence -Wunused-variableReinUsesLisp2019-10-051-1/+1
* | | service/bcat: Silence -Wreorder and -WunusedReinUsesLisp2019-10-052-2/+2
* | | service/audio: Silence -WunusedReinUsesLisp2019-10-051-1/+1
* | | service/apm: Silence -Wunused and -WreorderReinUsesLisp2019-10-052-4/+5
| |/ |/|
* | Merge pull request #2936 from VPeruS/use-isallzeroarraybunnei2019-10-041-1/+1
|\ \
| * | [crypto] Use IsAllZeroArray helper functionvperus2019-10-021-1/+1
* | | Merge pull request #2539 from DarkLordZach/bcatDavid2019-10-0326-40/+1636
|\ \ \ | |/ / |/| |
| * | qt: Add service dialogZach Hilman2019-10-021-6/+5
| * | boxcat: Use updated game-asset API URL and tagsZach Hilman2019-10-011-6/+6
| * | bcat: Add FSC accessors for BCAT dataZach Hilman2019-10-0110-31/+51
| * | boxcat: Implement events global fieldZach Hilman2019-09-303-12/+14
| * | bcat: Implement DeliveryCacheProgressImpl structureZach Hilman2019-09-306-88/+314
| * | boxcat: Use Etag header names for file digestZach Hilman2019-09-302-24/+21
| * | boxcat: Add downloading and client for launch parameter dataZach Hilman2019-09-302-16/+77
| * | bcat: Add backend function for BCAT Indirect (launch parameter)Zach Hilman2019-09-302-0/+11
| * | bcat: Expose CreateBackendFromSettings helper functionZach Hilman2019-09-302-2/+2
| * | am: Unstub PopLaunchParameter and add bcat connection for app-specific dataZach Hilman2019-09-302-16/+52
| * | bcat: Implement cmd 90201 ClearDeliveryCacheStorageZach Hilman2019-09-301-1/+23
| * | bcat: Implement cmd 30100 SetPassphraseZach Hilman2019-09-301-1/+33
| * | bcat: Implement cmd RequestSyncDeliveryCache and variantZach Hilman2019-09-301-2/+70
| * | bcat: Implement IDeliveryCacheProgressService commandsZach Hilman2019-09-301-0/+131
| * | bcat: Implement IDeliveryCacheFileService commandsZach Hilman2019-09-301-0/+117
| * | bcat: Implement IDeliveryCacheDirectoryService commandsZach Hilman2019-09-301-0/+99
| * | bcat: Implement IDeliveryCacheStorageService commandsZach Hilman2019-09-301-0/+58
| * | bcat: Add commands to create IDeliveryCacheStorageServiceZach Hilman2019-09-303-2/+32
| * | module: Create BCAT backend based upon Settings value on constructionZach Hilman2019-09-303-1/+36
| * | bcat: Add BCAT backend for Boxcat serviceZach Hilman2019-09-302-0/+407
| * | bcat: Add backend class to generify the functions of BCATZach Hilman2019-09-302-0/+100
| * | settings: Add option to set BCAT backendZach Hilman2019-09-302-0/+6
| * | nifm: Signal to applications that internet access is availableZach Hilman2019-09-301-3/+10
| * | core/loader: Track the NSO build ID of the current processZach Hilman2019-09-303-0/+14
| * | applets: Add accessor for AppletFrontendSetZach Hilman2019-09-302-0/+6
| * | filesystem: Add getter for BCAT temporary directoryZach Hilman2019-09-303-0/+16
| * | vfs: Add function to extract ZIP file into virtual filesystemZach Hilman2019-09-302-0/+96
| * | Revert "arm_dynarmic: Check if jit is nullptr when preparing reschedule"bunnei2019-09-301-3/+0
| * | Merge pull request #2574 from DarkLordZach/dynarmic-jit-nullptrbunnei2019-09-301-0/+3
| |\ \ | | |/ | |/|
| | * arm_dynarmic: Check if jit is nullptr when preparing rescheduleZach Hilman2019-06-101-0/+3
* | | Signal styleset changes at a better timeDavid Marcec2019-09-241-8/+2
|/ /
* | Merge pull request #2683 from DarkLordZach/lock-exitDavid2019-09-226-7/+48
|\ \
| * | qt: Prompt user for confirmation if exit lock is activeZach Hilman2019-09-221-1/+1
| * | am: Implement ISelfController ExitLock commandsZach Hilman2019-09-221-2/+6
| * | am: Implement ISelfController ExitZach Hilman2019-09-224-4/+20
| * | am: Add RequestExit event to AppletMessageQueueZach Hilman2019-09-222-0/+6
| * | core: Track system exit lock statusZach Hilman2019-09-222-0/+15
* | | Merge pull request #2876 from ogniK5377/AcquireNpadStyleSetUpdateEventHandle-fixZach Hilman2019-09-223-11/+18
|\ \ \
| * | | removed commentDavid Marcec2019-09-221-1/+0
| * | | RebasedDavid Marcec2019-09-223-11/+19
* | | | Merge pull request #2895 from FearlessTobi/debug-logsDavid2019-09-221-7/+7
|\ \ \ \
| * | | | service/acc: Lower log severity from INFO to DEBUGFearlessTobi2019-09-221-7/+7
* | | | | Merge pull request #2873 from ogniK5377/new-ioctlsFernando Sahmkow2019-09-2224-73/+153
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | server side clang format fix2David Marcec2019-09-221-18/+18
| * | | | Use clang-format provided by build serverDavid Marcec2019-09-221-20/+18
| * | | | disable clang-format tempDavid Marcec2019-09-201-0/+2
| * | | | Initial implementation of Ioctl2 & Ioctl3David Marcec2019-09-1924-63/+143
* | | | | Merge pull request #2884 from ogniK5377/deglobal-sys-servicesFernando Sahmkow2019-09-2264-212/+291
|\ \ \ \ \
| * | | | | removed unneeded semicolonDavid Marcec2019-09-221-1/+1
| * | | | | Removed reference to core timing to nvflinger and used system insteadDavid Marcec2019-09-221-1/+1
| * | | | | marked controller constructors as explicitDavid Marcec2019-09-228-8/+8
| * | | | | RebaseDavid Marcec2019-09-2225-62/+75
| * | | | | RebaseDavid Marcec2019-09-225-20/+21
| * | | | | Deglobalize System: ViDavid Marcec2019-09-223-8/+8
| * | | | | Deglobalize System: TimeDavid Marcec2019-09-224-14/+21
| * | | | | RebaseDavid Marcec2019-09-222-8/+12
| * | | | | Deglobalize System: NvFlingerDavid Marcec2019-09-222-6/+7
| * | | | | RebaseDavid Marcec2019-09-224-8/+12
| * | | | | Deglobalize System: NimDavid Marcec2019-09-222-7/+12
| * | | | | Deglobalize System: NifmDavid Marcec2019-09-222-13/+23
| * | | | | Deglobalize System: NFPDavid Marcec2019-09-224-14/+16
| * | | | | Deglobalize System: LDRDavid Marcec2019-09-222-6/+7
| * | | | | Deglobalize System: IRSDavid Marcec2019-09-223-5/+6
| * | | | | Deglobalize System: HidDavid Marcec2019-09-2220-37/+44
| * | | | | Deglobalize System: FriendDavid Marcec2019-09-224-22/+24
| * | | | | Deglobalize System: FatalDavid Marcec2019-09-226-20/+29
| * | | | | Deglobalize System: BtmDavid Marcec2019-09-222-7/+13
| * | | | | Deglobalize System: BtdrvDavid Marcec2019-09-222-5/+9
| * | | | | Deglobalize System: AocDavid Marcec2019-09-222-11/+13
| * | | | | Deglobalize System: AmDavid Marcec2019-09-221-1/+1
* | | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"David Marcec2019-09-2218-73477/+123
|/ / / / /
* | | | | Merge pull request #2535 from DarkLordZach/cheat-v2David2019-09-2213-760/+1960
|\ \ \ \ \
| * | | | | dmnt_cheat_vm: Default initialize structure valuesZach Hilman2019-09-223-89/+88
| * | | | | dmnt_cheat_vm: Make Cheat VM compliant to code styleZach Hilman2019-09-224-870/+862
| * | | | | core: Initialize cheats after load to avoid VMManager crashZach Hilman2019-09-221-0/+5
| * | | | | core: Update RegisterCheatList for new VMZach Hilman2019-09-222-11/+16
| * | | | | patch_manager: Update cheat parsing for new VMZach Hilman2019-09-222-15/+20
| * | | | | nso: Pass build ID directlyZach Hilman2019-09-221-2/+1
| * | | | | cheat_engine: Move to memory and strip VMZach Hilman2019-09-225-728/+325
| * | | | | memory: Port Atmosphere's DmntCheatVmZach Hilman2019-09-223-0/+1598
* | | | | | Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1David2019-09-2218-123/+73477
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | pl_u: Use kernel physical memoryZach Hilman2019-09-222-4/+8
| * | | | | pl_u: Remove excess static qualifierZach Hilman2019-09-221-1/+1
| * | | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-09-223-111/+42
| * | | | | system_archive: Synthesize shared fonts system archivesZach Hilman2019-09-223-5/+101
| * | | | | pl_u: Expose method to encrypt TTF to BFTTFZach Hilman2019-09-222-14/+14
| * | | | | externals: Move OSS font data to file_sys in coreZach Hilman2019-09-2213-1/+73324
| | |_|/ / | |/| | |
* | | | | Merge pull request #2612 from DarkLordZach/prepo-newDavid2019-09-225-30/+99
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | prepo: Remove system global accessorsZach Hilman2019-09-223-15/+18
| * | | | prepo: Implement SaveReport New and System variantsZach Hilman2019-09-221-15/+71
| * | | | reporter: Differentiate between Old, New, and System play reportsZach Hilman2019-09-222-5/+15
| |/ / /
* | | | configure_debug: Move reporting option to loggingZach Hilman2019-09-229-18/+19
* | | | filesystem: Add const qualification to various accessorsZach Hilman2019-09-219-80/+91
* | | | core: Store FileSystemController in coreZach Hilman2019-09-212-0/+32
* | | | settings: Add options for managing gamecard emulationZach Hilman2019-09-211-2/+3
* | | | settings: Add options for setting storage sizesZach Hilman2019-09-211-0/+29
* | | | yuzu: Port old usages of Filesystem namespace to FilesystemControllerZach Hilman2019-09-2112-31/+78
* | | | settings: Update LogSettings to show NAND/SDMC paths from FileUtilZach Hilman2019-09-211-2/+3
* | | | card_image: Add accessors for gamecard certificateZach Hilman2019-09-212-0/+9
* | | | card_image: Add functions to query gamecard update partitionZach Hilman2019-09-212-0/+24
* | | | content_archive: Add accessors for Rights ID and SDK VersionZach Hilman2019-09-212-0/+10
* | | | partition_data_manager: Add accessor for decrypted PRODINFO partitionZach Hilman2019-09-212-0/+5
* | | | services: Pass FileSystemController as reference to services that need itZach Hilman2019-09-2111-20/+47
* | | | am: Unstub IApplicationFunctions EnsureSaveData (20)Zach Hilman2019-09-211-8/+14
* | | | filesystem: Pass Size Getter functions to IFileSystem for sizesZach Hilman2019-09-213-20/+31
* | | | sdmc_factory: Add SD Card size gettersZach Hilman2019-09-212-0/+12
* | | | bis_factory: Add getters for NAND partition sizesZach Hilman2019-09-212-0/+38
* | | | filesystem: Add FileSystemController to deglobalize FS servicesZach Hilman2019-09-212-58/+359
* | | | submisson_package: Fix edge case with improperly sized filenamesZach Hilman2019-09-211-1/+2
* | | | sdmc_factory: Add accessor for SDMC Album directoryZach Hilman2019-09-212-0/+6
* | | | sdmc_factory: Add accessor for SDMC PlaceholderCacheZach Hilman2019-09-212-1/+10
* | | | sdmc_factory: Add accessor for content directoryZach Hilman2019-09-212-0/+7
* | | | savedata_factory: Implement savedata creation and don't create dir on openZach Hilman2019-09-212-26/+40
* | | | patch_manager: Add short-circuit edge-case to GetPatchVersionNamesZach Hilman2019-09-211-0/+2
* | | | patch_manager: Add error checking to load dir to prevent crashesZach Hilman2019-09-211-0/+15
* | | | registered_cache: Process *.cnmt.nca filesZach Hilman2019-09-211-16/+23
* | | | registered_cache: Implement PlaceholderCache to manage placeholder and installing contentZach Hilman2019-09-212-0/+175
* | | | bis_factory: Fix mod loader edge-case with homebrew title IDsZach Hilman2019-09-211-1/+1
* | | | bis_factory: Add accessors for BIS placeholder cachesZach Hilman2019-09-212-1/+20
* | | | bis_factory: Add accessor for NAND Image DirectoryZach Hilman2019-09-212-0/+6
* | | | bis_factory: Add accessors for BIS content directoriesZach Hilman2019-09-212-0/+11
* | | | bis_factory: Add accessors for BIS partitionsZach Hilman2019-09-212-0/+61
|/ / /
* | | Merge pull request #2806 from FearlessTobi/port-4882David2019-09-214-10/+84
|\ \ \
| * | | Address review commentsFearlessTobi2019-09-102-6/+9
| * | | Add frametime logging for tracking performance over timefearlessTobi2019-09-104-10/+81
* | | | Merge pull request #2872 from FernandoS27/mem-gpu-optDavid2019-09-211-2/+7
|\ \ \ \
| * | | | Core/Memory: Only FlushAndInvalidate GPU if the page is marked as RasterizerCachedMemoryFernando Sahmkow2019-09-191-2/+7
| | |/ / | |/| |
* | | | Merge pull request #2576 from DarkLordZach/nsp-fix-1David2019-09-212-14/+39
|\ \ \ \
| * | | | nsp: Correct status codes for extracted NSPsZach Hilman2019-06-102-13/+17
| * | | | nsp: Use title ID from NPDM metadata for extracted type NSPsZach Hilman2019-06-102-1/+22
| | |_|/ | |/| |
* | | | Mark KickOffPb & SubmitGPFIFO as traceDavid Marcec2019-09-211-4/+4
| |/ / |/| |
* | | Merge pull request #2667 from DarkLordZach/profile-editorbunnei2019-09-145-10/+130
|\ \ \ | |_|/ |/| |
| * | acc_su: Implement GetProfileEditor (205)Zach Hilman2019-07-033-1/+13
| * | acc: Implement IProfileEditor-specific commands 'Store' and 'StoreWithImage'Zach Hilman2019-07-031-1/+73
| * | profile_manager: Add setter for ProfileBase and ProfileDataZach Hilman2019-07-032-0/+13
| * | acc: Add IProfileCommon for IProfile and IProfileEditorZach Hilman2019-07-031-8/+31
* | | Merge pull request #2847 from VelocityRa/nro-nacp-fixDavid2019-09-092-0/+10
|\ \ \
| * | | nro: Implement ReadControlDataNick Renieris2019-09-072-0/+10
* | | | Merge pull request #2716 from lioncash/hle-globalDavid2019-09-0917-97/+143
|\ \ \ \
| * | | | service/am: Remove usages of global system accessorsLioncash2019-09-0517-97/+143
* | | | | Merge pull request #2763 from lioncash/map-physDavid2019-09-092-39/+41
|\ \ \ \ \
| * | | | | kernel/vm_manager: Correct doxygen comment parameter tags for MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-4/+4
| * | | | | kernel/vm_manager: Move variables closer to usage spots in MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-16/+10
| * | | | | kernel/vm_manager: Correct behavior in failure case of UnmapPhysicalMemory()Lioncash2019-08-301-0/+2
| * | | | | kernel/vm_manager: Reserve memory ahead of time for slow path in MergeAdjacentVMALioncash2019-08-301-1/+4
| * | | | | kernel/vm_manager: std::move shared_ptr instance in MergeAdjacentVMALioncash2019-08-301-1/+1
| * | | | | kernel/vm_manager: Deduplicate iterator creation in MergeAdjacentVMALioncash2019-08-301-7/+10
| * | | | | kernel/vm_manager: Simplify some std::vector constructor callsLioncash2019-08-301-2/+2
| * | | | | kernel/vm_manager: Simplify some assertion messagesLioncash2019-08-301-10/+10
| | |/ / / | |/| | |
* | | | | Merge pull request #2418 from DarkLordZach/srv-esDavid2019-09-053-51/+536
|\ \ \ \ \
| * | | | | key_manager: Convert Ticket union to std::variantZach Hilman2019-07-083-57/+88
| * | | | | es: Populate/synthesize tickets on constructionZach Hilman2019-07-083-15/+17
| * | | | | key_manager: Add structure for Ticket parsingZach Hilman2019-07-083-44/+194
| * | | | | es: Implement ETicket GetPersonalizedTicketData (17)Zach Hilman2019-07-081-1/+21
| * | | | | es: Implement ETicket GetCommonTicketData (16)Zach Hilman2019-07-081-1/+20
| * | | | | es: Implement ETicket GetPersonalizedTicketSize (15)Zach Hilman2019-07-081-1/+17
| * | | | | es: Implement ETicket GetCommonTicketSize (14)Zach Hilman2019-07-081-1/+17
| * | | | | es: Implement ETicket ListPersonalizedTicket (12)Zach Hilman2019-07-081-1/+24
| * | | | | es: Implement ETicket ListCommonTicket (11)Zach Hilman2019-07-081-1/+24
| * | | | | es: Implement ETicket CountPersonalizedTicket (10)Zach Hilman2019-07-081-1/+12
| * | | | | es: Implement ETicket CountCommonTicket (9)Zach Hilman2019-07-081-1/+12
| * | | | | es: Implement ETicket GetTitleKey (8)Zach Hilman2019-07-081-1/+27
| * | | | | es: Implement ETicket ImportTicket (1)Zach Hilman2019-07-081-1/+45
| * | | | | key_manager: Add accessors/helpers for ticket managementZach Hilman2019-07-082-14/+100
| * | | | | key_manager: Add equality operator for RSAKeyPairZach Hilman2019-07-081-0/+7
* | | | | | Merge pull request #2707 from DarkLordZach/oss-miimodelDavid2019-09-054-1/+63
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | system_archive: Add open-source reimplementation of MiiModel dataZach Hilman2019-07-104-1/+63
* | | | | | Merge pull request #2834 from Morph1984/audrenu_QueryAudioDeviceInputEventDavid2019-09-051-1/+15
|\ \ \ \ \ \
| * | | | | | Add Kernel::EventPair audio_input_device_switch_event;Morph19842019-09-041-0/+1
| * | | | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEventMorph19842019-09-041-1/+14
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2836 from Morph1984/hid_vibrationDavid2019-09-054-2/+32
|\ \ \ \ \ \
| * | | | | | dittoMorph19842019-09-041-1/+1
| * | | | | | IsVibrationEnabled() as a const member funcMorph19842019-09-041-1/+1
| * | | | | | clang-formatMorph19842019-09-041-2/+2
| * | | | | | Update npad.hMorph19842019-09-041-0/+1
| * | | | | | Update npad.cppMorph19842019-09-041-0/+6
| * | | | | | Update hid.hMorph19842019-09-041-0/+2
| * | | | | | Update hid.cppMorph19842019-09-041-2/+23
| |/ / / / /
* | | | | | Merge pull request #2818 from MysticExile/fmtDavid2019-09-052-2/+2
|\ \ \ \ \ \
| * | | | | | Fix clang-formatEthan2019-09-041-1/+1
| * | | | | | accommodate for fmt updateEthan2019-08-292-2/+2
| |/ / / / /
* | | | | | AM: Stub IApplicationFunctions::GetGpuErrorDetectedSystemEvent (#2827)mailwl2019-09-042-0/+16
* | | | | | Merge pull request #2829 from Morph1984/audiobunnei2019-09-041-2/+15
|\ \ \ \ \ \
| * | | | | | remove <f32>Morph19842019-09-041-1/+1
| * | | | | | explicitly represent 1 as a float (1.0f instead of 1)Morph19842019-09-041-1/+1
| * | | | | | Change u32 -> f32Morph19842019-09-041-1/+1
| * | | | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolumeMorph19842019-09-031-2/+15
| |/ / / / /
* | | | | | Merge pull request #2708 from DarkLordZach/mii-db-source-crashDavid2019-09-041-0/+4
|\ \ \ \ \ \
| * | | | | | mii: Handle logging of unknown database sourceZach Hilman2019-07-101-0/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2793 from ReinUsesLisp/bgr565bunnei2019-09-041-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gpu: Change optional<reference_wrapper<T>> to T* for FramebufferConfigReinUsesLisp2019-08-211-1/+1
* | | | | | Merge pull request #2748 from FernandoS27/align-memorybunnei2019-08-2114-37/+59
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Kernel: Address FeedbackFernando Sahmkow2019-07-192-3/+9
| * | | | | VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-1914-36/+52
* | | | | | Merge pull request #2747 from lioncash/audiobunnei2019-08-187-108/+179
|\ \ \ \ \ \
| * | | | | | service/audren_u: Handle audio USB output revision queries in ListAudioDeviceName()Lioncash2019-07-192-16/+45
| * | | | | | service/audren_u: Move revision testing code out of AudRenULioncash2019-07-192-63/+63
| * | | | | | service/audio: Remove global system accessorsLioncash2019-07-197-34/+54
| * | | | | | service/audren_u: Remove unnecessary return value from GetActiveAudioDeviceName()Lioncash2019-07-191-2/+1
| * | | | | | service/audren_u: Report proper device namesLioncash2019-07-191-6/+29
| |/ / / / /
* | | | | | Merge pull request #2592 from FernandoS27/sync1bunnei2019-07-2635-170/+627
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | NVServices: Correct delayed responses.Fernando Sahmkow2019-07-051-24/+19
| * | | | | Nv_Host_Ctrl: Correct difference calculationFernando Sahmkow2019-07-051-5/+7
| * | | | | NVServices: Address FeedbackFernando Sahmkow2019-07-058-21/+38
| * | | | | NVServices: Styling, define constructors as explicit and correctionsFernando Sahmkow2019-07-0520-41/+49
| * | | | | NVFlinger: Correct GCC compile errorFernando Sahmkow2019-07-056-17/+16
| * | | | | NVServices: Make NVEvents Automatic according to documentation.Fernando Sahmkow2019-07-052-4/+7
| * | | | | NVServices: Correct CtrlEventWaitSync to block the ipc until timeout.Fernando Sahmkow2019-07-0523-31/+104
| * | | | | GPU: Correct Interrupts to interrupt on syncpt/value instead of event, mirroring hardwareFernando Sahmkow2019-07-057-19/+22
| * | | | | nvflinger: Make the force 30 fps still force 30 fpsFernando Sahmkow2019-07-051-1/+1
| * | | | | nv_services: Fixes to event liberation.Fernando Sahmkow2019-07-051-6/+14
| * | | | | nvflinger: Acquire buffers in the same order as they were queued.Fernando Sahmkow2019-07-052-3/+11
| * | | | | nv_services: Deglobalize NvServicesFernando Sahmkow2019-07-0523-51/+65
| * | | | | nv_host_ctrl: Make Sync GPU variant always return synced result.Fernando Sahmkow2019-07-051-0/+5
| * | | | | nvhost_ctrl: Corrections to event handlingFernando Sahmkow2019-07-052-8/+12
| * | | | | Gpu: Mark areas as protected.Fernando Sahmkow2019-07-051-0/+6
| * | | | | nv_services: Stub CtrlEventSignalFernando Sahmkow2019-07-052-12/+34
| * | | | | Gpu: Implement Hardware Interrupt Manager and manage GPU interruptsFernando Sahmkow2019-07-058-9/+69
| * | | | | nv_services: Implement NvQueryEvent, NvCtrlEventWait, NvEventRegister, NvEventUnregisterFernando Sahmkow2019-07-057-17/+192
| * | | | | nv_services: Create GPU channels correctlyFernando Sahmkow2019-07-052-2/+5
| * | | | | video_core: Implement GPU side SyncpointsFernando Sahmkow2019-07-053-7/+33
| * | | | | nv_services: Correct buffer queue fencing and GPFifo fencingFernando Sahmkow2019-07-058-57/+70
| * | | | | nvflinger: Implement swap intervalsFernando Sahmkow2019-07-055-8/+21
* | | | | | Merge pull request #2687 from lioncash/tls-processbunnei2019-07-183-14/+30
|\ \ \ \ \ \
| * | | | | | kernel/process: Allocate the process' TLS region during initializationLioncash2019-07-073-3/+14
| * | | | | | kernel/process: Move main thread stack allocation to its own functionLioncash2019-07-072-12/+17
| | |_|/ / / | |/| | | |
* | | | | | Kernel: Downgrade WaitForAddress and SignalToAddress messages to Trace.Fernando Sahmkow2019-07-181-4/+4
* | | | | | Merge pull request #2726 from lioncash/accessRodrigo Locatti2019-07-172-7/+6
|\ \ \ \ \ \
| * | | | | | core: Remove CurrentArmInterface() global accessorLioncash2019-07-132-7/+6
* | | | | | | Merge pull request #2690 from SciresM/physmem_fixesFernando Sahmkow2019-07-148-41/+477
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Remove unicorn mappings/unmappingsMichael Scire2019-07-121-19/+0
| * | | | | | Prevent merging of device mapped memory blocks.Michael Scire2019-07-091-0/+5
| * | | | | | Remove unused member function declarationMichael Scire2019-07-071-9/+0
| * | | | | | physmem: add helpers, cleanup logic.Michael Scire2019-07-072-171/+170
| * | | | | | clang-format fixesMichael Scire2019-07-072-3/+3
| * | | | | | address review commentaryMichael Scire2019-07-075-36/+42
| * | | | | | Implement MapPhysicalMemory/UnmapPhysicalMemoryMichael Scire2019-07-078-21/+475
| |/ / / / /
* | | | | | Clang formatDavid Marcec2019-07-121-2/+4
* | | | | | "AudioRenderer" thread should have a unique nameDavid Marcec2019-07-122-4/+4
* | | | | | Merge pull request #2717 from SciresM/unmirror_memorybunnei2019-07-112-7/+34
|\ \ \ \ \ \
| * | | | | | Restore memory perms on svcUnmapMemory/UnloadNroMichael Scire2019-07-112-7/+34
* | | | | | | Merge pull request #2723 from lioncash/membunnei2019-07-1110-67/+6
|\ \ \ \ \ \ \
| * | | | | | | yuzu: Remove setting for using UnicornLioncash2019-07-114-16/+6
| * | | | | | | core/arm: Remove obsolete Unicorn memory mappingLioncash2019-07-116-51/+0
| |/ / / / / /
* | | | | | | service/am: Implement IsAutoSleepDisabledLioncash2019-07-112-1/+10
* | | | | | | service/am: Implement SetAutoSleepDisabledLioncash2019-07-112-1/+23
|/ / / / / /
* | | | | | Merge pull request #2700 from ogniK5377/GetFriendListbunnei2019-07-101-1/+34
|\ \ \ \ \ \
| * | | | | | IFriendService::GetFriendListDavid Marcec2019-07-091-1/+34
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2611 from DarkLordZach/pm-info-cmdbunnei2019-07-103-16/+116
|\ \ \ \ \ \
| * | | | | | pm: Implement pm:shell and pm:dmnt GetApplicationPidZach Hilman2019-06-273-7/+33
| * | | | | | pm: Implement pm:dmnt GetTitlePidZach Hilman2019-06-271-7/+36
| * | | | | | pm: Implement pm:info GetTitleIdZach Hilman2019-06-271-2/+47
* | | | | | | Merge pull request #2650 from DarkLordZach/mii-iface-verbunnei2019-07-101-1/+15
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | mii: Implement IDatabaseService SetInterfaceVersionZach Hilman2019-07-071-1/+15
* | | | | | | Merge pull request #2657 from ogniK5377/npad-assignmentsZach Hilman2019-07-086-3/+100
|\ \ \ \ \ \ \
| * | | | | | | addressed issuesDavid Marcec2019-07-081-6/+7
| * | | | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignmentDavid Marcec2019-07-016-3/+99
* | | | | | | | Merge pull request #2651 from DarkLordZach/apm-boost-mode-1bunnei2019-07-0814-57/+258
|\ \ \ \ \ \ \ \
| * | | | | | | | am: Implement SetCpuBoostMode in terms of APMZach Hilman2019-06-295-13/+26
| * | | | | | | | core: Keep instance of APM ControllerZach Hilman2019-06-292-0/+20
| * | | | | | | | apm: Implement SetCpuBoostModeZach Hilman2019-06-292-0/+14
| * | | | | | | | apm: Add getters for performance config and modeZach Hilman2019-06-292-33/+49
| * | | | | | | | apm: Add apm:am serviceZach Hilman2019-06-292-11/+9
| * | | | | | | | apm: Add Controller class to manage speed data and applicationZach Hilman2019-06-293-0/+140
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2642 from DarkLordZach/fsp-log-2bunnei2019-07-089-28/+99
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | fsp-srv: Implement GetAccessLogVersionInfoZach Hilman2019-06-292-3/+14
| * | | | | | | reporter: Add report class for filesystem access logsZach Hilman2019-06-292-0/+25
| * | | | | | | fsp-srv: Implement OutputAccessLogToSdCardZach Hilman2019-06-297-27/+62
| |/ / / / / /
* | | | | | | Merge pull request #2674 from lioncash/reporterZach Hilman2019-07-072-15/+35
|\ \ \ \ \ \ \
| * | | | | | | core/reporter: Allow moves into SaveToFile()Lioncash2019-07-051-1/+1
| * | | | | | | core/reporter: Add missing includes and forward declarationsLioncash2019-07-052-1/+9
| * | | | | | | core/reporter: Remove unnecessary namespace qualifiersLioncash2019-07-052-3/+3
| * | | | | | | core/reporter: Remove pessimizing move in GetHLERequestContextData()Lioncash2019-07-051-1/+1
| * | | | | | | core/reporter: Make bracing consistentLioncash2019-07-051-8/+18
| * | | | | | | core/reporter: Return in error case in SaveToFile()Lioncash2019-07-051-1/+3
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2677 from lioncash/assertZach Hilman2019-07-075-43/+48
|\ \ \ \ \ \ \
| * | | | | | | memory: Remove unused includesLioncash2019-07-061-2/+0
| * | | | | | | memory: Remove unused PageTable forward declarationLioncash2019-07-061-4/+0
| * | | | | | | kernel/vm_manager: Rename 'new map' to 'stack'Lioncash2019-07-063-37/+37
| * | | | | | | kernel/vm_manager: Handle stack/TLS IO region placement betterLioncash2019-07-061-2/+13
| |/ / / / / /
* | | | | | | clang-format fixesMichael Scire2019-07-061-4/+5
* | | | | | | am: Implement GetAccumulatedSuspendedTickValueMichael Scire2019-07-062-7/+19
|/ / / / / /
* | | | | | Merge pull request #2669 from FearlessTobi/move-cpujit-settingZach Hilman2019-07-044-5/+5
|\ \ \ \ \ \
| * | | | | | yuzu: Remove CPU Jit setting from the UIfearlessTobi2019-07-044-5/+5
* | | | | | | Merge pull request #2555 from lioncash/tlsZach Hilman2019-07-046-81/+148
|\ \ \ \ \ \ \
| * | | | | | | kernel/process: Default initialize all member variablesLioncash2019-07-041-2/+2
| * | | | | | | kernel/process: Decouple TLS handling from threadsLioncash2019-07-044-66/+97
| * | | | | | | kernel/vm_manager: Add overload of FindFreeRegion() that operates on a boundaryLioncash2019-07-042-13/+49
* | | | | | | | Merge pull request #2658 from ogniK5377/QueryAudioDeviceOutputEventbunnei2019-07-041-3/+16
|\ \ \ \ \ \ \ \
| * | | | | | | | IAudioDevice::QueryAudioDeviceOutputEventDavid Marcec2019-07-011-3/+16
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2638 from DarkLordZach/quest-flagbunnei2019-07-043-1/+11
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | set: Implement GetQuestFlagZach Hilman2019-06-292-1/+10
| * | | | | | | settings: Add config option for kiosk (quest) modeZach Hilman2019-06-291-0/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2613 from ogniK5377/InitalizeApplicationInfoZach Hilman2019-07-045-6/+110
|\ \ \ \ \ \ \
| * | | | | | | Added errors.h to cmakelistDavid Marcec2019-06-281-0/+1
| * | | | | | | Addressed issuesDavid Marcec2019-06-282-17/+12
| * | | | | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestrictedDavid Marcec2019-06-274-6/+114
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2608 from ogniK5377/Time_GetSharedMemoryNativeHandleZach Hilman2019-07-048-28/+260
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | Addressed issuesDavid Marcec2019-06-265-37/+53
| * | | | | | Implement Time::GetSharedMemoryNativeHandleDavid Marcec2019-06-258-29/+245
* | | | | | | Merge pull request #2604 from ogniK5377/INotificationServicebunnei2019-07-035-1/+130
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | Attemp clang format fix?David Marcec2019-06-281-1/+0
| * | | | | | Addressed issuesDavid Marcec2019-06-282-13/+13
| * | | | | | SizedNotificationInfo should be 0x10 bytes, user_uuid is incorrect, this should be the users account idDavid Marcec2019-06-251-1/+3
| * | | | | | fixed spelling errors and fixed issue with Pop not returning the SizedNotificationInfoDavid Marcec2019-06-251-6/+8
| * | | | | | Implemented INotificationServiceDavid Marcec2019-06-245-1/+127
| |/ / / / /
* | | | | | file_sys: Rename other ContentRecordType membersBakugo2019-07-025-7/+8
* | | | | | file_sys/registered_cache: Improve missing metadata errorBakugo2019-07-011-2/+2
* | | | | | file_sys/submission_package: Don't warn about missing DeltaFragment NCAsBakugo2019-07-011-4/+7
* | | | | | file_sys/registered_cache: Ignore DeltaFragment NCAs during installationBakugo2019-07-011-0/+3
* | | | | | file_sys: Rename ContentRecordType::Patch to DeltaFragmentBakugo2019-07-011-1/+1
| |_|_|/ / |/| | | |
* | | | | Merge pull request #2583 from FernandoS27/core-timing-safebunnei2019-06-303-49/+14
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Core_Timing: Make core_timing threadsafe by default.Fernando Sahmkow2019-06-163-49/+14
* | | | | Merge pull request #2533 from DarkLordZach/memory-frozenbunnei2019-06-284-0/+274
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | freezer: Update documentationZach Hilman2019-06-211-1/+8
| * | | | core: Move Freezer class to tools namespaceZach Hilman2019-06-214-17/+17
| * | | | freezer: Add documentation for methodsZach Hilman2019-06-212-30/+49
| * | | | memory: Add class to manage and enforce memory freezingZach Hilman2019-06-214-0/+248
* | | | | Merge pull request #2548 from DarkLordZach/applet-shopnbunnei2019-06-2617-120/+879
|\ \ \ \ \
| * | | | | applets: Pass current process title ID to appletsZach Hilman2019-06-2511-41/+59
| * | | | | general_frontend: Add documentation for parental controls and ecommerce appletsZach Hilman2019-06-254-20/+48
| * | | | | web_browser: Only delete temporary directory if it was createdZach Hilman2019-06-251-1/+3
| * | | | | web_browser: Take ECommerce applet frontend optionally in constructorZach Hilman2019-06-251-1/+6
| * | | | | frontend: Add base class and default impl for ECommerce applet frontendZach Hilman2019-06-252-0/+102
| * | | | | web_browser: Use function tables for execute and initializeZach Hilman2019-06-252-7/+285
| * | | | | web_browser: Correct structures and properly parse TLVs/ShimKindZach Hilman2019-06-252-61/+168
| * | | | | applets: Track ECommerce and Parental Control applet frontendsZach Hilman2019-06-252-7/+29
| * | | | | web_browser: Rename OpenPage to OpenPageLocalZach Hilman2019-06-252-7/+7
| * | | | | frontend: Add base class and default impl of parent controls applet frontendZach Hilman2019-06-252-1/+52
| * | | | | applets: Implement Auth applet backendZach Hilman2019-06-252-0/+146
| | |_|/ / | |/| | |
* | | | | glue: Correct missing bytes in ApplicationLaunchParameterZach Hilman2019-06-267-37/+71
* | | | | core: Keep track of ARPManager and register current application on bootZach Hilman2019-06-252-0/+76
* | | | | glue: Implement arp:w and arp:r servicesZach Hilman2019-06-253-2/+330
* | | | | glue: Add errors for glue/arp servicesZach Hilman2019-06-254-2/+65
* | | | | glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
* | | | | arp: Move to glue servicesZach Hilman2019-06-252-91/+0
* | | | | glue: Add manager to keep track of application registryZach Hilman2019-06-253-0/+121
* | | | | registered_cache: Add getter to determine source slot in content provider unionZach Hilman2019-06-252-0/+17
* | | | | patch_manager: Add getter for title versionZach Hilman2019-06-252-2/+14
|/ / / /
* | | | Update reporter.cppThomas May2019-06-221-5/+5
* | | | Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\ \ \ \
| * | | | service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
| |/ / /
* | | | Merge pull request #2575 from DarkLordZach/process-id-typesbunnei2019-06-215-9/+27
|\ \ \ \
| * | | | kernel: Differentiate kernel and user processes when picking IDZach Hilman2019-06-105-9/+27
| | |_|/ | |/| |
* | | | Merge pull request #2546 from DarkLordZach/kipsbunnei2019-06-2110-119/+521
|\ \ \ \
| * | | | kernel_executable: Optimize BLZ decompressionZach Hilman2019-06-072-10/+13
| * | | | game_list: Accept *.kip as a file extension of executablesZach Hilman2019-06-051-1/+1
| * | | | loader: Add recognition for KIP file typeZach Hilman2019-06-052-0/+11
| * | | | loader: Add KIP and INI file parser-specific errorsZach Hilman2019-06-052-1/+9
| * | | | loader: Add AppLoader_KIP for KIP filesZach Hilman2019-06-053-0/+135
| * | | | program_metadata: Add function to load meta from raw parametersZach Hilman2019-06-052-0/+20
| * | | | partition_data_manager: Remove KIP processing and use FileSysZach Hilman2019-06-051-118/+13
| * | | | file_sys: Add classes to parse KIP1 and INI1 filesZach Hilman2019-06-053-0/+330
* | | | | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-2130-53/+796
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-2621-70/+135
| * | | | prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| * | | | fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| * | | | service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| * | | | applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| * | | | applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
| * | | | svc: Save report on call to svcBreakZach Hilman2019-05-251-1/+7
| * | | | core: Add Reporter class to take/save reportsZach Hilman2019-05-255-1/+416
| * | | | settings: Add 'Reporting Services' config optionZach Hilman2019-05-251-0/+1
| * | | | arm_interface: Expand backtrace generationZach Hilman2019-05-252-7/+194
| * | | | core: Track load offsets of NSO modulesZach Hilman2019-05-253-0/+18
* | | | | Merge pull request #2596 from FernandoS27/revert-2590bunnei2019-06-201-1/+1
|\ \ \ \ \
| * | | | | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
* | | | | | Merge pull request #2595 from jonsn0w/patch-1Hexagon122019-06-201-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Update content_archive.cppjonsn0w2019-06-201-2/+2
* | | | | | Merge pull request #2591 from lioncash/recordbunnei2019-06-204-398/+0
|\ \ \ \ \ \
| * | | | | | core: Remove unused CiTrace source filesLioncash2019-06-184-398/+0
* | | | | | | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
| |/ / / / /
* | | | | | Addressed issuesDavid Marcec2019-06-174-9/+14
* | | | | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
* | | | | | CleanupDavid Marcec2019-06-1611-29/+38
* | | | | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-168-8/+79
* | | | | | Merge pull request #2581 from lioncash/hexZach Hilman2019-06-159-28/+33
|\ \ \ \ \ \
| * | | | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-129-28/+33
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2582 from lioncash/reservedbunnei2019-06-141-1/+0
|\ \ \ \ \ \
| * | | | | | file_sys/ips_layer: Remove unnecessary reserve() callLioncash2019-06-131-1/+0
| |/ / / / /
* | | | | | Merge pull request #2580 from lioncash/redundantZach Hilman2019-06-131-3/+1
|\ \ \ \ \ \
| * | | | | | kernel/vm_manager: Remove redundant Reset call in destructorLioncash2019-06-121-3/+1
| |/ / / / /
* | | | | | Merge pull request #2577 from lioncash/fsZach Hilman2019-06-131-17/+29
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | file_sys/card_image: Remove obsolete TODOLioncash2019-06-121-1/+1
| * | | | | file_sys/card_image: Deduplicate casts within AddNCAFromPartition()Lioncash2019-06-111-3/+6
| * | | | | file_sys/card_image: Make bracing consistentLioncash2019-06-111-4/+8
| * | | | | file_sys/card_image: Assign collapsed NCA contents directly to ncas memberLioncash2019-06-111-3/+1
| * | | | | file_sys/card_image: Deduplicate type castLioncash2019-06-111-4/+6
| * | | | | file_sys/card_image: Get rid of a magic numberLioncash2019-06-111-1/+1
| * | | | | file_sys/card_image: Use std::array deduction guidesLioncash2019-06-111-1/+6
| | |_|_|/ | |/| | |
* / | | | file_sys/nca_metadata: Update CNMT structuresLioncash2019-06-111-2/+7
|/ / / /
* | | | Merge pull request #2571 from lioncash/refZach Hilman2019-06-102-2/+2
|\ \ \ \
| * | | | kernel/process: Make Create()'s name parameter be taken by valueLioncash2019-06-102-2/+2
| |/ / /
* | | | kernel/svc: Implement TotalMemoryUsedWithoutMmHeap/TotalMemoryAvailableWithoutMmHeapLioncash2019-06-103-2/+42
* | | | kernel/svc: Amend naming for TotalMemoryUsage in svcGetInfo()Lioncash2019-06-103-6/+6
* | | | kernel/svc: Remove duplicate enum entry in svcGetInfo()Lioncash2019-06-101-2/+1
|/ / /
* | | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-074-16/+40
* | | Merge pull request #2514 from ReinUsesLisp/opengl-compatZach Hilman2019-06-072-2/+0
|\ \ \
| * | | rasterizer_opengl: Remove OpenGL core profileReinUsesLisp2019-05-302-2/+0
* | | | Merge pull request #2549 from lioncash/headerZach Hilman2019-06-061-1/+0
|\ \ \ \
| * | | | kernel/process: Remove unused boost header includeLioncash2019-06-051-1/+0
| | |_|/ | |/| |
* | | | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \ \ \
| * | | | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
* | | | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| * | | | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| * | | | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
* | | | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-057-66/+97
|\ \ \ \ \
| * | | | | core/core: Remove unnecessary includesLioncash2019-05-293-13/+37
| * | | | | core/loader: Remove LoadKernelSystemModeLioncash2019-05-293-21/+0
| * | | | | core/telemetry_session: Remove unnecessary web service nulling out in destructorLioncash2019-05-291-2/+1
| * | | | | core/telemetry_session: Remove usages of the global system accessorLioncash2019-05-293-30/+54
| * | | | | core/telemetry_session: Explicitly delete copy and move constructorsLioncash2019-05-291-1/+7
| * | | | | core/telemetry_session: Remove unused includeLioncash2019-05-291-1/+0
| |/ / / /
* | | | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-055-76/+34
|\ \ \ \ \
| * | | | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-053-6/+6
| * | | | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-055-34/+39
| * | | | | core/core_timing_utils: Simplify overload setLioncash2019-06-052-49/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-0510-402/+1081
|\ \ \ \ \
| * | | | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| * | | | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| * | | | | Address review commentsMichael Scire2019-05-236-47/+120
| * | | | | clang-format fixesMichael Scire2019-05-234-31/+32
| * | | | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-239-403/+1010
* | | | | | yuzu/bootmanager: Treat the resolution factor as a u32Lioncash2019-06-032-13/+21
| |/ / / / |/| | | |
* | | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-3011-111/+1059
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| * | | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-255-13/+12
| * | | | mii: Implement Delete and Destroy fileZach Hilman2019-04-253-8/+116
| * | | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| * | | | mii_manager: Cleanup and optimizationZach Hilman2019-04-253-36/+50
| * | | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-252-15/+244
| * | | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| * | | | common: Extract UUID to its own classZach Hilman2019-04-253-78/+28
* | | | | Merge pull request #2518 from ReinUsesLisp/sdl2-windowbunnei2019-05-291-2/+1
|\ \ \ \ \
| * | | | | emu_window: Pass OnMinimalClientAreaChangeRequest argument by copyReinUsesLisp2019-05-261-2/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #2519 from lioncash/signbunnei2019-05-272-5/+5
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | core_timing_util: Silence sign-comparison warningsLioncash2019-05-251-4/+4
| * | | | loader/nso: Silence sign-comparison warningLioncash2019-05-251-1/+1
| | |_|/ | |/| |
* | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ | |/ / / |/| | |
| * | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| * | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| * | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| |/ /
* | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-254-9/+10
|\ \ \ | |/ / |/| |
| * | Address review commentTobias2019-05-191-1/+1
| * | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-184-9/+10
* | | Merge pull request #2410 from lioncash/affinitybunnei2019-05-192-42/+58
|\ \ \
| * | | kernel/svc: Make svcCreateThread/svcStartThread/svcSleepThread/svcExitThread calls show up in the debug logLioncash2019-04-291-4/+4
| * | | kernel/svc: Reorganize svcSetThreadCoreMask()Lioncash2019-04-291-32/+39
| * | | kernel/thread: Update thread processor ID flagsLioncash2019-04-292-7/+16
* | | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \ \
| * | | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| * | | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| * | | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |_|/ | |/| |
* | | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \ \
| * | | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
| | |_|/ | |/| |
* | | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \ \
| * | | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ / /
* | | | Merge pull request #2490 from lioncash/floatHexagon122019-05-191-1/+1
|\ \ \ \
| * | | | ipc_helpers: Amend floating-point type in Pop<double> specializationLioncash2019-05-191-1/+1
| |/ / /
* | | | Merge pull request #2486 from lioncash/resetnameSebastian Valle2019-05-1918-31/+32
|\ \ \ \
| * | | | core/kernel/object: Rename ResetType enum membersLioncash2019-05-1818-31/+32
| |/ / /
* / / / kernel/svc: Mark GetThreadList() and UnmapProcessCodeMemory() as internally linkedLioncash2019-05-191-4/+4
|/ / /
* | | Merge pull request #2437 from lioncash/audctlbunnei2019-05-091-2/+2
|\ \ \
| * | | service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
| |/ /
* | | Merge pull request #2445 from FearlessTobi/port-4749bunnei2019-05-092-9/+9
|\ \ \
| * | | core/telemetry_session: Only create the backend when we really need itzhupengfei2019-05-042-9/+9
* | | | Merge pull request #2453 from lioncash/enumbunnei2019-05-091-9/+0
|\ \ \ \
| * | | | core/memory: Remove unused FlushMode enumLioncash2019-05-071-9/+0
| |/ / /
* / / / core/frontend/emu_window: Make GraphicsContext's destructor virtualLioncash2019-05-042-0/+4
|/ / /
* | | loader/nso: Remove left-in debug pragmaLioncash2019-05-011-2/+0
* | | Merge pull request #2412 from lioncash/systembunnei2019-04-293-7/+11
|\ \ \ | |/ / |/| |
| * | kernel/vm_manager: Remove usages of global system accessorsLioncash2019-04-173-7/+11
* | | Merge pull request #2416 from lioncash/waitbunnei2019-04-256-44/+50
|\ \ \
| * | | kernel/thread: Unify wait synchronization typesLioncash2019-04-176-38/+34
| * | | kernel/svc: Migrate svcCancelSynchronization behavior to a thread functionLioncash2019-04-173-7/+17
| |/ /
* | | Merge pull request #2424 from FernandoS27/compatbunnei2019-04-252-0/+2
|\ \ \
| * | | Allow picking a Compatibility Profile for OpenGL.Fernando Sahmkow2019-04-202-0/+2
* | | | Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2521-112/+653
|\ \ \ \
| * | | | web_browser: Make OpenPage non-constZach Hilman2019-04-1710-18/+23
| * | | | main: Add GMainWindow hooks for Error displayZach Hilman2019-04-172-3/+3
| * | | | general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| * | | | general_frontend: Add frontend scaffold for PhotoViewer appletZach Hilman2019-04-172-0/+55
| * | | | frontend: Add frontend receiver for Error appletZach Hilman2019-04-173-2/+79
| * | | | applets: Add Error appletZach Hilman2019-04-173-24/+224
| * | | | applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| * | | | web_browser: Make OpenPage constZach Hilman2019-04-172-3/+3
| * | | | core: Remove specific applets in favor of AppletManagerZach Hilman2019-04-172-47/+32
| * | | | am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| * | | | applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
| | |/ / | |/| |
* | | | Merge pull request #2420 from lioncash/audctlbunnei2019-04-232-2/+32
|\ \ \ \ | |_|/ / |/| | |
| * | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
* | | | Merge pull request #2415 from lioncash/constbunnei2019-04-202-2/+2
|\ \ \ \
| * | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member functionLioncash2019-04-172-2/+2
| | |/ / | |/| |
* | | | Merge pull request #2421 from lioncash/svc-callbunnei2019-04-201-1/+1
|\ \ \ \
| * | | | kernel/svc: Name supervisor call 0x36Lioncash2019-04-191-1/+1
| | |/ / | |/| |
* | | | Merge pull request #2374 from lioncash/pagetablebunnei2019-04-2029-163/+206
|\ \ \ \ | |/ / / |/| | |
| * | | core/core: Move process execution start to System's Load()Lioncash2019-04-1220-107/+144
| * | | core/process: Remove unideal page table setting from LoadFromMetadata()Lioncash2019-04-121-5/+0
| * | | core/core: Move main process creation into Load()Lioncash2019-04-121-4/+3
| * | | video_core/gpu: Create threads separately from initializationLioncash2019-04-121-11/+4
| * | | core/cpu_core_manager: Create threads separately from initialization.Lioncash2019-04-1211-39/+58
* | | | Merge pull request #2397 from lioncash/thread-unusedbunnei2019-04-183-18/+17
|\ \ \ \ | |_|/ / |/| | |
| * | | svc: Specify handle value in thread's nameLioncash2019-04-152-2/+10
| * | | kernel/thread: Remove unused guest_handle member variableLioncash2019-04-143-16/+7
| | |/ | |/|
* | | Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\ \ \
| * | | service: Update service function tablesLioncash2019-04-1127-57/+262
* | | | Merge pull request #2393 from lioncash/svcbunnei2019-04-164-2/+274
|\ \ \ \
| * | | | kernel/svc: Implement svcUnmapProcessCodeMemoryLioncash2019-04-133-1/+143
| * | | | kernel/svc: Implement svcMapProcessCodeMemoryLioncash2019-04-134-1/+131
| | |_|/ | |/| |
* | | | kernel/thread: Remove BoostPriority()Lioncash2019-04-152-11/+0
| |_|/ |/| |
* | | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \ \
| * | | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| * | | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| | |/ | |/|
* | | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-142-6/+11
|\ \ \
| * | | added a toggle to force 30fps modezarroboogs2019-04-092-6/+11
* | | | Merge pull request #2381 from lioncash/fsbunnei2019-04-141-8/+7
|\ \ \ \
| * | | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
| * | | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| | |/ / | |/| |
* | | | Merge pull request #2017 from jroweboy/glwidgetbunnei2019-04-141-9/+30
|\ \ \ \ | |_|_|/ |/| | |
| * | | QT Frontend: Migrate to QOpenGLWindowJames Rowe2019-01-221-9/+30
* | | | Merge pull request #2360 from lioncash/svc-globalbunnei2019-04-128-364/+413
|\ \ \ \
| * | | | kernel/svc: Deglobalize the supervisor call handlersLioncash2019-04-088-364/+413
| | |_|/ | |/| |
* | | | Merge pull request #2388 from lioncash/constexprbunnei2019-04-1210-10/+10
|\ \ \ \
| * | | | kernel: Make handle type declarations constexprLioncash2019-04-1110-10/+10
| | |_|/ | |/| |
* / | | kernel/server_session: Remove obsolete TODOsLioncash2019-04-101-7/+2
|/ / /
* | | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-1015-187/+362
|\ \ \
| * | | patch_manager: Dump NSO name with build IDZach Hilman2019-03-284-9/+11
| * | | game_list: Register content with ContentProviderZach Hilman2019-03-271-2/+3
| * | | core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-278-27/+32
| * | | core: Store system-wide ContentProvider for the emulatorZach Hilman2019-03-272-0/+40
| * | | file_sys: Create ContentProvider interface and default implementationsZach Hilman2019-03-272-152/+279
* | | | kernel/process: Set page table when page table resizes occur.Lioncash2019-04-091-0/+2
| |/ / |/| |
* | | Merge pull request #2361 from lioncash/pagetablebunnei2019-04-077-18/+3
|\ \ \
| * | | core/memory: Remove GetCurrentPageTable()Lioncash2019-04-072-6/+1
| * | | arm/arm_dynarmic: Remove unnecessary current_page_table memberLioncash2019-04-072-8/+0
| * | | kernel: Handle page table switching within MakeCurrentProcess()Lioncash2019-04-073-4/+2
* | | | Merge pull request #2356 from lioncash/pairbunnei2019-04-076-18/+15
|\ \ \ \
| * | | | kernel/server_session: Return a std::pair from CreateSessionPair()Lioncash2019-04-064-11/+8
| * | | | kernel/server_port: Return a std::pair from CreatePortPair()Lioncash2019-04-062-7/+7
| |/ / /
* / / / core/memory: Remove unused enum constantsLioncash2019-04-071-10/+0
|/ / /
* | | Merge pull request #2325 from lioncash/namebunnei2019-04-061-0/+4
|\ \ \
| * | | kernel/server_session: Provide a GetName() overrideLioncash2019-04-031-0/+4
* | | | Merge pull request #2240 from FearlessTobi/port-4651bunnei2019-04-063-4/+5
|\ \ \ \
| * | | | gdbstub: Fix some bugs in IsMemoryBreak() and ServeBreak. Add workaround to let watchpoints break into GDB. (#4651)Dimitri A2019-03-153-4/+5
* | | | | Merge pull request #2340 from lioncash/viewbunnei2019-04-061-1/+3
|\ \ \ \ \
| * | | | | file_sys/fsmitm_romfsbuild: Utilize a string_view in romfs_calc_path_hash()Lioncash2019-04-051-1/+3
* | | | | | Merge pull request #2334 from lioncash/overridebunnei2019-04-0613-23/+9
|\ \ \ \ \ \
| * | | | | | core: Add missing override specifiers where applicableLioncash2019-04-0413-23/+9
* | | | | | | Merge pull request #2341 from lioncash/comparebunnei2019-04-062-11/+0
|\ \ \ \ \ \ \
| * | | | | | | file_sys/nca_metadata: Remove unnecessary comparison operators for TitleTypeLioncash2019-04-052-11/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2339 from lioncash/rankbunnei2019-04-065-17/+29
|\ \ \ \ \ \ \
| * | | | | | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-054-6/+6
| * | | | | | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| * | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-053-4/+15
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2343 from lioncash/todobunnei2019-04-062-15/+14
|\ \ \ \ \ \ \
| * | | | | | | file_sys/program_metadata: Remove obsolete TODOsLioncash2019-04-052-15/+14
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2329 from lioncash/sanitizebunnei2019-04-061-0/+14
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomicLioncash2019-04-041-0/+14
* | | | | | | | Merge pull request #2344 from lioncash/resultbunnei2019-04-061-4/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | hle/result: Remove unnecessary bitfield entry for ResultCodeLioncash2019-04-051-4/+0
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2292 from lioncash/nacpbunnei2019-04-052-12/+24
|\ \ \ \ \ \ \
| * | | | | | | file_sys/control_metadata: Amend naming of membersLioncash2019-04-042-12/+24
| | |_|_|_|/ / | |/| | | | |
* | | | | | | hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #2328 from lioncash/transferbunnei2019-04-043-17/+37
|\ \ \ \ \ \
| * | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
| * | | | | | kernel/transfer_memory: Add accessors to data and sizesLioncash2019-04-032-11/+31
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2093 from FreddyFunk/disk-cache-better-compressionbunnei2019-04-042-11/+8
|\ \ \ \ \ \
| * | | | | | Addressed feedbackunknown2019-03-291-4/+4
| * | | | | | core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-292-11/+8
* | | | | | | Merge pull request #2324 from lioncash/enum-unusedbunnei2019-04-042-2/+0
|\ \ \ \ \ \ \
| * | | | | | | kernel/object: Remove unused handle type entryLioncash2019-04-032-2/+0
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| * | | | | | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
* | | | | | | Merge pull request #2305 from lioncash/sharedbunnei2019-04-033-5/+18
|\ \ \ \ \ \ \
| * | | | | | | kernel/shared_memory: Remove unused core/memory.h includeLioncash2019-03-291-1/+0
| * | | | | | | kernel/shared_memory: Sanitize supplied size when unmappingLioncash2019-03-293-4/+18
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2314 from lioncash/constbunnei2019-04-0311-18/+18
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | kernel/thread: Make AllWaitObjectsReady() a const qualified member functionLioncash2019-04-022-2/+2
| * | | | | | kernel/wait_object: Make ShouldWait() take thread members by pointer-to-constLioncash2019-04-0211-11/+11
| * | | | | | kernel/thread: Avoid sign conversion within GetCommandBufferAddress()Lioncash2019-04-011-2/+2
| * | | | | | kernel/thread: Make parameter of GetWaitObjectIndex() const qualifiedLioncash2019-04-012-3/+3
* | | | | | | Merge pull request #2270 from lioncash/plistbunnei2019-04-037-2/+123
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Implement svcGetThreadListLioncash2019-04-024-1/+70
| * | | | | | | kernel/svc: Implement svcGetProcessListLioncash2019-04-024-1/+53
* | | | | | | | Merge pull request #2313 from lioncash/reslimitbunnei2019-04-023-14/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/resource_limit: Remove the name member from resource limitsLioncash2019-04-013-14/+6
| |/ / / / / /
* | | | | | | process: Fix up compilationReinUsesLisp2019-04-021-1/+1
* | | | | | | Merge pull request #2281 from lioncash/memorybunnei2019-04-025-7/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | kernel/codeset: Make CodeSet's memory data member a regular std::vectorLioncash2019-03-225-7/+8
* | | | | | | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-013-3/+1
|\ \ \ \ \ \ \
| * | | | | | | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-293-3/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-016-14/+14
* | | | | | | Merge pull request #2304 from lioncash/memsizebunnei2019-03-313-9/+28
|\ \ \ \ \ \ \
| * | | | | | | kernel/process: Report total physical memory used to svcGetInfoLioncash2019-03-293-4/+11
| * | | | | | | kernel/process: Store the total size of the code memory loadedLioncash2019-03-292-0/+5
| * | | | | | | kernel/process: Store the main thread stack size to a data memberLioncash2019-03-282-4/+7
| * | | | | | | kernel/process: Make Run's stack size parameter a u64Lioncash2019-03-282-2/+2
| * | | | | | | kernel/process: Ensure that given stack size is always page-alignedLioncash2019-03-281-0/+4
* | | | | | | | Merge pull request #2308 from lioncash/deductionbunnei2019-03-313-12/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/scheduler: Remove unused parameter to AddThread()Lioncash2019-03-303-4/+4
| * | | | | | | | kernel/scheduler: Use deduction guides on mutex locksLioncash2019-03-301-8/+8
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
* | | | | | | | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
* | | | | | | | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/ / / / / / /
* | | | | | | Merge pull request #2266 from FernandoS27/arbitrationbunnei2019-03-295-14/+18
|\ \ \ \ \ \ \
| * | | | | | | Fix small bug that kept a thread as a condvar thread after being signalled.Fernando Sahmkow2019-03-202-6/+8
| * | | | | | | Add CondVar Thread State.Fernando Sahmkow2019-03-204-4/+6
| * | | | | | | Small fixes to address_arbiter to better match the IDB.Fernando Sahmkow2019-03-202-5/+5
* | | | | | | | Merge pull request #2265 from FernandoS27/multilevelqueuebunnei2019-03-292-19/+27
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Fixes and corrections on formatting.Fernando Sahmkow2019-03-271-6/+9
| * | | | | | | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-272-19/+24
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2284 from lioncash/heap-allocbunnei2019-03-283-59/+81
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | kernel/vm_manager: Handle shrinking of the heap size within SetHeapSize()Lioncash2019-03-242-24/+46
| * | | | | | kernel/vm_manager: Rename HeapAllocate to SetHeapSizeLioncash2019-03-243-4/+3
| * | | | | | kernel/vm_manager: Handle case of identical calls to HeapAllocateLioncash2019-03-241-0/+5
| * | | | | | kernel/vm_manager: Remove unused class variablesLioncash2019-03-241-3/+0
| * | | | | | kernel/vm_manager: Remove unnecessary heap_used data memberLioncash2019-03-243-13/+2
| * | | | | | kernel/vm_manager: Tidy up heap allocation codeLioncash2019-03-243-27/+37
* | | | | | | Merge pull request #2285 from lioncash/unused-structbunnei2019-03-261-8/+0
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | kernel/process: Remove unused AddressMapping structLioncash2019-03-241-8/+0
* | | | | | | Merge pull request #2287 from lioncash/coretiming-cbbunnei2019-03-266-11/+11
|\ \ \ \ \ \ \
| * | | | | | | core/core_timing: Make callback parameters consistentLioncash2019-03-246-11/+11
| |/ / / / / /
* | | | | | | Merge pull request #2286 from lioncash/fwdbunnei2019-03-261-3/+0
|\ \ \ \ \ \ \
| * | | | | | | kernel/kernel: Remove unnecessary forward declarationLioncash2019-03-241-3/+0
| |/ / / / / /
* / / / / / / core/cheat_engine: Make MemoryReadImpl and MemoryWriteImpl internally linkedLioncash2019-03-241-0/+2
|/ / / / / /
* | | | | | Merge pull request #2232 from lioncash/transfer-memorybunnei2019-03-246-6/+282
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | core/hle/kernel/svc: Implement svcUnmapTransferMemoryLioncash2019-03-131-1/+48
| * | | | | core/hle/kernel/svc: Implement svcMapTransferMemoryLioncash2019-03-131-1/+57
| * | | | | core/hle/kernel: Split transfer memory handling out into its own classLioncash2019-03-136-4/+177
* | | | | | Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-237-3/+154
|\ \ \ \ \ \
| * | | | | | set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| * | | | | | set_sys: Use official nintendo version stringZach Hilman2019-03-114-19/+25
| * | | | | | system_version: Correct sizes on VectorVfsFile constructionZach Hilman2019-03-111-4/+4
| * | | | | | set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| * | | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-106-3/+128
* | | | | | | Merge pull request #2280 from lioncash/nsobunnei2019-03-233-73/+92
|\ \ \ \ \ \ \
| * | | | | | | loader/nso: Place translation unit specific functions into an anonymous namespaceLioncash2019-03-221-20/+21
| * | | | | | | loader/nso: Clean up use of magic constantsLioncash2019-03-221-4/+6
| * | | | | | | file_sys/patch_manager: Deduplicate NSO headerLioncash2019-03-223-64/+65
| * | | | | | | loader/nso: Fix definition of the NSO header structLioncash2019-03-221-3/+15
| * | | | | | | file_sys/patch_manager: Remove two magic valuesLioncash2019-03-221-2/+5
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2279 from lioncash/cheat-globalbunnei2019-03-226-48/+57
|\ \ \ \ \ \ \
| * | | | | | | file_sys/cheat_engine: Silence truncation and sign-conversion warningsLioncash2019-03-222-5/+6
| * | | | | | | file_sys/cheat_engine: Remove use of global system accessorsLioncash2019-03-226-43/+51
| |/ / / / / /
* | | | | | | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-222-13/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | memory: Check that core is powered on before attempting to use GPU.bunnei2019-03-211-1/+1
| * | | | | | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-211-10/+2
| * | | | | | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-211-2/+2
* | | | | | | Merge pull request #2234 from lioncash/mutexbunnei2019-03-225-29/+62
|\ \ \ \ \ \ \
| * | | | | | | core/hle/kernel/mutex: Remove usages of global system accessorsLioncash2019-03-151-11/+15
| * | | | | | | core/hle/kernel: Make Mutex a per-process class.Lioncash2019-03-155-18/+47
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #2274 from lioncash/includebunnei2019-03-221-3/+0
|\ \ \ \ \ \ \
| * | | | | | | core/memory: Remove unnecessary includesLioncash2019-03-211-3/+0
* | | | | | | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-224-22/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-214-22/+20
| * | | | | | | | kernel/vm_manager: Amend flag values for CodeMutableLioncash2019-03-211-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-2210-0/+813
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-0510-77/+56
| * | | | | | | core: Add support for registering and controlling ownership of CheatEngineZach Hilman2019-03-052-0/+13
| * | | | | | | cheat_engine: Add parser and interpreter for game cheatsZach Hilman2019-03-053-0/+715
| * | | | | | | loader/nso: Set main code region in VMManagerZach Hilman2019-03-053-2/+21
| * | | | | | | vm_manager: Add support for storing and getting main code regionZach Hilman2019-03-052-0/+28
| * | | | | | | patch_manager: Display cheats in game list add-onsZach Hilman2019-03-051-0/+2
| * | | | | | | patch_manager: Add support for loading cheats listsZach Hilman2019-03-052-0/+56
| * | | | | | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
* | | | | | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-216-96/+96
|\ \ \ \ \ \ \ \
| * | | | | | | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-066-96/+96
* | | | | | | | | Merge pull request #2262 from lioncash/enumbunnei2019-03-212-2/+15
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys/content_archive: Amend name of Data_Unknown5 enum entryLioncash2019-03-192-2/+15
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #2268 from lioncash/codesetbunnei2019-03-218-45/+111
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | kernel/process: Make MapSegment lambda reference parameter constLioncash2019-03-201-1/+1
| * | | | | | | | kernel: Move CodeSet structure to its own source filesLioncash2019-03-208-44/+110
* | | | | | | | | Merge pull request #2267 from FernandoS27/fix-2238bunnei2019-03-211-1/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fix crash caused by 2238.Fernando Sahmkow2019-03-201-1/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
* | | | | | | | | loader: Remove Linker classLioncash2019-03-203-185/+0
* | | | | | | | | loader: Remove Linker inheritance from NRO and NSO loadersLioncash2019-03-202-4/+4
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ \ \ \
| * | | | | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| * | | | | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| * | | | | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
* | | | | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
* | | | | | | | | Merge pull request #2238 from lioncash/threadbunnei2019-03-182-21/+41
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | kernel/thread: Expand documentation of nominal_priority and current_priorityLioncash2019-03-162-3/+11
| * | | | | | | | kernel/thread: Make bracing consistent within UpdatePriority()Lioncash2019-03-161-2/+4
| * | | | | | | | kernel/thread: Amend condition within UpdatePriority()Lioncash2019-03-161-3/+3
| * | | | | | | | kernel/thread: Maintain priority ordering of added mutex waiting threadsLioncash2019-03-161-14/+24
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #2252 from bunnei/move-page-tablebunnei2019-03-1711-219/+91
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Move PageTable struct into Common.bunnei2019-03-1711-219/+91
* | | | | | | | | Merge pull request #2249 from lioncash/ipcbunnei2019-03-171-0/+30
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | ipc_helpers: Allow pushing and popping floating-point valuesLioncash2019-03-161-0/+30
* | | | | | | | | | Merge pull request #2245 from lioncash/unused-defbunnei2019-03-171-6/+0
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/thread: Actually remove the definition of ExitCurrentThread()Lioncash2019-03-161-6/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2243 from bunnei/mem-simplify-cachebunnei2019-03-172-66/+21
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | memory: Simplify rasterizer cache operations.bunnei2019-03-162-66/+21
* | | | | | | | | | Merge pull request #2129 from FernandoS27/cntpctbunnei2019-03-173-2/+12
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Corrections, documenting and fixes.Fernando Sahmkow2019-02-162-4/+3
| * | | | | | | | | Use u128 on Clock Cycles calculation.Fernando Sahmkow2019-02-163-6/+6
| * | | | | | | | | Correct CNTPCT to use Clock Cycles instead of Cpu Cycles.Fernando Sahmkow2019-02-163-2/+13
* | | | | | | | | | Merge pull request #2242 from lioncash/thread-fnbunnei2019-03-164-33/+31
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/thread: Move thread exiting logic from ExitCurrentThread to svcExitThreadLioncash2019-03-162-8/+7
| * | | | | | | | | kernel/thread: Migrate WaitCurrentThread_Sleep into the Thread interfaceLioncash2019-03-164-25/+24
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | gpu: Use host address for caching instead of guest address.bunnei2019-03-152-6/+10
| |_|_|_|_|/ / / |/| | | | | | |
* | | | | | | | Merge pull request #2230 from lioncash/globalbunnei2019-03-152-8/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Remove use of global system accessorsLioncash2019-03-132-8/+9
| |/ / / / / / /
* | | | | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-134-14/+36
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/server_port: Make data members privateLioncash2019-03-114-14/+36
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-133-19/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | core/hle/result: Remove now-unnecessary manually defined copy assignment operatorLioncash2019-03-101-5/+0
| * | | | | | | | core/hle/result: Amend error in comment description for ResultCodeLioncash2019-03-101-1/+1
| * | | | | | | | core/hle/result: Remove now-unused constructor for ResultCodeLioncash2019-03-101-10/+0
| * | | | | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-103-3/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-139-40/+146
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| * | | | | | | core/ipc_helper: Allow popping all signed value types with RequestParserLioncash2019-02-271-0/+15
| * | | | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
* | | | | | | | Merge pull request #2211 from lioncash/arbiterbunnei2019-03-128-64/+80
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel: Make the address arbiter instance per-processLioncash2019-03-087-27/+34
| * | | | | | | | kernel/svc: Move address arbiter signaling behind a unified API functionLioncash2019-03-083-22/+26
| * | | | | | | | kernel/svc: Move address arbiter waiting behind a unified API functionLioncash2019-03-083-19/+24
* | | | | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ \ \ \
| * | | | | | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| * | | | | | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| * | | | | | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| * | | | | | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
* | | | | | | | | Merge pull request #2193 from lioncash/globalbunnei2019-03-105-17/+23
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | |
| * | | | | | | | kernel/scheduler: Pass in system instance in constructorLioncash2019-03-045-17/+23
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | clang fixHexagon122019-03-091-1/+2
* | | | | | | | Log 2 new setting valuesHexagon122019-03-091-0/+2
* | | | | | | | Merge pull request #2210 from lioncash/optionalbunnei2019-03-084-47/+47
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optionalLioncash2019-03-084-47/+47
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2195 from lioncash/shared-globalbunnei2019-03-071-3/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()Lioncash2019-03-041-3/+2
| |/ / / / / /
* | | | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-076-36/+78
|\ \ \ \ \ \ \
| * | | | | | | kernel/server_session: Make data members privateLioncash2019-03-065-32/+73
| * | | | | | | kernel/client_session: Make data members privateLioncash2019-03-061-4/+5
* | | | | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-078-22/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | gpu: Refactor a/synchronous implementations into their own classes.bunnei2019-03-071-2/+7
| * | | | | | | | gpu: Move command processing to another thread.bunnei2019-03-072-5/+5
| * | | | | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-073-14/+4
| * | | | | | | | gpu: Refactor to take RendererBase instead of RasterizerInterface.bunnei2019-03-071-1/+1
| * | | | | | | | settings: Add new graphics setting for use_asynchronous_gpu_emulation.bunnei2019-03-072-0/+3
| * | | | | | | | core: Set is_powered_on before GPU is initialized.bunnei2019-03-071-1/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-076-8/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-056-8/+12
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2190 from lioncash/ogl-globalbunnei2019-03-072-11/+7
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | core/core: Remove the global telemetry accessor functionLioncash2019-03-041-4/+0
| * | | | | | | core/core: Replace direct usage of the global system telemetry accessor from Shutdown()Lioncash2019-03-041-7/+7
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2199 from lioncash/arbiterbunnei2019-03-066-112/+184
|\ \ \ \ \ \ \
| * | | | | | | kernel/address_arbiter: Pass in system instance to constructorLioncash2019-03-055-23/+42
| * | | | | | | kernel/address_arbiter: Minor tidying upLioncash2019-03-051-18/+18
| * | | | | | | kernel/address_arbiter: Convert the address arbiter into a classLioncash2019-03-055-82/+135
| | |/ / / / / | |/| | | | |
* | | | | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
* | | | | | | Merge pull request #2194 from lioncash/membunnei2019-03-063-30/+66
|\ \ \ \ \ \ \
| * | | | | | | vm_manager: Use range helpers in HeapAlloc() and HeapFree()Lioncash2019-03-041-4/+2
| * | | | | | | vm_manager: Provide address range checking functions for other memory regionsLioncash2019-03-042-4/+35
| * | | | | | | svc: Migrate address range checking functions to VMManagerLioncash2019-03-043-23/+30
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2200 from lioncash/audiobunnei2019-03-064-10/+21
|\ \ \ \ \ \ \
| * | | | | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-054-10/+21
| | |/ / / / / | |/| | | | |
* / | | | | | kernel/thread: Remove obsolete TODO in Create()Lioncash2019-03-051-2/+0
|/ / / / / /
* / / / / / Memory: don't lock hle mutex in memory read/writeWeiyi Wang2019-03-021-6/+0
|/ / / / /
* | | | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \ \ \
| * | | | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
* | | | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / / / /
* | | | | Merge pull request #2174 from lioncash/fwdbunnei2019-02-281-1/+1
|\ \ \ \ \
| * | | | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
* | | | | | Speed up memory page mapping (#2141)Annomatg2019-02-271-6/+11
|/ / / / /
* | | | | Merge pull request #2169 from lioncash/namingbunnei2019-02-271-13/+13
|\ \ \ \ \
| * | | | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-271-13/+13
* | | | | | Merge pull request #2170 from lioncash/emu-windowbunnei2019-02-272-2/+2
|\ \ \ \ \ \
| * | | | | | core/frontend/emu_window: Make ClipToTouchScreen a const member functionLioncash2019-02-272-2/+2
| |/ / / / /
* | | | | | Merge pull request #2161 from lioncash/handle-tablebunnei2019-02-276-19/+63
|\ \ \ \ \ \
| * | | | | | kernel/handle_table: Make local variables as const where applicableLioncash2019-02-251-4/+5
| * | | | | | kernel/handle_table: Allow process capabilities to limit the handle table sizeLioncash2019-02-256-10/+54
| * | | | | | kernel/handle-table: In-class initialize data membersLioncash2019-02-252-3/+2
| * | | | | | kernel/handle_table: Resolve truncation warningsLioncash2019-02-251-2/+2
| | |/ / / / | |/| | | |
* | | | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-277-13/+13
* | | | | | common/vector_math: Move Vec[x] types into the Common namespaceLioncash2019-02-271-1/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #2156 from FreddyFunk/patch-1bunnei2019-02-261-1/+1
|\ \ \ \ \
| * | | | | file_sys/vfs_vector: Fix ignored offset on WriteFrederic L2019-02-251-1/+1
* | | | | | service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
| |/ / / / |/| | | |
* | | | | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
* | | | | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
* | | | | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
|/ / / /
* | | | Merge pull request #2130 from lioncash/system_enginebunnei2019-02-211-1/+1
|\ \ \ \
| * | | | video_core: Remove usages of System::GetInstance() within the enginesLioncash2019-02-161-1/+1
| |/ / /
* | | | Fixes Unicode Key File Directories (#2120)Jungy2019-02-211-1/+2
* | | | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-207-57/+123
* | | | address_arbiter: Use nested namespaces where applicableLioncash2019-02-162-8/+4
|/ / /
* | | core_timing: Convert core timing into a classLioncash2019-02-1643-289/+404
* | | Merge pull request #2115 from lioncash/localbunnei2019-02-141-3/+3
|\ \ \
| * | | core_timing: Make EmptyTimedCallback a local variableLioncash2019-02-131-3/+3
* | | | threadsafe_queue: Remove NeedSize template parameterLioncash2019-02-131-2/+2
|/ / /
* | | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1229-73/+69
* | | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
* | | Merge pull request #2091 from FearlessTobi/port-4603bunnei2019-02-071-4/+10
|\ \ \
| * | | gdbstub: only let Execute breakpoints write/restore BKPT opcodes into target memoryDimitri ALBORA2019-02-061-4/+10
* | | | gl_shader_cache: Link loading screen with disk shader cache loadReinUsesLisp2019-02-071-2/+0
* | | | gl_shader_disk_cache: Pass core system as argument and guard against games without title idsReinUsesLisp2019-02-071-1/+1
* | | | settings: Hide shader cache behind a settingReinUsesLisp2019-02-072-0/+3
* | | | rasterizer_interface: Add disk cache entry for the rasterizerReinUsesLisp2019-02-071-0/+3
|/ / /
* | | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
* | | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
* | | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
|/ /
* | Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\ \
| * | hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| * | hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| * | hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| * | hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| * | hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
* | | kernel: Remove the Timer classLioncash2019-02-017-229/+0
* | | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \ \
| * | | service/ns: Update function tablesLioncash2019-01-301-14/+20
| * | | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| * | | service/audio: Update function tablesLioncash2019-01-304-8/+23
| * | | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| * | | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| * | | service/btm: Update function tablesLioncash2019-01-301-55/+97
| * | | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| * | | service/psc: Update function tablesLioncash2019-01-301-8/+9
* | | | Merge pull request #2077 from lioncash/virtbunnei2019-01-315-15/+3
|\ \ \ \
| * | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directlyLioncash2019-01-301-3/+3
| * | | | kernel/timer: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| * | | | kernel/readable_event: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | |/ / | |/| |
* | | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
* | | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
|/ / /
* | | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
* | | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
* | | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
* | | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
* | | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
|/ /
* | hle/ipc_helpers: Fix clang-format warningsLioncash2019-01-301-1/+0
* | hle/ipc_helpers: Allow pushing signed valuesLioncash2019-01-291-0/+22
* | service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
* | service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
* | service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
* | kernel/svc: Log out uncaught C++ exceptions from svcBreakLioncash2019-01-271-0/+4
* | Merge pull request #2054 from bunnei/scope-context-refactorbunnei2019-01-243-0/+43
|\ \
| * | frontend: Refactor ScopeAcquireWindowContext out of renderer_opengl.bunnei2019-01-243-0/+43
| |/
* / citra_qt: Log settings on launchzhupengfei2019-01-222-0/+30
|/
* Merge pull request #2025 from DarkLordZach/loader-banner-logobunnei2019-01-2011-0/+77
|\
| * loader: Propagate NCA logo section to ReadBanner and ReadLogoZach Hilman2019-01-159-0/+61
| * content_archive: Add getter for logo section of NCAZach Hilman2019-01-152-0/+16
* | Merge pull request #2031 from lioncash/privbunnei2019-01-195-18/+29
|\ \
| * | core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
| * | core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-175-16/+21
| |/
* / file_sys/directory: Remove unused DirectoryBackend classLioncash2019-01-181-23/+0
|/
* Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-103-7/+21
|\
| * settings: Fix comment structureZach Hilman2019-01-081-4/+5
| * settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-083-11/+10
| * time: Use custom RTC settings if applicable for gameZach Hilman2019-01-081-6/+10
| * core: Set custom RTC differential on game bootZach Hilman2019-01-081-0/+7
| * settings: Add custom RTC settingsZach Hilman2019-01-081-0/+3
* | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-1020-586/+1012
|\ \ | |/ |/|
| * travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-292-3/+2
| * web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-297-134/+139
| * core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-284-2/+22
| * frontend: Add frontend responder for web browserZach Hilman2018-12-282-0/+52
| * applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-284-0/+234
| * loader: Add accessor for Manual RomFSZach Hilman2018-12-285-0/+30
| * hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| * romfs: Add SingleDiscard extraction typeZach Hilman2018-12-282-2/+6
| * am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
* | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \
| * | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| * | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| * | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
* | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \
| * | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ /
* | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \
| * | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
* | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ | |_|/ / |/| | |
| * | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ /
* | | Removed pulse event typeDavid Marcec2019-01-043-7/+0
* | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \
| * | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| * | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
* | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| |/ / |/| |
* | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \
| * | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| |/ /
* | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
* | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \
| * | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| |/ /
* / / core/kernel: Remove unnecessary inclusionsLioncash2019-01-0116-16/+22
|/ /
* | Merge pull request #1966 from lioncash/backtracebunnei2018-12-312-7/+8
|\ \
| * | arm_interface: Make include path relative for arm_interface.hLioncash2018-12-311-1/+1
| * | arm_interface: Make LogBacktrace() a const member functionLioncash2018-12-312-2/+2
| * | arm_interface: Mark variables as const where applicable in LogBacktrace()Lioncash2018-12-311-3/+4
| * | arm_interface: Remove unnecessary semicolonLioncash2018-12-311-1/+1
* | | kernel/svc: Correct misleading error message within CreateThread()Lioncash2018-12-311-2/+3
* | | kernel/svc: Sanitize core number and thread priorities in CreateThread()Lioncash2018-12-311-6/+17
* | | kernel/process: Rename GetAllowedProcessorMask() and GetAllowedThreadPriorityMask()Lioncash2018-12-312-11/+11
* | | kernel/svc: Simplify thread core ID sanitizing in CreateThreadLioncash2018-12-311-7/+1
|/ /
* | Merge pull request #1956 from lioncash/process-threadSebastian Valle2018-12-315-57/+51
|\ \
| * | kernel/process: Start the main thread using the specified ideal coreLioncash2018-12-281-2/+2
| * | kernel: Rename 'default' CPU core to 'ideal' coreLioncash2018-12-284-21/+21
| * | kernel/thread: Move process thread initialization into process.cppLioncash2018-12-283-36/+30
* | | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-306-1/+41
|\ \ \
| * | | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-294-18/+36
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-198-47/+20
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-036-14/+39
| * | | Print backtrace on svcBreakDavid Marcec2018-12-033-0/+24
* | | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
* | | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
| |_|/ |/| |
* | | Merge pull request #1954 from lioncash/npdmbunnei2018-12-281-3/+7
|\ \ \
| * | | file_sys/program_metadata: Print out more descriptive address space descriptionsLioncash2018-12-281-3/+7
| | |/ | |/|
* / | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-284-49/+35
|/ /
* | Merge pull request #1928 from lioncash/capsbunnei2018-12-2712-125/+670
|\ \
| * | kernel/process: Hook up the process capability parser to the process itselfLioncash2018-12-217-122/+44
| * | kernel/process_capability: Handle debug capability flagsLioncash2018-12-212-1/+18
| * | kernel/process_capability: Handle handle table capability flagsLioncash2018-12-212-1/+11
| * | kernel/process_capability: Handle kernel version capability flagsLioncash2018-12-212-1/+18
| * | kernel/process_capability: Handle program capability flagsLioncash2018-12-213-2/+29
| * | kernel/process_capability: Handle interrupt capability flagsLioncash2018-12-211-1/+21
| * | kernel/process_capability: Handle syscall capability flagsLioncash2018-12-212-1/+29
| * | kernel/process_capability: Handle the priority mask and core mask flagsLioncash2018-12-212-1/+40
| * | kernel/process: Introduce process capability parsing skeletonLioncash2018-12-215-3/+468
* | | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ \
| * | | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
* | | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ \
| * | | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
* | | | | Merge pull request #1949 from lioncash/unmapbunnei2018-12-271-0/+1
|\ \ \ \ \
| * | | | | kernel/vm_manager: Reset region attributes when unmapping a VMALioncash2018-12-271-0/+1
* | | | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-275-5/+50
* | | | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
* | | | | | savedata_factory: Partially implement IVFC save sizes using filesZach Hilman2018-12-272-0/+38
* | | | | | loader: Add accessor for game control dataZach Hilman2018-12-275-9/+14
* | | | | | control_metadata: Update NACP fields with latest Switchbrew dataZach Hilman2018-12-272-6/+29
* | | | | | control_metadata: Use value member instead of unique_ptr to store structZach Hilman2018-12-272-10/+13
* | | | | | vfs: Add reinterpret_casts to WriteArray and ObjectZach Hilman2018-12-271-2/+2
|/ / / / /
* | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-264-6/+72
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-044-6/+72
* | | | | Merge pull request #1886 from FearlessTobi/port-4164bunnei2018-12-232-0/+22
|\ \ \ \ \
| * | | | | yuzu, video_core: Screenshot functionalityzhupengfei2018-12-182-0/+22
* | | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-238-0/+197
|\ \ \ \ \ \
| * | | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-034-13/+5
| * | | | | | qt: Implement GUI dialog frontend for ProfileSelectorZach Hilman2018-12-031-0/+2
| * | | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| * | | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| * | | | | | core: Add getter/setter for ProfileSelector in SystemZach Hilman2018-12-032-0/+16
| * | | | | | frontend: Add frontend applet for ProfileSelectZach Hilman2018-12-033-0/+48
| * | | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
* | | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-213-0/+3
|\ \ \ \ \ \ \
| * | | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-193-0/+3
* | | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-217-28/+59
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| * | | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| * | | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| * | | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-194-7/+7
| * | | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| * | | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
* | | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| * | | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| * | | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| * | | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| * | | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
* | | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \ \
| * | | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1918 from MerryMage/cntfrqbunnei2018-12-181-0/+1
|\ \ \ \ \ \ \
| * | | | | | | arm_dynarmic: Set CNTFRQ valueMerryMage2018-12-181-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \
| * | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
* | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
* | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-154-9/+165
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| * | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| * | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| * | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| * | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-225-77/+139
| * | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-195-2/+114
* | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \
| * | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| * | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| * | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| * | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| * | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| * | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| * | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| * | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
* | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| |/ / / / / /
* | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
* | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \
| * | | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |_|/ / / / | |/| | | | |
* | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFSLioncash2018-12-111-4/+3
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1846 from lioncash/dirbunnei2018-12-111-2/+2
|\ \ \ \ \ \
| * | | | | | file_sys/directory: Amend path buffer size for directory entriesLioncash2018-12-031-2/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-1111-14/+102
|\ \ \ \ \ \
| * | | | | | loader: Add support for reading the name of game's developerZach Hilman2018-12-035-0/+26
| * | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| * | | | | | patch_manager: Obey disabled add-ons list when patching gameZach Hilman2018-12-032-11/+50
| * | | | | | core: Make GetGameFileFromPath function externally accessibleZach Hilman2018-12-032-3/+9
| * | | | | | settings: Store list of disabled add-ons per title IDZach Hilman2018-12-031-0/+5
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1887 from FearlessTobi/port-4476bunnei2018-12-111-8/+4
|\ \ \ \ \ \
| * | | | | | web_service: move telemetry condition from TelemetrySession constructor to destructorfearlessTobi2018-12-081-8/+4
* | | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \ \
| * | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
* | | | | | | | Merge pull request #1885 from lioncash/data_idbunnei2018-12-111-1/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enumLioncash2018-12-081-1/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
* | | | | | | | | Merge pull request #1880 from DarkLordZach/cache-storageHexagon122018-12-101-1/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | savedata_factory: Add support for CacheStorageZach Hilman2018-12-071-0/+2
| * | | | | | | | | savedata_factory: Delete TemporaryStorage on startupZach Hilman2018-12-071-1/+5
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-105-28/+41
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | memory: Convert ASSERT into a DEBUG_ASSERT within GetPointerFromVMA()Lioncash2018-12-061-1/+1
| * | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-065-28/+41
* | | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| * | | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| * | | | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| * | | | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| * | | | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1873 from lioncash/constbunnei2018-12-0810-10/+10
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | loaders: Make GetFileType() a const qualified member functionLioncash2018-12-0510-10/+10
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1875 from DarkLordZach/oss-ngword2bunnei2018-12-063-1/+41
|\ \ \ \ \ \ \ \
| * | | | | | | | system_archive: Implement open source NgWord2Zach Hilman2018-12-063-1/+41
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| * | | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| * | | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
* | | | | | | | Merge pull request #1867 from lioncash/allocbunnei2018-12-062-4/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | ng_word: Deduplicate use of a constant valueLioncash2018-12-051-1/+1
| * | | | | | | | system_archive: Use a regular function pointer instead of std::function for file-scope system archive arrayLioncash2018-12-051-3/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1866 from lioncash/cachebunnei2018-12-061-8/+2
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| |/ / / / / /
* / / / / / / Call shrink_to_fit after page-table vector resizing to cause crt to actually lower vector capacity. For 36-bit titles saves 800MB of commit.heapo2018-12-051-0/+8
|/ / / / / /
* | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-058-1/+227
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | file_sys: Implement system archive synthesizer for NgWord (806)Zach Hilman2018-11-235-6/+61
| * | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| * | | | | file_sys: Add framework for synthesizing open source archivesZach Hilman2018-11-163-0/+109
| * | | | | vfs_vector: Add VFS backend for std::arrayZach Hilman2018-11-161-0/+52
* | | | | | Merge pull request #1838 from lioncash/dedupbunnei2018-12-051-27/+26
|\ \ \ \ \ \
| * | | | | | file_sys/registered_cache: Eliminate variable shadowingLioncash2018-12-021-27/+26
* | | | | | | Merge pull request #1836 from lioncash/unusedbunnei2018-12-051-1/+0
|\ \ \ \ \ \ \
| * | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()Lioncash2018-12-021-1/+0
| |/ / / / / /
* | | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
* | | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
* | | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
* | | | | | | Merge pull request #1845 from lioncash/nrobunnei2018-12-045-19/+23
|\ \ \ \ \ \ \
| * | | | | | | loader/nso: Remove dependency on the System classLioncash2018-12-033-8/+11
| * | | | | | | loader/nro: Make the static LoadNro function internally linkedLioncash2018-12-032-7/+5
| * | | | | | | loader/nro: Remove dependency on the System classLioncash2018-12-032-10/+13
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-045-10/+19
|\ \ \ \ \ \ \
| * | | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-045-10/+19
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
* | | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
|/ / / / / /
* | | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
* | | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| * | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
| | |/ / / | |/| | |
* | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-036-31/+17
|\ \ \ \ \
| * | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-026-31/+17
| |/ / / /
* | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0333-236/+397
|\ \ \ \ \
| * | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| * | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2930-311/+169
| * | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2925-153/+274
| * | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| * | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| * | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-296-61/+210
| * | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
* | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-035-5/+97
|\ \ \ \ \ \
| * | | | | | file_sys: Override missing mutating functions to be stubbed out for ReadOnlyVfsDirectory by defaultLioncash2018-12-012-0/+25
| * | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-015-5/+72
* | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \
| * | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \
| * | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|/ / / | |/| | | | |
* | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
* | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / /
* | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| | |/ / / | |/| | |
* | | | | Fix debug buildLioncash2018-12-011-1/+1
| |/ / / |/| | |
* | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
* | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / /
* | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \
| * | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| * | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| * | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| * | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| * | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| * | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| * | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
* | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \
| * | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
* | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-281-5/+10
|\ \ \ \ \
| * | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-281-8/+6
| * | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-271-3/+10
* | | | | | Merge pull request #1814 from lioncash/ptrbunnei2018-11-282-28/+26
|\ \ \ \ \ \
| * | | | | | file_sys/registered_cache: Remove unused <map> includeLioncash2018-11-271-1/+0
| * | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()Lioncash2018-11-272-27/+26
* | | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
* | | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ \
| * | | | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
* | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)Lioncash2018-11-271-7/+17
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #1804 from lioncash/castbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | gdbstub: Silence value truncation warning within FpuWrite()Lioncash2018-11-271-1/+1
| | |/ / / / | |/| | | |
* | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
* | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
* | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
* | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
|/ / / / /
* | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| |/ / /
* | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
* | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ | |/ / / |/| | |
| * | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
* | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \
| * | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
* | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \
| * | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1692 from Hedges/GDBCleanbunnei2018-11-241-37/+86
|\ \ \ \ \
| * | | | | GDBStub improvements:Hedges2018-11-131-37/+86
* | | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-242-13/+31
|\ \ \ \ \ \
| * | | | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| * | | | | | Report resolution scaling support for vi and amDavid Marcec2018-11-162-13/+29
* | | | | | | Merge pull request #1747 from DarkLordZach/exefs-lfsbunnei2018-11-242-2/+48
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | patch_manager: Show LayeredExeFS patch in add-ons columnZach Hilman2018-11-211-3/+14
| * | | | | | patch_manager: Apply LayeredExeFS patchesZach Hilman2018-11-201-0/+25
| * | | | | | settings: Add option to dump ExeFS of games upon launchZach Hilman2018-11-202-0/+10
* | | | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-234-4/+102
|\ \ \ \ \ \ \
| * | | | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| * | | | | | | applets: Add StubAppletZach Hilman2018-11-223-0/+98
* | | | | | | | Merge pull request #1777 from lioncash/core-mgrbunnei2018-11-234-97/+225
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Relocate CPU core management to its own classLioncash2018-11-224-97/+225
* | | | | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
* | | | | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
* | | | | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| * | | | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| * | | | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| * | | | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| * | | | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
* | | | | | | | am: Correct build failureLioncash2018-11-211-2/+2
* | | | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| * | | | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| * | | | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| * | | | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| * | | | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / / / /
* | | | | | | | Merge pull request #1746 from lioncash/randombunnei2018-11-212-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| | |/ / / / / / | |/| | | | | |
* / | | | | | | file_sys/card_image: Provide named members for the GamecardInfo structLioncash2018-11-211-1/+12
|/ / / / / / /
* | | | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-2012-106/+840
|\ \ \ \ \ \ \
| * | | | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| * | | | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| * | | | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| * | | | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| * | | | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| * | | | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| * | | | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| * | | | | | | applet: Add operation completed callbackZach Hilman2018-11-184-6/+12
| * | | | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| * | | | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-185-11/+29
| * | | | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-186-44/+41
| * | | | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-182-4/+9
| * | | | | | | am: Implement text check software keyboard modeZach Hilman2018-11-185-14/+103
| * | | | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-1811-62/+106
| * | | | | | | qt/main: Register Qt Software Keyboard frontend with AMZach Hilman2018-11-181-0/+1
| * | | | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| * | | | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-183-0/+130
| * | | | | | | frontend/applets: Add frontend software keyboard provider and defaultZach Hilman2018-11-183-0/+63
| * | | | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-183-0/+77
| * | | | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| * | | | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| * | | | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| * | | | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| * | | | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| * | | | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| * | | | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \ \
| * | | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
* | | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / / /
* | | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-196-215/+114
* | | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
* | | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
* | | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
* | | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
* | | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
* | | | | | | settings: Add settings for multiple players and controllersZach Hilman2018-11-191-3/+48
* | | | | | | settings: Add Native type for keyboardZach Hilman2018-11-191-0/+210
* | | | | | | settings: Add Native type for mouse buttonsZach Hilman2018-11-192-0/+34
* | | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
* | | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
* | | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
* | | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
* | | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
* | | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
* | | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-197-23/+405
|\ \ \ \ \ \
| * | | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| * | | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| * | | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| * | | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| * | | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| * | | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-152-3/+7
| * | | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
* | | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ \
| * | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
* | | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
* | | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
* | | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \ \
| * | | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
|/ / / / / / /
* | | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \ \
| * | | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| * | | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-1610-14/+34
|\ \ \ \ \ \ \
| * | | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| * | | | | | | file_sys: Use common KeyManager in NCA container typesZach Hilman2018-11-026-7/+18
| * | | | | | | content_archive: Add optional KeyManager parameter to constructorZach Hilman2018-11-022-3/+5
* | | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-164-33/+16
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/errors: Remove currently unused filesystem error codesLioncash2018-11-161-10/+0
| * | | | | | | | file_sys/errors: Get rid of the ErrCodes namespaceLioncash2018-11-161-17/+5
| * | | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-164-14/+19
| | |_|/ / / / / | |/| | | | | |
* / | | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / / /
* | | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
* | | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \ \
| * | | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \ \
| * | | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-157-7/+48
|\ \ \ \ \ \ \
| * | | | | | | patch_manager: Add support for dumping decompressed NSOsZach Hilman2018-10-292-1/+14
| * | | | | | | settings: Add setting to control NSO dumpingZach Hilman2018-10-291-0/+1
| * | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-294-6/+33
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
* | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \
| * | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| * | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
* | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-144-2/+28
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-134-2/+28
| |/ / / / /
* | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \
| * | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| * | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / /
* | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \
| * | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / /
* | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-1410-16/+260
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-294-17/+75
| * | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| * | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| * | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-294-14/+32
| * | | | | loader/nro: Call RegisterRomFS from LoadZach Hilman2018-10-291-0/+5
| * | | | | control_metadata: Add GetRawBytes function to NACPZach Hilman2018-10-292-0/+7
| |/ / / /
* | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-134-3/+15
|\ \ \ \ \
| * | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-131-1/+2
| * | | | | settings: Add config option to set RNG seedZach Hilman2018-11-121-0/+2
| * | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| * | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| * | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| * | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
* | | | | Merge pull request #1652 from FreddyFunk/static-castbunnei2018-11-111-2/+2
|\ \ \ \ \
| * | | | | configure_system: Fix compiler warningFrederic Laing2018-11-061-2/+2
* | | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-106-35/+138
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | FixupsDavid Marcec2018-11-071-1/+1
| * | | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-076-35/+138
| |/ / / /
* | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \
| * | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| |/ / / /
* | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
* | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
* | | | | Added missing logDavid Marcec2018-11-071-0/+1
* | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
|/ / / /
* | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \
| * | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
* | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
| |_|_|/ |/| | |
* | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / /
* | | Merge pull request #1615 from lioncash/inputbunnei2018-11-021-1/+2
|\ \ \
| * | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-311-1/+2
| |/ /
* | | Merge pull request #1604 from FearlessTobi/port-4369bunnei2018-11-012-0/+15
|\ \ \
| * | | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-282-0/+15
* | | | service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
| |_|/ |/| |
* | | general: Remove unused boost inclusions where applicableLioncash2018-10-302-3/+0
* | | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-3024-144/+141
* | | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ \
| * | | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| * | | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| | |/ | |/|
* | | core: Make System references const where applicableLioncash2018-10-282-3/+3
* | | core: Add missing const variants of getters for the System classLioncash2018-10-282-10/+49
|/ /
* | Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ \
| * | svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| * | svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
| |/
* | file_sys/patch_manager: Remove unnecessary if-statements (#1586)Frederic L2018-10-281-7/+6
* | Merge pull request #1598 from DeeJayBro/delete-directorybunnei2018-10-281-2/+26
|\ \
| * | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
| |/
* | Merge pull request #1600 from DarkLordZach/nsp-secondary-loader-fixbunnei2018-10-281-17/+20
|\ \
| * | loader/nsp: Move secondary loader initialization to constructorZach Hilman2018-10-271-17/+20
| |/
* / key_manager: Use isxdigit instead of isdigit when reading key fileZach Hilman2018-10-281-1/+1
|/
* Merge pull request #1430 from DarkLordZach/remove-promote-dirbunnei2018-10-2617-95/+1
|\
| * vfs: Remove InterpretAsDirectory and related functionsZach Hilman2018-10-1917-95/+1
* | Merge pull request #1569 from lioncash/amiibobunnei2018-10-262-3/+5
|\ \
| * | yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-242-3/+5
* | | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
* | | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
* | | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
* | | nro: Make LoadNro method accessible outside of apploader code.bunnei2018-10-262-6/+18
* | | ips_layer: Use rle_size instead of data_size in RLE patch applicationZach Hilman2018-10-251-1/+1
* | | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ \
| * | | service/usb: Update service function tablesLioncash2018-10-251-21/+22
* | | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ \
| * | | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| * | | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| * | | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / /
* | | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ \
| * | | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| * | | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| * | | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| * | | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| * | | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| * | | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| * | | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| * | | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| * | | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / /
* | | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-253-43/+48
|\ \ \ \
| * | | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-243-43/+48
| |/ / /
* | | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ \
| * | | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |/ / | |/| |
* | | | Merge pull request #1563 from lioncash/framebunnei2018-10-241-4/+0
|\ \ \ \
| * | | | perf_stats: Remove unused variable within DoFrameLimiting()Lioncash2018-10-241-4/+0
| |/ / /
* | | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ \
| * | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ / /
* | | | Merge pull request #1561 from lioncash/fsbunnei2018-10-242-3/+6
|\ \ \ \ | |_|/ / |/| | |
| * | | vfs: Handle failure of file reading within VfsRawCopy()Lioncash2018-10-241-2/+6
| * | | key_manager: Remove unused variable in DeriveBase()Lioncash2018-10-241-1/+0
| |/ /
* | | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-245-30/+227
|\ \ \ | |/ / |/| |
| * | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-242-13/+37
| * | acc: Fix account UUID duplication errorZach Hilman2018-10-244-17/+47
| * | configure_system: Clear selection after user deleteZach Hilman2018-10-241-1/+1
| * | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-245-28/+129
| * | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| * | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| * | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| * | settings: Add users and current_user settings and remove usernameZach Hilman2018-10-241-1/+3
* | | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ \ | |/ / |/| |
| * | Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| * | Added break types to svcBreakDavid Marcec2018-10-231-4/+42
* | | Added Amiibo support (#1390)David2018-10-244-50/+295
* | | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-244-5/+29
|\ \ \
| * | | qt: Add support for dumping a DLC Data RomFSZach Hilman2018-10-182-0/+5
| * | | registered_cache: Deduplicate results of ListEntry and ListEntryFilterZach Hilman2018-10-172-2/+16
| * | | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| * | | patch_manager: Add support for using LayeredFS with DataZach Hilman2018-10-171-2/+3
* | | | Merge pull request #1540 from lioncash/handlebunnei2018-10-248-98/+95
|\ \ \ \ | |_|/ / |/| | |
| * | | kernel/process: Make the handle table per-processLioncash2018-10-208-98/+95
* | | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-224-0/+90
|\ \ \ \
| * | | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| * | | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| * | | | service: Add skeleton for psm serviceZach Hilman2018-10-214-0/+74
| |/ / /
* | | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ \
| * | | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / /
* | | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-214-2/+109
* | | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
* | | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-214-0/+44
* | | | am: Update service function tablesLioncash2018-10-214-15/+60
* | | | prepo: Update service function table.Lioncash2018-10-211-8/+13
* | | | lbl: Update service function table namesLioncash2018-10-211-28/+28
* | | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
|/ / /
* | | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ \
| * | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
* | | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ \
| * | | | es: Update service function tablesLioncash2018-10-191-7/+11
| * | | | audio: Update service function tablesLioncash2018-10-191-17/+20
| * | | | omm: Update service function tablesLioncash2018-10-191-16/+18
| * | | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| * | | | hid: Update service function tablesLioncash2018-10-191-6/+45
| * | | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| * | | | ns: Update service function tableLioncash2018-10-191-6/+49
| * | | | set_cal: Update service function tableLioncash2018-10-191-1/+2
* | | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ \
| * | | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \
| * | | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| * | | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| * | | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| * | | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| * | | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| * | | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| * | | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| * | | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |_|/ / | |/| | |
* | | | | crypto: Use compressed sizes in offset calculation for KIP decompressionZach Hilman2018-10-201-1/+2
| |/ / / |/| | |
* | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / |/| |
* | | Merge pull request #1523 from lioncash/lockbunnei2018-10-191-9/+15
|\ \ \
| * | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| * | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-181-9/+7
* | | | Merge pull request #1511 from lioncash/contentbunnei2018-10-192-258/+292
|\ \ \ \
| * | | | content_archive: Simpify assignment of bktr_base_romfs in the constructorLioncash2018-10-161-2/+1
| * | | | content_archive: Make IsValidNCA() an internally linked functionLioncash2018-10-162-3/+1
| * | | | content_archive: Simplify rights ID checkLioncash2018-10-161-2/+2
| * | | | content_archive: Split loading into separate functionsLioncash2018-10-162-253/+290
| * | | | content_archive: Pass and take NCASectionHeader instance by referenceLioncash2018-10-162-3/+3
| | |_|/ | |/| |
* | | | Merge pull request #1521 from ogniK5377/imp-mmubunnei2018-10-191-8/+42
|\ \ \ \
| * | | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
| | |_|/ | |/| |
* | | | core: Remove unnecessary assert in ArmInterface()Lioncash2018-10-181-2/+1
| |_|/ |/| |
* | | Merge pull request #1510 from lioncash/xcibunnei2018-10-183-7/+8
|\ \ \ | |/ / |/| |
| * | XCI: Add function for checking the existence of the program NCALioncash2018-10-163-7/+8
| |/
* | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1822-648/+1720
|\ \
| * | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| * | WipDavid Marcec2018-10-122-3/+23
| * | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| * | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| * | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| * | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| * | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| * | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| * | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| * | "Better Hid" rework part 1David Marcec2018-10-1022-644/+1500
* | | Merge pull request #1497 from bunnei/flush-framebuffersbunnei2018-10-182-3/+3
|\ \ \
| * | | config: Rename use_accurate_framebuffers -> use_accurate_gpu_emulation.bunnei2018-10-162-3/+3
| | |/ | |/|
* | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \
| * | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
* | | | Merge pull request #1509 from DarkLordZach/device-save-databunnei2018-10-181-1/+12
|\ \ \ \ | |_|/ / |/| | |
| * | | savedata_factory: Add TemporaryStorage SaveDataSpaceIdZach Hilman2018-10-161-1/+4
| * | | savedata_factory: Add support for DeviceSaveDataZach Hilman2018-10-161-0/+8
* | | | Merge pull request #1443 from DarkLordZach/lower-loader-logs-1bunnei2018-10-162-3/+9
|\ \ \ \
| * | | | patch_manager: Move non-Program RomFS patch log to DebugZach Hilman2018-10-131-2/+8
| * | | | content_archive: Move get key log to Trace levelZach Hilman2018-10-131-1/+1
* | | | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
* | | | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-1611-56/+71
|\ \ \ \ \
| * | | | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-159-27/+45
| * | | | | core: Make the live Cpu instances unique_ptrs instead of shared_ptrsLioncash2018-10-151-9/+9
| * | | | | core: Make the exclusive monitor a unique_ptr instead of a shared_ptrLioncash2018-10-155-15/+13
| * | | | | core: Make CPUBarrier a unique_ptr instead of a shared_ptrLioncash2018-10-153-11/+10
* | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-1610-42/+41
| |_|/ / / |/| | | |
* | | | | Merge pull request #1473 from lioncash/cmakebunnei2018-10-161-2/+2
|\ \ \ \ \
| * | | | | core/CMakeLists: Make all web_service-related libraries privateLioncash2018-10-111-1/+1
| * | | | | core/CMakeLists: Use target_compile_definitions instead of add_definitions for specifying ENABLE_WEB_SERVICELioncash2018-10-111-1/+1
* | | | | | file_sys/control_metadata: Get rid of magic constantsLioncash2018-10-161-3/+6
* | | | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-163-3/+20
|\ \ \ \ \ \
| * | | | | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-153-2/+18
| * | | | | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
* | | | | | | Merge pull request #1499 from lioncash/nrobunnei2018-10-157-28/+39
|\ \ \ \ \ \ \
| * | | | | | | nso: Return an optional address from LoadModuleLioncash2018-10-155-16/+29
| * | | | | | | nso: Make LoadModule take a VfsFile by const referenceLioncash2018-10-153-11/+9
| * | | | | | | nro: Make LoadNro take a VfsFile by const referenceLioncash2018-10-152-6/+6
| | |_|_|_|/ / | |/| | | | |
* | | | | | | crypto: Various crypto fixes for quickstart guideZach Hilman2018-10-151-2/+2
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #1486 from lioncash/filebunnei2018-10-144-63/+72
|\ \ \ \ \ \
| * | | | | | partition_data_manager: Reserve and insert data within output vector in DecryptPackage2()Lioncash2018-10-131-20/+16
| * | | | | | partition_data_manager: Remove unused std::map instance within DecryptPackage2()Lioncash2018-10-131-2/+0
| * | | | | | partition_data_manager: Take package2_keys by const referenceLioncash2018-10-132-2/+3
| * | | | | | partition_data_manager: Move IV data to where it's needed in DecryptPackage2()Lioncash2018-10-131-3/+1
| * | | | | | partition_data_manager: Remove commented out codeLioncash2018-10-131-2/+0
| * | | | | | key_manager/partition_data_manager: Silence truncation compiler warningsLioncash2018-10-134-10/+15
| * | | | | | partition_data_manager: Dehardcode array boundsLioncash2018-10-132-7/+12
| * | | | | | partition_data_manager: Take VirtualFile by const reference in constructorLioncash2018-10-132-2/+2
| * | | | | | partition_data_manager: Amend constructor initializer list orderLioncash2018-10-131-2/+3
| * | | | | | partition_data_manager: Remove unused includesLioncash2018-10-132-4/+1
| * | | | | | key_manager: Use std::vector's insert() instead of std::copy with a back_inserterLioncash2018-10-131-2/+2
| * | | | | | key_manager: Brace long conditional bodyLioncash2018-10-131-1/+2
| * | | | | | key_manager: Don't assume file seeks and reads will always succeedLioncash2018-10-131-7/+17
| * | | | | | key_manager: Remove unnecessary seek in DeriveSDSeed()Lioncash2018-10-131-1/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-145-15/+14
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-135-15/+14
| |/ / / /
* | | | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ \ \
| * | | | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / / /
* / / / / Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / / /
* | | | Merge pull request #1409 from DarkLordZach/key-derivationbunnei2018-10-137-74/+1569
|\ \ \ \
| * | | | partition_data_manager: Rename system files for hekateZach Hilman2018-10-074-178/+228
| * | | | crypto: Add PartitionDataManagerZach Hilman2018-10-073-0/+692
| * | | | key_manager: Add support for loading keys from partition dataZach Hilman2018-10-072-0/+88
| * | | | key_manager: Add ETicket key derivationZach Hilman2018-10-073-2/+277
| * | | | key_manager: Add base key derivationZach Hilman2018-10-072-4/+220
| * | | | key_manager: Add BIS key getterZach Hilman2018-10-072-2/+19
| * | | | key_manager: Add support for more keysZach Hilman2018-10-072-3/+99
| * | | | key_manager: Add keyblob supportZach Hilman2018-10-072-0/+14
| * | | | key_manager: Add support for crypto revisions past 04Zach Hilman2018-10-071-43/+63
| * | | | key_manager: Add support for comments in keyfilesZach Hilman2018-10-071-0/+3
| * | | | vfs: Move forward declarations to separate fileZach Hilman2018-10-072-9/+22
| * | | | key_manager: Add support for console-specific keyfileZach Hilman2018-10-072-3/+13
| * | | | key_manager: Rename KEK to KekZach Hilman2018-10-072-8/+9
* | | | | Merge pull request #1483 from lioncash/codesetbunnei2018-10-137-83/+45
|\ \ \ \ \
| * | | | | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-127-83/+45
* | | | | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ / / /
* | | | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ \ \
| * | | | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| * | | | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| * | | | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ \ \
| * | | | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| * | | | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ \
| * | | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| * | | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ / /
* | | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ \
| * | | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / /
* | | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ \
| * | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| |/ / /
* / / / nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
|/ / /
* | | kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-109-38/+39
* | | Merge pull request #1461 from lioncash/warnbunnei2018-10-101-3/+3
|\ \ \
| * | | ips_layer: Silence truncation and conversion warningsLioncash2018-10-091-3/+3
* | | | Merge pull request #1464 from lioncash/uniquebunnei2018-10-106-15/+13
|\ \ \ \ | |_|/ / |/| | |
| * | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptrLioncash2018-10-096-15/+13
| |/ /
* | | Merge pull request #1459 from ogniK5377/breakbunnei2018-10-091-5/+20
|\ \ \
| * | | Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
| * | | Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
| * | | svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
* | | | Merge pull request #1465 from lioncash/telemetrybunnei2018-10-092-7/+9
|\ \ \ \
| * | | | telemetry_session: Remove doxygen comment for a non-existent parameterLioncash2018-10-091-1/+0
| * | | | telemetry_session: Add missing includesLioncash2018-10-092-2/+5
| * | | | telemetry_session: Remove unimplemented FinalizeAsyncJob prototypeLioncash2018-10-091-2/+0
| * | | | telemetry_session: Use a std::array in GenerateTelemetryId()Lioncash2018-10-091-2/+4
| | |/ / | |/| |
* | | | ips_layer: Avoid constructing std::vector instances where not necessaryLioncash2018-10-091-6/+25
* | | | ips_layer: Remove unnecessary explicit std::pair constructor in std::arrayLioncash2018-10-091-5/+13
* | | | ips_layer: Add missing includesLioncash2018-10-092-7/+17
* | | | ips_layer: std::move data within PatchIPS() and Apply()Lioncash2018-10-091-2/+5
|/ / /
* | | Merge pull request #1423 from DarkLordZach/romfs-file-extsbunnei2018-10-085-10/+38
|\ \ \
| * | | patch_manager: Avoid romfs_ext requirement for patchingZach Hilman2018-10-041-4/+1
| * | | fsmitm_romfsbuild: Extract stubs and IPS to romfs_ext dirZach Hilman2018-10-045-21/+38
| * | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFSZach Hilman2018-10-041-0/+14
* | | | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-084-23/+299
|\ \ \ \ | |_|/ / |/| | |
| * | | ips_layer: Fix inaccuracies with comments and flagsZach Hilman2018-10-043-16/+51
| * | | ips_layer: Deduplicate resource usageZach Hilman2018-10-043-31/+37
| * | | ips_layer: Add support for escape sequences and midline commentsZach Hilman2018-10-043-8/+41
| * | | patch_manager: Add support for IPSwitch format patchesZach Hilman2018-10-041-22/+56
| * | | ips_layer: Add IPSwitchCompiler to process IPSwitch formatZach Hilman2018-10-042-0/+168
| |/ /
* | | Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ \ \
| * | | Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | |/ | |/|
* | | Merge pull request #1457 from ogniK5377/unmap-bufferbunnei2018-10-081-1/+6
|\ \ \
| * | | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
| |/ /
* | | nso/nro: Use default allocation size for arg_dataZach Hilman2018-10-074-14/+20
* | | cmd: Support passing game arguments from command lineZach Hilman2018-10-072-2/+2
* | | settings: Add program_args string settingZach Hilman2018-10-071-0/+1
* | | nso/nro: Add NSO arguments structure to data sectionZach Hilman2018-10-074-3/+38
|/ /
* | Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-0715-16/+128
|\ \
| * | romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-059-6/+36
| * | patch_manager: Add support for NSP packed updatesZach Hilman2018-10-051-2/+2
| * | patch_manager: Add support for packed updatesZach Hilman2018-10-054-5/+18
| * | loader: Add getter for packed updateZach Hilman2018-10-056-3/+58
| * | loader: Add ReadRomFSIVFCOffset to NSP, XCI, and NAX loadersZach Hilman2018-10-056-6/+20
| |/
* | Merge pull request #1448 from ogniK5377/frontend-accessbunnei2018-10-074-0/+26
|\ \
| * | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| * | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
* | | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-064-14/+53
|\ \ \ | |/ / |/| |
| * | Review comments -part 4fearlessTobi2018-10-021-0/+1
| * | Address more review commentsfearlessTobi2018-10-021-1/+1
| * | Address a bunch of review commentsfearlessTobi2018-10-022-6/+7
| * | Port web_service from CitrafearlessTobi2018-10-024-14/+51
* | | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
* | | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
* | | Merge pull request #1439 from lioncash/threadbunnei2018-10-0514-206/+392
|\ \ \ | |_|/ |/| |
| * | kernel/thread: Make all instance variables privateLioncash2018-10-0414-206/+392
* | | Merge pull request #1415 from DarkLordZach/ipsbunnei2018-10-048-36/+255
|\ \ \
| * | | nso: Optimize loading of IPS patchesZach Hilman2018-10-025-51/+43
| * | | deconstructed_rom_directory: Force NSO loader to patch NSOsZach Hilman2018-10-011-1/+3
| * | | nso: Add framework to support patching of uncompressed NSOsZach Hilman2018-10-012-2/+17
| * | | patch_manager: Add PatchNSO functionZach Hilman2018-10-013-0/+104
| * | | patch_manager: Use strings for patch type instead of enumZach Hilman2018-10-012-29/+33
| * | | file_sys: Implement function to apply IPS patchesZach Hilman2018-10-012-0/+103
| * | | nso: Replace NSOHeader padding bytes with build IDZach Hilman2018-10-011-2/+1
| | |/ | |/|
* | | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ \
| * | | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| |/ /
* | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \
| * | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| | |/ | |/|
* | | Merge pull request #1436 from lioncash/viewbunnei2018-10-042-73/+101
|\ \ \
| * | | submission_package: Avoid dangling std::string_view within SetTicketKeys()Lioncash2018-10-031-2/+5
| * | | submission_package: Correct location of null check within SetTicketKeys()Lioncash2018-10-031-3/+6
| * | | submission_package: Use std::string's rfind() when looking for the extension in InitializeExeFSAndRomFS()Lioncash2018-10-031-1/+1
| * | | submission_package: Ensure the 'extracted' member variable is always initializedLioncash2018-10-032-3/+1
| * | | submission_package: Move ExeFS and RomFS initialization to its own functionLioncash2018-10-032-10/+18
| * | | submission_package: Move NCA reading code to its own functionLioncash2018-10-032-43/+48
| * | | submission_package: Move ticket key setting to its own functionLioncash2018-10-031-21/+28
| * | | submission_package: Invert conditionals within NSP's constructor to reduce nestingLioncash2018-10-031-45/+49
| |/ /
* | | Merge pull request #1432 from lioncash/lblbunnei2018-10-041-19/+19
|\ \ \
| * | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| | |/ | |/|
* | | Merge pull request #1435 from lioncash/xcibunnei2018-10-041-1/+3
|\ \ \ | |/ / |/| |
| * | card_image: Ensure program_nca_status is always initializedLioncash2018-10-031-1/+3
| |/
* | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-012-21/+28
* | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-013-5/+8
* | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
* | romfs_factory: Read from all locations with StorageId NoneZach Hilman2018-10-011-26/+25
* | patch_manager: Add DLC recognition to PatchManagerZach Hilman2018-10-012-0/+27
|/
* Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\
| * Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
* | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
* | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
* | kernel/process: Make data member variables privateLioncash2018-09-3016-72/+117
* | arm_interface: Add missing fpsr/tpidr members to the ThreadContext structLioncash2018-09-303-5/+15
* | loader: Make the Load() function take a process as a regular reference, not a SharedPtrLioncash2018-09-2918-42/+28
* | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \
| * | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
* | | Merge pull request #1395 from lioncash/vmbunnei2018-09-2917-158/+413
|\ \ \
| * | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-2511-75/+60
| * | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| * | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-255-20/+56
| * | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-2410-38/+259
* | | | Merge pull request #1394 from lioncash/streambunnei2018-09-271-1/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | stream: Preserve enum class type in GetState()Lioncash2018-09-241-1/+1
| |/ /
* | | Merge pull request #1389 from PhiBabin/valgrindMat M2018-09-271-1/+1
|\ \ \
| * | | FPCR register was uninitialized at start upPhilippe Babin2018-09-231-1/+1
* | | | fsmitm_romfsbuild: std::move std::vector instances in Build()Lioncash2018-09-261-2/+2
* | | | fsmitm_romfsbuild: Replace manual value aligning with Common::AlignUp()Lioncash2018-09-261-12/+11
* | | | Merge pull request #1399 from lioncash/schedbunnei2018-09-264-14/+14
|\ \ \ \
| * | | | core_cpu: Make arm_interface instances a std::unique_ptrLioncash2018-09-252-4/+4
| * | | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-253-10/+10
| |/ / /
* | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \
| * | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
* | | | | patch_manager: Invert conditionals within ApplyLayeredFS()Lioncash2018-09-261-27/+30
* | | | | vfs_vector: Amend initializer list order in VectorVfsFile's constructor initializer listLioncash2018-09-261-1/+1
* | | | | fsmitm_romfsbuild: Avoid type truncation warningsLioncash2018-09-261-7/+10
* | | | | fsmitm_romfsbuild: Remove unnecessary constructors and initializers for RomFSBuildFileContext and RomFSBuildDirectoryContextLioncash2018-09-261-5/+3
* | | | | fsmitm_romfsbuild: Remove unnecessary loops in Build()Lioncash2018-09-261-6/+0
* | | | | fsmitm_romfsbuild: Make auto variable into a std::size_t variable within Build()Lioncash2018-09-261-1/+1
* | | | | vfs/etc: Append std:: to size_t usagesLioncash2018-09-266-22/+23
* | | | | vfs_concat/vfs_layered: Remove friend declarations from ConcatenatedVfsFileLioncash2018-09-268-61/+59
* | | | | vfs_static: Remove template byte parameter from StaticVfsFileLioncash2018-09-254-42/+42
* | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-2524-33/+1037
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | fsmitm: Cleanup and modernize fsmitm portZach Hilman2018-09-2421-377/+377
| * | | | qt: Add UI elements for LayeredFS and related toolsZach Hilman2018-09-222-2/+2
| * | | | romfs: Implement CreateRomFSZach Hilman2018-09-222-4/+25
| * | | | file_sys: Port Atmosphere-NX fs_mitm implementationZach Hilman2018-09-222-0/+474
| * | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| * | | | bis_factory: Add mod directory VFS getterZach Hilman2018-09-223-3/+18
| * | | | patch_manager: Add LayeredFS mods supportZach Hilman2018-09-222-1/+44
| * | | | vfs_concat: Rewrite and fix ConcatenatedVfsFileZach Hilman2018-09-222-14/+59
| * | | | vfs_layered: Add LayeredVfsDirectoryZach Hilman2018-09-222-0/+178
| * | | | vfs_vector: Add VectorVfsFileZach Hilman2018-09-222-0/+75
| * | | | vfs_static: Add StaticVfsFileZach Hilman2018-09-222-0/+78
| * | | | vfs: Add and rewite VfsRawCopy functionsZach Hilman2018-09-222-6/+36
| * | | | vfs: Add GetEntries methodZach Hilman2018-09-224-0/+32
* | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \
| * | | | | svc: Updated svc namestech4me2018-09-241-7/+7
* | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
* | | | | | Stubbed IRS (#1349)David2018-09-242-18/+167
* | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
* | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-231-1/+8
| |_|_|/ / |/| | | |
* | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
* | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| |_|/ / |/| | |
* | | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
* | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \
| * | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
* | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-214-1/+10
|\ \ \ \ \
| * | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-214-1/+10
| |/ / / /
* | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \
| * | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
| | |_|/ / | |/| | |
* | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \
| * | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| * | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
* | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
| |_|/ / / |/| | | |
* | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \
| * | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| |/ / / /
* | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-201-0/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| * | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| |/ / /
* | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \
| * | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ | |/| |
* | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \
| * | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| * | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / | |/| |
* | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \
| * | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| * | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| * | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| * | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| * | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| * | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / /
* | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
* | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / /
* | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
* | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \
| * | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| | |/ | |/|
* | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
* | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ /
* | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \
| * | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
* | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \
| * | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| |/ /
* | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \
| * | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| |/ /
* | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \
| * | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ /
* | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \
| * | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| * | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| * | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| |/ /
* | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-191-2/+3
* | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \
| * | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| * | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ /
* | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \
| * | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ /
* / / arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
|/ /
* | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \
| * | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
* | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \
| * | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ /
* | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \
| * | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ /
* | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \
| * | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| * | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| * | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| * | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ /
* | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \
| * | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |/ | |/|
* / | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1579-395/+409
|/ /
* | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-144-9/+10
|\ \
| * | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-134-9/+10
| |/
* | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \
| * | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/
* | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ | |/ |/|
| * services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
* | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/
* Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-132-0/+4
|\
| * Add audio stretching supportfearlessTobi2018-09-082-0/+4
* | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \
| * | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
* | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \
| * | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| * | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
* | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
* | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
|/ / /
* | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \
| * | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ /
* / / service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
|/ /
* | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \
| * | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
* | | externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/ /
* | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-112-2/+26
* | video_core: Move command buffer loop.Markus Wick2018-09-102-31/+12
* | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \
| * | hid: Implement ReloadInputDevicesfearlessTobi2018-09-092-4/+6
| |/
* / service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
|/
* core: Migrate current_process pointer to the kernelLioncash2018-09-074-5/+34
* Merge pull request #1250 from lioncash/file-sysbunnei2018-09-074-4/+16
|\
| * file_sys/nca_patch: Amend constructor initializer list orderLioncash2018-09-061-2/+2
| * file_sys/nca_patch: Remove unnecessary includesLioncash2018-09-062-2/+9
| * file_sys/patch_manager: Add missing includesLioncash2018-09-062-0/+5
* | core/core: Remove unnecessary sm/controller includeLioncash2018-09-065-2/+5
|/
* Merge pull request #1242 from lioncash/file-sysbunnei2018-09-062-8/+17
|\
| * file_sys/submission_package: Correct constructor initialization list orderLioncash2018-09-051-2/+2
| * file_sys/submission_package: Replace includes with forward declarations where applicableLioncash2018-09-052-6/+15
* | bktr: Fix bucket overlap errorZach Hilman2018-09-047-9/+9
* | drd: Parse title ID from program metadataZach Hilman2018-09-042-4/+29
* | patch_manager: Centralize Control-type NCA parsingZach Hilman2018-09-044-55/+74
* | nsp: Fix error masking issue with XCI filesZach Hilman2018-09-043-6/+13
* | game_list: Fix version display on non-NAND titlesZach Hilman2018-09-043-8/+33
* | bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
* | bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
* | bktr: Fix missing includes and optimize styleZach Hilman2018-09-0411-101/+107
* | loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
* | loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
* | patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
* | file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
* | file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
* | content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
* | registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
* | game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-041-1/+1
* | aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
|/
* main: Only show DRD deprecation warning onceZach Hilman2018-09-046-3/+6
* control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
* card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
* nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
* qt: Add UI support for NSP filesZach Hilman2018-09-041-0/+4
* registration: Add support for installing NSP filesZach Hilman2018-09-042-10/+16
* loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
* card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
* file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
* drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
* loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
* key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
* Merge pull request #1237 from degasus/optimizationsbunnei2018-09-042-3/+3
|\
| * core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
* | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-041-0/+2
|\ \
| * | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-041-0/+2
* | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0420-26/+62
|\ \ \
| * | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0420-26/+62
| | |/ | |/|
* | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-042-2/+6
|\ \ \
| * | | Update microprofile scopes.Markus Wick2018-09-042-2/+6
| |/ /
* | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ | |/ / |/| |
| * | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
* | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \
| * | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ | |/|
* / | vfs_real: Forward declare IOFileLioncash2018-09-027-14/+31
|/ /
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-022-2/+30
|\ \
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-3118-43/+85
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-313-38/+17
* core: Make the main System class use the PImpl idiomLioncash2018-08-314-276/+383
* kernel: Eliminate kernel global stateLioncash2018-08-2951-440/+665
* Merge pull request #1193 from lioncash/privbunnei2018-08-282-8/+8
|\
| * gpu: Make memory_manager privateLioncash2018-08-282-8/+8
* | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
|/
* Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
* | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \
| * | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
| |/
* | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \
| * | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
* | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \
| * | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ | |/|
* | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \
| * | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
* | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-271-0/+1
|\ \ \ \
| * | | | debug_utils: Remove unused includesLioncash2018-08-251-0/+1
| | |_|/ | |/| |
* | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \
| * | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| * | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
* | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \
| * | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \
| * | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / /
* | | | / set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
| |_|_|/ |/| | |
* | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ /
* | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2527-81/+806
|\ \ \
| * | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| * | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| * | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| * | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| * | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| * | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| * | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| * | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| * | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| * | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| * | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| * | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| * | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| * | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| * | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-232-8/+11
| * | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| * | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| * | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| * | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| * | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| * | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| * | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
| | |/ | |/|
* | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-241-0/+7
|\ \ \ | |_|/ |/| |
| * | qt: Add filename and title id to window title while runningZach Hilman2018-08-231-0/+7
| |/
* / Added GetBootMode (#1107)David2018-08-244-3/+25
|/
* Merge pull request #1136 from tech4me/masterbunnei2018-08-222-4/+4
|\
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-212-4/+4
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-223-7/+18
|\ \
| * | Port #3353 from CitrafearlessTobi2018-08-213-7/+18
* | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
* | | PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
* | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \
| * | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
* | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
|/ / /
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/|
* / | perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ /
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-218-8/+34
|\ \
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-216-5/+22
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
* | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \
| * | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
* | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ | |_|/ / |/| | |
| * | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| * | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| * | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| * | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| * | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| * | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| * | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| * | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| * | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| * | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| * | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| * | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| * | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |/ | |/|
* | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ | |_|/ |/| |
| * | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| * | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
* | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-211-62/+7
|\ \ \ | |_|/ |/| |
| * | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-151-62/+7
* | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \
| * | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ | |/|
* | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ | |/ / |/| |
| * | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| * | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| * | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| * | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| * | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| * | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| * | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| * | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| * | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| * | If statement style changeDavid Marcec2018-08-111-11/+19
| * | Second round of account changesDavid Marcec2018-08-113-18/+21
| * | First round of account changesDavid Marcec2018-08-113-49/+55
| * | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| * | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1137-148/+758
| |\ \
| * | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| * | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| * | | Open first user addedDavid Marcec2018-08-081-1/+3
| * | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| * | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| * | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| * | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
* | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
* | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \
| * | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6
* | | | | Merge pull request #1093 from greggameplayer/GetDefaultDisplayResolutionChangeEventbunnei2018-08-172-1/+13
|\ \ \ \ \
| * | | | | correct coding stylegreggameplayer2018-08-161-1/+1
| * | | | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
* | | | | | Merge pull request #1087 from MerryMage/dynarmicbunnei2018-08-171-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | dynarmic: Update to 550d662MerryMage2018-08-161-0/+3
* | | | | | Merge pull request #1085 from lioncash/namespacebunnei2018-08-162-12/+14
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | common: Namespace hex_util.h/.cppLioncash2018-08-162-12/+14
| |/ / / /
* | | | | Merge pull request #1075 from lioncash/includebunnei2018-08-164-35/+22
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | loader/nca: Remove unnecessary includes and member variablesLioncash2018-08-152-20/+11
| * | | | loader/xci: Remove unnecessary includes and member variablesLioncash2018-08-152-15/+11
| | |_|/ | |/| |
* | | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-1624-58/+1135
|\ \ \ \
| * | | | registration: Various style and documentation improvementsZach Hilman2018-08-123-18/+22
| * | | | registration: Add support for force overwrite of installedZach Hilman2018-08-122-22/+48
| * | | | vfs_real: Add CreateFullPath to Create* operationsZach Hilman2018-08-122-13/+6
| * | | | control_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-2/+1
| * | | | romfs: Remove cyclic shared_ptr leak in romfs codeZach Hilman2018-08-123-8/+8
| * | | | registration: Update documentation and styleZach Hilman2018-08-125-42/+69
| * | | | nca_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-3/+2
| * | | | bis_factory: Create NAND dirs if they don't existZach Hilman2018-08-121-2/+9
| * | | | registration: Take RawCopy function as parameterZach Hilman2018-08-122-10/+15
| * | | | registered_cache: Fix missing reading from yuzu_metaZach Hilman2018-08-121-7/+16
| * | | | file_sys: Comply to style guidelinesZach Hilman2018-08-126-27/+38
| * | | | qt: Add 'Install to NAND' option to menuZach Hilman2018-08-122-1/+2
| * | | | file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
| * | | | file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
| * | | | card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
| * | | | vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
| * | | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| * | | | bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
| * | | | loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
| * | | | loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
| * | | | vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
| * | | | crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
* | | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ \
| * | | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| * | | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
* | | | | | Merge pull request #1079 from lioncash/fmtbunnei2018-08-163-12/+11
|\ \ \ \ \ \
| * | | | | | loader: Make ResultStatus directly compatible with fmtLioncash2018-08-153-12/+11
| |/ / / / /
* | | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-163-1/+12
|\ \ \ \ \ \
| * | | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-133-1/+12
* | | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ \
| * | | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / / | |/| | | | |
* / | | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
|/ / / / / /
* | | | | | Merge pull request #1067 from lioncash/initbunnei2018-08-151-3/+3
|\ \ \ \ \ \
| * | | | | | emu_window: Ensure WindowConfig members are always initializedLioncash2018-08-151-3/+3
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1073 from lioncash/3dsbunnei2018-08-156-17/+0
|\ \ \ \ \ \
| * | | | | | loader: Remove address mapping remnants from citraLioncash2018-08-156-17/+0
| |/ / / / /
* | | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ \
| * | | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| |/ / / / /
* | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| * | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
* | | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ \
| * | | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / /
* | | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-146-0/+148
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| * | | | | Added missing channel devicesDavid Marcec2018-08-135-0/+144
* | | | | | arm_dynarmic: Remove IsExecuting check from PrepareRescheduleMerryMage2018-08-131-3/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #1032 from lioncash/sanitizebunnei2018-08-131-10/+10
|\ \ \ \ \
| * | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()Lioncash2018-08-121-10/+10
* | | | | | Merge pull request #1031 from lioncash/verbositybunnei2018-08-132-7/+7
|\ \ \ \ \ \
| * | | | | | card_image: Use type aliases to shorten definitionsLioncash2018-08-122-6/+6
| * | | | | | card_image: Simplify return statement of GetSubdirectories()Lioncash2018-08-121-1/+1
| |/ / / / /
* | / / / / kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
| |/ / / / |/| | | |
* | | | | Merge pull request #1043 from Subv/timingbunnei2018-08-133-2/+11
|\ \ \ \ \
| * | | | | CPU/Timing: Use an approximated amortized amount of ticks when advancing timing.Subv2018-08-132-1/+11
| * | | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
| |/ / / /
* | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-132-2/+2
|\ \ \ \ \
| * | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| |/ / / /
* | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-134-5/+13
|\ \ \ \ \
| * | | | | Core/HLE: Make the 'reschedule_pending' flag atomic.Subv2018-08-131-1/+1
| * | | | | CPU/HLE: Lock the HLE mutex before performing a reschedule.Subv2018-08-131-0/+3
| * | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| * | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-132-4/+4
| |/ / / /
* | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \
| * | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / /
* | | | | vfs: Make VfsFilesystem constructor explicitLioncash2018-08-121-1/+1
* | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-124-10/+16
* | | | | Merge pull request #1025 from ogniK5377/bad-castbunnei2018-08-124-4/+4
|\ \ \ \ \
| * | | | | made ResultStatus a u16David Marcec2018-08-123-3/+3
| * | | | | Fixed invalid cast in loaderDavid Marcec2018-08-121-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \
| * | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | |/ / / | |/| | |
* | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-121-5/+26
|\ \ \ \ \
| * | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-121-4/+2
| * | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-121-5/+28
| | |/ / / | |/| | |
* | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
* | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| |/ / / |/| | |
* | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
|/ / /
* | | Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\ \ \
| * | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| * | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| * | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
* | | | core: Namespace EmuWindowLioncash2018-08-124-5/+16
|/ / /
* | | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1214-103/+219
|\ \ \
| * | | loader: Add more descriptive errorsZach Hilman2018-08-1014-103/+219
| | |/ | |/|
* / | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-112-5/+2
|/ /
* | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \
| * | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| * | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
* | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \
| * | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| * | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
* | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1013-113/+560
|\ \ \ \ | |_|/ / |/| | |
| * | | vfs: Fix documentationZach Hilman2018-08-091-2/+2
| * | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-091-1/+1
| * | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-091-17/+27
| * | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| * | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| * | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| * | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-096-13/+34
| * | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| * | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| * | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| * | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
* | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ | |/ / / |/| | |
| * | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |/ | |/|
* | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \
| * | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
* | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ | |_|_|/ |/| | |
| * | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ /
* | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0812-8/+128
|\ \ \
| * | | loader: Add icon and title support to XCIZach Hilman2018-08-076-3/+43
| * | | Use const where applicableZach Hilman2018-08-072-2/+2
| * | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-077-6/+86
* | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ | |_|_|/ |/| | |
| * | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| | |/ | |/|
* | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \
| * | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| |/ /
* | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \
| * | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
* | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / /
* / / acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
|/ /
* | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \
| * | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
* | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \
| * | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |/ | |/|
* | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \
| * | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ /
* | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \
| * | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ /
* | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \
| * | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| * | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/ /
* | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \
| * | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ /
* | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \
| * | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| * | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ /
* | | Merge pull request #952 from lioncash/usbbunnei2018-08-074-0/+257
|\ \ \
| * | | service: Add usb servicesLioncash2018-08-074-0/+257
| |/ /
* | | Merge pull request #949 from lioncash/privbunnei2018-08-073-7/+21
|\ \ \
| * | | client_port: Make all data members privateLioncash2018-08-073-7/+21
| |/ /
* / / loader: Fix scope error in DeconstructedRomDirectoryZach Hilman2018-08-071-1/+1
|/ /
* | Merge pull request #931 from DarkLordZach/nca-as-drdbunnei2018-08-074-37/+24
|\ \
| * | loader: Make AppLoader_NCA rely on directory loading codeZach Hilman2018-08-064-37/+24
* | | GDBStub works with both Unicorn and Dynarmic now (#941)Hedges2018-08-074-2/+26
* | | Merge pull request #940 from lioncash/privatebunnei2018-08-071-4/+8
|\ \ \
| * | | kernel/event: Make data members privateLioncash2018-08-061-4/+8
* | | | Merge pull request #934 from lioncash/chronobunnei2018-08-074-16/+16
|\ \ \ \ | |/ / / |/| | |
| * | | perf_stats: Correct literal used for MAX_LAG_TIME_USLioncash2018-08-061-2/+2
| * | | core_timing: Make GetGlobalTimeUs() return std::chrono::microsecondsLioncash2018-08-064-14/+14
| |/ /
* | | Merge pull request #933 from lioncash/memorybunnei2018-08-061-12/+11
|\ \ \
| * | | memory: Make prototype parameter names match their definitionsLioncash2018-08-061-5/+5
| * | | memory: Correct prototype of ZeroBlockLioncash2018-08-061-1/+1
| * | | memory: Remove unnecessary const qualifiers in prototypesLioncash2018-08-061-9/+8
| |/ /
* | | Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
* | | Merge pull request #932 from lioncash/funcbunnei2018-08-062-9/+9
|\ \ \
| * | | core_timing: Convert typedef into a type aliasLioncash2018-08-061-4/+4
| * | | core_timing: Use transparent functors where applicableLioncash2018-08-061-5/+5
| |/ /
* | | Merge pull request #929 from lioncash/addrbunnei2018-08-062-83/+89
|\ \ \
| * | | gdbstub: Use type alias for breakpoint mapsLioncash2018-08-051-37/+42
| * | | gdbstub: Move all file-static variables into the GDBStub namespaceLioncash2018-08-051-35/+36
| * | | gdbstub: Replace PAddr alias with VAddrLioncash2018-08-052-14/+14
* | | | Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ \ \ \
| * | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| |/ / /
* | | | Merge pull request #925 from bunnei/audrenbunnei2018-08-064-233/+16
|\ \ \ \ | |_|/ / |/| | |
| * | | audio_core: Implement audren_u audio playback.bunnei2018-08-052-218/+9
| * | | audio_core: Use s16 where possible for audio samples.bunnei2018-08-051-3/+3
| * | | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-052-11/+3
| * | | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-041-1/+1
| | |/ | |/|
* | | Merge pull request #912 from lioncash/global-varbunnei2018-08-057-27/+57
|\ \ \ | |_|/ |/| |
| * | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-043-7/+7
| * | video_core: Eliminate the g_renderer global variableLioncash2018-08-047-24/+54
* | | Merge pull request #924 from lioncash/arpbunnei2018-08-054-0/+95
|\ \ \
| * | | service: Add arp servicesLioncash2018-08-054-0/+95
| | |/ | |/|
* | | Merge pull request #921 from lioncash/viewbunnei2018-08-055-35/+35
|\ \ \
| * | | aes_util: Add static assertion to Transcode() and XTSTranscode() to ensure well-defined behaviorLioncash2018-08-041-0/+4
| * | | aes_util: Make CalculateNintendoTweak() an internally linked functionLioncash2018-08-042-12/+10
| * | | aes_util: Make Transcode() a const member functionLioncash2018-08-042-8/+9
| * | | core/crypto: Remove unnecessary includesLioncash2018-08-044-5/+5
| * | | key_manager: Use regular std::string instead of std::string_viewLioncash2018-08-042-10/+7
| |/ /
* / / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ /
* | Merge pull request #849 from DarkLordZach/xcibunnei2018-08-0426-62/+1318
|\ \ | |/ |/|
| * Add missing parameter to files.push_back()Zach Hilman2018-08-011-5/+5
| * Fix merge conflicts with opus and update docsZach Hilman2018-08-012-1/+3
| * Use more descriptive error codes and messagesZach Hilman2018-08-017-19/+51
| * Use static const instead of const staticZach Hilman2018-08-011-2/+2
| * Use ErrorEncrypted where applicable and fix no keys crashZach Hilman2018-08-014-17/+37
| * Add missing includes and use const where applicableZach Hilman2018-08-0111-24/+40
| * Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-012-7/+20
| * Make XCI comply to review and style guidelinesZach Hilman2018-08-0114-455/+222
| * Extract mbedtls to cpp fileZach Hilman2018-08-014-86/+126
| * Add missing string.h includeZach Hilman2018-08-011-0/+1
| * Update mbedtls and fix compile errorZach Hilman2018-08-011-0/+1
| * Remove files that are not usedZach Hilman2018-08-0124-42/+1406
* | Merge pull request #913 from lioncash/unused-funcbunnei2018-08-041-16/+0
|\ \
| * | memory: Remove unused GetSpecialHandlers() functionLioncash2018-08-031-16/+0
* | | Merge pull request #914 from lioncash/codesetbunnei2018-08-045-20/+41
|\ \ \
| * | | kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| * | | kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-035-20/+40
| |/ /
* / / kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
|/ /
* | Merge pull request #908 from lioncash/memorybunnei2018-08-0314-502/+29
|\ \
| * | core/memory: Get rid of 3DS leftoversLioncash2018-08-0314-502/+29
* | | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-035-5/+47
* | | Merge pull request #898 from lioncash/migbunnei2018-08-034-0/+53
|\ \ \ | |/ / |/| |
| * | service: Add migration servicesLioncash2018-08-024-0/+53
* | | Merge pull request #892 from lioncash/globalbunnei2018-08-033-11/+11
|\ \ \
| * | | video_core: Make global EmuWindow instance part of the base renderer classLioncash2018-08-023-11/+11
* | | | Merge pull request #894 from lioncash/objectbunnei2018-08-0343-155/+185
|\ \ \ \
| * | | | kernel: Move object class to its own source filesLioncash2018-08-0243-155/+185
| | |/ / | |/| |
* | | | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ \ \
| * | | | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| * | | | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| * | | | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| |/ / /
* | | | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ \ \
| * | | | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| * | | | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| * | | | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ / /
* | | | Merge pull request #903 from lioncash/copybunnei2018-08-031-3/+6
|\ \ \ \
| * | | | vfs_vector: Remove unused variable in FindAndRemoveVectorElement()Lioncash2018-08-021-2/+2
| * | | | vfs_vector: Avoid unnecessary copies where applicableLioncash2018-08-021-2/+5
| |/ / /
* | | | Merge pull request #899 from lioncash/unusedbunnei2018-08-027-334/+0
|\ \ \ \
| * | | | hw: Remove unused filesLioncash2018-08-027-334/+0
| |/ / /
* | | | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ \ \
| * | | | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | |/ / | |/| |
* | | | service: Add psc servicesLioncash2018-08-024-0/+96
| |/ / |/| |
* | | Merge pull request #888 from lioncash/capsbunnei2018-08-024-0/+171
|\ \ \
| * | | service: Add capture servicesLioncash2018-08-014-0/+171
| |/ /
* | | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ \
| * | | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ /
* | | Merge pull request #889 from lioncash/fspbunnei2018-08-026-0/+89
|\ \ \
| * | | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-016-0/+89
| |/ /
* / / service: Add bpc and pcv servicesLioncash2018-08-016-0/+179
|/ /
* | Merge pull request #882 from lioncash/unusedbunnei2018-08-011-6/+0
|\ \ | |/ |/|
| * kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
* | Merge pull request #871 from bunnei/audio-configbunnei2018-08-011-0/+5
|\ \ | |/ |/|
| * audio_core: Add configuration settings.bunnei2018-08-011-0/+5
* | Merge pull request #877 from lioncash/removebunnei2018-08-016-104/+0
|\ \
| * | kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-316-104/+0
* | | Merge pull request #880 from lioncash/audiobunnei2018-08-0114-2/+289
|\ \ \ | |_|/ |/| |
| * | service/audio: Add missing servicesLioncash2018-08-0114-2/+289
* | | Merge pull request #876 from lioncash/includebunnei2018-08-0123-28/+47
|\ \ \
| * | | kernel: Remove unnecessary includesLioncash2018-07-3123-28/+47
| | |/ | |/|
* | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ | |_|/ |/| |
| * | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
* | | Merge pull request #869 from Subv/ubsanbunnei2018-07-312-6/+17
|\ \ \
| * | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| * | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
* | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-314-0/+94
|\ \ \ \
| * | | | service: Add fgm servicesLioncash2018-07-314-0/+94
| | |_|/ | |/| |
* | | | Merge pull request #874 from lioncash/ambunnei2018-07-318-0/+156
|\ \ \ \ | |_|_|/ |/| | |
| * | | service/am: Add missing am servicesLioncash2018-07-318-0/+156
| |/ /
* | | Merge pull request #870 from lioncash/initbunnei2018-07-311-9/+7
|\ \ \
| * | | arm_dynarmic: Make SetTlsAddress() prototype and definition consistentLioncash2018-07-311-1/+1
| * | | arm_dynarmic: Remove unnecessary qualifying of ThreadContextLioncash2018-07-311-3/+3
| * | | arm_dynarmic: Correct initializer list orderLioncash2018-07-311-5/+3
| |/ /
* / / service: Add the pcie serviceLioncash2018-07-314-0/+83
|/ /
* | audio_core: Move to audout_u impl.bunnei2018-07-314-13/+6
* | Implemented various hwopus functions (#853)David2018-07-313-6/+132
* | Merge pull request #858 from lioncash/castbunnei2018-07-301-3/+2
|\ \
| * | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()Lioncash2018-07-291-3/+2
* | | Merge pull request #857 from lioncash/wlanbunnei2018-07-304-1/+192
|\ \ \
| * | | service: Add wlan servicesLioncash2018-07-294-1/+192
| |/ /
* | | Merge pull request #856 from lioncash/btmbunnei2018-07-304-0/+140
|\ \ \
| * | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| * | | service: Add btm servicesLioncash2018-07-294-0/+106
| |/ /
* / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ /
* | Merge pull request #847 from lioncash/ncmbunnei2018-07-284-0/+78
|\ \
| * | service: Add ncm servicesLioncash2018-07-274-0/+78
* | | Merge pull request #846 from lioncash/miibunnei2018-07-284-0/+126
|\ \ \
| * | | service: Add mii servicesLioncash2018-07-274-0/+126
* | | | Merge pull request #842 from bunnei/audio-corebunnei2018-07-285-94/+124
|\ \ \ \
| * | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| * | | | core: Add AudioCore to global state.bunnei2018-07-282-0/+9
| * | | | audio_core: Add initial code for keeping track of audout state.bunnei2018-07-281-1/+1
| | |/ / | |/| |
* / | | RomFS ExtractionZach Hilman2018-07-2812-20/+351
|/ / /
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-274-0/+241
|\ \ \
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| * | | service: Add nfc servicesLioncash2018-07-274-0/+202
| |/ /
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-274-0/+109
|\ \ \
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-271-3/+35
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| |/ /
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| |
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
* | | Merge pull request #837 from lioncash/privbunnei2018-07-271-5/+17
|\ \ \
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-261-5/+17
* | | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
* | | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
* | | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
| |/ / |/| |
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| |/ /
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ /
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-264-0/+162
|\ \ \
| * | | service: Add ldn servicesLioncash2018-07-264-0/+162
| |/ /
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \ | |_|/ |/| |
| * | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| * | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/
* | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ | |/ |/|
| * lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| * lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| * lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
* | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \
| * | service: Add ldr servicesLioncash2018-07-264-0/+101
* | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \
| * | | service: Add eupld servicesLioncash2018-07-264-0/+72
| * | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |/ | |/|
* | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ | |_|/ |/| |
| * | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
* | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \
| * | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| * | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ /
* | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ | |_|/ |/| |
| * | service: Add pm servicesLioncash2018-07-254-0/+90
| |/
* / service: Add the es serviceLioncash2018-07-254-0/+77
|/
* Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\
| * time: Add the time:a serviceLioncash2018-07-253-10/+11
| * time: Simplify interface creationLioncash2018-07-246-64/+15
* | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \
| * | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
* | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \
| * | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| * | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
* | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \
| * | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| * | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| | |_|/ | |/| |
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| | |_|/ | |/| |
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / /
* / / / deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ /
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ /
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ /
* | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ | |_|/ |/| |
| * | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
* | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \
| * | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| * | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| |/ /
* | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ | |_|/ |/| |
| * | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
* | | VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-243-36/+62
| |/ |/|
* | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \
| * | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| |/
* | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \
| * | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/
* | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \
| * | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/
* | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \
| * | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| * | nro: Make bracing consistentLioncash2018-07-231-10/+24
| * | nro: Make constructor explicitLioncash2018-07-231-1/+1
| * | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/
* | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \
| * | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| * | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| |
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
* | | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
| |/ |/|
* | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ | |/ |/|
| * set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| * set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
* | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ | |/ |/|
| * Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
* | Merge pull request #768 from lioncash/string-viewbunnei2018-07-228-93/+158
|\ \ | |/ |/|
| * vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| * file_util, vfs: Use std::string_view where applicableLioncash2018-07-228-91/+153
* | Implement exclusive monitorMerryMage2018-07-229-13/+160
|/
* file_util: Use a u64 to represent number of entriesLioncash2018-07-222-4/+4
* Merge pull request #760 from lioncash/pathbunnei2018-07-223-5/+7
|\
| * file_util: Use an enum class for GetUserPath()Lioncash2018-07-213-5/+7
* | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/
* Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\
| * vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| * partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| * partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| * partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
* | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \
| * | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
| |/
* | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \
| * | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| |/
* | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \
| * | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
* | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \
| * | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| * | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| * | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| * | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |/ | |/|
* | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ | |/ / |/| |
| * | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/
* | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \
| * | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
* | | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ /
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/
* | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \
| * | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| * | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ /
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-209-71/+70
|\ \ \
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-209-71/+70
| |/ /
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ /
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \ | |_|/ |/| |
| * | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| * | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/
* / pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ /
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/|
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / /
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / /
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / /
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / /
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / /
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / /
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / /
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
* | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \
| * | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
* | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / /
* | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| * | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| * | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / /
* | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \ | |_|_|/ |/| | |
| * | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ /
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|/ / |/| | |
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \ | |_|_|/ |/| | |
| * | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ | |/|
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| | |/ | |/|
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-193-7/+11
|\ \ \
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-192-7/+7
| | |/ | |/|
* | | Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1949-1862/+1807
| |/ |/|
* | Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
* | Single touch supportZach Hilman2018-07-181-4/+19
|/
* vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
* vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
* vi: Partially implement buffer crop parameters.bunnei2018-07-186-10/+26
* General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
* Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\
| * scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
* | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* / nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
* Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\
| * Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
* | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \
| * | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/
* / No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/
* More improvements to GDBStub (#653)Hedges2018-07-137-49/+172
* We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
* initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
* Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\
| * Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
* | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
|/
* Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\
| * Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
* | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
* | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \
| * | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
* | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ | |/ / |/| |
| * | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
* | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ /
* | Revert "Virtual Filesystem (#597)"bunnei2018-07-0842-1682/+1618
* | Virtual Filesystem (#597)Zach Hilman2018-07-0642-1618/+1682
* | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
* | Update clang formatJames Rowe2018-07-0325-114/+106
* | Rename logging macro back to LOG_*James Rowe2018-07-0379-556/+556
* | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
* | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
* | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-292-0/+3
|\ \
| * | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-272-0/+3
* | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \ | |/ / |/| |
| * | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
* | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ /
* | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
* | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
* | Merge pull request #579 from SciresM/masterbunnei2018-06-2211-9/+308
|\ \
| * | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| * | Add additional missing format.Michael Scire2018-06-222-21/+27
| * | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| * | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| * | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| * | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| * | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-214-10/+110
| * | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-214-6/+67
| * | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
* | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
* | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \
| * | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ /
* / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-219-15/+452
|/ /
* | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-205-10/+11
* | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
* | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \
| * | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| * | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| * | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
* | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ | |/ / |/| |
| * | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
* | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ |/|
* | Common/string_util: add StringFromBuffer functionmailwl2018-06-071-22/+9
* | Merge pull request #522 from mailwl/mm-ubunnei2018-06-074-0/+83
|\ \
| * | Remove unused header filesmailwl2018-06-061-2/+0
| * | Small fixesmailwl2018-06-052-6/+8
| * | Service/MM: add service and stub some functionsmailwl2018-06-054-0/+83
* | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \
| * | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| * | | Correct function resultsmailwl2018-06-041-4/+16
| * | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
* | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
* | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \
| * | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| * | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| | |/ / | |/| |
* / | | GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
|/ / /
* | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
* | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
* | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
* | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/ /
* | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
* | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
* | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
* | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
* | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \
| * | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
* | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
* | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
* | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \
| * | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| * | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| * | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
| |/ /
* | | add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
* | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
* | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
|/ /
* | Service/BCAT: add module and servicesmailwl2018-05-286-0/+118
* | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \
| * | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
* | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
* | | Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ /
* | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| |
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-214-1/+98
|\ \ \
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-202-0/+50
| |/ /
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
* | | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1117-181/+577
|\ \
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| * | thread: Rename mask to affinity_masks.bunnei2018-05-113-4/+4
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-115-17/+39
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| * | core: Implement multicore support.bunnei2018-05-1111-75/+110
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
* | | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
* | | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ /
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0228-103/+104
|\ \
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0228-103/+104
* | | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ /
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ /
* | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
* | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-302-4/+3
* | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
* | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
* | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
* | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2711-27/+26
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2711-13/+138
|\ \
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-273-4/+4
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-2684-1072/+1018
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-262-13/+2
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-239-25/+63
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
* | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
| |/ / |/| |
* | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
* | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
* | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \
| * | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| * | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
* | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-261-0/+4
|\ \ \ \
| * | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
* | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| * | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| |/ / /
* | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \
| * | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / /
* | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
* | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
|/ / /
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-252-17/+50
|\ \ \
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-252-17/+50
* | | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
* | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
* | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
* | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
* | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
* | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
* | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
* | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
* | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
* | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
* | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
* | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
* | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
* | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
* | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
* | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
* | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
* | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
* | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
* | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
* | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
* | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
* | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
* | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
* | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
* | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2314-443/+238
|\ \ \
| * | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| * | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| * | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-213-8/+8
| * | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| * | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| * | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| * | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
* | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \
| * | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| * | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / | |/| |
* / | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
|/ / /
* | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \
| * | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
* | | | core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / /
* | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ | |/ / |/| |
| * | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
* | | Merge pull request #367 from lioncash/clampbunnei2018-04-201-1/+2
|\ \ \
| * | | math_util: Remove the Clamp() functionLioncash2018-04-201-1/+2
* | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \
| * | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| |/ / /
* | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-201-1/+2
|\ \ \ \
| * | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-201-1/+2
| |/ / /
* | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \
| * | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| * | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| * | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / /
* / / / vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / /
* | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
* | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ | |/ / |/| |
| * | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| * | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| * | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
* | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
|/ /
* | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \
| * | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
* | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
|/ /
* | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \
| * | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
* | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
* | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/ /
* | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \
| * | Various fixes and clangHexagon122018-04-116-115/+108
| * | Decimal changeHexagon122018-04-101-4/+4
| * | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| * | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| * | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| * | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| * | Updated hid with more service names.Hexagon122018-04-101-0/+50
| * | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| * | Updated the unknown nameHexagon122018-04-101-1/+1
| * | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| * | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| * | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| * | Updated audren with more service names.Hexagon122018-04-101-10/+14
| * | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| * | Updated audout with more service names.Hexagon122018-04-101-13/+16
| * | Updated audin with more service names.Hexagon122018-04-101-9/+16
| * | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| * | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| * | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| * | Updated AM with more service names.Hexagon122018-04-101-2/+82
* | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
* | | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
* | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-064-0/+11
* | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
* | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
* | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
* | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
* | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
* | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
* | service: Add friend:u interface.bunnei2018-04-034-0/+41
* | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-032-4/+4
|\ \
| * | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| * | Change Telemetry Names to yuzuN00byKing2018-03-271-2/+2
* | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-031-6/+6
|\ \ \
| * | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
* | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / /
* | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \
| * | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
* | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
* | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
* | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
* | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
* | | | memory: Fix stack region.bunnei2018-03-316-10/+12
|/ / /
* | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
* | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
* | | service: Add NFP module interface.bunnei2018-03-306-0/+99
* | | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
* | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
* | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-273-10/+7
* | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-272-6/+6
* | | config: Add setting for whether the system is docked or not.bunnei2018-03-272-2/+9
|/ /
* | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
* | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
* | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \
| * | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| * | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| * | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
* | | Merge pull request #273 from Subv/texturesbunnei2018-03-251-0/+11
|\ \ \
| * | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-251-0/+11
| |/ /
* / / Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-258-32/+96
|/ /
* | arm_dynarmic: Fix timingMerryMage2018-03-241-7/+3
* | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-244-7/+66
|\ \
| * | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-231-6/+0
| * | memory: Fix typo in RasterizerFlushVirtualRegion.bunnei2018-03-231-3/+3
| * | memory: RasterizerFlushVirtualRegion should also check process image region.bunnei2018-03-231-0/+1
| * | rasterizer: Flush and invalidate regions should be 64-bit.bunnei2018-03-232-3/+3
| * | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-232-3/+3
| * | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| * | memory: Port RasterizerFlushVirtualRegion from Citra.bunnei2018-03-232-1/+58
| * | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-231-3/+3
* | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-2412-48/+329
|\ \ \
| * | | FS: Move the file open mode calculation to a separate function.Subv2018-03-231-7/+14
| * | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-216-7/+29
| * | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| * | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| * | | FS: Implement DiskFileSystem's OpenDirectory interface.Subv2018-03-205-6/+19
| * | | FS: Implement DiskFileSystem::GetEntryType for existing files/directories.Subv2018-03-201-2/+4
| * | | FS: Updated the Directory Entry structure to match the Switch.Subv2018-03-205-30/+84
| * | | FS: Support the file Append open mode.Subv2018-03-202-2/+23
| * | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| * | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-205-0/+79
* | | | Service/SSL: add ssl servicemailwl2018-03-234-0/+43
* | | | Remove more N3DS ReferencesN00byKing2018-03-222-20/+0
* | | | Service/spl: add module and servicesmailwl2018-03-228-0/+174
| |/ / |/| |
* | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
* | | Service: add fatal:u, fatal:p servicesmailwl2018-03-208-0/+144
* | | Clang FixesN00byKing2018-03-194-8/+9
* | | oopsN00byKing2018-03-191-3/+3
* | | More Warning cleanupsN00byKing2018-03-193-3/+3
* | | Clean Warnings (?)N00byKing2018-03-1914-19/+19
|/ /
* | Merge pull request #193 from N00byKing/3184_2_robotic_boogaloobunnei2018-03-197-41/+41
|\ \
| * | Implements citra-emu/citra#3184N00byKing2018-02-257-41/+41
* | | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
* | | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
* | | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
* | | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
* | | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-193-20/+6
* | | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
* | | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
* | | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
* | | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-166-2/+18
* | | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
* | | kernel: Move stack region outside of application heap.bunnei2018-03-166-11/+6
* | | memory: Add regions for map region, "new" map region, etc.bunnei2018-03-161-19/+29
* | | process: Fix stack memory state.bunnei2018-03-161-2/+4
* | | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
* | | IGeneralService: fix function listmailwl2018-03-161-2/+3
* | | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
* | | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
* | | core: Move process creation out of global state.bunnei2018-03-1420-66/+81
* | | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-0412-43/+91
|\ \ \
| * | | FS: Use the correct error code when trying to open files that don't exist.Subv2018-03-042-26/+6
| * | | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| * | | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-048-17/+70
* | | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ / /
* | | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ \
| * | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
* | | | Service/Set: add more servicesmailwl2018-03-0312-10/+348
|/ / /
* | | Merge pull request #216 from Subv/savedatabunnei2018-03-0220-39/+541
|\ \ \
| * | | SaveData: Use the current titleid when opening the savedata archive.Subv2018-03-021-2/+3
| * | | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-027-21/+20
| * | | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| * | | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-0210-16/+329
| * | | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| | |/ | |/|
* / | thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/ /
* | Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ \
| * | Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| * | Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| * | IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
* | | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ \
| * | | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| * | | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
* | | | file_sys: Style tweaksshinyquagsire232018-02-262-11/+5
* | | | loader: Check error on NPDM load, use TID for CodeSetshinyquagsire232018-02-253-6/+10
* | | | loader: Use NPDM information when loading NSOsshinyquagsire232018-02-252-4/+15
* | | | file_sys: Add support for parsing NPDM filesshinyquagsire232018-02-253-0/+276
* | | | Merge pull request #212 from mailwl/stubsbunnei2018-02-2410-9/+112
|\ \ \ \
| * | | | Stub more functionsmailwl2018-02-227-8/+90
| * | | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-225-1/+22
| |/ / /
* | | | Merge pull request #217 from shinyquagsire23/time-s-missingbunnei2018-02-231-0/+4
|\ \ \ \
| * | | | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
| |/ / /
* | | | Merge pull request #210 from MerryMage/f/dynarmic/sysregbunnei2018-02-232-2/+33
|\ \ \ \ | |/ / / |/| | |
| * | | dynarmic: Update to 6b4c6b0MerryMage2018-02-211-2/+18
| * | | arm_dynarmic: LOG_INFO on unicorn fallbackMerryMage2018-02-211-0/+4
| * | | memory: LOG_ERROR when falling off end of page tableMerryMage2018-02-211-0/+11
| |/ /
* | | Merge pull request #211 from shinyquagsire23/time_localbunnei2018-02-223-0/+9
|\ \ \
| * | | time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
| |/ /
* / / core: Fix scheduler-shutdown related crashMerryMage2018-02-211-5/+9
|/ /
* | Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-2/+26
|\ \
| * | Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-2/+26
* | | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
* | | service: Add Friend service interface.bunnei2018-02-196-0/+100
|/ /
* | Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-1910-378/+237
|\ \
| * | scheduler: Cleanup based on PR feedback.bunnei2018-02-193-5/+4
| * | kernel: Use Scheduler class for threading.bunnei2018-02-185-173/+24
| * | kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-183-0/+210
| * | core: Use shared_ptr for cpu_core.bunnei2018-02-182-6/+4
| * | kernel: Remove unused address_arbiter code.bunnei2018-02-185-199/+0
* | | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ /
* | Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ \
| * | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
* | | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ \ | |/ / |/| |
| * | nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| * | Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| * | Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| * | Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| * | nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| * | Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| * | Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| * | Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| * | Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
* | | Service/hid: stub some functionsmailwl2018-02-164-1/+98
* | | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
* | | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-156-0/+182
* | | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/ /
* | Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ \
| * | hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| * | hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| * | service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| * | audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| * | vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| * | nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| * | vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| * | vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
* | | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
| |/ |/|
* | memory: Silence formatting sepecifier warningsLioncash2018-02-141-21/+30
* | nso: Silence formatting specifier warningsLioncash2018-02-141-2/+4
* | deconstructed_rom_directory: Silence formatting specifier warningsLioncash2018-02-141-3/+4
* | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
* | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
* | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
* | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
* | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
* | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
* | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
* | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
* | gdbstub: Silence formatting specifier warningsLioncash2018-02-141-6/+9
|/
* audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
* Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\
| * vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| * vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| * TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
* | Merge pull request #184 from mailwl/lmbunnei2018-02-131-20/+49
|\ \ | |/ |/|
| * Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
* | arm_dynarmic: Support direct page table accessMerryMage2018-02-122-10/+19
|/
* Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\
| * Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
* | Merge pull request #178 from Subv/command_buffersbunnei2018-02-1210-174/+27
|\ \ | |/ |/|
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-1210-183/+24
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-123-3/+5
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-105-58/+102
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
* Merge pull request #171 from bunnei/libnx-fixesbunnei2018-02-096-9/+38
|\
| * nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
| * IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
| * nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
| * acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
* | dynarmic: Update to 41ae12263MerryMage2018-02-092-31/+45
|/
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-083-0/+162
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\
| * mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
* | Extra nvdrv support (#162)David2018-02-0617-37/+765
|/
* Merge pull request #164 from ogniK5377/libnx_sm_fixbunnei2018-02-051-0/+2
|\
| * Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
* | Changed .istorage to .romfsDavid Marcec2018-02-052-5/+5
|/
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
* logger: Add Time service logging category.bunnei2018-02-051-10/+10
* logger: Add SET service logging category.bunnei2018-02-051-1/+1
* logger: Add PCTL service logging category.bunnei2018-02-051-1/+1
* logger: Add LM service logging category.bunnei2018-02-051-2/+2
* logger: Add APM service logging category.bunnei2018-02-051-2/+3
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
* logger: Add NIFM service logging category.bunnei2018-02-054-11/+11
* logger: Add VI service logging category.bunnei2018-02-054-21/+20
* hid: Stub out several functions.bunnei2018-02-051-1/+39
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
* logger: Add AM service logging category.bunnei2018-02-043-42/+42
* logger: Add "account" service logging category.bunnei2018-02-041-8/+8
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
* Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\
| * GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| * WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| * svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| * ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
* | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-0310-0/+378
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-027-379/+571
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
* | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-026-0/+128
|\ \
| * | Services/vi: add vi:s and vi:u servicesmailwl2018-02-026-0/+128
| |/
* | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ | |/ |/|
| * shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
* | [WIP] sfdnsres: stub (#146)mailwl2018-01-305-2/+52
|/
* Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-278-415/+243
|\
| * memory: Replace all memory hooking with Special regionsMerryMage2018-01-278-415/+243
* | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
* | audout_u: Various cleanups.bunnei2018-01-251-29/+17
* | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
* | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
* | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
* | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
* | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
* | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
* | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
* | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-2510-169/+2
* | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
* | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-14/+166
* | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
* | Correct SpellingN00byKing2018-01-231-2/+2
* | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \
| * | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| * | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| * | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| * | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| * | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
* | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ | |/ / |/| |
| * | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| * | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| * | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
* | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ | |/ / |/| |
| * | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
* | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-229-363/+452
|/ /
* | Added stubs for audio services. (#116)st4rk2018-01-2212-5/+309
* | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \
| * | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| * | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
* | | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-218-5/+162
* | | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ \
| * | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| | |/ | |/|
* | | file_sys: Clang format fixes.bunnei2018-01-213-4/+4
* | | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
* | | deconstructed_rom_directory: Implement istorage loading for RomFS.bunnei2018-01-212-2/+71
* | | filesystem: Implement basic IStorage functionality.David Marcec2018-01-216-0/+258
* | | file_sys: Cleanup to better match Switch file system constructs.bunnei2018-01-2110-63/+136
* | | file_sys: Remove disk_archive, savedata_archive, and title_metadata.bunnei2018-01-217-835/+0
* | | archive_backend: Minor changes to match Switch IFileSystem.bunnei2018-01-215-26/+26
* | | file_sys: Repurpose 3DS IVFC code for Switch ROMFS.bunnei2018-01-213-51/+43
| |/ |/|
* | gdbstub: Update registers and sizes for aarch64Rozlette2018-01-211-113/+155
|/
* Merge pull request #72 from N00byKing/patch-2bunnei2018-01-211-1/+0
|\
| * Update core.cppN00byKing2018-01-171-1/+0
* | Merge pull request #92 from gdkchan/nro_refactorbunnei2018-01-211-2/+2
|\ \
| * | Fix NRO Entry Pointgdkchan2018-01-181-2/+2
* | | Merge pull request #122 from tgsm/time-remove-pragmabunnei2018-01-212-4/+0
|\ \ \
| * | | service/time: remove accidental #pragmastgsm2018-01-212-4/+0
* | | | loader: Minor style fix in deconstructed_rom_directoryRozlette2018-01-211-1/+0
|/ / /
* | | Merge pull request #117 from jroweboy/clang-formatbunnei2018-01-2143-57/+62
|\ \ \
| * | | Format: Run the new clang format on everythingJames Rowe2018-01-2143-57/+62
* | | | Merge pull request #120 from Rozelette/masterbunnei2018-01-201-0/+3
|\ \ \ \
| * | | | memory: Return false for large VAddr in IsValidVirtualAddressRozlette2018-01-201-0/+3
| |/ / /
* | | | loader: Clean up ctors and includes.bunnei2018-01-2010-18/+22
* | | | loader: Add DeconstructedRomDirectory for game dumps.bunnei2018-01-205-0/+156
* | | | loader: Refactor to also pass filepath into IdentifyType.bunnei2018-01-208-19/+19
* | | | nso: Remove code specific to directory loading.bunnei2018-01-202-17/+6
|/ / /
* | | Port citra #3352 to yuzu (#103)River City Ransomware2018-01-203-4/+25
* | | Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
* | | Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-206-21/+22
* | | Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ \ \
| * | | ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
* | | | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-198-0/+161
|/ / /
* | | Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ \ \
| * | | nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| * | | svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| * | | svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
* | | | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ \ \
| * | | | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
* | | | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
* | | | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ / / /
* / / / Fix dispdrv typogdkchan2018-01-191-1/+1
|/ / /
* | | Merge pull request #100 from Rozelette/masterbunnei2018-01-197-32/+113
|\ \ \ | |/ / |/| |
| * | time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| * | time: Refactor time:* to use a single shared moduleRozlette2018-01-187-26/+107
* | | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
* | | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-187-0/+159
* | | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ \ | |/ / |/| |
| * | lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
* | | Merge pull request #84 from lioncash/cmakebunnei2018-01-181-170/+167
|\ \ \
| * | | CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-181-170/+167
* | | | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ \ \
| * | | | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| * | | | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| |/ / /
* | | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ \
| * | | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| * | | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ / /
* | | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ \ | |_|/ / |/| | |
| * | | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ /
* | | controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
* | | Merge pull request #80 from gdkchan/nro_fixbunnei2018-01-181-20/+9
|\ \ \ | |/ / |/| |
| * | Fix NRO loadinggdkchan2018-01-181-20/+9
* | | Merge pull request #73 from N00byKing/3093bunnei2018-01-182-0/+2
|\ \ \ | |/ / |/| |
| * | Update CMakeLists.txtN00byKing2018-01-171-0/+1
| * | Update title_metadata.hN00byKing2018-01-171-0/+1
* | | Merge pull request #76 from Rozelette/masterbunnei2018-01-175-85/+164
|\ \ \
| * | | TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-175-85/+164
* | | | Remove relocation on NSO/NROgdkchan2018-01-173-19/+2
|/ / /
* | | Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ \ \
| * | | hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
* | | | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ \ \
| * | | | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
* | | | | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |_|_|/ |/| | |
* | | | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-173-3/+35
|\ \ \ \ | |/ / / |/| | |
| * | | hle_ipc: Clang format.bunnei2018-01-171-2/+3
| * | | ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
* | | | Fix gdbstub typo, fixes Citra #3318River City Ransomware2018-01-171-1/+1
| |/ / |/| |
* | | Merge pull request #60 from jroweboy/game-framebunnei2018-01-172-1/+4
|\ \ \ | |/ / |/| |
| * | UI: Fix frame rate perf statsJames Rowe2018-01-172-1/+4
* | | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ \ | |/ / |/| |
| * | hid: clang-formatshinyquagsire232018-01-171-3/+3
| * | hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| * | hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
| |/
* | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-176-0/+86
* | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
* | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-174-16/+18
* | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
* | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
* | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
* | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
* | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
* | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
* | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
* | Merge pull request #52 from ogniK5377/fspbunnei2018-01-176-5/+90
|\ \
| * | Update memory.hDavid2018-01-171-2/+2
| * | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| * | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| * | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| * | Increased heap size and changed tls area vaddrDavid Marcec2018-01-161-2/+2
* | | Merge pull request #44 from Rozelette/masterbunnei2018-01-161-3/+7
|\ \ \
| * | | nso: Modify .bss size calculation logicRozlette2018-01-161-3/+7
| | |/ | |/|
* | | clang-formatMerryMage2018-01-1613-37/+31
| |/ |/|
* | Build: Automagically handle unicornJames Rowe2018-01-161-1/+1
* | Build: Add unicorn as a submodule and build it if neededJames Rowe2018-01-161-1/+1
|/
* nso: Load subsdk4 if available.bunnei2018-01-151-1/+1
* pctl: Clang format.bunnei2018-01-151-1/+1
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55