summaryrefslogtreecommitdiffstats
path: root/src/core (follow)
Commit message (Expand)AuthorAgeFilesLines
* glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
* arp: Move to glue servicesZach Hilman2019-06-252-91/+0
* glue: Add manager to keep track of application registryZach Hilman2019-06-253-0/+121
* registered_cache: Add getter to determine source slot in content provider unionZach Hilman2019-06-252-0/+17
* patch_manager: Add getter for title versionZach Hilman2019-06-252-2/+14
* Update reporter.cppThomas May2019-06-221-5/+5
* Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\
| * service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
* | Merge pull request #2575 from DarkLordZach/process-id-typesbunnei2019-06-215-9/+27
|\ \
| * | kernel: Differentiate kernel and user processes when picking IDZach Hilman2019-06-105-9/+27
* | | Merge pull request #2546 from DarkLordZach/kipsbunnei2019-06-2110-119/+521
|\ \ \
| * | | kernel_executable: Optimize BLZ decompressionZach Hilman2019-06-072-10/+13
| * | | game_list: Accept *.kip as a file extension of executablesZach Hilman2019-06-051-1/+1
| * | | loader: Add recognition for KIP file typeZach Hilman2019-06-052-0/+11
| * | | loader: Add KIP and INI file parser-specific errorsZach Hilman2019-06-052-1/+9
| * | | loader: Add AppLoader_KIP for KIP filesZach Hilman2019-06-053-0/+135
| * | | program_metadata: Add function to load meta from raw parametersZach Hilman2019-06-052-0/+20
| * | | partition_data_manager: Remove KIP processing and use FileSysZach Hilman2019-06-051-118/+13
| * | | file_sys: Add classes to parse KIP1 and INI1 filesZach Hilman2019-06-053-0/+330
* | | | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-2130-53/+796
|\ \ \ \ | |_|_|/ |/| | |
| * | | loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-2621-70/+135
| * | | prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| * | | fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| * | | service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| * | | applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| * | | applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
| * | | svc: Save report on call to svcBreakZach Hilman2019-05-251-1/+7
| * | | core: Add Reporter class to take/save reportsZach Hilman2019-05-255-1/+416
| * | | settings: Add 'Reporting Services' config optionZach Hilman2019-05-251-0/+1
| * | | arm_interface: Expand backtrace generationZach Hilman2019-05-252-7/+194
| * | | core: Track load offsets of NSO modulesZach Hilman2019-05-253-0/+18
* | | | Merge pull request #2596 from FernandoS27/revert-2590bunnei2019-06-201-1/+1
|\ \ \ \
| * | | | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
* | | | | Merge pull request #2595 from jonsn0w/patch-1Hexagon122019-06-201-2/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Update content_archive.cppjonsn0w2019-06-201-2/+2
* | | | | Merge pull request #2591 from lioncash/recordbunnei2019-06-204-398/+0
|\ \ \ \ \
| * | | | | core: Remove unused CiTrace source filesLioncash2019-06-184-398/+0
* | | | | | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
| |/ / / /
* | | | | Addressed issuesDavid Marcec2019-06-174-9/+14
* | | | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
* | | | | CleanupDavid Marcec2019-06-1611-29/+38
* | | | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-168-8/+79
* | | | | Merge pull request #2581 from lioncash/hexZach Hilman2019-06-159-28/+33
|\ \ \ \ \
| * | | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-129-28/+33
* | | | | | Merge pull request #2582 from lioncash/reservedbunnei2019-06-141-1/+0
|\ \ \ \ \ \
| * | | | | | file_sys/ips_layer: Remove unnecessary reserve() callLioncash2019-06-131-1/+0
| |/ / / / /
* | | | | | Merge pull request #2580 from lioncash/redundantZach Hilman2019-06-131-3/+1
|\ \ \ \ \ \
| * | | | | | kernel/vm_manager: Remove redundant Reset call in destructorLioncash2019-06-121-3/+1
| |/ / / / /
* | | | | | Merge pull request #2577 from lioncash/fsZach Hilman2019-06-131-17/+29
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | file_sys/card_image: Remove obsolete TODOLioncash2019-06-121-1/+1
| * | | | | file_sys/card_image: Deduplicate casts within AddNCAFromPartition()Lioncash2019-06-111-3/+6
| * | | | | file_sys/card_image: Make bracing consistentLioncash2019-06-111-4/+8
| * | | | | file_sys/card_image: Assign collapsed NCA contents directly to ncas memberLioncash2019-06-111-3/+1
| * | | | | file_sys/card_image: Deduplicate type castLioncash2019-06-111-4/+6
| * | | | | file_sys/card_image: Get rid of a magic numberLioncash2019-06-111-1/+1
| * | | | | file_sys/card_image: Use std::array deduction guidesLioncash2019-06-111-1/+6
| | |_|_|/ | |/| | |
* / | | | file_sys/nca_metadata: Update CNMT structuresLioncash2019-06-111-2/+7
|/ / / /
* | | | Merge pull request #2571 from lioncash/refZach Hilman2019-06-102-2/+2
|\ \ \ \
| * | | | kernel/process: Make Create()'s name parameter be taken by valueLioncash2019-06-102-2/+2
| |/ / /
* | | | kernel/svc: Implement TotalMemoryUsedWithoutMmHeap/TotalMemoryAvailableWithoutMmHeapLioncash2019-06-103-2/+42
* | | | kernel/svc: Amend naming for TotalMemoryUsage in svcGetInfo()Lioncash2019-06-103-6/+6
* | | | kernel/svc: Remove duplicate enum entry in svcGetInfo()Lioncash2019-06-101-2/+1
|/ / /
* | | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-074-16/+40
* | | Merge pull request #2514 from ReinUsesLisp/opengl-compatZach Hilman2019-06-072-2/+0
|\ \ \
| * | | rasterizer_opengl: Remove OpenGL core profileReinUsesLisp2019-05-302-2/+0
* | | | Merge pull request #2549 from lioncash/headerZach Hilman2019-06-061-1/+0
|\ \ \ \
| * | | | kernel/process: Remove unused boost header includeLioncash2019-06-051-1/+0
| | |_|/ | |/| |
* | | | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \ \ \
| * | | | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
* | | | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| * | | | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| * | | | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
* | | | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-057-66/+97
|\ \ \ \ \
| * | | | | core/core: Remove unnecessary includesLioncash2019-05-293-13/+37
| * | | | | core/loader: Remove LoadKernelSystemModeLioncash2019-05-293-21/+0
| * | | | | core/telemetry_session: Remove unnecessary web service nulling out in destructorLioncash2019-05-291-2/+1
| * | | | | core/telemetry_session: Remove usages of the global system accessorLioncash2019-05-293-30/+54
| * | | | | core/telemetry_session: Explicitly delete copy and move constructorsLioncash2019-05-291-1/+7
| * | | | | core/telemetry_session: Remove unused includeLioncash2019-05-291-1/+0
| |/ / / /
* | | | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-055-76/+34
|\ \ \ \ \
| * | | | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-053-6/+6
| * | | | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-055-34/+39
| * | | | | core/core_timing_utils: Simplify overload setLioncash2019-06-052-49/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-0510-402/+1081
|\ \ \ \ \
| * | | | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| * | | | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| * | | | | Address review commentsMichael Scire2019-05-236-47/+120
| * | | | | clang-format fixesMichael Scire2019-05-234-31/+32
| * | | | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-239-403/+1010
* | | | | | yuzu/bootmanager: Treat the resolution factor as a u32Lioncash2019-06-032-13/+21
| |/ / / / |/| | | |
* | | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-3011-111/+1059
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| * | | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-255-13/+12
| * | | | mii: Implement Delete and Destroy fileZach Hilman2019-04-253-8/+116
| * | | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| * | | | mii_manager: Cleanup and optimizationZach Hilman2019-04-253-36/+50
| * | | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-252-15/+244
| * | | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| * | | | common: Extract UUID to its own classZach Hilman2019-04-253-78/+28
* | | | | Merge pull request #2518 from ReinUsesLisp/sdl2-windowbunnei2019-05-291-2/+1
|\ \ \ \ \
| * | | | | emu_window: Pass OnMinimalClientAreaChangeRequest argument by copyReinUsesLisp2019-05-261-2/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #2519 from lioncash/signbunnei2019-05-272-5/+5
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | core_timing_util: Silence sign-comparison warningsLioncash2019-05-251-4/+4
| * | | | loader/nso: Silence sign-comparison warningLioncash2019-05-251-1/+1
| | |_|/ | |/| |
* | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ | |/ / / |/| | |
| * | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| * | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| * | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| |/ /
* | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-254-9/+10
|\ \ \ | |/ / |/| |
| * | Address review commentTobias2019-05-191-1/+1
| * | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-184-9/+10
* | | Merge pull request #2410 from lioncash/affinitybunnei2019-05-192-42/+58
|\ \ \
| * | | kernel/svc: Make svcCreateThread/svcStartThread/svcSleepThread/svcExitThread calls show up in the debug logLioncash2019-04-291-4/+4
| * | | kernel/svc: Reorganize svcSetThreadCoreMask()Lioncash2019-04-291-32/+39
| * | | kernel/thread: Update thread processor ID flagsLioncash2019-04-292-7/+16
* | | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \ \
| * | | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| * | | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| * | | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |_|/ | |/| |
* | | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \ \
| * | | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
| | |_|/ | |/| |
* | | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \ \
| * | | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ / /
* | | | Merge pull request #2490 from lioncash/floatHexagon122019-05-191-1/+1
|\ \ \ \
| * | | | ipc_helpers: Amend floating-point type in Pop<double> specializationLioncash2019-05-191-1/+1
| |/ / /
* | | | Merge pull request #2486 from lioncash/resetnameSebastian Valle2019-05-1918-31/+32
|\ \ \ \
| * | | | core/kernel/object: Rename ResetType enum membersLioncash2019-05-1818-31/+32
| |/ / /
* / / / kernel/svc: Mark GetThreadList() and UnmapProcessCodeMemory() as internally linkedLioncash2019-05-191-4/+4
|/ / /
* | | Merge pull request #2437 from lioncash/audctlbunnei2019-05-091-2/+2
|\ \ \
| * | | service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
| |/ /
* | | Merge pull request #2445 from FearlessTobi/port-4749bunnei2019-05-092-9/+9
|\ \ \
| * | | core/telemetry_session: Only create the backend when we really need itzhupengfei2019-05-042-9/+9
* | | | Merge pull request #2453 from lioncash/enumbunnei2019-05-091-9/+0
|\ \ \ \
| * | | | core/memory: Remove unused FlushMode enumLioncash2019-05-071-9/+0
| |/ / /
* / / / core/frontend/emu_window: Make GraphicsContext's destructor virtualLioncash2019-05-042-0/+4
|/ / /
* | | loader/nso: Remove left-in debug pragmaLioncash2019-05-011-2/+0
* | | Merge pull request #2412 from lioncash/systembunnei2019-04-293-7/+11
|\ \ \ | |/ / |/| |
| * | kernel/vm_manager: Remove usages of global system accessorsLioncash2019-04-173-7/+11
* | | Merge pull request #2416 from lioncash/waitbunnei2019-04-256-44/+50
|\ \ \
| * | | kernel/thread: Unify wait synchronization typesLioncash2019-04-176-38/+34
| * | | kernel/svc: Migrate svcCancelSynchronization behavior to a thread functionLioncash2019-04-173-7/+17
| |/ /
* | | Merge pull request #2424 from FernandoS27/compatbunnei2019-04-252-0/+2
|\ \ \
| * | | Allow picking a Compatibility Profile for OpenGL.Fernando Sahmkow2019-04-202-0/+2
* | | | Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2521-112/+653
|\ \ \ \
| * | | | web_browser: Make OpenPage non-constZach Hilman2019-04-1710-18/+23
| * | | | main: Add GMainWindow hooks for Error displayZach Hilman2019-04-172-3/+3
| * | | | general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| * | | | general_frontend: Add frontend scaffold for PhotoViewer appletZach Hilman2019-04-172-0/+55
| * | | | frontend: Add frontend receiver for Error appletZach Hilman2019-04-173-2/+79
| * | | | applets: Add Error appletZach Hilman2019-04-173-24/+224
| * | | | applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| * | | | web_browser: Make OpenPage constZach Hilman2019-04-172-3/+3
| * | | | core: Remove specific applets in favor of AppletManagerZach Hilman2019-04-172-47/+32
| * | | | am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| * | | | applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
| | |/ / | |/| |
* | | | Merge pull request #2420 from lioncash/audctlbunnei2019-04-232-2/+32
|\ \ \ \ | |_|/ / |/| | |
| * | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
* | | | Merge pull request #2415 from lioncash/constbunnei2019-04-202-2/+2
|\ \ \ \
| * | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member functionLioncash2019-04-172-2/+2
| | |/ / | |/| |
* | | | Merge pull request #2421 from lioncash/svc-callbunnei2019-04-201-1/+1
|\ \ \ \
| * | | | kernel/svc: Name supervisor call 0x36Lioncash2019-04-191-1/+1
| | |/ / | |/| |
* | | | Merge pull request #2374 from lioncash/pagetablebunnei2019-04-2029-163/+206
|\ \ \ \ | |/ / / |/| | |
| * | | core/core: Move process execution start to System's Load()Lioncash2019-04-1220-107/+144
| * | | core/process: Remove unideal page table setting from LoadFromMetadata()Lioncash2019-04-121-5/+0
| * | | core/core: Move main process creation into Load()Lioncash2019-04-121-4/+3
| * | | video_core/gpu: Create threads separately from initializationLioncash2019-04-121-11/+4
| * | | core/cpu_core_manager: Create threads separately from initialization.Lioncash2019-04-1211-39/+58
* | | | Merge pull request #2397 from lioncash/thread-unusedbunnei2019-04-183-18/+17
|\ \ \ \ | |_|/ / |/| | |
| * | | svc: Specify handle value in thread's nameLioncash2019-04-152-2/+10
| * | | kernel/thread: Remove unused guest_handle member variableLioncash2019-04-143-16/+7
| | |/ | |/|
* | | Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\ \ \
| * | | service: Update service function tablesLioncash2019-04-1127-57/+262
* | | | Merge pull request #2393 from lioncash/svcbunnei2019-04-164-2/+274
|\ \ \ \
| * | | | kernel/svc: Implement svcUnmapProcessCodeMemoryLioncash2019-04-133-1/+143
| * | | | kernel/svc: Implement svcMapProcessCodeMemoryLioncash2019-04-134-1/+131
| | |_|/ | |/| |
* | | | kernel/thread: Remove BoostPriority()Lioncash2019-04-152-11/+0
| |_|/ |/| |
* | | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \ \
| * | | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| * | | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| | |/ | |/|
* | | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-142-6/+11
|\ \ \
| * | | added a toggle to force 30fps modezarroboogs2019-04-092-6/+11
* | | | Merge pull request #2381 from lioncash/fsbunnei2019-04-141-8/+7
|\ \ \ \
| * | | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
| * | | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| | |/ / | |/| |
* | | | Merge pull request #2017 from jroweboy/glwidgetbunnei2019-04-141-9/+30
|\ \ \ \ | |_|_|/ |/| | |
| * | | QT Frontend: Migrate to QOpenGLWindowJames Rowe2019-01-221-9/+30
* | | | Merge pull request #2360 from lioncash/svc-globalbunnei2019-04-128-364/+413
|\ \ \ \
| * | | | kernel/svc: Deglobalize the supervisor call handlersLioncash2019-04-088-364/+413
| | |_|/ | |/| |
* | | | Merge pull request #2388 from lioncash/constexprbunnei2019-04-1210-10/+10
|\ \ \ \
| * | | | kernel: Make handle type declarations constexprLioncash2019-04-1110-10/+10
| | |_|/ | |/| |
* / | | kernel/server_session: Remove obsolete TODOsLioncash2019-04-101-7/+2
|/ / /
* | | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-1015-187/+362
|\ \ \
| * | | patch_manager: Dump NSO name with build IDZach Hilman2019-03-284-9/+11
| * | | game_list: Register content with ContentProviderZach Hilman2019-03-271-2/+3
| * | | core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-278-27/+32
| * | | core: Store system-wide ContentProvider for the emulatorZach Hilman2019-03-272-0/+40
| * | | file_sys: Create ContentProvider interface and default implementationsZach Hilman2019-03-272-152/+279
* | | | kernel/process: Set page table when page table resizes occur.Lioncash2019-04-091-0/+2
| |/ / |/| |
* | | Merge pull request #2361 from lioncash/pagetablebunnei2019-04-077-18/+3
|\ \ \
| * | | core/memory: Remove GetCurrentPageTable()Lioncash2019-04-072-6/+1
| * | | arm/arm_dynarmic: Remove unnecessary current_page_table memberLioncash2019-04-072-8/+0
| * | | kernel: Handle page table switching within MakeCurrentProcess()Lioncash2019-04-073-4/+2
* | | | Merge pull request #2356 from lioncash/pairbunnei2019-04-076-18/+15
|\ \ \ \
| * | | | kernel/server_session: Return a std::pair from CreateSessionPair()Lioncash2019-04-064-11/+8
| * | | | kernel/server_port: Return a std::pair from CreatePortPair()Lioncash2019-04-062-7/+7
| |/ / /
* / / / core/memory: Remove unused enum constantsLioncash2019-04-071-10/+0
|/ / /
* | | Merge pull request #2325 from lioncash/namebunnei2019-04-061-0/+4
|\ \ \
| * | | kernel/server_session: Provide a GetName() overrideLioncash2019-04-031-0/+4
* | | | Merge pull request #2240 from FearlessTobi/port-4651bunnei2019-04-063-4/+5
|\ \ \ \
| * | | | gdbstub: Fix some bugs in IsMemoryBreak() and ServeBreak. Add workaround to let watchpoints break into GDB. (#4651)Dimitri A2019-03-153-4/+5
* | | | | Merge pull request #2340 from lioncash/viewbunnei2019-04-061-1/+3
|\ \ \ \ \
| * | | | | file_sys/fsmitm_romfsbuild: Utilize a string_view in romfs_calc_path_hash()Lioncash2019-04-051-1/+3
* | | | | | Merge pull request #2334 from lioncash/overridebunnei2019-04-0613-23/+9
|\ \ \ \ \ \
| * | | | | | core: Add missing override specifiers where applicableLioncash2019-04-0413-23/+9
* | | | | | | Merge pull request #2341 from lioncash/comparebunnei2019-04-062-11/+0
|\ \ \ \ \ \ \
| * | | | | | | file_sys/nca_metadata: Remove unnecessary comparison operators for TitleTypeLioncash2019-04-052-11/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2339 from lioncash/rankbunnei2019-04-065-17/+29
|\ \ \ \ \ \ \
| * | | | | | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-054-6/+6
| * | | | | | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| * | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-053-4/+15
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2343 from lioncash/todobunnei2019-04-062-15/+14
|\ \ \ \ \ \ \
| * | | | | | | file_sys/program_metadata: Remove obsolete TODOsLioncash2019-04-052-15/+14
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2329 from lioncash/sanitizebunnei2019-04-061-0/+14
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomicLioncash2019-04-041-0/+14
* | | | | | | | Merge pull request #2344 from lioncash/resultbunnei2019-04-061-4/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | hle/result: Remove unnecessary bitfield entry for ResultCodeLioncash2019-04-051-4/+0
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2292 from lioncash/nacpbunnei2019-04-052-12/+24
|\ \ \ \ \ \ \
| * | | | | | | file_sys/control_metadata: Amend naming of membersLioncash2019-04-042-12/+24
| | |_|_|_|/ / | |/| | | | |
* | | | | | | hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #2328 from lioncash/transferbunnei2019-04-043-17/+37
|\ \ \ \ \ \
| * | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
| * | | | | | kernel/transfer_memory: Add accessors to data and sizesLioncash2019-04-032-11/+31
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2093 from FreddyFunk/disk-cache-better-compressionbunnei2019-04-042-11/+8
|\ \ \ \ \ \
| * | | | | | Addressed feedbackunknown2019-03-291-4/+4
| * | | | | | core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-292-11/+8
* | | | | | | Merge pull request #2324 from lioncash/enum-unusedbunnei2019-04-042-2/+0
|\ \ \ \ \ \ \
| * | | | | | | kernel/object: Remove unused handle type entryLioncash2019-04-032-2/+0
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| * | | | | | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
* | | | | | | Merge pull request #2305 from lioncash/sharedbunnei2019-04-033-5/+18
|\ \ \ \ \ \ \
| * | | | | | | kernel/shared_memory: Remove unused core/memory.h includeLioncash2019-03-291-1/+0
| * | | | | | | kernel/shared_memory: Sanitize supplied size when unmappingLioncash2019-03-293-4/+18
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2314 from lioncash/constbunnei2019-04-0311-18/+18
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | kernel/thread: Make AllWaitObjectsReady() a const qualified member functionLioncash2019-04-022-2/+2
| * | | | | | kernel/wait_object: Make ShouldWait() take thread members by pointer-to-constLioncash2019-04-0211-11/+11
| * | | | | | kernel/thread: Avoid sign conversion within GetCommandBufferAddress()Lioncash2019-04-011-2/+2
| * | | | | | kernel/thread: Make parameter of GetWaitObjectIndex() const qualifiedLioncash2019-04-012-3/+3
* | | | | | | Merge pull request #2270 from lioncash/plistbunnei2019-04-037-2/+123
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Implement svcGetThreadListLioncash2019-04-024-1/+70
| * | | | | | | kernel/svc: Implement svcGetProcessListLioncash2019-04-024-1/+53
* | | | | | | | Merge pull request #2313 from lioncash/reslimitbunnei2019-04-023-14/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/resource_limit: Remove the name member from resource limitsLioncash2019-04-013-14/+6
| |/ / / / / /
* | | | | | | process: Fix up compilationReinUsesLisp2019-04-021-1/+1
* | | | | | | Merge pull request #2281 from lioncash/memorybunnei2019-04-025-7/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | kernel/codeset: Make CodeSet's memory data member a regular std::vectorLioncash2019-03-225-7/+8
* | | | | | | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-013-3/+1
|\ \ \ \ \ \ \
| * | | | | | | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-293-3/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-016-14/+14
* | | | | | | Merge pull request #2304 from lioncash/memsizebunnei2019-03-313-9/+28
|\ \ \ \ \ \ \
| * | | | | | | kernel/process: Report total physical memory used to svcGetInfoLioncash2019-03-293-4/+11
| * | | | | | | kernel/process: Store the total size of the code memory loadedLioncash2019-03-292-0/+5
| * | | | | | | kernel/process: Store the main thread stack size to a data memberLioncash2019-03-282-4/+7
| * | | | | | | kernel/process: Make Run's stack size parameter a u64Lioncash2019-03-282-2/+2
| * | | | | | | kernel/process: Ensure that given stack size is always page-alignedLioncash2019-03-281-0/+4
* | | | | | | | Merge pull request #2308 from lioncash/deductionbunnei2019-03-313-12/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/scheduler: Remove unused parameter to AddThread()Lioncash2019-03-303-4/+4
| * | | | | | | | kernel/scheduler: Use deduction guides on mutex locksLioncash2019-03-301-8/+8
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
* | | | | | | | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
* | | | | | | | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/ / / / / / /
* | | | | | | Merge pull request #2266 from FernandoS27/arbitrationbunnei2019-03-295-14/+18
|\ \ \ \ \ \ \
| * | | | | | | Fix small bug that kept a thread as a condvar thread after being signalled.Fernando Sahmkow2019-03-202-6/+8
| * | | | | | | Add CondVar Thread State.Fernando Sahmkow2019-03-204-4/+6
| * | | | | | | Small fixes to address_arbiter to better match the IDB.Fernando Sahmkow2019-03-202-5/+5
* | | | | | | | Merge pull request #2265 from FernandoS27/multilevelqueuebunnei2019-03-292-19/+27
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Fixes and corrections on formatting.Fernando Sahmkow2019-03-271-6/+9
| * | | | | | | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-272-19/+24
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2284 from lioncash/heap-allocbunnei2019-03-283-59/+81
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | kernel/vm_manager: Handle shrinking of the heap size within SetHeapSize()Lioncash2019-03-242-24/+46
| * | | | | | kernel/vm_manager: Rename HeapAllocate to SetHeapSizeLioncash2019-03-243-4/+3
| * | | | | | kernel/vm_manager: Handle case of identical calls to HeapAllocateLioncash2019-03-241-0/+5
| * | | | | | kernel/vm_manager: Remove unused class variablesLioncash2019-03-241-3/+0
| * | | | | | kernel/vm_manager: Remove unnecessary heap_used data memberLioncash2019-03-243-13/+2
| * | | | | | kernel/vm_manager: Tidy up heap allocation codeLioncash2019-03-243-27/+37
* | | | | | | Merge pull request #2285 from lioncash/unused-structbunnei2019-03-261-8/+0
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | kernel/process: Remove unused AddressMapping structLioncash2019-03-241-8/+0
* | | | | | | Merge pull request #2287 from lioncash/coretiming-cbbunnei2019-03-266-11/+11
|\ \ \ \ \ \ \
| * | | | | | | core/core_timing: Make callback parameters consistentLioncash2019-03-246-11/+11
| |/ / / / / /
* | | | | | | Merge pull request #2286 from lioncash/fwdbunnei2019-03-261-3/+0
|\ \ \ \ \ \ \
| * | | | | | | kernel/kernel: Remove unnecessary forward declarationLioncash2019-03-241-3/+0
| |/ / / / / /
* / / / / / / core/cheat_engine: Make MemoryReadImpl and MemoryWriteImpl internally linkedLioncash2019-03-241-0/+2
|/ / / / / /
* | | | | | Merge pull request #2232 from lioncash/transfer-memorybunnei2019-03-246-6/+282
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | core/hle/kernel/svc: Implement svcUnmapTransferMemoryLioncash2019-03-131-1/+48
| * | | | | core/hle/kernel/svc: Implement svcMapTransferMemoryLioncash2019-03-131-1/+57
| * | | | | core/hle/kernel: Split transfer memory handling out into its own classLioncash2019-03-136-4/+177
* | | | | | Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-237-3/+154
|\ \ \ \ \ \
| * | | | | | set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| * | | | | | set_sys: Use official nintendo version stringZach Hilman2019-03-114-19/+25
| * | | | | | system_version: Correct sizes on VectorVfsFile constructionZach Hilman2019-03-111-4/+4
| * | | | | | set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| * | | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-106-3/+128
* | | | | | | Merge pull request #2280 from lioncash/nsobunnei2019-03-233-73/+92
|\ \ \ \ \ \ \
| * | | | | | | loader/nso: Place translation unit specific functions into an anonymous namespaceLioncash2019-03-221-20/+21
| * | | | | | | loader/nso: Clean up use of magic constantsLioncash2019-03-221-4/+6
| * | | | | | | file_sys/patch_manager: Deduplicate NSO headerLioncash2019-03-223-64/+65
| * | | | | | | loader/nso: Fix definition of the NSO header structLioncash2019-03-221-3/+15
| * | | | | | | file_sys/patch_manager: Remove two magic valuesLioncash2019-03-221-2/+5
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2279 from lioncash/cheat-globalbunnei2019-03-226-48/+57
|\ \ \ \ \ \ \
| * | | | | | | file_sys/cheat_engine: Silence truncation and sign-conversion warningsLioncash2019-03-222-5/+6
| * | | | | | | file_sys/cheat_engine: Remove use of global system accessorsLioncash2019-03-226-43/+51
| |/ / / / / /
* | | | | | | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-222-13/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | memory: Check that core is powered on before attempting to use GPU.bunnei2019-03-211-1/+1
| * | | | | | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-211-10/+2
| * | | | | | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-211-2/+2
* | | | | | | Merge pull request #2234 from lioncash/mutexbunnei2019-03-225-29/+62
|\ \ \ \ \ \ \
| * | | | | | | core/hle/kernel/mutex: Remove usages of global system accessorsLioncash2019-03-151-11/+15
| * | | | | | | core/hle/kernel: Make Mutex a per-process class.Lioncash2019-03-155-18/+47
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #2274 from lioncash/includebunnei2019-03-221-3/+0
|\ \ \ \ \ \ \
| * | | | | | | core/memory: Remove unnecessary includesLioncash2019-03-211-3/+0
* | | | | | | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-224-22/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-214-22/+20
| * | | | | | | | kernel/vm_manager: Amend flag values for CodeMutableLioncash2019-03-211-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-2210-0/+813
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-0510-77/+56
| * | | | | | | core: Add support for registering and controlling ownership of CheatEngineZach Hilman2019-03-052-0/+13
| * | | | | | | cheat_engine: Add parser and interpreter for game cheatsZach Hilman2019-03-053-0/+715
| * | | | | | | loader/nso: Set main code region in VMManagerZach Hilman2019-03-053-2/+21
| * | | | | | | vm_manager: Add support for storing and getting main code regionZach Hilman2019-03-052-0/+28
| * | | | | | | patch_manager: Display cheats in game list add-onsZach Hilman2019-03-051-0/+2
| * | | | | | | patch_manager: Add support for loading cheats listsZach Hilman2019-03-052-0/+56
| * | | | | | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
* | | | | | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-216-96/+96
|\ \ \ \ \ \ \ \
| * | | | | | | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-066-96/+96
* | | | | | | | | Merge pull request #2262 from lioncash/enumbunnei2019-03-212-2/+15
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys/content_archive: Amend name of Data_Unknown5 enum entryLioncash2019-03-192-2/+15
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #2268 from lioncash/codesetbunnei2019-03-218-45/+111
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | kernel/process: Make MapSegment lambda reference parameter constLioncash2019-03-201-1/+1
| * | | | | | | | kernel: Move CodeSet structure to its own source filesLioncash2019-03-208-44/+110
* | | | | | | | | Merge pull request #2267 from FernandoS27/fix-2238bunnei2019-03-211-1/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fix crash caused by 2238.Fernando Sahmkow2019-03-201-1/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
* | | | | | | | | loader: Remove Linker classLioncash2019-03-203-185/+0
* | | | | | | | | loader: Remove Linker inheritance from NRO and NSO loadersLioncash2019-03-202-4/+4
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ \ \ \
| * | | | | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| * | | | | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| * | | | | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
* | | | | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
* | | | | | | | | Merge pull request #2238 from lioncash/threadbunnei2019-03-182-21/+41
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | kernel/thread: Expand documentation of nominal_priority and current_priorityLioncash2019-03-162-3/+11
| * | | | | | | | kernel/thread: Make bracing consistent within UpdatePriority()Lioncash2019-03-161-2/+4
| * | | | | | | | kernel/thread: Amend condition within UpdatePriority()Lioncash2019-03-161-3/+3
| * | | | | | | | kernel/thread: Maintain priority ordering of added mutex waiting threadsLioncash2019-03-161-14/+24
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #2252 from bunnei/move-page-tablebunnei2019-03-1711-219/+91
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Move PageTable struct into Common.bunnei2019-03-1711-219/+91
* | | | | | | | | Merge pull request #2249 from lioncash/ipcbunnei2019-03-171-0/+30
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | ipc_helpers: Allow pushing and popping floating-point valuesLioncash2019-03-161-0/+30
* | | | | | | | | | Merge pull request #2245 from lioncash/unused-defbunnei2019-03-171-6/+0
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/thread: Actually remove the definition of ExitCurrentThread()Lioncash2019-03-161-6/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2243 from bunnei/mem-simplify-cachebunnei2019-03-172-66/+21
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | memory: Simplify rasterizer cache operations.bunnei2019-03-162-66/+21
* | | | | | | | | | Merge pull request #2129 from FernandoS27/cntpctbunnei2019-03-173-2/+12
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Corrections, documenting and fixes.Fernando Sahmkow2019-02-162-4/+3
| * | | | | | | | | Use u128 on Clock Cycles calculation.Fernando Sahmkow2019-02-163-6/+6
| * | | | | | | | | Correct CNTPCT to use Clock Cycles instead of Cpu Cycles.Fernando Sahmkow2019-02-163-2/+13
* | | | | | | | | | Merge pull request #2242 from lioncash/thread-fnbunnei2019-03-164-33/+31
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/thread: Move thread exiting logic from ExitCurrentThread to svcExitThreadLioncash2019-03-162-8/+7
| * | | | | | | | | kernel/thread: Migrate WaitCurrentThread_Sleep into the Thread interfaceLioncash2019-03-164-25/+24
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | gpu: Use host address for caching instead of guest address.bunnei2019-03-152-6/+10
| |_|_|_|_|/ / / |/| | | | | | |
* | | | | | | | Merge pull request #2230 from lioncash/globalbunnei2019-03-152-8/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Remove use of global system accessorsLioncash2019-03-132-8/+9
| |/ / / / / / /
* | | | | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-134-14/+36
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/server_port: Make data members privateLioncash2019-03-114-14/+36
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-133-19/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | core/hle/result: Remove now-unnecessary manually defined copy assignment operatorLioncash2019-03-101-5/+0
| * | | | | | | | core/hle/result: Amend error in comment description for ResultCodeLioncash2019-03-101-1/+1
| * | | | | | | | core/hle/result: Remove now-unused constructor for ResultCodeLioncash2019-03-101-10/+0
| * | | | | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-103-3/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-139-40/+146
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| * | | | | | | core/ipc_helper: Allow popping all signed value types with RequestParserLioncash2019-02-271-0/+15
| * | | | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
* | | | | | | | Merge pull request #2211 from lioncash/arbiterbunnei2019-03-128-64/+80
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel: Make the address arbiter instance per-processLioncash2019-03-087-27/+34
| * | | | | | | | kernel/svc: Move address arbiter signaling behind a unified API functionLioncash2019-03-083-22/+26
| * | | | | | | | kernel/svc: Move address arbiter waiting behind a unified API functionLioncash2019-03-083-19/+24
* | | | | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ \ \ \
| * | | | | | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| * | | | | | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| * | | | | | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| * | | | | | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
* | | | | | | | | Merge pull request #2193 from lioncash/globalbunnei2019-03-105-17/+23
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | |
| * | | | | | | | kernel/scheduler: Pass in system instance in constructorLioncash2019-03-045-17/+23
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | clang fixHexagon122019-03-091-1/+2
* | | | | | | | Log 2 new setting valuesHexagon122019-03-091-0/+2
* | | | | | | | Merge pull request #2210 from lioncash/optionalbunnei2019-03-084-47/+47
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optionalLioncash2019-03-084-47/+47
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2195 from lioncash/shared-globalbunnei2019-03-071-3/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()Lioncash2019-03-041-3/+2
| |/ / / / / /
* | | | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-076-36/+78
|\ \ \ \ \ \ \
| * | | | | | | kernel/server_session: Make data members privateLioncash2019-03-065-32/+73
| * | | | | | | kernel/client_session: Make data members privateLioncash2019-03-061-4/+5
* | | | | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-078-22/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | gpu: Refactor a/synchronous implementations into their own classes.bunnei2019-03-071-2/+7
| * | | | | | | | gpu: Move command processing to another thread.bunnei2019-03-072-5/+5
| * | | | | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-073-14/+4
| * | | | | | | | gpu: Refactor to take RendererBase instead of RasterizerInterface.bunnei2019-03-071-1/+1
| * | | | | | | | settings: Add new graphics setting for use_asynchronous_gpu_emulation.bunnei2019-03-072-0/+3
| * | | | | | | | core: Set is_powered_on before GPU is initialized.bunnei2019-03-071-1/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-076-8/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-056-8/+12
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2190 from lioncash/ogl-globalbunnei2019-03-072-11/+7
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | core/core: Remove the global telemetry accessor functionLioncash2019-03-041-4/+0
| * | | | | | | core/core: Replace direct usage of the global system telemetry accessor from Shutdown()Lioncash2019-03-041-7/+7
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2199 from lioncash/arbiterbunnei2019-03-066-112/+184
|\ \ \ \ \ \ \
| * | | | | | | kernel/address_arbiter: Pass in system instance to constructorLioncash2019-03-055-23/+42
| * | | | | | | kernel/address_arbiter: Minor tidying upLioncash2019-03-051-18/+18
| * | | | | | | kernel/address_arbiter: Convert the address arbiter into a classLioncash2019-03-055-82/+135
| | |/ / / / / | |/| | | | |
* | | | | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
* | | | | | | Merge pull request #2194 from lioncash/membunnei2019-03-063-30/+66
|\ \ \ \ \ \ \
| * | | | | | | vm_manager: Use range helpers in HeapAlloc() and HeapFree()Lioncash2019-03-041-4/+2
| * | | | | | | vm_manager: Provide address range checking functions for other memory regionsLioncash2019-03-042-4/+35
| * | | | | | | svc: Migrate address range checking functions to VMManagerLioncash2019-03-043-23/+30
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2200 from lioncash/audiobunnei2019-03-064-10/+21
|\ \ \ \ \ \ \
| * | | | | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-054-10/+21
| | |/ / / / / | |/| | | | |
* / | | | | | kernel/thread: Remove obsolete TODO in Create()Lioncash2019-03-051-2/+0
|/ / / / / /
* / / / / / Memory: don't lock hle mutex in memory read/writeWeiyi Wang2019-03-021-6/+0
|/ / / / /
* | | | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \ \ \
| * | | | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
* | | | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / / / /
* | | | | Merge pull request #2174 from lioncash/fwdbunnei2019-02-281-1/+1
|\ \ \ \ \
| * | | | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
* | | | | | Speed up memory page mapping (#2141)Annomatg2019-02-271-6/+11
|/ / / / /
* | | | | Merge pull request #2169 from lioncash/namingbunnei2019-02-271-13/+13
|\ \ \ \ \
| * | | | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-271-13/+13
* | | | | | Merge pull request #2170 from lioncash/emu-windowbunnei2019-02-272-2/+2
|\ \ \ \ \ \
| * | | | | | core/frontend/emu_window: Make ClipToTouchScreen a const member functionLioncash2019-02-272-2/+2
| |/ / / / /
* | | | | | Merge pull request #2161 from lioncash/handle-tablebunnei2019-02-276-19/+63
|\ \ \ \ \ \
| * | | | | | kernel/handle_table: Make local variables as const where applicableLioncash2019-02-251-4/+5
| * | | | | | kernel/handle_table: Allow process capabilities to limit the handle table sizeLioncash2019-02-256-10/+54
| * | | | | | kernel/handle-table: In-class initialize data membersLioncash2019-02-252-3/+2
| * | | | | | kernel/handle_table: Resolve truncation warningsLioncash2019-02-251-2/+2
| | |/ / / / | |/| | | |
* | | | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-277-13/+13
* | | | | | common/vector_math: Move Vec[x] types into the Common namespaceLioncash2019-02-271-1/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #2156 from FreddyFunk/patch-1bunnei2019-02-261-1/+1
|\ \ \ \ \
| * | | | | file_sys/vfs_vector: Fix ignored offset on WriteFrederic L2019-02-251-1/+1
* | | | | | service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
| |/ / / / |/| | | |
* | | | | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
* | | | | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
* | | | | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
|/ / / /
* | | | Merge pull request #2130 from lioncash/system_enginebunnei2019-02-211-1/+1
|\ \ \ \
| * | | | video_core: Remove usages of System::GetInstance() within the enginesLioncash2019-02-161-1/+1
| |/ / /
* | | | Fixes Unicode Key File Directories (#2120)Jungy2019-02-211-1/+2
* | | | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-207-57/+123
* | | | address_arbiter: Use nested namespaces where applicableLioncash2019-02-162-8/+4
|/ / /
* | | core_timing: Convert core timing into a classLioncash2019-02-1643-289/+404
* | | Merge pull request #2115 from lioncash/localbunnei2019-02-141-3/+3
|\ \ \
| * | | core_timing: Make EmptyTimedCallback a local variableLioncash2019-02-131-3/+3
* | | | threadsafe_queue: Remove NeedSize template parameterLioncash2019-02-131-2/+2
|/ / /
* | | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1229-73/+69
* | | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
* | | Merge pull request #2091 from FearlessTobi/port-4603bunnei2019-02-071-4/+10
|\ \ \
| * | | gdbstub: only let Execute breakpoints write/restore BKPT opcodes into target memoryDimitri ALBORA2019-02-061-4/+10
* | | | gl_shader_cache: Link loading screen with disk shader cache loadReinUsesLisp2019-02-071-2/+0
* | | | gl_shader_disk_cache: Pass core system as argument and guard against games without title idsReinUsesLisp2019-02-071-1/+1
* | | | settings: Hide shader cache behind a settingReinUsesLisp2019-02-072-0/+3
* | | | rasterizer_interface: Add disk cache entry for the rasterizerReinUsesLisp2019-02-071-0/+3
|/ / /
* | | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
* | | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
* | | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
|/ /
* | Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\ \
| * | hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| * | hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| * | hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| * | hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| * | hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
* | | kernel: Remove the Timer classLioncash2019-02-017-229/+0
* | | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \ \
| * | | service/ns: Update function tablesLioncash2019-01-301-14/+20
| * | | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| * | | service/audio: Update function tablesLioncash2019-01-304-8/+23
| * | | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| * | | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| * | | service/btm: Update function tablesLioncash2019-01-301-55/+97
| * | | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| * | | service/psc: Update function tablesLioncash2019-01-301-8/+9
* | | | Merge pull request #2077 from lioncash/virtbunnei2019-01-315-15/+3
|\ \ \ \
| * | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directlyLioncash2019-01-301-3/+3
| * | | | kernel/timer: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| * | | | kernel/readable_event: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | |/ / | |/| |
* | | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
* | | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
|/ / /
* | | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
* | | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
* | | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
* | | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
* | | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
|/ /
* | hle/ipc_helpers: Fix clang-format warningsLioncash2019-01-301-1/+0
* | hle/ipc_helpers: Allow pushing signed valuesLioncash2019-01-291-0/+22
* | service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
* | service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
* | service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
* | kernel/svc: Log out uncaught C++ exceptions from svcBreakLioncash2019-01-271-0/+4
* | Merge pull request #2054 from bunnei/scope-context-refactorbunnei2019-01-243-0/+43
|\ \
| * | frontend: Refactor ScopeAcquireWindowContext out of renderer_opengl.bunnei2019-01-243-0/+43
| |/
* / citra_qt: Log settings on launchzhupengfei2019-01-222-0/+30
|/
* Merge pull request #2025 from DarkLordZach/loader-banner-logobunnei2019-01-2011-0/+77
|\
| * loader: Propagate NCA logo section to ReadBanner and ReadLogoZach Hilman2019-01-159-0/+61
| * content_archive: Add getter for logo section of NCAZach Hilman2019-01-152-0/+16
* | Merge pull request #2031 from lioncash/privbunnei2019-01-195-18/+29
|\ \
| * | core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
| * | core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-175-16/+21
| |/
* / file_sys/directory: Remove unused DirectoryBackend classLioncash2019-01-181-23/+0
|/
* Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-103-7/+21
|\
| * settings: Fix comment structureZach Hilman2019-01-081-4/+5
| * settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-083-11/+10
| * time: Use custom RTC settings if applicable for gameZach Hilman2019-01-081-6/+10
| * core: Set custom RTC differential on game bootZach Hilman2019-01-081-0/+7
| * settings: Add custom RTC settingsZach Hilman2019-01-081-0/+3
* | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-1020-586/+1012
|\ \ | |/ |/|
| * travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-292-3/+2
| * web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-297-134/+139
| * core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-284-2/+22
| * frontend: Add frontend responder for web browserZach Hilman2018-12-282-0/+52
| * applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-284-0/+234
| * loader: Add accessor for Manual RomFSZach Hilman2018-12-285-0/+30
| * hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| * romfs: Add SingleDiscard extraction typeZach Hilman2018-12-282-2/+6
| * am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
* | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \
| * | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| * | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| * | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
* | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \
| * | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ /
* | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \
| * | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
* | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ | |_|/ / |/| | |
| * | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ /
* | | Removed pulse event typeDavid Marcec2019-01-043-7/+0
* | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \
| * | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| * | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
* | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| |/ / |/| |
* | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \
| * | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| |/ /
* | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
* | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \
| * | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| |/ /
* / / core/kernel: Remove unnecessary inclusionsLioncash2019-01-0116-16/+22
|/ /
* | Merge pull request #1966 from lioncash/backtracebunnei2018-12-312-7/+8
|\ \
| * | arm_interface: Make include path relative for arm_interface.hLioncash2018-12-311-1/+1
| * | arm_interface: Make LogBacktrace() a const member functionLioncash2018-12-312-2/+2
| * | arm_interface: Mark variables as const where applicable in LogBacktrace()Lioncash2018-12-311-3/+4
| * | arm_interface: Remove unnecessary semicolonLioncash2018-12-311-1/+1
* | | kernel/svc: Correct misleading error message within CreateThread()Lioncash2018-12-311-2/+3
* | | kernel/svc: Sanitize core number and thread priorities in CreateThread()Lioncash2018-12-311-6/+17
* | | kernel/process: Rename GetAllowedProcessorMask() and GetAllowedThreadPriorityMask()Lioncash2018-12-312-11/+11
* | | kernel/svc: Simplify thread core ID sanitizing in CreateThreadLioncash2018-12-311-7/+1
|/ /
* | Merge pull request #1956 from lioncash/process-threadSebastian Valle2018-12-315-57/+51
|\ \
| * | kernel/process: Start the main thread using the specified ideal coreLioncash2018-12-281-2/+2
| * | kernel: Rename 'default' CPU core to 'ideal' coreLioncash2018-12-284-21/+21
| * | kernel/thread: Move process thread initialization into process.cppLioncash2018-12-283-36/+30
* | | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-306-1/+41
|\ \ \
| * | | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-294-18/+36
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-198-47/+20
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-036-14/+39
| * | | Print backtrace on svcBreakDavid Marcec2018-12-033-0/+24
* | | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
* | | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
| |_|/ |/| |
* | | Merge pull request #1954 from lioncash/npdmbunnei2018-12-281-3/+7
|\ \ \
| * | | file_sys/program_metadata: Print out more descriptive address space descriptionsLioncash2018-12-281-3/+7
| | |/ | |/|
* / | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-284-49/+35
|/ /
* | Merge pull request #1928 from lioncash/capsbunnei2018-12-2712-125/+670
|\ \
| * | kernel/process: Hook up the process capability parser to the process itselfLioncash2018-12-217-122/+44
| * | kernel/process_capability: Handle debug capability flagsLioncash2018-12-212-1/+18
| * | kernel/process_capability: Handle handle table capability flagsLioncash2018-12-212-1/+11
| * | kernel/process_capability: Handle kernel version capability flagsLioncash2018-12-212-1/+18
| * | kernel/process_capability: Handle program capability flagsLioncash2018-12-213-2/+29
| * | kernel/process_capability: Handle interrupt capability flagsLioncash2018-12-211-1/+21
| * | kernel/process_capability: Handle syscall capability flagsLioncash2018-12-212-1/+29
| * | kernel/process_capability: Handle the priority mask and core mask flagsLioncash2018-12-212-1/+40
| * | kernel/process: Introduce process capability parsing skeletonLioncash2018-12-215-3/+468
* | | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ \
| * | | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
* | | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ \
| * | | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
* | | | | Merge pull request #1949 from lioncash/unmapbunnei2018-12-271-0/+1
|\ \ \ \ \
| * | | | | kernel/vm_manager: Reset region attributes when unmapping a VMALioncash2018-12-271-0/+1
* | | | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-275-5/+50
* | | | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
* | | | | | savedata_factory: Partially implement IVFC save sizes using filesZach Hilman2018-12-272-0/+38
* | | | | | loader: Add accessor for game control dataZach Hilman2018-12-275-9/+14
* | | | | | control_metadata: Update NACP fields with latest Switchbrew dataZach Hilman2018-12-272-6/+29
* | | | | | control_metadata: Use value member instead of unique_ptr to store structZach Hilman2018-12-272-10/+13
* | | | | | vfs: Add reinterpret_casts to WriteArray and ObjectZach Hilman2018-12-271-2/+2
|/ / / / /
* | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-264-6/+72
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-044-6/+72
* | | | | Merge pull request #1886 from FearlessTobi/port-4164bunnei2018-12-232-0/+22
|\ \ \ \ \
| * | | | | yuzu, video_core: Screenshot functionalityzhupengfei2018-12-182-0/+22
* | | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-238-0/+197
|\ \ \ \ \ \
| * | | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-034-13/+5
| * | | | | | qt: Implement GUI dialog frontend for ProfileSelectorZach Hilman2018-12-031-0/+2
| * | | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| * | | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| * | | | | | core: Add getter/setter for ProfileSelector in SystemZach Hilman2018-12-032-0/+16
| * | | | | | frontend: Add frontend applet for ProfileSelectZach Hilman2018-12-033-0/+48
| * | | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
* | | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-213-0/+3
|\ \ \ \ \ \ \
| * | | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-193-0/+3
* | | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-217-28/+59
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| * | | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| * | | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| * | | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-194-7/+7
| * | | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| * | | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
* | | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| * | | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| * | | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| * | | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| * | | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
* | | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \ \
| * | | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1918 from MerryMage/cntfrqbunnei2018-12-181-0/+1
|\ \ \ \ \ \ \
| * | | | | | | arm_dynarmic: Set CNTFRQ valueMerryMage2018-12-181-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \
| * | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
* | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
* | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-154-9/+165
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| * | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| * | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| * | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| * | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-225-77/+139
| * | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-195-2/+114
* | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \
| * | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| * | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| * | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| * | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| * | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| * | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| * | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| * | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
* | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| |/ / / / / /
* | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
* | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \
| * | | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |_|/ / / / | |/| | | | |
* | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFSLioncash2018-12-111-4/+3
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1846 from lioncash/dirbunnei2018-12-111-2/+2
|\ \ \ \ \ \
| * | | | | | file_sys/directory: Amend path buffer size for directory entriesLioncash2018-12-031-2/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-1111-14/+102
|\ \ \ \ \ \
| * | | | | | loader: Add support for reading the name of game's developerZach Hilman2018-12-035-0/+26
| * | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| * | | | | | patch_manager: Obey disabled add-ons list when patching gameZach Hilman2018-12-032-11/+50
| * | | | | | core: Make GetGameFileFromPath function externally accessibleZach Hilman2018-12-032-3/+9
| * | | | | | settings: Store list of disabled add-ons per title IDZach Hilman2018-12-031-0/+5
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1887 from FearlessTobi/port-4476bunnei2018-12-111-8/+4
|\ \ \ \ \ \
| * | | | | | web_service: move telemetry condition from TelemetrySession constructor to destructorfearlessTobi2018-12-081-8/+4
* | | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \ \
| * | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
* | | | | | | | Merge pull request #1885 from lioncash/data_idbunnei2018-12-111-1/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enumLioncash2018-12-081-1/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
* | | | | | | | | Merge pull request #1880 from DarkLordZach/cache-storageHexagon122018-12-101-1/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | savedata_factory: Add support for CacheStorageZach Hilman2018-12-071-0/+2
| * | | | | | | | | savedata_factory: Delete TemporaryStorage on startupZach Hilman2018-12-071-1/+5
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-105-28/+41
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | memory: Convert ASSERT into a DEBUG_ASSERT within GetPointerFromVMA()Lioncash2018-12-061-1/+1
| * | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-065-28/+41
* | | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| * | | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| * | | | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| * | | | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| * | | | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1873 from lioncash/constbunnei2018-12-0810-10/+10
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | loaders: Make GetFileType() a const qualified member functionLioncash2018-12-0510-10/+10
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1875 from DarkLordZach/oss-ngword2bunnei2018-12-063-1/+41
|\ \ \ \ \ \ \ \
| * | | | | | | | system_archive: Implement open source NgWord2Zach Hilman2018-12-063-1/+41
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| * | | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| * | | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
* | | | | | | | Merge pull request #1867 from lioncash/allocbunnei2018-12-062-4/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | ng_word: Deduplicate use of a constant valueLioncash2018-12-051-1/+1
| * | | | | | | | system_archive: Use a regular function pointer instead of std::function for file-scope system archive arrayLioncash2018-12-051-3/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1866 from lioncash/cachebunnei2018-12-061-8/+2
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| |/ / / / / /
* / / / / / / Call shrink_to_fit after page-table vector resizing to cause crt to actually lower vector capacity. For 36-bit titles saves 800MB of commit.heapo2018-12-051-0/+8
|/ / / / / /
* | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-058-1/+227
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | file_sys: Implement system archive synthesizer for NgWord (806)Zach Hilman2018-11-235-6/+61
| * | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| * | | | | file_sys: Add framework for synthesizing open source archivesZach Hilman2018-11-163-0/+109
| * | | | | vfs_vector: Add VFS backend for std::arrayZach Hilman2018-11-161-0/+52
* | | | | | Merge pull request #1838 from lioncash/dedupbunnei2018-12-051-27/+26
|\ \ \ \ \ \
| * | | | | | file_sys/registered_cache: Eliminate variable shadowingLioncash2018-12-021-27/+26
* | | | | | | Merge pull request #1836 from lioncash/unusedbunnei2018-12-051-1/+0
|\ \ \ \ \ \ \
| * | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()Lioncash2018-12-021-1/+0
| |/ / / / / /
* | | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
* | | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
* | | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
* | | | | | | Merge pull request #1845 from lioncash/nrobunnei2018-12-045-19/+23
|\ \ \ \ \ \ \
| * | | | | | | loader/nso: Remove dependency on the System classLioncash2018-12-033-8/+11
| * | | | | | | loader/nro: Make the static LoadNro function internally linkedLioncash2018-12-032-7/+5
| * | | | | | | loader/nro: Remove dependency on the System classLioncash2018-12-032-10/+13
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-045-10/+19
|\ \ \ \ \ \ \
| * | | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-045-10/+19
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
* | | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
|/ / / / / /
* | | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
* | | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| * | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
| | |/ / / | |/| | |
* | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-036-31/+17
|\ \ \ \ \
| * | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-026-31/+17
| |/ / / /
* | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0333-236/+397
|\ \ \ \ \
| * | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| * | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2930-311/+169
| * | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2925-153/+274
| * | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| * | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| * | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-296-61/+210
| * | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
* | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-035-5/+97
|\ \ \ \ \ \
| * | | | | | file_sys: Override missing mutating functions to be stubbed out for ReadOnlyVfsDirectory by defaultLioncash2018-12-012-0/+25
| * | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-015-5/+72
* | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \
| * | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \
| * | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|/ / / | |/| | | | |
* | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
* | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / /
* | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| | |/ / / | |/| | |
* | | | | Fix debug buildLioncash2018-12-011-1/+1
| |/ / / |/| | |
* | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
* | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / /
* | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \
| * | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| * | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| * | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| * | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| * | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| * | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| * | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
* | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \
| * | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
* | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-281-5/+10
|\ \ \ \ \
| * | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-281-8/+6
| * | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-271-3/+10
* | | | | | Merge pull request #1814 from lioncash/ptrbunnei2018-11-282-28/+26
|\ \ \ \ \ \
| * | | | | | file_sys/registered_cache: Remove unused <map> includeLioncash2018-11-271-1/+0
| * | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()Lioncash2018-11-272-27/+26
* | | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
* | | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ \
| * | | | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
* | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)Lioncash2018-11-271-7/+17
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #1804 from lioncash/castbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | gdbstub: Silence value truncation warning within FpuWrite()Lioncash2018-11-271-1/+1
| | |/ / / / | |/| | | |
* | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
* | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
* | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
* | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
|/ / / / /
* | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| |/ / /
* | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
* | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ | |/ / / |/| | |
| * | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
* | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \
| * | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
* | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \
| * | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1692 from Hedges/GDBCleanbunnei2018-11-241-37/+86
|\ \ \ \ \
| * | | | | GDBStub improvements:Hedges2018-11-131-37/+86
* | | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-242-13/+31
|\ \ \ \ \ \
| * | | | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| * | | | | | Report resolution scaling support for vi and amDavid Marcec2018-11-162-13/+29
* | | | | | | Merge pull request #1747 from DarkLordZach/exefs-lfsbunnei2018-11-242-2/+48
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | patch_manager: Show LayeredExeFS patch in add-ons columnZach Hilman2018-11-211-3/+14
| * | | | | | patch_manager: Apply LayeredExeFS patchesZach Hilman2018-11-201-0/+25
| * | | | | | settings: Add option to dump ExeFS of games upon launchZach Hilman2018-11-202-0/+10
* | | | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-234-4/+102
|\ \ \ \ \ \ \
| * | | | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| * | | | | | | applets: Add StubAppletZach Hilman2018-11-223-0/+98
* | | | | | | | Merge pull request #1777 from lioncash/core-mgrbunnei2018-11-234-97/+225
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Relocate CPU core management to its own classLioncash2018-11-224-97/+225
* | | | | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
* | | | | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
* | | | | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| * | | | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| * | | | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| * | | | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| * | | | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
* | | | | | | | am: Correct build failureLioncash2018-11-211-2/+2
* | | | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| * | | | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| * | | | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| * | | | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| * | | | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / / / /
* | | | | | | | Merge pull request #1746 from lioncash/randombunnei2018-11-212-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| | |/ / / / / / | |/| | | | | |
* / | | | | | | file_sys/card_image: Provide named members for the GamecardInfo structLioncash2018-11-211-1/+12
|/ / / / / / /
* | | | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-2012-106/+840
|\ \ \ \ \ \ \
| * | | | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| * | | | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| * | | | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| * | | | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| * | | | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| * | | | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| * | | | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| * | | | | | | applet: Add operation completed callbackZach Hilman2018-11-184-6/+12
| * | | | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| * | | | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-185-11/+29
| * | | | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-186-44/+41
| * | | | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-182-4/+9
| * | | | | | | am: Implement text check software keyboard modeZach Hilman2018-11-185-14/+103
| * | | | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-1811-62/+106
| * | | | | | | qt/main: Register Qt Software Keyboard frontend with AMZach Hilman2018-11-181-0/+1
| * | | | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| * | | | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-183-0/+130
| * | | | | | | frontend/applets: Add frontend software keyboard provider and defaultZach Hilman2018-11-183-0/+63
| * | | | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-183-0/+77
| * | | | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| * | | | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| * | | | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| * | | | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| * | | | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| * | | | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| * | | | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \ \
| * | | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
* | | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / / /
* | | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-196-215/+114
* | | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
* | | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
* | | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
* | | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
* | | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
* | | | | | | settings: Add settings for multiple players and controllersZach Hilman2018-11-191-3/+48
* | | | | | | settings: Add Native type for keyboardZach Hilman2018-11-191-0/+210
* | | | | | | settings: Add Native type for mouse buttonsZach Hilman2018-11-192-0/+34
* | | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
* | | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
* | | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
* | | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
* | | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
* | | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
* | | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-197-23/+405
|\ \ \ \ \ \
| * | | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| * | | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| * | | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| * | | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| * | | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| * | | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-152-3/+7
| * | | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
* | | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ \
| * | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
* | | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
* | | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
* | | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \ \
| * | | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
|/ / / / / / /
* | | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \ \
| * | | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| * | | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-1610-14/+34
|\ \ \ \ \ \ \
| * | | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| * | | | | | | file_sys: Use common KeyManager in NCA container typesZach Hilman2018-11-026-7/+18
| * | | | | | | content_archive: Add optional KeyManager parameter to constructorZach Hilman2018-11-022-3/+5
* | | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-164-33/+16
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/errors: Remove currently unused filesystem error codesLioncash2018-11-161-10/+0
| * | | | | | | | file_sys/errors: Get rid of the ErrCodes namespaceLioncash2018-11-161-17/+5
| * | | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-164-14/+19
| | |_|/ / / / / | |/| | | | | |
* / | | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / / /
* | | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
* | | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \ \
| * | | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \ \
| * | | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-157-7/+48
|\ \ \ \ \ \ \
| * | | | | | | patch_manager: Add support for dumping decompressed NSOsZach Hilman2018-10-292-1/+14
| * | | | | | | settings: Add setting to control NSO dumpingZach Hilman2018-10-291-0/+1
| * | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-294-6/+33
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
* | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \
| * | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| * | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
* | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-144-2/+28
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-134-2/+28
| |/ / / / /
* | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \
| * | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| * | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / /
* | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \
| * | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / /
* | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-1410-16/+260
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-294-17/+75
| * | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| * | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| * | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-294-14/+32
| * | | | | loader/nro: Call RegisterRomFS from LoadZach Hilman2018-10-291-0/+5
| * | | | | control_metadata: Add GetRawBytes function to NACPZach Hilman2018-10-292-0/+7
| |/ / / /
* | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-134-3/+15
|\ \ \ \ \
| * | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-131-1/+2
| * | | | | settings: Add config option to set RNG seedZach Hilman2018-11-121-0/+2
| * | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| * | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| * | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| * | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
* | | | | Merge pull request #1652 from FreddyFunk/static-castbunnei2018-11-111-2/+2
|\ \ \ \ \
| * | | | | configure_system: Fix compiler warningFrederic Laing2018-11-061-2/+2
* | | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-106-35/+138
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | FixupsDavid Marcec2018-11-071-1/+1
| * | | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-076-35/+138
| |/ / / /
* | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \
| * | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| |/ / / /
* | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
* | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
* | | | | Added missing logDavid Marcec2018-11-071-0/+1
* | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
|/ / / /
* | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \
| * | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
* | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
| |_|_|/ |/| | |
* | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / /
* | | Merge pull request #1615 from lioncash/inputbunnei2018-11-021-1/+2
|\ \ \
| * | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-311-1/+2
| |/ /
* | | Merge pull request #1604 from FearlessTobi/port-4369bunnei2018-11-012-0/+15
|\ \ \
| * | | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-282-0/+15
* | | | service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
| |_|/ |/| |
* | | general: Remove unused boost inclusions where applicableLioncash2018-10-302-3/+0
* | | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-3024-144/+141
* | | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ \
| * | | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| * | | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| | |/ | |/|
* | | core: Make System references const where applicableLioncash2018-10-282-3/+3
* | | core: Add missing const variants of getters for the System classLioncash2018-10-282-10/+49
|/ /
* | Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ \
| * | svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| * | svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
| |/
* | file_sys/patch_manager: Remove unnecessary if-statements (#1586)Frederic L2018-10-281-7/+6
* | Merge pull request #1598 from DeeJayBro/delete-directorybunnei2018-10-281-2/+26
|\ \
| * | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
| |/
* | Merge pull request #1600 from DarkLordZach/nsp-secondary-loader-fixbunnei2018-10-281-17/+20
|\ \
| * | loader/nsp: Move secondary loader initialization to constructorZach Hilman2018-10-271-17/+20
| |/
* / key_manager: Use isxdigit instead of isdigit when reading key fileZach Hilman2018-10-281-1/+1
|/
* Merge pull request #1430 from DarkLordZach/remove-promote-dirbunnei2018-10-2617-95/+1
|\
| * vfs: Remove InterpretAsDirectory and related functionsZach Hilman2018-10-1917-95/+1
* | Merge pull request #1569 from lioncash/amiibobunnei2018-10-262-3/+5
|\ \
| * | yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-242-3/+5
* | | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
* | | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
* | | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
* | | nro: Make LoadNro method accessible outside of apploader code.bunnei2018-10-262-6/+18
* | | ips_layer: Use rle_size instead of data_size in RLE patch applicationZach Hilman2018-10-251-1/+1
* | | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ \
| * | | service/usb: Update service function tablesLioncash2018-10-251-21/+22
* | | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ \
| * | | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| * | | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| * | | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / /
* | | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ \
| * | | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| * | | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| * | | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| * | | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| * | | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| * | | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| * | | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| * | | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| * | | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / /
* | | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-253-43/+48
|\ \ \ \
| * | | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-243-43/+48
| |/ / /
* | | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ \
| * | | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |/ / | |/| |
* | | | Merge pull request #1563 from lioncash/framebunnei2018-10-241-4/+0
|\ \ \ \
| * | | | perf_stats: Remove unused variable within DoFrameLimiting()Lioncash2018-10-241-4/+0
| |/ / /
* | | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ \
| * | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ / /
* | | | Merge pull request #1561 from lioncash/fsbunnei2018-10-242-3/+6
|\ \ \ \ | |_|/ / |/| | |
| * | | vfs: Handle failure of file reading within VfsRawCopy()Lioncash2018-10-241-2/+6
| * | | key_manager: Remove unused variable in DeriveBase()Lioncash2018-10-241-1/+0
| |/ /
* | | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-245-30/+227
|\ \ \ | |/ / |/| |
| * | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-242-13/+37
| * | acc: Fix account UUID duplication errorZach Hilman2018-10-244-17/+47
| * | configure_system: Clear selection after user deleteZach Hilman2018-10-241-1/+1
| * | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-245-28/+129
| * | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| * | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| * | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| * | settings: Add users and current_user settings and remove usernameZach Hilman2018-10-241-1/+3
* | | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ \ | |/ / |/| |
| * | Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| * | Added break types to svcBreakDavid Marcec2018-10-231-4/+42
* | | Added Amiibo support (#1390)David2018-10-244-50/+295
* | | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-244-5/+29
|\ \ \
| * | | qt: Add support for dumping a DLC Data RomFSZach Hilman2018-10-182-0/+5
| * | | registered_cache: Deduplicate results of ListEntry and ListEntryFilterZach Hilman2018-10-172-2/+16
| * | | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| * | | patch_manager: Add support for using LayeredFS with DataZach Hilman2018-10-171-2/+3
* | | | Merge pull request #1540 from lioncash/handlebunnei2018-10-248-98/+95
|\ \ \ \ | |_|/ / |/| | |
| * | | kernel/process: Make the handle table per-processLioncash2018-10-208-98/+95
* | | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-224-0/+90
|\ \ \ \
| * | | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| * | | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| * | | | service: Add skeleton for psm serviceZach Hilman2018-10-214-0/+74
| |/ / /
* | | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ \
| * | | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / /
* | | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-214-2/+109
* | | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
* | | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-214-0/+44
* | | | am: Update service function tablesLioncash2018-10-214-15/+60
* | | | prepo: Update service function table.Lioncash2018-10-211-8/+13
* | | | lbl: Update service function table namesLioncash2018-10-211-28/+28
* | | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
|/ / /
* | | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ \
| * | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
* | | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ \
| * | | | es: Update service function tablesLioncash2018-10-191-7/+11
| * | | | audio: Update service function tablesLioncash2018-10-191-17/+20
| * | | | omm: Update service function tablesLioncash2018-10-191-16/+18
| * | | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| * | | | hid: Update service function tablesLioncash2018-10-191-6/+45
| * | | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| * | | | ns: Update service function tableLioncash2018-10-191-6/+49
| * | | | set_cal: Update service function tableLioncash2018-10-191-1/+2
* | | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ \
| * | | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \
| * | | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| * | | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| * | | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| * | | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| * | | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| * | | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| * | | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| * | | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |_|/ / | |/| | |
* | | | | crypto: Use compressed sizes in offset calculation for KIP decompressionZach Hilman2018-10-201-1/+2
| |/ / / |/| | |
* | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / |/| |
* | | Merge pull request #1523 from lioncash/lockbunnei2018-10-191-9/+15
|\ \ \
| * | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| * | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-181-9/+7
* | | | Merge pull request #1511 from lioncash/contentbunnei2018-10-192-258/+292
|\ \ \ \
| * | | | content_archive: Simpify assignment of bktr_base_romfs in the constructorLioncash2018-10-161-2/+1
| * | | | content_archive: Make IsValidNCA() an internally linked functionLioncash2018-10-162-3/+1
| * | | | content_archive: Simplify rights ID checkLioncash2018-10-161-2/+2
| * | | | content_archive: Split loading into separate functionsLioncash2018-10-162-253/+290
| * | | | content_archive: Pass and take NCASectionHeader instance by referenceLioncash2018-10-162-3/+3
| | |_|/ | |/| |
* | | | Merge pull request #1521 from ogniK5377/imp-mmubunnei2018-10-191-8/+42
|\ \ \ \
| * | | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
| | |_|/ | |/| |
* | | | core: Remove unnecessary assert in ArmInterface()Lioncash2018-10-181-2/+1
| |_|/ |/| |
* | | Merge pull request #1510 from lioncash/xcibunnei2018-10-183-7/+8
|\ \ \ | |/ / |/| |
| * | XCI: Add function for checking the existence of the program NCALioncash2018-10-163-7/+8
| |/
* | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1822-648/+1720
|\ \
| * | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| * | WipDavid Marcec2018-10-122-3/+23
| * | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| * | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| * | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| * | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| * | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| * | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| * | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| * | "Better Hid" rework part 1David Marcec2018-10-1022-644/+1500
* | | Merge pull request #1497 from bunnei/flush-framebuffersbunnei2018-10-182-3/+3
|\ \ \
| * | | config: Rename use_accurate_framebuffers -> use_accurate_gpu_emulation.bunnei2018-10-162-3/+3
| | |/ | |/|
* | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \
| * | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
* | | | Merge pull request #1509 from DarkLordZach/device-save-databunnei2018-10-181-1/+12
|\ \ \ \ | |_|/ / |/| | |
| * | | savedata_factory: Add TemporaryStorage SaveDataSpaceIdZach Hilman2018-10-161-1/+4
| * | | savedata_factory: Add support for DeviceSaveDataZach Hilman2018-10-161-0/+8
* | | | Merge pull request #1443 from DarkLordZach/lower-loader-logs-1bunnei2018-10-162-3/+9
|\ \ \ \
| * | | | patch_manager: Move non-Program RomFS patch log to DebugZach Hilman2018-10-131-2/+8
| * | | | content_archive: Move get key log to Trace levelZach Hilman2018-10-131-1/+1
* | | | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
* | | | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-1611-56/+71
|\ \ \ \ \
| * | | | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-159-27/+45
| * | | | | core: Make the live Cpu instances unique_ptrs instead of shared_ptrsLioncash2018-10-151-9/+9
| * | | | | core: Make the exclusive monitor a unique_ptr instead of a shared_ptrLioncash2018-10-155-15/+13
| * | | | | core: Make CPUBarrier a unique_ptr instead of a shared_ptrLioncash2018-10-153-11/+10
* | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-1610-42/+41
| |_|/ / / |/| | | |
* | | | | Merge pull request #1473 from lioncash/cmakebunnei2018-10-161-2/+2
|\ \ \ \ \
| * | | | | core/CMakeLists: Make all web_service-related libraries privateLioncash2018-10-111-1/+1
| * | | | | core/CMakeLists: Use target_compile_definitions instead of add_definitions for specifying ENABLE_WEB_SERVICELioncash2018-10-111-1/+1
* | | | | | file_sys/control_metadata: Get rid of magic constantsLioncash2018-10-161-3/+6
* | | | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-163-3/+20
|\ \ \ \ \ \
| * | | | | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-153-2/+18
| * | | | | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
* | | | | | | Merge pull request #1499 from lioncash/nrobunnei2018-10-157-28/+39
|\ \ \ \ \ \ \
| * | | | | | | nso: Return an optional address from LoadModuleLioncash2018-10-155-16/+29
| * | | | | | | nso: Make LoadModule take a VfsFile by const referenceLioncash2018-10-153-11/+9
| * | | | | | | nro: Make LoadNro take a VfsFile by const referenceLioncash2018-10-152-6/+6
| | |_|_|_|/ / | |/| | | | |
* | | | | | | crypto: Various crypto fixes for quickstart guideZach Hilman2018-10-151-2/+2
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #1486 from lioncash/filebunnei2018-10-144-63/+72
|\ \ \ \ \ \
| * | | | | | partition_data_manager: Reserve and insert data within output vector in DecryptPackage2()Lioncash2018-10-131-20/+16
| * | | | | | partition_data_manager: Remove unused std::map instance within DecryptPackage2()Lioncash2018-10-131-2/+0
| * | | | | | partition_data_manager: Take package2_keys by const referenceLioncash2018-10-132-2/+3
| * | | | | | partition_data_manager: Move IV data to where it's needed in DecryptPackage2()Lioncash2018-10-131-3/+1
| * | | | | | partition_data_manager: Remove commented out codeLioncash2018-10-131-2/+0
| * | | | | | key_manager/partition_data_manager: Silence truncation compiler warningsLioncash2018-10-134-10/+15
| * | | | | | partition_data_manager: Dehardcode array boundsLioncash2018-10-132-7/+12
| * | | | | | partition_data_manager: Take VirtualFile by const reference in constructorLioncash2018-10-132-2/+2
| * | | | | | partition_data_manager: Amend constructor initializer list orderLioncash2018-10-131-2/+3
| * | | | | | partition_data_manager: Remove unused includesLioncash2018-10-132-4/+1
| * | | | | | key_manager: Use std::vector's insert() instead of std::copy with a back_inserterLioncash2018-10-131-2/+2
| * | | | | | key_manager: Brace long conditional bodyLioncash2018-10-131-1/+2
| * | | | | | key_manager: Don't assume file seeks and reads will always succeedLioncash2018-10-131-7/+17
| * | | | | | key_manager: Remove unnecessary seek in DeriveSDSeed()Lioncash2018-10-131-1/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-145-15/+14
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-135-15/+14
| |/ / / /
* | | | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ \ \
| * | | | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / / /
* / / / / Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / / /
* | | | Merge pull request #1409 from DarkLordZach/key-derivationbunnei2018-10-137-74/+1569
|\ \ \ \
| * | | | partition_data_manager: Rename system files for hekateZach Hilman2018-10-074-178/+228
| * | | | crypto: Add PartitionDataManagerZach Hilman2018-10-073-0/+692
| * | | | key_manager: Add support for loading keys from partition dataZach Hilman2018-10-072-0/+88
| * | | | key_manager: Add ETicket key derivationZach Hilman2018-10-073-2/+277
| * | | | key_manager: Add base key derivationZach Hilman2018-10-072-4/+220
| * | | | key_manager: Add BIS key getterZach Hilman2018-10-072-2/+19
| * | | | key_manager: Add support for more keysZach Hilman2018-10-072-3/+99
| * | | | key_manager: Add keyblob supportZach Hilman2018-10-072-0/+14
| * | | | key_manager: Add support for crypto revisions past 04Zach Hilman2018-10-071-43/+63
| * | | | key_manager: Add support for comments in keyfilesZach Hilman2018-10-071-0/+3
| * | | | vfs: Move forward declarations to separate fileZach Hilman2018-10-072-9/+22
| * | | | key_manager: Add support for console-specific keyfileZach Hilman2018-10-072-3/+13
| * | | | key_manager: Rename KEK to KekZach Hilman2018-10-072-8/+9
* | | | | Merge pull request #1483 from lioncash/codesetbunnei2018-10-137-83/+45
|\ \ \ \ \
| * | | | | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-127-83/+45
* | | | | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ / / /
* | | | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ \ \
| * | | | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| * | | | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| * | | | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ \ \
| * | | | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| * | | | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ \
| * | | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| * | | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ / /
* | | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ \
| * | | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / /
* | | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ \
| * | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| |/ / /
* / / / nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
|/ / /
* | | kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-109-38/+39
* | | Merge pull request #1461 from lioncash/warnbunnei2018-10-101-3/+3
|\ \ \
| * | | ips_layer: Silence truncation and conversion warningsLioncash2018-10-091-3/+3
* | | | Merge pull request #1464 from lioncash/uniquebunnei2018-10-106-15/+13
|\ \ \ \ | |_|/ / |/| | |
| * | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptrLioncash2018-10-096-15/+13
| |/ /
* | | Merge pull request #1459 from ogniK5377/breakbunnei2018-10-091-5/+20
|\ \ \
| * | | Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
| * | | Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
| * | | svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
* | | | Merge pull request #1465 from lioncash/telemetrybunnei2018-10-092-7/+9
|\ \ \ \
| * | | | telemetry_session: Remove doxygen comment for a non-existent parameterLioncash2018-10-091-1/+0
| * | | | telemetry_session: Add missing includesLioncash2018-10-092-2/+5
| * | | | telemetry_session: Remove unimplemented FinalizeAsyncJob prototypeLioncash2018-10-091-2/+0
| * | | | telemetry_session: Use a std::array in GenerateTelemetryId()Lioncash2018-10-091-2/+4
| | |/ / | |/| |
* | | | ips_layer: Avoid constructing std::vector instances where not necessaryLioncash2018-10-091-6/+25
* | | | ips_layer: Remove unnecessary explicit std::pair constructor in std::arrayLioncash2018-10-091-5/+13
* | | | ips_layer: Add missing includesLioncash2018-10-092-7/+17
* | | | ips_layer: std::move data within PatchIPS() and Apply()Lioncash2018-10-091-2/+5
|/ / /
* | | Merge pull request #1423 from DarkLordZach/romfs-file-extsbunnei2018-10-085-10/+38
|\ \ \
| * | | patch_manager: Avoid romfs_ext requirement for patchingZach Hilman2018-10-041-4/+1
| * | | fsmitm_romfsbuild: Extract stubs and IPS to romfs_ext dirZach Hilman2018-10-045-21/+38
| * | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFSZach Hilman2018-10-041-0/+14
* | | | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-084-23/+299
|\ \ \ \ | |_|/ / |/| | |
| * | | ips_layer: Fix inaccuracies with comments and flagsZach Hilman2018-10-043-16/+51
| * | | ips_layer: Deduplicate resource usageZach Hilman2018-10-043-31/+37
| * | | ips_layer: Add support for escape sequences and midline commentsZach Hilman2018-10-043-8/+41
| * | | patch_manager: Add support for IPSwitch format patchesZach Hilman2018-10-041-22/+56
| * | | ips_layer: Add IPSwitchCompiler to process IPSwitch formatZach Hilman2018-10-042-0/+168
| |/ /
* | | Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ \ \
| * | | Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | |/ | |/|
* | | Merge pull request #1457 from ogniK5377/unmap-bufferbunnei2018-10-081-1/+6
|\ \ \
| * | | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
| |/ /
* | | nso/nro: Use default allocation size for arg_dataZach Hilman2018-10-074-14/+20
* | | cmd: Support passing game arguments from command lineZach Hilman2018-10-072-2/+2
* | | settings: Add program_args string settingZach Hilman2018-10-071-0/+1
* | | nso/nro: Add NSO arguments structure to data sectionZach Hilman2018-10-074-3/+38
|/ /
* | Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-0715-16/+128
|\ \
| * | romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-059-6/+36
| * | patch_manager: Add support for NSP packed updatesZach Hilman2018-10-051-2/+2
| * | patch_manager: Add support for packed updatesZach Hilman2018-10-054-5/+18
| * | loader: Add getter for packed updateZach Hilman2018-10-056-3/+58
| * | loader: Add ReadRomFSIVFCOffset to NSP, XCI, and NAX loadersZach Hilman2018-10-056-6/+20
| |/
* | Merge pull request #1448 from ogniK5377/frontend-accessbunnei2018-10-074-0/+26
|\ \
| * | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| * | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
* | | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-064-14/+53
|\ \ \ | |/ / |/| |
| * | Review comments -part 4fearlessTobi2018-10-021-0/+1
| * | Address more review commentsfearlessTobi2018-10-021-1/+1
| * | Address a bunch of review commentsfearlessTobi2018-10-022-6/+7
| * | Port web_service from CitrafearlessTobi2018-10-024-14/+51
* | | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
* | | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
* | | Merge pull request #1439 from lioncash/threadbunnei2018-10-0514-206/+392
|\ \ \ | |_|/ |/| |
| * | kernel/thread: Make all instance variables privateLioncash2018-10-0414-206/+392
* | | Merge pull request #1415 from DarkLordZach/ipsbunnei2018-10-048-36/+255
|\ \ \
| * | | nso: Optimize loading of IPS patchesZach Hilman2018-10-025-51/+43
| * | | deconstructed_rom_directory: Force NSO loader to patch NSOsZach Hilman2018-10-011-1/+3
| * | | nso: Add framework to support patching of uncompressed NSOsZach Hilman2018-10-012-2/+17
| * | | patch_manager: Add PatchNSO functionZach Hilman2018-10-013-0/+104
| * | | patch_manager: Use strings for patch type instead of enumZach Hilman2018-10-012-29/+33
| * | | file_sys: Implement function to apply IPS patchesZach Hilman2018-10-012-0/+103
| * | | nso: Replace NSOHeader padding bytes with build IDZach Hilman2018-10-011-2/+1
| | |/ | |/|
* | | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ \
| * | | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| |/ /
* | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \
| * | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| | |/ | |/|
* | | Merge pull request #1436 from lioncash/viewbunnei2018-10-042-73/+101
|\ \ \
| * | | submission_package: Avoid dangling std::string_view within SetTicketKeys()Lioncash2018-10-031-2/+5
| * | | submission_package: Correct location of null check within SetTicketKeys()Lioncash2018-10-031-3/+6
| * | | submission_package: Use std::string's rfind() when looking for the extension in InitializeExeFSAndRomFS()Lioncash2018-10-031-1/+1
| * | | submission_package: Ensure the 'extracted' member variable is always initializedLioncash2018-10-032-3/+1
| * | | submission_package: Move ExeFS and RomFS initialization to its own functionLioncash2018-10-032-10/+18
| * | | submission_package: Move NCA reading code to its own functionLioncash2018-10-032-43/+48
| * | | submission_package: Move ticket key setting to its own functionLioncash2018-10-031-21/+28
| * | | submission_package: Invert conditionals within NSP's constructor to reduce nestingLioncash2018-10-031-45/+49
| |/ /
* | | Merge pull request #1432 from lioncash/lblbunnei2018-10-041-19/+19
|\ \ \
| * | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| | |/ | |/|
* | | Merge pull request #1435 from lioncash/xcibunnei2018-10-041-1/+3
|\ \ \ | |/ / |/| |
| * | card_image: Ensure program_nca_status is always initializedLioncash2018-10-031-1/+3
| |/
* | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-012-21/+28
* | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-013-5/+8
* | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
* | romfs_factory: Read from all locations with StorageId NoneZach Hilman2018-10-011-26/+25
* | patch_manager: Add DLC recognition to PatchManagerZach Hilman2018-10-012-0/+27
|/
* Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\
| * Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
* | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
* | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
* | kernel/process: Make data member variables privateLioncash2018-09-3016-72/+117
* | arm_interface: Add missing fpsr/tpidr members to the ThreadContext structLioncash2018-09-303-5/+15
* | loader: Make the Load() function take a process as a regular reference, not a SharedPtrLioncash2018-09-2918-42/+28
* | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \
| * | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
* | | Merge pull request #1395 from lioncash/vmbunnei2018-09-2917-158/+413
|\ \ \
| * | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-2511-75/+60
| * | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| * | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-255-20/+56
| * | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-2410-38/+259
* | | | Merge pull request #1394 from lioncash/streambunnei2018-09-271-1/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | stream: Preserve enum class type in GetState()Lioncash2018-09-241-1/+1
| |/ /
* | | Merge pull request #1389 from PhiBabin/valgrindMat M2018-09-271-1/+1
|\ \ \
| * | | FPCR register was uninitialized at start upPhilippe Babin2018-09-231-1/+1
* | | | fsmitm_romfsbuild: std::move std::vector instances in Build()Lioncash2018-09-261-2/+2
* | | | fsmitm_romfsbuild: Replace manual value aligning with Common::AlignUp()Lioncash2018-09-261-12/+11
* | | | Merge pull request #1399 from lioncash/schedbunnei2018-09-264-14/+14
|\ \ \ \
| * | | | core_cpu: Make arm_interface instances a std::unique_ptrLioncash2018-09-252-4/+4
| * | | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-253-10/+10
| |/ / /
* | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \
| * | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
* | | | | patch_manager: Invert conditionals within ApplyLayeredFS()Lioncash2018-09-261-27/+30
* | | | | vfs_vector: Amend initializer list order in VectorVfsFile's constructor initializer listLioncash2018-09-261-1/+1
* | | | | fsmitm_romfsbuild: Avoid type truncation warningsLioncash2018-09-261-7/+10
* | | | | fsmitm_romfsbuild: Remove unnecessary constructors and initializers for RomFSBuildFileContext and RomFSBuildDirectoryContextLioncash2018-09-261-5/+3
* | | | | fsmitm_romfsbuild: Remove unnecessary loops in Build()Lioncash2018-09-261-6/+0
* | | | | fsmitm_romfsbuild: Make auto variable into a std::size_t variable within Build()Lioncash2018-09-261-1/+1
* | | | | vfs/etc: Append std:: to size_t usagesLioncash2018-09-266-22/+23
* | | | | vfs_concat/vfs_layered: Remove friend declarations from ConcatenatedVfsFileLioncash2018-09-268-61/+59
* | | | | vfs_static: Remove template byte parameter from StaticVfsFileLioncash2018-09-254-42/+42
* | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-2524-33/+1037
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | fsmitm: Cleanup and modernize fsmitm portZach Hilman2018-09-2421-377/+377
| * | | | qt: Add UI elements for LayeredFS and related toolsZach Hilman2018-09-222-2/+2
| * | | | romfs: Implement CreateRomFSZach Hilman2018-09-222-4/+25
| * | | | file_sys: Port Atmosphere-NX fs_mitm implementationZach Hilman2018-09-222-0/+474
| * | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| * | | | bis_factory: Add mod directory VFS getterZach Hilman2018-09-223-3/+18
| * | | | patch_manager: Add LayeredFS mods supportZach Hilman2018-09-222-1/+44
| * | | | vfs_concat: Rewrite and fix ConcatenatedVfsFileZach Hilman2018-09-222-14/+59
| * | | | vfs_layered: Add LayeredVfsDirectoryZach Hilman2018-09-222-0/+178
| * | | | vfs_vector: Add VectorVfsFileZach Hilman2018-09-222-0/+75
| * | | | vfs_static: Add StaticVfsFileZach Hilman2018-09-222-0/+78
| * | | | vfs: Add and rewite VfsRawCopy functionsZach Hilman2018-09-222-6/+36
| * | | | vfs: Add GetEntries methodZach Hilman2018-09-224-0/+32
* | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \
| * | | | | svc: Updated svc namestech4me2018-09-241-7/+7
* | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
* | | | | | Stubbed IRS (#1349)David2018-09-242-18/+167
* | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
* | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-231-1/+8
| |_|_|/ / |/| | | |
* | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
* | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| |_|/ / |/| | |
* | | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
* | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \
| * | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
* | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-214-1/+10
|\ \ \ \ \
| * | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-214-1/+10
| |/ / / /
* | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \
| * | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
| | |_|/ / | |/| | |
* | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \
| * | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| * | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
* | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
| |_|/ / / |/| | | |
* | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \
| * | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| |/ / / /
* | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-201-0/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| * | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| |/ / /
* | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \
| * | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ | |/| |
* | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \
| * | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| * | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / | |/| |
* | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \
| * | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| * | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| * | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| * | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| * | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| * | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / /
* | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
* | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / /
* | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
* | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \
| * | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| | |/ | |/|
* | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
* | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ /
* | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \
| * | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
* | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \
| * | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| |/ /
* | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \
| * | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| |/ /
* | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \
| * | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ /
* | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \
| * | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| * | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| * | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| |/ /
* | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-191-2/+3
* | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \
| * | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| * | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ /
* | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \
| * | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ /
* / / arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
|/ /
* | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \
| * | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
* | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \
| * | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ /
* | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \
| * | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ /
* | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \
| * | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| * | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| * | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| * | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ /
* | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \
| * | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |/ | |/|
* / | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1579-395/+409
|/ /
* | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-144-9/+10
|\ \
| * | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-134-9/+10
| |/
* | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \
| * | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/
* | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ | |/ |/|
| * services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
* | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/
* Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-132-0/+4
|\
| * Add audio stretching supportfearlessTobi2018-09-082-0/+4
* | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \
| * | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
* | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \
| * | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| * | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
* | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
* | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
|/ / /
* | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \
| * | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ /
* / / service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
|/ /
* | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \
| * | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
* | | externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/ /
* | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-112-2/+26
* | video_core: Move command buffer loop.Markus Wick2018-09-102-31/+12
* | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \
| * | hid: Implement ReloadInputDevicesfearlessTobi2018-09-092-4/+6
| |/
* / service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
|/
* core: Migrate current_process pointer to the kernelLioncash2018-09-074-5/+34
* Merge pull request #1250 from lioncash/file-sysbunnei2018-09-074-4/+16
|\
| * file_sys/nca_patch: Amend constructor initializer list orderLioncash2018-09-061-2/+2
| * file_sys/nca_patch: Remove unnecessary includesLioncash2018-09-062-2/+9
| * file_sys/patch_manager: Add missing includesLioncash2018-09-062-0/+5
* | core/core: Remove unnecessary sm/controller includeLioncash2018-09-065-2/+5
|/
* Merge pull request #1242 from lioncash/file-sysbunnei2018-09-062-8/+17
|\
| * file_sys/submission_package: Correct constructor initialization list orderLioncash2018-09-051-2/+2
| * file_sys/submission_package: Replace includes with forward declarations where applicableLioncash2018-09-052-6/+15
* | bktr: Fix bucket overlap errorZach Hilman2018-09-047-9/+9
* | drd: Parse title ID from program metadataZach Hilman2018-09-042-4/+29
* | patch_manager: Centralize Control-type NCA parsingZach Hilman2018-09-044-55/+74
* | nsp: Fix error masking issue with XCI filesZach Hilman2018-09-043-6/+13
* | game_list: Fix version display on non-NAND titlesZach Hilman2018-09-043-8/+33
* | bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
* | bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
* | bktr: Fix missing includes and optimize styleZach Hilman2018-09-0411-101/+107
* | loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
* | loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
* | patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
* | file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
* | file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
* | content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
* | registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
* | game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-041-1/+1
* | aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
|/
* main: Only show DRD deprecation warning onceZach Hilman2018-09-046-3/+6
* control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
* card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
* nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
* qt: Add UI support for NSP filesZach Hilman2018-09-041-0/+4
* registration: Add support for installing NSP filesZach Hilman2018-09-042-10/+16
* loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
* card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
* file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
* drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
* loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
* key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
* Merge pull request #1237 from degasus/optimizationsbunnei2018-09-042-3/+3
|\
| * core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
* | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-041-0/+2
|\ \
| * | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-041-0/+2
* | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0420-26/+62
|\ \ \
| * | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0420-26/+62
| | |/ | |/|
* | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-042-2/+6
|\ \ \
| * | | Update microprofile scopes.Markus Wick2018-09-042-2/+6
| |/ /
* | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ | |/ / |/| |
| * | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
* | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \
| * | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ | |/|
* / | vfs_real: Forward declare IOFileLioncash2018-09-027-14/+31
|/ /
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-022-2/+30
|\ \
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-3118-43/+85
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-313-38/+17
* core: Make the main System class use the PImpl idiomLioncash2018-08-314-276/+383
* kernel: Eliminate kernel global stateLioncash2018-08-2951-440/+665
* Merge pull request #1193 from lioncash/privbunnei2018-08-282-8/+8
|\
| * gpu: Make memory_manager privateLioncash2018-08-282-8/+8
* | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
|/
* Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
* | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \
| * | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
| |/
* | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \
| * | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
* | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \
| * | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ | |/|
* | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \
| * | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
* | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-271-0/+1
|\ \ \ \
| * | | | debug_utils: Remove unused includesLioncash2018-08-251-0/+1
| | |_|/ | |/| |
* | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \
| * | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| * | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
* | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \
| * | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \
| * | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / /
* | | | / set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
| |_|_|/ |/| | |
* | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ /
* | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2527-81/+806
|\ \ \
| * | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| * | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| * | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| * | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| * | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| * | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| * | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| * | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| * | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| * | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| * | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| * | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| * | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| * | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| * | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-232-8/+11
| * | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| * | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| * | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| * | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| * | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| * | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| * | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
| | |/ | |/|
* | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-241-0/+7
|\ \ \ | |_|/ |/| |
| * | qt: Add filename and title id to window title while runningZach Hilman2018-08-231-0/+7
| |/
* / Added GetBootMode (#1107)David2018-08-244-3/+25
|/
* Merge pull request #1136 from tech4me/masterbunnei2018-08-222-4/+4
|\
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-212-4/+4
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-223-7/+18
|\ \
| * | Port #3353 from CitrafearlessTobi2018-08-213-7/+18
* | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
* | | PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
* | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \
| * | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
* | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
|/ / /
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/|
* / | perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ /
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-218-8/+34
|\ \
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-216-5/+22
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
* | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \
| * | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
* | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ | |_|/ / |/| | |
| * | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| * | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| * | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| * | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| * | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| * | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| * | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| * | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| * | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| * | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| * | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| * | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| * | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |/ | |/|
* | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ | |_|/ |/| |
| * | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| * | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
* | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-211-62/+7
|\ \ \ | |_|/ |/| |
| * | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-151-62/+7
* | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \
| * | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ | |/|
* | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ | |/ / |/| |
| * | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| * | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| * | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| * | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| * | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| * | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| * | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| * | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| * | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| * | If statement style changeDavid Marcec2018-08-111-11/+19
| * | Second round of account changesDavid Marcec2018-08-113-18/+21
| * | First round of account changesDavid Marcec2018-08-113-49/+55
| * | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| * | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1137-148/+758
| |\ \
| * | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| * | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| * | | Open first user addedDavid Marcec2018-08-081-1/+3
| * | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| * | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| * | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| * | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
* | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
* | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \
| * | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6
* | | | | Merge pull request #1093 from greggameplayer/GetDefaultDisplayResolutionChangeEventbunnei2018-08-172-1/+13
|\ \ \ \ \
| * | | | | correct coding stylegreggameplayer2018-08-161-1/+1
| * | | | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
* | | | | | Merge pull request #1087 from MerryMage/dynarmicbunnei2018-08-171-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | dynarmic: Update to 550d662MerryMage2018-08-161-0/+3
* | | | | | Merge pull request #1085 from lioncash/namespacebunnei2018-08-162-12/+14
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | common: Namespace hex_util.h/.cppLioncash2018-08-162-12/+14
| |/ / / /
* | | | | Merge pull request #1075 from lioncash/includebunnei2018-08-164-35/+22
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | loader/nca: Remove unnecessary includes and member variablesLioncash2018-08-152-20/+11
| * | | | loader/xci: Remove unnecessary includes and member variablesLioncash2018-08-152-15/+11
| | |_|/ | |/| |
* | | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-1624-58/+1135
|\ \ \ \
| * | | | registration: Various style and documentation improvementsZach Hilman2018-08-123-18/+22
| * | | | registration: Add support for force overwrite of installedZach Hilman2018-08-122-22/+48
| * | | | vfs_real: Add CreateFullPath to Create* operationsZach Hilman2018-08-122-13/+6
| * | | | control_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-2/+1
| * | | | romfs: Remove cyclic shared_ptr leak in romfs codeZach Hilman2018-08-123-8/+8
| * | | | registration: Update documentation and styleZach Hilman2018-08-125-42/+69
| * | | | nca_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-3/+2
| * | | | bis_factory: Create NAND dirs if they don't existZach Hilman2018-08-121-2/+9
| * | | | registration: Take RawCopy function as parameterZach Hilman2018-08-122-10/+15
| * | | | registered_cache: Fix missing reading from yuzu_metaZach Hilman2018-08-121-7/+16
| * | | | file_sys: Comply to style guidelinesZach Hilman2018-08-126-27/+38
| * | | | qt: Add 'Install to NAND' option to menuZach Hilman2018-08-122-1/+2
| * | | | file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
| * | | | file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
| * | | | card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
| * | | | vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
| * | | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| * | | | bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
| * | | | loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
| * | | | loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
| * | | | vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
| * | | | crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
* | | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ \
| * | | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| * | | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
* | | | | | Merge pull request #1079 from lioncash/fmtbunnei2018-08-163-12/+11
|\ \ \ \ \ \
| * | | | | | loader: Make ResultStatus directly compatible with fmtLioncash2018-08-153-12/+11
| |/ / / / /
* | | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-163-1/+12
|\ \ \ \ \ \
| * | | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-133-1/+12
* | | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ \
| * | | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / / | |/| | | | |
* / | | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
|/ / / / / /
* | | | | | Merge pull request #1067 from lioncash/initbunnei2018-08-151-3/+3
|\ \ \ \ \ \
| * | | | | | emu_window: Ensure WindowConfig members are always initializedLioncash2018-08-151-3/+3
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1073 from lioncash/3dsbunnei2018-08-156-17/+0
|\ \ \ \ \ \
| * | | | | | loader: Remove address mapping remnants from citraLioncash2018-08-156-17/+0
| |/ / / / /
* | | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ \
| * | | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| |/ / / / /
* | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| * | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
* | | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ \
| * | | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / /
* | | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-146-0/+148
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| * | | | | Added missing channel devicesDavid Marcec2018-08-135-0/+144
* | | | | | arm_dynarmic: Remove IsExecuting check from PrepareRescheduleMerryMage2018-08-131-3/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #1032 from lioncash/sanitizebunnei2018-08-131-10/+10
|\ \ \ \ \
| * | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()Lioncash2018-08-121-10/+10
* | | | | | Merge pull request #1031 from lioncash/verbositybunnei2018-08-132-7/+7
|\ \ \ \ \ \
| * | | | | | card_image: Use type aliases to shorten definitionsLioncash2018-08-122-6/+6
| * | | | | | card_image: Simplify return statement of GetSubdirectories()Lioncash2018-08-121-1/+1
| |/ / / / /
* | / / / / kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
| |/ / / / |/| | | |
* | | | | Merge pull request #1043 from Subv/timingbunnei2018-08-133-2/+11
|\ \ \ \ \
| * | | | | CPU/Timing: Use an approximated amortized amount of ticks when advancing timing.Subv2018-08-132-1/+11
| * | | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
| |/ / / /
* | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-132-2/+2
|\ \ \ \ \
| * | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| |/ / / /
* | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-134-5/+13
|\ \ \ \ \
| * | | | | Core/HLE: Make the 'reschedule_pending' flag atomic.Subv2018-08-131-1/+1
| * | | | | CPU/HLE: Lock the HLE mutex before performing a reschedule.Subv2018-08-131-0/+3
| * | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| * | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-132-4/+4
| |/ / / /
* | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \
| * | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / /
* | | | | vfs: Make VfsFilesystem constructor explicitLioncash2018-08-121-1/+1
* | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-124-10/+16
* | | | | Merge pull request #1025 from ogniK5377/bad-castbunnei2018-08-124-4/+4
|\ \ \ \ \
| * | | | | made ResultStatus a u16David Marcec2018-08-123-3/+3
| * | | | | Fixed invalid cast in loaderDavid Marcec2018-08-121-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \
| * | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | |/ / / | |/| | |
* | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-121-5/+26
|\ \ \ \ \
| * | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-121-4/+2
| * | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-121-5/+28
| | |/ / / | |/| | |
* | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
* | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| |/ / / |/| | |
* | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
|/ / /
* | | Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\ \ \
| * | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| * | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| * | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
* | | | core: Namespace EmuWindowLioncash2018-08-124-5/+16
|/ / /
* | | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1214-103/+219
|\ \ \
| * | | loader: Add more descriptive errorsZach Hilman2018-08-1014-103/+219
| | |/ | |/|
* / | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-112-5/+2
|/ /
* | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \
| * | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| * | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
* | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \
| * | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| * | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
* | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1013-113/+560
|\ \ \ \ | |_|/ / |/| | |
| * | | vfs: Fix documentationZach Hilman2018-08-091-2/+2
| * | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-091-1/+1
| * | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-091-17/+27
| * | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| * | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| * | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| * | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-096-13/+34
| * | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| * | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| * | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| * | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
* | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ | |/ / / |/| | |
| * | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |/ | |/|
* | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \
| * | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
* | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ | |_|_|/ |/| | |
| * | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ /
* | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0812-8/+128
|\ \ \
| * | | loader: Add icon and title support to XCIZach Hilman2018-08-076-3/+43
| * | | Use const where applicableZach Hilman2018-08-072-2/+2
| * | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-077-6/+86
* | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ | |_|_|/ |/| | |
| * | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| | |/ | |/|
* | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \
| * | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| |/ /
* | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \
| * | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
* | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / /
* / / acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
|/ /
* | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \
| * | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
* | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \
| * | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |/ | |/|
* | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \
| * | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ /
* | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \
| * | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ /
* | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \
| * | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| * | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/ /
* | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \
| * | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ /
* | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \
| * | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| * | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ /
* | | Merge pull request #952 from lioncash/usbbunnei2018-08-074-0/+257
|\ \ \
| * | | service: Add usb servicesLioncash2018-08-074-0/+257
| |/ /
* | | Merge pull request #949 from lioncash/privbunnei2018-08-073-7/+21
|\ \ \
| * | | client_port: Make all data members privateLioncash2018-08-073-7/+21
| |/ /
* / / loader: Fix scope error in DeconstructedRomDirectoryZach Hilman2018-08-071-1/+1
|/ /
* | Merge pull request #931 from DarkLordZach/nca-as-drdbunnei2018-08-074-37/+24
|\ \
| * | loader: Make AppLoader_NCA rely on directory loading codeZach Hilman2018-08-064-37/+24
* | | GDBStub works with both Unicorn and Dynarmic now (#941)Hedges2018-08-074-2/+26
* | | Merge pull request #940 from lioncash/privatebunnei2018-08-071-4/+8
|\ \ \
| * | | kernel/event: Make data members privateLioncash2018-08-061-4/+8
* | | | Merge pull request #934 from lioncash/chronobunnei2018-08-074-16/+16
|\ \ \ \ | |/ / / |/| | |
| * | | perf_stats: Correct literal used for MAX_LAG_TIME_USLioncash2018-08-061-2/+2
| * | | core_timing: Make GetGlobalTimeUs() return std::chrono::microsecondsLioncash2018-08-064-14/+14
| |/ /
* | | Merge pull request #933 from lioncash/memorybunnei2018-08-061-12/+11
|\ \ \
| * | | memory: Make prototype parameter names match their definitionsLioncash2018-08-061-5/+5
| * | | memory: Correct prototype of ZeroBlockLioncash2018-08-061-1/+1
| * | | memory: Remove unnecessary const qualifiers in prototypesLioncash2018-08-061-9/+8
| |/ /
* | | Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
* | | Merge pull request #932 from lioncash/funcbunnei2018-08-062-9/+9
|\ \ \
| * | | core_timing: Convert typedef into a type aliasLioncash2018-08-061-4/+4
| * | | core_timing: Use transparent functors where applicableLioncash2018-08-061-5/+5
| |/ /
* | | Merge pull request #929 from lioncash/addrbunnei2018-08-062-83/+89
|\ \ \
| * | | gdbstub: Use type alias for breakpoint mapsLioncash2018-08-051-37/+42
| * | | gdbstub: Move all file-static variables into the GDBStub namespaceLioncash2018-08-051-35/+36
| * | | gdbstub: Replace PAddr alias with VAddrLioncash2018-08-052-14/+14
* | | | Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ \ \ \
| * | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| |/ / /
* | | | Merge pull request #925 from bunnei/audrenbunnei2018-08-064-233/+16
|\ \ \ \ | |_|/ / |/| | |
| * | | audio_core: Implement audren_u audio playback.bunnei2018-08-052-218/+9
| * | | audio_core: Use s16 where possible for audio samples.bunnei2018-08-051-3/+3
| * | | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-052-11/+3
| * | | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-041-1/+1
| | |/ | |/|
* | | Merge pull request #912 from lioncash/global-varbunnei2018-08-057-27/+57
|\ \ \ | |_|/ |/| |
| * | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-043-7/+7
| * | video_core: Eliminate the g_renderer global variableLioncash2018-08-047-24/+54
* | | Merge pull request #924 from lioncash/arpbunnei2018-08-054-0/+95
|\ \ \
| * | | service: Add arp servicesLioncash2018-08-054-0/+95
| | |/ | |/|
* | | Merge pull request #921 from lioncash/viewbunnei2018-08-055-35/+35
|\ \ \
| * | | aes_util: Add static assertion to Transcode() and XTSTranscode() to ensure well-defined behaviorLioncash2018-08-041-0/+4
| * | | aes_util: Make CalculateNintendoTweak() an internally linked functionLioncash2018-08-042-12/+10
| * | | aes_util: Make Transcode() a const member functionLioncash2018-08-042-8/+9
| * | | core/crypto: Remove unnecessary includesLioncash2018-08-044-5/+5
| * | | key_manager: Use regular std::string instead of std::string_viewLioncash2018-08-042-10/+7
| |/ /
* / / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ /
* | Merge pull request #849 from DarkLordZach/xcibunnei2018-08-0426-62/+1318
|\ \ | |/ |/|
| * Add missing parameter to files.push_back()Zach Hilman2018-08-011-5/+5
| * Fix merge conflicts with opus and update docsZach Hilman2018-08-012-1/+3
| * Use more descriptive error codes and messagesZach Hilman2018-08-017-19/+51
| * Use static const instead of const staticZach Hilman2018-08-011-2/+2
| * Use ErrorEncrypted where applicable and fix no keys crashZach Hilman2018-08-014-17/+37
| * Add missing includes and use const where applicableZach Hilman2018-08-0111-24/+40
| * Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-012-7/+20
| * Make XCI comply to review and style guidelinesZach Hilman2018-08-0114-455/+222
| * Extract mbedtls to cpp fileZach Hilman2018-08-014-86/+126
| * Add missing string.h includeZach Hilman2018-08-011-0/+1
| * Update mbedtls and fix compile errorZach Hilman2018-08-011-0/+1
| * Remove files that are not usedZach Hilman2018-08-0124-42/+1406
* | Merge pull request #913 from lioncash/unused-funcbunnei2018-08-041-16/+0
|\ \
| * | memory: Remove unused GetSpecialHandlers() functionLioncash2018-08-031-16/+0
* | | Merge pull request #914 from lioncash/codesetbunnei2018-08-045-20/+41
|\ \ \
| * | | kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| * | | kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-035-20/+40
| |/ /
* / / kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
|/ /
* | Merge pull request #908 from lioncash/memorybunnei2018-08-0314-502/+29
|\ \
| * | core/memory: Get rid of 3DS leftoversLioncash2018-08-0314-502/+29
* | | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-035-5/+47
* | | Merge pull request #898 from lioncash/migbunnei2018-08-034-0/+53
|\ \ \ | |/ / |/| |
| * | service: Add migration servicesLioncash2018-08-024-0/+53
* | | Merge pull request #892 from lioncash/globalbunnei2018-08-033-11/+11
|\ \ \
| * | | video_core: Make global EmuWindow instance part of the base renderer classLioncash2018-08-023-11/+11
* | | | Merge pull request #894 from lioncash/objectbunnei2018-08-0343-155/+185
|\ \ \ \
| * | | | kernel: Move object class to its own source filesLioncash2018-08-0243-155/+185
| | |/ / | |/| |
* | | | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ \ \
| * | | | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| * | | | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| * | | | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| |/ / /
* | | | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ \ \
| * | | | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| * | | | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| * | | | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ / /
* | | | Merge pull request #903 from lioncash/copybunnei2018-08-031-3/+6
|\ \ \ \
| * | | | vfs_vector: Remove unused variable in FindAndRemoveVectorElement()Lioncash2018-08-021-2/+2
| * | | | vfs_vector: Avoid unnecessary copies where applicableLioncash2018-08-021-2/+5
| |/ / /
* | | | Merge pull request #899 from lioncash/unusedbunnei2018-08-027-334/+0
|\ \ \ \
| * | | | hw: Remove unused filesLioncash2018-08-027-334/+0
| |/ / /
* | | | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ \ \
| * | | | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | |/ / | |/| |
* | | | service: Add psc servicesLioncash2018-08-024-0/+96
| |/ / |/| |
* | | Merge pull request #888 from lioncash/capsbunnei2018-08-024-0/+171
|\ \ \
| * | | service: Add capture servicesLioncash2018-08-014-0/+171
| |/ /
* | | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ \
| * | | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ /
* | | Merge pull request #889 from lioncash/fspbunnei2018-08-026-0/+89
|\ \ \
| * | | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-016-0/+89
| |/ /
* / / service: Add bpc and pcv servicesLioncash2018-08-016-0/+179
|/ /
* | Merge pull request #882 from lioncash/unusedbunnei2018-08-011-6/+0
|\ \ | |/ |/|
| * kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
* | Merge pull request #871 from bunnei/audio-configbunnei2018-08-011-0/+5
|\ \ | |/ |/|
| * audio_core: Add configuration settings.bunnei2018-08-011-0/+5
* | Merge pull request #877 from lioncash/removebunnei2018-08-016-104/+0
|\ \
| * | kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-316-104/+0
* | | Merge pull request #880 from lioncash/audiobunnei2018-08-0114-2/+289
|\ \ \ | |_|/ |/| |
| * | service/audio: Add missing servicesLioncash2018-08-0114-2/+289
* | | Merge pull request #876 from lioncash/includebunnei2018-08-0123-28/+47
|\ \ \
| * | | kernel: Remove unnecessary includesLioncash2018-07-3123-28/+47
| | |/ | |/|
* | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ | |_|/ |/| |
| * | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
* | | Merge pull request #869 from Subv/ubsanbunnei2018-07-312-6/+17
|\ \ \
| * | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| * | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
* | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-314-0/+94
|\ \ \ \
| * | | | service: Add fgm servicesLioncash2018-07-314-0/+94
| | |_|/ | |/| |
* | | | Merge pull request #874 from lioncash/ambunnei2018-07-318-0/+156
|\ \ \ \ | |_|_|/ |/| | |
| * | | service/am: Add missing am servicesLioncash2018-07-318-0/+156
| |/ /
* | | Merge pull request #870 from lioncash/initbunnei2018-07-311-9/+7
|\ \ \
| * | | arm_dynarmic: Make SetTlsAddress() prototype and definition consistentLioncash2018-07-311-1/+1
| * | | arm_dynarmic: Remove unnecessary qualifying of ThreadContextLioncash2018-07-311-3/+3
| * | | arm_dynarmic: Correct initializer list orderLioncash2018-07-311-5/+3
| |/ /
* / / service: Add the pcie serviceLioncash2018-07-314-0/+83
|/ /
* | audio_core: Move to audout_u impl.bunnei2018-07-314-13/+6
* | Implemented various hwopus functions (#853)David2018-07-313-6/+132
* | Merge pull request #858 from lioncash/castbunnei2018-07-301-3/+2
|\ \
| * | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()Lioncash2018-07-291-3/+2
* | | Merge pull request #857 from lioncash/wlanbunnei2018-07-304-1/+192
|\ \ \
| * | | service: Add wlan servicesLioncash2018-07-294-1/+192
| |/ /
* | | Merge pull request #856 from lioncash/btmbunnei2018-07-304-0/+140
|\ \ \
| * | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| * | | service: Add btm servicesLioncash2018-07-294-0/+106
| |/ /
* / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ /
* | Merge pull request #847 from lioncash/ncmbunnei2018-07-284-0/+78
|\ \
| * | service: Add ncm servicesLioncash2018-07-274-0/+78
* | | Merge pull request #846 from lioncash/miibunnei2018-07-284-0/+126
|\ \ \
| * | | service: Add mii servicesLioncash2018-07-274-0/+126
* | | | Merge pull request #842 from bunnei/audio-corebunnei2018-07-285-94/+124
|\ \ \ \
| * | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| * | | | core: Add AudioCore to global state.bunnei2018-07-282-0/+9
| * | | | audio_core: Add initial code for keeping track of audout state.bunnei2018-07-281-1/+1
| | |/ / | |/| |
* / | | RomFS ExtractionZach Hilman2018-07-2812-20/+351
|/ / /
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-274-0/+241
|\ \ \
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| * | | service: Add nfc servicesLioncash2018-07-274-0/+202
| |/ /
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-274-0/+109
|\ \ \
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-271-3/+35
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| |/ /
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| |
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
* | | Merge pull request #837 from lioncash/privbunnei2018-07-271-5/+17
|\ \ \
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-261-5/+17
* | | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
* | | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
* | | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
| |/ / |/| |
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| |/ /
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ /
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-264-0/+162
|\ \ \
| * | | service: Add ldn servicesLioncash2018-07-264-0/+162
| |/ /
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \ | |_|/ |/| |
| * | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| * | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/
* | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ | |/ |/|
| * lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| * lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| * lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
* | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \
| * | service: Add ldr servicesLioncash2018-07-264-0/+101
* | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \
| * | | service: Add eupld servicesLioncash2018-07-264-0/+72
| * | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |/ | |/|
* | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ | |_|/ |/| |
| * | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
* | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \
| * | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| * | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ /
* | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ | |_|/ |/| |
| * | service: Add pm servicesLioncash2018-07-254-0/+90
| |/
* / service: Add the es serviceLioncash2018-07-254-0/+77
|/
* Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\
| * time: Add the time:a serviceLioncash2018-07-253-10/+11
| * time: Simplify interface creationLioncash2018-07-246-64/+15
* | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \
| * | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
* | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \
| * | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| * | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
* | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \
| * | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| * | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| | |_|/ | |/| |
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| | |_|/ | |/| |
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / /
* / / / deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ /
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ /
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ /
* | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ | |_|/ |/| |
| * | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
* | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \
| * | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| * | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| |/ /
* | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ | |_|/ |/| |
| * | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
* | | VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-243-36/+62
| |/ |/|
* | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \
| * | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| |/
* | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \
| * | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/
* | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \
| * | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/
* | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \
| * | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| * | nro: Make bracing consistentLioncash2018-07-231-10/+24
| * | nro: Make constructor explicitLioncash2018-07-231-1/+1
| * | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/
* | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \
| * | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| * | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| |
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
* | | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
| |/ |/|
* | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ | |/ |/|
| * set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| * set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
* | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ | |/ |/|
| * Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
* | Merge pull request #768 from lioncash/string-viewbunnei2018-07-228-93/+158
|\ \ | |/ |/|
| * vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| * file_util, vfs: Use std::string_view where applicableLioncash2018-07-228-91/+153
* | Implement exclusive monitorMerryMage2018-07-229-13/+160
|/
* file_util: Use a u64 to represent number of entriesLioncash2018-07-222-4/+4
* Merge pull request #760 from lioncash/pathbunnei2018-07-223-5/+7
|\
| * file_util: Use an enum class for GetUserPath()Lioncash2018-07-213-5/+7
* | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/
* Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\
| * vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| * partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| * partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| * partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
* | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \
| * | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
| |/
* | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \
| * | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| |/
* | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \
| * | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
* | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \
| * | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| * | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| * | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| * | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |/ | |/|
* | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ | |/ / |/| |
| * | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/
* | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \
| * | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
* | | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ /
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/
* | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \
| * | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| * | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ /
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-209-71/+70
|\ \ \
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-209-71/+70
| |/ /
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ /
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \ | |_|/ |/| |
| * | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| * | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/
* / pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ /
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/|
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / /
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / /
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / /
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / /
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / /
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / /
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / /
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
* | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \
| * | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
* | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / /
* | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| * | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| * | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / /
* | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \ | |_|_|/ |/| | |
| * | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ /
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|/ / |/| | |
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \ | |_|_|/ |/| | |
| * | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ | |/|
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| | |/ | |/|
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-193-7/+11
|\ \ \
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-192-7/+7
| | |/ | |/|
* | | Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1949-1862/+1807
| |/ |/|
* | Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
* | Single touch supportZach Hilman2018-07-181-4/+19
|/
* vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
* vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
* vi: Partially implement buffer crop parameters.bunnei2018-07-186-10/+26
* General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
* Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\
| * scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
* | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* / nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
* Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\
| * Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
* | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \
| * | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/
* / No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/
* More improvements to GDBStub (#653)Hedges2018-07-137-49/+172
* We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
* initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
* Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\
| * Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
* | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
|/
* Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\
| * Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
* | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
* | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \
| * | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
* | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ | |/ / |/| |
| * | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
* | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ /
* | Revert "Virtual Filesystem (#597)"bunnei2018-07-0842-1682/+1618
* | Virtual Filesystem (#597)Zach Hilman2018-07-0642-1618/+1682
* | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
* | Update clang formatJames Rowe2018-07-0325-114/+106
* | Rename logging macro back to LOG_*James Rowe2018-07-0379-556/+556
* | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
* | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
* | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-292-0/+3
|\ \
| * | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-272-0/+3
* | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \ | |/ / |/| |
| * | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
* | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ /
* | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
* | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
* | Merge pull request #579 from SciresM/masterbunnei2018-06-2211-9/+308
|\ \
| * | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| * | Add additional missing format.Michael Scire2018-06-222-21/+27
| * | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| * | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| * | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| * | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| * | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-214-10/+110
| * | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-214-6/+67
| * | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
* | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
* | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \
| * | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ /
* / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-219-15/+452
|/ /
* | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-205-10/+11
* | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
* | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \
| * | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| * | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| * | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
* | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ | |/ / |/| |
| * | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
* | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ |/|
* | Common/string_util: add StringFromBuffer functionmailwl2018-06-071-22/+9
* | Merge pull request #522 from mailwl/mm-ubunnei2018-06-074-0/+83
|\ \
| * | Remove unused header filesmailwl2018-06-061-2/+0
| * | Small fixesmailwl2018-06-052-6/+8
| * | Service/MM: add service and stub some functionsmailwl2018-06-054-0/+83
* | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \
| * | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| * | | Correct function resultsmailwl2018-06-041-4/+16
| * | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
* | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
* | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \
| * | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| * | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| | |/ / | |/| |
* / | | GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
|/ / /
* | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
* | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
* | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
* | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/ /
* | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
* | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
* | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
* | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
* | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \
| * | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
* | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
* | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
* | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \
| * | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| * | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| * | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
| |/ /
* | | add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
* | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
* | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
|/ /
* | Service/BCAT: add module and servicesmailwl2018-05-286-0/+118
* | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \
| * | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
* | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
* | | Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ /
* | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| |
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-214-1/+98
|\ \ \
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-202-0/+50
| |/ /
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
* | | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1117-181/+577
|\ \
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| * | thread: Rename mask to affinity_masks.bunnei2018-05-113-4/+4
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-115-17/+39
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| * | core: Implement multicore support.bunnei2018-05-1111-75/+110
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
* | | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
* | | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ /
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0228-103/+104
|\ \
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0228-103/+104
* | | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ /
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ /
* | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
* | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-302-4/+3
* | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
* | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
* | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
* | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2711-27/+26
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2711-13/+138
|\ \
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-273-4/+4
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-2684-1072/+1018
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-262-13/+2
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-239-25/+63
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
* | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
| |/ / |/| |
* | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
* | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
* | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \
| * | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| * | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
* | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-261-0/+4
|\ \ \ \
| * | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
* | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| * | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| |/ / /
* | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \
| * | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / /
* | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
* | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
|/ / /
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-252-17/+50
|\ \ \
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-252-17/+50
* | | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
* | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
* | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
* | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
* | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
* | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
* | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
* | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
* | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
* | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
* | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
* | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
* | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
* | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
* | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
* | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
* | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
* | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
* | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
* | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
* | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
* | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
* | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
* | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
* | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
* | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2314-443/+238
|\ \ \
| * | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| * | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| * | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-213-8/+8
| * | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| * | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| * | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| * | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
* | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \
| * | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| * | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / | |/| |
* / | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
|/ / /
* | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \
| * | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
* | | | core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / /
* | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ | |/ / |/| |
| * | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
* | | Merge pull request #367 from lioncash/clampbunnei2018-04-201-1/+2
|\ \ \
| * | | math_util: Remove the Clamp() functionLioncash2018-04-201-1/+2
* | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \
| * | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| |/ / /
* | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-201-1/+2
|\ \ \ \
| * | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-201-1/+2
| |/ / /
* | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \
| * | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| * | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| * | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / /
* / / / vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / /
* | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
* | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ | |/ / |/| |
| * | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| * | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| * | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
* | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
|/ /
* | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \
| * | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
* | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
|/ /
* | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \
| * | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
* | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
* | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/ /
* | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \
| * | Various fixes and clangHexagon122018-04-116-115/+108
| * | Decimal changeHexagon122018-04-101-4/+4
| * | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| * | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| * | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| * | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| * | Updated hid with more service names.Hexagon122018-04-101-0/+50
| * | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| * | Updated the unknown nameHexagon122018-04-101-1/+1
| * | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| * | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| * | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| * | Updated audren with more service names.Hexagon122018-04-101-10/+14
| * | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| * | Updated audout with more service names.Hexagon122018-04-101-13/+16
| * | Updated audin with more service names.Hexagon122018-04-101-9/+16
| * | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| * | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| * | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| * | Updated AM with more service names.Hexagon122018-04-101-2/+82
* | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
* | | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
* | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-064-0/+11
* | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
* | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
* | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
* | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
* | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
* | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
* | service: Add friend:u interface.bunnei2018-04-034-0/+41
* | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-032-4/+4
|\ \
| * | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| * | Change Telemetry Names to yuzuN00byKing2018-03-271-2/+2
* | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-031-6/+6
|\ \ \
| * | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
* | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / /
* | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \
| * | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
* | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
* | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
* | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
* | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
* | | | memory: Fix stack region.bunnei2018-03-316-10/+12
|/ / /
* | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
* | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
* | | service: Add NFP module interface.bunnei2018-03-306-0/+99
* | | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
* | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
* | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-273-10/+7
* | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-272-6/+6
* | | config: Add setting for whether the system is docked or not.bunnei2018-03-272-2/+9
|/ /
* | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
* | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
* | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \
| * | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| * | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| * | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
* | | Merge pull request #273 from Subv/texturesbunnei2018-03-251-0/+11
|\ \ \
| * | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-251-0/+11
| |/ /
* / / Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-258-32/+96
|/ /
* | arm_dynarmic: Fix timingMerryMage2018-03-241-7/+3
* | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-244-7/+66
|\ \
| * | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-231-6/+0
| * | memory: Fix typo in RasterizerFlushVirtualRegion.bunnei2018-03-231-3/+3
| * | memory: RasterizerFlushVirtualRegion should also check process image region.bunnei2018-03-231-0/+1
| * | rasterizer: Flush and invalidate regions should be 64-bit.bunnei2018-03-232-3/+3
| * | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-232-3/+3
| * | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| * | memory: Port RasterizerFlushVirtualRegion from Citra.bunnei2018-03-232-1/+58
| * | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-231-3/+3
* | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-2412-48/+329
|\ \ \
| * | | FS: Move the file open mode calculation to a separate function.Subv2018-03-231-7/+14
| * | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-216-7/+29
| * | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| * | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| * | | FS: Implement DiskFileSystem's OpenDirectory interface.Subv2018-03-205-6/+19
| * | | FS: Implement DiskFileSystem::GetEntryType for existing files/directories.Subv2018-03-201-2/+4
| * | | FS: Updated the Directory Entry structure to match the Switch.Subv2018-03-205-30/+84
| * | | FS: Support the file Append open mode.Subv2018-03-202-2/+23
| * | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| * | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-205-0/+79
* | | | Service/SSL: add ssl servicemailwl2018-03-234-0/+43
* | | | Remove more N3DS ReferencesN00byKing2018-03-222-20/+0
* | | | Service/spl: add module and servicesmailwl2018-03-228-0/+174
| |/ / |/| |
* | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
* | | Service: add fatal:u, fatal:p servicesmailwl2018-03-208-0/+144
* | | Clang FixesN00byKing2018-03-194-8/+9
* | | oopsN00byKing2018-03-191-3/+3
* | | More Warning cleanupsN00byKing2018-03-193-3/+3
* | | Clean Warnings (?)N00byKing2018-03-1914-19/+19
|/ /
* | Merge pull request #193 from N00byKing/3184_2_robotic_boogaloobunnei2018-03-197-41/+41
|\ \
| * | Implements citra-emu/citra#3184N00byKing2018-02-257-41/+41
* | | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
* | | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
* | | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
* | | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
* | | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-193-20/+6
* | | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
* | | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
* | | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
* | | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-166-2/+18
* | | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
* | | kernel: Move stack region outside of application heap.bunnei2018-03-166-11/+6
* | | memory: Add regions for map region, "new" map region, etc.bunnei2018-03-161-19/+29
* | | process: Fix stack memory state.bunnei2018-03-161-2/+4
* | | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
* | | IGeneralService: fix function listmailwl2018-03-161-2/+3
* | | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
* | | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
* | | core: Move process creation out of global state.bunnei2018-03-1420-66/+81
* | | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-0412-43/+91
|\ \ \
| * | | FS: Use the correct error code when trying to open files that don't exist.Subv2018-03-042-26/+6
| * | | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| * | | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-048-17/+70
* | | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ / /
* | | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ \
| * | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
* | | | Service/Set: add more servicesmailwl2018-03-0312-10/+348
|/ / /
* | | Merge pull request #216 from Subv/savedatabunnei2018-03-0220-39/+541
|\ \ \
| * | | SaveData: Use the current titleid when opening the savedata archive.Subv2018-03-021-2/+3
| * | | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-027-21/+20
| * | | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| * | | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-0210-16/+329
| * | | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| | |/ | |/|
* / | thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/ /
* | Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ \
| * | Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| * | Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| * | IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
* | | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ \
| * | | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| * | | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
* | | | file_sys: Style tweaksshinyquagsire232018-02-262-11/+5
* | | | loader: Check error on NPDM load, use TID for CodeSetshinyquagsire232018-02-253-6/+10
* | | | loader: Use NPDM information when loading NSOsshinyquagsire232018-02-252-4/+15
* | | | file_sys: Add support for parsing NPDM filesshinyquagsire232018-02-253-0/+276
* | | | Merge pull request #212 from mailwl/stubsbunnei2018-02-2410-9/+112
|\ \ \ \
| * | | | Stub more functionsmailwl2018-02-227-8/+90
| * | | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-225-1/+22
| |/ / /
* | | | Merge pull request #217 from shinyquagsire23/time-s-missingbunnei2018-02-231-0/+4
|\ \ \ \
| * | | | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
| |/ / /
* | | | Merge pull request #210 from MerryMage/f/dynarmic/sysregbunnei2018-02-232-2/+33
|\ \ \ \ | |/ / / |/| | |
| * | | dynarmic: Update to 6b4c6b0MerryMage2018-02-211-2/+18
| * | | arm_dynarmic: LOG_INFO on unicorn fallbackMerryMage2018-02-211-0/+4
| * | | memory: LOG_ERROR when falling off end of page tableMerryMage2018-02-211-0/+11
| |/ /
* | | Merge pull request #211 from shinyquagsire23/time_localbunnei2018-02-223-0/+9
|\ \ \
| * | | time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
| |/ /
* / / core: Fix scheduler-shutdown related crashMerryMage2018-02-211-5/+9
|/ /
* | Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-2/+26
|\ \
| * | Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-2/+26
* | | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
* | | service: Add Friend service interface.bunnei2018-02-196-0/+100
|/ /
* | Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-1910-378/+237
|\ \
| * | scheduler: Cleanup based on PR feedback.bunnei2018-02-193-5/+4
| * | kernel: Use Scheduler class for threading.bunnei2018-02-185-173/+24
| * | kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-183-0/+210
| * | core: Use shared_ptr for cpu_core.bunnei2018-02-182-6/+4
| * | kernel: Remove unused address_arbiter code.bunnei2018-02-185-199/+0
* | | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ /
* | Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ \
| * | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
* | | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ \ | |/ / |/| |
| * | nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| * | Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| * | Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| * | Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| * | nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| * | Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| * | Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| * | Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| * | Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
* | | Service/hid: stub some functionsmailwl2018-02-164-1/+98
* | | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
* | | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-156-0/+182
* | | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/ /
* | Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ \
| * | hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| * | hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| * | service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| * | audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| * | vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| * | nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| * | vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| * | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| * | vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
* | | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
| |/ |/|
* | memory: Silence formatting sepecifier warningsLioncash2018-02-141-21/+30
* | nso: Silence formatting specifier warningsLioncash2018-02-141-2/+4
* | deconstructed_rom_directory: Silence formatting specifier warningsLioncash2018-02-141-3/+4
* | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
* | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
* | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
* | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
* | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
* | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
* | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
* | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
* | gdbstub: Silence formatting specifier warningsLioncash2018-02-141-6/+9
|/
* audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
* Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\
| * vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| * vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| * TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
* | Merge pull request #184 from mailwl/lmbunnei2018-02-131-20/+49
|\ \ | |/ |/|
| * Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
* | arm_dynarmic: Support direct page table accessMerryMage2018-02-122-10/+19
|/
* Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\
| * Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
* | Merge pull request #178 from Subv/command_buffersbunnei2018-02-1210-174/+27
|\ \ | |/ |/|
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-1210-183/+24
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-123-3/+5
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-105-58/+102
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
* Merge pull request #171 from bunnei/libnx-fixesbunnei2018-02-096-9/+38
|\
| * nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
| * IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
| * nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
| * acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
* | dynarmic: Update to 41ae12263MerryMage2018-02-092-31/+45
|/
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-083-0/+162
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\
| * mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
* | Extra nvdrv support (#162)David2018-02-0617-37/+765
|/
* Merge pull request #164 from ogniK5377/libnx_sm_fixbunnei2018-02-051-0/+2
|\
| * Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
* | Changed .istorage to .romfsDavid Marcec2018-02-052-5/+5
|/
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
* logger: Add Time service logging category.bunnei2018-02-051-10/+10
* logger: Add SET service logging category.bunnei2018-02-051-1/+1
* logger: Add PCTL service logging category.bunnei2018-02-051-1/+1
* logger: Add LM service logging category.bunnei2018-02-051-2/+2
* logger: Add APM service logging category.bunnei2018-02-051-2/+3
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
* logger: Add NIFM service logging category.bunnei2018-02-054-11/+11
* logger: Add VI service logging category.bunnei2018-02-054-21/+20
* hid: Stub out several functions.bunnei2018-02-051-1/+39
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
* logger: Add AM service logging category.bunnei2018-02-043-42/+42
* logger: Add "account" service logging category.bunnei2018-02-041-8/+8
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
* Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\
| * GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| * WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| * svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| * ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
* | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-0310-0/+378
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-027-379/+571
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
* | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-026-0/+128
|\ \
| * | Services/vi: add vi:s and vi:u servicesmailwl2018-02-026-0/+128
| |/
* | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ | |/ |/|
| * shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
* | [WIP] sfdnsres: stub (#146)mailwl2018-01-305-2/+52
|/
* Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-278-415/+243
|\
| * memory: Replace all memory hooking with Special regionsMerryMage2018-01-278-415/+243
* | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
* | audout_u: Various cleanups.bunnei2018-01-251-29/+17
* | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
* | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
* | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
* | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
* | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
* | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
* | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
* | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-2510-169/+2
* | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
* | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-14/+166
* | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
* | Correct SpellingN00byKing2018-01-231-2/+2
* | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \
| * | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| * | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| * | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| * | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| * | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
* | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ | |/ / |/| |
| * | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| * | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| * | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
* | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ | |/ / |/| |
| * | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
* | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-229-363/+452
|/ /
* | Added stubs for audio services. (#116)st4rk2018-01-2212-5/+309
* | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \
| * | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| * | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
* | | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-218-5/+162
* | | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ \
| * | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| | |/ | |/|
* | | file_sys: Clang format fixes.bunnei2018-01-213-4/+4
* | | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
* | | deconstructed_rom_directory: Implement istorage loading for RomFS.bunnei2018-01-212-2/+71
* | | filesystem: Implement basic IStorage functionality.David Marcec2018-01-216-0/+258
* | | file_sys: Cleanup to better match Switch file system constructs.bunnei2018-01-2110-63/+136
* | | file_sys: Remove disk_archive, savedata_archive, and title_metadata.bunnei2018-01-217-835/+0
* | | archive_backend: Minor changes to match Switch IFileSystem.bunnei2018-01-215-26/+26
* | | file_sys: Repurpose 3DS IVFC code for Switch ROMFS.bunnei2018-01-213-51/+43
| |/ |/|
* | gdbstub: Update registers and sizes for aarch64Rozlette2018-01-211-113/+155
|/
* Merge pull request #72 from N00byKing/patch-2bunnei2018-01-211-1/+0
|\
| * Update core.cppN00byKing2018-01-171-1/+0
* | Merge pull request #92 from gdkchan/nro_refactorbunnei2018-01-211-2/+2
|\ \
| * | Fix NRO Entry Pointgdkchan2018-01-181-2/+2
* | | Merge pull request #122 from tgsm/time-remove-pragmabunnei2018-01-212-4/+0
|\ \ \
| * | | service/time: remove accidental #pragmastgsm2018-01-212-4/+0
* | | | loader: Minor style fix in deconstructed_rom_directoryRozlette2018-01-211-1/+0
|/ / /
* | | Merge pull request #117 from jroweboy/clang-formatbunnei2018-01-2143-57/+62
|\ \ \
| * | | Format: Run the new clang format on everythingJames Rowe2018-01-2143-57/+62
* | | | Merge pull request #120 from Rozelette/masterbunnei2018-01-201-0/+3
|\ \ \ \
| * | | | memory: Return false for large VAddr in IsValidVirtualAddressRozlette2018-01-201-0/+3
| |/ / /
* | | | loader: Clean up ctors and includes.bunnei2018-01-2010-18/+22
* | | | loader: Add DeconstructedRomDirectory for game dumps.bunnei2018-01-205-0/+156
* | | | loader: Refactor to also pass filepath into IdentifyType.bunnei2018-01-208-19/+19
* | | | nso: Remove code specific to directory loading.bunnei2018-01-202-17/+6
|/ / /
* | | Port citra #3352 to yuzu (#103)River City Ransomware2018-01-203-4/+25
* | | Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
* | | Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-206-21/+22
* | | Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ \ \
| * | | ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
* | | | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-198-0/+161
|/ / /
* | | Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ \ \
| * | | nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| * | | svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| * | | svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
* | | | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ \ \
| * | | | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
* | | | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
* | | | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ / / /
* / / / Fix dispdrv typogdkchan2018-01-191-1/+1
|/ / /
* | | Merge pull request #100 from Rozelette/masterbunnei2018-01-197-32/+113
|\ \ \ | |/ / |/| |
| * | time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| * | time: Refactor time:* to use a single shared moduleRozlette2018-01-187-26/+107
* | | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
* | | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-187-0/+159
* | | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ \ | |/ / |/| |
| * | lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
* | | Merge pull request #84 from lioncash/cmakebunnei2018-01-181-170/+167
|\ \ \
| * | | CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-181-170/+167
* | | | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ \ \
| * | | | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| * | | | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| |/ / /
* | | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ \
| * | | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| * | | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ / /
* | | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ \ | |_|/ / |/| | |
| * | | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ /
* | | controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
* | | Merge pull request #80 from gdkchan/nro_fixbunnei2018-01-181-20/+9
|\ \ \ | |/ / |/| |
| * | Fix NRO loadinggdkchan2018-01-181-20/+9
* | | Merge pull request #73 from N00byKing/3093bunnei2018-01-182-0/+2
|\ \ \ | |/ / |/| |
| * | Update CMakeLists.txtN00byKing2018-01-171-0/+1
| * | Update title_metadata.hN00byKing2018-01-171-0/+1
* | | Merge pull request #76 from Rozelette/masterbunnei2018-01-175-85/+164
|\ \ \
| * | | TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-175-85/+164
* | | | Remove relocation on NSO/NROgdkchan2018-01-173-19/+2
|/ / /
* | | Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ \ \
| * | | hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
* | | | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ \ \
| * | | | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
* | | | | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |_|_|/ |/| | |
* | | | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-173-3/+35
|\ \ \ \ | |/ / / |/| | |
| * | | hle_ipc: Clang format.bunnei2018-01-171-2/+3
| * | | ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
* | | | Fix gdbstub typo, fixes Citra #3318River City Ransomware2018-01-171-1/+1
| |/ / |/| |
* | | Merge pull request #60 from jroweboy/game-framebunnei2018-01-172-1/+4
|\ \ \ | |/ / |/| |
| * | UI: Fix frame rate perf statsJames Rowe2018-01-172-1/+4
* | | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ \ | |/ / |/| |
| * | hid: clang-formatshinyquagsire232018-01-171-3/+3
| * | hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| * | hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
| |/
* | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-176-0/+86
* | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
* | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-174-16/+18
* | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
* | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
* | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
* | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
* | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
* | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
* | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
* | Merge pull request #52 from ogniK5377/fspbunnei2018-01-176-5/+90
|\ \
| * | Update memory.hDavid2018-01-171-2/+2
| * | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| * | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| * | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| * | Increased heap size and changed tls area vaddrDavid Marcec2018-01-161-2/+2
* | | Merge pull request #44 from Rozelette/masterbunnei2018-01-161-3/+7
|\ \ \
| * | | nso: Modify .bss size calculation logicRozlette2018-01-161-3/+7
| | |/ | |/|
* | | clang-formatMerryMage2018-01-1613-37/+31
| |/ |/|
* | Build: Automagically handle unicornJames Rowe2018-01-161-1/+1
* | Build: Add unicorn as a submodule and build it if neededJames Rowe2018-01-161-1/+1
|/
* nso: Load subsdk4 if available.bunnei2018-01-151-1/+1
* pctl: Clang format.bunnei2018-01-151-1/+1
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
* settings: Fix button mappings array to have correct entries.bunnei2018-01-151-2/+6
* Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-153-17/+450
|\
| * hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| * hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| * settings: Screenshot buttonshinyquagsire232018-01-151-0/+2
| * settings: adjust button configs for Switch controllersshinyquagsire232018-01-151-17/+50
| * hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
* | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/
* Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
* renderer: Render previous frame when no new one is available.bunnei2018-01-151-1/+4
* lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
* time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-156-1/+121
* audio: Add files to CMake.bunnei2018-01-152-1/+4
* hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
* audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
* hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
* shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
* svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
* kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
* Add missing FileType declarations in GuessFromExtension and GetFileTypeStringThog2018-01-141-0/+8
* Update dynarmic to bc73004MerryMage2018-01-131-12/+17
* Fix build on macOS and linuxMerryMage2018-01-131-2/+0
* arm_unicorn: Log unmapped memory access address.bunnei2018-01-131-1/+1
* yuzu: Update license text to be consistent across project.bunnei2018-01-1361-61/+61
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-132-4/+1
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-132-53/+0
* Remove gpu debugger and get yuzu qt to compileJames Rowe2018-01-135-69/+1
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-1313-1492/+1
* core: Gut out cryptop, since it doesn't compile with C++17.bunnei2018-01-134-126/+7
* configuration: Add cpu_core configuration optionMerryMage2018-01-123-4/+18
* arm_dynarmic: Implement coreMerryMage2018-01-127-64/+165
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
* core: Fix recent GCC build breaks.bunnei2018-01-122-2/+4
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
* CMakeLists: Add framebuffer_layout.cpp.bunnei2018-01-111-0/+1
* frontend: Update for undocked Switch screen layout.bunnei2018-01-116-274/+39
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1111-166/+430
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-116-0/+726
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-104-10/+25
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-099-161/+169
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-093-18/+16
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-093-63/+60
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
* fix macos buildMerryMage2018-01-091-4/+4
* core_timing: Use 1.020GHz for core clock rate.bunnei2018-01-091-5/+3
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-097-556/+276
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
* nso: Always load the filepath specified by the user.bunnei2018-01-071-1/+3
* core_timing: Increase clock speed for Switch docked.bunnei2018-01-073-3/+3
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
* cmake: Don't compile Dynarmic as it's unused.bunnei2018-01-041-1/+1
* core: Increase tight_loop 100x for speed.bunnei2018-01-041-1/+1
* arm_unicorn: Load/release unicorn DLL.bunnei2018-01-041-0/+16
* unicorn: Use for arm interface on Windows.bunnei2018-01-044-9/+242
* arm_dynarmic: More cleanup.bunnei2018-01-041-6/+0
* core: Remove unicorn_dynload.bunnei2018-01-041-2/+0
* arm_dynarmic: Gut interface until dynarmic is ready for general use.bunnei2018-01-042-142/+44
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-0333-14549/+22
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
* hle: Move SVC code to kernel namespace.bunnei2018-01-034-134/+121
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
* cmake: Add missing object_address_table.bunnei2018-01-011-0/+2
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-014-18/+18
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
* svc: Minor cleanups.bunnei2017-12-301-8/+9
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
* service: Add empty interface for pctl:a.bunnei2017-12-296-0/+90
* kernel: Add basic support for Domain object.bunnei2017-12-295-4/+112
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-294-10/+41
* svc: Implement MapMemory.bunnei2017-12-293-4/+17
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
* service: Add empty interface for aoc:u.bunnei2017-12-284-0/+44
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
* hle: Use Switch formatted result codes.bunnei2017-11-018-346/+110
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-238-87/+87
* nso: Load more common submodules.bunnei2017-10-231-15/+11
* memory: Support 32-bit paging, move heap address space up.bunnei2017-10-232-3/+3
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
* memory: Print addresses as 64-bit.bunnei2017-10-191-2/+2
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-159-843/+10
* hle: Add service stubs for apm and appletOE.bunnei2017-10-1510-2/+136
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1516-639/+571
* nso: Add a log for loading submodules.bunnei2017-10-141-0/+1
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
* Remove more 3DS-specific code.bunnei2017-10-135-48/+3
* Remove more 3DS-specific code.bunnei2017-10-136-1413/+1
* Remove more 3DS-specific code.bunnei2017-10-133-55/+0
* Remove lots more 3DS-specific code.bunnei2017-10-1348-6870/+6
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10195-22288/+2
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-10116-1713/+3915
|\
| * Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| * Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-083-63/+61
| |\
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| | * Memory: Remove all GetPointer usages from the GDB stub.Subv2017-10-041-8/+12
| * | Merge pull request #2975 from shinyquagsire23/archive-ncch-container-and-overrideSebastian Valle2017-10-067-78/+581
| |\ \
| | * | file_sys, loader: add support for reading TMDs to determine app pathsshinyquagsire232017-10-012-5/+27
| | * | file_sys: add class for Title Metadata (TMD)shinyquagsire232017-10-013-0/+338
| | * | file_sys/ncch_container: add RomFS, ExeFS override to allow for backward compatibility with existing .romfs system archive dumpsshinyquagsire232017-10-012-69/+206
| | * | file_sys/archive_ncch: use NCCHContainer instead of loading .romfs filesshinyquagsire232017-10-011-6/+12
| * | | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \ \
| | * | | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| * | | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ \ | | |_|_|/ | |/| | |
| | * | | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| | | |/ | | |/|
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-014-22/+61
| |\ \ \
| | * | | Memory: Make WriteBlock take a Process parameter on which to operateSubv2017-10-012-10/+19
| | * | | Memory: Make ReadBlock take a Process parameter on which to operateSubv2017-10-012-12/+30
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | |
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| * | | | Moved down_count to CoreTimingHuw Pascoe2017-09-308-42/+32
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| * | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/|
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| |
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3023-72/+83
| * | | Merge pull request #2961 from Subv/load_titlesbunnei2017-09-2914-61/+87
| |\ \ \ | | |/ / | |/| |
| | * | Loaders: Don't automatically set the current process every time we load an application.Subv2017-09-278-37/+40
| | * | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| | * | Memory: Allow IsValidVirtualAddress to be called with a specific process parameter.Subv2017-09-272-7/+25
| * | | Merge pull request #2954 from Subv/cache_unmapped_memJames Rowe2017-09-271-1/+16
| |\ \ \ | | |/ / | |/| |
| | * | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions.Subv2017-09-261-1/+16
| | |/
| * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-256-18/+65
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-2511-26/+55
| |\ \
| | * | ARM_Interface: Implement PageTableChangedMerryMage2017-09-256-6/+39
| | * | memory: Remove GetCurrentPageTablePointersMerryMage2017-09-242-10/+0
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-246-12/+18
| | |/
| * | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \
| | * | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | |/
| * | Loader/NCCH: Add support for loading application updates (#2927)Max Thomas2017-09-258-439/+670
| * | Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| |/
| * WebService: Verify username and token (#2930)B3n302017-09-193-0/+23
| * Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-167-42/+77
| |\
| | * Services/NS: Port ns:s to the new service framework.Subv2017-09-167-42/+77
| * | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-1513-119/+177
| |\ \
| | * | CPU/Dynarmic: Disable the fast page-table access in dynarmic until it supports switching page tables at runtime.Subv2017-09-151-1/+3
| | * | Kernel/Memory: Make IsValidPhysicalAddress not go through the current process' virtual memory mapping.Subv2017-09-151-2/+1
| | * | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | * | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-154-30/+69
| | * | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | * | Kernel/Memory: Give each Process its own page table.Subv2017-09-109-87/+93
| * | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \
| | * | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| * | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-057-53/+289
| |\ \ \ \
| | * | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | * | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | * | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | * | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-275-11/+144
| * | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| * | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| | |/ / / | |/| | |
| * | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-295-43/+78
| |\ \ \ \
| | * | | | EmuWindow: refactor touch input into a TouchDevicewwylele2017-08-242-39/+63
| | * | | | HID: use TouchDevice for touch padwwylele2017-08-243-4/+15
| * | | | | Merge pull request #2905 from danzel/fix-2902Sebastian Valle2017-08-294-5/+5
| |\ \ \ \ \ | | |_|_|_|/ | |/| | | |
| | * | | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-294-5/+5
| | |/ / /
| * | | | web_services: Refactor to remove dependency on Core.bunnei2017-08-261-1/+7
| * | | | qt: Add an option to view/regenerate telemetry ID.bunnei2017-08-262-3/+28
| * | | | settings: Add enable_telemetry, citra_username, and citra_token.bunnei2017-08-261-0/+3
| * | | | telemetry_session: Log telemetry ID.bunnei2017-08-261-0/+36
| * | | | SidebySide Layout (#2859)ThaMighty902017-08-255-4/+53
| |/ / /
| * | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-246-4/+46
| |\ \ \
| | * | | Kernel/Memory: Acquire the global HLE lock when a memory read/write operation falls outside of the fast path, for it might perform an MMIO operation.Subv2017-08-221-1/+8
| | * | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-225-3/+38
| * | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \
| | * | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| * | | | | GPU/Warnings: Explicitly cast the screen refresh ticks to u64.Subv2017-08-211-1/+1
| * | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-213-2/+7
| * | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| * | | | | CPU/Dynarmic: Fixed a warning when incrementing the number of ticks in ExecuteInstructions.Subv2017-08-211-1/+1
| * | | | | Dyncom: Use size_t instead of int to store the instruction offsets in the instruction cache.Subv2017-08-212-4/+4
| * | | | | Dyncom: Fixed a conversion warning when decoding thumb instructions.Subv2017-08-211-1/+1
| |/ / / /
| * | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-208-254/+47
| |\ \ \ \ | | |_|_|/ | |/| | |
| | * | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | * | | move MotionEmu from core/frontend to input_common as a InputDevicewwylele2017-08-116-254/+4
| | * | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-113-5/+48
| * | | | Added missing parts in libnetwork (#2838)B3n302017-08-193-1/+14
| * | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \
| | * | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| * | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ | | |_|/ / / | |/| | | |
| | * | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | * | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / /
| * | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \
| | * | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | |/ / /
| * | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-091-1/+1
| |\ \ \ \
| | * | | | Update cryptoppJames2017-08-081-1/+1
| | |/ / /
| * / / / Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ / /
| * | | telemetry: Add field for OsPlatform.bunnei2017-08-041-0/+9
| * | | telemetry: Add field for BuildName.bunnei2017-08-041-0/+1
| * | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| * | | telemetry_session: Log BuildDate and ProgramName fields.bunnei2017-08-041-0/+7
| * | | core: Expose AppLoader as a public interface.bunnei2017-08-041-4/+5
| * | | loader: Expose program title.bunnei2017-08-043-12/+31
| * | | Handle invalid filenames when renaming files/directoriesJames2017-07-312-4/+78
| * | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \
| | * | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | * | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | * | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | * | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | * | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | * | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | |/ /
* | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-108-58/+40
* | | | loader: Add support for NRO, as well as various fixes and shared linker.bunnei2017-10-069-146/+434
* | | | nso: Fixes to support homebrew NSOs without a MOD header.bunnei2017-10-042-17/+23
* | | | arm_interface: Set TLS address for dynarmic core.bunnei2017-09-305-0/+32
* | | | nso: Refactor and allocate .bss section.bunnei2017-09-308-130/+160
* | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
* | | | loader: Add support for loading an NSO.bunnei2017-09-305-0/+342
* | | | externals: Add lz4.bunnei2017-09-301-1/+1
* | | | memory: Log with 64-bit values.bunnei2017-09-301-8/+8
* | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
* | | | core: Various changes to support 64-bit addressing.bunnei2017-09-305-54/+54
* | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-308-78/+111
* | | | elf: Check if machine is ARM.bunnei2017-09-301-2/+9
|/ / /
* | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-226-68/+113
|\ \ \ | |/ / |/| |
| * | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-224-47/+72
| * | Memory: Add TryVirtualToPhysicalAddress, returning a boost::optionalYuri Kunde Schlesner2017-06-222-7/+23
| * | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-224-14/+18
* | | telemetry: Log performance, configuration, and system data.bunnei2017-07-183-12/+80
* | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
* | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-165-22/+264
|\ \ \
| * | | apt: load shared font from system archivewwylele2017-06-264-20/+260
| * | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| |/ /
* | | web_service: Add CMake flag to enable.bunnei2017-07-122-3/+12
* | | telemetry_session: Use TelemetryJson to submit real telemetry.bunnei2017-07-121-2/+2
* | | web_service: Add skeleton project.bunnei2017-07-101-1/+1
* | | settings: Add telemetry endpoint URL.bunnei2017-07-101-0/+3
* | | Merge pull request #2815 from mailwl/bosspSebastian Valle2017-07-081-0/+3
|\ \ \
| * | | Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| | |/ | |/|
* | | Merge pull request #2797 from yuriks/cached-vma-free-crashbunnei2017-07-081-5/+20
|\ \ \ | |/ / |/| |
| * | Memory: Fix crash when unmapping a VMA covering cached surfacesYuri Kunde Schlesner2017-06-221-5/+20
| |/
* | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \
| * | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| * | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| * | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| * | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
* | | gpu: add comments for TextureCopywwylele2017-06-292-8/+8
* | | gpu: fix edge cases for TextureCopywwylele2017-06-271-18/+23
* | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-275-1/+436
|\ \ \
| * | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| * | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-262-4/+3
| * | | UDS: Run clang-format.Subv2017-06-263-51/+55
| * | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| * | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| * | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| * | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-154-1/+261
| |/ /
* | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
* | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
* | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
* | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \
| * | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ | |/|
* / | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-211-7/+12
|/ /
* | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-212-1/+5
|\ \
| * | Memory: Add enum definitions for the n3DS FCRAM sizeYuri Kunde Schlesner2017-06-211-1/+3
| * | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/
* | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \
| * | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| * | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/
* | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \
| * | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| |/
* / Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
|/
* Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
* Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
* Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
* Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
* Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
* IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
* IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
* Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
* ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
* Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-099-64/+355
|\
| * Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| * Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| * Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-085-4/+269
| * Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
* | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-082-1/+2
* | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
* | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ | |/ |/|
| * Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
* | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0631-12/+79
* | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-066-24/+147
* | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
* | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-064-9/+10
* | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
* | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
* | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0614-73/+100
* | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-036-24/+22
* | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-032-4/+3
* | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-032-53/+37
* | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-036-24/+60
* | Optimized messages that were repetitive and added ability for core errors to specify more details optionally.TheKoopaKingdom2017-06-031-2/+15
* | Made some changes from review comments:TheKoopaKingdom2017-06-038-35/+33
* | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-035-8/+43
* | Fixed encrypted ROM error messages.TheKoopaKingdom2017-06-033-9/+19
* | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \
| * | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| * | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| * | cam: use IPCHelperwwylele2017-05-241-278/+238
* | | Merge pull request #2739 from yuriks/kernel-reorgbunnei2017-06-0125-341/+428
|\ \ \
| * | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3018-203/+242
| * | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3013-132/+176
| * | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
| * | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| | |/ | |/|
* | | CMake: Remove unnecessary include_directories for dynarmicYuri Kunde Schlesner2017-05-281-3/+0
* | | CMake: Add cryptopp include path to target propertyYuri Kunde Schlesner2017-05-281-1/+0
* | | CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-281-1/+1
|/ /
* | CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-281-2/+2
* | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-282-2/+0
* | Move screen size constants from video_core to coreYuri Kunde Schlesner2017-05-285-13/+46
* | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-284-4/+4
* | Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-284-1/+215
* | Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-2632-277/+343
|\ \
| * | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| * | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2523-132/+178
| * | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
| * | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-2510-105/+115
| * | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
| * | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-251-18/+15
* | | telemetry: Log a few simple data fields throughout core.bunnei2017-05-253-1/+22
* | | core: Keep track of telemetry for the current emulation session.bunnei2017-05-255-0/+83
| |/ |/|
* | Merge pull request #2692 from Subv/vfp_ftzSebastian Valle2017-05-222-0/+26
|\ \ | |/ |/|
| * fixup! Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-222-4/+0
| * Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-082-0/+30
* | Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-228-51/+84
|\ \
| * | Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| * | Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| * | Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-158-32/+86
* | | Merge pull request #2694 from Subv/vfp_vsub_ftzMerry2017-05-221-2/+12
|\ \ \
| * | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.Subv2017-05-141-2/+12
| | |/ | |/|
* | | Merge pull request #2661 from Subv/uds5bunnei2017-05-195-33/+602
|\ \ \
| * | | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| * | | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| * | | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-155-7/+537
* | | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
* | | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-147-49/+121
|\ \ \ \
| * | | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-105-52/+105
| * | | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-101-1/+6
| * | | | Memory: Add constants for the n3DS additional RAMYuri Kunde Schlesner2017-05-102-2/+16
* | | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-109-24/+208
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| * | | | ir: implement new 3ds HID via ir:rstwwylele2017-05-049-24/+207
* | | | | Merge pull request #2696 from Subv/vfp_revertYuri Kunde Schlesner2017-05-093-59/+30
|\ \ \ \ \
| * | | | | Dyncom/VFP: Strip the VFP_NAN_FLAG sentinel value when setting vfp exceptions.Subv2017-05-092-2/+2
| * | | | | Revert "Remove `exceptions` parameter from `normaliseround` VFP functions"Subv2017-05-093-57/+28
| | |_|/ / | |/| | |
* | | | | Dyncom: Remove disassembler codeYuri Kunde Schlesner2017-05-084-1589/+2
* | | | | Dyncom: Tweak types and log formattingYuri Kunde Schlesner2017-05-083-8/+10
* | | | | Remove unused symbols codeYuri Kunde Schlesner2017-05-083-46/+0
* | | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-082-40/+2
|/ / / /
* / / / Create a random console_unique_id (#2668)B3n302017-05-062-5/+71
|/ / /
* | | Merge pull request #2606 from wwylele/irbunnei2017-05-046-44/+761
|\ \ \
| * | | ir: implement circle pad prowwylele2017-05-036-44/+761
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \ | |_|_|/ |/| | |
| * | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| |/ /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | |_|/ |/| |
| * | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | |_|/ |/| |
| * | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| * | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| * | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| * | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| * | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| * | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| * | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| * | | address more commentsLectem2017-03-191-20/+20
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
* | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
* | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
* | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
* | | | | Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-222-12/+24
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add custom layout settings.SonofUgly2017-02-232-12/+24
* | | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
| |/ / / |/| | |
* | | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-1710-401/+213
|\ \ \ \
| * | | | Input: remove unused stuff & clean upwwylele2017-03-017-412/+1
| * | | | InputCommon: add Keyboardwwylele2017-03-011-2/+0
| * | | | HID: use AnalogDevicewwylele2017-03-013-2/+30
| * | | | HID: use ButtonDevicewwylele2017-03-015-1/+100
| * | | | Input: add device and factory templatewwylele2017-03-012-0/+98
| | |/ / | |/| |
* | | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-176-8/+11
|\ \ \ \
| * | | | file_sys: lower log level for setting host pathwwylele2017-03-084-4/+4
| * | | | loader/ncch: less verbose log for loading game list. only log program ID when bootingwwylele2017-03-081-3/+6
| * | | | loader: lower file name logging levelwwylele2017-03-081-1/+1
| |/ / /
* | | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \ \
| * | | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| |/ / /
* / / / cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
|/ / /
* | | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
* | | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ \
| * | | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
* | | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
* | | | Doxygen: Amend minor issues (#2593)Mat M2017-02-279-13/+15
* | | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-2712-45/+213
|\ \ \ \ | |/ / / |/| | |
| * | | PerfStats: Re-order and document members betterYuri Kunde Schlesner2017-02-272-5/+14
| * | | Core: Re-write frame limiterYuri Kunde Schlesner2017-02-274-39/+50
| * | | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-276-8/+23
| * | | PerfStats: Add method to get the instantaneous time ratioYuri Kunde Schlesner2017-02-273-7/+22
| * | | Add performance statistics to status barYuri Kunde Schlesner2017-02-278-3/+120
| * | | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-273-1/+2
* | | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-2513-6/+564
|\ \ \ \
| * | | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| * | | | HW: add AES engine & implement AES-CCMwwylele2017-02-218-0/+415
* | | | | Merge pull request #2421 from Subv/timersYuri Kunde Schlesner2017-02-253-16/+36
|\ \ \ \ \
| * | | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
| * | | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
| | |/ / / | |/| | |
* | | | | Merge pull request #2585 from MerryMage/sxtb16-sxtab16bunnei2017-02-201-4/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | dyncom: Correct SXTAB16 and SXTB16MerryMage2017-02-181-4/+4
* | | | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
* | | | | core: add missing errors.h in CMakeLists.txtwwylele2017-02-151-0/+1
* | | | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
* | | | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
* | | | | turned clang format back onnoah the goodra2017-02-141-1/+1
| |/ / / |/| | |
* | | | Core: add cryptopp library (#2412)Weiyi Wang2017-02-131-1/+2
* | | | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-139-60/+295
|\ \ \ \
| * | | | loader: use self NCCH archivewwylele2017-02-136-90/+7
| * | | | file_sys: add Self NCCH archivewwylele2017-02-135-0/+318
| |/ / /
* | | | core: Free AppLoader on shutdown to release file (#2558)Yuri Kunde Schlesner2017-02-111-9/+2
* | | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-112-6/+0
|/ / /
* | | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-056-68/+364
|\ \ \
| * | | fix wwylele's comment and use typename in templatesLectem2017-02-051-4/+4
| * | | fix comments alignmentLectem2016-12-301-22/+22
| * | | move Pop methods out of class bodyLectem2016-12-261-72/+88
| * | | IPC helpers exampleLectem2016-12-263-35/+40
| * | | IPC helpersLectem2016-12-263-48/+323
* | | | Merge pull request #2496 from mailwl/cfg-memYuri Kunde Schlesner2017-02-041-5/+8
|\ \ \ \
| * | | | Core: update Kernel Config Memory to latest version (11.2)mailwl2017-01-301-5/+8
| | |_|/ | |/| |
* | | | Merge pull request #2518 from MerryMage/coprocYuri Kunde Schlesner2017-02-045-15/+140
|\ \ \ \
| * | | | arm_dynarmic: Update memory interfaceMerryMage2017-02-031-10/+10
| * | | | arm_dynarmic: CP15 supportMerryMage2017-02-035-5/+130
| |/ / /
* | | | Merge pull request #2509 from jfmherokiller/settingscastpatchbunnei2017-02-031-1/+1
|\ \ \ \
| * | | | removed the possibly uneeded cast on values.gdbstub_portnoah the goodra2017-01-311-1/+1
* | | | | GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
|/ / / /
* / / / HLE/Applets: Stub Mint (eShop) Applet (#2463)mailwl2017-01-314-0/+108
|/ / /
* | | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-3011-172/+1457
|\ \ \
| * | | CAM: implement basic camera functions with a blank camerawwylele2017-01-1111-172/+1457
| |/ /
* | | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \ \
| * | | CFG: override language setting on bootwwylele2017-01-191-36/+38
* | | | Merge pull request #2494 from Kloen/killing-warnings-2-final-mixYuri Kunde Schlesner2017-01-301-1/+1
|\ \ \ \
| * | | | core: inline CPU, 132 warnings fixed on GCCKloen2017-01-301-1/+1
* | | | | Merge pull request #2492 from Kloen/killing-warnings-HD1.5ReMIXYuri Kunde Schlesner2017-01-304-0/+28
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
| * | | | core: fix savedata_archive.cpp warnings about unhandled enumeration values on OSXKloen2017-01-291-0/+12
| * | | | core: fix archive_sdmc.cpp warnings about unhandled enumeration value on OSXKloen2017-01-291-0/+12
| * | | | core: fix archive_extsavedata.cpp warning on OSXKloen2017-01-291-0/+2
| | |_|/ | |/| |
* / | | core: emu_window.cpp, fix conversion warnings from float to s16 on MSVCKloen2017-01-291-6/+6
|/ / /
* | | SDL: Select audio device (#2403)Kloen Lansfiel2017-01-261-0/+1
* | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \
| * | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
* | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
* | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
* | | | loader: Add support for 3DSX special relocation types, fixes citra-emu/citra#2449Thomas Farr2017-01-181-9/+25
* | | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-164-5/+6
* | | | HID: manages updating itself using correct tickswwylele2017-01-163-62/+93
|/ / /
* / / GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ /
* | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-124-32/+30
|\ \
| * | Threads: Check the process' resource limit for the max allowed priority when creating a thread and remove the priority clamping code.Subv2017-01-112-13/+9
| * | Thread: Added priority range checking to svcSetThreadPriority and removed priority clamping code from Thread::SetPriority.Subv2017-01-113-18/+18
| * | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-129-297/+424
|\ \ \ | |/ / |/| |
| * | Service/AC: add ac:i servicemailwl2016-12-309-297/+424
* | | Merge pull request #2397 from Subv/pulsebunnei2017-01-105-13/+20
|\ \ \
| * | | Kernel: Implemented Pulse event and timers.Subv2017-01-055-13/+20
| |/ /
* | | Merge pull request #2384 from bunnei/internal-res-optionbunnei2017-01-082-2/+1
|\ \ \
| * | | config: Add option for specifying screen resolution scale factor.bunnei2017-01-072-2/+1
* | | | Merge pull request #1951 from wwylele/motion-sensorbunnei2017-01-075-8/+212
|\ \ \ \ | |/ / / |/| | |
| * | | Frontend: make motion sensor interfaced thread-safewwylele2016-12-292-2/+8
| * | | Frontend: emulate motion sensorwwylele2016-12-265-8/+206
| | |/ | |/|
* | | Merge pull request #2410 from Subv/sleepthreadbunnei2017-01-073-0/+14
|\ \ \
| * | | Kernel: Don't attempt to yield execution in SleepThread(0) if there are no available threads to run.Subv2017-01-063-0/+14
* | | | Merge pull request #2396 from Subv/sema_acquirebunnei2017-01-071-1/+2
|\ \ \ \
| * | | | Kernel/Semaphore: Fixed a regression in semaphore waits.Subv2017-01-051-1/+2
| |/ / /
* | | | Kernel: Fix SharedMemory objects always returning error when addr = 0 (#2404)Hyper2017-01-061-1/+5
* | | | Merge pull request #2408 from Subv/priority_boostingbunnei2017-01-061-27/+0
|\ \ \ \
| * | | | Kernel: Removed the priority boost code for starved threads.Subv2017-01-051-27/+0
| |/ / /
* / / / Kernel: Remove some unused functions.Subv2017-01-052-32/+0
|/ / /
* | | Merge pull request #2393 from Subv/synchSebastian Valle2017-01-0517-159/+221
|\ \ \
| * | | Kernel: Add some asserts to enforce the invariants in the scheduler.Subv2017-01-052-2/+13
| * | | Kernel: Remove a thread from all of its waiting objects' waiting_threads list when it is awoken.Subv2017-01-051-18/+4
| * | | Kernel: Remove Thread::wait_objects_index and use wait_objects to hold all the objects that a thread is waiting on.Subv2017-01-054-21/+22
| * | | Kernel: Use different thread statuses when a thread calls WaitSynchronization1 and WaitSynchronizationN with wait_all = true.Subv2017-01-043-16/+20
| * | | Kernel/Mutex: Propagate thread priority changes to other threads inheriting the priority via mutexesSubv2017-01-045-42/+60
| * | | Kernel/Mutex: Update a mutex priority when a thread stops waiting on it.Subv2017-01-045-24/+42
| * | | Kernel/Mutex: Implemented priority inheritance.Subv2017-01-045-31/+51
| * | | Kernel: Object ShouldWait and Acquire calls now take a thread as a parameter.Subv2017-01-0417-68/+56
| * | | Kernel/Synch: Do not attempt a reschedule on every syscall.Subv2017-01-042-2/+18
| | |/ | |/|
* | | Fix some warnings (#2399)Jonathan Hao2017-01-047-15/+8
* | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-305-0/+42
|/ /
* | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-305-2/+91
|\ \
| * | Config: auto-select region and languagewwylele2016-12-075-2/+91
* | | Core: remove unused hle.cppwwylele2016-12-271-58/+0
* | | Core: reset cpu_core in Shutdown to make IsPoweredOn work properlywwylele2016-12-241-0/+1
| |/ |/|
* | core: Move emu_window and key_map into coreMerryMage2016-12-237-2/+648
* | Service/NWM: add nwm servicesmailwl2016-12-2218-10/+317
* | Merge pull request #2366 from MerryMage/MemoryReadCodebunnei2016-12-221-0/+1
|\ \
| * | arm_dynarmic: Provide MemoryReadCode callbackMerryMage2016-12-221-0/+1
* | | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-2232-407/+377
|\ \ \ | |/ / |/| |
| * | ThreadContext: Move from "core" to "arm_interface".bunnei2016-12-228-37/+26
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-228-93/+91
| * | Address clang-format issues.bunnei2016-12-226-32/+33
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-2219-107/+94
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-2212-311/+264
| * | core: Consolidate top-level system state into a singleton.bunnei2016-12-222-23/+120
| * | loader: Remove duplicate docstrings.bunnei2016-12-223-56/+0
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-222-49/+92
|\ \ \ | |/ / |/| |
| * | csnd:SND reformat source codemailwl2016-12-122-49/+92
* | | Revert "Memory: Always flush whole pages from surface cache"bunnei2016-12-181-10/+0
* | | Thread: remove the thread from the thread list when exitingwwylele2016-12-173-3/+15
* | | Merge pull request #2337 from lioncash/gdbbunnei2016-12-161-9/+8
|\ \ \
| * | | gdbstub: const correctness changesLioncash2016-12-161-9/+8
* | | | Merge pull request #2322 from MerryMage/ctx-mnuMerry2016-12-165-0/+35
|\ \ \ \
| * | | | loader: Implement ReadProgramIdMerryMage2016-12-153-0/+28
| * | | | archive_source_sd_savedata: Add static method to get a specific save data pathMerryMage2016-12-152-0/+7
* | | | | Kernel: remove object's waiting thread if it is deadwwylele2016-12-161-1/+2
| |/ / / |/| | |
* | | | Merge pull request #2260 from Subv/schedulingbunnei2016-12-167-195/+209
|\ \ \ \
| * | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-143-27/+39
| * | | | Properly remove a thread from its wait_objects' waitlist when it is awoken by a timeout.Subv2016-12-103-2/+11
| * | | | WaitSynch: Removed unused variables and reduced SharedPtr copies.Subv2016-12-094-73/+56
| * | | | Use boost remove_erase_if instead of the erase-remove idiomSubv2016-12-071-2/+3
| * | | | Improved the algorithm for GetHighestPriorityReadyThread.Subv2016-12-071-14/+13
| * | | | Threading: Added some utility functions and const correctness.Subv2016-12-043-15/+35
| * | | | Threading: Reworked the way our scheduler works.Subv2016-12-047-189/+179
* | | | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ \ \
| * | | | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
* | | | | | Merge pull request #2332 from lioncash/gdbYuri Kunde Schlesner2016-12-165-16/+23
|\ \ \ \ \ \
| * | | | | | gdbstub: Remove global variable from public interfaceLioncash2016-12-155-16/+23
* | | | | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-168-13/+81
|\ \ \ \ \ \ \
| * | | | | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-158-13/+81
* | | | | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-153-0/+6
|\ \ \ \ \ \ \
| * | | | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-153-0/+6
| |/ / / / / /
* / / / / / / act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / / /
* | | | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-158-10/+44
|\ \ \ \ \ \
| * | | | | | Service/ACT: move ACT services to foldermailwl2016-12-148-10/+44
| | |_|/ / / | |/| | | |
* | | | | | Memory: Always flush whole pages from surface cacheYuri Kunde Schlesner2016-12-151-0/+10
| |/ / / / |/| | | |
* | | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1524-170/+591
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-1416-68/+108
| * | | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-096-47/+38
| * | | | Kernel/IPC: Small codestyle cleanupSubv2016-12-092-3/+1
| * | | | Added a framework for partially handling Session disconnections.Subv2016-12-088-9/+67
| * | | | Use std::move where appropriate.Subv2016-12-0812-177/+187
| * | | | Return an error code when connecting to a saturated port.Subv2016-12-055-7/+20
| * | | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| * | | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-056-22/+59
| * | | | Kernel: Remove the Redirection handle type.Subv2016-12-051-2/+0
| * | | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-0512-69/+86
| * | | | Declare empty ServerSession and ClientSession constructors as default.Subv2016-12-032-4/+4
| * | | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-012-3/+5
| * | | | Fixed the rebase mistakes.Subv2016-12-0110-82/+76
| * | | | A bit of a redesign.Subv2016-12-0113-263/+266
| * | | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-016-26/+21
| * | | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-014-24/+52
| * | | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-014-5/+6
| * | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-0116-88/+314
| |/ / /
* | / / Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
| |/ / |/| |
* | | Merge pull request #2267 from JayFoxRox/fix-mingw-ccSebastian Valle2016-12-111-2/+2
|\ \ \
| * | | gdbstub: Remove unused includeJannik Vogel2016-12-051-1/+0
| * | | Support mingw cross-compileJannik Vogel2016-12-051-1/+2
* | | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
* | | | Core: Add a forgotten #include <cstring> for memcpy.Emmanuel Gil Peyrot2016-12-111-0/+1
* | | | Add all services to the Service namespaceLioncash2016-12-1145-482/+390
* | | | Merge pull request #2291 from lioncash/svcbunnei2016-12-0910-12/+61
|\ \ \ \
| * | | | service: Add cfg:nor serviceLioncash2016-12-094-0/+49
| * | | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
* | | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
* | | | | Merge pull request #2287 from lioncash/svcYuri Kunde Schlesner2016-12-0912-12/+170
|\ \ \ \ \
| * | | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
| * | | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
| * | | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
| * | | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-086-0/+90
* | | | | | Merge pull request #2280 from Subv/citrace_sizeSebastian Valle2016-12-081-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Fixed the gpu command list size when creating CiTraces.Subv2016-12-081-2/+2
| | |/ / / | |/| | |
* | | | | service: Add mvd and qtm servicesLioncash2016-12-0814-0/+271
* | | | | Merge pull request #2284 from lioncash/svcYuri Kunde Schlesner2016-12-088-30/+199
|\ \ \ \ \
| * | | | | service: Add nfc servicesLioncash2016-12-088-30/+199
* | | | | | Merge pull request #2277 from lioncash/explicitYuri Kunde Schlesner2016-12-088-10/+10
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | file_sys: Make a few single-argument constructors explicitLioncash2016-12-078-10/+10
| | |_|_|/ | |/| | |
* | | | | Merge pull request #2283 from lioncash/svcYuri Kunde Schlesner2016-12-0821-28/+212
|\ \ \ \ \
| * | | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| * | | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| * | | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| * | | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| * | | | | nim: Update function tablesLioncash2016-12-082-0/+2
| * | | | | http_c: Update function tableLioncash2016-12-081-0/+4
| * | | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| * | | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| * | | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| * | | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| * | | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| * | | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| * | | | | act: Update function tablesLioncash2016-12-082-0/+10
| * | | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
| | |_|/ / | |/| | |
* | | | | Merge pull request #2281 from lioncash/appletYuri Kunde Schlesner2016-12-088-30/+22
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | applet: Move common IsRunning underlying variable to the Applet classLioncash2016-12-078-28/+19
| * | | | applet: Make virtual destructor defaultedLioncash2016-12-071-1/+1
| * | | | applet: Make constructor protectedLioncash2016-12-071-1/+2
* | | | | Update AM service function tablesLioncash2016-12-086-113/+246
| |/ / / |/| | |
* | | | Merge pull request #2232 from wwylele/other-savebunnei2016-12-0711-80/+351
|\ \ \ \ | |/ / / |/| | |
| * | | FileSys: Implement OtherSaveDatawwylele2016-11-297-0/+214
| * | | FS: add missing MediaTypewwylele2016-11-291-1/+1
| * | | FileSys: abstract SD save data archive sourcewwylele2016-11-296-79/+136
* | | | Implement Frame rate limiter (#2223)emmauss2016-12-063-0/+35
| |/ / |/| |
* | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| |/ |/|
* | Set client SDK version to Service APIsmailwl2016-11-307-13/+86
|/
* Merge pull request #2196 from Subv/system_modeYuri Kunde Schlesner2016-11-287-9/+35
|\
| * Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-283-16/+17
| * Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-207-9/+34
* | Merge pull request #2222 from linkmauve/die-frameskip-dieYuri Kunde Schlesner2016-11-283-22/+1
|\ \
| * | GPU: Remove the broken frame_skip option.Emmanuel Gil Peyrot2016-11-273-22/+1
* | | Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-2827-304/+1180
|\ \ \ | |/ / |/| |
| * | FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-195-23/+22
| * | FileSys: remove unused DiskArchivewwylele2016-11-192-179/+0
| * | PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| * | FileSys: w->rw permission lift only happens in SDMC archivewwylele2016-11-194-2/+14
| * | FileSys: add SDMCWriteOnlyArchivewwylele2016-11-196-0/+140
| * | FileSys: add SDMCArchivewwylele2016-11-193-1/+301
| * | FileSys: add ExtSaveDataArchivewwylele2016-11-192-1/+115
| * | FileSys: add SaveDataArchivewwylele2016-11-197-4/+368
| * | FileSys: remove Open from FileBackendwwylele2016-11-194-64/+44
| * | FileSys: remove Open from DirectoryBackendwwylele2016-11-194-25/+5
| * | FileSys: add PathParserwwylele2016-11-193-0/+161
| * | FileSys: make Archive interfaces return error codewwylele2016-11-016-87/+91
* | | Merge pull request #2168 from mailwl/micSebastian Valle2016-11-272-16/+307
|\ \ \
| * | | Output parameters to logmailwl2016-11-251-4/+6
| * | | MIC_U: Stub service funcionsmailwl2016-11-252-16/+305
* | | | dynarmic: Add ticks based on ticks executed, not ticks requestedMerryMage2016-11-261-2/+2
|/ / /
* | | Expose page table to dynarmic for optimized reads and writes to the JITJames Rowe2016-11-253-6/+18
* | | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
* | | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ \
| * | | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
* | | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \ \
| * | | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
* | | | | Merge pull request #2193 from Subv/pulse_eventsbunnei2016-11-202-0/+10
|\ \ \ \ \
| * | | | | Kernel/Events: Log an error when trying to create Pulse events and timers.Subv2016-11-192-0/+10
| | |_|_|/ | |/| | |
* / | | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-195-16/+27
|/ / / /
* | | | Merge pull request #2172 from jroweboy/fix-mingwbunnei2016-11-161-1/+1
|\ \ \ \
| * | | | Add mingw compile supportJames Rowe2016-11-141-1/+1
| | |/ / | |/| |
* / | | Support additional screen layouts.James Rowe2016-11-052-0/+18
|/ / /
* | | Style fixmailwl2016-11-021-2/+2
* | | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
* | | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
| |/ |/|
* | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \
| * | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| |/
* | Merge pull request #2123 from jbeich/freebsdbunnei2016-10-311-0/+8
|\ \
| * | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
* | | Small fix to let IDA see target.xmlmailwl2016-10-281-1/+1
|/ /
* | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
* | Fix typosRicardo de Almeida Gonzaga2016-10-205-5/+5
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-083-4/+1808
|\ \ | |/ |/|
| * Update the stub code of BOSSJamePeng2016-10-023-4/+1808
* | Merge pull request #1652 from wwylele/kernal-toolbunnei2016-10-057-7/+26
|\ \
| * | move ResetType to kernel.hwwylele2016-09-223-7/+6
| * | name objectswwylele2016-09-221-0/+4
| * | implement wait tree widgetwwylele2016-09-224-0/+16
| |/
* | Merge pull request #2106 from wwylele/delete-recursivebunnei2016-10-048-22/+93
|\ \
| * | fs: clean up log formatwwylele2016-10-021-22/+24
| * | fs: implement DeleteDirectoryRecursivelywwylele2016-10-028-1/+70
| |/
* | gpu: DisplayTransfer: a less amazing algorithm for flipwwylele2016-09-291-8/+11
* | gpu: keep the old signal strategy for null pointerwwylele2016-09-291-4/+8
* | gpu: add validity check for TextureCopy, DisplayTransfer and FillMemorywwylele2016-09-291-6/+88
* | memory: fix IsValidVirtualAddress for RasterizerCachedMemorywwylele2016-09-291-0/+3
* | gpu: move MemoryFill, TextureCopy and DisplayTransfer into functionswwylele2016-09-291-247/+249
|/
* Remove special rules for Windows.h and library includesYuri Kunde Schlesner2016-09-211-1/+1
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-21106-106/+106
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-21146-369/+117
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-1995-451/+467
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-18208-10514/+10705
* Dyncom: Disable clang-format on the decoding table.Emmanuel Gil Peyrot2016-09-181-0/+3
* arm_dynarmic: Implement GetVFPSystemReg/SetVFPSystemReg.bunnei2016-09-151-5/+12
* arm: ResetContext shouldn't be part of ARM_Interface.bunnei2016-09-156-30/+17
* arm_dynarmic/arm_dyncom: Remove unnecessary "virtual" keyword.bunnei2016-09-152-2/+2
* dyncom: Use VFP_FPSCR/VFP_FPEXC.bunnei2016-09-151-4/+4
* core: Add configuration option for CPU JIT.bunnei2016-09-152-7/+13
* dynarmic: Implement ARM CPU interface.bunnei2016-09-153-0/+233
* Merge pull request #2032 from bunnei/qt-graphicsbunnei2016-09-013-0/+12
|\
| * system: Add a function to see if the emulator is running.bunnei2016-08-302-0/+11
| * config: Add a setting for graphics V-Sync.bunnei2016-08-301-0/+1
* | configure_audio: User-configuratble option to enable/disable audio stretchingMerryMage2016-08-312-0/+2
* | Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\ \ | |/ |/|
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-2914-99/+3041
|\ \
| * | LDR: Implement CROwwylele2016-08-279-99/+3013
| * | ARM: add ClearInstructionCache functionwwylele2016-08-273-0/+11
| * | Memory: add ReadCString functionwwylele2016-08-272-0/+17
| |/
* | Merge pull request #1987 from Lectem/ipcdescriptorsYuri Kunde Schlesner2016-08-275-22/+110
|\ \ | |/ |/|
| * fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-025-22/+110
* | dyncom: Read-after-write in SMLAMerryMage2016-08-221-2/+4
* | Dyncom: Correct implementation of STM for R15MerryMage2016-08-141-3/+4
|/
* Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\
| * Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
* | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
* | Merge pull request #1959 from MerryMage/revsh-upstreambunnei2016-07-281-4/+13
|\ \
| * | dyncom: Fix translation of thumb REVSHMerryMage2016-07-281-4/+13
* | | CoreTiming: avoid overflowwwylele2016-07-231-1/+1
* | | HLE: implement system timewwylele2016-07-232-2/+60
| |/ |/|
* | Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-106-37/+253
|\ \
| * | Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| * | Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| * | Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| * | Service::CFG: add missing languagewwylele2016-07-021-1/+2
| * | Service::CFG: name sound output modeswwylele2016-07-022-2/+7
| |/
* | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-072-10/+15
|\ \
| * | Fix the errorcode of archive handleJamePeng2016-07-042-10/+15
* | | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ \
| * | | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
* | | | HLE/Applets: Implement ErrEula appletmailwl2016-07-045-0/+118
| |/ / |/| |
* | | Result: fix and update ErrorModulewwylele2016-06-301-6/+19
| |/ |/|
* | Merge pull request #1869 from wwylele/dont-be-lazyYuri Kunde Schlesner2016-06-291-2/+6
|\ \
| * | Switch context on the same thread if necessarywwylele2016-05-301-2/+6
* | | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-292-15/+125
|\ \ \
| * | | Fix parameter name in EnableNotificationmailwl2016-05-312-2/+6
| * | | Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| * | | remove ugly functionmailwl2016-05-311-35/+3
| * | | srv: Update according 3dbrewmailwl2016-05-311-15/+137
| |/ /
* | | Merge pull request #1877 from wwylele/wait-fix-timeoutbunnei2016-06-181-0/+49
|\ \ \
| * | | Thread: update timeout when rerunning WaitSynchwwylele2016-06-041-0/+49
| |/ /
* | | Merge pull request #1898 from archshift/interpreter-split-take2bunnei2016-06-165-2727/+2729
|\ \ \ | |_|/ |/| |
| * | Make arm_dyncom_trans* into a fully fledged compilation unitarchshift2016-06-124-53/+73
| * | arm_dyncom_interpreter: slightly change AllocBuffer to be intuitivearchshift2016-06-121-15/+15
| * | arm_dyncom_interpreter: Add specialized GetAddressingOpLoadStoreT funcarchshift2016-06-112-39/+19
| * | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-112-34/+34
| * | arm_dyncom_interpreter: Rename anonymous enum to TransExtDataarchshift2016-06-114-166/+164
| * | arm_dyncom_interpreter.cpp: #include translation info from inc filesarchshift2016-06-113-2648/+2652
* | | Merge pull request #1842 from Subv/portsbunnei2016-06-128-3/+178
|\ \ \
| * | | Kernel/SVC: Implemented svcCreatePort.Subv2016-06-116-3/+41
| * | | Kernel: Added ClientPort and ServerPort classes.Subv2016-06-056-2/+139
* | | | hid: add missing headerwwylele2016-06-111-0/+2
* | | | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-113-40/+53
|\ \ \ \
| * | | | fixup! fixup! Refactor input systemwwylele2016-05-151-1/+1
| * | | | implement circle pad modifierwwylele2016-05-151-1/+5
| * | | | Refactor input subsystemwwylele2016-05-153-40/+49
* | | | | Revert "Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)"archshift2016-06-115-2731/+2727
* | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-092-42/+42
* | | | | arm_dyncom_interpreter.cpp: Split by translation and interpreter logicarchshift2016-06-095-2727/+2731
| |_|/ / |/| | |
* | | | gdbstub: E0 should be E00shinyquagsire232016-06-081-1/+1
* | | | service: Add other DLP servicesLioncash2016-06-0510-23/+150
| |/ / |/| |
* | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-012-15/+22
| |/ |/|
* | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-3017-138/+454
|\ \
| * | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-282-2/+60
| * | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-285-21/+19
| * | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| * | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| * | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| * | Memory: CopyBlockMerryMage2016-05-282-2/+43
| * | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| * | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| * | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| * | APT: Remove use of Memory::GetPointerMerryMage2016-05-215-35/+36
| * | Kernel/Thread: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| * | Applets/swkdb: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| * | Memory: ZeroBlockMerryMage2016-05-212-0/+39
| * | FileSys/Path: Replace Memory::GetPointer with Memory::ReadBlockMerryMage2016-05-211-6/+6
| * | Memory: ReadBlock/WriteBlockMerryMage2016-05-213-4/+81
| * | Memory: IsValidVirtualAddress/IsValidPhysicalAddressMerryMage2016-05-213-0/+26
* | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \
| * | | clean up config blockwwylele2016-05-031-29/+13
* | | | Merge pull request #1568 from JayFoxRox/fix-printfMat M2016-05-273-26/+61
|\ \ \ \
| * | | | Fix ftoi behaviourJannik Vogel2016-05-162-22/+53
| * | | | Respect fpscr in ftoizJannik Vogel2016-05-162-4/+4
| * | | | Disable VFP3 instructionsJannik Vogel2016-05-161-0/+4
* | | | | Merge pull request #1810 from JayFoxRox/fix-float-exceptionsbunnei2016-05-273-91/+130
|\ \ \ \ \
| * | | | | Remove `exceptions` parameter from `normaliseround` VFP functionsJannik Vogel2016-05-183-28/+57
| * | | | | Fix exception propagation for VFP single precisionJannik Vogel2016-05-182-33/+38
| * | | | | Fix exception propagation for VFP double precisionJannik Vogel2016-05-182-34/+39
| | |_|/ / | |/| | |
* | | | | Merge pull request #1855 from MerryMage/memory-headers-20160526Mat M2016-05-262-1/+2
|\ \ \ \ \
| * | | | | Memory: Added necessary headers and removed unnecessary headerMerryMage2016-05-262-1/+2
| |/ / / /
* | | | | Merge pull request #1817 from linkmauve/smdh-stuffbunnei2016-05-2510-105/+198
|\ \ \ \ \
| * | | | | Loader: Split SMDH into its own header and import helpers from QGameListEmmanuel Gil Peyrot2016-05-214-47/+138
| * | | | | CitraQt: Simplify the game list loader codeEmmanuel Gil Peyrot2016-05-212-14/+12
| * | | | | Loader: Add a GetFileType method to get the type of a loaded fileEmmanuel Gil Peyrot2016-05-214-0/+30
| * | | | | Loader, Frontends: Refactor loader creation and game loadingEmmanuel Gil Peyrot2016-05-214-47/+21
| |/ / / /
* | | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-242-3/+3
* | | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-249-10/+138
|\ \ \ \ \
| * | | | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-209-10/+138
* | | | | | SVC::WaitSynchronizationN: Reschedule at the endwwylele2016-05-211-2/+3
| |/ / / / |/| | | |
* | | | | Fix read-after-write in SMUAD, SMLAD, SMUSD, SMLSDJannik Vogel2016-05-181-4/+8
* | | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-185-0/+56
* | | | | Merge pull request #1800 from JayFoxRox/set-fpscrbunnei2016-05-183-0/+6
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Set fpscr for new threadsJannik Vogel2016-05-173-0/+6
* | | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|_|/ |/| | |
* | | | Memory: Fixed a regression caused by #1695 and #1689.Subv2016-05-141-0/+3
|/ / /
* | | Merge pull request #1689 from Subv/shmembunnei2016-05-1318-128/+417
|\ \ \
| * | | HLE/Applets: Give each applet its own block of heap memory, and use that when creating the framebuffer shared memory block.Subv2016-05-135-5/+44
| * | | Kernel: Account for automatically-allocated shared memories in the amount of used linear heap memory.Subv2016-05-131-0/+5
| * | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-134-66/+167
| * | | Kernel/SharedMemory: Log an error when Map fails.Subv2016-05-131-1/+10
| * | | Kernel: Implemented shared memory permissions.Subv2016-05-134-9/+50
| * | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
| * | | Kernel/Memory: Remove the Shared Memory region from the legacy memory map.Subv2016-05-131-1/+0
| * | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-1310-118/+147
| * | | Kernel/SVC: Fixed the register order for svcCreateMemoryBlock.Subv2016-05-132-2/+3
* | | | Merge pull request #1695 from Subv/tls_allocbunnei2016-05-135-28/+74
|\ \ \ \
| * | | | Kernel/Threads: Dynamically allocate the TLS region for threads in the BASE region of the linear heap.Subv2016-05-075-28/+74
* | | | | gdbstub: Silence missing prototype warningsLioncash2016-05-101-3/+3
* | | | | dyncom: Reset the context into user mode correctlyLioncash2016-05-091-1/+1
| |/ / / |/| | |
* | | | Merge pull request #1766 from Subv/log_cpubunnei2016-05-083-0/+10
|\ \ \ \
| * | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1).Subv2016-05-073-0/+10
| |/ / /
* | | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-075-29/+29
|\ \ \ \
| * | | | fixup simple type conversions where possibleAlexander Laties2016-05-075-29/+29
* | | | | Merge pull request #1761 from Subv/applets_fbbunnei2016-05-075-23/+44
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-075-23/+44
| | |_|/ | |/| |
* | | | fix:return proper errorwwylele2016-05-061-2/+3
* | | | Merge pull request #1762 from bunnei/globalbunnei2016-05-064-8/+21
|\ \ \ \
| * | | | HLE: Rename RescheduleIsPending to IsReschedulePending.bunnei2016-05-063-3/+3
| * | | | hle: Get rid of global access to g_rescheduleLioncash2016-03-214-8/+21
* | | | | Merge pull request #1700 from wwylele/gamelist-iconbunnei2016-05-066-23/+149
|\ \ \ \ \
| * | | | | add icon & title to game listwwylele2016-05-046-23/+149
* | | | | | Layout Mii parameters input/output, and return success as result of applet workmailwl2016-05-052-0/+49
| |_|/ / / |/| | | |
* | | | | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \ \ \ \
| * | | | | remove duplicated function declarationwwylele2016-05-011-13/+0
| * | | | | add config block 0x00170000wwylele2016-04-291-0/+4
| |/ / / /
* | | | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-304-2/+4
* | | | | LCD: Remove unneeded #undef with no matching #define.Emmanuel Gil Peyrot2016-04-301-2/+0
* | | | | Merge pull request #1729 from MerryMage/null-sinkbunnei2016-04-302-0/+8
|\ \ \ \ \
| * | | | | Audio: Add sink selection to configuration filesMerryMage2016-04-302-0/+8
| |/ / / /
* | | | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \ \ \
| * | | | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
* | | | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-302-1/+29
|\ \ \ \ \ \
| * | | | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-212-1/+29
| |/ / / / /
* | | | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | return checks if event and memory createdmailwl2016-04-231-1/+8
| * | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
* | | | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-293-12/+0
* | | | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-273-59/+152
|\ \ \ \ \ \
| * | | | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| * | | | | | DSP_DSP: Add return IPC headersMerryMage2016-04-272-4/+27
| * | | | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-272-42/+106
| * | | | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
* | | | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
* | | | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \ \ \
| * | | | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|/ / / / | |/| | | | |
* | | | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
| |/ / / / / |/| | | | |
* | | | | | ncch: Use correct format specifier (for long long uint)Sam Spilsbury2016-04-231-1/+1
* | | | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
* | | | | | gdbstub: Don't check if unsigned int is > 0Sam Spilsbury2016-04-231-2/+2
| |/ / / / |/| | | |
* | | | | HWRasterizer: Texture forwardingtfarley2016-04-217-181/+348
* | | | | Config: Add scaled resolution optiontfarley2016-04-212-1/+2
|/ / / /
* | | | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ \ \ | |_|/ / |/| | |
| * | | Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| * | | Code styleRyan Loebs2016-03-301-2/+2
| * | | Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| * | | Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| * | | But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| * | | Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| * | | Formatting...Ryan Loebs2016-03-291-1/+1
| * | | Addressing PR commentsRyan Loebs2016-03-291-4/+4
| * | | SOC UpdatesRyan Loebs2016-03-291-3/+46
* | | | core: Clean out some unnecessary header includesLioncash2016-04-163-14/+1
* | | | Merge pull request #1667 from wwylele/ncch-loader-fixbunnei2016-04-151-2/+2
|\ \ \ \
| * | | | ncch:only decompress .code sectionwwylele2016-04-141-2/+2
* | | | | Y2R: num_tiles should be allowed when its value is 128 (#1669)JamePeng2016-04-151-1/+1
|/ / / /
* | | | Merge pull request #1613 from mailwl/anpbunnei2016-04-112-2/+7
|\ \ \ \
| * | | | Set Kernel config "Unknown Value" to 0x1mailwl2016-04-112-2/+7
* | | | | CitraQt: Apply config at startupJannik Vogel2016-04-112-0/+16
|/ / / /
* | | / Fix BLX LR opcode interpretationmailwl2016-04-091-2/+3
| |_|/ |/| |
* | | Merge pull request #1644 from polaris-/gdb-fixesbunnei2016-04-081-23/+85
|\ \ \
| * | | Adopted WinterMute's gdbstub changespolaris-2016-04-061-23/+85
* | | | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
* | | | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-083-0/+28
* | | | Update cpsr (T)humb bit while creating threadmailwl2016-04-081-1/+1
* | | | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \ \ \
| * | | | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| * | | | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| * | | | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
* | | | | Fix thumb ADR instruction alignmentmailwl2016-04-061-6/+2
| |/ / / |/| | |
* | | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-064-55/+234
|\ \ \ \
| * | | | frd:u: Initial stub some functionsmailwl2016-03-274-55/+234
| | |/ / | |/| |
* | | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-0614-37/+31
|\ \ \ \ | |_|/ / |/| | |
| * | | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-0514-37/+31
| | |/ | |/|
* | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-034-0/+63
|\ \ \
| * | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-024-0/+63
* | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-023-3/+54
|\ \ \ \
| * | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-313-3/+54
* | | | | Merge pull request #1390 from purpasmart96/citra_gsp_error_codesbunnei2016-04-013-80/+97
|\ \ \ \ \
| * | | | | GSP: Return proper error codes for register writespurpasmart962016-03-313-80/+97
| |/ / / /
* | | | | Merge pull request #1618 from MerryMage/one-stepMathew Maidment2016-03-311-26/+57
|\ \ \ \ \
| * | | | | DynCom: Optimize single steppingMerryMage2016-03-301-26/+57
| | |_|/ / | |/| | |
* | | | | Merge pull request #1419 from mailwl/branch-gspbunnei2016-03-311-6/+41
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueuemailwl2016-03-311-6/+41
| | |_|/ | |/| |
* / | | Add common methods to all cfg:* portsRyan Loebs2016-03-293-0/+21
|/ / /
* | | use reference instead of pointerwwylele2016-03-261-9/+9
* | | Merge pull request #1549 from wwylele/acc_gyrobunnei2016-03-264-23/+187
|\ \ \ | |_|/ |/| |
| * | implement GyroscopeCalibrateParamwwylele2016-03-252-9/+20
| * | implement accel and gyro backendwwylele2016-03-224-23/+176
* | | Merge pull request #1560 from lioncash/savedatabunnei2016-03-221-1/+2
|\ \ \
| * | | archive_extsavedata: Fix member initialization orderLioncash2016-03-211-1/+2
| | |/ | |/|
* | | Merge pull request #1563 from lioncash/lolfiqbunnei2016-03-221-4/+3
|\ \ \
| * | | armstate: Correct FIQ register bankingLioncash2016-03-211-4/+3
| |/ /
* | | Merge pull request #1559 from lioncash/vecbunnei2016-03-211-8/+5
|\ \ \
| * | | soc_u: Get rid of explicit delete and newLioncash2016-03-211-8/+5
| |/ /
* | | session: Make helper functions constexprLioncash2016-03-211-6/+6
* | | loader: Make MakeMagic constexprLioncash2016-03-211-1/+1
|/ /
* | Merge pull request #1302 from Subv/save_fixbunnei2016-03-2024-143/+400
|\ \
| * | HLE/FS: Change the error code returned when an ExtSaveData archive is not found.Subv2016-03-205-33/+45
| * | HLE/FS: Corrected some style concerns.Subv2016-03-208-14/+12
| * | HLE/FS: Fixed creating the config savefile when it doesn't exist.Subv2016-03-201-1/+1
| * | HLE/FS: Implemented GetFormatInfoSubv2016-03-2019-62/+257
| * | HLE/FS: Don't return an error when deleting the ExtSaveData if it does not exist.Subv2016-03-201-1/+1
| * | HLE/FS: Return the proper error codes when opening files.Subv2016-03-207-28/+43
| * | HLE/FS: Fixed the OpenDirectory error codeSubv2016-03-201-1/+1
| * | HLE/FS: Return the proper error codes on file Read/Write operations.Subv2016-03-207-18/+40
| * | HLE/FS: Corrected the error codes for DeleteFileSubv2016-03-206-12/+22
| * | HLE/FS: Corrected the error codes for CreateFileSubv2016-03-202-2/+7
| * | HLE/FS: FS::CreateFile takes an u64 for the file size.Subv2016-03-208-10/+10
| |/
* / Fix missing headerLittleWhite2016-03-201-0/+2
|/
* Merge pull request #1505 from pippo2931/fefbunnei2016-03-181-1/+25
|\
| * Fix headerpippo29312016-03-121-1/+1
| * GetArchiveResource stubpippo29312016-03-121-1/+25
* | core/video_core: Make NumIds functions constexprLioncash2016-03-172-2/+2
* | core/video_core: Don't cast away const in subscript operatorsLioncash2016-03-172-6/+6
* | Reorganize the ndm service path for dummy implement functionJamePeng2016-03-146-26/+122
* | hid: fix pad updatewwylele2016-03-131-1/+1
* | svc: Move ResetType enum to the kernel event headerLioncash2016-03-1310-16/+17
* | svc: Remove unused ArbitrationType enumLioncash2016-03-121-9/+0
* | svc: Make ResetType an enum classLioncash2016-03-1211-24/+23
|/
* Merge pull request #1266 from Subv/miiappletbunnei2016-03-127-2/+156
|\
| * HLE/Applets: Implemented a dummy Mii Selector applet.Subv2016-03-127-2/+156
* | Merge pull request #1500 from lioncash/nullptrbunnei2016-03-121-1/+1
|\ \
| * | gsp_gpu: Change 0 literal to nullptrLioncash2016-03-121-1/+1
* | | hle: Update service function tablesLioncash2016-03-124-1/+16
|/ /
* | Fix missing returnLittleWhite2016-03-091-0/+2
* | Merge pull request #1474 from lioncash/rendererbunnei2016-03-093-10/+10
|\ \
| * | renderer_base: Don't directly expose the rasterizer unique_ptrLioncash2016-03-093-10/+10
* | | Merge pull request #1344 from LittleWhite-tb/error-outputbunnei2016-03-095-9/+17
|\ \ \ | |/ / |/| |
| * | Improve error report from Init() functionsLittleWhite2016-03-085-7/+14
| * | Display errors in GUI when loading ROM failedLittleWhite2016-03-031-2/+3
* | | DSP: Implement Pipe 2MerryMage2016-03-061-43/+151
* | | Memory: Do correct Phys->Virt address translation for non-APP linheapYuri Kunde Schlesner2016-03-063-3/+6
* | | Merge pull request #1455 from yuriks/ResultVal-unionMathew Maidment2016-03-061-42/+16
|\ \ \
| * | | core: Use unrestricted union to hold storage of ResultVal valueYuri Kunde Schlesner2016-03-051-42/+16
* | | | DSP: Print hash of firmware to consoleMerryMage2016-03-061-8/+21
* | | | Loader/NCCH: Log the program ID during loadingYuri Kunde Schlesner2016-03-051-1/+2
|/ / /
* | | Merge pull request #1429 from mailwl/branch-acubunnei2016-03-051-2/+17
|\ \ \
| * | | ac:u: Stub IsConnectedmailwl2016-03-041-2/+17
| |/ /
* | | Merge pull request #1389 from yuriks/stub-cambunnei2016-03-043-20/+563
|\ \ \ | |/ / |/| |
| * | Service/CAM: Add doxycomments to all service functionsYuri Kunde Schlesner2016-03-011-0/+217
| * | Service/CAM: Dummy implementation of some functionsYuri Kunde Schlesner2016-02-133-20/+346
* | | Merge pull request #1434 from Kloen/legendbunnei2016-03-021-0/+1
|\ \ \
| * | | ThreadProcessorId_All on SVC::CreateThreadKloen2016-03-011-0/+1
* | | | Merge pull request #1297 from Subv/savesbunnei2016-03-011-2/+4
|\ \ \ \
| * | | | DiskDirectory: Initialize the directory member with valid info.Subv2016-01-161-2/+4
* | | | | Service/CFG: Fix potential endianess issueYuri Kunde Schlesner2016-03-011-2/+3
* | | | | Service/CFG: Add block 0x000A0000 (username) to default config fileYuri Kunde Schlesner2016-03-011-1/+14
| |/ / / |/| | |
* | | | Initial implementation ir:usermailwl2016-02-263-18/+142
* | | | AudioCore: Skeleton ImplementationMerryMage2016-02-215-66/+99
* | | | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-128-28/+28
| |/ / |/| |
* | | services: Get rid of unnecessary includesLioncash2016-02-0269-132/+32
* | | services: Update function tablesLioncash2016-02-022-5/+11
* | | Merge pull request #1377 from MerryMage/mmiobunnei2016-01-316-13/+127
|\ \ \
| * | | Memory: Implement MMIOMerryMage2016-01-306-13/+127
| |/ /
* | | elf: Don't cast away constLioncash2016-01-251-3/+3
* | | archive_backend: Remove unnecessary const from return typesLioncash2016-01-252-8/+8
* | | ARM_Disasm::DisassembleMemHalf: actually use width in determining opcode namerob turner2016-01-191-9/+9
|/ /
* | Merge pull request #1327 from Subv/unmap_memblockbunnei2016-01-155-5/+60
|\ \
| * | HLE/SVC: Implement UnmapMemoryBlock.Subv2016-01-145-5/+60
* | | Merge pull request #1283 from Subv/soc_fixupbunnei2016-01-051-3/+13
|\ \ \
| * | | HLE/Sockets: Fixed the buffer offset in recvfrom.Subv2015-12-241-3/+13
* | | | Merge pull request #1310 from lioncash/servicesbunnei2015-12-3125-113/+369
|\ \ \ \
| * | | | services: Update some function tablesLioncash2015-12-3025-113/+369
| | |/ / | |/| |
* / | | arm_dyncom_dec: Fix decoding of VMLSLioncash2015-12-302-206/+202
|/ / /
* | | Merge pull request #1306 from Subv/syncbunnei2015-12-301-3/+3
|\ \ \
| * | | HLE/Timers: Reset OneShot timers when they are acquired instead of when they're triggered.Subv2015-12-301-3/+3
* | | | core: Use unique_ptr for holding the interpreter instancesLioncash2015-12-302-8/+12
|/ / /
* | | Merge pull request #1300 from Subv/arbitrateaddressbunnei2015-12-292-9/+18
|\ \ \
| * | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.Subv2015-12-282-9/+18
* | | | dyncom: Handle modifying the APSR via an MRC instructionLioncash2015-12-281-12/+9
* | | | svc: Remove superfluous printf argumentLioncash2015-12-251-1/+1
|/ / /
* | | dyncom: Remove PC dispatch from several instructionsLioncash2015-12-211-94/+0
* | | dyncom: Handle unprivileged load/store variants correctlyLioncash2015-12-201-7/+33
* | | svc: Fix compilation with LOG_TRACE enabledLioncash2015-12-131-1/+1
|/ /
* | Merge pull request #1272 from yuriks/merge-rasterizerYuri Kunde Schlesner2015-12-083-11/+11
|\ \
| * | VideoCore: Unify interface to OpenGL and SW rasterizersYuri Kunde Schlesner2015-12-083-11/+11
| * | VideoCore: Rename HWRasterizer methods to be less confusingYuri Kunde Schlesner2015-12-073-10/+10
* | | dyncom: Remove static keyword from header functionsLioncash2015-12-063-19/+19
* | | arm_interface: Make GetNumInstructions constLioncash2015-12-061-1/+1
* | | arm_interface: directly initialize class membersLioncash2015-12-061-7/+2
* | | dyncom: const correctness changesLioncash2015-12-063-7/+7
|/ /
* | Merge pull request #1252 from Subv/cambunnei2015-12-041-0/+156
|\ \ | |/ |/|
| * Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-231-0/+156
* | Kernel: Implement svcGetSystemInfoYuri Kunde Schlesner2015-12-017-1/+95
* | armstate: Zero out the registers on creationLioncash2015-11-291-11/+11
* | Core/ARM11: Correct the size of the VFP register array in the ThreadContext structure.Subv2015-11-291-1/+1
* | Merge pull request #1225 from lioncash/cleanbunnei2015-11-291-12/+13
|\ \
| * | csnd_snd: Get rid of type punningLioncash2015-10-281-12/+13
* | | Merge pull request #1248 from polaris-/add-ssl-stubsbunnei2015-11-241-2/+51
|\ \ \ | |_|/ |/| |
| * | Add stub functions for Initialize and GenerateRandomData in ssl:Cpolaris-2015-11-221-2/+51
* | | Merge pull request #1246 from polaris-/patch-1bunnei2015-11-221-26/+31
|\ \ \ | |/ / |/| |
| * | Fix read and write register blocks in gdbstubpolaris-2015-11-221-26/+31
* | | Add Initialize and GenerateRandomData stubspolaris-2015-11-221-0/+2
|/ /
* | Merge pull request #1122 from polaris-/gdbstubbunnei2015-11-129-9/+1145
|\ \ | |/ |/|
| * Fix bug with reading addresses and lengthspolaris-2015-11-041-45/+55
| * Change headerspolaris-2015-10-291-2/+2
| * Add some headers so TravisCI will hopefully workpolaris-2015-10-221-0/+2
| * Use CHAR_BIT instead of 8polaris-2015-10-221-11/+11
| * Handle changes pointed out in comments on PRpolaris-2015-10-221-61/+34
| * Add a register variable to loopspolaris-2015-10-211-6/+9
| * Update register read loops to go with last commitpolaris-2015-10-211-6/+7
| * Pad responses to gdb for VFP registerspolaris-2015-10-211-0/+3
| * Try to add support for VFP registerspolaris-2015-10-211-4/+21
| * Fix buffer overflow commentspolaris-2015-10-211-2/+3
| * Remove unnecessary new lines, changed Deinit to Shutdownpolaris-2015-10-124-10/+7
| * Use BreakpointAddress struct instead of passing address directlypolaris-2015-10-043-8/+18
| * Implement gdbstubpolaris-2015-10-049-9/+1128
* | Merge pull request #1165 from esoteric-programmer/masterbunnei2015-10-282-4/+66
|\ \
| * | Added CSND stub.Matthias Ernst2015-10-282-4/+66
* | | Merge pull request #1208 from archshift/free-bytesbunnei2015-10-288-1/+60
|\ \ \
| * | | Implement FS_User::GetFreeBytesarchshift2015-10-288-1/+60
* | | | Fix copy pasteFiliph Sandström2015-10-241-1/+1
* | | | Fix wrong branchFiliph Sandström2015-10-231-0/+12
* | | | Add GetTotalStepCount StubFiliph Sandström2015-10-231-1/+1
* | | | Update ptm.hFiliph Sandström2015-10-231-0/+8
* | | | Merge pull request #1199 from Gareth422/encryption-checkbunnei2015-10-203-20/+25
|\ \ \ \ | |/ / / |/| | |
| * | | Loader: Change NCCH header types to be explicitly little-endianGareth Poole2015-10-112-18/+17
| * | | Loader: Implement encryption checkGareth Poole2015-10-113-2/+8
* | | | Merge pull request #1194 from linkmauve/no-newlinebunnei2015-10-104-47/+47
|\ \ \ \ | |/ / / |/| | |
| * | | CitraQt, SkyEye, Loader, VideoCore: Remove newlines in LOG_* calls.Emmanuel Gil Peyrot2015-10-094-47/+47
* | | | Fixed spelling errorsGareth Poole2015-10-091-2/+2
|/ / /
* | / Silence -Wsign-compare warnings.Rohit Nirmal2015-10-072-2/+2
| |/ |/|
* | Merge pull request #1095 from archshift/game-listbunnei2015-10-022-13/+41
|\ \
| * | Expose loader helper functions for identifying files.archshift2015-10-012-13/+41
* | | Merge pull request #1177 from linkmauve/fix-msvc-todobunnei2015-09-301-4/+3
|\ \ \
| * | | Service/CFG: Use a constexpr function for country initializationEmmanuel Gil Peyrot2015-09-301-4/+3
* | | | ivfc_archive: Fix a printf specifierLioncash2015-09-301-1/+1
|/ / /
* | | fix some xcode 7.0 warningsMartin Lindhe2015-09-292-4/+4
* | | Merge pull request #1160 from lioncash/clangbunnei2015-09-228-16/+18
|\ \ \
| * | | general: Silence some warnings when using clangLioncash2015-09-168-16/+18
| | |/ | |/|
* / | Implement 3dsx RomFSCruel2015-09-213-3/+61
|/ /
* | Service/CFG: Add default entry for block 0x000A0001 (birthday)Yuri Kunde Schlesner2015-09-141-0/+6
* | Service/CFG: Correct flags in 2 default blocksYuri Kunde Schlesner2015-09-141-2/+2
* | Service/CFG: Add additional blocks to default save dataYuri Kunde Schlesner2015-09-141-0/+34
* | Fix narrowing conversion warningYuri Kunde Schlesner2015-09-141-1/+1
* | Service/CFG: Move several private types from the header to the cppYuri Kunde Schlesner2015-09-142-63/+49
* | Service/CFG: Clean up default block creationYuri Kunde Schlesner2015-09-142-27/+17
|/
* GSP: Implement command 0x05, used for flushing cachesYuri Kunde Schlesner2015-09-142-13/+34
* general: Replace 0 literals with nullptr where applicableLioncash2015-09-121-1/+1
* General: Replace NULL and '0' usages with nullptr where applicableLioncash2015-09-114-31/+31
* Merge pull request #1130 from lioncash/blockYuri Kunde Schlesner2015-09-101-14/+7
|\
| * memory: Get rid of pointer castsLioncash2015-09-101-14/+7
* | General: Fix up doxygen commentsLioncash2015-09-107-11/+9
* | Merge pull request #1131 from lioncash/uninitYuri Kunde Schlesner2015-09-101-3/+6
|\ \
| * | y2r: Give local variables an initial valueLioncash2015-09-101-3/+6
| |/
* / disk_archive: Remove unimplemented constructor declarationsLioncash2015-09-101-2/+0
|/
* DynCom: Converted all 0xE condition code checks to ConditionCode::ALarchshift2015-09-062-132/+132
* Merge pull request #1101 from archshift/camu-service-namesbunnei2015-09-031-3/+60
|\
| * Add cam:u service function names to its function tablearchshift2015-09-031-3/+60
* | Merge pull request #1072 from yuriks/GetSystemTick-advance-timebunnei2015-09-011-1/+4
|\ \ | |/ |/|
| * SVC: Advance time when calling GetSystemTick to escape busy-wait loopsYuri Kunde Schlesner2015-08-301-1/+4
* | Merge pull request #1085 from Subv/fs_statbunnei2015-08-301-1/+1
|\ \
| * | Services/FS: Correctly tell the guest app whether a file was correctly opened or not.Subv2015-08-291-1/+1
* | | Kernel: Fix wrong linear heap base on titles using newer kernelsYuri Kunde Schlesner2015-08-281-1/+1
* | | Kernel: Fix assertion failure when ControlMemory is called with size=0Yuri Kunde Schlesner2015-08-271-0/+8
* | | Core: Improve APT Shared Font hackYuri Kunde Schlesner2015-08-273-4/+29
* | | dyncom: Simplify some comparisons in CondPassedLioncash2015-08-261-4/+4
* | | dyncom: Change return type of CondPassed to boolLioncash2015-08-261-57/+39
| |/ |/|
* | Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-254-0/+24
* | Fix broken boot introduced by last-minute change in #1025Yuri Kunde Schlesner2015-08-221-1/+1
* | Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-2228-308/+722
|\ \
| * | Kernel: Remove unused legacy heap MapBlock_* functionsYuri Kunde Schlesner2015-08-163-78/+0
| * | APT: Adjust shared font hack so it works with the new linear heap codeYuri Kunde Schlesner2015-08-161-10/+11
| * | Kernel: Implement svcGetProcessInfo in a basic wayYuri Kunde Schlesner2015-08-166-3/+73
| * | Kernel: Add more infrastructure to support different memory layoutsYuri Kunde Schlesner2015-08-1610-28/+148
| * | HLE: Remove empty ConfigMem and SharedPage Shutdown functionsYuri Kunde Schlesner2015-08-165-10/+0
| * | Move core/mem_map.{cpp,h} => core/hle/kernel/memory.{cpp,h}Yuri Kunde Schlesner2015-08-166-6/+5
| * | Memory: Move address type conversion routines to memory.cpp/hYuri Kunde Schlesner2015-08-169-53/+47
| * | Process: Store kernel compatibility version during loadingYuri Kunde Schlesner2015-08-162-3/+7
| * | Kernel: Properly implement ControlMemory FREE and COMMITYuri Kunde Schlesner2015-08-166-38/+338
| * | Memory: Move PAGE_MASK and PAGE_BITS to memory.hYuri Kunde Schlesner2015-08-162-3/+2
| * | VMManager: Introduce names for used ResultCodesYuri Kunde Schlesner2015-08-162-6/+11
| * | VMManager: Make LogLayout log level configurable as a parameterYuri Kunde Schlesner2015-08-163-5/+15
| * | VMManager: Change block offsets to size_tYuri Kunde Schlesner2015-08-162-3/+3
* | | Merge pull request #996 from yuriks/texture-copyYuri Kunde Schlesner2015-08-194-36/+101
|\ \ \ | |_|/ |/| |
| * | GPU: Implement TextureCopy-mode display transfersYuri Kunde Schlesner2015-08-164-36/+101
| |/
* | Merge pull request #1033 from bbarenblat/masterYuri Kunde Schlesner2015-08-161-0/+6
|\ \
| * | Properly indicate that CIA support is not implemented yetBenjamin Barenblat2015-08-151-0/+4
| * | Give CIA file type a nameBenjamin Barenblat2015-08-151-0/+2
* | | Merge pull request #1032 from lioncash/swapbunnei2015-08-162-12/+6
|\ \ \ | |_|/ |/| |
| * | vfp: use std::swap where applicableLioncash2015-08-162-12/+6
| |/
* / Shader: Initial implementation of x86_x64 JIT compiler for Pica vertex shaders.bunnei2015-08-161-0/+1
|/
* Merge pull request #1027 from lioncash/debuggerbunnei2015-08-144-1/+49
|\
| * arm_interface: Implement interface for retrieving VFP registersLioncash2015-08-074-1/+49
* | ARM Core, Video Core, CitraQt, Citrace: Use CommonTypes types instead of the standard u?int*_t types.Emmanuel Gil Peyrot2015-08-115-340/+345
* | arm_disasm: ARMv6 mul/div and abs media instructionsaroulin2015-08-112-1/+119
* | arm_disasm: ARMv6 parallel add/sub media instructionsaroulin2015-08-112-0/+167
* | arm_disasm: ARMv6 reversal media instructionsaroulin2015-08-092-0/+26
* | arm_disasm: ARMv6 saturation media instructionsaroulin2015-08-092-2/+55
* | arm_disasm: ARMv6 packing and sign-extend media instructionsaroulin2015-08-092-1/+181
* | Merge pull request #1026 from lioncash/disasmLioncash2015-08-071-12/+4
|\ \ | |/ |/|
| * arm_disasm: Remove unnecessary codeLioncash2015-08-071-12/+4
* | Disassembler: ARMv6K REX instructionsaroulin2015-08-062-6/+97
* | Disassembler: ARMv6K hint instructionsaroulin2015-08-062-0/+56
* | Merge pull request #1008 from lioncash/pcbunnei2015-07-302-21/+40
|\ \
| * | dyncom: Handle the case where PC is the source register for STR/VSTM/VLDMLioncash2015-07-292-21/+40
| |/
* | Merge pull request #1014 from lioncash/unused-warnbunnei2015-07-292-3/+5
|\ \
| * | core: Eliminate some unused variable warningsLioncash2015-07-292-3/+5
* | | Merge pull request #1013 from lioncash/unusedYuri Kunde Schlesner2015-07-291-3/+0
|\ \ \ | |/ / |/| |
| * | dyncom: Remove an unused variableLioncash2015-07-291-3/+0
* | | core: Fix missing prototype warningsLioncash2015-07-292-0/+2
|/ /
* | Merge pull request #1009 from lioncash/tableYuri Kunde Schlesner2015-07-291-1/+2
|\ \
| * | am_net: Add missing function to the function tableLioncash2015-07-291-0/+1
| * | am_net: Add correct function name to the function tableLioncash2015-07-291-1/+1
| |/
* | Merge pull request #982 from Subv/homebunnei2015-07-297-18/+84
|\ \ | |/ |/|
| * Service/APT: Fixed a regression, PreloadLibraryApplet should also start an applet when called.Subv2015-07-246-5/+36
| * Service/APT: Return proper parameters in GetLockHandle.Subv2015-07-244-14/+49
* | dyncom: Handle left-operand PC correctly for data-processing opsLioncash2015-07-291-7/+33
* | Merge pull request #899 from zawata/Winsock-Deprecationbunnei2015-07-281-2/+8
|\ \
| * | SOC:U : Update deprecated function gethostbyname() to getaddrinfo()zawata2015-07-201-2/+8
* | | Merge pull request #1003 from lioncash/armcruftbunnei2015-07-286-124/+91
|\ \ \
| * | | dyncom: Remove an unnecessary typedefLioncash2015-07-282-7/+5
| * | | dyncom: Use enum class for instruction decoding resultsLioncash2015-07-285-41/+40
| * | | dyncom: Remove code duplication regarding thumb instructionsLioncash2015-07-283-23/+12
| * | | dyncom: Migrate exclusive memory access control into armstateLioncash2015-07-282-50/+35
| * | | dyncom: Remove duplicated typedef and externLioncash2015-07-281-4/+0
* | | | Merge pull request #873 from jroweboy/input_arrayTony Wasserka2015-07-283-24/+45
|\ \ \ \ | |/ / / |/| | |
| * | | Move input values into an arrayJames Rowe2015-07-283-24/+45
* | | | dyncom: Use std::array for register arraysLioncash2015-07-262-28/+29
* | | | dyncom: Use ARMul_State as an objectLioncash2015-07-2612-1105/+1023
* | | | dyncom: Remove unnecessary initialization code.Lioncash2015-07-264-59/+2
* | | | dyncom: Remove unnecessary abort-related cruftLioncash2015-07-262-48/+1
* | | | dyncom: Rename armdefs.h to armstate.hLioncash2015-07-2615-33/+33
* | | | dyncom: Get rid of skyeye typedefsLioncash2015-07-267-61/+55
* | | | dyncom: Move helper functions to their own headerLioncash2015-07-2610-41/+57
* | | | dyncom: Move arminit.cpp and armsupp.cpp into skyeye_commonLioncash2015-07-263-2/+2
|/ / /
* | | Merge pull request #989 from lioncash/externYuri Kunde Schlesner2015-07-261-25/+25
|\ \ \
| * | | armdefs: Remove unnecessary extern keywordsLioncash2015-07-261-25/+25
* | | | loader: Remove unnecessary else usagesLioncash2015-07-261-9/+9
|/ / /
* | | Merge pull request #888 from zawata/Warning-Fixes-2Yuri Kunde Schlesner2015-07-252-3/+3
|\ \ \
| * | | Core\HLE : Fix Warningzawata2015-07-172-3/+3
| |/ /
* | | Merge pull request #892 from zawata/another-warning-fixesYuri Kunde Schlesner2015-07-252-2/+2
|\ \ \
| * | | Core : Change variable typezawata2015-07-191-1/+1
| * | | Core : Fix Conversion Warningszawata2015-07-191-1/+1
* | | | Merge pull request #983 from yuriks/null-memory-fillYuri Kunde Schlesner2015-07-241-13/+18
|\ \ \ \
| * | | | GSP: Don't try to write memory fill registers if start address is 0Yuri Kunde Schlesner2015-07-241-13/+18
| | |_|/ | |/| |
* / | | Qt/GPU Breakpoints: Added three more breakpoint types:Subv2015-07-232-0/+11
|/ / /
* | | Merge pull request #962 from Subv/am_appbunnei2015-07-223-3/+33
|\ \ \
| * | | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.Subv2015-07-213-3/+33
* | | | Merge pull request #966 from Subv/logbunnei2015-07-211-4/+8
|\ \ \ \
| * | | | Services/Logging: Log more useful information when some operations fail.Subv2015-07-211-4/+8
| |/ / /
* | | | Merge pull request #957 from Subv/hwtest_crashbunnei2015-07-211-0/+8
|\ \ \ \
| * | | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.Subv2015-07-211-0/+8
| |/ / /
* | | | dyncom: Pass SVC immediates directly.Lioncash2015-07-213-6/+6
* | | | Services/CFG: Added some missing functions to cfg:sSubv2015-07-211-1/+3
|/ / /
* | | Merge pull request #939 from Subv/queryprocmembunnei2015-07-202-6/+28
|\ \ \
| * | | Kernel/SVC: Implemented svcQueryProcessMemorySubv2015-07-172-6/+28
* | | | Merge pull request #951 from Subv/bit5bunnei2015-07-202-12/+31
|\ \ \ \
| * | | | GPU/DisplayTransfer: Implemented bit 5 in the transfer flags.Subv2015-07-202-12/+31
* | | | | Merge pull request #946 from archshift/update-frdubunnei2015-07-201-1/+12
|\ \ \ \ \
| * | | | | Add more frd:u unknown service commands from 3dbrewarchshift2015-07-191-1/+12
| | |_|/ / | |/| | |
* | | | | dyncom: Properly retrieve the PC value in BX if used.Lioncash2015-07-201-3/+5
| |/ / / |/| | |
* | | | Change trace/unimplemented service call logs to use hexarchshift2015-07-191-1/+1
|/ / /
* / / Dyncom: Support for a missing ARMv6 Thumb MOV encodingYuri Kunde Schlesner2015-07-181-10/+4
|/ /
* | Merge pull request #938 from Subv/querymemYuri Kunde Schlesner2015-07-172-4/+24
|\ \
| * | Kernel/SVC: Implemented svcQueryMemory.Subv2015-07-172-4/+24
* | | Merge pull request #937 from yuriks/codeset-leakbunnei2015-07-1712-8/+45
|\ \ \ | |/ / |/| |
| * | Ensure all kernel objects are released during shutdownYuri Kunde Schlesner2015-07-1712-8/+45
* | | arm_dyncom_interpreter: Simplify assignment in SMLAWLioncash2015-07-171-1/+1
|/ /
* | Merge pull request #918 from yuriks/romfsbunnei2015-07-1717-97/+111
|\ \
| * | Loader: Fix variable type and remove unused variableYuri Kunde Schlesner2015-07-141-2/+1
| * | Archive: Correct a few incorrect types in function signaturesYuri Kunde Schlesner2015-07-146-22/+22
| * | Loader: Remove unnecessary pointer indirection to IOFileYuri Kunde Schlesner2015-07-1410-50/+50
| * | FS: Stream RomFS from file instead of loading all of it to memorycondut2015-07-149-32/+47
* | | Merge pull request #904 from aroulin/y2r-narrowing-warningarchshift2015-07-141-1/+1
|\ \ \ | |/ / |/| |
| * | Y2R: Fix narrowing warningaroulin2015-07-121-1/+1
* | | CiTrace: Clean up initialization method.Tony Wasserka2015-07-132-70/+46
* | | CiTrace: Record default vertex attributes.Tony Wasserka2015-07-134-43/+57
* | | Add CiTrace recording support.Tony Wasserka2015-07-137-1/+419
* | | GPU: Be robust against nullptr addresses; properly reset busy bits in the trigger registers.Tony Wasserka2015-07-131-27/+34
* | | HW: Fix a stupid issue which led to unknown register reads/writes.Tony Wasserka2015-07-131-0/+30
* | | Merge pull request #921 from linkmauve/fix-appletbunnei2015-07-127-7/+32
|\ \ \
| * | | Core: Fix applet includes using iwyu.Emmanuel Gil Peyrot2015-07-127-7/+32
| |/ /
* / / Kernel: Add CodeSet case to Object::IsWaitableYuri Kunde Schlesner2015-07-121-0/+1
|/ /
* | Merge pull request #823 from Subv/applets_drawingbunnei2015-07-1211-58/+567
|\ \
| * | Applets: Reworked how the Applet update event is handled.Subv2015-07-127-35/+61
| * | Applets: Add infrastructure to allow custom drawing and input handling in Applets.Subv2015-07-127-39/+162
| * | HLE/APT: Initial HLE support for applets.Subv2015-07-129-50/+410
* | | Core: Properly configure address space when loading a binaryYuri Kunde Schlesner2015-07-1211-52/+223
* | | Memory: Fix unmapping of pagesYuri Kunde Schlesner2015-07-121-4/+2
* | | Loader: Clean up 3dsx loader a bit, fixing a potential buffer overrunYuri Kunde Schlesner2015-07-121-13/+16
* | | Loader: Make 3dsx loader logs a bit less confusingYuri Kunde Schlesner2015-07-121-6/+3
* | | Kernel: Remove unused member from EventYuri Kunde Schlesner2015-07-122-2/+1
|/ /
* | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-1159-120/+203
|\ \
| * | Core: Cleanup hw includes.Emmanuel Gil Peyrot2015-06-288-7/+18
| * | Core: Cleanup soc:U includes.Emmanuel Gil Peyrot2015-06-282-26/+36
| * | Core, VideoCore: Replace or fix exit() calls.Emmanuel Gil Peyrot2015-06-282-4/+6
| * | Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-2821-38/+72
| * | Core: Cleanup core includes.Emmanuel Gil Peyrot2015-06-288-14/+14
| * | CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-288-4/+17
| * | Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-2810-16/+22
| * | Common: Cleanup memory and misc includes.Emmanuel Gil Peyrot2015-06-283-3/+4
| * | Common: Fix FileUtil includes, and everything relying on those.Emmanuel Gil Peyrot2015-06-287-0/+7
| * | Services: Use the standard _WIN32 define in soc:U instead of our own EMU_PLATFORM.Emmanuel Gil Peyrot2015-06-271-8/+7
| |/
* | Loader: Remove log line causing warningaroulin2015-07-081-1/+0
* | Merge pull request #797 from linkmauve/blended-downscalingbunnei2015-07-061-33/+46
|\ \
| * | GPU: Implement blended downscaling for display transfers.Emmanuel Gil Peyrot2015-06-281-27/+40
| * | GPU: Use shifts instead of multiplications to calculate the actual size of the output.Emmanuel Gil Peyrot2015-06-281-6/+6
| |/
* | Merge pull request #885 from Subv/ipc_headersbunnei2015-07-061-5/+13
|\ \
| * | Services/SOC: Added command headers to some of the soc commands.Subv2015-06-251-5/+13
| |/
* | vfp: Change return type of VFPInit from unsigned int to void.Lioncash2015-06-292-4/+2
* | vfp: Handle accesses to FPINST/FPINST2 system registersLioncash2015-06-294-42/+53
|/
* Add helpers to create IPC command buffer headers and descriptorsYuri Kunde Schlesner2015-06-233-7/+43
* Merge pull request #860 from yuriks/y2r-colorYuri Kunde Schlesner2015-06-225-174/+734
|\
| * Y2R: Rework conversion process, enabling support for all formatsYuri Kunde Schlesner2015-06-225-163/+695
| * Y2R: Re-organize how params are stored. Support SetConversionParamsYuri Kunde Schlesner2015-06-211-72/+100
* | Merge pull request #855 from purpasmart96/service_rearrangmentbunnei2015-06-2173-635/+1186
|\ \ | |/ |/|
| * Services: Continue separation of services into their own folderspurpasmart962015-06-1273-635/+1186
* | kernel: Fix svcWaitSynch to always acquire requested wait objects.bunnei2015-06-179-113/+68
* | Merge pull request #866 from lioncash/typoLioncash2015-06-161-1/+1
|\ \
| * | hw: Fix mismatched Write callLioncash2015-06-161-1/+1
| |/
* | vfp: Handle accesses to the VFP media feature registersLioncash2015-06-133-4/+8
* | vfp: Implement VMOVBCR/VMOVBRCLioncash2015-06-122-5/+8
|/
* arm_dyncom_thumb: Fix handling of writeback for thumb LDMIALioncash2015-06-041-5/+19
* ExtSavedata: Save the icon passed to CreateExtSaveData to the correct folder.Subv2015-06-024-14/+38
* Merge pull request #838 from lioncash/thumbLioncash2015-06-011-3/+40
|\
| * arm_dyncom_thumb: Fix encoding of BKPT's immediateLioncash2015-06-011-1/+4
| * arm_dyncom_thumb: Implement CPS and SETENDLioncash2015-06-011-0/+13
| * arm_dyncom_thumb: Implement SXTH, SXTB, UXTH, and UXTB.Lioncash2015-06-011-0/+11
| * arm_dyncom_thumb: Implement REV, REV16, and REVSH.Lioncash2015-06-011-2/+12
* | Merge pull request #811 from archshift/commonifyarchshift2015-05-311-1/+1
|\ \
| * | Move video_core/color.h to common/color.harchshift2015-05-301-1/+1
| |/
* | Merge pull request #832 from yuriks/refresh-rate-optionbunnei2015-05-312-4/+2
|\ \ | |/ |/|
| * Remove gpu_refresh_rate configuration optionYuri Kunde Schlesner2015-05-302-4/+2
* | Merge pull request #810 from yuriks/memmapYuri Kunde Schlesner2015-05-307-38/+491
|\ \
| * | Memmap: Remove unused global pointers to memory areasYuri Kunde Schlesner2015-05-272-31/+8
| * | Kernel: Add VMManager to manage process address spacesYuri Kunde Schlesner2015-05-276-16/+492
* | | Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-2938-105/+105
| |/ |/|
* | hid: Get rid of undefined behaviorLioncash2015-05-271-2/+2
|/
* Merge pull request #826 from lioncash/tablesYuri Kunde Schlesner2015-05-271-22/+11
|\
| * arm_dyncom_thumb: Merge STR/LDR table subsets.Lioncash2015-05-271-22/+11
* | Merge pull request #825 from lioncash/dyncLioncash2015-05-271-6/+1
|\ \
| * | arm_dyncom_interpreter: Remove unused variableLioncash2015-05-261-5/+1
| * | arm_dyncom_interpreter: Remove unused macroLioncash2015-05-251-1/+0
| |/
* | Merge pull request #821 from Subv/ImportDisplayCaptureInfobunnei2015-05-261-1/+47
|\ \
| * | Service/GSP: Implemented ImportDisplayCaptureInfo.Subv2015-05-261-1/+47
| |/
* / Core/SVC: Map the shared memory created in CreateMemoryBlock to the specified address.Subv2015-05-251-0/+2
|/
* dyncom: Get rid of armemu.hLioncash2015-05-245-50/+29
* y2r_u: Remove unused variable in StartConversionLioncash2015-05-231-1/+0
* dyncom: Remove unused cpu parameter from decode_thumb_instrLioncash2015-05-231-3/+2
* dyncom: remove load_r15 from arm_instLioncash2015-05-232-490/+331
* dyncom: Remove unnecessary parameter for load/store operationsLioncash2015-05-231-39/+39
* Merge pull request #801 from purpasmart96/hid_stubsbunnei2015-05-234-9/+47
|\
| * HID: Stub DisableAccelerometer and DisableGyroscopeLowpurpasmart962015-05-234-9/+47
* | Merge pull request #802 from bunnei/vfp-trace-logLioncash2015-05-231-23/+23
|\ \
| * | VFP: Log as trace to get rid of spamming.bunnei2015-05-231-23/+23
| |/
* | Flush for y2r (moflex)tfarley2015-05-231-0/+11
* | OpenGL renderertfarley2015-05-232-3/+22
* | INI hw/sw renderer toggletfarley2015-05-221-0/+2
|/
* Merge pull request #798 from yuriks/y2r-bwYuri Kunde Schlesner2015-05-221-35/+265
|\
| * Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-221-35/+265
* | dyncom: Eliminate clang warningsLioncash2015-05-214-406/+404
|/
* Kernel: Fix a warning introduced with ResourceLimit, and remove the fallback code to prevent it from happening again.Emmanuel Gil Peyrot2015-05-211-2/+1
* y2r_u: Stub StartConversion to prevent moflex games from hanging.bunnei2015-05-211-1/+17
* Kernel: Move reschedules from SVCs to actual mechanisms that reschedule.bunnei2015-05-217-20/+22
* Merge pull request #766 from purpasmart96/cfg_service_updatebunnei2015-05-185-337/+304
|\
| * CFG: Update the cfg service to be like other integrated servicespurpasmart962015-05-165-337/+304
* | Merge pull request #772 from lioncash/warnbunnei2015-05-183-9/+9
|\ \
| * | vfp: Get rid of warningsLioncash2015-05-142-6/+6
| * | process: Get rid of warningsLioncash2015-05-141-3/+3
* | | Implement svcBreakarchshift2015-05-172-1/+17
* | | Merge pull request #781 from archshift/deletebunnei2015-05-161-33/+0
|\ \ \
| * | | Delete unused hle/coprocessor.cpparchshift2015-05-161-33/+0
* | | | APT/FS: Remove asserts that were causing false positivespurpasmart962015-05-162-5/+5
|/ / /
* | | Merge pull request #774 from lioncash/decodingsYuri Kunde Schlesner2015-05-152-33/+191
|\ \ \
| * | | dyncom: Add ARMv6K NOP and hint instructions to the decoding tableLioncash2015-05-142-12/+152
| * | | dyncom: Handle some MSR variants individuallyLioncash2015-05-142-24/+41
| * | | dyncom: Move exclusive load/stores above bbl and swi in the decoding tableLioncash2015-05-142-14/+15
| |/ /
* | | Merge pull request #770 from lioncash/dyncom_cleanbunnei2015-05-152-275/+260
|\ \ \
| * | | dyncom: Remove duplicate enums/prototypesLioncash2015-05-141-7/+1
| * | | dyncom: Remove unnecessary definesLioncash2015-05-141-4/+4
| * | | dyncom: Make translation-unit functions and variables staticLioncash2015-05-141-66/+64
| * | | dyncom: Remove unnecessary typedefsLioncash2015-05-142-196/+197
| * | | dyncom: Remove unused structsLioncash2015-05-141-8/+0
| |/ /
* | | Core/ResourceLimits: Implemented the basic structure of ResourceLimits.Subv2015-05-1512-14/+341
* | | Memory: Use a table based lookup scheme to read from memory regionsYuri Kunde Schlesner2015-05-155-128/+174
* | | Memory: Read SharedPage directly from Memory::ReadYuri Kunde Schlesner2015-05-153-59/+37
* | | Memory: Read ConfigMem directly from Memory::ReadYuri Kunde Schlesner2015-05-153-50/+38
* | | Memmap: Re-organize memory function in two filesYuri Kunde Schlesner2015-05-1526-257/+247
* | | Memmap: Remove unused declarationsYuri Kunde Schlesner2015-05-152-20/+3
* | | thread: Fix a conditional check in RescheduleLioncash2015-05-141-1/+1
|/ /
* | dyncom: Removed irrelevant log.bunnei2015-05-141-2/+0
* | dyncom: Fix decoding of BKPT's immediateLioncash2015-05-131-1/+1
|/
* Merge pull request #756 from purpasmart96/ptm_service_changesbunnei2015-05-135-125/+112
|\
| * PTM: Changed the way the ptm services are handled to be like thepurpasmart962015-05-125-125/+112
* | Merge pull request #748 from Subv/tls_maxbunnei2015-05-124-10/+24
|\ \
| * | Core/Memory: Add TLS support for creating up to 300 threadsSubv2015-05-124-10/+24
* | | Merge pull request #751 from yuriks/idle-threadbunnei2015-05-123-46/+21
|\ \ \
| * | | Thread: Remove the idle threadYuri Kunde Schlesner2015-05-123-46/+21
* | | | Merge pull request #757 from Subv/schedulingbunnei2015-05-121-0/+2
|\ \ \ \
| * | | | Core/Scheduling: Prepare the new priority in the thread queue when svcSetPriority is calledSubv2015-05-121-0/+2
| |/ / /
* | | | Merge pull request #752 from lioncash/flushbunnei2015-05-123-84/+98
|\ \ \ \
| * | | | vfp: Handle flush-to-zero mode.Lioncash2015-05-113-84/+98
| |/ / /
* | | | Merge pull request #755 from lioncash/mcrr-mrrcbunnei2015-05-121-7/+68
|\ \ \ \ | |_|/ / |/| | |
| * | | dyncom: Stub MCRR and MRRCLioncash2015-05-121-7/+68
| |/ /
* | | Merge pull request #750 from Subv/process_svcYuri Kunde Schlesner2015-05-126-4/+46
|\ \ \ | |_|/ |/| |
| * | fixup!Subv2015-05-123-16/+12
| * | Core/HLE: Implemented the SVCs GetProcessId and GetProcessIdOfThreadSubv2015-05-116-4/+50
* | | NWM_UDS: Fix a typo in the nwm service port namepurpasmart962015-05-121-1/+1
| |/ |/|
* | Thread: Correctly set main thread initial stack positionYuri Kunde Schlesner2015-05-113-5/+4
|/
* Merge pull request #740 from yuriks/gsp-shmemarchshift2015-05-117-34/+67
|\
| * fixup! GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-1/+1
| * GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-9/+11
| * Kernel: Zero-fill shared memory blocks when mappingYuri Kunde Schlesner2015-05-111-0/+8
| * Kernel: Capture SharedMemory attributes at creation, not when mappingYuri Kunde Schlesner2015-05-117-28/+51
* | fixup! Set the TLS address in the schedulerSubv2015-05-116-11/+10
* | Core/Memory: Give every emulated thread it's own TLS area.Subv2015-05-118-11/+31
|/
* Common: Remove the BIT macroYuri Kunde Schlesner2015-05-091-2/+2
* Merge pull request #734 from yuriks/memmapTony Wasserka2015-05-0910-167/+181
|\
| * Memory: Add GetPhysicalPointer helper functionYuri Kunde Schlesner2015-05-092-5/+14
| * Memory: Support more regions in the VAddr-PAddr translation functionsYuri Kunde Schlesner2015-05-092-28/+33
| * Memory: Sort memory region variables by VAddrYuri Kunde Schlesner2015-05-092-10/+10
| * Memory: Re-organize and rename memory area address constantsYuri Kunde Schlesner2015-05-099-131/+131
* | Loader: Add missing includeYuri Kunde Schlesner2015-05-091-0/+1
|/
* Loader: Remove .bin file supportYuri Kunde Schlesner2015-05-092-20/+0
* Kernel: Remove unused g_main_thread variableYuri Kunde Schlesner2015-05-093-5/+1
* Process: Rename StaticAddressMapping => AddressMappingYuri Kunde Schlesner2015-05-096-10/+10
* Process: Add more documentation to the class membersYuri Kunde Schlesner2015-05-091-2/+16
* Process: Use BitField to store process flagsYuri Kunde Schlesner2015-05-092-16/+24
* Loader/NCCH: Fix formatting of bracesYuri Kunde Schlesner2015-05-091-9/+9
* Process: Support parsing of exheader kernel capsYuri Kunde Schlesner2015-05-096-4/+77
* Kernel: Remove g_program_idYuri Kunde Schlesner2015-05-096-21/+3
* Kernel: Introduce skeleton Process class to hold process dataYuri Kunde Schlesner2015-05-0913-48/+191
* Core: Fix sorting in CMakeFiles.txtYuri Kunde Schlesner2015-05-081-21/+21
* Merge pull request #728 from lioncash/varsLioncash2015-05-081-19/+17
|\
| * dyncom: Remove an unnecessary variable in the interpreterLioncash2015-05-081-19/+17
* | Remove unnecessary dyncom header filesLioncash2015-05-086-82/+2
|/
* Common: Remove mem_arena.cpp/hYuri Kunde Schlesner2015-05-082-94/+31
* Fix printf format warningYuri Kunde Schlesner2015-05-071-1/+1
* Common: Remove common.hYuri Kunde Schlesner2015-05-0757-29/+85
* Clean-up includesYuri Kunde Schlesner2015-05-077-9/+13
* FileSys: De-inline Path membersYuri Kunde Schlesner2015-05-074-125/+139
* FileSys: Clean-up includes, de-inline destructorsYuri Kunde Schlesner2015-05-077-20/+35
* Move typedefs from kernel.h to more appropriate placesYuri Kunde Schlesner2015-05-072-10/+8
* HLE: Clean up SVC dispatch mechanismYuri Kunde Schlesner2015-05-065-79/+40
* Core: Remove some unused functions and typesYuri Kunde Schlesner2015-05-042-32/+1
* CoreTiming: Initialize static variables at bootup.bunnei2015-05-021-0/+10
* HLE: Properly initialize and shutdown remaining modules.bunnei2015-05-025-3/+20
* Dyncom: Move cream cache to ARMul_State.bunnei2015-05-024-25/+18
* Kernel: Properly initialize and shutdown all modules.bunnei2015-05-024-9/+20
* HW: Properly initialize and shutdown all modules.bunnei2015-05-023-3/+8
* Services: Initialize all state variables at bootup.bunnei2015-05-028-22/+38
* Memory: Properly cleanup & shutdown.bunnei2015-05-023-38/+60
* ConfigMem: Remove duplicate retail bitpurpasmart962015-04-291-1/+0
* Merge pull request #692 from purpasmart96/log_improvementsbunnei2015-04-284-22/+59
|\
| * Services/Loader: Use more sensible log formats for certain functionspurpasmart962015-04-284-22/+59
* | ptm_sysm: Add static specifier to IsLegacyPowerOffLioncash2015-04-251-1/+1
* | dyncom: Remove more unused/unnecessary codeLioncash2015-04-205-95/+1
* | dyncom: Remove unused/unnecessary VFP cruftLioncash2015-04-187-823/+15
* | Merge pull request #696 from yuriks/interface-deinlinebunnei2015-04-153-50/+49
|\ \
| * | De-inline functions from Interface, removing them from service.hYuri Kunde Schlesner2015-04-143-50/+49
* | | Core_ARM11: Replace debug prints with our own logging functions in vfpsingle.Emmanuel Gil Peyrot2015-04-142-39/+36
* | | Kernel: Use the correct format string for u64 hex.Emmanuel Gil Peyrot2015-04-141-1/+1
* | | Headers: Add some forgotten overrides, thanks clang!Emmanuel Gil Peyrot2015-04-142-2/+2
|/ /
* | SVC: Assert on unsupported CreateThread processor ID.bunnei2015-04-101-3/+9
* | SVC: Update various SVCs to cause a reschedule.bunnei2015-04-102-6/+22
* | Kernel: Implemented priority inheritance for mutexes.bunnei2015-04-103-4/+22
* | Thread: Implement priority boost for starved threads.bunnei2015-04-104-28/+74
* | SVC: Reschedule on svcCreateThread.bunnei2015-04-101-0/+2
* | APT: (Subv) Fix bug where start event was being incorrectly signaled.bunnei2015-04-101-6/+7
* | Kernel: Fixed default thread priority.bunnei2015-04-102-5/+4
* | Initialize base address to 0x0Gareth Higgins2015-04-091-0/+1
|/
* Merge pull request #689 from lioncash/formatTony Wasserka2015-04-081-1/+1
|\
| * gpu: Fix a missing format specifierLioncash2015-04-071-1/+1
* | Merge pull request #688 from lioncash/unusedbunnei2015-04-085-50/+30
|\ \
| * | dyncom: Remove unnecessary enum and typedefLioncash2015-04-075-50/+30
| |/
* | Merge pull request #676 from purpasmart96/ir_service_refcbunnei2015-04-0811-59/+188
|\ \ | |/ |/|
| * IR: Move The IR services to their own folder and implement "GetHandles"purpasmart962015-04-0411-59/+188
* | vfp: Make the FPSID values match the MPCoreLioncash2015-04-061-7/+7
* | vfp: Get rid of the VFP_OFFSET macroLioncash2015-04-065-64/+69
* | Merge pull request #685 from lioncash/cpregsbunnei2015-04-069-134/+217
|\ \
| * | core: Migrate 3DS-specific CP15 register setting into InitLioncash2015-04-062-8/+5
| * | arm_interface: Support retrieval/storage to CP15 registersLioncash2015-04-063-0/+25
| * | Move CP15 enum definitions into their own enum.Lioncash2015-04-065-168/+163
| * | dyncom: Properly return the value of the user RO thread registerLioncash2015-04-062-4/+10
| * | dyncom: Set CP15 reset values on initializationLioncash2015-04-061-0/+60
* | | dyncom: Suppress uninitialized variable warningsLioncash2015-04-061-4/+4
|/ /
* | Clean-up mem_map constants and fix framebuffer translation errorsYuri Kunde Schlesner2015-04-063-27/+27
* | Merge pull request #680 from archshift/bg-colorbunnei2015-04-041-0/+5
|\ \ | |/ |/|
| * Allow the user to set the background clear color during emulationarchshift2015-04-041-0/+5
* | Merge pull request #641 from purpasmart96/service_stubsbunnei2015-04-0418-68/+405
|\ \ | |/ |/|
| * Services: Stubs and minor changespurpasmart962015-04-0318-68/+405
* | dyncom: Move CP15 register writing into its own function.Lioncash2015-04-024-88/+265
* | dyncom: Move CP15 register reading into its own function.Lioncash2015-04-024-49/+253
* | dyncom: Migrate InAPrivilegedMode to armsuppLioncash2015-03-263-4/+7
* | Merge pull request #672 from purpasmart96/citra_moar_app_membunnei2015-03-251-2/+2
|\ \
| * | ConfigMem: Set the app memory to be 96MB instead of the default 64MBpurpasmart962015-03-241-2/+2
| |/
* | Merge pull request #674 from lioncash/sys-instrsbunnei2015-03-251-2/+62
|\ \
| * | dyncom: Implement SRSLioncash2015-03-241-1/+32
| * | dyncom: Implement RFELioncash2015-03-241-1/+30
| |/
* / dyncom: Remove unused/unnecessary macros and macro constantsLioncash2015-03-242-39/+2
|/
* Merge pull request #656 from Subv/nzbunnei2015-03-227-26/+265
|\
| * Service/FS: Document and log some unknown values.Subv2015-03-191-1/+26
| * Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and DeleteSystemSaveDataSubv2015-03-147-26/+240
* | armmmu: Remove unnecessary enum valuesLioncash2015-03-211-30/+20
* | Merge pull request #659 from lioncash/setendbunnei2015-03-207-83/+240
|\ \
| * | dyncom: Make Load/Store instructions support big endianLioncash2015-03-177-82/+205
| * | dyncom: Implement SETENDLioncash2015-03-151-1/+35
* | | Merge pull request #650 from Subv/scalingbunnei2015-03-182-5/+16
|\ \ \
| * | | GPU/DisplayTransfer: Made the scaling bits a single 2bit valueSubv2015-03-162-6/+17
| * | | GPU: Fixed the bit 25 in the display transfer flags.Subv2015-03-102-5/+5
* | | | Merge pull request #655 from purpasmart96/hid_fixesbunnei2015-03-174-12/+72
|\ \ \ \
| * | | | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow alongpurpasmart962015-03-174-12/+72
| | |_|/ | |/| |
* | | | Merge pull request #660 from purpasmart96/ncch_updatesbunnei2015-03-171-11/+14
|\ \ \ \
| * | | | NCCH: Minor updates to the ncch headerpurpasmart962015-03-151-11/+14
| |/ / /
* | | | arm_interface: Get rid of GetTicks.Lioncash2015-03-165-17/+6
* | | | GPU: Implemented the flip_data (bit 0) bit in display transfers.Subv2015-03-142-6/+15
|/ / /
* | | Merge pull request #642 from bunnei/touchpadbunnei2015-03-124-130/+140
|\ \ \ | |_|/ |/| |
| * | hid_user: Removed unnecessary includes.bunnei2015-03-111-2/+0
| * | HID: Removed unnecessary global variables.bunnei2015-03-112-58/+42
| * | HID: Added additional variable comments and some code cleanups.bunnei2015-03-112-20/+29
| * | HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-113-111/+32
| * | HID: Cleanup how `next_touch_index` is calculated for Pad and touch.bunnei2015-03-101-2/+2
| * | HID: Changed TouchDataEntry `valid` to a BitField and added some doc strings.bunnei2015-03-102-4/+4
| * | HID: Added static asserts to check register position in shared memory.bunnei2015-03-101-2/+16
| * | HID: Added functions to emulate the touchpad.bunnei2015-03-102-0/+61
| * | HID: Moved some docstrings to the header.bunnei2015-03-102-24/+16
| * | HID: Refactored shared memory decoding for touchpad support.bunnei2015-03-102-33/+64
* | | Merge pull request #629 from archshift/lcdfbbunnei2015-03-108-41/+232
|\ \ \ | |/ / |/| |
| * | Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-097-26/+184
| * | Implement SetLcdForceBlack, move register enum to hw.harchshift2015-03-064-36/+69
* | | dyncom: Minor cleanupLioncash2015-03-101-26/+7
| |/ |/|
* | Merge pull request #648 from Subv/fill_bitTony Wasserka2015-03-091-1/+1
|\ \
| * | GPU: Use the correct position for the finished bit in memory fillsSubv2015-03-091-1/+1
* | | Merge pull request #646 from Subv/24bit_fillsTony Wasserka2015-03-092-5/+5
|\ \ \
| * | | GPU: Corrected the 24 bit memory fills component orderSubv2015-03-092-5/+5
| |/ /
* | | Merge pull request #589 from kevinhartman/config-errorsbunnei2015-03-091-5/+10
|\ \ \
| * | | Fix error message for bad config block request.Kevin Hartman2015-02-211-5/+10
* | | | dyncom: Fix an indexing bug in STMLioncash2015-03-091-5/+4
* | | | dyncom: General cleanup of STMLioncash2015-03-091-16/+14
* | | | dyncom: Increment addr when accessing LR in LDMLioncash2015-03-091-0/+2
| |/ / |/| |
* | | Merge pull request #538 from yuriks/perf-statTony Wasserka2015-03-072-0/+14
|\ \ \ | |_|/ |/| |
| * | Add profiling infrastructure and widgetYuri Kunde Schlesner2015-03-022-0/+14
* | | Merge pull request #615 from Subv/servicesbunnei2015-03-0540-1110/+1202
|\ \ \
| * | | Services: Moved the PTM and APT services to their own folderSubv2015-03-0440-1110/+1202
* | | | Merge pull request #625 from lioncash/warnbunnei2015-03-042-4/+4
|\ \ \ \
| * | | | vfp: Get rid of warningsLioncash2015-03-042-4/+4
* | | | | GPU: Added RGB565/RGB8 framebuffer support and various cleanups.bunnei2015-03-041-50/+25
| |/ / / |/| | |
* | | | Merge pull request #622 from Subv/titlesYuri Kunde Schlesner2015-03-021-8/+45
|\ \ \ \
| * | | | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.Subv2015-03-021-8/+45
* | | | | Merge pull request #623 from Subv/cardbunnei2015-03-021-1/+25
|\ \ \ \ \
| * | | | | Services/FS: Stubbed CardSlotIsInserted to always return falseSubv2015-03-011-1/+25
| |/ / / /
* | | | | Merge pull request #618 from lioncash/refbunnei2015-03-021-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | result: Make comparison operators take referencesLioncash2015-02-281-2/+2
| |/ / /
* | | | Merge pull request #621 from Subv/powerbunnei2015-03-021-1/+13
|\ \ \ \ | |_|/ / |/| | |
| * | | Services/PTM: Stubbed PTM_Sysm::IsLegacyPowerOff.Subv2015-03-011-1/+13
| |/ /
* | | Merge pull request #616 from archshift/5551archshift2015-02-281-1/+1
|\ \ \
| * | | Added RGBA5551 compatibility in the rasterizerarchshift2015-02-281-1/+1
| |/ /
* | | Merge pull request #620 from lioncash/bkptbunnei2015-02-281-2/+3
|\ \ \
| * | | arm_disasm: Show conditional code for BKPT instructions.Lioncash2015-02-281-2/+3
| |/ /
* / / arm_disasm: Remove unused variableLioncash2015-02-281-2/+1
|/ /
* | Merge pull request #599 from Subv/mortonbunnei2015-02-272-23/+64
|\ \
| * | GPU: Implemented bits 3 and 1 from the display transfer flags.Subv2015-02-272-23/+64
* | | arm: The CP15 Main ID register is not writeableLioncash2015-02-261-3/+1
|/ /
* | Merge pull request #604 from Subv/arc_ssdYuri Kunde Schlesner2015-02-264-45/+70
|\ \
| * | Archives: Properly implemented the SystemSaveData archive.Subv2015-02-264-45/+70
* | | arm: Remove unnecessary booleansLioncash2015-02-252-22/+5
* | | Services: Implemented Y2R_U::GetTransferEndEventSubv2015-02-241-1/+18
|/ /
* | Merge pull request #595 from linkmauve/new-3ds-inputbunnei2015-02-242-0/+25
|\ \
| * | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.Emmanuel Gil Peyrot2015-02-222-0/+25
* | | Merge pull request #581 from archshift/tfebunnei2015-02-231-1/+164
|\ \ \
| * | | Added information reporting from ThrowFatalErrorarchshift2015-02-221-1/+164
* | | | GPU: Fixed RGBA8 as output format in a display transfer.Subv2015-02-221-8/+7
* | | | Merge pull request #471 from archshift/pp3ports3bunnei2015-02-221-0/+37
|\ \ \ \
| * | | | GPU: Add support for more framebuffer formats in display transfers.Tony Wasserka2015-02-221-0/+37
* | | | | Merge pull request #596 from kevinhartman/unaligned-cleanupbunnei2015-02-222-35/+2
|\ \ \ \ \
| * | | | | Cleaned up unaligned access.Kevin Hartman2015-02-222-35/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #594 from Subv/display_transferbunnei2015-02-221-8/+6
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | GPU: Fixed the RGBA8 input format and RGB8 output formatSubv2015-02-221-8/+6
| |/ / /
* | | | Merge pull request #588 from archshift/somebranchbunnei2015-02-203-15/+5
|\ \ \ \ | |/ / / |/| | |
| * | | Misc cleanup of common and related functionsarchshift2015-02-201-2/+3
| * | | Remove duplication of INSERT_PADDING_WORDS between pica.h and gpu.harchshift2015-02-201-11/+0
| * | | Remove the useless msg_handler compilation unit that was left over from Dolphinarchshift2015-02-191-2/+2
| | |/ | |/|
* / | Convert a few C stdlib asserts to Citra's own assertsarchshift2015-02-191-6/+4
|/ /
* | Merge pull request #580 from lioncash/emplacebunnei2015-02-181-1/+1
|\ \
| * | core/video_core: Use in-place construction where possibleLioncash2015-02-171-1/+1
* | | GPU: Properly implement memory fills.Tony Wasserka2015-02-184-33/+78
* | | Merge pull request #570 from purpasmart96/config_membunnei2015-02-184-50/+58
|\ \ \
| * | | ConfigMem: Clean up the Config memory to be more like the shared page and movedpurpasmart962015-02-174-50/+58
* | | | Merge pull request #582 from lioncash/warningsbunnei2015-02-181-4/+4
|\ \ \ \
| * | | | vfpinstr: Fix trivial signed/unsigned mismatch warningsLioncash2015-02-181-4/+4
* | | | | Merge pull request #579 from lioncash/bkptbunnei2015-02-182-2/+28
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | dyncom: Support conditional BKPT instructionsLioncash2015-02-172-2/+28
* | | | | Services: Fixed "Tried to connect to named port err:f".Subv2015-02-161-1/+1
* | | | | Merge pull request #574 from lioncash/warnbunnei2015-02-161-2/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | vfpdouble: Use %p for printing pointer addresses.Lioncash2015-02-151-2/+2
* | | | | dyncom: Actually set the destination register for USAD8/USADA8.Lioncash2015-02-161-0/+1
|/ / / /
* | | | Merge pull request #539 from linkmauve/framebuffer-formatsbunnei2015-02-151-0/+19
|\ \ \ \
| * | | | video_core: Implement the remaining framebuffer formats in the OpenGL renderer.Emmanuel Gil Peyrot2015-02-151-0/+19
| | |/ / | |/| |
* / | | arm: Set the A bit on reset.Lioncash2015-02-151-1/+1
|/ / /
* | | Merge pull request #529 from Subv/masterbunnei2015-02-148-46/+64
|\ \ \
| * | | Build: Fixed some warningsSubv2015-02-128-46/+64
* | | | core: Apply static to local functionsLioncash2015-02-1311-245/+252
* | | | arm: General cleanupLioncash2015-02-1313-227/+116
| |/ / |/| |
* | | dyncom: Switch the app and system cores into the correct mode at initializationLioncash2015-02-135-17/+21
* | | dyncom: Clean up the constructorLioncash2015-02-133-16/+7
* | | dyncom: Remove warning for SXTAHLioncash2015-02-131-1/+0
* | | arm: Remove ARMul_EmulateInitLioncash2015-02-124-55/+1
* | | armdefs: Remove unnecessary extern CLioncash2015-02-121-6/+0
|/ /
* | Implemented WriteHWRegsWithMask for GSP.Kevin Hartman2015-02-111-6/+91
* | arm: Remove ARM26 support.Lioncash2015-02-112-45/+4
* | Merge pull request #559 from lioncash/cleanbunnei2015-02-114-24/+40
|\ \
| * | arm: Get rid of some magic constants. Specify proper ARM mode.Lioncash2015-02-113-3/+10
| * | arm: Change some more constants into enumsLioncash2015-02-112-21/+30
* | | Asserts: break/crash program, fit to style guide; log.h->assert.harchshift2015-02-1159-77/+33
* | | GSP: Fixed typo in SignalInterruptbunnei2015-02-111-1/+1
* | | Merge pull request #552 from bunnei/setbufferswap-fixbunnei2015-02-111-4/+3
|\ \ \
| * | | GSP: Call SetBufferSwap for each screen on corresponding signal interrupt.bunnei2015-02-111-4/+3
* | | | Merge pull request #526 from purpasmart96/citra_stubsbunnei2015-02-114-8/+191
|\ \ \ \
| * | | | Services: Stub some functionspurpasmart962015-02-084-8/+191
* | | | | Merge pull request #556 from lioncash/cleanbunnei2015-02-114-28/+19
|\ \ \ \ \ | | |_|/ / | |/| | |
| * | | | arm: Remove TRUE/FALSE definesLioncash2015-02-104-28/+19
* | | | | Merge pull request #555 from lioncash/lutbunnei2015-02-111-7/+7
|\ \ \ \ \
| * | | | | arm_dyncom_thumb: Make lookup tables staticLioncash2015-02-101-7/+7
| |/ / / /
* | | | | PTM: Fixed a problem with the gamecoin PTM file.Subv2015-02-101-21/+13
* | | | | Archives: Made the Format function more generic.Subv2015-02-103-9/+10
* | | | | Archives: Expose the File and Directory classes to HLESubv2015-02-103-58/+62
* | | | | ResultVal: Fixed compilation when reassigning a ResultVal.Subv2015-02-101-3/+3
* | | | | FS: Allow multiple instances of the same archive type to be open at onceYuri Kunde Schlesner2015-02-1019-159/+199
* | | | | FS: Get rid of completely useless Archive classYuri Kunde Schlesner2015-02-101-36/+26
|/ / / /
* | | | Merge pull request #553 from lioncash/denormbunnei2015-02-102-0/+6
|\ \ \ \
| * | | | vfp: Normalize accumulator for multiply accumulate instructionsLioncash2015-02-102-0/+6
* | | | | dyncom: Add more regs to MCR/MRCLioncash2015-02-102-18/+35
|/ / / /
* | / / Scheduler refactor Pt. 1Kevin Hartman2015-02-107-284/+287
| |/ / |/| |
* | | Merge pull request #551 from bunnei/mutex-fixesbunnei2015-02-103-20/+24
|\ \ \
| * | | Mutex: Locks should be recursive.bunnei2015-02-102-16/+20
| * | | WaitSynch: Always reschedule (verified behavior on hw).bunnei2015-02-101-4/+4
* | | | vfpdouble: Fix the FTOUI NaN sign settingLioncash2015-02-091-1/+1
* | | | Throw more unused/unnecessary VFP code outLioncash2015-02-093-215/+1
* | | | vfp_helper: Convert some flags to enums. Throw out more duplicated FPSCR stuffLioncash2015-02-094-192/+153
* | | | vfp_helper: Normalize tabs to spacesLioncash2015-02-091-172/+170
|/ / /
* | | vfp_helper: Remove unnecessary extern C blocksLioncash2015-02-061-17/+1
* | | vfp: Move FPSID, FPEXC, and FPSCR values over to enums.Lioncash2015-02-063-150/+104
* | | Merge pull request #537 from lioncash/vfpbunnei2015-02-041-6/+6
|\ \ \
| * | | vfp: Fix VCVTLioncash2015-02-041-6/+6
* | | | Merge pull request #536 from lioncash/deadbunnei2015-02-042-1765/+0
|\ \ \ \ | |/ / / |/| | |
| * | | vfp: Throw out unused codeLioncash2015-02-042-1765/+0
* | | | dyncom: Remove more unnecessary codeLioncash2015-02-031-45/+3
|/ / /
* | | core: Fix some warnings on OSXLioncash2015-02-034-6/+5
* | | Kernel: Stop creating useless Handles during object creationYuri Kunde Schlesner2015-02-0218-57/+41
* | | Kernel: Make WaitObjects share ownership of Threads waiting on themYuri Kunde Schlesner2015-02-026-12/+17
* | | Explicitly instantiate constructors/destructors for Kernel objectsYuri Kunde Schlesner2015-02-0217-8/+51
* | | Mutex: Replace g_mutex_held_locks with a set inside ThreadYuri Kunde Schlesner2015-02-023-23/+18
* | | HID: Fix crash when pressing a key when the emulator is stoppedYuri Kunde Schlesner2015-02-021-0/+2
* | | SVC: Enable CloseHandle, clean up DuplicateHandleYuri Kunde Schlesner2015-02-021-9/+5
* | | Kernel: Fix bug in HandleTable::CloseYuri Kunde Schlesner2015-02-021-1/+1
* | | Kernel: Remove Object::GetHandle (it's not used anymore :D)Yuri Kunde Schlesner2015-02-022-9/+1
* | | Kernel: Introduce unique Object ids for debuggingYuri Kunde Schlesner2015-02-024-8/+16
* | | Kernel: Use separate Handle tables for CoreTiming userdataYuri Kunde Schlesner2015-02-024-18/+25
* | | Kernel: Remove previous scheduled event when a Timer is re-SetYuri Kunde Schlesner2015-02-021-0/+3
* | | FS: Remove use of GetHandleYuri Kunde Schlesner2015-02-021-1/+1
* | | Thread: Modernize two functions that slipped through previous rebasesYuri Kunde Schlesner2015-02-024-18/+16
* | | Service: Store function names as const char* instead of std::stringYuri Kunde Schlesner2015-02-021-6/+6
* | | Service: Clean-up InterfaceYuri Kunde Schlesner2015-02-0246-67/+54
* | | Make Port/Service registration and querying more HW-accurateYuri Kunde Schlesner2015-02-024-106/+80
* | | Filesys: Move creation of Handles for File/Directory to service handlersYuri Kunde Schlesner2015-02-023-32/+33
* | | Merge pull request #514 from rohit-n/fix-warningsbunnei2015-02-011-2/+2
|\ \ \
| * | | Silence a few warnings.Rohit Nirmal2015-01-301-2/+2
* | | | Merge pull request #525 from lioncash/armwarnbunnei2015-02-012-6/+3
|\ \ \ \
| * | | | vfp: Get rid of some compile warningsLioncash2015-02-012-6/+3
* | | | | arm: Clean up ARMul_StateLioncash2015-02-015-138/+84
|/ / / /
* | | | arm: Adios armemuLioncash2015-02-0116-8599/+166
* | | | Merge pull request #512 from lioncash/assignmentTony Wasserka2015-01-312-4/+4
|\ \ \ \ | |_|/ / |/| | |
| * | | shared_memory: Fix assignments in SharedMemory::MapLioncash2015-01-302-4/+4
| |/ /
* | | dyncom: clean up arm_dyncom_dec.hLioncash2015-01-301-43/+2
* | | arm: Move headers over to pragma onceLioncash2015-01-307-31/+11
* | | arm: Get rid of armcpu.h and skyeye_types.hLioncash2015-01-306-115/+0
* | | arm: Clean out armos.h and armmmu.hLioncash2015-01-302-181/+23
* | | Merge pull request #513 from lioncash/cleanupbunnei2015-01-306-1667/+168
|\ \ \
| * | | arm: Throw out a lot of unnecessary codeLioncash2015-01-306-1536/+56
| * | | armdefs: Move some defines over to enumsLioncash2015-01-301-131/+112
| |/ /
* | | loader: Add missing printf argumentLioncash2015-01-301-1/+1
* | | archive: Fix initializer list order for the File class.Lioncash2015-01-301-1/+1
* | | apt_u: Fix missing printf specifiersLioncash2015-01-301-2/+2
|/ /
* | Kernel: Mark all appropriate kernel objects as "final"Yuri Kunde Schlesner2015-01-307-8/+7
* | SVC: Use CASCADE_RESULT in SVC handlersYuri Kunde Schlesner2015-01-302-77/+32
* | Remove result.h InvalidHandleYuri Kunde Schlesner2015-01-304-30/+32
* | SVC: Change return type of handlers to ResultCodeYuri Kunde Schlesner2015-01-302-132/+127
* | Kernel: Convert Event to not use HandlesYuri Kunde Schlesner2015-01-3010-152/+151
* | Kernel: Convert Timer to (mostly) not use HandlesYuri Kunde Schlesner2015-01-303-111/+112
* | Kernel: Convert Mutex to not use HandlesYuri Kunde Schlesner2015-01-305-114/+110
* | Kernel: Convert AddressArbiter to not use HandlesYuri Kunde Schlesner2015-01-303-38/+55
* | Kernel: Convert Semaphore to not use HandlesYuri Kunde Schlesner2015-01-303-67/+88
* | Kernel: Convert SharedMemory to not use HandlesYuri Kunde Schlesner2015-01-308-102/+107
* | Additions to ResultVal to make it more convenient to use.Yuri Kunde Schlesner2015-01-301-1/+25
* | Move VAddr/PAddr typedefs to kernel.hYuri Kunde Schlesner2015-01-302-9/+7
* | Kernel: Remove useless/duplicated comments; mark functions staticYuri Kunde Schlesner2015-01-306-32/+8
* | Merge pull request #412 from purpasmart96/svc_table_cleanupbunnei2015-01-281-7/+7
|\ \
| * | SVC: Update the SVC function tablepurpasmart962015-01-271-7/+7
* | | dyncom: Minor cleanupLioncash2015-01-271-126/+137
* | | Merge pull request #345 from purpasmart96/apt_stubsbunnei2015-01-271-91/+276
|\ \ \
| * | | APT_U: Stub some functions & misc changespurpasmart962015-01-231-91/+276
* | | | Update vfp.cppbunnei2015-01-271-1/+1
* | | | Merge pull request #485 from Subv/more_servsbunnei2015-01-2621-3/+426
|\ \ \ \
| * | | | Services/HID: Removed some files due to a rebase errorSubv2015-01-243-267/+0
| * | | | Services: Stubbed more services.Subv2015-01-2424-3/+693
* | | | | Merge pull request #410 from chinhodado/cleanupbunnei2015-01-245-483/+157
|\ \ \ \ \
| * | | | | Cleanup: Logging in CoreChin2015-01-195-483/+157
* | | | | | vfp: Clean up vertical alignment for instructionsLioncash2015-01-231-131/+125
* | | | | | cam_u.h: fix indentationarchshift2015-01-221-2/+2
| |/ / / / |/| | | |
* | | | | Merge pull request #493 from archshift/ptmplaybunnei2015-01-226-0/+106
|\ \ \ \ \
| * | | | | Stubbed cam:u servicearchshift2015-01-214-0/+51
| * | | | | Stubbed ptm:play servicearchshift2015-01-214-0/+55
* | | | | | dyncom: Minor cleanupLioncash2015-01-221-282/+270
* | | | | | WaitSynchronization: Added a result code for invalid result, fixed bug.bunnei2015-01-221-3/+9
* | | | | | Thread: Fix WaitSynchronization1 to not set register 1 on thread wakeup.bunnei2015-01-223-25/+45
* | | | | | Thread: Use std::find in CheckWait_WaitObject.bunnei2015-01-221-4/+5
* | | | | | Mutex: Cleanup and remove redundant code.bunnei2015-01-223-47/+29
* | | | | | Kernel: Renamed some functions for clarity.bunnei2015-01-227-10/+10
* | | | | | Kernel: Changed "ShouldWait" to return bool and "Acquire" to return void.bunnei2015-01-229-71/+42
* | | | | | WaitObject: Renamed "Wait" to "ShouldWait", made "ShouldWait" and "Acquire" pure virtual.bunnei2015-01-229-23/+22
* | | | | | Event: Fix implementation of "non-sticky" events.bunnei2015-01-221-0/+4
* | | | | | Session: Change to a WaitObject.bunnei2015-01-223-2/+9
* | | | | | Kernel: Reschedule on SignalEvent and SendSyncRequest, fix some bugs.bunnei2015-01-222-1/+2
* | | | | | Mutex: Fix a bug where the thread should not wait if it already has the mutex.bunnei2015-01-221-1/+4
* | | | | | Kernel: Moved Wait and Acquire to WaitObject, added way to retrieve a WaitObject safely.bunnei2015-01-224-20/+59
* | | | | | SVC: Removed a Sleep that made no sensebunnei2015-01-221-6/+1
* | | | | | AddressArbiter: Changed to Kernel::Object, big cleanup, removed code that made no sense.bunnei2015-01-225-38/+45
* | | | | | Kernel: Get rid of WaitTypes and simplify lots of code, removing hacks.bunnei2015-01-229-122/+63
* | | | | | WaitSynchronizationN: Improved commentsbunnei2015-01-221-7/+12
* | | | | | WaitSynchronizationN: Refactor to fix several bugsbunnei2015-01-228-79/+76
* | | | | | Kernel: Separate WaitSynchronization into Wait and Acquire methods.bunnei2015-01-228-18/+59
* | | | | | WaitSynchronizationN: Handle case where handles=nullptr.bunnei2015-01-221-0/+4
* | | | | | WaitSynchronizationN: Handle case where handle_count is invalid.bunnei2015-01-221-3/+7
* | | | | | WaitSynchronizationN: Handle case where handle_count=0.bunnei2015-01-221-19/+29
* | | | | | WaitSynchronizationN: Implement return valuesbunnei2015-01-2210-83/+189
* | | | | | Event: Fixed some bugs and cleanup (Subv)bunnei2015-01-224-57/+16
* | | | | | Thread: Keep track of multiple wait objects.bunnei2015-01-223-16/+30
* | | | | | Event: Get rid of permanent_lock hack.bunnei2015-01-222-36/+8
* | | | | | WaitObject: Added RemoveWaitingThread, fixed a bug, and cleanup.bunnei2015-01-222-4/+17
* | | | | | Kernel: Added WaitObject and changed "waitable" objects inherit from it.bunnei2015-01-228-71/+73
* | | | | | Added HID_SPVR service and split HID_U implementation into service/hid/hid.xxxarchshift2015-01-2110-219/+333
|/ / / / /
* | | | | Merge pull request #498 from lioncash/staticsbunnei2015-01-201-14/+14
|\ \ \ \ \
| * | | | | core_timing: Mark several variables as staticLioncash2015-01-201-14/+14
* | | | | | core: Fix a few docstringsLioncash2015-01-204-4/+4
|/ / / / /
* | | | | Merge pull request #492 from archshift/aptbunnei2015-01-202-1/+4
|\ \ \ \ \
| * | | | | Expose GetSharedFont and NotifyToWait to APT:A and APT:S respectivelyarchshift2015-01-192-1/+4
* | | | | | Merge pull request #241 from linkmauve/better-loaderbunnei2015-01-208-352/+344
|\ \ \ \ \ \
| * | | | | | Loader: Clean up the ELF AppLoader.Emmanuel Gil Peyrot2015-01-152-42/+35
| * | | | | | Loader: Clean up the 3DSX AppLoader.Emmanuel Gil Peyrot2015-01-151-17/+24
| * | | | | | Loader: Clean up the NCCH AppLoader.Emmanuel Gil Peyrot2015-01-151-51/+48
| * | | | | | Loader: Display the type of the file being loaded.Emmanuel Gil Peyrot2015-01-151-3/+23
| * | | | | | Loader: Guess filetype from the magic, or fallback to the extension.Emmanuel Gil Peyrot2015-01-158-26/+112
| * | | | | | Loader: Don’t assume the file hasn’t been read before.Emmanuel Gil Peyrot2015-01-153-4/+13
| * | | | | | Loader: Keep a reference to the file and pass it to the correct AppLoader, instead of loading it multiple times.Emmanuel Gil Peyrot2015-01-158-176/+116
| * | | | | | Loader: Initialize the default NCCH values in the class declaration, not in the constructor.Emmanuel Gil Peyrot2015-01-152-8/+4
| * | | | | | Loader: Remove the useless THREEDSXReader class.Emmanuel Gil Peyrot2015-01-151-10/+4
| * | | | | | Loader: Never forget to change is_loaded.Emmanuel Gil Peyrot2015-01-156-7/+15
| * | | | | | Loader: Don’t duplicate the docstring into the cpp file.Emmanuel Gil Peyrot2015-01-154-56/+0
| * | | | | | Loader: Fix indentation, whitespace, and a few other such cosmetic stuff.Emmanuel Gil Peyrot2015-01-152-26/+24
* | | | | | | dyncom: Clarify precedence for ternary statementsLioncash2015-01-203-3/+3
* | | | | | | Merge pull request #494 from lioncash/shiftbunnei2015-01-191-7/+33
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | dyncom: Implement missing shifts in ScaledRegisterPostIndexed, etcLioncash2015-01-191-7/+33
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #383 from zhuowei/shared_pagebunnei2015-01-195-0/+116
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Add some support for the shared page (currently 3d slider is implemented)Zhuowei Zhang2015-01-165-0/+116
* | | | | | dyncom: Handle the ARM A2 encoding of STRT/LDRTLioncash2015-01-171-10/+24
* | | | | | dyncom: Handle the ARM A2 encoding of LDRBT/STRBT.Lioncash2015-01-171-17/+15
| |_|/ / / |/| | | |
* | | | | APT: Fix typo in setting return code for NotifyToWaitbunnei2015-01-161-1/+1
* | | | | DSP: Removed useless spam log for SignalInterruptbunnei2015-01-161-5/+2
* | | | | Merge pull request #482 from yuriks/fix-vblankbunnei2015-01-165-102/+91
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GPU: Fix buffer overrun in Display TransfersYuri Kunde Schlesner2015-01-141-9/+12
| * | | | GSP: Fix appending of interrupts to the shared memory bufferYuri Kunde Schlesner2015-01-142-17/+12
| * | | | GPU: Do periodic VBlank updates using CoreTimingYuri Kunde Schlesner2015-01-143-51/+44
| * | | | GPU: Correct wrong default framebuffer address for sub-screen.Yuri Kunde Schlesner2015-01-141-2/+2
| * | | | GSP: Update framebuffer info on all interruptsYuri Kunde Schlesner2015-01-141-12/+13
| * | | | GPU: Fire GPU interrupts at the correct places.Yuri Kunde Schlesner2015-01-142-21/+18
* | | | | Merge pull request #481 from Subv/hm_bbunnei2015-01-151-7/+21
|\ \ \ \ \
| * | | | | APT: Fixed the comment style in some variablesSebastian Valle2015-01-141-2/+2
| * | | | | APTU: Stubbed NotifyToWait, taken from 3dmoo.Subv2015-01-141-7/+21
| |/ / / /
* | | | | Merge pull request #480 from Subv/arb_2bunnei2015-01-143-4/+21
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | AddrArbiter: Implement arbitration types 3 and 4.Subv2015-01-133-4/+21
* | | | | Services: Added some missing services.Subv2015-01-139-1/+364
|/ / / /
* | / / vfp: Remove dead codeLioncash2015-01-121-50/+14
| |/ / |/| |
* | | dyncom: Fix 32-bit ASR shifts for immediatesLioncash2015-01-121-5/+3
* | | dyncom: Remove unused flag macrosLioncash2015-01-121-15/+3
* | | Merge pull request #472 from lioncash/overflowbunnei2015-01-123-147/+175
|\ \ \ | |_|/ |/| |
| * | dyncom: Get rid of unnecessary outer-scope variables in InterpreterMainLoopLioncash2015-01-121-97/+108
| * | dyncom: Fix overflow flag setting for ADD/RSB/RSC/SUB/SBCLioncash2015-01-121-38/+41
| * | dyncom: Add a helper function for addition with a carryLioncash2015-01-123-12/+26
* | | Fix building on MinGWdarkf2015-01-121-0/+13
|/ /
* | dyncom: Fix ADC overflow flag settingLioncash2015-01-121-8/+12
* | Merge pull request #456 from Subv/waitsync1bunnei2015-01-121-3/+2
|\ \
| * | SVC: Wake up the thread after the delay in WaitSync1Subv2015-01-111-3/+2
* | | dyncom: Fix conditional execution of MSRLioncash2015-01-121-29/+31
* | | Merge pull request #466 from Subv/wakebunnei2015-01-111-0/+3
|\ \ \ | |/ / |/| |
| * | Thread: Prevent waking a thread multiple times.Subv2015-01-111-0/+3
* | | Stubbed y2r:u IsBusyConversionarchshift2015-01-111-1/+16
* | | Added Archive ID to fs:USER debug logs involving opening the archive.archshift2015-01-101-3/+3
* | | Logging: Log all called service functions (under trace). Compile out all trace logs under release for performance.archshift2015-01-109-33/+22
* | | Kernel: Start using boost::intrusive_ptr for lifetime managementYuri Kunde Schlesner2015-01-0912-90/+95
* | | Kernel: Don't re-assign object's handle when duplicating oneYuri Kunde Schlesner2015-01-092-2/+3
|/ /
* | Merge pull request #444 from yuriks/handle-reform2bunnei2015-01-0924-374/+329
|\ \
| * | Thread: Fix nullptr access in a logging functionYuri Kunde Schlesner2015-01-091-1/+2
| * | Thread: Rename thread_queue => thread_listYuri Kunde Schlesner2015-01-091-6/+6
| * | Thread: Reduce use of Handles and move some funcs to inside the class.Yuri Kunde Schlesner2015-01-0911-302/+222
| * | Kernel: Move Thread's definition to the header fileYuri Kunde Schlesner2015-01-093-53/+67
| * | Move ThreadContext to core/core.h and deal with the falloutYuri Kunde Schlesner2015-01-0917-32/+52
* | | Merge pull request #436 from kevinhartman/system-corebunnei2015-01-091-0/+5
|\ \ \ | |/ / |/| |
| * | Warn if a new thread is intended to be run on the system CPU core until we implement correct scheduling for such a thread.Kevin Hartman2015-01-071-0/+5
* | | Merge pull request #255 from Subv/cbranch_3bunnei2015-01-098-5/+234
|\ \ \
| * | | SVC: Implemented the Timer service calls.Subv2015-01-098-5/+234
* | | | Core: Fixed a crash and removed some unused variables.Subv2015-01-092-8/+2
* | | | DynCom: Add a comment to GetTicks.Subv2015-01-091-0/+1
* | | | Timing: Use CoreTiming::GetTicks to keep track of ticks.Subv2015-01-092-6/+2
* | | | Merge pull request #443 from Subv/sleep_threadbunnei2015-01-093-8/+43
|\ \ \ \
| * | | | SVC: Fixed SleepThread.Subv2015-01-093-8/+43
| | |_|/ | |/| |
* | | | Merge pull request #446 from lioncash/umaalbunnei2015-01-081-4/+4
|\ \ \ \ | |/ / / |/| | |
| * | | dyncom: Fix UMAALLioncash2015-01-081-4/+4
* | | | Threads: Use a dummy idle thread when no other are ready.Subv2015-01-084-2/+47
* | | | Merge pull request #404 from bunnei/more-frame-synch-fixesbunnei2015-01-081-1/+4
|\ \ \ \
| * | | | GSP: Toggle active framebuffer each framebunnei2015-01-081-1/+4
* | | | | Merge pull request #431 from yuriks/thread-queue-cleanupbunnei2015-01-071-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Common: Clean up ThreadQueueListYuri Kunde Schlesner2015-01-071-1/+1
* | | | | Merge pull request #442 from lioncash/smulbunnei2015-01-071-10/+7
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | dyncom: Fix SMULWB/SMULWTLioncash2015-01-071-10/+7
| |/ / /
* | | | Merge pull request #425 from Subv/coretimingbunnei2015-01-074-418/+378
|\ \ \ \
| * | | | CoreTiming: Ported the CoreTiming namespace from PPSSPPSubv2015-01-074-418/+378
* | | | | Fix double-free in Service manager during shutdownYuri Kunde Schlesner2015-01-072-25/+4
| |/ / / |/| | |
* | | | Merge pull request #438 from lioncash/swpbunnei2015-01-071-0/+1
|\ \ \ \
| * | | | dyncom: Fix SWPBLioncash2015-01-071-0/+1
| | |_|/ | |/| |
* | | | Merge pull request #434 from lioncash/smbunnei2015-01-071-1/+56
|\ \ \ \ | |/ / / |/| | |
| * | | dyncom: Move over SMLALXYLioncash2015-01-071-1/+56
| | |/ | |/|
* | | Merge pull request #376 from Subv/arc_reorderbunnei2015-01-0711-34/+73
|\ \ \ | |/ / |/| |
| * | Archives/Exdata: Don't set concrete_mount_point in the ctorSubv2015-01-061-1/+1
| * | Archives: Changed the unimplemented archives comment.Subv2015-01-061-1/+1
| * | Archives: Addressed some commentsSubv2015-01-065-15/+15
| * | SaveDataCheck: Fixed a typoSubv2015-01-051-1/+1
| * | Archives: Make SYSTEM_ID and SDCARD_ID stringsSubv2015-01-046-9/+11
| * | Archives: Changed the way paths are built for the archives.Subv2015-01-0410-27/+64
| * | SaveDataCheck: Move the files to nand/titleSubv2015-01-041-1/+2
| * | Archives: Change the folder layout of some archives.Subv2015-01-033-4/+3
* | | Merge pull request #417 from kevinhartman/exclusive-tag-fixbunnei2015-01-062-16/+18
|\ \ \
| * | | Added exclusive reservation granule from ARMv7 spec to dyncom to protect LDR/STREX.Kevin Hartman2015-01-062-16/+18
* | | | Merge pull request #413 from purpasmart96/serv_cleanbunnei2015-01-067-33/+36
|\ \ \ \
| * | | | Services: Clean up a few things and add a few function namespurpasmart962015-01-067-33/+36
* | | | | Merge pull request #272 from rohit-n/sign-comparebunnei2015-01-061-4/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Silence some -Wsign-compare warnings.Rohit Nirmal2015-01-011-4/+4
| |/ / /
* | | | Merge pull request #422 from lioncash/bxjbunnei2015-01-051-8/+25
|\ \ \ \
| * | | | dyncom: Partially emulate BXJLioncash2015-01-051-8/+25
* | | | | Merge pull request #416 from bunnei/fake-dsp-interruptbunnei2015-01-053-5/+28
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | DSP: Signal (faked) interrupt on every frame.bunnei2015-01-053-5/+28
* | | | | dyncom: Actually set the Q flag for SMLABB/SMLABT/SMLATB/SMLATTLioncash2015-01-051-1/+2
* | | | | Merge pull request #418 from lioncash/qdbunnei2015-01-054-25/+117
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | dyncom: Implement QADD/QSUB/QDADD/QDSUBLioncash2015-01-054-25/+117
* | | | | Merge pull request #407 from Subv/arbiterbunnei2015-01-051-0/+11
|\ \ \ \ \
| * | | | | AddressArbiter: Ported arbitration type 2 from 3dmoo.Subv2015-01-031-0/+11
* | | | | | Merge pull request #415 from Dante38490/masterbunnei2015-01-051-0/+2
|\ \ \ \ \ \
| * | | | | | Fix correct espaceDante384902015-01-051-2/+2
| * | | | | | Add support load 3DS roomDante384902015-01-051-0/+2
* | | | | | | Merge pull request #408 from Subv/mutexbunnei2015-01-051-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Mutex: Add the calling thread to the waiting list when neededSubv2015-01-041-2/+2
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #386 from archshift/y2rubunnei2015-01-054-0/+72
|\ \ \ \ \ \
| * | | | | | Stub the y2r:u servicearchshift2015-01-034-0/+72
* | | | | | | skyeye: Remove duplicate typedefsLioncash2015-01-044-41/+17
| |/ / / / / |/| | | | |
* | | | | | FileSys: Fix crash bug in DiskFile exposed by #400Yuri Kunde Schlesner2015-01-031-4/+0
* | | | | | FileSys: Fix a few memory leaksYuri Kunde Schlesner2015-01-032-6/+7
* | | | | | Merge pull request #396 from bunnei/default-dyncombunnei2015-01-032-3/+3
|\ \ \ \ \ \
| * | | | | | Core: Change default CPU to dyncom.bunnei2015-01-032-3/+3
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #398 from lioncash/smbunnei2015-01-031-1/+43
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | dyncom: Implement SMLAWLioncash2015-01-031-1/+43
| | |_|/ / | |/| | |
* / | | | VFP: Minor cleanup, functionally the same.bunnei2015-01-031-2587/+2476
|/ / / /
* | | | Merge pull request #395 from lioncash/revbunnei2015-01-031-45/+45
|\ \ \ \
| * | | | dyncom: Implement REVSHLioncash2015-01-031-45/+45
| |/ / /
* / / / dyncom: Implement SMLALD/SMLSLDLioncash2015-01-031-3/+72
|/ / /
* | | Merge pull request #381 from Subv/savedatacheckbunnei2015-01-0314-319/+275
|\ \ \
| * | | IVFCArchive: Use a critical log to notify of invalid operations.Subv2015-01-031-9/+9
| * | | SaveDataCheck: Remove unneeded constructor from a classSubv2015-01-031-2/+0
| * | | Archives: Added some documentation to IVFCArchiveSubv2015-01-031-0/+5
| * | | Archives: Reduced duplicate code in RomFS and SaveCheck.Subv2015-01-0314-341/+238
| * | | SaveDataCheck: Preliminary work in this archive.Subv2015-01-034-7/+63
* | | | Merge pull request #392 from lioncash/smbunnei2015-01-031-3/+64
|\ \ \ \ | |/ / / |/| | |
| * | | dyncom: Implement SMMLA/SMMUL/SMMLSLioncash2015-01-031-3/+64
* | | | Merge pull request #391 from lioncash/pedanticbunnei2015-01-032-4/+4
|\ \ \ \
| * | | | elf: Make DidRelocate constLioncash2015-01-031-1/+1
| * | | | archive: Fix initializer list orderLioncash2015-01-031-3/+3
| | |/ / | |/| |
* | | | dyncom: Implemented LDREXD/STREXD/LDREXH/STREXHbunnei2015-01-033-227/+282
| |/ / |/| |
* | | Merge pull request #390 from lioncash/wutbunnei2015-01-031-27/+0
|\ \ \
| * | | dyncom: Remove dead function InterpreterInitInstLengthLioncash2015-01-031-27/+0
| |/ /
* | | Merge pull request #388 from lioncash/smbunnei2015-01-035-52/+90
|\ \ \
| * | | armemu: Fix missing Q flag check for SMLSD.Lioncash2015-01-031-2/+6
| * | | dyncom: Implement SMLAD/SMUAD/SMLSD/SMUSDLioncash2015-01-035-50/+84
| |/ /
* / / soc_u: Fix a missing formatting argumentLioncash2015-01-031-1/+1
|/ /
* | dyncom: Implement SXTAB16 and SXTB16Lioncash2015-01-021-3/+58
* | Merge pull request #358 from neobrain/pica_progress2bunnei2015-01-022-1/+8
|\ \
| * | GPU: Pseudo-implement horizontal scaling.Tony Wasserka2014-12-312-1/+8
* | | Merge pull request #379 from lioncash/shbunnei2015-01-021-8/+110
|\ \ \
| * | | dyncom: Implement SHADD8/SHADD16/SHSUB8/SHSUB16/SHASX/SHSAXLioncash2015-01-011-8/+110
| | |/ | |/|
* | | Fix SADD8/SSUB8 in the armemuLioncash2015-01-011-50/+28
* | | dyncom: Implement SADD8/SSUB8Lioncash2015-01-011-55/+108
|/ /
* | SOC_U: Preliminary implementation of sockets.Subv2014-12-314-22/+721
* | Merge pull request #375 from lioncash/uopsbunnei2014-12-311-9/+208
|\ \ | |/ |/|
| * dyncom: Implement UADD8/UADD16/USUB8/USUB16/UASX/USAXLioncash2014-12-311-9/+208
* | dyncom: Massive refactorbunnei2014-12-312-654/+221
* | Merge pull request #369 from darkf/mingw_bunnei2014-12-311-0/+8
|\ \
| * \ Fix merge conflictsdarkf2014-12-30167-12294/+13495
| |\ \
| * | | Add comment regarding __WIN32__ in SkyEye codedarkf2014-11-291-0/+4
| * | | Fix MinGW builddarkf2014-11-291-0/+4
* | | | vfp: Get rid of a few warningsLioncash2014-12-302-2/+2
| |_|/ |/| |
* | | vfp: Implement VMOVBRRSSLioncash2014-12-303-12/+44
* | | dyncom: Implement USAT16/SSAT16Lioncash2014-12-301-2/+61
* | | Merge pull request #368 from purpasmart96/dsp_membunnei2014-12-303-2/+12
|\ \ \
| * | | MemMap: Add support for DSP Read & Writes in the memory mappurpasmart962014-12-303-2/+12
* | | | APT:A: Some style changesSubv2014-12-301-12/+12
* | | | Archives: Implemented ExtSaveData and SharedExtSaveDataSubv2014-12-3014-60/+264
| |_|/ |/| |
* | | dyncom: Implement USAT/SSATbunnei2014-12-303-2/+131
|/ /
* | Merge pull request #253 from purpasmart96/mem_mapbunnei2014-12-302-69/+76
|\ \
| * | MemMap: Added AXI_WRAM & SHARED_PAGE along with other stuffpurpasmart962014-12-142-69/+76
* | | dyncom: Various cleanups to match coding style, no functional changes.bunnei2014-12-305-7087/+5962
* | | Merge pull request #361 from lioncash/moreqopsbunnei2014-12-294-65/+142
|\ \ \
| * | | dyncom: Implement QADD8/QSUB8Lioncash2014-12-291-32/+42
| * | | armemu: Implement QADD8/QSUB8Lioncash2014-12-293-33/+100
* | | | dyncom: Fix SMLALXY's instruction labelsLioncash2014-12-291-2/+2
* | | | Merge pull request #303 from linkmauve/fs-cleanupTony Wasserka2014-12-299-169/+97
|\ \ \ \ | |/ / / |/| | |
| * | | FileSys: Clean up according to the coding style, and remove redundant namespaced names.Emmanuel Gil Peyrot2014-12-249-169/+97
* | | | Merge pull request #360 from lioncash/dynuxtbunnei2014-12-291-2/+55
|\ \ \ \
| * | | | dyncom: Implement UXTB16/UXTAB16Lioncash2014-12-291-2/+55
* | | | | Merge pull request #347 from bunnei/frameskipbunnei2014-12-293-27/+38
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GPU: Implement frameskip and remove forced framebuffer swap hack.bunnei2014-12-293-27/+38
* | | | | Merge pull request #355 from lioncash/simpbunnei2014-12-291-225/+142
|\ \ \ \ \
| * | | | | armemu: Simplify SSAT/SSAT16/SXTB/SXTABLioncash2014-12-281-71/+48
| * | | | | armemu: Simplify REV/REV16/SXTH/SXTAHLioncash2014-12-281-38/+26
| * | | | | armemu: Simplify USAT16/UXTB/UXTABLioncash2014-12-281-65/+42
| * | | | | armemu: Simplify REVSH/UXTH/UXTAHLioncash2014-12-281-48/+23
* | | | | | Merge pull request #359 from lioncash/vfpbunnei2014-12-295-1664/+1053
|\ \ \ \ \ \
| * | | | | | vfp: Actually make the code somewhat readableLioncash2014-12-295-1664/+1053
* | | | | | | Merge pull request #331 from yuriks/handle-reformbunnei2014-12-2914-208/+249
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Kernel: New handle managerYuri Kunde Schlesner2014-12-2813-168/+209
| * | | | | | Kernel: Replace GetStaticHandleType by HANDLE_TYPE constantsYuri Kunde Schlesner2014-12-288-15/+15
| * | | | | | Rename ObjectPool to HandleTableYuri Kunde Schlesner2014-12-2812-54/+54
* | | | | | | dyncom: Implement PKHBT and PKHTB.bunnei2014-12-281-2/+57
* | | | | | | armemu: Fix PKHTB to do an arithmetic shift and correctly decode immediate field.bunnei2014-12-281-13/+5
* | | | | | | dyncom: Implement USAD8/USADA8Lioncash2014-12-283-3/+53
* | | | | | | Merge pull request #354 from lioncash/usaduflowbunnei2014-12-283-4/+14
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | armemu: Fix underflows in USAD8/USADA8Lioncash2014-12-283-4/+14
| |/ / / / /
* | | | | | dyncom: Implement UQADD8, UQADD16, UQSUB8, UQSUB16, UQASX, and UQSAX.Lioncash2014-12-273-12/+102
* | | | | | armemu: Implement UQADD8, UQADD16, UQSUB16, UQASX, and UQSAXLioncash2014-12-273-19/+93
|/ / / / /
* | | | | dyncom: Implement UHADD8, UHADD16, UHSUB8, UHSUB16, UHASX, and UHSAXLioncash2014-12-271-11/+123
* | | | | armemu: Implement UHADD8, UHADD16, UHSUB8, UHSUB16, UHASX, and UHSAXLioncash2014-12-271-2/+73
|/ / / /
* | | | Merge pull request #339 from bunnei/fixup-gsp-synchbunnei2014-12-267-117/+59
|\ \ \ \
| * | | | GPU: Further improve synchronization.bunnei2014-12-261-22/+20
| * | | | ARM: Add a mechanism for faking CPU time elapsed during HLE.bunnei2014-12-266-95/+39
* | | | | Merge pull request #330 from purpasmart96/new_srvbunnei2014-12-2661-309/+367
|\ \ \ \ \
| * | | | | More services & small clean upspurpasmart962014-12-2661-309/+367
* | | | | | Merge pull request #343 from lioncash/smmlabunnei2014-12-261-2/+30
|\ \ \ \ \ \
| * | | | | | armemu: Implement SMMUL, SMMLA, and SMMLS.Lioncash2014-12-251-2/+30
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #341 from lioncash/moresmopsbunnei2014-12-261-2/+33
|\ \ \ \ \ \
| * | | | | | armemu: Implement SMLALD/SMLSLDLioncash2014-12-241-2/+33
| |/ / / / /
* / / / / / armemu: Fix GE/Q flag setting semanticsLioncash2014-12-241-62/+56
|/ / / / /
* | | | | Merge pull request #328 from archshift/writeablebunnei2014-12-241-1/+18
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Stubbed IsSdmcWriteable to always return writeable.archshift2014-12-241-1/+18
* | | | | armemu: Set the Q flag correctly for much of the other opsLioncash2014-12-231-8/+8
* | | | | armemu: Set the Q flag properly for SMLAD/SMUADLioncash2014-12-233-13/+28
* | | | | Merge pull request #334 from lioncash/cpsrbunnei2014-12-231-1/+1
|\ \ \ \ \
| * | | | | armemu: Fix retrieval of the CPSR in MRS instructions.Lioncash2014-12-231-1/+1
* | | | | | Merge pull request #335 from lioncash/cpsrcreatebunnei2014-12-234-25/+78
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | armemu: Properly set the Q flag for SSAT16/USAT16 upon saturation.Lioncash2014-12-231-9/+23
| * | | | | armemu: Fix SELLioncash2014-12-231-1/+1
| * | | | | armemu: Fix construction of the CPSRLioncash2014-12-234-15/+54
| |/ / / /
* / / / / dyncom: Move over QADD16/QASX/QSAX/QSUB16Lioncash2014-12-221-7/+87
|/ / / /
* | | | Merge pull request #322 from chinhodado/masterbunnei2014-12-224-11/+8
|\ \ \ \ | |/ / / |/| | |
| * | | More warning cleanupsChin2014-12-214-11/+8
* | | | Merge pull request #332 from lioncash/selbunnei2014-12-221-1/+58
|\ \ \ \
| * | | | dyncom: Move SEL overLioncash2014-12-221-1/+58
* | | | | Merge pull request #312 from Subv/still_more_savedata_stuffbunnei2014-12-2214-30/+508
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | CFG: Fixed some warnings and errors in ClangSubv2014-12-222-4/+4
| * | | | CFG: More style changesSubv2014-12-221-5/+5
| * | | | CFGU: IndentationSubv2014-12-211-4/+3
| * | | | CFG: Some indentationSubv2014-12-211-11/+13
| * | | | CFG: Changed the CreateConfigInfoBlk search loopSubv2014-12-211-7/+4
| * | | | CFG: Corrected the licenses in cfg_i.cpp and cfg_u.cppSubv2014-12-212-2/+2
| * | | | CFG: Create a new subfolder cfg inside service to handle cfgSubv2014-12-2111-489/+617
| * | | | CFGU: Some changesSubv2014-12-211-12/+33
| * | | | CFGU: Addressed some issues.Subv2014-12-211-43/+55
| * | | | CFGU: Addressed some comments.Subv2014-12-211-11/+13
| * | | | Style: Addressed some commentsSubv2014-12-212-6/+12
| * | | | CFG_U: Use Common::make_unique instead of the std versionSubv2014-12-211-1/+2
| * | | | CFG:U: Implemented some more blocksSubv2014-12-211-4/+30
| * | | | CFG: Implemented block 0x00070001 in the config savefileSubv2014-12-211-0/+5
| * | | | CFGU: Use an absolute offset in the config savefile blocksSubv2014-12-211-1/+3
| * | | | CFG: Load the Config savedata file if it already exists.Subv2014-12-211-3/+4
| * | | | CFGU: Added block 0x000A0002 to the default savegame fileSubv2014-12-211-0/+18
| * | | | CFG: Refactored how the config file works.Subv2014-12-212-56/+127
| * | | | CFG:U: Add some data to the 0x00050005 config block.Subv2014-12-211-6/+11
| * | | | CFG: Implemented the GetConfigInfoBlk2 function.Subv2014-12-215-15/+197
* | | | | Merge pull request #324 from lioncash/dyncbunnei2014-12-221-7/+102
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | dyncom: Move over SASX/SSAX/SADD16/SSUB16Lioncash2014-12-221-7/+102
* | | | | Merge pull request #291 from purpasmart96/licensebunnei2014-12-21130-137/+137
|\ \ \ \ \
| * | | | | License changepurpasmart962014-12-21130-137/+137
* | | | | | Merge pull request #271 from archshift/createfbunnei2014-12-218-1/+91
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Added CreateFile to the FS_USER servicearchshift2014-12-218-1/+91
* | | | | | Merge pull request #323 from lioncash/saddsubbunnei2014-12-211-14/+87
|\ \ \ \ \ \
| * | | | | | armemu: Implement SADD8/SSUB8Lioncash2014-12-211-14/+87
* | | | | | | Thread: Wait current thread on svc_SleepThreadbunnei2014-12-213-22/+35
| |_|_|/ / / |/| | | | |
* | | | | | Merge pull request #316 from yuriks/thread-handlebunnei2014-12-203-2/+16
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Kernel: Implement support for current thread pseudo-handleYuri Kunde Schlesner2014-12-203-2/+16
* | | | | | Merge pull request #296 from lioncash/dynbunnei2014-12-201-1/+47
|\ \ \ \ \ \
| * | | | | | dyncom: Implement UMAALLioncash2014-12-191-1/+47
* | | | | | | Merge pull request #310 from lioncash/ssat16bunnei2014-12-201-14/+20
|\ \ \ \ \ \ \
| * | | | | | | armemu: Fix SSAT16Lioncash2014-12-191-1/+1
| * | | | | | | armemu: Clean up naming and formatting for SSAT16Lioncash2014-12-191-14/+20
| | |_|_|/ / / | |/| | | | |
* | | | | | | armemu: Should be using labs for USAD8/USADA8Lioncash2014-12-201-4/+4
* | | | | | | Merge pull request #311 from lioncash/usadabunnei2014-12-201-1/+24
|\ \ \ \ \ \ \
| * | | | | | | armemu: Implement USAD8 and USADA8Lioncash2014-12-191-1/+24
* | | | | | | | Merge pull request #313 from lioncash/smlsdbunnei2014-12-201-6/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | armemu: Implement SMLSDLioncash2014-12-191-6/+10
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #314 from lioncash/qsax-qasxbunnei2014-12-201-7/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | armemu: Implement QASX and QSAXLioncash2014-12-191-7/+20
| |/ / / / / / /
* | | | | | | | Merge pull request #315 from chinhodado/masterbunnei2014-12-204-9/+16
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | Clean up some warningsChin2014-12-204-9/+16
* | | | | | | | Common: Add a clone of std::make_uniqueYuri Kunde Schlesner2014-12-203-10/+14
* | | | | | | | Merge pull request #306 from Subv/even_more_savedatabunnei2014-12-201-2/+31
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | FS_U: Added the command to the docs of SaveData functionsSubv2014-12-201-0/+2
| * | | | | | | SaveData: Added some documentation to FormatSaveDataSubv2014-12-181-2/+29
* | | | | | | | Merge pull request #294 from lioncash/varbunnei2014-12-191-12/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | armemu: Narrow the scope of some variables in handle_v6_insnLioncash2014-12-171-12/+9
* | | | | | | | | Merge pull request #305 from lioncash/parenbunnei2014-12-191-4/+4
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | armemu: Get rid of bitwise parenthesis warningsLioncash2014-12-181-4/+4
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #302 from purpasmart96/flushshutupbunnei2014-12-191-1/+25
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | GSP_GPU: Shut up FlushDataCachepurpasmart962014-12-191-1/+25
* | | | | | | | Merge pull request #308 from Subv/more_savedatabunnei2014-12-191-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | SystemSaveData: Fixed a typo that was segfaultingSubv2014-12-191-1/+1
* | | | | | | | | Merge pull request #304 from lioncash/sflagsbunnei2014-12-181-4/+29
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | armemu: Set GE flags correctly for SSUB16, SADD16, SSAX, and SASX.Lioncash2014-12-181-4/+29
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #307 from lioncash/usat16bunnei2014-12-181-11/+20
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | armemu: Fix lower-bounds clamping for USAT16Lioncash2014-12-181-1/+6
| * | | | | | | | | armemu: More concise names for USAT16-related variablesLioncash2014-12-181-11/+15
| |/ / / / / / / /
* | | | | | | | | Merge pull request #301 from Subv/more_savedatabunnei2014-12-185-2/+78
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| / / / / / / / | |/ / / / / / /
| * | | | | | | SystemSaveData: Added a TODO to move it to the NAND.Subv2014-12-181-1/+3
| * | | | | | | SaveData: Implemented the SystemSaveData archive.Subv2014-12-185-2/+76
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #299 from lioncash/joinbunnei2014-12-181-34/+23
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | armemu: Combine SSUB16, SADD16, SASX, and SSAX.Lioncash2014-12-181-34/+23
* | | | | | | Merge pull request #298 from lioncash/flagsbunnei2014-12-181-4/+22
|\ \ \ \ \ \ \
| * | | | | | | armemu: Unset GE flags for UADD8 if results are < 0x100Lioncash2014-12-171-4/+22
* | | | | | | | Merge pull request #295 from lioncash/umaalbunnei2014-12-181-3/+25
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | armemu: Implement UMAALLioncash2014-12-171-3/+25
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #292 from lioncash/backportsbunnei2014-12-181-19/+30
|\ \ \ \ \ \ \
| * | | | | | | armemu: Fix PKHTBNormmatt2014-12-171-6/+12
| * | | | | | | armemu: Implement REVSHNormmatt2014-12-171-5/+9
| * | | | | | | armemu: Fix UXTAB/UXTAHNormmatt2014-12-171-4/+4
| * | | | | | | armemu: Fix SXTABNormmatt2014-12-171-2/+2
| * | | | | | | armemu: Fix SXTAHNormmatt2014-12-171-2/+3
| |/ / / / / /
* | | | | | | Merge pull request #297 from lioncash/ssub16bunnei2014-12-181-8/+8
|\ \ \ \ \ \ \
| * | | | | | | armemu: Fix SSUB16Lioncash2014-12-171-8/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #185 from purpasmart96/mem_permbunnei2014-12-182-5/+13
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | Kernel:Add missing permissions in shared memory & svcpurpasmart962014-11-192-5/+13
* | | | | | | Filesystem/Archives: Implemented the SaveData archiveSubv2014-12-1822-490/+454
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #293 from lioncash/sopsbunnei2014-12-171-8/+9
|\ \ \ \ \ \
| * | | | | | armemu: Fix SADD16Lioncash2014-12-171-8/+9
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #287 from lioncash/qaddsub16bunnei2014-12-171-33/+37
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | armemu: Fix lower-bound signed saturation clamping for QADD16/QSUB16.Lioncash2014-12-161-2/+2
| * | | | | armemu: Join QADD16 and QSUB16 together.Lioncash2014-12-161-33/+37
* | | | | | Merge pull request #289 from lioncash/smopsbunnei2014-12-171-38/+35
|\ \ \ \ \ \
| * | | | | | armemu: Fix SMUAD, SMUSD, and SMLADLioncash2014-12-161-3/+3
| * | | | | | armemu: Join SMUAD, SMUSD, and SMLADLioncash2014-12-161-38/+35
| |/ / / / /
* | | | | | Merge pull request #290 from lioncash/vsubbunnei2014-12-171-2/+5
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | armemu: Fix FTOUI NaN sign.Normmatt2014-12-161-1/+1
| * | | | | armemu: Fix FSUBS bug where NaN shouldn't be negatedNormmatt2014-12-161-1/+4
| |/ / / /
* | | | | Merge pull request #286 from yuriks/msvc-fixbunnei2014-12-162-6/+8
|\ \ \ \ \
| * | | | | Comment out empty arrays causing compile errors in MSVCYuri Kunde Schlesner2014-12-162-6/+8
* | | | | | Merge pull request #285 from lioncash/uxtab16bunnei2014-12-161-10/+25
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | armemu: Implement UXTAB16Lioncash2014-12-161-10/+25
| |/ / / /
* | | | | Merge pull request #283 from yuriks/archive-refactorbunnei2014-12-1623-506/+320
|\ \ \ \ \
| * | | | | Work around libstdc++'s lack of support for std::hash on enumsYuri Kunde Schlesner2014-12-161-0/+15
| * | | | | FS.Archive: Clean up treatment of archives and their handlesYuri Kunde Schlesner2014-12-1611-387/+197
| * | | | | Service.FS: Rename FileSys::File to FileBackendYuri Kunde Schlesner2014-12-1610-17/+17
| * | | | | Service.FS: Rename FileSys::Directory to DirectoryBackendYuri Kunde Schlesner2014-12-1610-18/+18
| * | | | | Service.FS: Rename FileSys::Archive to ArchiveBackendYuri Kunde Schlesner2014-12-166-12/+12
| * | | | | Service.FS: Do archive registration using IdCode instead of nameYuri Kunde Schlesner2014-12-167-42/+32
| * | | | | HLE: Rename namespaces to match move & fix initialization orderYuri Kunde Schlesner2014-12-169-43/+43
| * | | | | HLE: Move kernel/archive.* to service/fs/Yuri Kunde Schlesner2014-12-169-12/+11
* | | | | | Merge pull request #282 from archshift/servicesbunnei2014-12-1610-0/+229
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Added stub for nim:aoc service...archshift2014-12-164-0/+62
| * | | | | Added stub for cecd:u service...archshift2014-12-164-0/+54
| * | | | | Added stub for ldr:ro service...archshift2014-12-164-0/+59
| * | | | | Added am:app service stub.archshift2014-12-164-0/+54
* | | | | | Merge pull request #281 from lioncash/uxtb16bunnei2014-12-161-12/+12
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | armemu: Fix UXTB16Lioncash2014-12-151-12/+12
| |/ / / /
* / / / / Remove SyncRequest from K::Object and create a new K::Session typeYuri Kunde Schlesner2014-12-1515-104/+129
|/ / / /
* | | | Merge pull request #276 from lioncash/decrappifybunnei2014-12-151-306/+169
|\ \ \ \
| * | | | Clean up armdefs.hLioncash2014-12-141-306/+169
| | |/ / | |/| |
* | | | Merge pull request #246 from Subv/cbranch_1bunnei2014-12-155-2/+160
|\ \ \ \
| * | | | Kernel/Semaphores: Fixed buildSubv2014-12-131-2/+2
| * | | | Kernel/Semaphore: Small style changeSubv2014-12-131-1/+1
| * | | | Kernel/Semaphores: Invert the available count checking.Subv2014-12-131-11/+9
| * | | | Kernel/Semaphores: Addressed some issues.Subv2014-12-132-32/+18
| * | | | Semaphore: Removed an unneeded functionSubv2014-12-131-5/+0
| * | | | Semaphores: Addressed some style issuesSubv2014-12-131-6/+5
| * | | | Semaphore: Implemented the initial_count parameter.Subv2014-12-132-5/+7
| * | | | SVC: Implemented ReleaseSemaphore.Subv2014-12-134-19/+81
| * | | | SVC: Implemented svcCreateSemaphoreSubv2014-12-135-1/+117
| |/ / /
* | | | Merge pull request #273 from bunnei/more-skyeye-fixesbunnei2014-12-153-419/+485
|\ \ \ \ | |/ / / |/| | |
| * | | ARM: Pull some SkyEye fixes from 3dmoo.bunnei2014-12-153-419/+485
* | | | kernel: Remove unused log argumentsLioncash2014-12-131-3/+3
|/ / /
* | | Add configurable per-class log filteringYuri Kunde Schlesner2014-12-131-1/+3
* | | Convert old logging calls to new logging macrosYuri Kunde Schlesner2014-12-1340-385/+336
* | | New logging systemYuri Kunde Schlesner2014-12-131-0/+1
* | | Merge pull request #267 from bunnei/apt-shared-fontbunnei2014-12-135-66/+132
|\ \ \
| * | | APT_U: Added GetSharedFont service function.bunnei2014-12-131-34/+100
| * | | MemMap: Renamed "GSP" heap to "linear", as this is not specific to GSP.bunnei2014-12-124-32/+32
* | | | DSP: Added stub for ReadPipeIfPossible.bunnei2014-12-121-1/+45
|/ / /
* | | Merge pull request #256 from Subv/mutexbunnei2014-12-113-37/+67
|\ \ \
| * | | Mutex: Remove some forward declarationsSubv2014-12-071-16/+15
| * | | Mutex: Release all held mutexes when a thread exits.Subv2014-12-073-22/+56
| * | | Mutex: Properly lock the mutex when a thread enters itSubv2014-12-061-12/+9
* | | | CFG:U: Store country codes as u16 instead of char pointers, and return the correct error in GetCountryCodeID.Emmanuel Gil Peyrot2014-12-101-44/+48
* | | | GSP: Trigger GPU interrupts at more accurate locations.bunnei2014-12-101-7/+6
* | | | GSP: Updated TriggerCmdReqQueue to return success code.bunnei2014-12-101-0/+3
* | | | GSP: Updated RegisterInterruptRelayQueue to return expected magic number.bunnei2014-12-101-1/+4
* | | | GPU: Fixed bug in command list size decoding.bunnei2014-12-103-4/+3
* | | | Remove unused NDMA moduleYuri Kunde Schlesner2014-12-094-88/+0
* | | | Merge pull request #217 from archshift/cmd_buffbunnei2014-12-091-12/+12
|\ \ \ \
| * | | | Log the cmd_buff arguments when citra comes across an unimplemented functionarchshift2014-11-251-12/+12
* | | | | Thread: Fixed to wait on address when in arbitration.bunnei2014-12-093-11/+31
* | | | | Merge pull request #244 from bunnei/cleanup-memmapbunnei2014-12-092-31/+21
|\ \ \ \ \
| * | | | | MemMap: Updated memory map to subtract base address instead of mask.bunnei2014-12-032-31/+21
* | | | | | Merge pull request #263 from lioncash/sasxbunnei2014-12-091-4/+4
|\ \ \ \ \ \
| * | | | | | armemu: Fix SSAXLioncash2014-12-081-1/+1
| * | | | | | armemu: Fix SASXLioncash2014-12-081-1/+1
| * | | | | | armemu: Fix parenthesis warnings regarding bitwise opsLioncash2014-12-081-4/+4
* | | | | | | Merge pull request #259 from ichfly/masterbunnei2014-12-095-0/+278
|\ \ \ \ \ \ \
| * | | | | | | Loader: Add 3DSX supportichfly2014-12-085-0/+278
| |/ / / / / /
* | | | | | | Merge pull request #264 from Subv/filesbunnei2014-12-091-3/+6
|\ \ \ \ \ \ \
| * | | | | | | Kernel/File: Fixed file read/write hwtestsSubv2014-12-081-3/+6
| |/ / / / / /
* | | | | | | Merge pull request #260 from archshift/opendirbunnei2014-12-097-3/+40
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Make OpenDirectory fail if the directory doesn't existarchshift2014-12-077-3/+40
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #245 from rohit-n/null-nullptrbunnei2014-12-071-6/+6
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Change NULLs to nullptrs.Rohit Nirmal2014-12-031-6/+6
* | | | | | Merge pull request #250 from Subv/cbranch_2bunnei2014-12-053-4/+31
|\ \ \ \ \ \
| * | | | | | Threads: Remove a redundant function.Subv2014-12-041-9/+1
| * | | | | | Threads: Implemented a sequential thread idSubv2014-12-042-4/+19
| * | | | | | SVC: Implemented GetThreadId.Subv2014-12-043-4/+24
| |/ / / / /
* | | | | | Merge pull request #222 from archshift/renamexyzbunnei2014-12-058-38/+229
|\ \ \ \ \ \
| * | | | | | Updated archive.cpp functions for proper error handlingarchshift2014-12-045-94/+41
| * | | | | | Implemented RenameDirectory in FS:USERarchshift2014-11-258-1/+123
| * | | | | | Implemented RenameFile in FS:USERarchshift2014-11-258-1/+123
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #248 from lioncash/kernelbunnei2014-12-052-10/+7
|\ \ \ \ \ \
| * | | | | | kernel: Shorten GetCountLioncash2014-12-041-6/+3
| * | | | | | kernel: Make some functions constLioncash2014-12-042-4/+4
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #249 from lioncash/enumbunnei2014-12-041-1/+1
|\ \ \ \ \ \
| * | | | | | mem_map: Make enum for addresses use u32 as the underlying typeLioncash2014-12-041-1/+1
| |/ / / / /
* | | | | | Merge pull request #247 from lioncash/constbunnei2014-12-042-4/+4
|\ \ \ \ \ \
| * | | | | | hid_user: Pass by reference with PadButtonPress/PadButtonReleaseLioncash2014-12-042-4/+4
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #238 from archshift/dspbunnei2014-12-042-26/+47
|\ \ \ \ \ \
| * | | | | | Add stub for ConvertProcessFromDspDramarchshift2014-12-042-26/+47
| | |/ / / / | |/| | | |
* | | | | | PTM_U: Added a stub for GetBatteryLevel & GetBatteryChargeState & GetAdapterStatepurpasmart962014-12-041-3/+72
| |/ / / / |/| | | |
* | | | | Merge pull request #231 from purpasmart96/serv_ac_wifi_statusbunnei2014-12-031-1/+19
|\ \ \ \ \
| * | | | | AC_U: Added a stub for GetWifiStatuspurpasmart962014-12-031-1/+19
| | |_|_|/ | |/| | |
* | | | | Merge pull request #219 from Subv/ptmbunnei2014-12-031-1/+18
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | PTM_U: Implemented the GetShellState function.Subv2014-12-011-1/+18
* | | | | Merge pull request #224 from bunnei/dsp-service-improvementsbunnei2014-12-012-26/+107
|\ \ \ \ \
| * | | | | DSP: Added stubs for several commonly used DSP service functions.bunnei2014-12-011-25/+106
| * | | | | DSP: Fixed typo in port name.bunnei2014-12-011-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #214 from Subv/masterbunnei2014-12-011-2/+86
|\ \ \ \ \
| * | | | | CFG:U: Implemented the GetCountryCodeID and GetCountryCodeString.Subv2014-11-301-2/+86
* | | | | | Merge pull request #225 from bunnei/fix-release-mutexbunnei2014-11-301-8/+7
|\ \ \ \ \ \
| * | | | | | Mutex: Changed behavior to always release mutex for all threads.bunnei2014-11-261-8/+7
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #226 from bunnei/svc-and-thread-fixesbunnei2014-11-302-1/+6
|\ \ \ \ \ \
| * | | | | | Thread: Check that thread is actually in "wait state" when verifying wait.bunnei2014-11-261-1/+1
| * | | | | | SVC: Add debug log to ArbitrateAddress.bunnei2014-11-261-0/+2
| * | | | | | SVC: SleepThread should yield to the next ready thread.bunnei2014-11-261-0/+3
| |/ / / / /
* | | | | | Merge pull request #235 from yuriks/dyncom-mapbunnei2014-11-301-33/+15
|\ \ \ \ \ \
| * | | | | | dyncom: Use unordered_map rather than the terrible 2-level bb_mapYuri Kunde Schlesner2014-11-291-33/+15
| | |/ / / / | |/| | | |
* / | | | | arm_dyncom_interpreter: Get rid of unused var warningsLioncash2014-11-291-4/+2
|/ / / / /
* | | / / Fixed formatting and switch statement warningsvaguilar2014-11-277-11/+13
| |_|/ / |/| | |
* | | | Remove unused includes to common/thread.hEmmanuel Gil Peyrot2014-11-251-2/+0
|/ / /
* | | Use pointers instead of passing handles around in some functions.Yuri Kunde Schlesner2014-11-241-19/+15
* | | Remove duplicated docs/update them for changed parameters.Yuri Kunde Schlesner2014-11-2410-88/+0
* | | HLE: Revamp error handling throrough the HLE codeYuri Kunde Schlesner2014-11-2423-310/+689
* | | Change some SkyEye defines to const intsYuri Kunde Schlesner2014-11-242-34/+16
* | | Merge pull request #191 from archshift/deletexyzbunnei2014-11-248-26/+194
|\ \ \ | |/ / |/| |
| * | Added DeleteFile and DeleteDirectory functions to FS:USER and the archives.archshift2014-11-238-26/+194
* | | Add more services and some fixes, along with more "override"purpasmart962014-11-2126-17/+464
* | | Merge pull request #211 from linkmauve/masterbunnei2014-11-1945-142/+142
|\ \ \
| * | | Remove tabs in all files except in skyeye imports and in generated GL codeEmmanuel Gil Peyrot2014-11-192-32/+32
| * | | Remove trailing spaces in every file but the ones imported from SkyEye, AOSP or generatedEmmanuel Gil Peyrot2014-11-1944-111/+111
* | | | Merge pull request #208 from lioncash/staticsbunnei2014-11-195-69/+69
|\ \ \ \ | |/ / / |/| | |
| * | | Add static to some variablesLioncash2014-11-195-69/+69
* | | | Merge pull request #207 from lioncash/docsTony Wasserka2014-11-183-3/+3
|\ \ \ \
| * | | | Fix documentation of parametersLioncash2014-11-183-3/+3
| |/ / /
* | | | Merge pull request #209 from lioncash/warnTony Wasserka2014-11-181-1/+1
|\ \ \ \
| * | | | directory_sdmc: Fix a signed/unsigned mismatch comparisonLioncash2014-11-181-1/+1
| |/ / /
* | | | Merge pull request #210 from lioncash/typedefTony Wasserka2014-11-181-10/+10
|\ \ \ \
| * | | | system: Get rid of an unnecessary enum typedefLioncash2014-11-181-10/+10
| |/ / /
* / / / Remove extraneous semicolonsLioncash2014-11-186-6/+6
|/ / /
* / / core: Mark some hle functions as staticLioncash2014-11-186-48/+48
|/ /
* | Archive: Fixed to not destroy archive handle on close.bunnei2014-11-181-3/+3
* | Archive: Fixed close archive before freeing.bunnei2014-11-181-1/+1
* | FS_User: Support FileSye::Path in a more generic way.bunnei2014-11-182-42/+76
* | FileSys: Updated backend code to use FileSys::Path instead of string for paths.bunnei2014-11-1812-38/+38
* | FileSys: Added DebugStr method to Path class.bunnei2014-11-181-0/+29
* | Merge pull request #201 from archshift/bossbunnei2014-11-174-0/+59
|\ \
| * | Add missing boss:U service, needed according to Nintendo Zone logs.archshift2014-11-174-0/+59
* | | mem_map: Add missing prototype for Write64Lioncash2014-11-171-0/+1
|/ /
* | Merge pull request #159 from SeannyM/enable_logTony Wasserka2014-11-151-0/+2
|\ \
| * | Add support for disabling log from settingsSean2014-11-031-0/+2
* | | Merge pull request #193 from lioncash/fmtbunnei2014-11-151-1/+1
|\ \ \
| * | | Fix two format strings.Lioncash2014-11-141-1/+1
* | | | Merge pull request #194 from lioncash/virtbunnei2014-11-151-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | ARM_Interface: Make destructor virtualLioncash2014-11-141-1/+1
* | | | Merge pull request #183 from archshift/lowpathbunnei2014-11-132-83/+180
|\ \ \ \
| * | | | Use std::u16string for conversion between UTF-8 and UTF-16, FS:USER functionsarchshift2014-11-133-138/+139
| * | | | Add support for UTF-16 strings for LowPaths in FS:USERarchshift2014-11-102-86/+182
| | |_|/ | |/| |
* | | | Merge pull request #188 from bunnei/apt-fixesbunnei2014-11-121-19/+90
|\ \ \ \
| * | | | APT_U: Added stub for function AppletUtility.bunnei2014-11-121-1/+29
| * | | | APT_U: Set a valid parameter buffer size in GlanceParameter.bunnei2014-11-121-17/+39
| * | | | APT_U: Release service lock on initialization.bunnei2014-11-121-0/+4
| * | | | APT_U: Fixes for GetLockHandle to boot system titles.bunnei2014-11-121-1/+18
| |/ / /
* | | | ARM: Fixed dyncom to use reg15 for PC (this core doesn't use pc variable).bunnei2014-11-121-2/+2
* | | | Core: Changed RunLoop iterations to 1000 (slightly better performance).bunnei2014-11-121-6/+6
* | | | ARM: Removed unnecessary goto with each instruction.bunnei2014-11-121-43/+39
* | | | ARM: Fixed several dyncom bugs.bunnei2014-11-123-17/+25
* | | | Add FRD:U service and functionsarchshift2014-11-114-0/+66
|/ / /
* | | Fix compilation errorsSean Maas2014-11-031-2/+2
* | | Merge pull request #163 from archshift/create-directorybunnei2014-11-028-4/+103
|\ \ \
| * | | Added CreateDirectory function to service/fs.cpp, and in Archive.archshift2014-11-028-4/+103
* | | | Merge pull request #166 from bunnei/skyeye-vfp-fixesbunnei2014-11-025-2138/+2622
|\ \ \ \
| * | | | ARM: Merged additional ARMv6 instructions implemented by 3dmoo.bunnei2014-11-021-42/+234
| * | | | ARM: Merge latest VFP fixes from 3dmoo team.bunnei2014-11-024-2096/+2388
| |/ / /
* / / / Added ReceiveNotification, PublishToSubscriber unimplemented functions to SRVarchshift2014-11-021-0/+2
|/ / /
* | | Added stub err:f service.archshift2014-11-024-0/+58