summaryrefslogtreecommitdiffstats
path: root/src/core/hle (follow)
Commit message (Expand)AuthorAgeFilesLines
* kernel: svc: Move all IsValid functions to an anonymous namespaceMorph2021-11-211-3/+15
* kernel: svc: Implement SetProcessMemoryPermissionMorph2021-11-211-1/+41
* kernel: KPageTable: Rename SetCodeMemoryPermission to SetProcessMemoryPermissionMorph2021-11-214-8/+8
* Settings: eliminate rescaling_factor.Fernando Sahmkow2021-11-162-27/+12
* applets/swkbd: Fix text check message encodingMorph2021-11-081-7/+15
* applets/swkbd: Skip text checking if the text has been confirmedMorph2021-11-082-8/+15
* service/pctl: Stub EndFreeCommunicationNarr the Reg2021-11-051-1/+8
* Merge pull request #7279 from Morph1984/system-get-program-idMorph2021-11-0517-45/+31
|\
| * general: Get the current process program id directly from the systemMorph2021-11-0413-43/+26
| * general: Rename GetTitleID to GetProgramIDMorph2021-11-0417-32/+35
* | Merge pull request #7287 from Morph1984/stub-aocFernando S2021-11-052-0/+29
|\ \ | |/ |/|
| * service: aoc: Stub NotifyUnmountAddOnContentMorph2021-11-042-1/+9
| * service: aoc: Stub NotifyMountAddOnContent and NotifyMountAddOnContentMorph2021-11-042-0/+21
* | Merge pull request #7282 from ameerj/core-includesbunnei2021-11-0489-163/+6
|\ \ | |/ |/|
| * core: Fix transitive include build errorsameerj2021-11-043-0/+6
| * core: Remove unused includesameerj2021-11-0488-164/+1
* | service/acc: Rename Unknown160 to InitializeApplicationInfoV2german772021-11-043-3/+3
* | service: acc: Stub acc:u0 '160'Morph2021-11-043-0/+9
|/
* svc: Correct WaitSynchronization num_handles param typeMorph2021-11-032-4/+4
* general: Remove MakeResult helpersMorph2021-11-0210-60/+41
* hle/result: Amend ResultVal documentationMorph2021-11-021-12/+10
* hle/result: Reimplement ResultVal using Common::ExpectedMorph2021-11-021-117/+63
* Merge pull request #7227 from vonchenplus/fix_memory_leak_v2bunnei2021-11-025-11/+51
|\
| * Fix dangling kernel objects when exitingFeng Chen2021-10-272-11/+13
| * Revert PR7009Feng Chen2021-10-271-2/+2
| * Fix memory leakFeng Chen2021-10-274-0/+38
* | Merge pull request #7244 from Morph1984/application-lang-pt-brbunnei2021-10-302-1/+26
|\ \
| * | ns: language: Add BrazilianPortuguese to ApplicationLanguageMorph2021-10-292-1/+26
* | | Merge pull request #7240 from Morph1984/resultval-remove-cvbunnei2021-10-301-2/+2
|\ \ \
| * | | hle/result: Remove cv-qualifiers from Arg in MakeResultMorph2021-10-281-2/+2
| | |/ | |/|
* | | hle/result: Declare copy/move constructor/assignment as noexceptMorph2021-10-281-3/+3
* | | hle/result: Add move assignment operator in ResultValMorph2021-10-281-0/+20
| |/ |/|
* | Merge pull request #7193 from FernandoS27/idleMorph2021-10-252-0/+22
|\ \ | |/ |/|
| * SVC: Implement svcInfo:IdleTickCountFernando Sahmkow2021-10-162-0/+22
* | Fixup channel submit IOCTL syncpoint parametersBilly Laws2021-10-242-21/+9
* | Merge pull request #7198 from ameerj/settings-chronobunnei2021-10-191-6/+7
|\ \
| * | settings: Remove std::chrono usageameerj2021-10-171-6/+7
| |/
* | Merge pull request #7173 from Morph1984/invalidate-unmapbunnei2021-10-171-0/+2
|\ \ | |/ |/|
| * KPageTable: Perform ranged invalidation when unmapping code memoryMorph2021-10-131-0/+2
* | Merge pull request #7187 from FernandoS27/boy-i-say-boybunnei2021-10-162-0/+16
|\ \
| * | NvHost/Core: Address Feedback.Fernando Sahmkow2021-10-161-3/+5
| * | Suspend temporallyFernandoS272021-10-161-1/+2
| * | NVHost_Ctrl: Force wait if the gpu falls behind too long.FernandoS272021-10-162-0/+13
| |/
* / service/vi: Stub IHOSBinderDriver::TransactParcel GetBufferHistory (#7184)Feng Chen2021-10-161-1/+11
|/
* Merge pull request #7110 from vonchenplus/fix_extract_offline_romefs_errorMorph2021-10-111-0/+10
|\
| * applets/web: Fallback to loader to get the manual romfs if none is foundFeng Chen2021-10-111-0/+10
* | kernel: hle_ipc: Foward declare KAutoObjectMorph2021-10-072-1/+2
* | service: Reduce header include overheadMorph2021-10-0730-38/+10
* | Merge pull request #7118 from ameerj/vc-gpu-implFernando S2021-10-065-52/+36
|\ \
| * | nvflinger: Use jthread and stop_token for VSync threadameerj2021-10-032-32/+8
| * | nvhost_ctrl: Refactor usage of gpu.LockSync()ameerj2021-10-031-15/+15
| * | gpu: Migrate implementation to the cpp fileameerj2021-10-032-5/+13
* | | Merge pull request #7115 from ameerj/log-compilebunnei2021-10-054-0/+6
|\ \ \
| * | | common/logging: Reduce scope of fmt includeameerj2021-10-022-0/+3
| * | | common/logging: Move Log::Entry declaration to a separate headerameerj2021-10-022-0/+3
| |/ /
* | | Merge pull request #7103 from Morph1984/service-ctx-eventbunnei2021-10-0526-271/+367
|\ \ \
| * | | service: Replace service event creation with ServiceContext::CreateEventMorph2021-10-0226-271/+367
* | | | Merge pull request #7091 from vonchenplus/fix_memroy_leakAmeer J2021-10-045-9/+113
|\ \ \ \
| * | | | Fix KShareMemory object leakFeng Chen2021-09-294-3/+105
| * | | | Fix KScopedAutoObject object leak when SendSyncRequestFeng Chen2021-09-251-6/+8
| | |_|/ | |/| |
* | | | service: am: Make use of Exit to exit the currently running applicationMorph2021-10-021-2/+2
| |/ / |/| |
* | | Merge pull request #7102 from Morph1984/remove-boxcatbunnei2021-10-023-619/+0
|\ \ \ | |_|/ |/| |
| * | service: bcat: Remove BoxCat BCAT implementationMorph2021-09-293-619/+0
* | | style: Remove extra space preceding the :: operatorMorph2021-09-295-6/+6
|/ /
* | Merge pull request #7018 from lat9nq/splat-stubsMorph2021-09-292-26/+67
|\ \
| * | audin_u: Return a buffer event in RegisterBufferEventlat9nq2021-09-152-2/+12
| * | audin_u: stub Start, RegisterBufferEvent, AppendAudioInBufferAutolat9nq2021-09-152-26/+57
* | | service/es: Update to 13.0.0german772021-09-271-0/+6
* | | service/npns: Update to 13.0.0german772021-09-271-0/+1
* | | service/vi: Update to 13.0.0german772021-09-272-0/+2
* | | service/am: Update to 13.0.0german772021-09-271-0/+4
* | | service/audio: Update to 13.0.0german772021-09-272-1/+10
* | | service/hid: Update to 13.0.0german772021-09-272-0/+10
* | | service/btdrv: Update to 13.0.0german772021-09-271-0/+4
* | | service/usb: Update to 13.0.0german772021-09-271-3/+3
* | | service: bsd: Stub ReadMorph2021-09-251-6/+5
* | | service: bsd: Implement ReadMorph2021-09-242-1/+15
* | | general: Update style to clang-format-12ameerj2021-09-244-27/+19
* | | common/uuid: Add validity checking functions to interfaceLioncash2021-09-223-7/+7
| |/ |/|
* | Merge pull request #7015 from german77/NotGoodForTerrabunnei2021-09-171-1/+14
|\ \
| * | ngct: Stub MatchNarr the Reg2021-09-151-1/+14
| |/
* / vfs: Partially implement GetFileTimeStampRawMorph2021-09-143-1/+37
|/
* FS: Mark recursive CreateDirectory as inaccurate and temporaryMorph2021-09-121-0/+5
* Merge pull request #6975 from ogniK5377/acc-async-ctxMorph2021-09-123-19/+152
|\
| * Mark is_complete as atomicChloe Marcec2021-09-082-4/+5
| * Addressed issuesChloe Marcec2021-09-083-15/+14
| * address name shadowing with systemChloe Marcec2021-09-061-2/+2
| * account: EnsureTokenIdCacheAsyncChloe Marcec2021-09-063-19/+152
* | Merge pull request #6974 from ogniK5377/fs-recursive-createdirMorph2021-09-121-8/+13
|\ \
| * | Addressed issuesChloe2021-09-081-1/+1
| * | FS: Recursively create directories for CreateDirectoryChloe Marcec2021-09-061-8/+13
* | | Merge pull request #6992 from german77/brainsMorph2021-09-125-3/+44
|\ \ \
| * | | am: Implement GetNotificationStorageChannelEventgerman772021-09-102-2/+16
| * | | hid: Stub SetTouchScreenConfigurationgerman772021-09-103-1/+28
* | | | Merge pull request #6987 from Morph1984/common-errorMorph2021-09-121-0/+1
|\ \ \ \
| * | | | kernel: Add missing <functional> includeMorph2021-09-111-0/+1
* | | | | Merge pull request #6986 from Morph1984/version-updateMorph2021-09-121-5/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | api_version: Update and add AtmosphereTargetFirmwareMorph2021-09-101-5/+12
| |/ / /
* | | | Merge pull request #6981 from ameerj/nvflinger-hb-formatFernando S2021-09-113-7/+8
|\ \ \ \ | |/ / / |/| | |
| * | | nvflinger: Use external surface format for framebuffer creationameerj2021-09-073-7/+8
| | |/ | |/|
* / | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-09-053-14/+24
|/ /
* / core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-09-044-16/+30
|/
* Merge pull request #6905 from Morph1984/nifm-miscbunnei2021-08-291-55/+58
|\
| * service: nifm: Populate fields in GetCurrentNetworkProfileMorph2021-08-271-29/+37
| * service: nifm: Cleanup GetCurrentIpConfigInfoMorph2021-08-271-26/+21
* | ngct: Stub NGCT:U servicegerman772021-08-273-0/+68
|/
* Revert "kernel: Various improvements to scheduler"bunnei2021-08-2619-205/+104
* Merge pull request #6878 from BreadFish64/optimize-GetHostThreadIDAmeer J2021-08-241-10/+13
|\
| * kernel: Optimize GetHostThreadIDBreadFish642021-08-161-10/+13
* | applet_error: Fix 64-bit error code conversionMorph2021-08-191-6/+25
* | Fix crash in logging in CreateStrayLayerValeri2021-08-191-1/+1
* | Fix check is thread current in GetThreadContextValeri2021-08-191-1/+1
* | Merge pull request #6832 from bunnei/scheduler-improvementsbunnei2021-08-1919-104/+205
|\ \
| * | core: hle: kernel: Disable dispatch count tracking on single core.bunnei2021-08-142-4/+11
| * | core: hle: kernel: k_thread: Mark KScopedDisableDispatch as nodiscard.bunnei2021-08-071-1/+1
| * | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-08-073-14/+24
| * | core: hle: kernel: k_auto_object: Add GetName method.bunnei2021-08-071-0/+4
| * | core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-08-074-16/+30
| * | core: hle: kernel: DisableDispatch on suspend threads.bunnei2021-08-071-0/+3
| * | core: hle: kernel: k_scheduler: Improve DisableScheduling and EnableScheduling.bunnei2021-08-071-14/+9
| * | core: hle: kernel: Use CurrentPhysicalCoreIndex as appropriate.bunnei2021-08-071-6/+2
| * | core: hle: kernel: k_scheduler: Remove unnecessary MakeCurrentProcess.bunnei2021-08-071-5/+0
| * | core: hle: kernel: k_scheduler: Improve ScheduleImpl.bunnei2021-08-071-6/+7
| * | core: hle: kernel: k_scheduler: Improve Unload.bunnei2021-08-071-17/+29
| * | core: hle: kernel: k_process: DisableDispatch on main thread.bunnei2021-08-071-0/+1
| * | core: hle: kernel: k_handle_table: Use KScopedDisableDispatch as necessary.bunnei2021-08-072-0/+8
| * | core: hle: kernel: k_thread: Add KScopedDisableDispatch.bunnei2021-08-072-1/+47
| * | core: hle: kernel: Ensure idle threads are closed before destroying scheduler.bunnei2021-08-073-24/+22
| * | core: hle: kernel: Reflect non-emulated threads as core 3.bunnei2021-08-075-4/+15
| |/
* | network: retrieve subnet mask and gateway infoSönke Holz2021-08-161-8/+16
* | nifm: use operator*() instead of .value() to get value of std::optionalSönke Holz2021-08-131-2/+2
* | nifm: treat a missing host IP address as a non-critical errorSönke Holz2021-08-131-2/+2
* | configuration: add option to select network interfacespholz2021-08-121-15/+21
* | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-072-99/+4
|\|
| * Merge pull request #6799 from ameerj/vp9-fixesbunnei2021-08-072-99/+4
| |\
| | * nvhost_nvdec_common: Remove BufferMapameerj2021-08-072-76/+0
| | * nvhost_nvdec_common: Stub UnmapBuffer Ioctlameerj2021-08-071-23/+4
* | | network: GetCurrentIpConfigInfo: return host IP addressSönke Holz2021-08-071-1/+4
|/ /
* | applet_swkbd: Include the null terminator in the buffer size calculationMorph2021-08-051-2/+4
* | service: set: Correct copy amount in GetAvailableLanguageCodesMorph2021-08-011-1/+2
|/
* hle: api_version: Update HOS version to 12.1.0Morph2021-07-311-7/+7
* Merge pull request #6752 from Morph1984/pt-brbunnei2021-07-303-10/+14
|\
| * service: set: Correct 4.0.0 max_entries to 0x40 (64) instead of 17Morph2021-07-301-8/+8
| * service: ns, set: Add PT_BR (Brazilian Portuguese)Morph2021-07-303-2/+6
* | applet_swkbd: Correct string buffer size calculationMorph2021-07-301-2/+2
|/
* Merge pull request #6751 from Morph1984/languagecodeAmeer J2021-07-292-42/+2
|\
| * service: ns: Remove unused ns_language headerMorph2021-07-271-42/+0
| * service: ns: Map ZH_TW and ZH_CN to Traditional/Simplified ChineseMorph2021-07-271-0/+2
* | Merge pull request #6742 from Morph1984/uuidbunnei2021-07-292-14/+14
|\ \ | |/ |/|
| * common: uuid: Return a lower-case hex string in FormatMorph2021-07-272-14/+14
* | Merge pull request #6696 from ameerj/speed-limit-renamebunnei2021-07-271-1/+1
|\ \
| * | general: Rename "Frame Limit" references to "Speed Limit"ameerj2021-07-241-1/+1
* | | Merge pull request #6697 from ameerj/fps-capbunnei2021-07-261-5/+6
|\ \ \ | |_|/ |/| |
| * | config, nvflinger: Add FPS cap settingameerj2021-07-241-5/+6
| |/
* | Merge pull request #6551 from bunnei/improve-kernel-objbunnei2021-07-2420-88/+325
|\ \ | |/ |/|
| * hle: service: kernel_helpers: Remove unnecessary pragma once.bunnei2021-07-211-2/+0
| * hle: kernel: svc: Remove part of ExitProcess.bunnei2021-07-211-5/+0
| * hle: service: nvdrv: Remove unused kernel reference.bunnei2021-07-211-1/+0
| * hle: service: hid: npad: Remove unused kernel reference.bunnei2021-07-211-1/+0
| * hle: kernel: Track and release server sessions, and protect methods with locks.bunnei2021-07-214-13/+82
| * hle: kernel: KProcess: Change process termination assert to a warning.bunnei2021-07-211-1/+1
| * hle: kernel: Ensure current running process is closed.bunnei2021-07-211-5/+6
| * hle: kernel: Ensure global handle table is finalized before closing.bunnei2021-07-211-0/+1
| * kernel: svc: ConnectToNamedPort: Close extra reference to port.bunnei2021-07-211-0/+1
| * hle: service: sm: Refactor to better manage ports.bunnei2021-07-214-45/+47
| * hle: kernel: k_process: Close the handle table on shutdown.bunnei2021-07-211-0/+3
| * hle: kernel: k_process: Close main thread reference after it is inserted into handle table.bunnei2021-07-211-0/+3
| * hle: kernel: Ensure global handle table is initialized.bunnei2021-07-211-0/+1
| * hle: service: Add a helper module for managing kernel objects.bunnei2021-07-219-20/+144
| * hle: kernel: Provide methods for tracking dangling kernel objects.bunnei2021-07-214-2/+43
* | applet_controller: Add preliminary support for version 8Morph2021-07-202-3/+33
|/
* Merge pull request #6525 from ameerj/nvdec-fixesFernando S2021-07-151-45/+40
|\
| * nvhost_nvdec_common: Read Submit ioctl data from object addrameerj2021-07-151-8/+2
| * nvhost_nvdec_common: Fix {Slice/Write}Vectors returnameerj2021-07-151-37/+38
* | applets/web: Resolve Nintendo CDN URLsMorph2021-07-151-0/+13
* | service: Append service name prefix to common filenamesMorph2021-07-1438-31/+31
* | applets: Append applet_ prefix to backend appletsMorph2021-07-1416-17/+17
* | Merge pull request #6599 from german77/disable_rumbleAmeer J2021-07-131-0/+5
|\ \
| * | npad: Disable vibration check if disabledgerman772021-07-111-0/+5
* | | boxcat: Silence -Wmaybe-uninitialized in httplib.hReinUsesLisp2021-07-121-0/+3
|/ /
* | Merge pull request #6539 from lat9nq/default-settingAmeer J2021-07-085-7/+8
|\ \
| * | core, input_common: Miscellaneous fixeslat9nq2021-06-291-1/+1
| * | general: Make most settings a BasicSettinglat9nq2021-06-284-6/+7
| |/
* | Report 2 channels active. Fixes Tales of Vesperia's mono channel audio.Kelebek12021-07-061-1/+1
* | service: mii: Retrieve the correct default miis.Morph2021-07-041-2/+3
* | Merge pull request #6498 from Kelebek1/Audiobunnei2021-07-031-5/+7
|\ \
| * | Fix XC2/VOEZ crashing, add audio looping and a few misc fixesKelebek12021-07-011-1/+1
| * | Decouple audio processing and run at variable rateKelebek12021-06-271-4/+6
* | | filesystem: Open a read-only directory for SDMC modsMorph2021-06-281-5/+9
* | | core: Simplify SDMC mod loadinglat9nq2021-06-281-1/+2
* | | core: Support LayeredFS mod from SDMC directorylat9nq2021-06-282-0/+10
|/ /
* | Merge pull request #6526 from bunnei/doom-updatebunnei2021-06-265-8/+60
|\ \ | |/ |/|
| * hle: service: hwopus: OpenHardwareOpusDecoderEx: Remove unused buffer size.bunnei2021-06-261-1/+30
| * hle: hle_helpers: Skip data payload offset checks on TIPC requests.bunnei2021-06-251-2/+6
| * hle: service: hwopus: Implement GetWorkBufferSizeEx and OpenHardwareOpusDecoderEx.bunnei2021-06-252-5/+15
| * hle: service: aoc: Stub GetAddOnContentListChangedEventWithProcessId.bunnei2021-06-252-1/+10
* | Merge pull request #6519 from Wunkolo/mem-size-literalbunnei2021-06-257-58/+74
|\ \ | |/ |/|
| * common: Replace common_sizes into user-literalsWunkolo2021-06-247-58/+74
* | Merge pull request #6522 from Morph1984/pragmabunnei2021-06-243-0/+6
|\ \
| * | general: Add missing #pragma once directivesMorph2021-06-243-0/+6
* | | Add missing includes (#6521)Chloe2021-06-241-0/+2
|/ /
* | Merge pull request #6517 from lioncash/fmtlibbunnei2021-06-241-3/+3
|\ \ | |/ |/|
| * General: Resolve fmt specifiers to adhere to 8.0.0 API where applicableLioncash2021-06-231-3/+3
* | Merge pull request #6504 from Kelebek1/samples-playedbunnei2021-06-231-1/+9
|\ \ | |/ |/|
| * Implement audout GetAudioOutPlayedSampleCountKelebek12021-06-221-1/+9
* | Merge pull request #6510 from ReinUsesLisp/npad-data-raceMai M2021-06-232-0/+8
|\ \
| * | npad: Fix data race when updating devicesRodrigo Locatti2021-06-222-0/+8
* | | Merge pull request #6493 from Morph1984/fs-nodiscardbunnei2021-06-231-2/+2
|\ \ \
| * | | common: fs: Remove [[nodiscard]] attribute on Remove* functionsMorph2021-06-221-2/+2
* | | | Merge pull request #6472 from Morph1984/splbunnei2021-06-237-45/+475
|\ \ \ \
| * | | | spl: Mark the other functions as unimplementedMorph2021-06-161-5/+30
| * | | | spl: Implement spl::GetConfigMorph2021-06-162-1/+90
| * | | | hle: api_version: Add HLE API version constantsMorph2021-06-161-0/+38
| * | | | spl: Add the general SPL interfaceMorph2021-06-164-45/+64
| * | | | spl: Add SPL typesMorph2021-06-161-0/+230
| * | | | spl: Add SPL result codesMorph2021-06-161-0/+29
* | | | | Merge pull request #6483 from Morph1984/get-tz-filebunnei2021-06-221-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: time: Use GetFileRelative to get files within subdirectoriesMorph2021-06-181-1/+1
| | |_|/ | |/| |
* | | | Merge pull request #6481 from Morph1984/missing-peak-setbunnei2021-06-221-0/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | kernel: Fix missing peak set in KResourceLimit::SetLimitValueMorph2021-06-181-0/+1
| |/ /
* / / nvflinger: Add toggle to disable buffer swap interval limitsameerj2021-06-171-0/+3
|/ /
* / fsp_srv: Fix filesystem access loggingMorph2021-06-162-12/+15
|/
* lm: Demote guest logs to LOG_DEBUGameerj2021-06-151-27/+20
* general: Remove extraneous includesMorph2021-06-131-1/+0
* hid: Stub IsFirmwareUpdateAvailableForSixAxisSensorgerman772021-06-112-1/+23
* kernel: Unconditionally set thread state when appropriateMorph2021-06-112-23/+12
* kernel: KLightConditionVariable: Update implementation to 12.xMorph2021-06-112-14/+31
* hle: service: sm: Remove redundant session reservation, etc.bunnei2021-06-102-18/+13
* hle: service: Increase arbitrary max sessions limit.bunnei2021-06-101-4/+1
* hle: kernel: KClientPort: Add an assert for session count.bunnei2021-06-101-0/+3
* hle: service: sm: Fix GetService setup of session & port.bunnei2021-06-102-5/+5
* hle: service: Use correct size for ServerSessionCountMax.bunnei2021-06-101-4/+6
* hle: kernel: KServerSession: Fix client disconnected.bunnei2021-06-103-9/+8
* kernel: svc: Add missing error check to CancelSynchronization.bunnei2021-06-101-2/+2
* hle: service: Increase arbitrary max sessions limit.bunnei2021-06-091-1/+1
* hle: kernel: KServerSession: Work-around scenario where session is closed too early.bunnei2021-06-081-7/+24
* hle: kernel: hle_ipc: Ensure SessionRequestHandler is valid.bunnei2021-06-083-5/+26
* hle: kernel: Remove service thread manager and use weak_ptr.bunnei2021-06-083-18/+8
* Merge pull request #6414 from bunnei/fix-service-threadsbunnei2021-06-0721-87/+101
|\
| * hle: kernel: KServerSession: Use ASSERT_MSG where appropriate.bunnei2021-06-071-1/+1
| * hle: kernel: k_server_session: Return service thread by strong pointer.bunnei2021-06-072-4/+4
| * hle: kernel: k_server_session: Ensure service thread is valid before dereference.bunnei2021-06-071-1/+3
| * hle: kernel: hle_ipc: Use default destructor for SessionRequestManager.bunnei2021-06-071-1/+1
| * hle: kernel: KAutoObjectWithListContainer: Use boost::instrusive::rbtree.bunnei2021-06-0711-22/+26
| * hle: kernel: Refactor to allocate a ServiceThread per service handler.bunnei2021-06-0513-67/+75
* | result: Add [[nodiscard]] specifiers where applicableLioncash2021-06-051-20/+20
|/
* fsp-srv: Replace one last instance of RESULT_SUCCESSMorph2021-06-031-1/+1
* fspsrv: Implement DisableAutoSaveDataCreation (#6355)Chloe2021-06-034-1/+17
* general: Replace RESULT_UNKNOWN with ResultUnknownMorph2021-06-0211-40/+40
* general: Replace RESULT_SUCCESS with ResultSuccessMorph2021-06-02110-928/+925
* common_funcs: Move R_ macros to result.hLioncash2021-05-311-0/+25
* Merge pull request #6377 from lioncash/pointbunnei2021-05-303-39/+17
|\
| * touchscreen: Make use of common point structLioncash2021-05-282-10/+10
| * common: Extract point into a common structLioncash2021-05-281-29/+7
* | Merge pull request #6387 from lioncash/class-tokenbunnei2021-05-301-43/+36
|\ \
| * | k_class_token: Use variable templates where applicableLioncash2021-05-291-43/+36
| |/
* | Merge pull request #6374 from Morph1984/swkbd-textcheck-encodingMai M2021-05-301-10/+15
|\ \
| * | applets/swkbd: Make use of std::move where applicableMorph2021-05-281-8/+8
| * | applets/swkbd: Only read the text check message on Failure/ConfirmMorph2021-05-281-2/+7
| |/
* | Merge pull request #6364 from german77/stub-lp2pMai M2021-05-301-0/+141
|\ \
| * | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkServicegerman772021-05-261-0/+141
| |/
* | Merge pull request #6384 from lioncash/virtualbunnei2021-05-2915-53/+48
|\ \
| * | kernel: Add missing override specifiersLioncash2021-05-2915-53/+48
| |/
* | Merge pull request #6382 from lioncash/nullbunnei2021-05-291-5/+5
|\ \
| * | k_thread: Move dereference after null check in Initialize()Lioncash2021-05-291-5/+5
| |/
* | Merge pull request #6373 from bunnei/use-slabheap-tlsbunnei2021-05-292-11/+191
|\ \
| * | hle: kernel: KSlabHeap: Allow host or guest allocations.bunnei2021-05-292-11/+191
* | | Fix two GCC 11 warnings: Unneeded copies.Markus Wick2021-05-291-1/+1
* | | Merge pull request #6371 from degasus/drop_ExceptionalExitbunnei2021-05-291-1/+0
|\ \ \ | |/ / |/| |
| * | core/arm_interface: Call SVC after end of dynarmic block.Markus Wick2021-05-271-1/+0
| |/
* | Merge pull request #6356 from ogniK5377/ApplyNpadSystemCommonPolicybunnei2021-05-281-1/+10
|\ \ | |/ |/|
| * hid: ApplyNpadSystemCommonPolicyChloe Marcec2021-05-241-1/+10
* | Merge pull request #6331 from lioncash/gestureMorph2021-05-262-67/+79
|\ \
| * | hid/gesture: Factor out last gesture retrieval into its own functionLioncash2021-05-182-14/+23
| * | hid/gesture: Ensure all ID arrays are initializedLioncash2021-05-181-4/+4
| * | hid/gesture: Make Point a templateLioncash2021-05-182-38/+46
| * | hid/gesture: Replace x,y members of GestureState with a PointLioncash2021-05-182-6/+4
| * | hid/gesture: Add default comparators to PointLioncash2021-05-182-10/+7
| * | hid/gesture: Rename Points to PointLioncash2021-05-181-5/+5
* | | common: fs: Rework the Common Filesystem interface to make use of std::filesystem (#6270)Morph2021-05-269-95/+111
* | | kernel: process_capability: Add MapRegion capabilityMorph2021-05-252-0/+12
| |/ |/|
* | hle: kernel: service_thread: Take reference to KServerSession on service request.bunnei2021-05-211-9/+5
* | hle: kernel: k_port: Use AcceptSession to ensure SessionList state is correct.bunnei2021-05-211-1/+1
* | hle: kernel: Use host memory allocations for KSlabMemory.bunnei2021-05-212-144/+20
* | Revert "WORKAROUND: Do not use slab heap while we track down issues with resource management."bunnei2021-05-211-2/+2
* | hle: kernel: hle_ipc: Simplify incoming/outgoing move/copy/domain objects.bunnei2021-05-213-62/+17
* | hle: kernel: Implement CloneCurrentObject and improve session management.bunnei2021-05-2113-99/+184
* | Revert "WORKAROUND: temp. disable session resource limits while we work out issues"bunnei2021-05-214-11/+11
* | Merge pull request #6320 from Morph1984/get-pidbunnei2021-05-212-9/+14
|\ \
| * | hle_ipc: unsigned -> u32Morph2021-05-161-7/+7
| * | hle_ipc: Add a getter for PIDMorph2021-05-162-2/+7
* | | Merge pull request #6317 from ameerj/fps-fixbunnei2021-05-191-1/+0
|\ \ \
| * | | perf_stats: Rework FPS counter to be more accurateameerj2021-05-161-1/+0
* | | | KTransferMemory: Return size instead of size * PageSize in GetSize()Morph2021-05-181-1/+1
| |_|/ |/| |
* | | Merge pull request #6284 from ameerj/shantae-fixbunnei2021-05-162-5/+35
|\ \ \
| * | | nvflinger: Create layers when they are queried but not foundameerj2021-05-062-5/+35
* | | | Merge pull request #6296 from lioncash/shadow-errorbunnei2021-05-1663-194/+212
|\ \ \ \
| * | | | core: Make variable shadowing a compile-time errorLioncash2021-05-1663-194/+212
| | |_|/ | |/| |
* | | | Merge pull request #6307 from Morph1984/fix-response-push-sizebunnei2021-05-162-2/+2
|\ \ \ \ | |/ / / |/| | |
| * | | nifm, ssl: Fix incorrect response sizesMorph2021-05-162-2/+2
| | |/ | |/|
* | | Merge pull request #6299 from bunnei/ipc-improvementsbunnei2021-05-1618-219/+353
|\ \ \ | |/ / |/| |
| * | hle: kernel: hle_ipc: Fix outgoing IPC response size calculation.bunnei2021-05-113-1/+15
| * | WORKAROUND: temp. disable session resource limits while we work out issuesbunnei2021-05-114-11/+11
| * | WORKAROUND: Do not use slab heap while we track down issues with resource management.bunnei2021-05-111-2/+2
| * | audrenbunnei2021-05-112-25/+16
| * | core: hle: ipc_helpers: Fix cast on raw_data_size calculation.bunnei2021-05-111-1/+1
| * | hle: service: sm: Add TIPC support.bunnei2021-05-112-41/+66
| * | hle: kernel: hle_ipc: Improve IPC code and add initial support for TIPC.bunnei2021-05-112-81/+57
| * | hle: service: sm: GetService: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+7
| * | hle: service: Add support for dispatching TIPC requests.bunnei2021-05-112-1/+52
| * | hle: service: Implement IPC::CommandType::Close.bunnei2021-05-113-11/+15
| * | hle: service: sm: Use RegisterNamedService to register the service.bunnei2021-05-111-1/+1
| * | hle: service: sm: Improve Initialize implementation.bunnei2021-05-112-0/+3
| * | hle: kernel: svc: Update ConnectToNamedPort to use new CreateNamedServicePort interface.bunnei2021-05-111-4/+3
| * | hle: kernel: Implement named service ports using service interface factory.bunnei2021-05-114-22/+30
| * | hle: kernel: KSession: Improve implementation of CloneCurrentObject.bunnei2021-05-111-2/+10
| * | hle: service: sm: Increase point buffer size.bunnei2021-05-111-1/+1
| * | hle: ipc_helpers: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+5
| * | hle: kernel: KClientPort: Cleanup comment format.bunnei2021-05-111-1/+1
| * | hle: ipc: Add declarations for TIPC.bunnei2021-05-111-1/+16
| * | hle: kernel: Further cleanup and add TIPC helpers.bunnei2021-05-112-4/+12
| * | hle: ipc_helpers: Update IPC response generation for TIPC.bunnei2021-05-112-19/+39
* | | ssl: Stub Import(Client/Server)PkiMorph2021-05-131-2/+40
* | | Merge pull request #6267 from german77/gestureRewriteMorph2021-05-122-76/+340
|\ \ \ | |/ / |/| |
| * | hid: Improve hardware accuracy of gesturesgerman772021-05-052-76/+340
* | | Merge pull request #6291 from lioncash/kern-shadowbunnei2021-05-1040-140/+138
|\ \ \
| * | | kernel: Eliminate variable shadowingLioncash2021-05-0840-140/+138
* | | | kernel: Delete unused filesgerman772021-05-092-151/+0
|/ / /
* | | Merge pull request #6266 from bunnei/kautoobject-refactorbunnei2021-05-08140-2699/+4595
|\ \ \
| * | | hle: kernel: KPageTable: CanContain should not be constexpr.bunnei2021-05-062-2/+2
| * | | hle: kernel: Move slab resource counts to Kernel.bunnei2021-05-064-33/+52
| * | | fixup! hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-061-2/+2
| * | | fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| * | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| * | | kernel: svc: Remove unused RetrieveResourceLimitValue function.bunnei2021-05-061-32/+0
| * | | hle: kernel: Fix un/sign mismatch errors with NUM_CPU_CORES.bunnei2021-05-061-3/+3
| * | | fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-6/+2
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-0/+3
| * | | fixup! hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-061-7/+0
| * | | fixup! hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-062-2/+2
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-061-12/+12
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-063-22/+28
| * | | fixup! hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-60/+58
| * | | fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-11/+9
| * | | fixup! hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-061-9/+2
| * | | fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-46/+46
| * | | fixup! hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Add initial impl. of slab setup.bunnei2021-05-061-8/+8
| * | | common: Rename NON_COPYABLE/NON_MOVABLE with YUZU_ prefix.bunnei2021-05-064-9/+9
| * | | fixup! hle: kernel: Rename Process to KProcess.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Migrate to KHandleTable.bunnei2021-05-061-1/+1
| * | | fixup! hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-061-3/+3
| * | | hle: kernel: svc: ConnectToNamedPort: Use KHandleTable::Reserve.bunnei2021-05-061-3/+8
| * | | hle: kernel: Migrate to KHandleTable.bunnei2021-05-0619-375/+496
| * | | hle: kernel: KClassToken: Ensure class tokens are correct.bunnei2021-05-061-1/+127
| * | | hle: kernel: Improve MapSharedMemory and implement UnmapSharedMemory.bunnei2021-05-0610-95/+210
| * | | hle: kernel: Rename Process to KProcess.bunnei2021-05-0646-160/+162
| * | | hle: kernel: Remove deprecated Object class.bunnei2021-05-0635-404/+15
| * | | hle: kernel: Do not shutdown twice on emulator close.bunnei2021-05-061-3/+1
| * | | hle: kernel: Cleanup shutdown of persistent kernel objects.bunnei2021-05-061-14/+12
| * | | hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-0621-166/+442
| * | | hle: kernel: Migrate KServerPort to KAutoObject.bunnei2021-05-067-50/+65
| * | | hle: kernel: Migrate KClientPort to KAutoObject.bunnei2021-05-0616-60/+89
| * | | hle: kernel: HandleTable: Remove deprecated APIs.bunnei2021-05-065-106/+23
| * | | hle: kernel: Migrate KResourceLimit to KAutoObject.bunnei2021-05-0613-122/+197
| * | | hle: kernel: svc: Migrate WaitSynchronization.bunnei2021-05-062-47/+78
| * | | hle: kernel: svc: Use new handle table API for Process.bunnei2021-05-062-16/+17
| * | | hle: kernel: Migrate KTransferMemory to KAutoObject.bunnei2021-05-0611-66/+207
| * | | hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-0630-350/+406
| * | | hle: kernel: svc: Migrate GetThreadContext, GetThreadCoreMask.bunnei2021-05-061-2/+59
| * | | hle: kernel: svc: Migrate GetProcessId, CancelSynchronization, SetThreadActivity.bunnei2021-05-061-13/+67
| * | | hle: kernel: KThread: Remove incorrect resource release.bunnei2021-05-061-2/+1
| * | | hle: kernel: svc_results: Update naming..bunnei2021-05-068-42/+43
| * | | hle: kernel: KThread: Add missing resource hint release.bunnei2021-05-061-1/+1
| * | | hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-0635-200/+215
| * | | hle: ipc_helpers: Add methods for copy/move references.bunnei2021-05-061-2/+24
| * | | hle: kernel: Move slab heaps to their own container.bunnei2021-05-062-10/+16
| * | | hle: kernel: Refactor several threads/events/sharedmemory to use slab heaps.bunnei2021-05-0610-58/+52
| * | | hle: kernel: Move slab heap management to KernelCore.bunnei2021-05-067-64/+106
| * | | hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-0620-0/+55
| * | | hle: kernel: Use unique_ptr for suspend and dummy threads.bunnei2021-05-061-8/+8
| * | | hle: kernel: Migrate KEvent to KAutoObject.bunnei2021-05-0637-266/+269
| * | | hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-0616-114/+128
| * | | hle: kernel: Migrate KProcess to KAutoObject.bunnei2021-05-0612-54/+73
| * | | hle: kernel: Refactor IPC interfaces to not use std::shared_ptr.bunnei2021-05-0628-59/+65
| * | | hle: kernel: Migrate more of KThread to KAutoObject.bunnei2021-05-0616-289/+442
| * | | hle: kernel: svc: Migrate GetThreadPriority, StartThread, and ExitThread.bunnei2021-05-061-21/+12
| * | | hle: kernel: svc: Migrate CreateThread.bunnei2021-05-061-14/+21
| * | | hle: kernel: Migrate idle threads.bunnei2021-05-062-13/+9
| * | | hle: kernel: Migrate KThread to KAutoObject.bunnei2021-05-062-109/+91
| * | | hle: kernel: Add initial impl. of slab setup.bunnei2021-05-062-0/+225
| * | | hle: kernel: Refactor out various KThread std::shared_ptr usage.bunnei2021-05-0610-58/+30
| * | | hle: kernel: Add initial impl. of KLinkedList.bunnei2021-05-061-0/+233
| * | | hle: kernel: Add initial impl. of KSlabAllocated.bunnei2021-05-061-0/+152
| * | | hle: kernel: Add initial impl. of KAutoObjectWithListContainer.bunnei2021-05-062-0/+107
| * | | hle: kernel: Add initial impl. of KAutoObject.bunnei2021-05-062-0/+304
| | |/ | |/|
* | | Merge pull request #6287 from lioncash/ldr-copybunnei2021-05-071-5/+3
|\ \ \ | |/ / |/| |
| * | ldr: Simplify memory copy within LoadNro()Lioncash2021-05-071-5/+3
* | | Merge pull request #6279 from ogniK5377/nvhost-profbunnei2021-05-061-3/+14
|\ \ \ | |/ / |/| |
| * | Update src/core/hle/service/nvdrv/interface.cppbunnei2021-05-061-1/+1
| * | nvdrv: /dev/nvhost-prof-gpu for productionChloe Marcec2021-05-031-3/+14
* | | service: Remove unused class variablesLioncash2021-05-053-7/+4
| |/ |/|
* | service: Resolve cases of member field shadowingLioncash2021-05-0456-101/+103
|/
* hid: Fix touch not initializing properly if disabledgerman772021-05-032-2/+10
* Merge pull request #6265 from Morph1984/snap-save-fixbunnei2021-05-021-2/+7
|\
| * service: filesystem: Return proper error codes for CreateFileMorph2021-05-011-2/+7
* | Disable touch if setting is not enabledgerman772021-05-012-2/+2
|/
* Merge pull request #6226 from german77/sevensixbunnei2021-04-307-12/+201
|\
| * address commentsgerman772021-04-272-5/+5
| * hid: Implement SevenSixAxis and ConsoleSixAxisSensorgerman772021-04-247-12/+201
* | service: Eliminate cases of member shadowingLioncash2021-04-2615-76/+81
* | nvhost_vic: Fix device closureameerj2021-04-252-10/+8
* | Merge pull request #6234 from Morph1984/stub-amMat M2021-04-242-1/+10
|\ \
| * | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabledMorph2021-04-242-1/+10
* | | Merge pull request #6235 from german77/ectx_awMat M2021-04-243-0/+47
|\ \ \
| * | | glue: Add ectx:aw placeholdergerman772021-04-243-0/+47
| | |/ | |/|
* | | Merge pull request #6228 from lioncash/semibunnei2021-04-241-6/+7
|\ \ \ | |_|/ |/| |
| * | lm: Make use of insert_or_assign() in Log()Lioncash2021-04-231-1/+1
| * | lm: Prevent redundant map lookups in Log()Lioncash2021-04-231-4/+5
| * | lm: Resolve -Wextra-semi warningLioncash2021-04-231-1/+1
* | | Merge pull request #6229 from lioncash/unused-varbunnei2021-04-242-6/+0
|\ \ \ | |_|/ |/| |
| * | acc/lbl: Remove unused variablesLioncash2021-04-232-6/+0
| |/
* / service: hid: Get transfer memory for InitializeSevenSixAxisSensorMorph2021-04-221-1/+38
|/
* Merge pull request #6214 from Morph1984/time-fix-kirby-clashbunnei2021-04-211-3/+5
|\
| * time: Write buffer before pushing RESULT_SUCCESS in GetClockSnapshotMorph2021-04-191-1/+2
| * time: Fix GetClockSnapshotFromSystemClockContextMorph2021-04-191-2/+3
* | Merge pull request #6217 from Morph1984/consistent-writebuffersbunnei2021-04-203-5/+12
|\ \
| * | general: Write buffers before pushing raw argumentsMorph2021-04-193-5/+12
| |/
* | Merge pull request #6215 from lioncash/duplicatebunnei2021-04-202-2/+1
|\ \
| * | npad: Remove duplicated class member variableLioncash2021-04-192-2/+1
| |/
* | arp: Use type alias for issue functionLioncash2021-04-191-4/+4
* | arp: Prevent uninitialized read of launch member variableLioncash2021-04-191-1/+1
|/
* applets: Send focus state change message on applet state changeMorph2021-04-1710-22/+56
* applets: Make the applet mode a protected property of AppletMorph2021-04-1714-22/+20
* Merge pull request #6125 from ogniK5377/nvdec-close-devbunnei2021-04-171-6/+4
|\
| * nvdrv: Cleanup CDMA Processor on device closureChloe Marcec2021-03-301-6/+4
* | applets/swkbd: Implement the Normal and Inline Software Keyboard AppletMorph2021-04-153-13/+1487
* | ILibraryAppletCreator: Implement CreateHandleStorageMorph2021-04-152-6/+64
* | hle_ipc: Add helper functions to get copy/move handlesMorph2021-04-152-2/+16
* | ILibraryAppletAccessor: Demote from ERROR to DEBUG for null storage logsMorph2021-04-151-2/+2
* | applets: Pass in the LibraryAppletMode each applet's constructorMorph2021-04-1513-33/+58
* | applets: Remove the previous software keyboard applet implementationMorph2021-04-152-227/+6
* | Merge pull request #6196 from bunnei/asserts-settingbunnei2021-04-1528-28/+28
|\ \
| * | common: Move settings to common from core.bunnei2021-04-1528-28/+28
* | | k_resource_limit: Minor cleanup of member variables/headersameerj2021-04-144-21/+13
* | | Merge pull request #6185 from ameerj/process-reslimitbunnei2021-04-142-38/+27
|\ \ \ | |/ / |/| |
| * | kernel/process: Replace process resource limit instance with the kernel's resource limitameerj2021-04-122-38/+27
* | | k_thread: Remove [[nodiscard]] attribute from ClearWaitCancelled()Lioncash2021-04-121-1/+1
|/ /
* | Merge pull request #6170 from Morph1984/more-time-fixesbunnei2021-04-116-21/+38
|\ \
| * | service: time: Setup the network clock with the local clock contextMorph2021-04-086-21/+38
* | | Merge pull request #6167 from Morph1984/time-fixbunnei2021-04-111-3/+8
|\ \ \
| * | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUserMorph2021-04-081-3/+8
* | | | Merge pull request #6112 from ogniK5377/pctlbunnei2021-04-114-31/+244
|\ \ \ \
| * | | | Addressed issuesChloe Marcec2021-03-302-21/+22
| * | | | pctl: Rework how pctl works to be more accurateChloe Marcec2021-03-264-31/+243
* | | | | Merge pull request #6099 from bunnei/derive-membunnei2021-04-1023-172/+2087
|\ \ \ \ \
| * | | | | hle: kernel: Breakup InitializeMemoryLayout.bunnei2021-03-241-3/+7
| * | | | | hle: kernel: k_memory_region_type: Minor code cleanup.bunnei2021-03-241-13/+12
| * | | | | hle: kernel: k_memory_region: Minor code cleanup.bunnei2021-03-241-7/+5
| * | | | | hle: kernel: k_memory_layout: Use pair instead of tuple.bunnei2021-03-241-2/+4
| * | | | | hle: kernel: k_system_control: Remove unnecessary inline.bunnei2021-03-241-4/+4
| * | | | | common: common_sizes: Move sizes to the Common namespace.bunnei2021-03-244-45/+46
| * | | | | hle: kernel: Merge KMemoryRegionAttr and KMemoryRegionType.bunnei2021-03-212-11/+9
| * | | | | hle: kernel: Remove unused variable.bunnei2021-03-211-1/+0
| * | | | | hle: kernel: k_memory_region_type: Remove extra ".bunnei2021-03-211-1/+1
| * | | | | hle: kernel: k_memory_layout: Move KMemoryRegionAllocator out of global.bunnei2021-03-213-35/+47
| * | | | | hle: kernel: k_memory_layout: Derive memory regions based on board layout.bunnei2021-03-215-56/+1031
| * | | | | common: common_sizes: Move Invalid to Size_* prefix and add missing values.bunnei2021-03-211-14/+14
| * | | | | hle: kernel: k_memory_region: Refactor to simplify code.bunnei2021-03-212-83/+89
| * | | | | hle: kernel: board: k_system_control: Extend to include memory region sizes.bunnei2021-03-212-1/+125
| * | | | | hle: kernel: board: Add secure_monitor module.bunnei2021-03-211-0/+26
| * | | | | common: Move common sizes to their own header for code reuse.bunnei2021-03-211-13/+1
| * | | | | hle: kernel: k_address_space_info: Cleanup.bunnei2021-03-211-9/+9
| * | | | | hle: kernel: Add k_trace module.bunnei2021-03-211-0/+12
| * | | | | hle: kernel: KSystemControl: Update to reflect board-specific behavior.bunnei2021-03-213-9/+39
| * | | | | hle: kernel: KMemoryManager: Add CalculateManagementOverheadSize.bunnei2021-03-212-0/+26
| * | | | | hle: kernel: KMemoryManager: Add aliases.bunnei2021-03-211-0/+4
| * | | | | hle: kernel: Add architecture and board specific memory regions.bunnei2021-03-212-0/+72
| * | | | | hle: kernel: KMemoryRegion: Derive region values.bunnei2021-03-211-0/+327
| * | | | | hle: kernel: Migrate some code from Common::SpinLock to KSpinLock.bunnei2021-03-215-25/+25
| * | | | | hle: kernel: Add initial KMemoryRegionType module.bunnei2021-03-212-18/+40
| * | | | | hle: kernel: Move KMemoryRegion to its own module and update.bunnei2021-03-213-31/+321
* | | | | | Merge pull request #6171 from german77/servicesbunnei2021-04-1030-97/+137
|\ \ \ \ \ \
| * | | | | | wlan: Update to 12.xgerman772021-04-091-0/+7
| * | | | | | usb: Use proper namesgerman772021-04-091-21/+21
| * | | | | | ITimeZoneService: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | spl: Update to 12.xgerman772021-04-091-0/+3
| * | | | | | sfdnsres: Use proper namesgerman772021-04-091-2/+2
| * | | | | | nsd: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | ethc: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | sm: Use proper names, update to 12.xgerman772021-04-091-4/+5
| * | | | | | set_sys: Update to 12.xgerman772021-04-091-0/+6
| * | | | | | pctl_module: Update to 12.xgerman772021-04-091-0/+3
| * | | | | | pcie: Use proper namesgerman772021-04-091-1/+1
| * | | | | | olsc: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | pl_u: Update to 12.xgerman772021-04-091-0/+4
| * | | | | | ldr: Use proper namesgerman772021-04-091-16/+16
| * | | | | | arp: Use proper names, update to 12.xgerman772021-04-092-3/+10
| * | | | | | caps_u: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | caps_a: Update to 12.xgerman772021-04-091-0/+1
| * | | | | | bpc: Use proper namesgerman772021-04-091-2/+2
| * | | | | | bcat_module: Update to 12.xgerman772021-04-091-0/+2
| * | | | | | codecctl: Use proper namesgerman772021-04-091-13/+13
| * | | | | | audren_u: Use proper namesgerman772021-04-092-4/+4
| * | | | | | audren_a: Use proper namesgerman772021-04-091-6/+6
| * | | | | | audrec_u: Use proper names, update to 12.xgerman772021-04-091-3/+4
| * | | | | | audrec_a: Use proper namesgerman772021-04-091-2/+2
| * | | | | | audout_u: Use proper namesgerman772021-04-091-3/+3
| * | | | | | audout_a: Use proper namesgerman772021-04-091-6/+6
| * | | | | | audin_u: Use proper namesgerman772021-04-091-7/+7
| * | | | | | audin_a: Use proper namesgerman772021-04-091-4/+4
* | | | | | | Merge pull request #6156 from lioncash/lock-discardbunnei2021-04-103-9/+12
|\ \ \ \ \ \ \
| * | | | | | | Amend bizarre clang-format suggestionsLioncash2021-04-073-5/+5
| * | | | | | | k_scoped_scheduler_lock_and_sleep: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| * | | | | | | k_scoped_lock: delete copy and move assignment operatorsLioncash2021-04-071-2/+5
| * | | | | | | k_scoped_lock: Mark class as [[nodiscard]]Lioncash2021-04-071-1/+1
| * | | | | | | k_scheduler: Mark KScopedSchedulerLock as [[nodiscard]]Lioncash2021-04-071-1/+1
* | | | | | | | Merge pull request #6113 from german77/playhistorybunnei2021-04-101-1/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | Friend: Stub GetPlayHistoryRegistrationKeygerman772021-03-271-1/+13
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #6158 from german77/hidServiceTablesbunnei2021-04-102-0/+85
|\ \ \ \ \ \ \ \
| * | | | | | | | hid: Update service function tablesgerman772021-04-072-0/+85
| | |/ / / / / / | |/| | | | | |
* | | | | | | | ns: Update to 12.xMorph2021-04-091-3/+38
* | | | | | | | aoc_u: Update to 12.xMorph2021-04-091-0/+2
* | | | | | | | nim: Update to 12.xMorph2021-04-091-44/+55
* | | | | | | | npns: Update to 12.xMorph2021-04-091-0/+3
* | | | | | | | bgtc: Update to 12.x and implement OpenTaskServiceMorph2021-04-092-1/+34
* | | | | | | | vi: Update to 12.xMorph2021-04-091-0/+8
* | | | | | | | erpt: Update to 12.xMorph2021-04-091-1/+6
* | | | | | | | btm: Update to 12.xMorph2021-04-091-0/+1
* | | | | | | | btdrv: Update to 12.xMorph2021-04-091-0/+19
* | | | | | | | Merge pull request #6168 from Morph1984/stub-SetNpadAnalogStickUseCenterClampbunnei2021-04-094-1/+29
|\ \ \ \ \ \ \ \
| * | | | | | | | service: hid: Stub SetAnalogStickUseCenterClampMorph2021-04-084-1/+29
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #6155 from ameerj/kernel-12-rescntbunnei2021-04-091-2/+2
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | kernel: Increase event and session countsameerj2021-04-071-2/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #6157 from Morph1984/am-update-12.xbunnei2021-04-091-0/+22
|\ \ \ \ \ \ \
| * | | | | | | ISelfController: Update to 11.xMorph2021-04-071-0/+1
| * | | | | | | IApplicationFunctions: Update to 11.xMorph2021-04-071-0/+6
| * | | | | | | IDebugFunctions: Update to 12.xMorph2021-04-071-0/+2
| * | | | | | | ICommonStateGetter: Update to 12.xMorph2021-04-071-0/+9
| * | | | | | | IGlobalStateController: Update to 12.xMorph2021-04-071-0/+1
| * | | | | | | IHomeMenuFunctions: Update to 12.xMorph2021-04-071-0/+3
| |/ / / / / /
* | | | | | | Merge pull request #6062 from ameerj/auto-stubbunnei2021-04-091-0/+6
|\ \ \ \ \ \ \
| * | | | | | | configuration: Add auto stub toggle that resets on bootameerj2021-03-301-4/+6
| * | | | | | | service: Auto stub fallbackameerj2021-03-301-0/+4
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #6145 from lat9nq/nvhost_empty_memcpybunnei2021-04-081-6/+11
|\ \ \ \ \ \ \
| * | | | | | | nvhost_nvdec_common: Avoid memcpy with null pointerslat9nq2021-04-051-6/+11
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #6154 from lioncash/svcrange2bunnei2021-04-081-0/+132
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | svc: Expand SVC tablesLioncash2021-04-071-0/+132
| |/ / / / /
* | | | | | Merge pull request #6160 from Morph1984/fs-update-12.xbunnei2021-04-082-6/+15
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | IFile: Update to 12.xMorph2021-04-071-3/+7
| * | | | | fsp-srv: Update to 12.xMorph2021-04-072-3/+8
| |/ / / /
* | | | | Merge pull request #6143 from lat9nq/nvhost_null_memcpybunnei2021-04-081-1/+7
|\ \ \ \ \
| * | | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpylat9nq2021-04-051-1/+7
| |/ / / /
* | | | | Merge pull request #6159 from Morph1984/acc-update-12.xbunnei2021-04-073-36/+45
|\ \ \ \ \
| * | | | | dauth_o: Update to 11.xMorph2021-04-071-6/+11
| * | | | | acc_u1: Update to 12.xMorph2021-04-071-13/+15
| * | | | | acc_su: Update to 12.xMorph2021-04-071-17/+19
| |/ / / /
* | | | | Merge pull request #6153 from lioncash/svcrangebunnei2021-04-072-6/+1
|\ \ \ \ \
| * | | | | process_capability: Handle extended SVC rangeLioncash2021-04-072-6/+1
| |/ / / /
* / / / / hwopus: Update to 12.xMorph2021-04-071-0/+4
|/ / / /
* | | | Merge pull request #6131 from german77/rightjoyconSLSRMorph2021-04-021-2/+6
|\ \ \ \
| * | | | HID: Fix SL and SR buttons for right joycongerman772021-04-021-2/+6
| | |/ / | |/| |
* | | | ISelfController: Stub SetAlbumImageTakenNotificationEnabledMorph2021-03-302-1/+17
| |/ / |/| |
* | | Merge pull request #6109 from german77/gestureIDbunnei2021-03-302-3/+13
|\ \ \
| * | | HID: Initialize correctly the gesture finger_id and filter invalid resultsNarr the Reg2021-03-262-3/+13
| |/ /
* | | Merge pull request #6102 from ogniK5377/fd-passbunnei2021-03-2920-78/+161
|\ \ \
| * | | nvdrv: Pass device fd and handle device create methods for device opening and closingChloe Marcec2021-03-2520-78/+161
| |/ /
* | | Merge pull request #6115 from bunnei/fix-kernel-initbunnei2021-03-281-1/+1
|\ \ \
| * | | hle: kernel: Initialize preemption task after schedulers.bunnei2021-03-271-1/+1
| |/ /
* / / service: friend: Change logging class from ACC to FriendMorph2021-03-271-11/+12
|/ /
* / nvdrv: Change InitializeEx to AllocAsExChloe Marcec2021-03-222-27/+49
|/
* Merge pull request #6052 from Morph1984/vi-getindirectlayerimagemapbunnei2021-03-201-1/+27
|\
| * IApplicationDisplayService: Stub GetIndirectLayerImageMapMorph2021-03-171-1/+27
* | Merge pull request #6056 from zkitX/spl-updatesbunnei2021-03-183-9/+178
|\ \ | |/ |/|
| * Fix casing on DeallocateAesKeySlotzkitx2021-03-111-3/+3
| * Update SPL to fit N's service refactor (4.0.0+) which split into new services.zkitx2021-03-113-9/+178
* | bsd: Avoid writing empty buffersMorph2021-03-161-2/+6
* | Merge pull request #6054 from Morph1984/time-GetClockSnapshotbunnei2021-03-141-0/+2
|\ \
| * | time: Assign the current time point to the ClockSnapshotMorph2021-03-101-0/+2
| |/
* / time: Fix CalculateSpanBetween implementationMorph2021-03-101-3/+9
|/
* common: Fiber: use a reference for YieldTo.bunnei2021-03-071-8/+3
* hle: kernel: KThread: Rework dummy threads & fix memory leak.bunnei2021-03-066-36/+65
* Revert "core: Switch to unique_ptr for usage of Common::Fiber."bunnei2021-03-065-24/+23
* Merge pull request #6006 from bunnei/fiber-unique-ptrbunnei2021-03-055-23/+24
|\
| * core: Switch to unique_ptr for usage of Common::Fiber.bunnei2021-02-275-23/+24
* | Merge pull request #6007 from bunnei/ldn-errorbunnei2021-02-281-1/+1
|\ \
| * | core: hle: ldn: Error out on call to Initialization.bunnei2021-02-271-1/+1
| |/
* | Merge pull request #5276 from german77/gesturesMorph2021-02-282-11/+240
|\ \ | |/ |/|
| * Implements touch, pan, pinch and rotation gesturesgerman2021-02-282-11/+240
* | Merge pull request #5953 from bunnei/memory-refactor-1bunnei2021-02-2742-1184/+1393
|\ \
| * | hle: kernel: Migrate PageHeap/PageTable to KPageHeap/KPageTable.bunnei2021-02-1914-134/+118
| * | hle: kernel: Migrate MemoryManager to KMemoryManager.bunnei2021-02-197-45/+46
| * | hle: kernel: Migrate PageLinkedList to KPageLinkedList.bunnei2021-02-197-37/+40
| * | hle: kernel: Migrate to KMemoryBlock, KMemoryBlockManager, and others.bunnei2021-02-1917-472/+475
| * | hle: kernel: Migrate SlabHeap to KSlabHeap.bunnei2021-02-193-21/+20
| * | hle: kernel: Migrate MemoryLayout to KMemoryLayout.bunnei2021-02-194-30/+29
| * | hle: kernel: Migrate AddressSpaceInfo to KAddressSpaceInfo.bunnei2021-02-193-57/+52
| * | hle: kernel: memory_manager: Rename AllocateContinuous to AllocateContinuous.bunnei2021-02-192-4/+28
| * | hle: kernel: KSystemControl does not belong in Memory namespace.bunnei2021-02-196-29/+36
| * | hle: kernel: memory: PageHeap: Migrate to KPageBitmap class.bunnei2021-02-194-197/+23
| * | hle: kernel: Add KPageBitmap class.bunnei2021-02-191-0/+279
| * | hle: kernel: system_control: Add function GenerateRandomU64.bunnei2021-02-192-3/+5
| * | hle: kernel: Add KSpinLock implementation.bunnei2021-02-192-0/+87
| * | hle: kernel: Rename SharedMemory to KSharedMemory.bunnei2021-02-1912-52/+52
* | | Merge pull request #5944 from Morph1984/gc-vibrationsbunnei2021-02-272-3/+130
|\ \ \
| * | | hid: Implement GameCube Controller VibrationsMorph2021-02-212-3/+130
* | | | acc: Stub GetNintendoAccountUserResourceCacheForApplicationMorph2021-02-211-1/+17
|/ / /
* / / kernel: Fix resource release exception on exitameerj2021-02-213-2/+13
|/ /
* | Merge pull request #4973 from ameerj/nvdec-optbunnei2021-02-192-3/+7
|\ \
| * | Address PR feedbackameerj2021-02-132-4/+2
| * | nvdec cleanupameerj2021-02-131-1/+7
* | | Merge pull request #4940 from german77/nativeGCbunnei2021-02-152-1/+88
|\ \ \
| * | | hid: Implement GC controllergerman2021-02-082-1/+88
| | |/ | |/|
* | | hle: service: ldn: IUserLocalCommunicationService: Improve the stub.bunnei2021-02-141-5/+29
* | | hle: service: ldn: IUserLocalCommunicationService: Indicate that LDN is disabled.bunnei2021-02-142-3/+18
* | | hle: service: am: IStorageAccessor: Fix out of bounds error handling.bunnei2021-02-141-6/+7
| |/ |/|
* | kernel: More accurately reserve and release resourcesameerj2021-02-136-14/+42
* | kernel: KScopedReservation implementationameerj2021-02-135-26/+151
* | kernel: Unify result codes (#5890)Chloe2021-02-1320-254/+222
* | Merge pull request #5902 from lioncash/core-warnbunnei2021-02-123-4/+7
|\ \
| * | bsd: Remove usage of optional emplace() with no argumentsLioncash2021-02-091-2/+4
| * | am/controller: Remove [[fallthrough]] from unreachable pathLioncash2021-02-091-1/+2
| * | nfp: Correct uninitialized size being used within GetTagInfo()Lioncash2021-02-091-1/+1
| |/
* | software_keyboard: Implement Finalize request commandMorph2021-02-111-0/+4
* | Merge pull request #5892 from german77/backupbunnei2021-02-091-1/+12
|\ \
| * | olsc: Stub GetSaveDataBackupSettinggerman2021-02-081-1/+12
| |/
* | Merge pull request #5868 from german77/HandheldFixbunnei2021-02-081-0/+1
|\ \ | |/ |/|
| * Prevent over scheduling audio events and terminate properly the motion update eventgerman2021-02-021-0/+1
* | Merge pull request #5872 from lioncash/svc-errorChloe2021-02-081-59/+188
|\ \
| * | svc: Provide more detailed error logs for svc functionsLioncash2021-02-061-59/+188
* | | Merge pull request #5887 from ogniK5377/lm-fixbunnei2021-02-071-7/+9
|\ \ \
| * | | lm: Fix ReadLeb128Chloe Marcec2021-02-071-7/+9
* | | | Merge pull request #5878 from aleasto/masterMorph2021-02-071-2/+7
|\ \ \ \ | |/ / / |/| | |
| * | | pl_u: Fix read out of boundsAlessandro Astone2021-02-061-2/+7
* | | | Merge pull request #5871 from lioncash/address-arbbunnei2021-02-061-54/+30
|\ \ \ \
| * | | | k_address_arbiter: Unfold R_UNLESS macrosLioncash2021-02-061-5/+8
| * | | | k_address_arbiter: Remove unnecessary usages of std::addressofLioncash2021-02-061-10/+10
| * | | | k_address_arbiter: Remove dead codeLioncash2021-02-061-40/+13
| | |/ / | |/| |
* | | | Merge pull request #5326 from german77/hidUpdate1bunnei2021-02-0610-168/+406
|\ \ \ \ | |/ / / |/| | |
| * | | Add footer types and address commentsgerman2021-02-047-58/+106
| * | | Fix npad struct to match switchbrewgerman2021-02-043-105/+134
| * | | Adds missing controller types and propertiesgerman2021-02-049-30/+191
* | | | Merge pull request #5862 from bunnei/keventbunnei2021-02-0659-559/+720
|\ \ \ \
| * | | | hle: kernel: Drop R_UNLESS_NOLOG in favor of expanded if-statement.bunnei2021-02-052-3/+11
| * | | | hle: kernel: KAddressArbiter: Remove noisy error log.bunnei2021-02-051-1/+1
| * | | | hle: kernel: svc: Cleanup KEvent/KReadableEvent/KWritableEvent SVCs.bunnei2021-02-055-69/+89
| * | | | hle: kernel: Reimplement KReadableEvent and KWritableEvent.bunnei2021-02-0538-298/+341
| * | | | hle: kernel: Implement KEvent.bunnei2021-02-052-0/+89
| * | | | hle: kernel: KAddressArbiter: Use R_UNLESS_NOLOG where applicable.bunnei2021-02-051-1/+1
| * | | | hle: kernel: Rename WritableEvent to KWritableEvent.bunnei2021-02-0543-99/+99
| * | | | hle: kernel: Rename ReadableEvent to KReadableEvent.bunnei2021-02-0539-74/+75
* | | | | Merge pull request #5875 from lioncash/identifierbunnei2021-02-061-9/+9
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | k_priority_queue: Unfold several declval usagesLioncash2021-02-041-5/+5
| * | | | k_priority_queue: Simplify affinity mask type aliasLioncash2021-02-041-2/+2
| * | | | k_priority_queue: Resolved reserved identifierLioncash2021-02-041-2/+2
| |/ / /
* | | | Merge pull request #5867 from Morph1984/am-GetHealthWarningDisappearedSystemEventbunnei2021-02-052-1/+14
|\ \ \ \ | |_|/ / |/| | |
| * | | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEventMorph2021-02-022-1/+14
* | | | k_affinity_mask: Avoid implicit truncation to boolLioncash2021-02-041-1/+1
| |/ / |/| |
* | | Merge pull request #5848 from ogniK5377/k-resourcelimitbunnei2021-02-0312-228/+340
|\ \ \
| * | | Simplify limitableresource namesChloe Marcec2021-02-036-36/+29
| * | | Compile errorChloe Marcec2021-02-021-1/+1
| * | | Address issuesChloe Marcec2021-02-023-19/+15
| * | | fix compile errorChloe Marcec2021-01-301-1/+1
| * | | cleanup commentingChloe Marcec2021-01-301-2/+2
| * | | Drop m_ from lockChloe Marcec2021-01-302-9/+9
| * | | Move to GetGlobalTimeNs, fix GetTotalPhysicalMemoryAvailableChloe Marcec2021-01-303-9/+7
| * | | kernel: Rewrite resource limit to be more accurateChloe Marcec2021-01-3012-229/+354
* | | | Merge pull request #5842 from german77/userfixbunnei2021-02-031-2/+8
|\ \ \ \ | |_|/ / |/| | |
| * | | Fix user changing to 0 if validgerman2021-01-291-2/+8
* | | | Merge pull request #5861 from german77/HandheldFixbunnei2021-02-021-2/+11
|\ \ \ \ | | |_|/ | |/| |
| * | | Only update motion for npad and prevent over scheduling eventsgerman2021-02-011-2/+11
* | | | Merge pull request #5859 from Morph1984/nifmbunnei2021-02-011-2/+157
|\ \ \ \
| * | | | nifm: Stub GetCurrentIpConfigInfoMorph2021-01-311-1/+29
| * | | | nifm: Stub GetCurrentNetworkProfileMorph2021-01-311-1/+41
| * | | | nifm: Add several structsMorph2021-01-311-0/+87
* | | | | Merge pull request #5856 from Morph1984/nifm-fix-getappletinfo-stubAmeer J2021-02-011-1/+5
|\ \ \ \ \
| * | | | | nifm: Fix GetAppletInfo stubMorph2021-01-311-1/+5
* | | | | | Merge pull request #5858 from Morph1984/IsGamePlayRecordingSupported-stubbunnei2021-02-012-1/+12
|\ \ \ \ \ \
| * | | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupportedMorph2021-01-312-1/+12
* | | | | | | prepo: Stub GetTransmissionStatusMorph2021-01-311-1/+11
* | | | | | | prepo: Stub RequestImmediateTransmissionMorph2021-01-311-1/+8
| |_|/ / / / |/| | | | |
* | | | | | bsd: Fix EventFd stubMorph2021-01-311-3/+3
|/ / / / /
* | | | | Merge pull request #5855 from Morph1984/bsd-fix-getsockopt-stubbunnei2021-01-311-1/+5
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | bsd: Fix GetSockOpt stubMorph2021-01-311-1/+5
* | | | | Merge pull request #5851 from ameerj/pop-inv-stubMorph2021-01-312-1/+10
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | am: Stub TryPopFromFriendInvitationStorageChannelameerj2021-01-312-1/+10
| | |_|/ | |/| |
* / | | bsd: Stub EventFdameerj2021-01-312-1/+12
|/ / /
* | | Merge pull request #5779 from bunnei/kthread-rewritebunnei2021-01-3056-1859/+2889
|\ \ \
| * | | hle: kernel: KLightLock: Fix several bugs.bunnei2021-01-291-3/+3
| * | | hle: kernel: KThread: Release thread resource on thread exit.bunnei2021-01-291-0/+1
| * | | yuzu: debugger: Ignore HLE threads.bunnei2021-01-292-7/+13
| * | | hle: kernel: process: Add state lock.bunnei2021-01-293-6/+15
| * | | hle: kernel: threading: Fix bug with host thread naming.bunnei2021-01-291-3/+2
| * | | hle: kernel: k_scheduler_lock: Cleanup.bunnei2021-01-291-3/+3
| * | | hle: kernel: Allocate a dummy KThread for each host thread, and use it for scheduling.bunnei2021-01-297-41/+45
| * | | hle: kernel: k_scheduler: Use atomics for current_thread, etc.bunnei2021-01-292-26/+28
| * | | hle: kernel: k_scheduler: Fix for single core mode.bunnei2021-01-291-1/+2
| * | | kernel: Fix build errors.bunnei2021-01-292-4/+9
| * | | hle: kernel: KScheduler: Introduce thread context_guard.bunnei2021-01-292-3/+16
| * | | hle: kernel: Recode implementation of KThread to be more accurate.bunnei2021-01-2912-767/+1553
| * | | kernel: svc_types: Add ThreadActivity.bunnei2021-01-291-0/+5
| * | | kernel: KSchedulerPriorityQueue: Lowest priority should be LowestThreadPriority.bunnei2021-01-291-1/+1
| * | | kernel: k_light_lock: Simplify EmuThreadHandle implementation.bunnei2021-01-294-23/+25
| * | | hle: kernel: TimeManager: Simplify to not rely on previous EmuThreadHandle implementation.bunnei2021-01-296-69/+25
| * | | core: hle: kernel: object: Implement Finalize() virtual method.bunnei2021-01-2915-6/+29
| * | | core: hle: kernel: svc_results: Populate with several missing error codes.bunnei2021-01-291-0/+3
| * | | core: hle: kernel: Implement KLightLock.bunnei2021-01-292-0/+171
| * | | core: hle: kernel: Implement KThreadQueue.bunnei2021-01-291-0/+81
| * | | hle: kernel: KThread: Clean up thread priorities.bunnei2021-01-299-75/+41
| * | | hle: kernel: KThread: Reorganize thread priority defaults.bunnei2021-01-297-27/+27
| * | | hle: kernel: KThread: Fix ThreadType definition.bunnei2021-01-295-11/+12
| * | | hle: kernel: Move single core "phantom mode" out of KThread.bunnei2021-01-293-10/+24
| * | | hle: kernel: KThread: Remove thread types that do not exist.bunnei2021-01-294-44/+27
| * | | core: hle: kernel: Rename Thread to KThread.bunnei2021-01-2938-246/+245
* | | | Merge pull request #5838 from german77/prepostubMorph2021-01-301-1/+10
|\ \ \ \
| * | | | Stub GetSystemSessionIdgerman2021-01-301-1/+10
| | |_|/ | |/| |
* | | | Merge pull request #5809 from ogniK5377/FlushAudioOutBuffersbunnei2021-01-291-1/+9
|\ \ \ \ | |_|/ / |/| | |
| * | | audout: FlushAudioOutBuffersChloe Marcec2021-01-241-1/+9
* | | | Merge pull request #5837 from german77/socketstubbunnei2021-01-292-1/+17
|\ \ \ \
| * | | | Stub GetSockOptgerman2021-01-282-1/+17
| | |/ / | |/| |
* | | | Merge pull request #5840 from Morph1984/prepo-fixLC2021-01-283-24/+70
|\ \ \ \
| * | | | prepo: Fix BufferDescriptorX invalid buffer errors and add "New" variants of SaveReportMorph2021-01-281-24/+42
| * | | | hle_ipc: Add Can(Read, Write)BufferMorph2021-01-282-0/+28
| |/ / /
* | | | hid: Add static_assert for Parameter sizeMorph2021-01-281-15/+19
* | | | npad: Remove unused device handle parameterMorph2021-01-273-11/+9
|/ / /
* | | Merge pull request #5812 from german77/StubSixaxisFusionbunnei2021-01-274-3/+104
|\ \ \
| * | | Stub Set/Get/Reset SixaxisSensorFusionParametersgerman2021-01-244-3/+104
| |/ /
* | | Merge pull request #5810 from ogniK5377/stereo-visionbunnei2021-01-273-7/+60
|\ \ \
| * | | hle: Implement remaining services for Stereo VisionChloe Marcec2021-01-243-7/+60
| |/ /
* | | Merge pull request #5824 from ogniK5377/IPsmSessionbunnei2021-01-261-1/+112
|\ \ \
| * | | Omit system referenceChloe Marcec2021-01-251-2/+1
| * | | psm: IPsmSessionChloe Marcec2021-01-251-2/+114
* | | | Merge pull request #5774 from ogniK5377/mii-raw-randombunnei2021-01-264-2274/+1657
|\ \ \ \
| * | | | mii: Fix BuildRandomStoreData & Cleanup raw_dataChloe Marcec2021-01-204-2274/+1657
* | | | | Merge pull request #5771 from ogniK5377/lm-reworkbunnei2021-01-253-271/+288
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Print Process ID and Thread ID as hexChloe Marcec2021-01-241-2/+2
| * | | | Clamp string reads to buffer sizeChloe Marcec2021-01-231-3/+5
| * | | | Mark DestinationToString as staticChloe Marcec2021-01-201-1/+1
| * | | | Mark LogPacketHeaderEntry hash as noexceptChloe Marcec2021-01-201-1/+1
| * | | | lm: Recode LM serviceChloe Marcec2021-01-203-271/+286
| |/ / /
* | | | Merge pull request #5799 from ogniK5377/event-register-unregisterbunnei2021-01-251-1/+7
|\ \ \ \ | |_|/ / |/| | |
| * | | Simplify conditionChloe Marcec2021-01-231-2/+1
| * | | nvdrv: Unregister already registered eventsChloe Marcec2021-01-231-1/+8
* | | | Merge pull request #5806 from bunnei/am-stubbunnei2021-01-241-1/+8
|\ \ \ \ | |/ / / |/| | |
| * | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.bunnei2021-01-211-1/+8
| |/ /
* | | Merge pull request #5776 from ogniK5377/lblbunnei2021-01-231-22/+261
|\ \ \
| * | | lbl: Implement most of lblChloe Marcec2021-01-201-22/+261
| |/ /
* | | Merge pull request #5765 from ogniK5377/StoreSaveDataThumbnail-stubbunnei2021-01-235-6/+66
|\ \ \
| * | | acc: Stub StoreSaveDataThumbnailChloe Marcec2021-01-195-6/+66
| |/ /
* | | Merge pull request #5270 from german77/multiTouchbunnei2021-01-212-29/+130
|\ \ \ | |/ / |/| |
| * | Always initialize keyboard inputgerman2021-01-151-5/+1
| * | Add mutitouch support for touch screensgerman2021-01-152-19/+25
| * | Allow to return up to 16 touch inputs per enginegerman2021-01-152-55/+75
| * | Allow all touch inputs at the same time and remove config options that are not longer necesarygerman2021-01-152-11/+20
| * | Add multitouch supportgerman2021-01-152-23/+93
* | | npad: Add check for HANDHELD_INDEX in UpdateControllerAt()Morph2021-01-181-1/+1
* | | Merge pull request #5360 from ReinUsesLisp/enforce-memclass-accessbunnei2021-01-1712-179/+189
|\ \ \ | |_|/ |/| |
| * | core: Silence Wclass-memaccess warningsReinUsesLisp2021-01-1512-179/+189
* | | Merge pull request #5358 from ReinUsesLisp/rename-insert-paddingLC2021-01-152-7/+7
|\| | | |/ |/|
| * common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINITReinUsesLisp2021-01-152-7/+7
* | common/bit_util: Replace CLZ/CTZ operations with standardized onesLioncash2021-01-154-8/+12
|/
* hle: kernel: thread: Preserve thread wait reason for debugging only.bunnei2021-01-117-1/+34
* hle: kernel: k_scheduler_lock: Fix shadowing errors.bunnei2021-01-111-1/+1
* core: hle: Add missing calls to MicroProfileOnThreadExit.bunnei2021-01-111-0/+4
* core: hle: Integrate new KConditionVariable and KAddressArbiter implementations.bunnei2021-01-1113-1173/+503
* core: hle: kernel: Update KAddressArbiter.bunnei2021-01-112-0/+435
* core: hle: kernel: Update KConditionVariable.bunnei2021-01-113-0/+411
* core: hle: kernel: Begin moving common SVC defintions to its own header.bunnei2021-01-111-0/+13
* hle: kernel: Remove unnecessary AddressArbiter definition.bunnei2021-01-111-1/+0
* hle: kernel: k_scheduler: Cleanup OnThreadPriorityChanged.bunnei2021-01-112-6/+3
* hle: kernel: Rename thread "status" to "state".bunnei2021-01-111-2/+2
* hle: kernel: thread: Replace ThreadStatus/ThreadSchedStatus with a single ThreadState.bunnei2021-01-1111-127/+97
* core: hle: kernel: Add some useful functions for checking kernel addresses.bunnei2021-01-111-0/+19
* core: hle: kernel: svc_types: Add type definitions for KAddressArbiter.bunnei2021-01-111-0/+12
* core: hle: kernel: Update KSynchronizationObject.bunnei2021-01-1130-599/+377
* core: hle: kernel: Begin moving common SVC results to its own header.bunnei2021-01-111-0/+20
* hle: service: nfp: Remove incorrect signaling behavior in GetDeviceState.bunnei2021-01-111-6/+0
* Merge pull request #5312 from german77/overclockenabledbunnei2021-01-102-1/+10
|\
| * Stub IsCpuOverclockEnabledgerman2021-01-082-1/+10
* | core: Silence unhandled enum in switch warningsReinUsesLisp2021-01-091-2/+4
|/
* fix for nvdec disabled, cleanup host1xameerj2021-01-071-11/+14
* nvdec syncpt incorporationameerj2021-01-077-20/+43
* core: Silence warnings when compiling without assertsReinUsesLisp2021-01-052-0/+3
* buffer_queue: Protect queue_sequence list access with a mutexameerj2021-01-042-13/+21
* hle: service: nvflinger: buffer_queue: Do not reset id/layer_id on Connect.bunnei2021-01-031-2/+0
* general: Fix various spelling errorsMorph2021-01-025-19/+19
* Merge pull request #5249 from ReinUsesLisp/lock-free-pagesbunnei2021-01-011-1/+1
|\
| * core/memory: Read and write page table atomicallyReinUsesLisp2020-12-301-1/+1
* | Merge pull request #5208 from bunnei/service-threadsbunnei2020-12-3144-666/+496
|\ \
| * | hle: kernel: service_thread: Make thread naming more consistent.bunnei2020-12-301-1/+1
| * | hle: kernel: Manage service threads on another thread.bunnei2020-12-301-9/+20
| * | hle: kernel: Manage host thread IDs using TLS.bunnei2020-12-301-46/+31
| * | hle: kernel: Move ServiceThread ownership to KernelCore.bunnei2020-12-294-5/+48
| * | hle: kernel: service_thread: Add thread name and take weak_ptr of ServerSession.bunnei2020-12-293-11/+22
| * | hle: service: Acquire and release a lock on requests.bunnei2020-12-295-25/+35
| * | core: hle: kernel: Clear process list on boot.bunnei2020-12-291-2/+2
| * | hle: service: vi: Refactor to grab buffer only once.bunnei2020-12-291-15/+4
| * | service: nvflinger: Improve synchronization for BufferQueue.bunnei2020-12-295-19/+72
| * | hle: service: Ensure system is powered on before writing IPC result.bunnei2020-12-291-1/+5
| * | core: kernel: Clear process list earlier.bunnei2020-12-291-2/+2
| * | hle: kernel: hle_ipc: Remove SleepClientThread.bunnei2020-12-292-54/+0
| * | hle: service: bsd: Update to work with service threads, removing SleepClientThread.bunnei2020-12-293-249/+45
| * | hle: service: nvdrv: Revert #4981 to remove usage of SleepClientThread.bunnei2020-12-2923-211/+83
| * | hle: kernel: service_thread: Add parameter for thread pool size.bunnei2020-12-293-7/+7
| * | hle: service: nvflinger: Refactor locking and interfaces.bunnei2020-12-293-45/+31
| * | hle: service: vi: Remove usage of SleepClientThread.bunnei2020-12-291-34/+43
| * | core: hle: server_session: Use separate threads for each service connection.bunnei2020-12-295-23/+138
* | | service/pcie: Fix invalid initialization argumentReinUsesLisp2020-12-301-1/+1
* | | Merge pull request #5247 from comex/xx-conceptsbunnei2020-12-301-3/+5
|\ \ \
| * | | k_priority_queue: Fix concepts usecomex2020-12-291-3/+5
| |/ /
* | | Merge pull request #5246 from comex/xx-includebunnei2020-12-301-0/+1
|\ \ \ | |_|/ |/| |
| * | Add missing include of "core/hle/kernel/kernel.h"comex2020-12-291-0/+1
| |/
* / svc: demote SleepThread log to LOG_TRACEameerj2020-12-291-1/+1
|/
* Merge pull request #5042 from Morph1984/project-aetherbunnei2020-12-2210-527/+643
|\
| * applets/web: Implement the online web browser appletMorph2020-12-182-3/+11
| * main, applets/web: Re-add progress dialog for RomFS extractionMorph2020-12-182-32/+44
| * pl_u, applets/web: Decrypt shared fonts to TTF filesMorph2020-12-183-18/+117
| * ns_vm: Stub NeedsUpdateVulnerabilityMorph2020-12-181-1/+10
| * controllers/npad: Make press_state atomicMorph2020-12-182-2/+3
| * applets/web: Implement the default web browser applet frontendMorph2020-12-181-1/+4
| * applets/web: Implement the offline browser applet backendMorph2020-12-182-13/+143
| * applets/web: Initial implementation of the web browser appletMorph2020-12-183-2/+428
| * applets: Remove the previous web browser applet implementationMorph2020-12-184-609/+37
* | Merge pull request #5131 from bunnei/scheduler-rewritebunnei2020-12-2129-1372/+2041
|\ \
| * | hle: kernel: Process: Various style fixes based on code review feedback.bunnei2020-12-061-2/+2
| * | hle: kernel: Thread: Various style fixes based on code review feedback.bunnei2020-12-061-22/+25
| * | hle: kernel: KScopedSchedulerLockAndSleep: Various style fixes based on code review feedback.bunnei2020-12-061-6/+6
| * | hle: kernel: KScopedLock: Various style fixes based on code review feedback.bunnei2020-12-061-6/+8
| * | hle: kernel: KAbstractSchedulerLock: Various style fixes based on code review feedback.bunnei2020-12-061-9/+7
| * | hle: kernel: KScheduler: Various style fixes based on code review feedback.bunnei2020-12-062-50/+41
| * | hle: kernel: KPriorityQueue: Various style fixes based on code review feedback.bunnei2020-12-061-29/+36
| * | hle: kernel: KAffinityMask: Various style fixes based on code review feedback.bunnei2020-12-061-17/+13
| * | hle: kernel: GlobalSchedulerContext: Various style fixes based on code review feedback.bunnei2020-12-062-5/+10
| * | hle: kernel: Use C++ style comments in KScheduler, etc.bunnei2020-12-064-152/+136
| * | kernel: KScopedSchedulerLockAndSleep: Remove unused ctor.bunnei2020-12-061-13/+7
| * | kernel: time_manager: Add missing lock guards.bunnei2020-12-061-3/+10
| * | hle: kernel: Migrate to KScopedSchedulerLock.bunnei2020-12-0614-48/+91
| * | hle: kernel: Separate KScopedSchedulerLockAndSleep from k_scheduler.bunnei2020-12-0610-69/+71
| * | hle: kernel: Separate KScheduler from GlobalSchedulerContext class.bunnei2020-12-064-118/+138
| * | hle: kernel: Rewrite scheduler implementation based on Mesopshere.bunnei2020-12-0620-1146/+1179
| * | hle: kernel: physical_core: Clear exclusive state after each run.bunnei2020-12-061-0/+1
| * | hle: kernel: Port KAbstractSchedulerLock from Mesosphere.bunnei2020-12-061-0/+76
| * | hle: kernel: svc: Remove reschedule on svcBreak.bunnei2020-12-061-5/+0
| * | hle: kernel: process: Add schedule count tracking, to be used for yield impl.bunnei2020-12-061-0/+13
| * | hle: kernel: svc: Remove unnecessary hack in svcSleep.bunnei2020-12-061-7/+0
| * | common: Port KPriorityQueue from Mesosphere.bunnei2020-12-061-0/+443
| * | hle: kernel: Port KAffinityMask from Mesosphere.bunnei2020-12-065-14/+77
* | | buffer_queue: better use of std::arrayameerj2020-12-181-59/+46
* | | Overwrite slots instead of queuing them, add disconnect signalameerj2020-12-173-27/+33
| |/ |/|
* | Merge pull request #5190 from Morph1984/validate_device_handlebunnei2020-12-162-0/+45
|\ \
| * | controllers/npad: Validate device handles before useMorph2020-12-122-0/+45
* | | Merge pull request #5119 from Morph1984/fs-opendatastoragewithprogramindexbunnei2020-12-155-8/+62
|\ \ \
| * | | fsp_srv: Implement OpenDataStorageWithProgramIndexMorph2020-12-084-1/+57
| * | | file_sys: Consolidate common Title ID operationsMorph2020-12-081-7/+5
* | | | Merge pull request #5168 from Morph1984/aoc-PurchaseEventManagerbunnei2020-12-152-2/+76
|\ \ \ \ | |_|/ / |/| | |
| * | | IPurchaseEventManager: Implement GetPurchasedEventReadableHandleMorph2020-12-081-1/+14
| * | | IPurchaseEventManager: Stub Set(Default)DeliveryTargetMorph2020-12-081-2/+27
| * | | aoc_u: Stub Create(Permanent)EcPurchasedEventManagerMorph2020-12-082-2/+38
| |/ /
* | | Merge pull request #5172 from lioncash/svc-widebunnei2020-12-121-35/+25
|\ \ \
| * | | svc: Remove unnecessary castsLioncash2020-12-081-35/+25
| |/ /
* | | Merge pull request #5123 from Morph1984/nim-IsLargeResourceAvailablebunnei2020-12-101-1/+13
|\ \ \
| * | | nim: Stub IsLargeResourceAvailableMorph2020-12-041-1/+13
| | |/ | |/|
* | | Merge pull request #5142 from comex/xx-poll-eventsRodrigo Locatti2020-12-094-40/+45
|\ \ \
| * | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`comex2020-12-074-40/+45
* | | | Merge pull request #5166 from lioncash/log-castbunnei2020-12-0921-76/+67
|\ \ \ \
| * | | | core: Remove unnecessary enum casts in log callsLioncash2020-12-0821-76/+67
* | | | | Merge pull request #5135 from Morph1984/applets-shadowbunnei2020-12-091-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | applets: Resolve variable shadowingMorph2020-12-051-1/+1
| | |_|/ | |/| |
* | | | controller: Use std::move within ConvertToFrontendParameters()Lioncash2020-12-081-3/+3
* | | | controller: Avoid unnecessary copies in ConfigurationComplete()Lioncash2020-12-081-9/+8
| |/ / |/| |
* | | Merge pull request #5148 from comex/xx-unused-fieldsbunnei2020-12-072-3/+3
|\ \ \
| * | | core: Mark unused fields as [[maybe_unused]]comex2020-12-072-3/+3
| |/ /
* | | Merge pull request #5154 from comex/xx-ipcbunnei2020-12-072-34/+37
|\ \ \
| * | | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cppcomex2020-12-072-34/+37
| |/ /
* | | Merge pull request #5147 from comex/xx-purevirtLC2020-12-071-33/+0
|\ \ \
| * | | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclasscomex2020-12-071-33/+0
| |/ /
* | | Merge pull request #5150 from comex/xx-boxcatLC2020-12-071-1/+1
|\ \ \
| * | | boxcat: Avoid unnecessary object copycomex2020-12-071-1/+1
| |/ /
* | | Merge pull request #5136 from lioncash/video-shadow3LC2020-12-071-3/+3
|\ \ \ | |_|/ |/| |
| * | video_core: Resolve more variable shadowing scenarios pt.3Lioncash2020-12-051-3/+3
| |/
* / Fix "explicitly defaulted but implicitly deleted" warningcomex2020-12-071-1/+1
|/
* Merge pull request #4996 from bunnei/use-4jitsbunnei2020-12-0416-120/+132
|\
| * kernel: scheduler: Minor cleanup to remove duplicated code.bunnei2020-11-292-46/+14
| * kernel: time_manager: Protect access with a mutex.bunnei2020-11-292-1/+5
| * hle: kernel: thread: Remove unused "Running" state.bunnei2020-11-292-6/+0
| * core: arm: Implement InvalidateCacheRange for CPU cache invalidation.bunnei2020-11-295-10/+21
| * hle: kernel: time_manager: Avoid a crash on process exit.bunnei2020-11-291-1/+4
| * hle: kernel: AddressArbiter: Remove unused code.bunnei2020-11-292-9/+0
| * hle: kernel: SynchronizationObject: Use atomic_bool for is_signaled.bunnei2020-11-291-1/+2
| * common: fiber: Use boost::context instead of native fibers on Windows.bunnei2020-11-291-1/+1
| * hle: kernel: multicore: Replace n-JITs impl. with 4 JITs.bunnei2020-11-298-57/+97
* | Merge pull request #5000 from lioncash/audio-errorbunnei2020-12-031-1/+1
|\ \ | |/ |/|
| * audio_core: Make shadowing and unused parameters errorsLioncash2020-12-031-1/+1
* | Merge pull request #4998 from Morph1984/bioshock-patchbunnei2020-11-291-2/+4
|\ \
| * | hid: Check if applet_resource exists in InitializeVibrationDeviceMorph2020-11-251-2/+4
| |/
* | Add missing types to NpadCommunicationModegerman2020-11-291-0/+2
* | Merge pull request #5021 from german77/StubCommunicationModebunnei2020-11-294-2/+50
|\ \
| * | Stub set and get NpadCommunicationModegerman2020-11-274-2/+50
* | | savedata_factory: Eliminate usage of the global system instanceLioncash2020-11-271-1/+2
* | | service: Eliminate usages of the global system instanceLioncash2020-11-27219-897/+1207
|/ /
* | Merge pull request #4975 from comex/invalid-syncpoint-idbunnei2020-11-261-2/+2
|\ \
| * | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint IDcomex2020-11-241-2/+2
* | | Merge pull request #4981 from ogniK5377/ioctl-ctrlbunnei2020-11-2624-91/+214
|\ \ \ | |_|/ |/| |
| * | nvservices: Reintroducee IoctlCtrlChloe Marcec2020-11-2424-91/+214
| |/
* | service: am: Implement ExecuteProgram and required stubs.bunnei2020-11-252-3/+34
* | hle: services: Fix a crash with improper NVFlinger lifetime management. (#4977)bunnei2020-11-2416-97/+98
* | Merge pull request #4972 from lioncash/unused4Rodrigo Locatti2020-11-241-1/+1
|\ \ | |/ |/|
| * svc: Remove unnecessary [[maybe_unused]] tagLioncash2020-11-231-1/+1
* | Merge pull request #4944 from lioncash/system-rembunnei2020-11-228-31/+66
|\ \
| * | patch_manager: Remove usages of the global system instanceLioncash2020-11-188-31/+66
| |/
* | Merge pull request #4907 from ogniK5377/nvdrv-cleanupbunnei2020-11-2126-898/+1220
|\ \
| * | Addressed issuesChloe Marcec2020-11-1010-17/+86
| * | core: Make nvservices more standardizedChloe Marcec2020-11-1026-903/+1156
* | | olsc: Move member initialization to after member functions.bunnei2020-11-201-2/+2
* | | hle: service: Stub OLSC Initialize and SetSaveDataBackupSettingEnabled functions.bunnei2020-11-193-0/+87
| |/ |/|
* | hid: Reimplement Begin/EndPermitVibrationSessionMorph2020-11-163-5/+17
* | controllers/npad: Load input devices on initMorph2020-11-161-0/+2
* | general: Fix compiler warnings on linux and miscellaneous changesMorph2020-11-162-8/+11
* | controllers/npad: Remove the old vibration filterMorph2020-11-163-50/+64
* | hid: Implement InitializeVibrationDevice and IsVibrationDeviceMountedMorph2020-11-163-12/+66
* | input_common: Add VibrationDevice and VibrationDeviceFactoryMorph2020-11-163-33/+27
* | configure_input: Add per-player vibrationMorph2020-11-161-2/+11
* | settings: Remove global vibration strength modifierMorph2020-11-161-3/+1
* | hid: Mark Begin/EndPermitVibrationSession as stubsMorph2020-11-163-18/+4
* | controllers/npad: Send an empty vibration on destruction/deactivationMorph2020-11-163-22/+38
* | hid: Stub IsVibrationDeviceMountedMorph2020-11-162-1/+23
* | controllers/npad: Add heuristics to reduce rumble state changesMorph2020-11-161-5/+46
* | configure_input: Hook up the vibration percentage spinboxMorph2020-11-161-1/+2
* | controllers/npad: Stop games from vibrating incorrect controllersMorph2020-11-161-0/+10
* | hid: Fix controller rumble based on new researchMorph2020-11-163-43/+69
* | hid: Pop a struct of parameters instead of popping individual parametersMorph2020-11-161-103/+237
* | hid: Reorder all HID commandsMorph2020-11-164-215/+230
* | hid: Implement GetVibrationDeviceInfoMorph2020-11-162-3/+39
* | hid: Stub InitializeVibrationDeviceMorph2020-11-161-3/+11
* | controllers/npad: Rename NPadType to NpadStyleSetMorph2020-11-163-9/+9
* | controllers/npad: Add DeviceHandle structMorph2020-11-161-27/+50
* | settings: Preparation for per-game input settingsMorph2020-11-166-25/+32
* | controllers/npad: Connect a controller on init if none are connectedMorph2020-11-161-0/+13
* | Merge pull request #4895 from Morph1984/cave-story-plus-applet-fixbunnei2020-11-132-26/+80
|\ \
| * | applets: Rename LibraryAppletVersion to ControllerAppletVersionMorph2020-11-082-15/+15
| * | applets/controller: Pop normal data for StrapGuide and FirmwareUpdateMorph2020-11-082-6/+19
| * | applets/controller: Introduce additional checks for mode and callerMorph2020-11-082-5/+39
| * | applets/controller: Add ControllerUpdateFirmwareArg structMorph2020-11-081-0/+7
* | | Merge pull request #4901 from bunnei/caps-stubbunnei2020-11-102-9/+17
|\ \ \ | |_|/ |/| |
| * | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.bunnei2020-11-072-9/+17
* | | ipc_helpers: Remove usage of the global system instanceLioncash2020-11-0816-7/+23
| |/ |/|
* | video_core: dma_pusher: Remove integrity check on command lists.bunnei2020-11-071-1/+0
* | Merge pull request #4888 from lioncash/unicorn-removebunnei2020-11-072-28/+5
|\ \ | |/ |/|
| * core: Remove usage of unicornLioncash2020-11-042-28/+5
* | Merge pull request #4858 from lioncash/initializerbunnei2020-11-041-0/+4
|\ \
| * | General: Resolve a few missing initializer warningsLioncash2020-10-301-0/+4
* | | Merge pull request #4869 from bunnei/improve-gpu-syncChloe2020-11-049-60/+291
|\ \ \ | |_|/ |/| |
| * | fixup! hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-012-3/+11
| * | hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-013-46/+106
| * | service: hle: nvflinger: Fix potential shutdown crash when GPU is destroyed.bunnei2020-11-011-0/+4
| * | hle service: nvdrv: nvhost_ctrl: Update to use SyncpointManager.bunnei2020-11-013-9/+31
| * | hle service: nvdrv: Update to instantiate SyncpointManager.bunnei2020-11-012-5/+18
| * | hle: service: nvdrv: Implement SyncpointManager, to manage syncpoints.bunnei2020-11-013-1/+125
* | | Merge pull request #4878 from bunnei/unload-nrrbunnei2020-11-031-1/+15
|\ \ \ | |/ / |/| |
| * | hle: service: ldr: Implement UnloadNrr.bunnei2020-10-311-1/+15
* | | Rename to align with switchbrew and remove gpu function (#4714)Levi Behunin2020-11-012-16/+10
|/ /
* | video_core: unbreak -Werror in NVDEC with ClangJan Beich2020-10-301-1/+1
* | kernel/process: Add missing <ctime> includeMorph2020-10-291-0/+1
* | Merge pull request #4835 from lat9nq/rng-default-timebunnei2020-10-291-1/+1
|\ \ | |/ |/|
| * kernel: Use the current time as the default RNG seedlat9nq2020-10-271-1/+1
* | Merge pull request #4846 from lioncash/service-fnbunnei2020-10-285-1/+7
|\ \
| * | service: Update function tablesLioncash2020-10-285-1/+7
* | | hle/kernel: Remove unused registered_core_threads to fix data racesReinUsesLisp2020-10-271-5/+0
|/ /
* | Merge pull request #4729 from ameerj/nvdec-prodbunnei2020-10-278-288/+468
|\ \
| * | video_core: NVDEC Implementationameerj2020-10-278-288/+468
| |/
* / hle: services: TimeZoneContentManager: This can be made explicit.bunnei2020-10-271-1/+1
|/
* Merge pull request #4828 from lioncash/lockguardRodrigo Locatti2020-10-251-1/+1
|\
| * general: Use template deduction guides for lock_guardLioncash2020-10-251-1/+1
* | Merge pull request #4792 from bunnei/rtc-fixbunnei2020-10-236-188/+302
|\ \ | |/ |/|
| * service: time: Update current time with changes to RTC setting.bunnei2020-10-136-188/+302
* | core: Fix clang build pt.3Lioncash2020-10-222-13/+3
* | Revert "core: Fix clang build"bunnei2020-10-2154-433/+322
* | kernel: Fix build with recent compiler flag changesLioncash2020-10-211-4/+8
* | Merge pull request #4796 from lioncash/clangLC2020-10-2154-322/+433
|\ \
| * | core: Fix clang buildLioncash2020-10-1854-322/+433
* | | Merge pull request #4390 from ogniK5377/get-applet-inf-stubbunnei2020-10-211-1/+11
|\ \ \
| * | | Added remaining paramsDavid Marcec2020-10-201-1/+4
| * | | nifm: GetAppletInfo stubDavid Marcec2020-10-201-1/+8
* | | | Merge pull request #4788 from ReinUsesLisp/lockfree-host-threadbunnei2020-10-201-28/+38
|\ \ \ \ | |/ / / |/| | |
| * | | kernel: Implement host thread register methods without lockingReinUsesLisp2020-10-131-28/+38
| | |/ | |/|
* | | Merge pull request #4785 from Morph1984/fs-hadesbunnei2020-10-201-2/+3
|\ \ \
| * | | filesystem: Fix CreateDirectory and DeleteFileMorph2020-10-131-2/+3
| |/ /
* | | Merge pull request #4783 from bunnei/nvdrv-freespacebunnei2020-10-182-0/+25
|\ \ \
| * | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.bunnei2020-10-132-0/+25
| |/ /
* | | Merge pull request #4801 from lioncash/missing-boundbunnei2020-10-181-1/+1
|\ \ \
| * | | mii/manager: Make use of unused lower bound in GetRandomValue()Lioncash2020-10-171-1/+1
* | | | service: bcat: Check client connection before interacting with socket.bunnei2020-10-171-0/+10
|/ / /
* | | Merge pull request #4784 from bunnei/cancelbufferbunnei2020-10-163-14/+53
|\ \ \
| * | | hle: service: vi: Implement BufferQueue::CancelBuffer.bunnei2020-10-143-14/+53
| | |/ | |/|
* / | service: acc: Stub IManagerForApplication::StoreOpenContext.bunnei2020-10-151-1/+7
|/ /
* / core/CMakeLists: Make some warnings errorsLioncash2020-10-1312-67/+52
|/
* Merge pull request #4736 from Morph1984/home-button-input-protection-stubbunnei2020-10-074-2/+50
|\
| * hid: Stub HomeButtonInputProtection service commandsMorph2020-09-304-2/+50
* | Merge pull request #4737 from Morph1984/setshimlibraryversion-stubbunnei2020-10-075-4/+38
|\ \
| * | caps_c: Stub SetShimLibraryVersionMorph2020-09-302-1/+18
| * | caps_u: Stub SetShimLibraryVersionMorph2020-09-302-2/+14
| * | caps_su: Properly stub SetShimLibraryVersionMorph2020-09-301-1/+6
| |/
* | Merge pull request #4742 from german77/InputFilterbunnei2020-10-061-49/+58
|\ \
| * | Only use inputs corresponding to controller typegerman2020-10-021-49/+58
* | | Merge pull request #4734 from german77/motionfusionbunnei2020-10-022-1/+15
|\ \ \ | |/ / |/| |
| * | Stubbed EnableSixAxisSensorFusiongerman2020-09-302-1/+15
* | | Merge pull request #4291 from german77/ImplementControllerRumbleDavid2020-09-303-13/+22
|\ \ \
| * | | First implementation of controller rumblegerman2020-09-293-13/+22
* | | | Merge pull request #4726 from lioncash/appletDavid2020-09-301-1/+2
|\ \ \ \ | |_|_|/ |/| | |
| * | | frontend/controller: Eliminate dependency on the global system instanceLioncash2020-09-261-1/+2
| |/ /
* | | Merge pull request #4705 from german77/SplitMotionPollerbunnei2020-09-305-76/+157
|\ \ \ | |_|/ |/| |
| * | Use different timing for motiongerman2020-09-245-76/+157
* | | Merge pull request #1703 from DarkLordZach/nvdec-ioctlbunnei2020-09-304-3/+256
|\ \ \ | |_|/ |/| |
| * | service: nvhost_vic: Ignore Submit commands.bunnei2020-06-052-1/+18
| * | nvdrv: Stub nvdec/vic ioctls to bypass nvdec moviesZach Hilman2020-06-054-3/+239
* | | Merge pull request #4717 from lioncash/debugLC2020-09-251-0/+17
|\ \ \
| * | | service: Restore "unused" functionLioncash2020-09-251-0/+17
| | |/ | |/|
* | | Merge pull request #4678 from Morph1984/LoadOpenContext-partial-implbunnei2020-09-243-1/+13
|\ \ \ | |/ / |/| |
| * | acc: Stub LoadOpenContextMorph2020-09-213-1/+13
* | | General: Make use of std::nullopt where applicableLioncash2020-09-224-7/+7
|/ /
* | Merge pull request #4683 from Morph1984/NpadHandheldActivationMode-implbunnei2020-09-203-5/+28
|\ \
| * | hid: Implement Get/SetNpadHandheldActivationModeMorph2020-09-183-5/+28
* | | Merge pull request #4643 from FearlessTobi/decrease-pad-update-intervalbunnei2020-09-191-1/+1
|\ \ \
| * | | Test: Decrease pad_update_nsFearlessTobi2020-09-101-1/+1
* | | | am: Stub GetPreviousProgramIndexMorph2020-09-182-1/+11
* | | | Merge pull request #4665 from lioncash/sm-kernelRodrigo Locatti2020-09-172-8/+10
|\ \ \ \
| * | | | service/sm: Slightly more efficient string name validationLioncash2020-09-171-2/+2
| * | | | service/sm: Eliminate dependency on the global system instanceLioncash2020-09-172-6/+8
* | | | | Merge pull request #4666 from lioncash/unused-funcRodrigo Locatti2020-09-171-22/+0
|\ \ \ \ \
| * | | | | service: Remove unused funcationLioncash2020-09-171-22/+0
| |/ / / /
* | | | | Merge pull request #4671 from lioncash/nfp-copyRodrigo Locatti2020-09-171-10/+13
|\ \ \ \ \
| * | | | | nfp: Eliminate two unnecessary copiesLioncash2020-09-171-10/+13
| |/ / / /
* | | | | Merge pull request #4594 from german77/MotionHIDbunnei2020-09-174-15/+184
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | configure_input: Hook up the motion button and checkboxMorph2020-09-051-1/+1
| * | | | Add cemu hook changes related to PR #4609german2020-09-051-2/+1
| * | | | Remove RealMotionDevicegerman2020-09-052-7/+8
| * | | | controllers/npad: Simplify motion entry assignmentMorph2020-09-051-29/+18
| * | | | Include HID and configuration changes related to motiongerman2020-09-054-15/+195
* | | | | file_sys/bis_factory: Eliminate usage of the global system accessorLioncash2020-09-171-1/+1
* | | | | kernel: Remove all dependencies on the global system instanceLioncash2020-09-145-11/+20
* | | | | Merge pull request #4636 from lioncash/kernel-hlebunnei2020-09-143-7/+5
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | service: Remove two usages of the global system accessorLioncash2020-09-073-7/+5
| | |/ / | |/| |
* | | | Merge pull request #4323 from ReinUsesLisp/no-spinbunnei2020-09-121-1/+1
|\ \ \ \
| * | | | kernel/scheduler: Use std::mutex instead of spin lockReinUsesLisp2020-07-131-1/+1
* | | | | Merge pull request #4634 from lioncash/blockingbunnei2020-09-123-19/+19
|\ \ \ \ \
| * | | | | bsd: Resolve unused value within SendToImplLioncash2020-09-071-0/+1
| * | | | | bsd: Resolve sign comparison warningsLioncash2020-09-071-3/+3
| * | | | | sockets_translate: Make use of designated initializersLioncash2020-09-071-12/+12
| * | | | | blocking_worker: Make use of templated lambdaLioncash2020-09-071-3/+2
| * | | | | blocking_worker: Resolve -Wdocumentation warningLioncash2020-09-071-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #4310 from ogniK5377/apollo-1-prodbunnei2020-09-111-72/+77
|\ \ \ \ \
| * | | | | audio_core: Apollo Part 1, AudioRenderer refactorDavid Marcec2020-07-251-72/+77
* | | | | | Merge pull request #4597 from Morph1984/mjolnir-p2bunnei2020-09-116-131/+415
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Address feedbackMorph2020-09-042-0/+7
| * | | | | applets/controller: Set min_players to have a minimum value of 1.Morph2020-09-041-1/+1
| * | | | | applets/controller: Implement fallback applet for the SDL frontendMorph2020-09-042-89/+0
| * | | | | applets/controller: Implement "Explain Text"Morph2020-09-042-16/+26
| * | | | | Project Mjölnir: Part 2 - Controller AppletMorph2020-09-046-42/+398
* | | | | | Merge pull request #4397 from ReinUsesLisp/bsdbunnei2020-09-069-56/+1384
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | service/bsd: Handle Poll with no entries accuratelyReinUsesLisp2020-07-281-0/+5
| * | | | | services/bsd: Implement most of bsd:sReinUsesLisp2020-07-285-55/+911
| * | | | | service/sockets: Add worker pool abstractionReinUsesLisp2020-07-281-0/+30
| * | | | | service/sockets: Add worker abstraction to execute blocking calls asynchronouslyReinUsesLisp2020-07-281-0/+132
| * | | | | service/sockets: Add translate functionsReinUsesLisp2020-07-282-0/+213
| * | | | | service/sockets: Add enumerations and structuresReinUsesLisp2020-07-282-0/+81
| * | | | | services/nifm: Implement GetCurrentIpAddressReinUsesLisp2020-07-281-1/+12
* | | | | | hid: Implement MergeSingleJoyasDualJoyMorph2020-09-043-5/+24
| |/ / / / |/| | | |
* | | | | Merge pull request #4590 from ReinUsesLisp/tsan-schedbunnei2020-09-031-2/+6
|\ \ \ \ \
| * | | | | hle/scheduler: Fix data race in is_context_switch_pendingReinUsesLisp2020-08-261-2/+6
* | | | | | Merge pull request #4568 from lioncash/fspbunnei2020-09-031-3/+13
|\ \ \ \ \ \
| * | | | | | fsp_srv: Resolve -Wunused-but-set-variable warningLioncash2020-08-231-1/+8
| * | | | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()Lioncash2020-08-231-2/+5
| |/ / / / /
* | | | | | Merge pull request #4564 from lioncash/file-includebunnei2020-09-031-0/+1
|\ \ \ \ \ \
| * | | | | | file_sys: Replace inclusions with forward declarations where applicableLioncash2020-08-231-0/+1
| |/ / / / /
* | | | | | Merge pull request #4382 from FearlessTobi/port-udp-configbunnei2020-09-012-1/+12
|\ \ \ \ \ \
| * | | | | | yuzu: Add motion and touch configurationFearlessTobi2020-08-292-1/+12
* | | | | | | Merge pull request #4589 from ReinUsesLisp/tsan-hostbunnei2020-09-011-1/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | hle/kernel: Fix data race in GetCurrentHostThreadIDReinUsesLisp2020-08-261-1/+2
| |/ / / / /
* | | | | | controllers/npad: Fix inconsistencies with controller connection statusesMorph2020-08-261-1/+7
* | | | | | controllers/npad: Fix LibNX controller connection statusesMorph2020-08-261-1/+9
* | | | | | controllers/npad: Fix LedPattern for P1-4Morph2020-08-261-3/+3
* | | | | | Project Mjölnir: Part 1Morph2020-08-263-127/+111
|/ / / / /
* | | | | common/fileutil: Convert namespace to Common::FSLioncash2020-08-165-73/+73
* | | | | Merge pull request #4526 from lioncash/core-semibunnei2020-08-153-7/+12
|\ \ \ \ \
| * | | | | core: Resolve several -Wextra-semi warningsLioncash2020-08-143-7/+12
* | | | | | Merge pull request #4527 from lioncash/pessimizing2bunnei2020-08-151-2/+1
|\ \ \ \ \ \
| * | | | | | software_keyboard: Resolve a pessimizing move warningLioncash2020-08-141-2/+1
| |/ / / / /
* | | | | | Merge pull request #4492 from lioncash/linkagebunnei2020-08-152-15/+11
|\ \ \ \ \ \
| * | | | | | system_control: Make functions internally linked where applicableLioncash2020-08-052-15/+11
* | | | | | | Merge pull request #4463 from lioncash/lockdiscardbunnei2020-08-151-1/+1
|\ \ \ \ \ \ \
| * | | | | | | kernel/scheduler: Mark SchedulerLock constructor as nodiscardLioncash2020-08-141-1/+1
| | |/ / / / / | |/| | | | |
* / | | | | | time_zone_content_manager: Collapse auto and default caseLioncash2020-08-141-3/+1
|/ / / / / /
* | | | | | General: Tidy up clang-format warnings part 2Lioncash2020-08-136-40/+49
* | | | | | Merge pull request #4491 from lioncash/unused-varsbunnei2020-08-102-18/+11
|\ \ \ \ \ \
| * | | | | | kernel: Remove unused variablesLioncash2020-08-052-18/+11
| |/ / / / /
* | | | | | Merge pull request #4457 from ogniK5377/SetScreenShotPermissionbunnei2020-08-072-1/+12
|\ \ \ \ \ \
| * | | | | | am: Unstub SetScreenShotPermissionDavid Marcec2020-07-312-1/+12
| | |/ / / / | |/| | | |
* | | | | | common/concepts: Rename IsBaseOf to DerivedFromLioncash2020-08-071-1/+1
* | | | | | Merge pull request #4490 from lioncash/arbiterbunnei2020-08-072-2/+3
|\ \ \ \ \ \
| * | | | | | scheduler: Resolve sign conversion warningLioncash2020-08-051-1/+2
| * | | | | | address_arbiter: Resolve sign conversion warningLioncash2020-08-051-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #4489 from lioncash/typesafebunnei2020-08-061-0/+4
|\ \ \ \ \ \
| * | | | | | ipc_helpers: Only allow trivially copyable objects with PushRaw() and PopRaw()Lioncash2020-08-051-0/+4
| |/ / / / /
* | | | | | Merge pull request #4475 from lioncash/bqueuebunnei2020-08-051-10/+11
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | buffer_queue: Make use of std::nulloptLioncash2020-08-031-5/+6
| * | | | | buffer_queue: Make use of designated initializersLioncash2020-08-031-5/+5
| |/ / / /
* | | | | Merge pull request #4401 from ogniK5377/GetIndirectLayerImageRequiredMemoryInfobunnei2020-08-051-1/+19
|\ \ \ \ \
| * | | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfoDavid Marcec2020-07-211-1/+19
| | |/ / / | |/| | |
* | | | | Merge pull request #4430 from bunnei/new-gpu-vmmbunnei2020-08-054-93/+227
|\ \ \ \ \
| * | | | | Update src/core/hle/service/nvdrv/devices/nvmap.cppbunnei2020-07-281-1/+1
| * | | | | hle: nvdrv: Rewrite of GPU memory management.bunnei2020-07-264-93/+227
* | | | | | Merge pull request #4481 from lioncash/cpp-depDavid2020-08-043-21/+21
|\ \ \ \ \ \
| * | | | | | yuzu: Resolve C++20 deprecation warnings related to lambda capturesLioncash2020-08-033-21/+21
* | | | | | | Merge pull request #4474 from lioncash/hle-profileDavid2020-08-041-17/+26
|\ \ \ \ \ \ \
| * | | | | | | profile_manager: Make use of std::nulloptLioncash2020-08-031-4/+4
| * | | | | | | profile_manager: Make use of designated initializersLioncash2020-08-031-13/+22
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #4456 from Morph1984/stub-really-long-fs-funcbunnei2020-08-045-34/+69
|\ \ \ \ \ \ \
| * | | | | | | minor nitsMorph2020-07-311-1/+3
| * | | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttributeMorph2020-07-302-23/+56
| * | | | | | | fs: Rename SaveDataDescriptor to SaveDataAttributeMorph2020-07-303-12/+12
| |/ / / / / /
* | | | | | | Merge pull request #4482 from lioncash/ldr-signbunnei2020-08-031-3/+2
|\ \ \ \ \ \ \
| * | | | | | | service/ldr: Resolve sign mismatch warningsLioncash2020-08-031-3/+2
| | |/ / / / / | |/| | | | |
* / | | | | | sm: Make use of IsBaseOf for GetServiceDavid Marcec2020-08-031-3/+2
|/ / / / / /
* / / / / / ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer (#4465)David2020-08-039-30/+30
|/ / / / /
* | | | | core_timing: Make use of uintptr_t to represent user_dataLioncash2020-07-286-13/+17
* | | | | remove unused variable;CrazyMax2020-07-271-1/+0
* | | | | nvflinger: Mark interface functions with return values as [[nodiscard]]Lioncash2020-07-261-16/+14
* | | | | nvflinger: Use return value of Lock()Lioncash2020-07-263-4/+4
|/ / / /
* | | | Merge pull request #4350 from ogniK5377/hid-update-connectedbunnei2020-07-252-33/+37
|\ \ \ \
| * | | | hid: Only update keyboard & debug pad inputs if enabledDavid Marcec2020-07-162-33/+37
* | | | | Address issuesDavid Marcec2020-07-201-2/+2
* | | | | swkbd: Return result for Calc request for inlined swkbdDavid Marcec2020-07-192-13/+49
| |/ / / |/| | |
* | | | Merge pull request #4348 from lioncash/nanobunnei2020-07-186-28/+34
|\ \ \ \
| * | | | core_timing: Make TimedCallback take std::chrono::nanosecondsLioncash2020-07-166-15/+13
| * | | | core_timing: Make use of std::chrono with ScheduleEventLioncash2020-07-165-16/+24
| | |/ / | |/| |
* | | | Merge pull request #4345 from Morph1984/fix-createfilebunnei2020-07-181-0/+4
|\ \ \ \
| * | | | Add comment to clarify the nullptr checkMorph2020-07-161-0/+1
| * | | | filesystem: Create subdirectories prior to creating a fileMorph2020-07-161-0/+3
| | |/ / | |/| |
* | | | Merge pull request #4365 from lioncash/miibunnei2020-07-181-53/+54
|\ \ \ \
| * | | | mii/manager: Make use of designated initializersLioncash2020-07-171-53/+54
* | | | | Merge pull request #4366 from lioncash/mii-signbunnei2020-07-181-3/+3
|\ \ \ \ \
| * | | | | mii/manager: Resolve sign mismatch warningsLioncash2020-07-171-3/+3
| |/ / / /
* | | | | Merge pull request #4357 from lioncash/unused4David2020-07-173-7/+2
|\ \ \ \ \
| * | | | | kernel: Remove unused variablesLioncash2020-07-163-7/+2
* | | | | | Merge pull request #4358 from lioncash/unused5David2020-07-171-2/+0
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | kernel/thread: Remove unimplemented function prototypeLioncash2020-07-161-2/+0
| |/ / / /
* | | | | Merge pull request #4292 from bunnei/mii-rewritebunnei2020-07-178-912/+3265
|\ \ \ \ \
| * | | | | hle: service: mii: Rewrite service to properly support creation of random and default miis.bunnei2020-07-128-912/+3265
* | | | | | Merge pull request #4327 from lioncash/desig2Rodrigo Locatti2020-07-162-58/+38
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | address_space_info: Use type alias to simplify codeLioncash2020-07-131-14/+13
| * | | | | address_space_info: Make use of designated initializersLioncash2020-07-132-46/+27
| | |_|/ / | |/| | |
* | | | | kernel: Add missing includeLioncash2020-07-161-0/+1
* | | | | cpu_manager: Mark function getters as staticLioncash2020-07-163-7/+8
* | | | | Merge pull request #4346 from lioncash/threadDavid2020-07-167-35/+26
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | kernel/process: Move name and system context to the bottom of the member listLioncash2020-07-151-6/+6
| * | | | kernel/handle_table: Remove usages of the global system instanceLioncash2020-07-154-8/+15
| * | | | kernel/thread: Remove global GetCurrentThread()Lioncash2020-07-153-23/+7
| |/ / /
* / / / memory_layout: Remove unused data memberLioncash2020-07-131-2/+0
|/ / /
* | | Merge pull request #4275 from CrazyMax/desired_languagebunnei2020-07-121-1/+13
|\ \ \
| * | | AM: fix GetDesiredLanguage:CrazyMax2020-07-081-1/+13
* | | | Merge pull request #4203 from VolcaEM/servicesbunnei2020-07-1126-154/+282
|\ \ \ \ | |_|/ / |/| | |
| * | | Rename two functions in NSVolcaEM2020-07-021-2/+2
| * | | Rename GetApplicationArea2 to GetApplicationAreaSizeVolcaEM2020-07-021-2/+2
| * | | Remove duplicate functionsVolcaEM2020-06-291-2/+0
| * | | Use decimal instead of hexadecimalVolcaEM2020-06-291-3/+5
| * | | Fix typoVolcaEM2020-06-291-1/+1
| * | | Clang-formatVolcaEM2020-06-291-1/+1
| * | | service: Update function tablesVolcaEM2020-06-2927-157/+285
* | | | configuration: implement per-game configurations (#4098)lat9nq2020-07-106-22/+23
* | | | Merge pull request #4248 from Morph1984/CreateManagedDisplaySeparableLayerbunnei2020-07-102-1/+20
|\ \ \ \
| * | | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayerMorph2020-07-052-1/+20
* | | | | Merge pull request #4202 from ReinUsesLisp/scoped-lockbunnei2020-07-091-11/+10
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | core_timing,scheduler: Use std::scoped_lock when possibleReinUsesLisp2020-06-291-11/+10
* | | | | GetDisplayVersion should return a null-terminated version string.CrazyMax2020-07-071-4/+16
| |/ / / |/| | |
* | | | Merge pull request #3924 from ogniK5377/GetKeyCodeMapbunnei2020-07-032-2/+72
|\ \ \ \
| * | | | Move GetKeyCodeMapImpl to an anonymous namespaceDavid Marcec2020-06-241-19/+19
| * | | | Fixed logging outputDavid Marcec2020-06-241-1/+1
| * | | | Implement GetKeyCodeMap & GetKeyCodeMap2David Marcec2020-06-242-2/+72
* | | | | Merge pull request #4193 from ogniK5377/GetIndirectLayerConsumerHandle-stubbunnei2020-07-031-1/+13
|\ \ \ \ \
| * | | | | am: Stub GetIndirectLayerConsumerHandleDavid Marcec2020-06-281-1/+13
* | | | | | Merge pull request #4192 from ogniK5377/acc-ListOpenContextStoredUsers-stubbunnei2020-07-035-4/+14
|\ \ \ \ \ \
| * | | | | | acc: ListOpenContextStoredUsers partial stubDavid Marcec2020-06-285-4/+14
| |/ / / / /
* | | | | | key_manager: Correct casing of instance()Lioncash2020-07-011-1/+1
* | | | | | Merge pull request #3967 from FearlessTobi/keys-singletonDavid2020-07-011-1/+1
|\ \ \ \ \ \
| * | | | | | crypto: Make KeyManager a singleton classFearlessTobi2020-05-201-1/+1
* | | | | | | Merge pull request #4153 from ogniK5377/prepo-multibufbunnei2020-07-011-1/+6
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | prepo: : Don't read extra buffer from report unless passedDavid Marcec2020-06-241-1/+6
* | | | | | | Merge pull request #3955 from FernandoS27/prometheus-2bbunnei2020-06-2844-1071/+2134
|\ \ \ \ \ \ \
| * | | | | | | Core/Common: Address Feedback.Fernando Sahmkow2020-06-285-16/+17
| * | | | | | | NvFlinger: Clang Format.Fernando Sahmkow2020-06-271-1/+1
| * | | | | | | SVC: Implement 32-bits wrappers and update Dynarmic.Fernando Sahmkow2020-06-272-30/+273
| * | | | | | | SVC: Add GetCurrentProcessorNumber32, CreateTransferMemory32, SetMemoryAttribute32Fernando Sahmkow2020-06-272-6/+39
| * | | | | | | SVC: Add GetThreadPriority32 & SetThreadPriority32Fernando Sahmkow2020-06-272-2/+30
| * | | | | | | Common/Kernel: Corrections and small bug fixing.Fernando Sahmkow2020-06-271-2/+2
| * | | | | | | Services/NvFlinger: Do vSync in a sepparate thread on Multicore.Fernando Sahmkow2020-06-272-3/+60
| * | | | | | | Kernel: Correct Host Context on Threads and Scheduler.Fernando Sahmkow2020-06-274-11/+11
| * | | | | | | Clang Format.Fernando Sahmkow2020-06-274-12/+11
| * | | | | | | General: Cleanup legacy code.Fernando Sahmkow2020-06-279-254/+6
| * | | | | | | Kernel/svcBreak: Implement CacheInvalidation for Singlecore and correct svcBreak.Fernando Sahmkow2020-06-272-3/+13
| * | | | | | | HLE_IPC: Correct HLE Event behavior on timeout.Fernando Sahmkow2020-06-273-1/+19
| * | | | | | | SingleCore: Improve Cycle timing Behavior and replace mutex in global scheduler for spinlock.Fernando Sahmkow2020-06-272-2/+3
| * | | | | | | FrameLimiting: Enable frame limiting for single core.Fernando Sahmkow2020-06-271-0/+1
| * | | | | | | SingleCore: Use Cycle Timing instead of Host Timing.Fernando Sahmkow2020-06-272-4/+13
| * | | | | | | Scheduler: Correct Reload/UnloadFernando Sahmkow2020-06-272-3/+5
| * | | | | | | Thread: Release the ARM Interface on exitting.Fernando Sahmkow2020-06-273-1/+8
| * | | | | | | General: Move ARM_Interface into Threads.Fernando Sahmkow2020-06-278-119/+88
| * | | | | | | Core: Refactor ARM Interface.Fernando Sahmkow2020-06-273-24/+43
| * | | | | | | SVC/ARM: Correct svcSendSyncRequest and cache ticks on arm interface.Fernando Sahmkow2020-06-271-1/+1
| * | | | | | | SingleCore: Move Host Timing from a sepparate thread to main cpu thread.Fernando Sahmkow2020-06-272-1/+10
| * | | | | | | ARM: Addapt to new Exclusive Monitor Interface.Fernando Sahmkow2020-06-272-9/+4
| * | | | | | | Scheduler: Correct yielding interaction with SetThreadActivity.Fernando Sahmkow2020-06-271-0/+15
| * | | | | | | General: Fix microprofile on dynarmic/svc, fix wait tree showing which threads were running.Fernando Sahmkow2020-06-275-3/+51
| * | | | | | | General: Fix Stop functionFernando Sahmkow2020-06-272-3/+20
| * | | | | | | Kernel: Rewind on SVC change.Fernando Sahmkow2020-06-273-5/+16
| * | | | | | | Kernel: Preempt Single core on redudant yields.Fernando Sahmkow2020-06-275-19/+40
| * | | | | | | CPU_Manager: Unload/Reload threads on preemption on SingleCoreFernando Sahmkow2020-06-272-0/+52
| * | | | | | | Synchronization: Correct wide Assertion.Fernando Sahmkow2020-06-271-2/+4
| * | | | | | | General: Initial Setup for Single Core.Fernando Sahmkow2020-06-272-0/+22
| * | | | | | | Scheduler: Set last running time on thread.Fernando Sahmkow2020-06-272-4/+2
| * | | | | | | Kernel: Corrections to TimeManager, Scheduler and Mutex.Fernando Sahmkow2020-06-273-5/+5
| * | | | | | | Kernel: Fixes, corrections and asserts to scheduler and different svcs.Fernando Sahmkow2020-06-278-38/+38
| * | | | | | | Scheduler: Correct yields.Fernando Sahmkow2020-06-272-7/+25
| * | | | | | | Mutex: Revert workaround due to poor exclusive memory.Fernando Sahmkow2020-06-271-9/+2
| * | | | | | | ARM/Memory: Correct Exclusive Monitor and Implement Exclusive Memory Writes.Fernando Sahmkow2020-06-274-9/+10
| * | | | | | | SVC: WaitSynchronization add Termination Pending Result.Fernando Sahmkow2020-06-272-1/+5
| * | | | | | | Scheduler: Remove arm_interface lock and a few corrections.Fernando Sahmkow2020-06-271-7/+3
| * | | | | | | SVC: Correct SetThreadActivity.Fernando Sahmkow2020-06-274-38/+59
| * | | | | | | SCC: Small corrections to CancelSynchronizationFernando Sahmkow2020-06-273-2/+14
| * | | | | | | Scheduler: Correct locking for hle threads.Fernando Sahmkow2020-06-271-1/+2
| * | | | | | | Scheduler: Fix HLE Threads on guardFernando Sahmkow2020-06-271-4/+6
| * | | | | | | Scheduler: Protect on closed threads.Fernando Sahmkow2020-06-271-7/+17
| * | | | | | | Scheduler: Correct assert.Fernando Sahmkow2020-06-271-4/+2
| * | | | | | | Core: Correct rebase.Fernando Sahmkow2020-06-271-6/+5
| * | | | | | | Scheduler: Release old thread fiber before trying to switch to the next thread fiber.Fernando Sahmkow2020-06-272-11/+35
| * | | | | | | NVDRV: Remove frame limiting as Host Timing already takes care.Fernando Sahmkow2020-06-271-1/+0
| * | | | | | | Mutex: Correct Result writting to clear exclusivity.Fernando Sahmkow2020-06-271-3/+11
| * | | | | | | SVC: Correct svcWaitForAddress and svcSignalToAddress.Fernando Sahmkow2020-06-274-68/+161
| * | | | | | | Scheduler: Correct Select Threads Step 2.Fernando Sahmkow2020-06-271-0/+1
| * | | | | | | Kernel: Corrections to Scheduling.Fernando Sahmkow2020-06-273-14/+15
| * | | | | | | Kernel: Correct Signal on Thread Death and Setup Sync Objects on Thread for DebuggingFernando Sahmkow2020-06-273-15/+17
| * | | | | | | Core: Correct HLE Event Callbacks and other issues.Fernando Sahmkow2020-06-275-37/+39
| * | | | | | | Process: Protect TLS region and Modules.Fernando Sahmkow2020-06-271-0/+4
| * | | | | | | General: Add AssertsFernando Sahmkow2020-06-273-0/+20
| * | | | | | | General: Add better safety for JIT use.Fernando Sahmkow2020-06-272-1/+8
| * | | | | | | SVC: Correct races on physical core switching.Fernando Sahmkow2020-06-271-5/+4
| * | | | | | | NVFlinger: Lock race condition between CPU, Host Timing, VSync.Fernando Sahmkow2020-06-273-0/+11
| * | | | | | | SVC: Add locks to the memory management.Fernando Sahmkow2020-06-271-0/+21
| * | | | | | | SVC: Correct WaitSynchronization, WaitProcessWideKey, SignalProcessWideKey.Fernando Sahmkow2020-06-279-33/+84
| * | | | | | | SVC: Cleanup old methods.Fernando Sahmkow2020-06-271-13/+9
| * | | | | | | CPU_Manager: Reconfigre guest threads for dynamrmic downsidesFernando Sahmkow2020-06-272-0/+5
| * | | | | | | SVC: Correct SendSyncRequest.Fernando Sahmkow2020-06-277-52/+115
| * | | | | | | SVC: Correct ArbitrateUnlockFernando Sahmkow2020-06-273-33/+37
| * | | | | | | SVC: Correct SignalEvent, ClearEvent, ResetSignal, WaitSynchronization, CancelSynchronization, ArbitrateLockFernando Sahmkow2020-06-278-90/+134
| * | | | | | | SVC: Remove global HLE Lock.Fernando Sahmkow2020-06-271-3/+0
| * | | | | | | SVC: Correct GetThreadPriority, SetThreadPriority, GetThreadCoreMask, SetThreadCoreMask, GetCurrentProcessorNumberFernando Sahmkow2020-06-273-15/+11
| * | | | | | | SVC: Correct CreateThread, StartThread, ExitThread, SleepThread.Fernando Sahmkow2020-06-273-37/+31
| * | | | | | | General: Recover Prometheus project from harddrive failure Fernando Sahmkow2020-06-2727-383/+710
| | |_|/ / / / | |/| | | | |
* | | | | | | ldr: Cleanup NRO & NRR structsDavid Marcec2020-06-281-8/+8
* | | | | | | Merge pull request #4026 from VolcaEM/ldrDavid2020-06-281-38/+73
|\ \ \ \ \ \ \
| * | | | | | | Move SHA256Hash to its original positionVolcaEM2020-06-181-2/+2
| * | | | | | | Remove unnecessary pragmasVolcaEM2020-06-161-8/+0
| * | | | | | | Revert IsValidNRO refactor but make it more readableVolcaEM2020-06-161-26/+13
| * | | | | | | Update assert stringVolcaEM2020-06-161-1/+1
| * | | | | | | Clang-format againVolcaEM2020-06-141-2/+2
| * | | | | | | Use consistent variable namesVolcaEM2020-06-141-4/+4
| * | | | | | | Clang-formatVolcaEM2020-06-141-1/+2
| * | | | | | | Make assert strings consistentVolcaEM2020-06-141-3/+3
| * | | | | | | Attempt to fix crashes in SSBU and refactor IsValidNROVolcaEM2020-06-141-36/+59
| * | | | | | | Address review commentsVolcaEM2020-06-021-4/+4
| * | | | | | | Add comment to nrr_kindVolcaEM2020-05-311-1/+1
| * | | | | | | ldr: Update NRR/NRO structs VolcaEM2020-05-311-40/+72
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #4184 from VolcaEM/patch-9David2020-06-281-0/+3
|\ \ \ \ \ \ \
| * | | | | | | Oops (fix typo)VolcaEM2020-06-271-1/+1
| * | | | | | | grc: Update function tableVolcaEM2020-06-271-0/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #4185 from VolcaEM/patch-10David2020-06-281-0/+1
|\ \ \ \ \ \ \
| * | | | | | | lbl: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #4186 from VolcaEM/patch-11David2020-06-281-0/+1
|\ \ \ \ \ \ \
| * | | | | | | ldn: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #4187 from VolcaEM/patch-12David2020-06-281-0/+6
|\ \ \ \ \ \ \
| * | | | | | | mig: Update function tableVolcaEM2020-06-271-0/+6
| |/ / / / / /
* | | | | | | Merge pull request #4188 from VolcaEM/patch-13David2020-06-281-16/+16
|\ \ \ \ \ \ \
| * | | | | | | mm: Update function tableVolcaEM2020-06-271-16/+16
| |/ / / / / /
* | | | | | | Merge pull request #4189 from VolcaEM/patch-14David2020-06-281-10/+10
|\ \ \ \ \ \ \
| * | | | | | | ncm: Update function tableVolcaEM2020-06-271-10/+10
| |/ / / / / /
* | | | | | | Merge pull request #4190 from VolcaEM/patch-15David2020-06-281-3/+3
|\ \ \ \ \ \ \
| * | | | | | | nfc: Update function tableVolcaEM2020-06-271-3/+3
| |/ / / / / /
* / / / / / / friend: Update function tableVolcaEM2020-06-271-0/+6
|/ / / / / /
* | | | | | Merge pull request #4158 from Morph1984/capsbunnei2020-06-2714-57/+69
|\ \ \ \ \ \
| * | | | | | caps_u: Fix GetAlbumContentsFileListForApplication stubMorph2020-06-261-9/+15
| * | | | | | caps: Use enum classes and check struct sizes on compile timeMorph2020-06-261-34/+40
| * | | | | | caps: Update copyright headersMorph2020-06-2614-14/+14
* | | | | | | Merge pull request #4152 from ogniK5377/ipc-errbunnei2020-06-271-25/+22
|\ \ \ \ \ \ \
| * | | | | | | Mark invalid IPC buffers as ASSERT_OR_EXECUTE_MSGDavid Marcec2020-06-241-25/+22
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #4154 from ogniK5377/swkbd-nullptrbunnei2020-06-271-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Prevent nullptr dereference on swkbd error caseDavid Marcec2020-06-241-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #4178 from VolcaEM/patch-6David2020-06-271-4/+43
|\ \ \ \ \ \ \
| * | | | | | | Use better names for "Unknown"sVolcaEM2020-06-271-39/+39
| * | | | | | | Update function namesVolcaEM2020-06-271-4/+4
| * | | | | | | es: Update function tableVolcaEM2020-06-271-2/+41
| | |/ / / / / | |/| | | | |
* | | | | | | btm: Give better names for unknown functionsDavid Marcec2020-06-271-5/+5
* | | | | | | btdrv: Update function table (#4174)VolcaEM2020-06-271-83/+84
* | | | | | | bpc: Update function tables (#4173)VolcaEM2020-06-271-7/+13
* | | | | | | bcat: Update function tables and add missing classes (#4172)VolcaEM2020-06-272-0/+5
* | | | | | | am: Update function tables and add missing classes (#4169)VolcaEM2020-06-273-17/+19
* | | | | | | aoc: Update function table (#4170)VolcaEM2020-06-271-0/+1
* | | | | | | Merge pull request #4177 from VolcaEM/patch-5LC2020-06-271-71/+76
|\ \ \ \ \ \ \
| * | | | | | | btm: Update function tablesVolcaEM2020-06-271-71/+76
| |/ / / / / /
* / / / / / / eupld: Update function tableVolcaEM2020-06-271-0/+1
|/ / / / / /
* | | | | | Merge pull request #4159 from ogniK5377/mem-manager-dumb-assertbunnei2020-06-261-1/+0
|\ \ \ \ \ \
| * | | | | | memory_manager: Remove useless assertionDavid Marcec2020-06-251-1/+0
| |/ / / / /
* | | | | | Merge pull request #4141 from Morph1984/SevenSixAxisSensorDavid2020-06-252-21/+85
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | hid: Stub a series of "SevenSixAxisSensor" service commandsMorph2020-06-242-21/+85
| | |_|/ / | |/| | |
* | | | | Merge pull request #4138 from Morph1984/GyroscopeZeroDriftModebunnei2020-06-244-6/+56
|\ \ \ \ \
| * | | | | hid: Implement Get/ResetGyroscopeZeroDriftModeMorph2020-06-214-6/+56
| |/ / / /
* | | | | Merge pull request #4128 from lioncash/move2bunnei2020-06-241-2/+2
|\ \ \ \ \
| * | | | | software_keyboard: Eliminate trivial redundant copiesLioncash2020-06-201-2/+2
* | | | | | lm: Silence no return value warningMorph2020-06-231-1/+2
* | | | | | account: Update function tables and add missing classes (#4145)VolcaEM2020-06-225-42/+384
| |/ / / / |/| | | |
* | | | | memory_manager: Explicitly specifcy std::min<size_t>MerryMage2020-06-181-2/+2
|/ / / /
* | | | Merge pull request #4070 from ogniK5377/GetTPCMasks-fixbunnei2020-06-152-21/+22
|\ \ \ \
| * | | | nvdrv: Fix GetTPCMasks for ioctl3David Marcec2020-06-102-21/+22
| | |_|/ | |/| |
* | | | Merge pull request #4069 from ogniK5377/total-phys-membunnei2020-06-141-2/+4
|\ \ \ \
| * | | | kernel: Account for system resource size for memory usageDavid Marcec2020-06-101-2/+4
| |/ / /
* | | | Merge pull request #4010 from ogniK5377/reserve-always-breakbunnei2020-06-131-5/+1
|\ \ \ \ | |/ / / |/| | |
| * | | kernel: ResourceLimit::Reserve remove useless while loopDavid Marcec2020-05-291-5/+1
| |/ /
* | | Downgrade "handle not signaled" error to traceDavid Marcec2020-06-041-1/+1
* | | Clang-formatVolcaEM2020-06-011-2/+1
* | | hid: Stub GetXpadIDsVolcaEM2020-06-012-1/+14
|/ /
* | clang-formatVolcaEM2020-05-211-1/+2
* | nifm: correct assert in CreateTemporaryNetworkProfileVolcaEM2020-05-211-1/+1
* | Merge pull request #3926 from ogniK5377/keyboard-statesbunnei2020-05-191-3/+4
|\ \
| * | hid: Clear keyboard states & fix logic issueDavid Marcec2020-05-121-3/+4
* | | Merge pull request #3665 from bunnei/device-savebunnei2020-05-162-1/+38
|\ \ \
| * | | service: fsp_srv: Stub implementation of OpenMultiCommitManager.bunnei2020-05-112-1/+38
| |/ /
* | | nv_flinger: Use enum for pixel format instead of u32David Marcec2020-05-162-3/+11
* | | time_zone: Use std::chrono::seconds for strong typing.bunnei2020-05-131-1/+1
* | | hle: service: time_zone_manager: Use current time zone setting.bunnei2020-05-112-3/+32
* | | Stub SendKeyboardLockKeyEventDavid Marcec2020-05-112-1/+11
|/ /
* | Replace externals with Conan (#3735)James Rowe2020-05-081-1/+1
* | Merge pull request #3879 from lioncash/global2bunnei2020-05-083-10/+16
|\ \ | |/ |/|
| * hle_ipc: Eliminate core memory globalsLioncash2020-05-033-10/+16
* | Merge pull request #3881 from lioncash/mem-warningbunnei2020-05-0511-23/+11
|\ \
| * | kernel/memory: Remove #pragma once within cpp fileLioncash2020-05-031-2/+0
| * | kernel/memory: Remove unused includesLioncash2020-05-037-8/+1
| * | kernel/memory: Remove unused variables in memory_block_managerLioncash2020-05-031-3/+0
| * | kernel/memory: Make use of std::array consistently in address_space_infoLioncash2020-05-031-6/+6
| * | kernel/memory: Resolve -Wshadow warningsLioncash2020-05-031-4/+4
| |/
* | Merge pull request #3880 from lioncash/encodingbunnei2020-05-056-12/+12
|\ \
| * | kernel/memory: Amend potential encoding warningsLioncash2020-05-036-12/+12
| |/
* | Merge pull request #3843 from ogniK5377/GetPopFromGeneralChannelEventbunnei2020-05-043-4/+20
|\ \
| * | am: IHomeMenuFunctions:GetPopFromGeneralChannelEventDavid Marcec2020-05-013-4/+20
* | | Merge pull request #3822 from ogniK5377/GetAccountIdbunnei2020-05-041-5/+8
|\ \ \ | |_|/ |/| |
| * | acc: Return a unique value per account for GetAccountIdDavid Marcec2020-04-291-5/+8
* | | Merge pull request #3871 from lioncash/semibunnei2020-05-031-4/+6
|\ \ \
| * | | readable_event: Remove unnecessary semicolon in Signal()Lioncash2020-05-021-4/+6
* | | | Merge pull request #3824 from ogniK5377/GetDisplayVersionbunnei2020-05-031-3/+14
|\ \ \ \ | |/ / / |/| | |
| * | | Update src/core/hle/service/am/am.cppbunnei2020-05-031-1/+1
| * | | am: Properly implement GetDisplayVersionDavid Marcec2020-04-291-3/+14
| |/ /
* | | Merge pull request #3811 from ogniK5377/audin-initbunnei2020-05-022-5/+94
|\ \ \
| * | | marked stubsDavid Marcec2020-04-281-4/+5
| * | | Audin:u ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecifiedDavid Marcec2020-04-282-5/+93
* | | | Merge pull request #3819 from ogniK5377/err-log2bunnei2020-05-027-0/+51
|\ \ \ \
| * | | | kernel: Don't fail silentlyDavid Marcec2020-04-297-0/+51
| | |/ / | |/| |
* | | | Merge pull request #3833 from qwell/caps_su-32-stubbunnei2020-05-022-1/+13
|\ \ \ \
| * | | | caps:su Stub out SetShimLibraryVersionJason Parker2020-04-302-1/+13
* | | | | Merge pull request #3821 from ogniK5377/InitializeApplicationInfo-fixbunnei2020-05-022-22/+15
|\ \ \ \ \
| * | | | | acc: Fix InitializeApplicationInfoDavid Marcec2020-04-292-22/+15
| | |/ / / | |/| | |
* | | | | Merge pull request #3812 from ogniK5377/lisst-qualified-usersbunnei2020-05-025-3/+15
|\ \ \ \ \
| * | | | | Updated comment to reflect ListQualifiedUsers betterDavid Marcec2020-04-281-1/+3
| * | | | | account: ListQualifiedUsersDavid Marcec2020-04-285-3/+13
| | |_|/ / | |/| | |
* | | | | nvdrv: Fix GetGpuTime stack corruptionDavid Marcec2020-05-011-2/+3
| |_|_|/ |/| | |
* | | | Merge pull request #3823 from ogniK5377/setvrmodeMat M2020-04-302-16/+6
|\ \ \ \
| * | | | am: IsVrModeEnabled & SetVrModeEnabled fixesDavid Marcec2020-04-292-16/+6
| | |/ / | |/| |
* | | | Merge pull request #3830 from ogniK5377/GetFriendInvitationStorageChannelEventMat M2020-04-302-1/+14
|\ \ \ \
| * | | | am: GetFriendInvitationStorageChannelEventDavid Marcec2020-04-302-1/+14
| |/ / /
* | | | Merge pull request #3835 from ogniK5377/GetFreeSpaceSize-GetTotalSpaceSizeMat M2020-04-301-2/+2
|\ \ \ \
| * | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSizeDavid Marcec2020-04-301-2/+2
| |/ / /
* | | | Merge pull request #3832 from ogniK5377/nim-eca-CreateServerInterfaceMat M2020-04-301-1/+69
|\ \ \ \
| * | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterfaceDavid Marcec2020-04-301-1/+69
| |/ / /
* | | | Merge pull request #3831 from ogniK5377/caps-su-namesMat M2020-04-301-0/+3
|\ \ \ \ | | |_|/ | |/| |
| * | | caps: Add missing service names to caps:suDavid Marcec2020-04-301-0/+3
| |/ /
* / / psm: Mark as debug instead of warningDavid Marcec2020-04-291-7/+14
|/ /
* | Merge pull request #3818 from ogniK5377/err-logMat M2020-04-294-3/+27
|\ \
| * | Don't fail silently for vi, sm, set and ns servicesDavid Marcec2020-04-294-3/+27
* | | Merge pull request #3783 from lioncash/pointerMat M2020-04-291-1/+3
|\ \ \ | |/ / |/| |
| * | physical_core: Make use of std::make_unique instead of std::make_shared in ctorLioncash2020-04-241-1/+3
* | | kernel: Bad GetInfo ids should not be marked as stubsDavid Marcec2020-04-281-2/+2
* | | style: Change AMs & Glues error codes to be dec instead of hexDavid Marcec2020-04-282-7/+7
| |/ |/|
* | Merge pull request #3785 from ogniK5377/set-buffer-count-unitbunnei2020-04-271-1/+9
|\ \
| * | vi: Don't let uninitialized data pass as a response for SetBufferCountDavid Marcec2020-04-241-1/+9
* | | Merge pull request #3797 from slashiee/hid-stubMat M2020-04-272-1/+13
|\ \ \
| * | | services: hid: Stub StopSevenSixAxisSensor.M&M2020-04-262-1/+13
* | | | Merge pull request #3744 from lioncash/table2bunnei2020-04-2618-7/+107
|\ \ \ \ | |/ / / |/| | |
| * | | service: Update function tablesLioncash2020-04-2018-7/+107
* | | | Merge pull request #3780 from lioncash/processbunnei2020-04-251-2/+138
|\ \ \ \ | |_|/ / |/| | |
| * | | svc: Re-add MapProcessCodeMemory/UnmapProcessCodeMemoryLioncash2020-04-241-2/+138
| | |/ | |/|
* | | Merge pull request #3777 from lioncash/warnRodrigo Locatti2020-04-241-2/+2
|\ \ \
| * | | page_table: Remove unused capturesLioncash2020-04-231-2/+2
| |/ /
* | | Merge pull request #3778 from lioncash/unused-varRodrigo Locatti2020-04-241-3/+0
|\ \ \
| * | | svc: Remove unused variableLioncash2020-04-231-3/+0
| |/ /
* / / shared_memory: Amend doxygen referenceLioncash2020-04-242-5/+5
|/ /
* | kernel: memory: Improve implementation of device shared memory. (#3707)bunnei2020-04-235-3/+105
* | Merge pull request #3730 from lioncash/timebunnei2020-04-231-24/+26
|\ \
| * | service/time: Remove reliance on the global system accessorLioncash2020-04-191-24/+26
* | | Merge pull request #3697 from lioncash/declarationsbunnei2020-04-232-6/+2
|\ \ \
| * | | General: Resolve warnings related to missing declarationsLioncash2020-04-172-6/+2
* | | | Merge pull request #3725 from MerryMage/fpcrbunnei2020-04-231-2/+1
|\ \ \ \
| * | | | thread: FPCR.FZ is likely not 1MerryMage2020-04-191-2/+1
* | | | | Merge pull request #3698 from lioncash/warningbunnei2020-04-211-2/+2
|\ \ \ \ \
| * | | | | time_zone_manager: Resolve sign conversion warningsLioncash2020-04-171-2/+2
| | |/ / / | |/| | |
* | | | | audio_renderer: Preliminary BehaviorInfo (#3736)David2020-04-211-2/+7
| |_|_|/ |/| | |
* | | | npad: Lower log level for VibrateController to DebugFearlessTobi2020-04-201-1/+1
* | | | audren: Lower log level for RequestUpdateImpl to DebugFearlessTobi2020-04-201-1/+1
* | | | Merge pull request #3712 from lioncash/removebunnei2020-04-202-3/+0
|\ \ \ \
| * | | | service: Remove unused RequestParser instancesLioncash2020-04-182-3/+0
* | | | | Merge pull request #3709 from lioncash/ambunnei2020-04-201-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | am: Resolve ineffective movesLioncash2020-04-181-2/+2
| |/ / /
* | | | Merge pull request #3696 from lioncash/cast-sizebunnei2020-04-192-21/+23
|\ \ \ \
| * | | | hle_ipc: Remove std::size_t casts where applicableLioncash2020-04-172-21/+23
| | |/ / | |/| |
* | | | Merge pull request #3715 from bunnei/fix-impl-fallthroughMat M2020-04-181-0/+2
|\ \ \ \
| * | | | service: hid: npad: Fix implicit fallthrough errors.bunnei2020-04-181-0/+2
| | |/ / | |/| |
* | | | Merge pull request #3713 from lioncash/timebunnei2020-04-185-4/+5
|\ \ \ \
| * | | | time/system_clock_core: Remove unnecessary initializerLioncash2020-04-181-1/+1
| * | | | service/time: Mark IsStandardNetworkSystemClockAccuracySufficient as constLioncash2020-04-181-1/+1
| * | | | service/time: Add virtual destructors where applicableLioncash2020-04-183-2/+3
| |/ / /
* / / / memory/slab_heap: Make use of static_cast over reinterpret_castLioncash2020-04-181-2/+2
|/ / /
* | | core: hle: Address various feedback & code cleanup.bunnei2020-04-1710-244/+144
* | | memory: Add copyright notice for Atmosphere where applicable.bunnei2020-04-176-0/+18
* | | kernel: Remove old VMManager class.bunnei2020-04-172-1971/+0
* | | service: ldr: Updates for new VMM.bunnei2020-04-171-150/+215
* | | kernel: memory: page_table: Simplify GetPhysicalAddr impl.bunnei2020-04-172-5/+3
* | | kernel: svc: Updates for new VMM.bunnei2020-04-171-488/+116
* | | kernel: process: Updates for new VMM.bunnei2020-04-172-79/+151
* | | service: pl_u: Update for new shared memory layout.bunnei2020-04-171-7/+5
* | | service: time: Update for new shared memory layout.bunnei2020-04-171-3/+2
* | | service: hid: Update for new shared memory layout.bunnei2020-04-171-3/+2
* | | service: irs: Update for new shared memory layout.bunnei2020-04-171-3/+3
* | | kernel: resource_limit: Reserve physical memory.bunnei2020-04-171-1/+6
* | | kernel: Initialize memory layout for new VMM.bunnei2020-04-172-0/+159
* | | core: system: Rename GetDeviceManager -> DeviceManager.bunnei2020-04-171-1/+1
* | | kernel: transfer_memory: Refactor for new VMM.bunnei2020-04-172-130/+16
* | | kernel: shared_memory: Refactor for new VMM.bunnei2020-04-172-220/+58
* | | kernel: errors: Add ERR_OUT_OF_RESOURCES.bunnei2020-04-171-0/+1
* | | kernel: process_capability: Update to use Memory::PageTable.bunnei2020-04-172-23/+25
* | | kernel: memory: Add PageTable class, to manage process address space.bunnei2020-04-172-0/+1508
* | | kernel: memory: Add MemoryLayout class, to build physical memory layout.bunnei2020-04-171-0/+73
* | | kernel: memory: Add MemoryManager class, to manage page heaps.bunnei2020-04-172-0/+274
* | | kernel: memory: Add MemoryBlockManager class, to manage memory blocks.bunnei2020-04-172-0/+254
* | | kernel: memory: Add PageHeap class, to manage a heap of pages.bunnei2020-04-172-0/+481
* | | kernel: memory: Add PageLinkedList class, to manage a list of pages.bunnei2020-04-171-0/+93
* | | kernel: memory: Add system_control code, which will be used for ASLR support.bunnei2020-04-172-0/+59
* | | physical_memory: Add missing include for <vector>.bunnei2020-04-171-0/+2
* | | kernel: memory: Add MemoryBlock class, for managing memory blocks and their state.bunnei2020-04-171-0/+315
* | | kernel: memory: Add memory_types.h, for things that are commonly used in memory code.bunnei2020-04-171-0/+18
* | | kernel: memory: Add SlabHeap class, for managing memory heaps.bunnei2020-04-171-0/+161
* | | kernel: memory: Add AddressSpaceInfo class, for managing the memory address space.bunnei2020-04-172-0/+164
* | | core: memory: Move to Core::Memory namespace.bunnei2020-04-1710-30/+34
* | | core: kernel: Add svc_types header to include SVC-specific types.bunnei2020-04-172-0/+69
* | | core: kernel: Move SVC to its own namesapce.bunnei2020-04-172-6/+6
* | | kernel: resource_limit: Improvements to implementation.bunnei2020-04-172-12/+50
* | | process: SetupMainThread: Zero out argument on process start.bunnei2020-04-171-0/+2
* | | Merge pull request #3671 from lioncash/switchbunnei2020-04-171-0/+2
|\ \ \ | |/ / |/| |
| * | kernel/thread: Resolve -Wswitch warningsLioncash2020-04-151-0/+2
* | | Merge pull request #3673 from lioncash/extrabunnei2020-04-176-23/+27
|\ \ \
| * | | CMakeLists: Specify -Wextra on linux buildsLioncash2020-04-166-23/+27
* | | | Merge pull request #3659 from bunnei/time-calc-standard-userRodrigo Locatti2020-04-163-1/+25
|\ \ \ \ | |/ / / |/| | |
| * | | service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.bunnei2020-04-153-1/+25
| | |/ | |/|
* | | CMakeLists: Make -Wreorder a compile-time errorLioncash2020-04-151-1/+1
| |/ |/|
* | service: friend: Stub IFriendService::GetBlockedUserListIds.bunnei2020-04-141-1/+10
|/
* Merge pull request #3606 from ReinUsesLisp/nvflingerbunnei2020-04-123-10/+44
|\
| * service/vi: Partially implement BufferQueue disconnectReinUsesLisp2020-04-103-10/+44
* | Buffer queue: Correct behavior of free buffer.Fernando Sahmkow2020-04-102-9/+33
|/
* Merge pull request #3563 from bunnei/fix-ldr-memstateFernando Sahmkow2020-04-031-5/+15
|\
| * services: ldr: Fix MemoryState for read/write regions of NROs.bunnei2020-03-261-5/+15
* | capsrv: Split Capture services into individual files and stub GetAlbumContentsFileListForApplication (#3571)Morph2020-04-0114-151/+524
* | Merge pull request #3568 from bunnei/time-calcspanbunnei2020-03-293-1/+31
|\ \
| * | services: time: Implement CalculateSpanBetween.bunnei2020-03-273-1/+31
| |/
* | Merge pull request #3562 from perillamint/vrsvcbunnei2020-03-282-3/+42
|\ \
| * | am: Implement VR related APIsperillamint2020-03-272-3/+42
| |/
* / services: hid: Stub InitializeSevenSixAxisSensor.bunnei2020-03-272-1/+9
|/
* sm/controller: Increase PointerBufferSizeFearlessTobi2020-03-231-1/+1
* Merge pull request #3477 from FearlessTobi/webapplet-shitbunnei2020-03-221-0/+6
|\
| * core/web_browser: Allow WebApplet to exit gracefully when an error occursFearlessTobi2020-03-221-0/+6
* | set: implement GetRegionCodeDan2020-03-192-1/+10
* | time_zone_content_manager: Fix out of bounds readReinUsesLisp2020-03-181-1/+1
* | NVFlinger: Do the microprofile Flip after processing a valid frame.Fernando Sahmkow2020-03-121-2/+2
* | core: hle: Implement separate A32/A64 SVC interfaces.bunnei2020-03-032-107/+380
* | core: Implement separate A32/A64 ARM interfaces.bunnei2020-03-038-36/+73
|/
* AM/ICommonStateGetter: Stub SetLcdBacklighOffEnabled (#3454)Morph2020-02-272-2/+14
* Merge pull request #3431 from CJBok/npad-fixbunnei2020-02-261-5/+5
|\
| * analog_from_button get direction implementationCJBok2020-02-181-5/+5
* | Scheduler: Inline global scheduler in Scheduler Lock.Fernando Sahmkow2020-02-221-4/+2
* | Kernel: Correct pending feedback.Fernando Sahmkow2020-02-221-3/+4
* | Kernel: Address Feedback.Fernando Sahmkow2020-02-226-30/+47
* | Kernel: Implement Scheduler locksFernando Sahmkow2020-02-222-0/+89
* | Kernel: Implement Time Manager.Fernando Sahmkow2020-02-224-1/+96
* | Kernel: Rename ThreadCallbackHandleTable and Setup Thread Ids on Kernel.Fernando Sahmkow2020-02-224-24/+105
* | Kernel: Make global scheduler depend on KernelCoreFernando Sahmkow2020-02-224-8/+24
* | httplib compatibilityBrian Clinkenbeard2020-02-191-3/+4
|/
* Merge pull request #3420 from namkazt/master2bunnei2020-02-172-0/+20
|\
| * nvhost_gpu: implement ChannelSetTimeslicenamkazy2020-02-162-0/+20
* | IUserLocalCommunicationService: add function Initialize2Nguyen Dac Nam2020-02-161-1/+9
* | HLE: correct function name of IUserLocalCommunicationServiceNguyen Dac Nam2020-02-161-1/+1
|/
* Merge pull request #3401 from FernandoS27/synchronizationbunnei2020-02-1431-176/+330
|\
| * Core: Address FeedbackFernando Sahmkow2020-02-145-16/+27
| * Core: Set all hardware emulation constants in a single file.Fernando Sahmkow2020-02-129-29/+37
| * Kernel: Refactor synchronization to better match REFernando Sahmkow2020-02-1122-80/+210
| * Kernel: Change WaitObject to Synchronization object. In order to better reflect RE.Fernando Sahmkow2020-02-1119-71/+76
* | Merge pull request #3400 from makigumo/patch-1bunnei2020-02-141-2/+4
|\ \
| * | update hwopus DecodeInterleaved for FW 7.0.0+makigumo2020-02-111-2/+4
| |/
* | address_arbiter: Collapse loops in InsertThread() and RemoveThread()Lioncash2020-02-121-19/+17
* | address_arbiter: Simplify GetThreadsWaitingOnAddress()Lioncash2020-02-122-10/+9
* | Merge pull request #3403 from lioncash/debugbunnei2020-02-121-2/+2
|\ \
| * | bcat/backend: Make formatting of passphrase consistent in NullBackend::SetPassphrase()Lioncash2020-02-121-1/+1
| * | bcat/backend: Prevent fmt exception in debug log within NullBackend::Clear()Lioncash2020-02-121-1/+1
| |/
* / kernel/thread: Remove trivial usages of the global system accessorLioncash2020-02-121-2/+2
|/
* hle: services: Use std::shared_ptr instead of copy by value.bunnei2020-02-089-50/+52
* Merge pull request #3381 from bunnei/ipc-fixbunnei2020-02-072-23/+57
|\
| * services: prepo: Fix IPC interface with SaveReport/SaveReportWithUser.bunnei2020-02-061-15/+15
| * hle_ipc: Add error checking to read/write buffer access.bunnei2020-02-061-8/+42
* | kernel: transfer_memory: Properly reserve and reset memory region.bunnei2020-02-065-40/+116
* | wait_object: Make wait behavior only require one object to signal.Zach Hilman2020-02-061-11/+2
* | am: Correct IPC object count mismatch.bunnei2020-02-061-6/+4
* | services: am: Clear events on PopOutData and PopInteractiveOutData.bunnei2020-02-061-0/+2
* | am: Refactor IStorage interface.bunnei2020-02-067-43/+81
* | applets: software_keyboard: Signal state change on end of interactive session.bunnei2020-02-061-0/+1
* | applets: software_keyboard: Minor cleanup.bunnei2020-02-061-2/+2
|/
* Merge pull request #3284 from CJBok/hid-fixbunnei2020-02-011-13/+26
|\
| * Moved analog direction logic to sdl_implCJBok2020-01-151-9/+22
| * Corrected directional states sensitivityCJBok2020-01-141-9/+9
| * hid: Fix analog sticks directional statesCJBok2020-01-091-12/+12
* | kernel/physical_core: Make use of std::unique_ptrLioncash2020-01-312-4/+10
* | kernel/physical_core: Remove unused kernel reference member variableLioncash2020-01-313-11/+7
* | Merge pull request #3353 from FernandoS27/ariesbunnei2020-01-319-9/+198
|\ \
| * | System: Address FeedbackFernando Sahmkow2020-01-274-10/+20
| * | Kernel: Remove a few global instances from the kernel.Fernando Sahmkow2020-01-262-2/+2
| * | Core: Refactor CpuCoreManager to CpuManager and Cpu to Core Manager.Fernando Sahmkow2020-01-265-6/+2
| * | ArmInterface: Delegate Exclusive monitor factory to exclusive monitor interfasce.Fernando Sahmkow2020-01-261-15/+2
| * | Core: Refactor CPU Management.Fernando Sahmkow2020-01-254-12/+127
| * | Kernel: Implement Physical Core.Fernando Sahmkow2020-01-242-0/+81
* | | bsd: Stub several more functions.bunnei2020-01-252-4/+48
|/ /
* | service: time: Implement ToPosixTimeWithMyRule.bunnei2020-01-234-1/+34
* | time: Fix month off-by-one error.bunnei2020-01-201-2/+2
* | Merge pull request #3271 from bunnei/time-rewritebunnei2020-01-2039-533/+2962
|\ \
| * | service: time: Implement GetStandardLocalSystemClock.bunnei2020-01-053-1/+9
| * | time: Remove overflow error checking (currently breaks ADO builds).bunnei2020-01-042-18/+2
| * | service: time: Implement GetClockSnapshotFromSystemClockContext.bunnei2020-01-043-3/+27
| * | service: time: Implement IsStandardNetworkSystemClockAccuracySufficient.bunnei2020-01-045-1/+51
| * | service: time: Rewrite implementation of glue services.bunnei2020-01-0434-444/+2806
| * | core: Initialize several structs that make use of Common::UUID.bunnei2020-01-045-100/+101
* | | core/memory: Create a special MapMemoryRegion for physical memory.Markus Wick2020-01-182-3/+5
* | | core/hle: Simplify PhysicalMemory usage in vm_manager.Markus Wick2020-01-181-23/+11
* | | core/kernel: Fix GetTotalPhysicalMemoryUsed.Markus Wick2020-01-111-2/+2
| |/ |/|
* | Merge pull request #3272 from bunnei/vi-close-layerbunnei2020-01-075-11/+48
|\ \
| * | service: vi: Implement CloseLayer.bunnei2020-01-045-11/+48
| |/
* | Merge pull request #3257 from degasus/no_busy_loopsbunnei2020-01-061-1/+1
|\ \
| * | video_core: Block in WaitFence.Markus Wick2019-12-301-1/+1
* | | Merge pull request #2945 from FernandoS27/fix-bcatbunnei2020-01-051-3/+17
|\ \ \ | |_|/ |/| |
| * | nifm: Only return that there's an internet connection when there's a BCATServerFernando Sahmkow2019-11-071-3/+17
* | | NvServices: Correct Ioctl Remap.Fernando Sahmkow2019-12-252-3/+5
| |/ |/|
* | Merge pull request #3214 from lioncash/svc-funcbunnei2019-12-132-9/+6
|\ \
| * | kernel/svc: Correct function signature of SignalProcessWideKeyLioncash2019-12-112-9/+6
* | | Kernel: Correct behavior of Address Arbiter threads. (#3165)Fernando Sahmkow2019-12-113-24/+67
|/ /
* | Merge pull request #3201 from lioncash/dumpbunnei2019-12-112-2/+24
|\ \
| * | kernel/svc: Provide implementations for svcDumpInfo/svcDumpInfoNewLioncash2019-12-082-2/+24
* | | kernel: Remove unnecessary includesLioncash2019-12-0815-11/+17
|/ /
* | CpuCore: Clear exclusive state after doing a run in dynarmic.Fernando Sahmkow2019-12-051-1/+0
* | kernel: Implement a more accurate IPC dispatch.bunnei2019-11-2818-167/+245
* | Merge pull request #3169 from lioncash/memorybunnei2019-11-2817-89/+133
|\ \
| * | core/memory; Migrate over SetCurrentPageTable() to the Memory classLioncash2019-11-271-7/+11
| * | core/memory: Migrate over Write{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-274-21/+25
| * | core/memory: Migrate over Read{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-278-33/+50
| * | core/memory: Migrate over ReadCString() to the Memory classLioncash2019-11-271-2/+4
| * | core/memory: Migrate over GetPointer()Lioncash2019-11-271-1/+2
| * | core: Prepare various classes for memory read/write migrationLioncash2019-11-278-17/+32
| * | core/memory: Migrate over address checking functions to the new Memory classLioncash2019-11-273-8/+8
| * | core/memory: Migrate over memory mapping functions to the new Memory classLioncash2019-11-271-6/+7
* | | Merge pull request #3170 from lioncash/enumbunnei2019-11-281-2/+2
|\ \ \ | |/ / |/| |
| * | file_sys/directory: Make EntryType an enum classLioncash2019-11-271-2/+2
* | | core_timing: Use better reference tracking for EventType. (#3159)bunnei2019-11-276-14/+14
|/ /
* | kernel: Fix reference management for client/server session.bunnei2019-11-263-20/+18
* | Merge pull request #3094 from lioncash/tablesbunnei2019-11-2533-7/+192
|\ \
| * | service: Update function tablesLioncash2019-11-1233-7/+192
| |/
* | kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. (#3154)bunnei2019-11-2569-364/+364
* | Update svc.cppbunnei2019-11-231-0/+1
* | svc: GetSystemTick should return cntpct_el0, not core ticks.bunnei2019-11-231-1/+3
* | Merge pull request #3114 from FernandoS27/cond-varbunnei2019-11-235-22/+74
|\ \
| * | Kernel: Optimize condition variable threads management.Fernando Sahmkow2019-11-214-24/+21
| * | Kernel: Correct SignalProcessWideKeyFernando Sahmkow2019-11-211-6/+2
| * | Kernel: Correct behavior of Condition Variables to be more similar to real hardware.Fernando Sahmkow2019-11-215-15/+74
* | | Merge pull request #3130 from FernandoS27/cancel-syncbunnei2019-11-233-2/+19
|\ \ \
| * | | Kernel: Correct Cancel Synchronization.Fernando Sahmkow2019-11-163-2/+19
* | | | Merge pull request #3112 from lioncash/skipbunnei2019-11-211-8/+16
|\ \ \ \
| * | | | service/am: Remove unnecessary Skip callsLioncash2019-11-141-8/+16
| |/ / /
* | | | Merge pull request #3111 from lioncash/querybunnei2019-11-212-5/+14
|\ \ \ \ | |_|/ / |/| | |
| * | | am: Stub QueryApplicationPlayStatisticsLioncash2019-11-142-5/+14
| |/ /
* | | Merge pull request #3091 from lioncash/core-conversionbunnei2019-11-1520-131/+124
|\ \ \ | |/ / |/| |
| * | service: Resolve sign conversion errorsLioncash2019-11-1215-58/+55
| * | kernel: Resolve sign conversion warningsLioncash2019-11-124-72/+60
| * | result: Add default error code for the ResultCode(-1) caseLioncash2019-11-121-1/+9
| * | result: Resolve sign-coversion warningsLioncash2019-11-121-1/+1
| |/
* | Merge pull request #3089 from SciresM/play_statisticsbunnei2019-11-142-0/+10
|\ \
| * | Implement stub for QueryApplicationPlayStatisticsByUidMichael Scire2019-11-112-0/+10
| |/
* / core: Migrate off deprecated mbedtls functionsLioncash2019-11-123-3/+3
|/
* Merge pull request #3062 from bunnei/event-improvebunnei2019-11-0623-87/+53
|\
| * kernel: readable_event: Signal only once.bunnei2019-11-031-2/+4
| * kernel: events: Remove ResetType::Automatic.bunnei2019-11-0323-84/+48
| * kernel: readable_event: Initialize members.bunnei2019-11-031-1/+1
* | Merge pull request #2859 from Morph1984/hidDavid2019-11-062-92/+126
|\ \
| * | hid: Stub SetNpadJoyAssignmentModeSingle and reorganize service commandsMorph2019-10-072-92/+126
* | | common_func: Use std::array for INSERT_PADDING_* macros.bunnei2019-11-043-8/+11
* | | core/am: Stub InitializeApplicationCopyrightFrameBuffer, SetApplicationCopyrightImage and SetApplicationCopyrightVisibilityFearlessTobi2019-11-032-3/+31
| |/ |/|
* | scheduler: Mark parameter of AskForReselectionOrMarkRedundant() as constLioncash2019-10-282-5/+5
* | scheduler: Silence sign conversion warningsLioncash2019-10-281-5/+5
* | scheduler: Initialize class members directly where applicableLioncash2019-10-282-6/+4
* | scheduler: Amend documentation commentsLioncash2019-10-282-75/+59
* | Merge pull request #2971 from FernandoS27/new-scheduler-v2David2019-10-2811-398/+955
|\ \
| * | Kernel Thread: Cleanup THREADPROCESSORID_DONT_UPDATE.Fernando Sahmkow2019-10-152-4/+1
| * | Kernel: Address Feedback 2Fernando Sahmkow2019-10-152-9/+6
| * | Kernel: Clang FormatFernando Sahmkow2019-10-152-5/+5
| * | Kernel: Reverse global accessor removal.Fernando Sahmkow2019-10-154-23/+9
| * | Kernel: Address Feedback.Fernando Sahmkow2019-10-156-67/+98
| * | Kernel Scheduler: Make sure the global scheduler shutdowns correctly.Fernando Sahmkow2019-10-153-0/+17
| * | Kernel_Thread: Eliminate most global accessors.Fernando Sahmkow2019-10-151-11/+11
| * | KernelSVC: Assert that condition variable address is aligned to 4 bytes.Fernando Sahmkow2019-10-151-0/+4
| * | Kernel: Correct Paused schedulingFernando Sahmkow2019-10-151-3/+1
| * | Kernel: Corrections to Wait Objects clearing in which a thread could still be signalled after a timeout or a cancel.Fernando Sahmkow2019-10-153-3/+4
| * | Kernel: Correct redundant yields to only advance time forward.Fernando Sahmkow2019-10-151-3/+5
| * | Kernel: Corrections to ModifyByWaitingCountAndSignalToAddressIfEqualFernando Sahmkow2019-10-151-5/+13
| * | Kernel: Correct Results in Condition Variables and MutexesFernando Sahmkow2019-10-153-24/+17
| * | Kernel: Clang FormatFernando Sahmkow2019-10-152-2/+3
| * | Kernel: Remove global system accessor from WaitObjectFernando Sahmkow2019-10-154-2/+17
| * | Scheduler: Implement Yield Count and Core migration on Thread Preemption.Fernando Sahmkow2019-10-152-5/+85
| * | Scheduler: Corrections to YieldAndBalanceLoad and Yield bombing protection.Fernando Sahmkow2019-10-152-8/+8
| * | Kernel: Initial implementation of thread preemption.Fernando Sahmkow2019-10-153-0/+30
| * | Scheduler: Add protections for Yield bombingFernando Sahmkow2019-10-155-24/+31
| * | Kernel: Style and CorrectionsFernando Sahmkow2019-10-158-90/+130
| * | Correct PrepareRescheduleFernando Sahmkow2019-10-153-37/+20
| * | Comment and reorganize the schedulerFernando Sahmkow2019-10-152-98/+104
| * | Add PrepareReschedule where required.Fernando Sahmkow2019-10-153-16/+18
| * | Correct compiling errors and addapt to the new interface.Fernando Sahmkow2019-10-151-4/+1
| * | Correct Supervisor Calls to work with the new scheduler,Fernando Sahmkow2019-10-151-26/+41
| * | Add interfacing to the Global SchedulerFernando Sahmkow2019-10-152-0/+17
| * | Addapt thread class to the new SchedulerFernando Sahmkow2019-10-152-60/+237
| * | Implement a new Core SchedulerFernando Sahmkow2019-10-152-258/+411
* | | Merge pull request #2991 from lioncash/npadbunnei2019-10-232-51/+23
|\ \ \
| * | | hid/npad: Fix incorrect connection boolean value in ConnectAllDisconnectedControllers()Lioncash2019-10-181-1/+1
| * | | hid/npad: Add missing break in default caseLioncash2019-10-181-0/+1
| * | | hid/npad: Replace std::for_each with ranged for loopsLioncash2019-10-181-13/+12
| * | | hid/npad: Remove redundant non-const variant of IsControllerSupported()Lioncash2019-10-182-34/+5
| * | | hid/npad: Move function declarationsLioncash2019-10-181-5/+6
* | | | apm/controller: Make SetPerformanceConfiguration() use an array of pairs over a mapLioncash2019-10-171-14/+34
* | | | apm/controller: Make GetCurrentPerformanceMode() a const member functionLioncash2019-10-172-2/+2
|/ / /
* | | Merge pull request #2912 from FernandoS27/async-fixesbunnei2019-10-165-28/+27
|\ \ \
| * | | NvFlinger: Remove leftover from corrections and clang format.Fernando Sahmkow2019-10-051-4/+0
| * | | Nvdrv: Correct Event setup in NvdrvFernando Sahmkow2019-10-052-23/+14
| * | | NVFlinger: Reverse the change that only signaled events on buffer acquire.Fernando Sahmkow2019-10-052-20/+1
| * | | Nvdrv: Do framelimiting only in the CPU ThreadFernando Sahmkow2019-10-051-0/+4
| * | | NvFlinger: Don't swap buffers if a frame is missing and always trigger event in sync gpu.Fernando Sahmkow2019-10-051-1/+3
| * | | GPU_Async: Correct fences, display events and more.Fernando Sahmkow2019-10-052-2/+21
| * | | Nvdrv: Correct Async regression and avoid signaling empty buffer vsyncsFernando Sahmkow2019-10-052-3/+9
* | | | Merge pull request #2972 from lioncash/systembunnei2019-10-159-33/+63
|\ \ \ \ | |_|/ / |/| | |
| * | | bcat: Remove use of global system accessorsLioncash2019-10-156-29/+55
| * | | nvflinger/buffer_queue: Remove use of a global system accessorLioncash2019-10-123-4/+8
* | | | pl_u: Fix mismatched rebase size error in font encryptionZach Hilman2019-10-132-11/+11
* | | | pl_u: Use kernel physical memoryZach Hilman2019-10-131-0/+1
* | | | pl_u: Remove excess static qualifierZach Hilman2019-10-131-1/+1
* | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-10-131-110/+47
|/ / /
* | | Merge pull request #2921 from FreddyFunk/compiler-warnings-corebunnei2019-10-091-6/+6
|\ \ \
| * | | Services::ES fix casting warningsFreddyFunk2019-09-291-6/+6
* | | | Merge pull request #2654 from DarkLordZach/lm-log-rewritebunnei2019-10-095-156/+278
|\ \ \ \
| * | | | lm: Flush manager output on core shutdownZach Hilman2019-09-222-5/+11
| * | | | lm: Rename Initialize to Log and implement with manager/reporterZach Hilman2019-09-221-140/+22
| * | | | lm: Implement manager class to output to reporterZach Hilman2019-09-222-0/+233
| * | | | core: Add LM::Manager to systemZach Hilman2019-09-223-16/+17
| |/ / /
* | | / hid: Implement DeactivateNpadMorph2019-10-072-1/+13
| |_|/ |/| |
* | | Merge pull request #2951 from lioncash/globalZach Hilman2019-10-0711-44/+66
|\ \ \
| * | | core: Remove Core::CurrentProcess()Lioncash2019-10-061-1/+1
| * | | hle/service: Replace global system instance calls with instance-based onesLioncash2019-10-0610-43/+65
* | | | bcat/module: Silence truncation warningsLioncash2019-10-061-3/+3
* | | | bcat: Take std::function instance by value in NullBackend's constructorLioncash2019-10-062-2/+2
* | | | bcat: In-class initialize ProgressServiceBackend's impl memberLioncash2019-10-062-2/+2
* | | | bcat: Make ProgressServiceBackend's constructor take a std::string_viewLioncash2019-10-062-3/+7
* | | | bcat: Make ProgressServiceBackend's GetEvent() constLioncash2019-10-062-2/+2
* | | | boxcat: Silence an unused variable warningLioncash2019-10-061-1/+2
|/ / /
* | | audio/audout_u: Change formatting for old clang-format versionsReinUsesLisp2019-10-051-1/+1
* | | service/nvdrv: Silence -WswitchReinUsesLisp2019-10-054-4/+10
* | | service/nfp: Silence -Wunused and -WswitchReinUsesLisp2019-10-051-4/+5
* | | service/hid: Silence -Wunused and -WswitchReinUsesLisp2019-10-0515-23/+18
* | | service/am: Silence -WreorderReinUsesLisp2019-10-051-2/+1
* | | service/hid: Remove unused system referenceReinUsesLisp2019-10-052-2/+1
* | | service/friend: Remove unused fieldReinUsesLisp2019-10-051-1/+0
* | | service/filesystem: Silence -Wunused-variableReinUsesLisp2019-10-051-1/+1
* | | service/bcat: Silence -Wreorder and -WunusedReinUsesLisp2019-10-052-2/+2
* | | service/audio: Silence -WunusedReinUsesLisp2019-10-051-1/+1
* | | service/apm: Silence -Wunused and -WreorderReinUsesLisp2019-10-052-4/+5
| |/ |/|
* | Merge pull request #2539 from DarkLordZach/bcatDavid2019-10-0316-40/+1497
|\ \
| * | qt: Add service dialogZach Hilman2019-10-021-6/+5
| * | boxcat: Use updated game-asset API URL and tagsZach Hilman2019-10-011-6/+6
| * | bcat: Add FSC accessors for BCAT dataZach Hilman2019-10-0110-31/+51
| * | boxcat: Implement events global fieldZach Hilman2019-09-303-12/+14
| * | bcat: Implement DeliveryCacheProgressImpl structureZach Hilman2019-09-305-84/+310
| * | boxcat: Use Etag header names for file digestZach Hilman2019-09-301-10/+11
| * | boxcat: Add downloading and client for launch parameter dataZach Hilman2019-09-302-16/+77
| * | bcat: Add backend function for BCAT Indirect (launch parameter)Zach Hilman2019-09-302-0/+11
| * | bcat: Expose CreateBackendFromSettings helper functionZach Hilman2019-09-302-2/+2
| * | am: Unstub PopLaunchParameter and add bcat connection for app-specific dataZach Hilman2019-09-302-16/+52
| * | bcat: Implement cmd 90201 ClearDeliveryCacheStorageZach Hilman2019-09-301-1/+23
| * | bcat: Implement cmd 30100 SetPassphraseZach Hilman2019-09-301-1/+33
| * | bcat: Implement cmd RequestSyncDeliveryCache and variantZach Hilman2019-09-301-2/+70
| * | bcat: Implement IDeliveryCacheProgressService commandsZach Hilman2019-09-301-0/+131
| * | bcat: Implement IDeliveryCacheFileService commandsZach Hilman2019-09-301-0/+117
| * | bcat: Implement IDeliveryCacheDirectoryService commandsZach Hilman2019-09-301-0/+99
| * | bcat: Implement IDeliveryCacheStorageService commandsZach Hilman2019-09-301-0/+58
| * | bcat: Add commands to create IDeliveryCacheStorageServiceZach Hilman2019-09-303-2/+32
| * | module: Create BCAT backend based upon Settings value on constructionZach Hilman2019-09-302-1/+16
| * | bcat: Add BCAT backend for Boxcat serviceZach Hilman2019-09-302-0/+407
| * | bcat: Add backend class to generify the functions of BCATZach Hilman2019-09-302-0/+100
| * | nifm: Signal to applications that internet access is availableZach Hilman2019-09-301-3/+10
| * | applets: Add accessor for AppletFrontendSetZach Hilman2019-09-302-0/+6
| * | filesystem: Add getter for BCAT temporary directoryZach Hilman2019-09-301-0/+9
| |/
* / Signal styleset changes at a better timeDavid Marcec2019-09-241-8/+2
|/
* Merge pull request #2683 from DarkLordZach/lock-exitDavid2019-09-224-7/+33
|\
| * qt: Prompt user for confirmation if exit lock is activeZach Hilman2019-09-221-1/+1
| * am: Implement ISelfController ExitLock commandsZach Hilman2019-09-221-2/+6
| * am: Implement ISelfController ExitZach Hilman2019-09-224-4/+20
| * am: Add RequestExit event to AppletMessageQueueZach Hilman2019-09-222-0/+6
* | Merge pull request #2876 from ogniK5377/AcquireNpadStyleSetUpdateEventHandle-fixZach Hilman2019-09-223-11/+18
|\ \
| * | removed commentDavid Marcec2019-09-221-1/+0
| * | RebasedDavid Marcec2019-09-223-11/+19
* | | Merge pull request #2895 from FearlessTobi/debug-logsDavid2019-09-221-7/+7
|\ \ \
| * | | service/acc: Lower log severity from INFO to DEBUGFearlessTobi2019-09-221-7/+7
* | | | Merge pull request #2873 from ogniK5377/new-ioctlsFernando Sahmkow2019-09-2224-73/+153
|\ \ \ \ | |_|/ / |/| | |
| * | | server side clang format fix2David Marcec2019-09-221-18/+18
| * | | Use clang-format provided by build serverDavid Marcec2019-09-221-20/+18
| * | | disable clang-format tempDavid Marcec2019-09-201-0/+2
| * | | Initial implementation of Ioctl2 & Ioctl3David Marcec2019-09-1924-63/+143
* | | | Merge pull request #2884 from ogniK5377/deglobal-sys-servicesFernando Sahmkow2019-09-2264-212/+291
|\ \ \ \
| * | | | removed unneeded semicolonDavid Marcec2019-09-221-1/+1
| * | | | Removed reference to core timing to nvflinger and used system insteadDavid Marcec2019-09-221-1/+1
| * | | | marked controller constructors as explicitDavid Marcec2019-09-228-8/+8
| * | | | RebaseDavid Marcec2019-09-2225-62/+75
| * | | | RebaseDavid Marcec2019-09-225-20/+21
| * | | | Deglobalize System: ViDavid Marcec2019-09-223-8/+8
| * | | | Deglobalize System: TimeDavid Marcec2019-09-224-14/+21
| * | | | RebaseDavid Marcec2019-09-222-8/+12
| * | | | Deglobalize System: NvFlingerDavid Marcec2019-09-222-6/+7
| * | | | RebaseDavid Marcec2019-09-224-8/+12
| * | | | Deglobalize System: NimDavid Marcec2019-09-222-7/+12
| * | | | Deglobalize System: NifmDavid Marcec2019-09-222-13/+23
| * | | | Deglobalize System: NFPDavid Marcec2019-09-224-14/+16
| * | | | Deglobalize System: LDRDavid Marcec2019-09-222-6/+7
| * | | | Deglobalize System: IRSDavid Marcec2019-09-223-5/+6
| * | | | Deglobalize System: HidDavid Marcec2019-09-2220-37/+44
| * | | | Deglobalize System: FriendDavid Marcec2019-09-224-22/+24
| * | | | Deglobalize System: FatalDavid Marcec2019-09-226-20/+29
| * | | | Deglobalize System: BtmDavid Marcec2019-09-222-7/+13
| * | | | Deglobalize System: BtdrvDavid Marcec2019-09-222-5/+9
| * | | | Deglobalize System: AocDavid Marcec2019-09-222-11/+13
| * | | | Deglobalize System: AmDavid Marcec2019-09-221-1/+1
* | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"David Marcec2019-09-222-50/+117
|/ / / /
* | | | Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1David2019-09-222-117/+50
|\ \ \ \ | |_|_|/ |/| | |
| * | | pl_u: Use kernel physical memoryZach Hilman2019-09-221-0/+1
| * | | pl_u: Remove excess static qualifierZach Hilman2019-09-221-1/+1
| * | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-09-222-109/+41
| * | | pl_u: Expose method to encrypt TTF to BFTTFZach Hilman2019-09-222-14/+14
| | |/ | |/|
* | | Merge pull request #2612 from DarkLordZach/prepo-newDavid2019-09-223-25/+84
|\ \ \
| * | | prepo: Remove system global accessorsZach Hilman2019-09-223-15/+18
| * | | prepo: Implement SaveReport New and System variantsZach Hilman2019-09-221-15/+71
| |/ /
* | | configure_debug: Move reporting option to loggingZach Hilman2019-09-228-14/+15
* | | filesystem: Add const qualification to various accessorsZach Hilman2019-09-213-68/+76
* | | yuzu: Port old usages of Filesystem namespace to FilesystemControllerZach Hilman2019-09-214-15/+38
* | | services: Pass FileSystemController as reference to services that need itZach Hilman2019-09-2111-20/+47
* | | am: Unstub IApplicationFunctions EnsureSaveData (20)Zach Hilman2019-09-211-8/+14
* | | filesystem: Pass Size Getter functions to IFileSystem for sizesZach Hilman2019-09-213-20/+31
* | | filesystem: Add FileSystemController to deglobalize FS servicesZach Hilman2019-09-212-58/+359
|/ /
* / Mark KickOffPb & SubmitGPFIFO as traceDavid Marcec2019-09-211-4/+4
|/
* Merge pull request #2667 from DarkLordZach/profile-editorbunnei2019-09-145-10/+130
|\
| * acc_su: Implement GetProfileEditor (205)Zach Hilman2019-07-033-1/+13
| * acc: Implement IProfileEditor-specific commands 'Store' and 'StoreWithImage'Zach Hilman2019-07-031-1/+73
| * profile_manager: Add setter for ProfileBase and ProfileDataZach Hilman2019-07-032-0/+13
| * acc: Add IProfileCommon for IProfile and IProfileEditorZach Hilman2019-07-031-8/+31
* | Merge pull request #2716 from lioncash/hle-globalDavid2019-09-0916-96/+141
|\ \
| * | service/am: Remove usages of global system accessorsLioncash2019-09-0516-96/+141
* | | Merge pull request #2763 from lioncash/map-physDavid2019-09-092-39/+41
|\ \ \
| * | | kernel/vm_manager: Correct doxygen comment parameter tags for MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-4/+4
| * | | kernel/vm_manager: Move variables closer to usage spots in MapPhysicalMemory/UnmapPhysicalMemoryLioncash2019-09-051-16/+10
| * | | kernel/vm_manager: Correct behavior in failure case of UnmapPhysicalMemory()Lioncash2019-08-301-0/+2
| * | | kernel/vm_manager: Reserve memory ahead of time for slow path in MergeAdjacentVMALioncash2019-08-301-1/+4
| * | | kernel/vm_manager: std::move shared_ptr instance in MergeAdjacentVMALioncash2019-08-301-1/+1
| * | | kernel/vm_manager: Deduplicate iterator creation in MergeAdjacentVMALioncash2019-08-301-7/+10
| * | | kernel/vm_manager: Simplify some std::vector constructor callsLioncash2019-08-301-2/+2
| * | | kernel/vm_manager: Simplify some assertion messagesLioncash2019-08-301-10/+10
* | | | Merge pull request #2418 from DarkLordZach/srv-esDavid2019-09-051-10/+220
|\ \ \ \ | |_|/ / |/| | |
| * | | key_manager: Convert Ticket union to std::variantZach Hilman2019-07-081-2/+2
| * | | es: Populate/synthesize tickets on constructionZach Hilman2019-07-081-2/+3
| * | | key_manager: Add structure for Ticket parsingZach Hilman2019-07-081-9/+9
| * | | es: Implement ETicket GetPersonalizedTicketData (17)Zach Hilman2019-07-081-1/+21
| * | | es: Implement ETicket GetCommonTicketData (16)Zach Hilman2019-07-081-1/+20
| * | | es: Implement ETicket GetPersonalizedTicketSize (15)Zach Hilman2019-07-081-1/+17
| * | | es: Implement ETicket GetCommonTicketSize (14)Zach Hilman2019-07-081-1/+17
| * | | es: Implement ETicket ListPersonalizedTicket (12)Zach Hilman2019-07-081-1/+24
| * | | es: Implement ETicket ListCommonTicket (11)Zach Hilman2019-07-081-1/+24
| * | | es: Implement ETicket CountPersonalizedTicket (10)Zach Hilman2019-07-081-1/+12
| * | | es: Implement ETicket CountCommonTicket (9)Zach Hilman2019-07-081-1/+12
| * | | es: Implement ETicket GetTitleKey (8)Zach Hilman2019-07-081-1/+27
| * | | es: Implement ETicket ImportTicket (1)Zach Hilman2019-07-081-1/+45
* | | | Merge pull request #2834 from Morph1984/audrenu_QueryAudioDeviceInputEventDavid2019-09-051-1/+15
|\ \ \ \
| * | | | Add Kernel::EventPair audio_input_device_switch_event;Morph19842019-09-041-0/+1
| * | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEventMorph19842019-09-041-1/+14
| | |/ / | |/| |
* | | | Merge pull request #2836 from Morph1984/hid_vibrationDavid2019-09-054-2/+32
|\ \ \ \
| * | | | dittoMorph19842019-09-041-1/+1
| * | | | IsVibrationEnabled() as a const member funcMorph19842019-09-041-1/+1
| * | | | clang-formatMorph19842019-09-041-2/+2
| * | | | Update npad.hMorph19842019-09-041-0/+1
| * | | | Update npad.cppMorph19842019-09-041-0/+6
| * | | | Update hid.hMorph19842019-09-041-0/+2
| * | | | Update hid.cppMorph19842019-09-041-2/+23
| |/ / /
* | | | Merge pull request #2818 from MysticExile/fmtDavid2019-09-051-1/+1
|\ \ \ \
| * | | | accommodate for fmt updateEthan2019-08-291-1/+1
| |/ / /
* | | | AM: Stub IApplicationFunctions::GetGpuErrorDetectedSystemEvent (#2827)mailwl2019-09-042-0/+16
* | | | Merge pull request #2829 from Morph1984/audiobunnei2019-09-041-2/+15
|\ \ \ \
| * | | | remove <f32>Morph19842019-09-041-1/+1
| * | | | explicitly represent 1 as a float (1.0f instead of 1)Morph19842019-09-041-1/+1
| * | | | Change u32 -> f32Morph19842019-09-041-1/+1
| * | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolumeMorph19842019-09-031-2/+15
| |/ / /
* | | | Merge pull request #2708 from DarkLordZach/mii-db-source-crashDavid2019-09-041-0/+4
|\ \ \ \
| * | | | mii: Handle logging of unknown database sourceZach Hilman2019-07-101-0/+4
* | | | | Merge pull request #2793 from ReinUsesLisp/bgr565bunnei2019-09-041-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gpu: Change optional<reference_wrapper<T>> to T* for FramebufferConfigReinUsesLisp2019-08-211-1/+1
* | | | | Merge pull request #2748 from FernandoS27/align-memorybunnei2019-08-2110-33/+55
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Kernel: Address FeedbackFernando Sahmkow2019-07-192-3/+9
| * | | | VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-1910-32/+48
* | | | | Merge pull request #2747 from lioncash/audiobunnei2019-08-187-108/+179
|\ \ \ \ \
| * | | | | service/audren_u: Handle audio USB output revision queries in ListAudioDeviceName()Lioncash2019-07-192-16/+45
| * | | | | service/audren_u: Move revision testing code out of AudRenULioncash2019-07-192-63/+63
| * | | | | service/audio: Remove global system accessorsLioncash2019-07-197-34/+54
| * | | | | service/audren_u: Remove unnecessary return value from GetActiveAudioDeviceName()Lioncash2019-07-191-2/+1
| * | | | | service/audren_u: Report proper device namesLioncash2019-07-191-6/+29
| |/ / / /
* | | | | Merge pull request #2592 from FernandoS27/sync1bunnei2019-07-2630-169/+542
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | NVServices: Correct delayed responses.Fernando Sahmkow2019-07-051-24/+19
| * | | | Nv_Host_Ctrl: Correct difference calculationFernando Sahmkow2019-07-051-5/+7
| * | | | NVServices: Address FeedbackFernando Sahmkow2019-07-058-21/+38
| * | | | NVServices: Styling, define constructors as explicit and correctionsFernando Sahmkow2019-07-0518-36/+31
| * | | | NVFlinger: Correct GCC compile errorFernando Sahmkow2019-07-056-17/+16
| * | | | NVServices: Make NVEvents Automatic according to documentation.Fernando Sahmkow2019-07-052-4/+7
| * | | | NVServices: Correct CtrlEventWaitSync to block the ipc until timeout.Fernando Sahmkow2019-07-0523-31/+104
| * | | | GPU: Correct Interrupts to interrupt on syncpt/value instead of event, mirroring hardwareFernando Sahmkow2019-07-055-14/+14
| * | | | nvflinger: Make the force 30 fps still force 30 fpsFernando Sahmkow2019-07-051-1/+1
| * | | | nv_services: Fixes to event liberation.Fernando Sahmkow2019-07-051-6/+14
| * | | | nvflinger: Acquire buffers in the same order as they were queued.Fernando Sahmkow2019-07-052-3/+11
| * | | | nv_services: Deglobalize NvServicesFernando Sahmkow2019-07-0523-51/+65
| * | | | nv_host_ctrl: Make Sync GPU variant always return synced result.Fernando Sahmkow2019-07-051-0/+5
| * | | | nvhost_ctrl: Corrections to event handlingFernando Sahmkow2019-07-052-8/+12
| * | | | Gpu: Mark areas as protected.Fernando Sahmkow2019-07-051-0/+6
| * | | | nv_services: Stub CtrlEventSignalFernando Sahmkow2019-07-052-12/+34
| * | | | Gpu: Implement Hardware Interrupt Manager and manage GPU interruptsFernando Sahmkow2019-07-053-8/+1
| * | | | nv_services: Implement NvQueryEvent, NvCtrlEventWait, NvEventRegister, NvEventUnregisterFernando Sahmkow2019-07-057-17/+192
| * | | | nv_services: Create GPU channels correctlyFernando Sahmkow2019-07-052-2/+5
| * | | | video_core: Implement GPU side SyncpointsFernando Sahmkow2019-07-053-7/+33
| * | | | nv_services: Correct buffer queue fencing and GPFifo fencingFernando Sahmkow2019-07-057-57/+69
| * | | | nvflinger: Implement swap intervalsFernando Sahmkow2019-07-055-8/+21
* | | | | Merge pull request #2687 from lioncash/tls-processbunnei2019-07-183-14/+30
|\ \ \ \ \
| * | | | | kernel/process: Allocate the process' TLS region during initializationLioncash2019-07-073-3/+14
| * | | | | kernel/process: Move main thread stack allocation to its own functionLioncash2019-07-072-12/+17
| | |_|/ / | |/| | |
* | | | | Kernel: Downgrade WaitForAddress and SignalToAddress messages to Trace.Fernando Sahmkow2019-07-181-4/+4
* | | | | Merge pull request #2690 from SciresM/physmem_fixesFernando Sahmkow2019-07-146-40/+470
|\ \ \ \ \
| * | | | | Remove unicorn mappings/unmappingsMichael Scire2019-07-121-19/+0
| * | | | | Prevent merging of device mapped memory blocks.Michael Scire2019-07-091-0/+5
| * | | | | Remove unused member function declarationMichael Scire2019-07-071-9/+0
| * | | | | physmem: add helpers, cleanup logic.Michael Scire2019-07-072-171/+170
| * | | | | clang-format fixesMichael Scire2019-07-072-3/+3
| * | | | | address review commentaryMichael Scire2019-07-075-36/+42
| * | | | | Implement MapPhysicalMemory/UnmapPhysicalMemoryMichael Scire2019-07-076-20/+468
| |/ / / /
* | | | | Clang formatDavid Marcec2019-07-121-2/+4
* | | | | "AudioRenderer" thread should have a unique nameDavid Marcec2019-07-122-4/+4
* | | | | Merge pull request #2717 from SciresM/unmirror_memorybunnei2019-07-112-7/+34
|\ \ \ \ \
| * | | | | Restore memory perms on svcUnmapMemory/UnloadNroMichael Scire2019-07-112-7/+34
* | | | | | Merge pull request #2723 from lioncash/membunnei2019-07-111-20/+0
|\ \ \ \ \ \
| * | | | | | core/arm: Remove obsolete Unicorn memory mappingLioncash2019-07-111-20/+0
| |/ / / / /
* | | | | | service/am: Implement IsAutoSleepDisabledLioncash2019-07-112-1/+10
* | | | | | service/am: Implement SetAutoSleepDisabledLioncash2019-07-112-1/+23
|/ / / / /
* | | | | Merge pull request #2700 from ogniK5377/GetFriendListbunnei2019-07-101-1/+34
|\ \ \ \ \
| * | | | | IFriendService::GetFriendListDavid Marcec2019-07-091-1/+34
| | |_|/ / | |/| | |
* | | | | Merge pull request #2611 from DarkLordZach/pm-info-cmdbunnei2019-07-103-16/+116
|\ \ \ \ \
| * | | | | pm: Implement pm:shell and pm:dmnt GetApplicationPidZach Hilman2019-06-273-7/+33
| * | | | | pm: Implement pm:dmnt GetTitlePidZach Hilman2019-06-271-7/+36
| * | | | | pm: Implement pm:info GetTitleIdZach Hilman2019-06-271-2/+47
* | | | | | Merge pull request #2650 from DarkLordZach/mii-iface-verbunnei2019-07-101-1/+15
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | mii: Implement IDatabaseService SetInterfaceVersionZach Hilman2019-07-071-1/+15
| |/ / / /
* | | | | Merge pull request #2657 from ogniK5377/npad-assignmentsZach Hilman2019-07-085-3/+99
|\ \ \ \ \
| * | | | | addressed issuesDavid Marcec2019-07-081-6/+7
| * | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignmentDavid Marcec2019-07-015-3/+98
* | | | | | Merge pull request #2651 from DarkLordZach/apm-boost-mode-1bunnei2019-07-0811-57/+236
|\ \ \ \ \ \
| * | | | | | am: Implement SetCpuBoostMode in terms of APMZach Hilman2019-06-295-13/+26
| * | | | | | apm: Implement SetCpuBoostModeZach Hilman2019-06-292-0/+14
| * | | | | | apm: Add getters for performance config and modeZach Hilman2019-06-292-33/+49
| * | | | | | apm: Add apm:am serviceZach Hilman2019-06-292-11/+9
| * | | | | | apm: Add Controller class to manage speed data and applicationZach Hilman2019-06-292-0/+138
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2642 from DarkLordZach/fsp-log-2bunnei2019-07-086-27/+73
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | fsp-srv: Implement GetAccessLogVersionInfoZach Hilman2019-06-292-3/+14
| * | | | | fsp-srv: Implement OutputAccessLogToSdCardZach Hilman2019-06-296-26/+61
| |/ / / /
* | | | | Merge pull request #2677 from lioncash/assertZach Hilman2019-07-073-37/+48
|\ \ \ \ \
| * | | | | kernel/vm_manager: Rename 'new map' to 'stack'Lioncash2019-07-063-37/+37
| * | | | | kernel/vm_manager: Handle stack/TLS IO region placement betterLioncash2019-07-061-2/+13
| | |_|/ / | |/| | |
* | | | | clang-format fixesMichael Scire2019-07-061-4/+5
* | | | | am: Implement GetAccumulatedSuspendedTickValueMichael Scire2019-07-062-7/+19
|/ / / /
* | | | Merge pull request #2555 from lioncash/tlsZach Hilman2019-07-046-81/+148
|\ \ \ \
| * | | | kernel/process: Default initialize all member variablesLioncash2019-07-041-2/+2
| * | | | kernel/process: Decouple TLS handling from threadsLioncash2019-07-044-66/+97
| * | | | kernel/vm_manager: Add overload of FindFreeRegion() that operates on a boundaryLioncash2019-07-042-13/+49
* | | | | Merge pull request #2658 from ogniK5377/QueryAudioDeviceOutputEventbunnei2019-07-041-3/+16
|\ \ \ \ \
| * | | | | IAudioDevice::QueryAudioDeviceOutputEventDavid Marcec2019-07-011-3/+16
| | |_|/ / | |/| | |
* | | | | Merge pull request #2638 from DarkLordZach/quest-flagbunnei2019-07-042-1/+10
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | set: Implement GetQuestFlagZach Hilman2019-06-292-1/+10
| | |/ / | |/| |
* | | | Merge pull request #2613 from ogniK5377/InitalizeApplicationInfoZach Hilman2019-07-044-6/+109
|\ \ \ \
| * | | | Addressed issuesDavid Marcec2019-06-282-17/+12
| * | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestrictedDavid Marcec2019-06-274-6/+114
| |/ / /
* | | | Merge pull request #2608 from ogniK5377/Time_GetSharedMemoryNativeHandleZach Hilman2019-07-047-28/+258
|\ \ \ \
| * | | | Addressed issuesDavid Marcec2019-06-265-37/+53
| * | | | Implement Time::GetSharedMemoryNativeHandleDavid Marcec2019-06-257-29/+243
* | | | | Merge pull request #2604 from ogniK5377/INotificationServicebunnei2019-07-034-1/+129
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Attemp clang format fix?David Marcec2019-06-281-1/+0
| * | | | Addressed issuesDavid Marcec2019-06-282-13/+13
| * | | | SizedNotificationInfo should be 0x10 bytes, user_uuid is incorrect, this should be the users account idDavid Marcec2019-06-251-1/+3
| * | | | fixed spelling errors and fixed issue with Pop not returning the SizedNotificationInfoDavid Marcec2019-06-251-6/+8
| * | | | Implemented INotificationServiceDavid Marcec2019-06-244-1/+126
| |/ / /
* | | / file_sys: Rename other ContentRecordType membersBakugo2019-07-021-2/+2
| |_|/ |/| |
* | | Merge pull request #2583 from FernandoS27/core-timing-safebunnei2019-06-301-3/+3
|\ \ \ | |_|/ |/| |
| * | Core_Timing: Make core_timing threadsafe by default.Fernando Sahmkow2019-06-161-3/+3
* | | Merge pull request #2548 from DarkLordZach/applet-shopnbunnei2019-06-2613-112/+690
|\ \ \
| * | | applets: Pass current process title ID to appletsZach Hilman2019-06-2511-41/+59
| * | | general_frontend: Add documentation for parental controls and ecommerce appletsZach Hilman2019-06-252-16/+16
| * | | web_browser: Only delete temporary directory if it was createdZach Hilman2019-06-251-1/+3
| * | | web_browser: Take ECommerce applet frontend optionally in constructorZach Hilman2019-06-251-1/+6
| * | | web_browser: Use function tables for execute and initializeZach Hilman2019-06-252-7/+285
| * | | web_browser: Correct structures and properly parse TLVs/ShimKindZach Hilman2019-06-252-61/+168
| * | | applets: Track ECommerce and Parental Control applet frontendsZach Hilman2019-06-252-7/+29
| * | | applets: Implement Auth applet backendZach Hilman2019-06-252-0/+146
| | |/ | |/|
* | | glue: Correct missing bytes in ApplicationLaunchParameterZach Hilman2019-06-264-28/+61
* | | glue: Implement arp:w and arp:r servicesZach Hilman2019-06-253-2/+330
* | | glue: Add errors for glue/arp servicesZach Hilman2019-06-253-0/+58
* | | glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
* | | arp: Move to glue servicesZach Hilman2019-06-252-91/+0
* | | glue: Add manager to keep track of application registryZach Hilman2019-06-252-0/+119
|/ /
* | Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\ \
| * | service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
* | | Merge pull request #2575 from DarkLordZach/process-id-typesbunnei2019-06-214-8/+25
|\ \ \
| * | | kernel: Differentiate kernel and user processes when picking IDZach Hilman2019-06-104-8/+25
| | |/ | |/|
* | | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-219-44/+102
|\ \ \ | |_|/ |/| |
| * | loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-263-6/+7
| * | prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| * | fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| * | service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| * | applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| * | applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
| * | svc: Save report on call to svcBreakZach Hilman2019-05-251-1/+7
* | | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
* | | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \ \
| * | | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
* | | | Addressed issuesDavid Marcec2019-06-173-8/+13
* | | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
* | | | CleanupDavid Marcec2019-06-1611-29/+38
* | | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-166-7/+72
* | | | Merge pull request #2581 from lioncash/hexZach Hilman2019-06-152-7/+7
|\ \ \ \
| * | | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-122-7/+7
| | |_|/ | |/| |
* / | | kernel/vm_manager: Remove redundant Reset call in destructorLioncash2019-06-121-3/+1
|/ / /
* | | Merge pull request #2571 from lioncash/refZach Hilman2019-06-102-2/+2
|\ \ \
| * | | kernel/process: Make Create()'s name parameter be taken by valueLioncash2019-06-102-2/+2
| |/ /
* | | kernel/svc: Implement TotalMemoryUsedWithoutMmHeap/TotalMemoryAvailableWithoutMmHeapLioncash2019-06-103-2/+42
* | | kernel/svc: Amend naming for TotalMemoryUsage in svcGetInfo()Lioncash2019-06-103-6/+6
* | | kernel/svc: Remove duplicate enum entry in svcGetInfo()Lioncash2019-06-101-2/+1
|/ /
* | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-071-16/+4
* | Merge pull request #2549 from lioncash/headerZach Hilman2019-06-061-1/+0
|\ \
| * | kernel/process: Remove unused boost header includeLioncash2019-06-051-1/+0
* | | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \ \
| * | | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
* | | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ \ | |/ / / |/| | |
| * | | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| * | | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| * | | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
* | | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-052-5/+37
|\ \ \ \
| * | | | core/core: Remove unnecessary includesLioncash2019-05-292-5/+37
| |/ / /
* | | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-053-7/+9
|\ \ \ \
| * | | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-052-3/+3
| * | | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-053-7/+9
| | |/ / | |/| |
* | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-057-402/+1073
|\ \ \ \ | |/ / / |/| | |
| * | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| * | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| * | | Address review commentsMichael Scire2019-05-235-45/+118
| * | | clang-format fixesMichael Scire2019-05-234-31/+32
| * | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-236-403/+1002
* | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-308-104/+1051
|\ \ \ \ | |_|/ / |/| | |
| * | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| * | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-253-6/+6
| * | | mii: Implement Delete and Destroy fileZach Hilman2019-04-253-8/+116
| * | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| * | | mii_manager: Cleanup and optimizationZach Hilman2019-04-253-36/+50
| * | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-251-15/+242
| * | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| * | | common: Extract UUID to its own classZach Hilman2019-04-253-78/+28
* | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ | |_|_|/ |/| | |
| * | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| * | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| * | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| | |/ | |/|
* | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-254-9/+10
|\ \ \ | |/ / |/| |
| * | Address review commentTobias2019-05-191-1/+1
| * | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-184-9/+10
* | | Merge pull request #2410 from lioncash/affinitybunnei2019-05-192-42/+58
|\ \ \
| * | | kernel/svc: Make svcCreateThread/svcStartThread/svcSleepThread/svcExitThread calls show up in the debug logLioncash2019-04-291-4/+4
| * | | kernel/svc: Reorganize svcSetThreadCoreMask()Lioncash2019-04-291-32/+39
| * | | kernel/thread: Update thread processor ID flagsLioncash2019-04-292-7/+16
* | | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \ \
| * | | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| * | | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| * | | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |_|/ | |/| |
* | | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \ \
| * | | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
| | |_|/ | |/| |
* | | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \ \
| * | | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ / /
* | | | Merge pull request #2490 from lioncash/floatHexagon122019-05-191-1/+1
|\ \ \ \
| * | | | ipc_helpers: Amend floating-point type in Pop<double> specializationLioncash2019-05-191-1/+1
| |/ / /
* | | | Merge pull request #2486 from lioncash/resetnameSebastian Valle2019-05-1918-31/+32
|\ \ \ \
| * | | | core/kernel/object: Rename ResetType enum membersLioncash2019-05-1818-31/+32
| |/ / /
* / / / kernel/svc: Mark GetThreadList() and UnmapProcessCodeMemory() as internally linkedLioncash2019-05-191-4/+4
|/ / /
* | | Merge pull request #2437 from lioncash/audctlbunnei2019-05-091-2/+2
|\ \ \
| * | | service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
| |/ /
* | | Merge pull request #2412 from lioncash/systembunnei2019-04-293-7/+11
|\ \ \ | |/ / |/| |
| * | kernel/vm_manager: Remove usages of global system accessorsLioncash2019-04-173-7/+11
* | | Merge pull request #2416 from lioncash/waitbunnei2019-04-256-44/+50
|\ \ \
| * | | kernel/thread: Unify wait synchronization typesLioncash2019-04-176-38/+34
| * | | kernel/svc: Migrate svcCancelSynchronization behavior to a thread functionLioncash2019-04-173-7/+17
| |/ /
* | | Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2514-63/+487
|\ \ \
| * | | web_browser: Make OpenPage non-constZach Hilman2019-04-178-15/+20
| * | | main: Add GMainWindow hooks for Error displayZach Hilman2019-04-171-2/+2
| * | | general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| * | | applets: Add Error appletZach Hilman2019-04-173-24/+224
| * | | applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| * | | am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| * | | applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
| |/ /
* | | Merge pull request #2420 from lioncash/audctlbunnei2019-04-232-2/+32
|\ \ \
| * | | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
* | | | Merge pull request #2415 from lioncash/constbunnei2019-04-202-2/+2
|\ \ \ \
| * | | | kernel/wait_object: Make GetHighestPriorityReadyThread() a const member functionLioncash2019-04-172-2/+2
| | |/ / | |/| |
* | | | Merge pull request #2421 from lioncash/svc-callbunnei2019-04-201-1/+1
|\ \ \ \
| * | | | kernel/svc: Name supervisor call 0x36Lioncash2019-04-191-1/+1
| | |/ / | |/| |
* | | | Merge pull request #2374 from lioncash/pagetablebunnei2019-04-203-14/+17
|\ \ \ \ | |/ / / |/| | |
| * | | core/core: Move process execution start to System's Load()Lioncash2019-04-122-8/+11
| * | | core/process: Remove unideal page table setting from LoadFromMetadata()Lioncash2019-04-121-5/+0
| * | | core/cpu_core_manager: Create threads separately from initialization.Lioncash2019-04-122-2/+7
* | | | Merge pull request #2397 from lioncash/thread-unusedbunnei2019-04-183-18/+17
|\ \ \ \ | |_|/ / |/| | |
| * | | svc: Specify handle value in thread's nameLioncash2019-04-152-2/+10
| * | | kernel/thread: Remove unused guest_handle member variableLioncash2019-04-143-16/+7
| | |/ | |/|
* | | Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\ \ \
| * | | service: Update service function tablesLioncash2019-04-1127-57/+262
* | | | Merge pull request #2393 from lioncash/svcbunnei2019-04-164-2/+274
|\ \ \ \
| * | | | kernel/svc: Implement svcUnmapProcessCodeMemoryLioncash2019-04-133-1/+143
| * | | | kernel/svc: Implement svcMapProcessCodeMemoryLioncash2019-04-134-1/+131
| | |_|/ | |/| |
* | | | kernel/thread: Remove BoostPriority()Lioncash2019-04-152-11/+0
| |_|/ |/| |
* | | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \ \
| * | | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| * | | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| | |/ | |/|
* | | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-141-6/+10
|\ \ \
| * | | added a toggle to force 30fps modezarroboogs2019-04-091-6/+10
* | | | Merge pull request #2381 from lioncash/fsbunnei2019-04-141-8/+7
|\ \ \ \ | |_|_|/ |/| | |
| * | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
| * | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| | |/ | |/|
* | | Merge pull request #2360 from lioncash/svc-globalbunnei2019-04-123-322/+373
|\ \ \
| * | | kernel/svc: Deglobalize the supervisor call handlersLioncash2019-04-083-322/+373
| | |/ | |/|
* | | Merge pull request #2388 from lioncash/constexprbunnei2019-04-1210-10/+10
|\ \ \
| * | | kernel: Make handle type declarations constexprLioncash2019-04-1110-10/+10
| | |/ | |/|
* / | kernel/server_session: Remove obsolete TODOsLioncash2019-04-101-7/+2
|/ /
* | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-104-10/+9
|\ \
| * | patch_manager: Dump NSO name with build IDZach Hilman2019-03-281-2/+1
| * | game_list: Register content with ContentProviderZach Hilman2019-03-271-2/+3
| * | core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-273-9/+8
* | | kernel/process: Set page table when page table resizes occur.Lioncash2019-04-091-0/+2
| |/ |/|
* | Merge pull request #2361 from lioncash/pagetablebunnei2019-04-073-4/+2
|\ \
| * | kernel: Handle page table switching within MakeCurrentProcess()Lioncash2019-04-073-4/+2
* | | kernel/server_session: Return a std::pair from CreateSessionPair()Lioncash2019-04-064-11/+8
* | | kernel/server_port: Return a std::pair from CreatePortPair()Lioncash2019-04-062-7/+7
|/ /
* | Merge pull request #2325 from lioncash/namebunnei2019-04-061-0/+4
|\ \
| * | kernel/server_session: Provide a GetName() overrideLioncash2019-04-031-0/+4
* | | Merge pull request #2334 from lioncash/overridebunnei2019-04-069-18/+5
|\ \ \
| * | | core: Add missing override specifiers where applicableLioncash2019-04-049-18/+5
* | | | Merge pull request #2339 from lioncash/rankbunnei2019-04-063-12/+15
|\ \ \ \
| * | | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-052-4/+4
| * | | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| * | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-051-1/+3
| |/ / /
* | | | Merge pull request #2329 from lioncash/sanitizebunnei2019-04-061-0/+14
|\ \ \ \
| * | | | kernel/svc: Properly sanitize mutex address in WaitProcessWideKeyAtomicLioncash2019-04-041-0/+14
* | | | | Merge pull request #2344 from lioncash/resultbunnei2019-04-061-4/+0
|\ \ \ \ \
| * | | | | hle/result: Remove unnecessary bitfield entry for ResultCodeLioncash2019-04-051-4/+0
* | | | | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| | |/ / / | |/| | |
* / | | | hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
|/ / / /
* | | | Merge pull request #2328 from lioncash/transferbunnei2019-04-043-17/+37
|\ \ \ \
| * | | | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
| * | | | kernel/transfer_memory: Add accessors to data and sizesLioncash2019-04-032-11/+31
| |/ / /
* | | | Merge pull request #2324 from lioncash/enum-unusedbunnei2019-04-042-2/+0
|\ \ \ \
| * | | | kernel/object: Remove unused handle type entryLioncash2019-04-032-2/+0
| | |/ / | |/| |
* | | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ \ | |_|/ / |/| | |
| * | | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| * | | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
* | | | Merge pull request #2305 from lioncash/sharedbunnei2019-04-033-5/+18
|\ \ \ \
| * | | | kernel/shared_memory: Remove unused core/memory.h includeLioncash2019-03-291-1/+0
| * | | | kernel/shared_memory: Sanitize supplied size when unmappingLioncash2019-03-293-4/+18
* | | | | Merge pull request #2314 from lioncash/constbunnei2019-04-0311-18/+18
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | kernel/thread: Make AllWaitObjectsReady() a const qualified member functionLioncash2019-04-022-2/+2
| * | | | kernel/wait_object: Make ShouldWait() take thread members by pointer-to-constLioncash2019-04-0211-11/+11
| * | | | kernel/thread: Avoid sign conversion within GetCommandBufferAddress()Lioncash2019-04-011-2/+2
| * | | | kernel/thread: Make parameter of GetWaitObjectIndex() const qualifiedLioncash2019-04-012-3/+3
* | | | | Merge pull request #2270 from lioncash/plistbunnei2019-04-037-2/+123
|\ \ \ \ \
| * | | | | kernel/svc: Implement svcGetThreadListLioncash2019-04-024-1/+70
| * | | | | kernel/svc: Implement svcGetProcessListLioncash2019-04-024-1/+53
* | | | | | Merge pull request #2313 from lioncash/reslimitbunnei2019-04-023-14/+6
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | kernel/resource_limit: Remove the name member from resource limitsLioncash2019-04-013-14/+6
| |/ / / /
* | | | | process: Fix up compilationReinUsesLisp2019-04-021-1/+1
* | | | | Merge pull request #2281 from lioncash/memorybunnei2019-04-022-4/+5
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | kernel/codeset: Make CodeSet's memory data member a regular std::vectorLioncash2019-03-222-4/+5
* | | | | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-011-1/+1
|\ \ \ \ \
| * | | | | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-291-1/+1
| | |_|/ / | |/| | |
* | | | | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-013-3/+3
* | | | | Merge pull request #2304 from lioncash/memsizebunnei2019-03-313-9/+28
|\ \ \ \ \
| * | | | | kernel/process: Report total physical memory used to svcGetInfoLioncash2019-03-293-4/+11
| * | | | | kernel/process: Store the total size of the code memory loadedLioncash2019-03-292-0/+5
| * | | | | kernel/process: Store the main thread stack size to a data memberLioncash2019-03-282-4/+7
| * | | | | kernel/process: Make Run's stack size parameter a u64Lioncash2019-03-282-2/+2
| * | | | | kernel/process: Ensure that given stack size is always page-alignedLioncash2019-03-281-0/+4
* | | | | | Merge pull request #2308 from lioncash/deductionbunnei2019-03-313-12/+12
|\ \ \ \ \ \
| * | | | | | kernel/scheduler: Remove unused parameter to AddThread()Lioncash2019-03-303-4/+4
| * | | | | | kernel/scheduler: Use deduction guides on mutex locksLioncash2019-03-301-8/+8
| | |_|_|/ / | |/| | | |
* | | | | | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
* | | | | | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
* | | | | | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/ / / / /
* | | | | Merge pull request #2266 from FernandoS27/arbitrationbunnei2019-03-295-14/+18
|\ \ \ \ \
| * | | | | Fix small bug that kept a thread as a condvar thread after being signalled.Fernando Sahmkow2019-03-202-6/+8
| * | | | | Add CondVar Thread State.Fernando Sahmkow2019-03-204-4/+6
| * | | | | Small fixes to address_arbiter to better match the IDB.Fernando Sahmkow2019-03-202-5/+5
* | | | | | Merge pull request #2265 from FernandoS27/multilevelqueuebunnei2019-03-292-19/+27
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Fixes and corrections on formatting.Fernando Sahmkow2019-03-271-6/+9
| * | | | | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-272-19/+24
| | |/ / / | |/| | |
* | | | | Merge pull request #2284 from lioncash/heap-allocbunnei2019-03-283-59/+81
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | kernel/vm_manager: Handle shrinking of the heap size within SetHeapSize()Lioncash2019-03-242-24/+46
| * | | | kernel/vm_manager: Rename HeapAllocate to SetHeapSizeLioncash2019-03-243-4/+3
| * | | | kernel/vm_manager: Handle case of identical calls to HeapAllocateLioncash2019-03-241-0/+5
| * | | | kernel/vm_manager: Remove unused class variablesLioncash2019-03-241-3/+0
| * | | | kernel/vm_manager: Remove unnecessary heap_used data memberLioncash2019-03-243-13/+2
| * | | | kernel/vm_manager: Tidy up heap allocation codeLioncash2019-03-243-27/+37
* | | | | Merge pull request #2285 from lioncash/unused-structbunnei2019-03-261-8/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | kernel/process: Remove unused AddressMapping structLioncash2019-03-241-8/+0
* | | | | Merge pull request #2287 from lioncash/coretiming-cbbunnei2019-03-264-9/+9
|\ \ \ \ \
| * | | | | core/core_timing: Make callback parameters consistentLioncash2019-03-244-9/+9
| |/ / / /
* / / / / kernel/kernel: Remove unnecessary forward declarationLioncash2019-03-241-3/+0
|/ / / /
* | | | Merge pull request #2232 from lioncash/transfer-memorybunnei2019-03-245-6/+280
|\ \ \ \ | |/ / / |/| | |
| * | | core/hle/kernel/svc: Implement svcUnmapTransferMemoryLioncash2019-03-131-1/+48
| * | | core/hle/kernel/svc: Implement svcMapTransferMemoryLioncash2019-03-131-1/+57
| * | | core/hle/kernel: Split transfer memory handling out into its own classLioncash2019-03-135-4/+175
* | | | Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-232-2/+79
|\ \ \ \
| * | | | set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| * | | | set_sys: Use official nintendo version stringZach Hilman2019-03-111-11/+7
| * | | | set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| * | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-102-2/+63
* | | | | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-221-12/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-211-10/+2
| * | | | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-211-2/+2
* | | | | Merge pull request #2234 from lioncash/mutexbunnei2019-03-225-29/+62
|\ \ \ \ \
| * | | | | core/hle/kernel/mutex: Remove usages of global system accessorsLioncash2019-03-151-11/+15
| * | | | | core/hle/kernel: Make Mutex a per-process class.Lioncash2019-03-155-18/+47
* | | | | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-224-22/+20
|\ \ \ \ \ \
| * | | | | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-214-22/+20
| * | | | | | kernel/vm_manager: Amend flag values for CodeMutableLioncash2019-03-211-1/+1
* | | | | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ \ \ \
| * | | | | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / / / /
* | | | | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-222-0/+6
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-053-25/+2
| * | | | | | vm_manager: Add support for storing and getting main code regionZach Hilman2019-03-052-0/+28
| * | | | | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
* | | | | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-216-96/+96
|\ \ \ \ \ \ \
| * | | | | | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-066-96/+96
* | | | | | | | Merge pull request #2268 from lioncash/codesetbunnei2019-03-214-45/+106
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | kernel/process: Make MapSegment lambda reference parameter constLioncash2019-03-201-1/+1
| * | | | | | | kernel: Move CodeSet structure to its own source filesLioncash2019-03-204-44/+105
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #2267 from FernandoS27/fix-2238bunnei2019-03-211-1/+2
|\ \ \ \ \ \ \
| * | | | | | | Fix crash caused by 2238.Fernando Sahmkow2019-03-201-1/+2
| |/ / / / / /
* | | | | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
* | | | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ \ \
| * | | | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| * | | | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| * | | | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
* | | | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
* | | | | | | | Merge pull request #2238 from lioncash/threadbunnei2019-03-182-21/+41
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/thread: Expand documentation of nominal_priority and current_priorityLioncash2019-03-162-3/+11
| * | | | | | | kernel/thread: Make bracing consistent within UpdatePriority()Lioncash2019-03-161-2/+4
| * | | | | | | kernel/thread: Amend condition within UpdatePriority()Lioncash2019-03-161-3/+3
| * | | | | | | kernel/thread: Maintain priority ordering of added mutex waiting threadsLioncash2019-03-161-14/+24
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #2252 from bunnei/move-page-tablebunnei2019-03-174-9/+10
|\ \ \ \ \ \ \
| * | | | | | | core: Move PageTable struct into Common.bunnei2019-03-174-9/+10
* | | | | | | | Merge pull request #2249 from lioncash/ipcbunnei2019-03-171-0/+30
|\ \ \ \ \ \ \ \
| * | | | | | | | ipc_helpers: Allow pushing and popping floating-point valuesLioncash2019-03-161-0/+30
| |/ / / / / / /
* / / / / / / / kernel/thread: Actually remove the definition of ExitCurrentThread()Lioncash2019-03-161-6/+0
|/ / / / / / /
* | | | | | | Merge pull request #2242 from lioncash/thread-fnbunnei2019-03-164-33/+31
|\ \ \ \ \ \ \
| * | | | | | | kernel/thread: Move thread exiting logic from ExitCurrentThread to svcExitThreadLioncash2019-03-162-8/+7
| * | | | | | | kernel/thread: Migrate WaitCurrentThread_Sleep into the Thread interfaceLioncash2019-03-164-25/+24
| |/ / / / / /
* | | | | / / gpu: Use host address for caching instead of guest address.bunnei2019-03-151-1/+2
| |_|_|_|/ / |/| | | | |
* | | | | | Merge pull request #2230 from lioncash/globalbunnei2019-03-152-8/+9
|\ \ \ \ \ \
| * | | | | | kernel/process: Remove use of global system accessorsLioncash2019-03-132-8/+9
| |/ / / / /
* | | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-134-14/+36
|\ \ \ \ \ \
| * | | | | | kernel/server_port: Make data members privateLioncash2019-03-114-14/+36
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-133-19/+5
|\ \ \ \ \ \
| * | | | | | core/hle/result: Remove now-unnecessary manually defined copy assignment operatorLioncash2019-03-101-5/+0
| * | | | | | core/hle/result: Amend error in comment description for ResultCodeLioncash2019-03-101-1/+1
| * | | | | | core/hle/result: Remove now-unused constructor for ResultCodeLioncash2019-03-101-10/+0
| * | | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-103-3/+4
| |/ / / / /
* | | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-139-40/+146
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| * | | | | core/ipc_helper: Allow popping all signed value types with RequestParserLioncash2019-02-271-0/+15
| * | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
* | | | | | Merge pull request #2211 from lioncash/arbiterbunnei2019-03-127-63/+79
|\ \ \ \ \ \
| * | | | | | kernel: Make the address arbiter instance per-processLioncash2019-03-086-26/+33
| * | | | | | kernel/svc: Move address arbiter signaling behind a unified API functionLioncash2019-03-083-22/+26
| * | | | | | kernel/svc: Move address arbiter waiting behind a unified API functionLioncash2019-03-083-19/+24
* | | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ \
| * | | | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| * | | | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| * | | | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| * | | | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
* | | | | | | Merge pull request #2193 from lioncash/globalbunnei2019-03-102-9/+11
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | kernel/scheduler: Pass in system instance in constructorLioncash2019-03-042-9/+11
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2210 from lioncash/optionalbunnei2019-03-084-47/+47
|\ \ \ \ \ \
| * | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optionalLioncash2019-03-084-47/+47
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2195 from lioncash/shared-globalbunnei2019-03-071-3/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()Lioncash2019-03-041-3/+2
| |/ / / /
* | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-076-36/+78
|\ \ \ \ \
| * | | | | kernel/server_session: Make data members privateLioncash2019-03-065-32/+73
| * | | | | kernel/client_session: Make data members privateLioncash2019-03-061-4/+5
| |/ / / /
* | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \
| * | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-074-15/+5
|\ \ \ \ \
| * | | | | gpu: Move command processing to another thread.bunnei2019-03-071-1/+1
| * | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-073-14/+4
| |/ / / /
* | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-076-8/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-056-8/+12
| |/ / /
* | | | Merge pull request #2199 from lioncash/arbiterbunnei2019-03-065-110/+181
|\ \ \ \
| * | | | kernel/address_arbiter: Pass in system instance to constructorLioncash2019-03-054-21/+39
| * | | | kernel/address_arbiter: Minor tidying upLioncash2019-03-051-18/+18
| * | | | kernel/address_arbiter: Convert the address arbiter into a classLioncash2019-03-055-82/+135
| |/ / /
* | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
* | | | Merge pull request #2194 from lioncash/membunnei2019-03-063-30/+66
|\ \ \ \
| * | | | vm_manager: Use range helpers in HeapAlloc() and HeapFree()Lioncash2019-03-041-4/+2
| * | | | vm_manager: Provide address range checking functions for other memory regionsLioncash2019-03-042-4/+35
| * | | | svc: Migrate address range checking functions to VMManagerLioncash2019-03-043-23/+30
| |/ / /
* | | | Merge pull request #2200 from lioncash/audiobunnei2019-03-063-10/+20
|\ \ \ \
| * | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-053-10/+20
| |/ / /
* / / / kernel/thread: Remove obsolete TODO in Create()Lioncash2019-03-051-2/+0
|/ / /
* | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \
| * | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
* | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / /
* | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
* | | Merge pull request #2169 from lioncash/namingbunnei2019-02-271-13/+13
|\ \ \
| * | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-271-13/+13
* | | | Merge pull request #2161 from lioncash/handle-tablebunnei2019-02-276-19/+63
|\ \ \ \
| * | | | kernel/handle_table: Make local variables as const where applicableLioncash2019-02-251-4/+5
| * | | | kernel/handle_table: Allow process capabilities to limit the handle table sizeLioncash2019-02-256-10/+54
| * | | | kernel/handle-table: In-class initialize data membersLioncash2019-02-252-3/+2
| * | | | kernel/handle_table: Resolve truncation warningsLioncash2019-02-251-2/+2
| | |/ / | |/| |
* | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-275-6/+6
| |/ / |/| |
* | | service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
|/ /
* | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
* | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
* | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
* | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-206-57/+119
* | address_arbiter: Use nested namespaces where applicableLioncash2019-02-162-8/+4
* | core_timing: Convert core timing into a classLioncash2019-02-1632-81/+123
* | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1221-54/+50
* | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
* | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
* | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
* | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
|/
* Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\
| * hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| * hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| * hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| * hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| * hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
* | kernel: Remove the Timer classLioncash2019-02-016-227/+0
* | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \
| * | service/ns: Update function tablesLioncash2019-01-301-14/+20
| * | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| * | service/audio: Update function tablesLioncash2019-01-304-8/+23
| * | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| * | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| * | service/btm: Update function tablesLioncash2019-01-301-55/+97
| * | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| * | service/psc: Update function tablesLioncash2019-01-301-8/+9
* | | Merge pull request #2077 from lioncash/virtbunnei2019-01-315-15/+3
|\ \ \
| * | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directlyLioncash2019-01-301-3/+3
| * | | kernel/timer: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| * | | kernel/readable_event: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| | |/ | |/|
* | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
* | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
|/ /
* | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
* | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
* | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
* | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
* | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
|/
* hle/ipc_helpers: Fix clang-format warningsLioncash2019-01-301-1/+0
* hle/ipc_helpers: Allow pushing signed valuesLioncash2019-01-291-0/+22
* service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
* service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
* service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
* kernel/svc: Log out uncaught C++ exceptions from svcBreakLioncash2019-01-271-0/+4
* core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
* core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-171-1/+1
* Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-101-7/+9
|\
| * settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-081-6/+4
| * time: Use custom RTC settings if applicable for gameZach Hilman2019-01-081-6/+10
* | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-108-583/+898
|\ \ | |/ |/|
| * travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-292-3/+2
| * web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-294-132/+134
| * core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-281-1/+1
| * applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-283-0/+232
| * hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| * am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
* | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \
| * | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| * | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| * | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
* | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \
| * | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ /
* | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \
| * | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
* | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ | |_|/ / |/| | |
| * | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ /
* | | Removed pulse event typeDavid Marcec2019-01-043-7/+0
* | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \
| * | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| * | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
* | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| |/ / |/| |
* | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \
| * | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| |/ /
* | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
* | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \
| * | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| |/ /
* / / core/kernel: Remove unnecessary inclusionsLioncash2019-01-0116-16/+22
|/ /
* | kernel/svc: Correct misleading error message within CreateThread()Lioncash2018-12-311-2/+3
* | kernel/svc: Sanitize core number and thread priorities in CreateThread()Lioncash2018-12-311-6/+17
* | kernel/process: Rename GetAllowedProcessorMask() and GetAllowedThreadPriorityMask()Lioncash2018-12-312-11/+11
* | kernel/svc: Simplify thread core ID sanitizing in CreateThreadLioncash2018-12-311-7/+1
* | Merge pull request #1956 from lioncash/process-threadSebastian Valle2018-12-315-57/+51
|\ \
| * | kernel/process: Start the main thread using the specified ideal coreLioncash2018-12-281-2/+2
| * | kernel: Rename 'default' CPU core to 'ideal' coreLioncash2018-12-284-21/+21
| * | kernel/thread: Move process thread initialization into process.cppLioncash2018-12-283-36/+30
* | | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-302-1/+5
|\ \ \
| * | | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-291-1/+2
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-193-11/+3
| * | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-031-14/+1
| * | | Print backtrace on svcBreakDavid Marcec2018-12-033-0/+24
* | | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
* | | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
| |_|/ |/| |
* | | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-284-49/+35
| |/ |/|
* | Merge pull request #1928 from lioncash/capsbunnei2018-12-276-123/+642
|\ \
| * | kernel/process: Hook up the process capability parser to the process itselfLioncash2018-12-212-120/+18
| * | kernel/process_capability: Handle debug capability flagsLioncash2018-12-212-1/+18
| * | kernel/process_capability: Handle handle table capability flagsLioncash2018-12-212-1/+11
| * | kernel/process_capability: Handle kernel version capability flagsLioncash2018-12-212-1/+18
| * | kernel/process_capability: Handle program capability flagsLioncash2018-12-213-2/+29
| * | kernel/process_capability: Handle interrupt capability flagsLioncash2018-12-211-1/+21
| * | kernel/process_capability: Handle syscall capability flagsLioncash2018-12-212-1/+29
| * | kernel/process_capability: Handle the priority mask and core mask flagsLioncash2018-12-212-1/+40
| * | kernel/process: Introduce process capability parsing skeletonLioncash2018-12-214-3/+466
* | | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ \
| * | | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
* | | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ \
| * | | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
* | | | | Merge pull request #1949 from lioncash/unmapbunnei2018-12-271-0/+1
|\ \ \ \ \
| * | | | | kernel/vm_manager: Reset region attributes when unmapping a VMALioncash2018-12-271-0/+1
* | | | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-272-2/+47
* | | | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
|/ / / / /
* | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-264-6/+72
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-044-6/+72
* | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-233-0/+131
|\ \ \ \ \
| * | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-034-13/+5
| * | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| * | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| * | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
* | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-211-0/+1
|\ \ \ \ \ \
| * | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-191-0/+1
* | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-216-26/+57
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| * | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| * | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| * | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-193-5/+5
| * | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| * | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
* | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / /
* | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \
| * | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| * | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| * | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| * | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| * | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
* | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \
| * | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
* | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \
| * | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
* | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
* | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-154-9/+165
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| * | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| * | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| * | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| * | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-225-77/+139
| * | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-195-2/+114
* | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \
| * | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| * | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| * | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| * | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| * | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| * | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| * | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| * | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
* | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| |/ / / / / /
* | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
* | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-111-0/+12
|\ \ \ \ \ \
| * | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \
| * | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
* | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \
| * | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
* | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-104-22/+36
|\ \ \ \ \ \ \ \
| * | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-064-22/+36
| |/ / / / / / /
* | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| * | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| * | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| * | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| * | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| |/ / / / / /
* | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| * | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| * | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
* | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-051-0/+10
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
* | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
* | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
* | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
* | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-045-10/+19
|\ \ \ \ \ \
| * | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-045-10/+19
| | |_|_|/ / | |/| | | |
* | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
* | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
|/ / / / /
* | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
* | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| * | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
* | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-033-19/+6
|\ \ \ \ \
| * | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-023-19/+6
| |/ / / /
* | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0332-234/+393
|\ \ \ \ \
| * | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| * | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2930-311/+169
| * | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2925-153/+274
| * | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| * | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| * | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-295-59/+206
| * | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
* | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-033-1/+35
|\ \ \ \ \ \
| * | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-013-1/+35
* | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \
| * | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \
| * | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
* | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / /
* | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| | |/ / / | |/| | |
* | | | | Fix debug buildLioncash2018-12-011-1/+1
| |/ / / |/| | |
* | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
* | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / /
* | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \
| * | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| * | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| * | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| * | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| * | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| * | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| * | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
* | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \
| * | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
* | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-281-5/+10
|\ \ \ \ \
| * | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-281-8/+6
| * | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-271-3/+10
* | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
* | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
* | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
* | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
* | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
* | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
| |/ / / / |/| | | |
* | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| |/ / /
* | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
* | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ | |/ / / |/| | |
| * | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
* | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \
| * | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
* | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \
| * | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-242-13/+31
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| * | | | Report resolution scaling support for vi and amDavid Marcec2018-11-162-13/+29
* | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-233-4/+100
|\ \ \ \ \
| * | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| * | | | | applets: Add StubAppletZach Hilman2018-11-222-0/+96
* | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \
| * | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
* | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
* | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \
| * | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / /
* | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| * | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| * | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| |/ / / / /
* | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| * | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| * | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
* | | | | | am: Correct build failureLioncash2018-11-211-2/+2
* | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \
| * | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| * | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| * | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| * | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| * | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \
| * | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / /
* | / / / / kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-207-106/+729
|\ \ \ \ \
| * | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| * | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| * | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| * | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| * | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| * | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| * | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| * | | | | applet: Add operation completed callbackZach Hilman2018-11-182-3/+5
| * | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| * | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-183-6/+20
| * | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-184-36/+34
| * | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-181-4/+8
| * | | | | am: Implement text check software keyboard modeZach Hilman2018-11-183-14/+95
| * | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-187-31/+48
| * | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| * | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-182-0/+128
| * | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-182-0/+75
| * | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| * | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| * | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| * | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| * | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| * | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| * | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
* | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \
| * | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
* | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / /
* | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-194-174/+61
* | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
* | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
* | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
* | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
* | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
* | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
* | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
* | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
* | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
* | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
* | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
* | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / |/| | | |
* | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-196-21/+400
|\ \ \ \ \
| * | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| * | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| * | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| * | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| * | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| * | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-151-1/+2
| * | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
* | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \
| * | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
* | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \
| * | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
* | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
* | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \
| * | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \
| * | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|/ / / | |/| | | | |
* / | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
|/ / / / / /
* | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \
| * | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| * | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-162-4/+11
|\ \ \ \ \ \
| * | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
* | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-163-13/+11
|\ \ \ \ \ \ \
| * | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-163-13/+11
| | |_|/ / / / | |/| | | | |
* / | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / /
* | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
* | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \
| * | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \
| * | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
* | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-152-4/+22
|\ \ \ \ \ \ \
| * | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-292-4/+22
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
* | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \
| * | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| * | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
* | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-143-1/+27
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-133-1/+27
| |/ / / / /
* | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \
| * | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| * | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / /
* | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \
| * | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / /
* | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-145-2/+227
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-292-15/+73
| * | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| * | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| * | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-292-0/+11
| |/ / / /
* | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-133-3/+13
|\ \ \ \ \
| * | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-131-1/+2
| * | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| * | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| * | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| * | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
* | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-106-35/+138
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | FixupsDavid Marcec2018-11-071-1/+1
| * | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-076-35/+138
* | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \
| * | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| |/ / / /
* | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
* | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
* | | | | Added missing logDavid Marcec2018-11-071-0/+1
* | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
|/ / / /
* | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \
| * | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
* | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
| |_|_|/ |/| | |
* | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / /
* | | Merge pull request #1615 from lioncash/inputbunnei2018-11-021-1/+2
|\ \ \
| * | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-311-1/+2
| |/ /
* | / service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
| |/ |/|
* | general: Remove unused boost inclusions where applicableLioncash2018-10-301-2/+0
* | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-307-23/+25
* | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \
| * | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| * | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| |/
* / core: Make System references const where applicableLioncash2018-10-282-3/+3
|/
* Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\
| * svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| * svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
* | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
|/
* Merge pull request #1569 from lioncash/amiibobunnei2018-10-262-3/+5
|\
| * yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-242-3/+5
* | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
* | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
* | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
* | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \
| * | service/usb: Update service function tablesLioncash2018-10-251-21/+22
* | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \
| * | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| * | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| * | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ /
* | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \
| * | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| * | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| * | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| * | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| * | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| * | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| * | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| * | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| * | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ /
* | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-253-43/+48
|\ \ \
| * | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-243-43/+48
| |/ /
* | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \
| * | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |/ | |/|
* | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ | |_|/ |/| |
| * | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/
* | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-244-29/+226
|\ \ | |/ |/|
| * profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-242-13/+37
| * acc: Fix account UUID duplication errorZach Hilman2018-10-244-17/+47
| * configure_system: Clear selection after user deleteZach Hilman2018-10-241-1/+1
| * profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-244-26/+129
| * acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| * am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| * profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
* | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ | |/ |/|
| * Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| * Added break types to svcBreakDavid Marcec2018-10-231-4/+42
* | Added Amiibo support (#1390)David2018-10-243-50/+294
* | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-241-1/+5
|\ \
| * | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
* | | Merge pull request #1540 from lioncash/handlebunnei2018-10-248-98/+95
|\ \ \ | |_|/ |/| |
| * | kernel/process: Make the handle table per-processLioncash2018-10-208-98/+95
* | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-223-0/+88
|\ \ \
| * | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| * | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| * | | service: Add skeleton for psm serviceZach Hilman2018-10-213-0/+72
| |/ /
* | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \
| * | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ /
* | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-213-2/+107
* | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
* | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-213-0/+42
* | | am: Update service function tablesLioncash2018-10-214-15/+60
* | | prepo: Update service function table.Lioncash2018-10-211-8/+13
* | | lbl: Update service function table namesLioncash2018-10-211-28/+28
* | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
|/ /
* | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \
| * | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
* | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \
| * | | es: Update service function tablesLioncash2018-10-191-7/+11
| * | | audio: Update service function tablesLioncash2018-10-191-17/+20
| * | | omm: Update service function tablesLioncash2018-10-191-16/+18
| * | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| * | | hid: Update service function tablesLioncash2018-10-191-6/+45
| * | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| * | | ns: Update service function tableLioncash2018-10-191-6/+49
| * | | set_cal: Update service function tableLioncash2018-10-191-1/+2
* | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \
| * | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
* | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| * | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| * | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| * | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| * | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| * | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| * | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| * | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |/ / | |/| |
* | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / |/| |
* | | Merge pull request #1523 from lioncash/lockbunnei2018-10-191-9/+15
|\ \ \
| * | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| * | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-181-9/+7
| |/ /
* / / Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
|/ /
* | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1821-648/+1702
|\ \
| * | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| * | WipDavid Marcec2018-10-122-3/+23
| * | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| * | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| * | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| * | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| * | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| * | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| * | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| * | "Better Hid" rework part 1David Marcec2018-10-1021-644/+1482
* | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \ | |_|/ |/| |
| * | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
* | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
* | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-164-15/+15
|\ \ \
| * | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-154-15/+15
* | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-163-12/+11
* | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-161-3/+15
|\ \ \ \ | |/ / / |/| | |
| * | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-151-2/+13
| * | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
* | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-144-14/+13
|\ \ \ \ | |_|/ / |/| | |
| * | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-134-14/+13
| |/ /
* | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \
| * | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ /
* / / Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ /
* | Merge pull request #1483 from lioncash/codesetbunnei2018-10-134-40/+14
|\ \
| * | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-124-40/+14
* | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \
| * | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ /
* | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \
| * | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| * | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| * | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |/ | |/|
* | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \
| * | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| * | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
* | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \
| * | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ | |/| |
* | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ | |/ / / |/| | |
| * | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| * | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ /
* | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \
| * | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ /
* | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \
| * | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| |/ /
* / / nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
|/ /
* / kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-106-29/+29
|/
* Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
* Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
* svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
* Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\
| * Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
* | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
|/
* Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-072-0/+10
|\
| * romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-052-0/+10
* | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
* | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
* | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
* | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
* | Merge pull request #1439 from lioncash/threadbunnei2018-10-0511-187/+363
|\ \ | |/ |/|
| * kernel/thread: Make all instance variables privateLioncash2018-10-0411-187/+363
* | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \
| * | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
* | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \
| * | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| | |/ | |/|
* | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| |/ |/|
* | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-011-20/+26
* | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-012-3/+5
* | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
|/
* Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\
| * Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
* | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
* | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
* | kernel/process: Make data member variables privateLioncash2018-09-307-55/+100
* | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \
| * | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
* | | Merge pull request #1395 from lioncash/vmbunnei2018-09-297-53/+319
|\ \ \
| * | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-254-13/+17
| * | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| * | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-252-5/+16
| * | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-244-10/+248
* | | | Merge pull request #1394 from lioncash/streambunnei2018-09-271-1/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | stream: Preserve enum class type in GetState()Lioncash2018-09-241-1/+1
| |/ /
* | | Merge pull request #1399 from lioncash/schedbunnei2018-09-262-9/+9
|\ \ \
| * | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-252-9/+9
* | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \
| * | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
* | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-252-1/+14
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
* | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \
| * | | | | svc: Updated svc namestech4me2018-09-241-7/+7
* | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
* | | | | | Stubbed IRS (#1349)David2018-09-242-18/+167
* | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
* | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-231-1/+8
| |_|_|/ / |/| | | |
* | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
* | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| |_|/ / |/| | |
* | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \
| * | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
* | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-211-0/+1
|\ \ \ \ \
| * | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-211-0/+1
| |/ / / /
* | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \
| * | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| * | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
| |/ / / /
* / / / / Revert GetRequestStateDavid Marcec2018-09-211-1/+1
|/ / / /
* | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
* | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
| |/ / |/| |
* | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
* | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \
| * | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ /
* | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
* | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ /
* | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \
| * | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
* | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \
| * | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| |/ /
* | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \
| * | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ /
* | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \
| * | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| * | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| * | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| |/ /
* | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-191-2/+3
* | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \
| * | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| * | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ /
* / / arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-181-2/+2
|/ /
* | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \
| * | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
* | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \
| * | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ /
* | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \
| * | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ /
* | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \
| * | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| * | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| * | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| * | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ /
* | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \
| * | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |/ | |/|
* / | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1531-119/+125
|/ /
* | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-142-7/+7
|\ \
| * | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-132-7/+7
| |/
* | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \
| * | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/
* | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ | |/ |/|
| * services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
* | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/
* Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\
| * pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
* | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \
| * | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| * | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
* | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
* | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
|/ /
* | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \
| * | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/
* / service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
|/
* Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\
| * hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
* | externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/
* Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-111-1/+25
* video_core: Move command buffer loop.Markus Wick2018-09-102-31/+12
* Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-101-4/+4
|\
| * hid: Implement ReloadInputDevicesfearlessTobi2018-09-091-4/+4
* | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
|/
* core: Migrate current_process pointer to the kernelLioncash2018-09-072-0/+23
* core/core: Remove unnecessary sm/controller includeLioncash2018-09-064-1/+5
* bktr: Fix bucket overlap errorZach Hilman2018-09-041-1/+1
* registration: Add RegisteredCacheUnionZach Hilman2018-09-042-0/+10
* Merge pull request #1235 from lioncash/forward-declbunnei2018-09-041-1/+3
|\
| * file_sys: Replace includes with forward declarations where applicableLioncash2018-09-041-1/+3
* | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ | |/ |/|
| * ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
* | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-022-2/+30
|\ \
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-316-4/+13
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-311-0/+1
* core: Make the main System class use the PImpl idiomLioncash2018-08-312-2/+4
* kernel: Eliminate kernel global stateLioncash2018-08-2945-429/+629
* Merge pull request #1193 from lioncash/privbunnei2018-08-281-6/+6
|\
| * gpu: Make memory_manager privateLioncash2018-08-281-6/+6
* | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
|/
* Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
* | Merge pull request #1175 from lioncash/nsbunnei2018-08-284-6/+8
|\ \
| * | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-254-6/+8
* | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \
| * | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
* | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \
| * | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| * | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
* | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \
| * | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |_|/ / | |/| | |
* | | | | set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
| |_|_|/ |/| | |
* | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ /
* | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-252-12/+36
|\ \ \ | |/ / |/| |
| * | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-232-8/+11
| * | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| |/
* / Added GetBootMode (#1107)David2018-08-244-3/+25
|/
* Added missing include for pl:uDavid Marcec2018-08-221-0/+1
* PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
* Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-223-2/+3
|\
| * vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-213-2/+3
* | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
|/
* Merge pull request #1129 from lioncash/headerbunnei2018-08-213-5/+19
|\
| * service/filesystem: Use forward declarations where applicableLioncash2018-08-213-5/+19
* | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ | |/ |/|
| * acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| * acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| * acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| * acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| * profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| * profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| * profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| * profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| * profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| * profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| * profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| * profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| * profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
* | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-214-16/+50
|\ \ | |/ |/|
| * filesystem: Add support for loading of system archivesZach Hilman2018-08-194-16/+50
* | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \
| * | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| |/
* | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2012-74/+438
|\ \ | |/ |/|
| * Better UUID randomnessDavid Marcec2018-08-111-2/+7
| * Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| * Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| * Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| * Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| * fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| * Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| * Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| * Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| * If statement style changeDavid Marcec2018-08-111-11/+19
| * Second round of account changesDavid Marcec2018-08-113-18/+21
| * First round of account changesDavid Marcec2018-08-113-49/+55
| * Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| * Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1117-36/+78
| |\
| * | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| * | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| * | Open first user addedDavid Marcec2018-08-081-1/+3
| * | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| * | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| * | began initial implementation of "ProfileManager"David Marcec2018-08-084-44/+200
| * | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
* | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
* | | correct coding stylegreggameplayer2018-08-161-1/+1
* | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
* | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-162-4/+23
|\ \ \
| * | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
* | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \
| * | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| * | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
* | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-161-1/+1
|\ \ \ \ \
| * | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-131-1/+1
* | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \
| * | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / | |/| | | |
* / | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
|/ / / / /
* | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \
| * | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
* | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| * | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
| |/ / / /
* | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \
| * | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / /
* | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-145-0/+144
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| * | | | Added missing channel devicesDavid Marcec2018-08-134-0/+140
* | | | | kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
|/ / / /
* | | | Merge pull request #1043 from Subv/timingbunnei2018-08-131-1/+0
|\ \ \ \
| * | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
* | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-132-2/+2
|\ \ \ \ \
| * | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| |/ / / /
* | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-131-2/+9
|\ \ \ \ \
| * | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| * | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-131-2/+4
| |/ / / /
* | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \
| * | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / /
* | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-121-1/+1
* | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \
| * | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| |/ / / /
* | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-121-5/+26
|\ \ \ \ \
| * | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-121-4/+2
| * | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-121-5/+28
| | |/ / / | |/| | |
* | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
* | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| |/ / / |/| | |
* | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
|/ / /
* | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
* | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
* | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
* | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-111-0/+1
| |/ |/|
* | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \
| * | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| * | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
* | | Merge pull request #990 from lioncash/entrybunnei2018-08-101-6/+3
|\ \ \
| * | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-091-5/+1
| * | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
* | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-104-12/+17
|\ \ \ \ | |_|/ / |/| | |
| * | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-094-11/+16
| * | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
* | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ | |/ / / |/| | |
| * | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |/ | |/|
* | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \
| * | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
* | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ | |_|_|/ |/| | |
| * | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ /
* | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ | |_|/ |/| |
| * | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| |/
* | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-082-124/+0
|\ \
| * | hle: Remove unused romfs.cpp/.hLioncash2018-08-082-124/+0
| |/
* | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \
| * | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
* | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ /
* / acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
|/
* Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\
| * nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
* | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \
| * | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/
* | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \
| * | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/
* | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \
| * | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| * | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/
* | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \
| * | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/
* | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \
| * | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| * | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/
* | Merge pull request #952 from lioncash/usbbunnei2018-08-073-0/+255
|\ \
| * | service: Add usb servicesLioncash2018-08-073-0/+255
| |/
* / client_port: Make all data members privateLioncash2018-08-073-7/+21
|/
* kernel/event: Make data members privateLioncash2018-08-061-4/+8
* Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
* Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\
| * address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
* | Merge pull request #925 from bunnei/audrenbunnei2018-08-064-233/+16
|\ \
| * | audio_core: Implement audren_u audio playback.bunnei2018-08-052-218/+9
| * | audio_core: Use s16 where possible for audio samples.bunnei2018-08-051-3/+3
| * | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-052-11/+3
| * | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-041-1/+1
* | | Merge pull request #912 from lioncash/global-varbunnei2018-08-053-10/+13
|\ \ \ | |_|/ |/| |
| * | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-041-2/+2
| * | video_core: Eliminate the g_renderer global variableLioncash2018-08-043-10/+13
| |/
* | Merge pull request #924 from lioncash/arpbunnei2018-08-053-0/+93
|\ \
| * | service: Add arp servicesLioncash2018-08-053-0/+93
| |/
* / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/
* Merge pull request #914 from lioncash/codesetbunnei2018-08-042-15/+36
|\
| * kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| * kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-032-15/+35
* | kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
|/
* Merge pull request #908 from lioncash/memorybunnei2018-08-039-302/+24
|\
| * core/memory: Get rid of 3DS leftoversLioncash2018-08-039-302/+24
* | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-034-5/+45
* | Merge pull request #898 from lioncash/migbunnei2018-08-033-0/+51
|\ \ | |/ |/|
| * service: Add migration servicesLioncash2018-08-023-0/+51
* | Merge pull request #894 from lioncash/objectbunnei2018-08-0333-146/+177
|\ \
| * | kernel: Move object class to its own source filesLioncash2018-08-0233-146/+177
| |/
* | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \
| * | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| * | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| * | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| |/
* | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \
| * | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| * | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| * | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/
* | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \
| * | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
* | | service: Add psc servicesLioncash2018-08-023-0/+94
| |/ |/|
* | Merge pull request #888 from lioncash/capsbunnei2018-08-023-0/+169
|\ \
| * | service: Add capture servicesLioncash2018-08-013-0/+169
| |/
* | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \
| * | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/
* | Merge pull request #889 from lioncash/fspbunnei2018-08-025-0/+85
|\ \
| * | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-015-0/+85
| |/
* / service: Add bpc and pcv servicesLioncash2018-08-015-0/+175
|/
* kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
* Merge pull request #877 from lioncash/removebunnei2018-08-015-102/+0
|\
| * kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-315-102/+0
* | Merge pull request #880 from lioncash/audiobunnei2018-08-0113-0/+277
|\ \
| * | service/audio: Add missing servicesLioncash2018-08-0113-0/+277
* | | Merge pull request #876 from lioncash/includebunnei2018-08-0122-27/+46
|\ \ \
| * | | kernel: Remove unnecessary includesLioncash2018-07-3122-27/+46
| | |/ | |/|
* | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ | |_|/ |/| |
| * | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
* | | Merge pull request #869 from Subv/ubsanbunnei2018-07-312-6/+17
|\ \ \
| * | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| * | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
* | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-313-0/+92
|\ \ \ \
| * | | | service: Add fgm servicesLioncash2018-07-313-0/+92
| | |_|/ | |/| |
* | | | Merge pull request #874 from lioncash/ambunnei2018-07-317-0/+150
|\ \ \ \ | |_|_|/ |/| | |
| * | | service/am: Add missing am servicesLioncash2018-07-317-0/+150
| |/ /
* / / service: Add the pcie serviceLioncash2018-07-313-0/+81
|/ /
* | audio_core: Move to audout_u impl.bunnei2018-07-312-4/+6
* | Implemented various hwopus functions (#853)David2018-07-312-5/+131
* | Merge pull request #857 from lioncash/wlanbunnei2018-07-303-1/+190
|\ \
| * | service: Add wlan servicesLioncash2018-07-293-1/+190
* | | Merge pull request #856 from lioncash/btmbunnei2018-07-303-0/+138
|\ \ \
| * | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| * | | service: Add btm servicesLioncash2018-07-293-0/+104
| |/ /
* / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ /
* | Merge pull request #847 from lioncash/ncmbunnei2018-07-283-0/+76
|\ \
| * | service: Add ncm servicesLioncash2018-07-273-0/+76
* | | Merge pull request #846 from lioncash/miibunnei2018-07-283-0/+124
|\ \ \
| * | | service: Add mii servicesLioncash2018-07-273-0/+124
* | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| |/ / |/| |
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-273-0/+239
|\ \ \
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| * | | service: Add nfc servicesLioncash2018-07-273-0/+200
| |/ /
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-273-0/+107
|\ \ \
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-271-3/+35
| * | | service: Add the lbl serviceLioncash2018-07-273-0/+75
| |/ /
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-273-1/+91
|\ \ \ | |/ / |/| |
| * | service: Add the btdrv serviceLioncash2018-07-273-1/+91
* | | Merge pull request #837 from lioncash/privbunnei2018-07-271-5/+17
|\ \ \
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-261-5/+17
* | | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
* | | | service/hid: Add the xcd:sys serviceLioncash2018-07-263-0/+55
* | | | service/hid: Add irs servicesLioncash2018-07-263-0/+73
| |/ / |/| |
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-263-0/+48
|\ \ \
| * | | service: Add the grc:c serviceLioncash2018-07-263-0/+48
| |/ /
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-263-0/+141
|\ \ \
| * | | service: Add the nim servicesLioncash2018-07-263-0/+141
| |/ /
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-263-0/+160
|\ \ \
| * | | service: Add ldn servicesLioncash2018-07-263-0/+160
| |/ /
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-265-0/+93
|\ \ \ | |_|/ |/| |
| * | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-263-0/+64
| * | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/
* | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ | |/ |/|
| * lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| * lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| * lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
* | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-263-0/+99
|\ \
| * | service: Add ldr servicesLioncash2018-07-263-0/+99
* | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-265-0/+139
|\ \ \
| * | | service: Add eupld servicesLioncash2018-07-263-0/+70
| * | | service: Add the erpt servicesLioncash2018-07-263-0/+69
| | |/ | |/|
* | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-268-135/+30
|\ \ \ | |_|/ |/| |
| * | service/nifm: Deduplicate interface codeLioncash2018-07-258-135/+30
* | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \
| * | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| * | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ /
* | | Merge pull request #822 from lioncash/pmbunnei2018-07-263-0/+88
|\ \ \ | |_|/ |/| |
| * | service: Add pm servicesLioncash2018-07-253-0/+88
| |/
* / service: Add the es serviceLioncash2018-07-253-0/+75
|/
* Merge pull request #801 from lioncash/timeMat M2018-07-255-60/+14
|\
| * time: Add the time:a serviceLioncash2018-07-253-10/+11
| * time: Simplify interface creationLioncash2018-07-245-60/+13
* | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \
| * | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
* | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-257-0/+7
|\ \ \
| * | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-247-0/+7
* | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \
| * | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| * | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| | |_|/ | |/| |
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-255-44/+13
|\ \ \ \
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| * | | | friend: Deduplicate interfacesLioncash2018-07-245-44/+9
| | |_|/ | |/| |
* / | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
|/ / /
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-242-2/+2
|\ \ \
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-242-2/+2
| |/ /
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ /
* | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ | |_|/ |/| |
| * | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
* | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ | |_|/ |/| |
| * | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| * | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| |/
* / VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-241-16/+29
|/
* Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\
| * vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| * vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
* | Merge pull request #779 from lioncash/sharedbunnei2018-07-247-259/+0
|\ \
| * | hle: Remove config_mem.h/.cppLioncash2018-07-235-100/+0
| * | hle: Remove shared_page.h/.cppLioncash2018-07-235-159/+0
| |/
* / set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
|/
* Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\
| * set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| * set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
* | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ | |/ |/|
| * Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
* | file_util, vfs: Use std::string_view where applicableLioncash2018-07-221-1/+1
|/
* Merge pull request #760 from lioncash/pathbunnei2018-07-222-3/+3
|\
| * file_util: Use an enum class for GetUserPath()Lioncash2018-07-212-3/+3
* | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/
* Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-213-0/+13
|\
| * CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-213-0/+13
* | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \
| * | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
* | | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ /
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/
* | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \
| * | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| * | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-209-71/+70
|\ \ \ | |_|/ |/| |
| * | thread: Convert ThreadStatus into an enum classLioncash2018-07-209-71/+70
| |/
* / pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ /
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/|
* | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \
| * | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| * | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
* | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \
| * | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / /
* | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \
| * | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / /
* | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / /
* | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ | |_|_|/ |/| | |
| * | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
| |/ /
* | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \
| * | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
| |/ /
* | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ | |_|/ |/| |
| * | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| * | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| * | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| * | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| * | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| * | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/
* | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
* | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
* | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
|/
* Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\
| * address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
* | Merge pull request #690 from lioncash/movebunnei2018-07-198-13/+21
|\ \
| * | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-198-13/+21
* | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \
| * | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ | |/|
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-191-6/+6
|\ \ \
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-191-6/+6
| |/ /
* | / Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-195-116/+383
| |/ |/|
* | Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
* | Single touch supportZach Hilman2018-07-181-4/+19
|/
* vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
* vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
* vi: Partially implement buffer crop parameters.bunnei2018-07-186-10/+26
* General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-175-101/+130
* Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-171-0/+1
|\
| * scheduler: Clear exclusive state when switching contextsMerryMage2018-07-161-0/+1
* | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* / nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
* Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\
| * Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
* | No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/
* We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
* initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
* Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\
| * Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
* | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
|/
* Merge pull request #559 from Subv/mount_savedatabunnei2018-07-121-2/+11
|\
| * Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-191-2/+11
* | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
* | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
* | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
* | Revert "Virtual Filesystem (#597)"bunnei2018-07-085-405/+71
* | Virtual Filesystem (#597)Zach Hilman2018-07-065-71/+405
* | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
* | Update clang formatJames Rowe2018-07-0317-75/+70
* | Rename logging macro back to LOG_*James Rowe2018-07-0354-401/+401
* | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
* | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
* | Merge pull request #588 from mailwl/hwopusbunnei2018-06-283-0/+51
|\ \
| * | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-253-0/+51
* | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ /
* | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
* | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
* | Merge pull request #579 from SciresM/masterbunnei2018-06-228-9/+295
|\ \
| * | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-222-17/+16
| * | Add additional missing format.Michael Scire2018-06-222-21/+27
| * | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| * | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| * | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-212-1/+5
| * | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| * | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-214-10/+110
| * | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-214-6/+67
| * | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
* | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
* | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
|/ /
* | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-203-4/+5
* | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
* | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \
| * | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| * | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| * | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
* | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ | |/ / |/| |
| * | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
* | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ |/|
* | Common/string_util: add StringFromBuffer functionmailwl2018-06-071-22/+9
* | Merge pull request #522 from mailwl/mm-ubunnei2018-06-073-0/+81
|\ \
| * | Remove unused header filesmailwl2018-06-061-2/+0
| * | Small fixesmailwl2018-06-052-6/+8
| * | Service/MM: add service and stub some functionsmailwl2018-06-053-0/+81
* | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \
| * | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| * | | Correct function resultsmailwl2018-06-041-4/+16
| * | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
* | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
* | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
* | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| |/ / |/| |
* | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
* | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
* | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
* | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/ /
* | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
* | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
* | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
* | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
* | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-033-0/+72
|\ \
| * | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-303-0/+72
* | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
* | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
* | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \
| * | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| * | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| * | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
| |/ /
* | | add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
* | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
* | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
|/ /
* | Service/BCAT: add module and servicesmailwl2018-05-285-0/+114
* | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \
| * | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
* | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
* | | Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ /
* | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| |
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-214-1/+98
|\ \ \
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-202-0/+50
| |/ /
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
* | | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-117-99/+249
|\ \
| * | thread: Rename mask to affinity_masks.bunnei2018-05-113-4/+4
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-112-3/+3
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| * | core: Implement multicore support.bunnei2018-05-115-45/+65
* | | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-072-68/+220
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0220-73/+74
|\ \
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0220-73/+74
* | | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ /
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ /
* | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-308-12/+16
* | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-302-4/+3
* | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
* | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
* | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
* | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-276-12/+12
* | Switched to NGLOG_WARNINGDavid Marcec2018-04-273-4/+4
* | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-2661-881/+791
|\ \
| * | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| * | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
| * | Service/PCTL: convert to module, add services, stubmailwl2018-04-256-37/+69
| * | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| * | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| * | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| * | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| * | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| * | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| * | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| * | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| * | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| * | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| * | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| * | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| * | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| * | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
| * | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-241-1/+21
| * | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2311-439/+236
| |\ \
| | * | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| | * | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-211-1/+1
| | * | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-213-8/+8
| | * | Kernel: Remove unused ConditionVariable class.Subv2018-04-215-148/+0
| | * | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| | * | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| | * | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
| * | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
| |\ \ \
| | * | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| | * | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| * | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ / /
* | | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-262-13/+2
* | | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-239-25/+63
* | | | lioncash proposed changesDavid2018-04-221-2/+2
* | | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2210-11/+107
|/ / /
* | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \
| * | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
* | | | core: Relocate g_service_manager to the System classLioncash2018-04-214-32/+32
|/ / /
* | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ | |/ / |/| |
| * | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
* | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \
| * | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
* | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-201-1/+2
|\ \ \ \
| * | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-201-1/+2
| |/ / /
* / / / vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / /
* / / nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
|/ /
* | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
* | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \
| * | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
* | | fsp_srv: Implement DeleteFile.bunnei2018-04-151-1/+15
|/ /
* | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \
| * | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
* | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
* | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/ /
* | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \
| * | Various fixes and clangHexagon122018-04-116-115/+108
| * | Decimal changeHexagon122018-04-101-4/+4
| * | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| * | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| * | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| * | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| * | Updated hid with more service names.Hexagon122018-04-101-0/+50
| * | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| * | Updated the unknown nameHexagon122018-04-101-1/+1
| * | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| * | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| * | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| * | Updated audren with more service names.Hexagon122018-04-101-10/+14
| * | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| * | Updated audout with more service names.Hexagon122018-04-101-13/+16
| * | Updated audin with more service names.Hexagon122018-04-101-9/+16
| * | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| * | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| * | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| * | Updated AM with more service names.Hexagon122018-04-101-2/+82
* | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
* | | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1010-127/+336
|/ /
* | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
* | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
* | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
* | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
* | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
* | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
* | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
* | service: Add friend:u interface.bunnei2018-04-033-0/+39
* | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
* | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \
| * | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
* | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
* | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
* | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
* | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-311-2/+21
* | | memory: Fix stack region.bunnei2018-03-312-3/+4
|/ /
* | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
* | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
* | service: Add NFP module interface.bunnei2018-03-305-0/+95
* | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
* | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-271-5/+5
* | config: Add setting for whether the system is docked or not.bunnei2018-03-271-2/+6
* | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \
| * | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| * | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| * | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
* | | Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-257-30/+92
|/ /
* | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-242-6/+7
|\ \
| * | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-231-6/+0
| * | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-232-3/+3
| * | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| * | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-231-3/+3
* | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-243-2/+106
|\ \ \
| * | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-211-0/+15
| * | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| * | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| * | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| * | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-202-0/+6
* | | | Service/SSL: add ssl servicemailwl2018-03-233-0/+41
* | | | Service/spl: add module and servicesmailwl2018-03-227-0/+168
| |/ / |/| |
* | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
* | | Service: add fatal:u, fatal:p servicesmailwl2018-03-207-0/+138
* | | Clang FixesN00byKing2018-03-193-7/+7
* | | oopsN00byKing2018-03-191-3/+3
* | | More Warning cleanupsN00byKing2018-03-192-2/+2
* | | Clean Warnings (?)N00byKing2018-03-1910-15/+15
|/ /
* | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
* | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
* | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
* | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
* | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-193-20/+6
* | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
* | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
* | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
* | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-161-0/+3
* | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
* | kernel: Move stack region outside of application heap.bunnei2018-03-163-8/+3
* | process: Fix stack memory state.bunnei2018-03-161-2/+4
* | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
* | IGeneralService: fix function listmailwl2018-03-161-2/+3
* | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
* | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
* | core: Move process creation out of global state.bunnei2018-03-1411-39/+43
* | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-045-2/+55
|\ \
| * | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| * | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-043-2/+40
* | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ /
* | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \
| * | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
* | | Service/Set: add more servicesmailwl2018-03-0311-10/+340
|/ /
* | Merge pull request #216 from Subv/savedatabunnei2018-03-027-13/+209
|\ \
| * | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-022-9/+8
| * | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| * | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-022-2/+10
| * | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| |/
* / thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/
* Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\
| * Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| * Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| * IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
* | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \
| * | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| * | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
* | | Merge pull request #212 from mailwl/stubsbunnei2018-02-249-8/+110
|\ \ \
| * | | Stub more functionsmailwl2018-02-227-8/+90
| * | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-224-0/+20
| |/ /
* / / time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
|/ /
* / time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
|/
* Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-2/+26
|\
| * Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-2/+26
* | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
* | service: Add Friend service interface.bunnei2018-02-195-0/+96
|/
* Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-197-369/+223
|\
| * scheduler: Cleanup based on PR feedback.bunnei2018-02-192-4/+3
| * kernel: Use Scheduler class for threading.bunnei2018-02-183-172/+16
| * kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-182-0/+208
| * kernel: Remove unused address_arbiter code.bunnei2018-02-184-197/+0
* | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/
* Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\
| * Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
* | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ | |/ |/|
| * nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| * Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| * Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| * Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| * nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| * Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| * Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| * Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| * Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
* | Service/hid: stub some functionsmailwl2018-02-164-1/+98
* | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
* | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-155-0/+178
* | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/
* Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\
| * hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| * hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| * service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| * audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| * vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| * nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| * vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| * hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| * hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| * vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
* | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
* | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
* | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
* | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
* | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
* | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
* | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
* | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
* | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
|/
* audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
* Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\
| * vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| * vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| * TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
* | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
|/
* Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\
| * Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
* | Merge pull request #178 from Subv/command_buffersbunnei2018-02-127-172/+18
|\ \ | |/ |/|
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-127-181/+15
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-123-3/+5
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-104-58/+100
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
* nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
* IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
* nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
* acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-082-0/+160
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\
| * mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
* | Extra nvdrv support (#162)David2018-02-0616-37/+761
|/
* Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
* logger: Add Time service logging category.bunnei2018-02-051-10/+10
* logger: Add SET service logging category.bunnei2018-02-051-1/+1
* logger: Add PCTL service logging category.bunnei2018-02-051-1/+1
* logger: Add LM service logging category.bunnei2018-02-051-2/+2
* logger: Add APM service logging category.bunnei2018-02-051-2/+3
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
* logger: Add NIFM service logging category.bunnei2018-02-054-11/+11
* logger: Add VI service logging category.bunnei2018-02-054-21/+20
* hid: Stub out several functions.bunnei2018-02-051-1/+39
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
* logger: Add AM service logging category.bunnei2018-02-043-42/+42
* logger: Add "account" service logging category.bunnei2018-02-041-8/+8
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
* Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\
| * GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| * WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| * svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| * ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
* | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-039-0/+370
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-026-379/+569
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
* | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-025-0/+124
|\ \
| * | Services/vi: add vi:s and vi:u servicesmailwl2018-02-025-0/+124
| |/
* | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ | |/ |/|
| * shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
* | [WIP] sfdnsres: stub (#146)mailwl2018-01-304-2/+51
|/
* Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-272-6/+6
|\
| * memory: Replace all memory hooking with Special regionsMerryMage2018-01-272-6/+6
* | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
* | audout_u: Various cleanups.bunnei2018-01-251-29/+17
* | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
* | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
* | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
* | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
* | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
* | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
* | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
* | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-259-166/+2
* | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
* | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-14/+166
* | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
* | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \
| * | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| * | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| * | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| * | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| * | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
* | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ | |/ / |/| |
| * | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| * | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| * | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
* | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ | |/ / |/| |
| * | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
* | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-228-363/+448
|/ /
* | Added stubs for audio services. (#116)st4rk2018-01-2211-5/+299
* | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \
| * | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| * | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
| |/
* | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-217-5/+158
* | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \
| * | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| |/
* | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
* | filesystem: Implement basic IStorage functionality.David Marcec2018-01-215-0/+254
|/
* service/time: remove accidental #pragmastgsm2018-01-212-4/+0
* Format: Run the new clang format on everythingJames Rowe2018-01-2130-40/+43
* Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
* Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-203-3/+3
* Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\
| * ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
* | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-197-0/+159
|/
* Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\
| * nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| * svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| * svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
* | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \
| * | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
* | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
* | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ /
* / Fix dispdrv typogdkchan2018-01-191-1/+1
|/
* Merge pull request #100 from Rozelette/masterbunnei2018-01-196-32/+109
|\
| * time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| * time: Refactor time:* to use a single shared moduleRozlette2018-01-186-26/+103
* | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
* | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-186-0/+154
* | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ | |/ |/|
| * lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
* | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \
| * | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| * | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
* | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \
| * | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| * | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ /
* | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ | |_|/ |/| |
| * | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/
* / controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
|/
* TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-174-83/+164
* Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\
| * hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
* | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \
| * | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
| |/
* | svc: Clang-format fix.bunnei2018-01-171-6/+4
* | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-173-3/+35
|\ \ | |/ |/|
| * hle_ipc: Clang format.bunnei2018-01-171-2/+3
| * ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
* | Merge pull request #60 from jroweboy/game-framebunnei2018-01-171-0/+3
|\ \ | |/ |/|
| * UI: Fix frame rate perf statsJames Rowe2018-01-171-0/+3
* | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ | |/ |/|
| * hid: clang-formatshinyquagsire232018-01-171-3/+3
| * hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| * hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
* | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-175-0/+82
* | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
* | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-173-14/+16
* | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
* | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
* | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
* | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
* | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
* | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
* | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
* | Merge pull request #52 from ogniK5377/fspbunnei2018-01-175-3/+88
|\ \
| * | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| * | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| * | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| |/
* / clang-formatMerryMage2018-01-169-26/+21
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
* Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-152-0/+398
|\
| * hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| * hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| * hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
* | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/
* Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
* renderer: Render previous frame when no new one is available.bunnei2018-01-151-1/+4
* lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
* time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-155-1/+117
* audio: Add files to CMake.bunnei2018-01-151-1/+0
* hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
* audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
* hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
* shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
* svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
* kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
* Fix build on macOS and linuxMerryMage2018-01-131-2/+0
* yuzu: Update license text to be consistent across project.bunnei2018-01-1349-49/+49
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-131-2/+0
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-134-249/+0
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
* core: Fix recent GCC build breaks.bunnei2018-01-121-2/+2
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1110-166/+423
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-115-0/+718
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-104-10/+25
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-098-159/+167
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-093-18/+16
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-093-63/+60
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-093-11/+7
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-032-23/+11
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
* hle: Move SVC code to kernel namespace.bunnei2018-01-033-131/+118
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-011-2/+2
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
* svc: Minor cleanups.bunnei2017-12-301-8/+9
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
* service: Add empty interface for pctl:a.bunnei2017-12-295-0/+86
* kernel: Add basic support for Domain object.bunnei2017-12-294-4/+110
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-293-10/+40
* svc: Implement MapMemory.bunnei2017-12-292-3/+16
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
* service: Add empty interface for aoc:u.bunnei2017-12-283-0/+42
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
* hle: Use Switch formatted result codes.bunnei2017-11-015-272/+86
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
* hle: Add service stubs for apm and appletOE.bunnei2017-10-159-2/+130
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1515-637/+567
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
* Remove more 3DS-specific code.bunnei2017-10-134-45/+0
* Remove more 3DS-specific code.bunnei2017-10-135-1411/+1
* Remove more 3DS-specific code.bunnei2017-10-131-9/+0
* Remove lots more 3DS-specific code.bunnei2017-10-1324-4161/+6
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10184-21488/+2
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-1066-610/+1824
|\
| * Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| * Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-082-55/+49
| |\
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| * | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \
| | * | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| * | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ | | |_|/ | |/| |
| | * | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-012-0/+12
| |\ \ \
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | |
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| * | | | Moved down_count to CoreTimingHuw Pascoe2017-09-301-1/+1
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| * | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/|
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| |
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3021-56/+59
| * | | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| |/ /
| * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-252-1/+24
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-251-7/+4
| |\ \
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-241-7/+4
| | |/
| * | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \
| | * | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | |/
| * / Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| |/
| * Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-166-40/+73
| |\
| | * Services/NS: Port ns:s to the new service framework.Subv2017-09-166-40/+73
| * | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-155-30/+33
| |\ \
| | * | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | * | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-152-25/+7
| | * | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | * | Kernel/Memory: Give each Process its own page table.Subv2017-09-102-5/+14
| * | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \
| | * | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| * | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-056-53/+287
| |\ \ \ \
| | * | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | * | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | * | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | * | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-274-11/+142
| * | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| * | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| | |/ / / | |/| | |
| * | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-291-4/+8
| |\ \ \ \
| | * | | | HID: use TouchDevice for touch padwwylele2017-08-241-4/+8
| | | |_|/ | | |/| |
| * / | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-293-3/+3
| |/ / /
| * | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-244-3/+36
| |\ \ \
| | * | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-224-3/+36
| * | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \
| | * | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| * | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-211-0/+3
| * | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| |/ / / /
| * | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-201-5/+27
| |\ \ \ \ | | |_|_|/ | |/| | |
| | * | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | * | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-111-5/+27
| * | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \
| | * | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| * | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ | | |_|/ / / | |/| | | |
| | * | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | * | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / /
| * | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \
| | * | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | |/ / /
| * | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-091-1/+1
| |\ \ \ \
| | * | | | Update cryptoppJames2017-08-081-1/+1
| | |/ / /
| * / / / Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ / /
| * | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| * | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \
| | * | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | * | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | * | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | * | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | * | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | * | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | |/ /
* | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-102-4/+4
* | | | nso: Refactor and allocate .bss section.bunnei2017-09-302-8/+10
* | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
* | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
* | | | core: Various changes to support 64-bit addressing.bunnei2017-09-302-21/+21
* | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-302-2/+2
|/ / /
* | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-224-10/+9
|\ \ \ | |/ / |/| |
| * | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-222-8/+7
| * | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-222-2/+2
* | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
* | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-164-22/+262
|\ \ \
| * | | apt: load shared font from system archivewwylele2017-06-263-20/+258
| * | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| |/ /
* | / Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| |/ |/|
* | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \
| * | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| * | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| * | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| * | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
* | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-273-1/+432
|\ \ \
| * | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| * | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-261-4/+1
| * | | UDS: Run clang-format.Subv2017-06-263-51/+55
| * | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| * | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| * | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| * | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-153-1/+259
| |/ /
* | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
* | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
* | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
* | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \
| * | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ | |/|
* / | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-211-7/+12
|/ /
* | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-211-0/+2
|\ \
| * | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/
* | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \
| * | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| * | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/
* | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \
| * | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| |/
* / Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
|/
* Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
* Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
* Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
* Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
* Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
* IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
* IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
* Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
* ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
* Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-098-63/+354
|\
| * Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| * Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| * Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-084-3/+268
| * Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
* | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-082-1/+2
* | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
* | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ | |/ |/|
| * Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
* | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0631-12/+79
* | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-065-24/+145
* | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
* | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-063-7/+8
* | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
* | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
* | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0613-73/+98
* | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-031-1/+2
* | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-031-2/+1
* | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-031-52/+2
* | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-032-7/+53
* | Made some changes from review comments:TheKoopaKingdom2017-06-032-9/+6
* | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-033-2/+12
* | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \
| * | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| * | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| * | cam: use IPCHelperwwylele2017-05-241-278/+238
* | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3017-203/+240
* | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3012-132/+174
* | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
* | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| |/ |/|
* | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-282-2/+0
* | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-281-1/+1
* | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
* | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2522-132/+177
* | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
* | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-255-44/+19
* | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
* | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-251-18/+15
|/
* Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-227-51/+83
|\
| * Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| * Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| * Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-157-32/+85
* | Merge pull request #2661 from Subv/uds5bunnei2017-05-194-33/+600
|\ \
| * | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| * | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| * | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-154-7/+535
* | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
* | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-144-45/+102
|\ \ \
| * | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-104-50/+102
| * | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-101-1/+6
* | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-108-23/+207
|\ \ \ \ | |/ / / |/| | |
| * | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| * | | ir: implement new 3ds HID via ir:rstwwylele2017-05-048-23/+206
* | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-081-8/+2
* | | | Create a random console_unique_id (#2668)B3n302017-05-062-5/+71
|/ / /
* | | Merge pull request #2606 from wwylele/irbunnei2017-05-044-44/+757
|\ \ \
| * | | ir: implement circle pad prowwylele2017-05-034-44/+757
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \ | |_|_|/ |/| | |
| * | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| |/ /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | |_|/ |/| |
| * | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | |_|/ |/| |
| * | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| * | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| * | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| * | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| * | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| * | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| * | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| * | | address more commentsLectem2017-03-191-20/+20
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
* | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
* | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
* | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
|/ / / /
* / / / apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / /
* | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-172-37/+56
|\ \ \
| * | | Input: remove unused stuff & clean upwwylele2017-03-011-34/+0
| * | | HID: use AnalogDevicewwylele2017-03-011-2/+9
| * | | HID: use ButtonDevicewwylele2017-03-012-1/+47
| |/ /
* | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \
| * | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| |/ /
* / / cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
|/ /
* | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
* | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \
| * | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
* | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
* | | Doxygen: Amend minor issues (#2593)Mat M2017-02-275-9/+10
* | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-274-1/+4
|\ \ \ | |/ / |/| |
| * | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-271-2/+1
| * | Add performance statistics to status barYuri Kunde Schlesner2017-02-271-0/+3
| * | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-273-1/+2
* | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-255-6/+149
|\ \ \
| * | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
* | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
* | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
| |/ / |/| |
* | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
* | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
* | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
* | | turned clang format back onnoah the goodra2017-02-141-1/+1
|/ /
* | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-132-1/+5
|\ \
| * | loader: use self NCCH archivewwylele2017-02-131-1/+1
| * | file_sys: add Self NCCH archivewwylele2017-02-131-0/+4
* | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-111-4/+0
|/ /
* | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-055-68/+363
|\ \
| * | fix wwylele's comment and use typename in templatesLectem2017-02-051-4/+4
| * | fix comments alignmentLectem2016-12-301-22/+22
| * | move Pop methods out of class bodyLectem2016-12-261-72/+88
| * | IPC helpers exampleLectem2016-12-263-35/+40
| * | IPC helpersLectem2016-12-262-48/+322
* | | Merge pull request #2496 from mailwl/cfg-memYuri Kunde Schlesner2017-02-041-5/+8
|\ \ \
| * | | Core: update Kernel Config Memory to latest version (11.2)mailwl2017-01-301-5/+8
| | |/ | |/|
* | | GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
* | | HLE/Applets: Stub Mint (eShop) Applet (#2463)mailwl2017-01-313-0/+106
|/ /
* | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-303-172/+1242
|\ \
| * | CAM: implement basic camera functions with a blank camerawwylele2017-01-113-172/+1242
| |/
* | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \
| * | CFG: override language setting on bootwwylele2017-01-191-36/+38
* | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
* | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \
| * | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
* | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
* | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
* | | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-161-3/+3
* | | | HID: manages updating itself using correct tickswwylele2017-01-162-58/+93
|/ / /
* / / GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ /
* | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-124-32/+30
|\ \
| * | Threads: Check the process' resource limit for the max allowed priority when creating a thread and remove the priority clamping code.Subv2017-01-112-13/+9
| * | Thread: Added priority range checking to svcSetThreadPriority and removed priority clamping code from Thread::SetPriority.Subv2017-01-113-18/+18
| * | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-128-295/+418
|\ \ \ | |/ / |/| |
| * | Service/AC: add ac:i servicemailwl2016-12-308-295/+418
* | | Merge pull request #2397 from Subv/pulsebunnei2017-01-105-13/+20
|\ \ \
| * | | Kernel: Implemented Pulse event and timers.Subv2017-01-055-13/+20
| |/ /
* | | Merge pull request #2410 from Subv/sleepthreadbunnei2017-01-073-0/+14
|\ \ \
| * | | Kernel: Don't attempt to yield execution in SleepThread(0) if there are no available threads to run.Subv2017-01-063-0/+14
* | | | Merge pull request #2396 from Subv/sema_acquirebunnei2017-01-071-1/+2
|\ \ \ \
| * | | | Kernel/Semaphore: Fixed a regression in semaphore waits.Subv2017-01-051-1/+2
| |/ / /
* | | | Kernel: Fix SharedMemory objects always returning error when addr = 0 (#2404)Hyper2017-01-061-1/+5
* | | | Merge pull request #2408 from Subv/priority_boostingbunnei2017-01-061-27/+0
|\ \ \ \
| * | | | Kernel: Removed the priority boost code for starved threads.Subv2017-01-051-27/+0
| |/ / /
* / / / Kernel: Remove some unused functions.Subv2017-01-052-32/+0
|/ / /
* | | Merge pull request #2393 from Subv/synchSebastian Valle2017-01-0517-159/+221
|\ \ \
| * | | Kernel: Add some asserts to enforce the invariants in the scheduler.Subv2017-01-052-2/+13
| * | | Kernel: Remove a thread from all of its waiting objects' waiting_threads list when it is awoken.Subv2017-01-051-18/+4
| * | | Kernel: Remove Thread::wait_objects_index and use wait_objects to hold all the objects that a thread is waiting on.Subv2017-01-054-21/+22
| * | | Kernel: Use different thread statuses when a thread calls WaitSynchronization1 and WaitSynchronizationN with wait_all = true.Subv2017-01-043-16/+20
| * | | Kernel/Mutex: Propagate thread priority changes to other threads inheriting the priority via mutexesSubv2017-01-045-42/+60
| * | | Kernel/Mutex: Update a mutex priority when a thread stops waiting on it.Subv2017-01-045-24/+42
| * | | Kernel/Mutex: Implemented priority inheritance.Subv2017-01-045-31/+51
| * | | Kernel: Object ShouldWait and Acquire calls now take a thread as a parameter.Subv2017-01-0417-68/+56
| * | | Kernel/Synch: Do not attempt a reschedule on every syscall.Subv2017-01-042-2/+18
| |/ /
* | | Fix some warnings (#2399)Jonathan Hao2017-01-044-8/+6
* | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-305-0/+42
|/ /
* | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-302-2/+62
|\ \
| * | Config: auto-select region and languagewwylele2016-12-072-2/+62
* | | Core: remove unused hle.cppwwylele2016-12-271-58/+0
| |/ |/|
* | core: Move emu_window and key_map into coreMerryMage2016-12-231-1/+1
* | Service/NWM: add nwm servicesmailwl2016-12-2217-8/+301
* | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-2213-135/+108
|\ \
| * | ThreadContext: Move from "core" to "arm_interface".bunnei2016-12-222-4/+5
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-224-44/+43
| * | Address clang-format issues.bunnei2016-12-222-11/+12
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-2212-82/+53
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-225-45/+45
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-222-49/+92
|\ \ \ | |/ / |/| |
| * | csnd:SND reformat source codemailwl2016-12-122-49/+92
* | | Thread: remove the thread from the thread list when exitingwwylele2016-12-173-3/+15
* | | Kernel: remove object's waiting thread if it is deadwwylele2016-12-161-1/+2
* | | Merge pull request #2260 from Subv/schedulingbunnei2016-12-167-195/+209
|\ \ \
| * | | Fixed the codestyle to match our clang-format rules.Subv2016-12-143-27/+39
| * | | Properly remove a thread from its wait_objects' waitlist when it is awoken by a timeout.Subv2016-12-103-2/+11
| * | | WaitSynch: Removed unused variables and reduced SharedPtr copies.Subv2016-12-094-73/+56
| * | | Use boost remove_erase_if instead of the erase-remove idiomSubv2016-12-071-2/+3
| * | | Improved the algorithm for GetHighestPriorityReadyThread.Subv2016-12-071-14/+13
| * | | Threading: Added some utility functions and const correctness.Subv2016-12-043-15/+35
| * | | Threading: Reworked the way our scheduler works.Subv2016-12-047-189/+179
* | | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ \
| * | | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
* | | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-167-13/+79
|\ \ \ \ \
| * | | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-157-13/+79
* | | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ \
| * | | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-152-0/+4
|\ \ \ \ \ \
| * | | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-152-0/+4
| |/ / / / /
* / / / / / act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / /
* | | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-157-6/+38
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Service/ACT: move ACT services to foldermailwl2016-12-147-6/+38
* | | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1523-168/+586
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-1416-68/+108
| * | | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-096-47/+38
| * | | | Kernel/IPC: Small codestyle cleanupSubv2016-12-092-3/+1
| * | | | Added a framework for partially handling Session disconnections.Subv2016-12-088-9/+67
| * | | | Use std::move where appropriate.Subv2016-12-0811-177/+186
| * | | | Return an error code when connecting to a saturated port.Subv2016-12-055-7/+20
| * | | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| * | | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-056-22/+59
| * | | | Kernel: Remove the Redirection handle type.Subv2016-12-051-2/+0
| * | | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-0512-69/+86
| * | | | Declare empty ServerSession and ClientSession constructors as default.Subv2016-12-032-4/+4
| * | | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-012-3/+5
| * | | | Fixed the rebase mistakes.Subv2016-12-0110-82/+76
| * | | | A bit of a redesign.Subv2016-12-0113-263/+266
| * | | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-016-26/+21
| * | | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-014-24/+52
| * | | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-014-5/+6
| * | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-0115-86/+310
| |/ / /
* | / / Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
| |/ / |/| |
* | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
* | | Add all services to the Service namespaceLioncash2016-12-1142-473/+378
* | | Merge pull request #2291 from lioncash/svcbunnei2016-12-099-12/+59
|\ \ \
| * | | service: Add cfg:nor serviceLioncash2016-12-093-0/+47
| * | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
* | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
* | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
* | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
* | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
* | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-085-0/+86
* | | | service: Add mvd and qtm servicesLioncash2016-12-0813-0/+259
* | | | service: Add nfc servicesLioncash2016-12-087-30/+193
* | | | Merge pull request #2283 from lioncash/svcYuri Kunde Schlesner2016-12-0821-28/+212
|\ \ \ \
| * | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| * | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| * | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| * | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| * | | | nim: Update function tablesLioncash2016-12-082-0/+2
| * | | | http_c: Update function tableLioncash2016-12-081-0/+4
| * | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| * | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| * | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| * | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| * | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| * | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| * | | | act: Update function tablesLioncash2016-12-082-0/+10
| * | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
| |/ / /
* | | | Merge pull request #2281 from lioncash/appletYuri Kunde Schlesner2016-12-088-30/+22
|\ \ \ \ | |/ / / |/| | |
| * | | applet: Move common IsRunning underlying variable to the Applet classLioncash2016-12-078-28/+19
| * | | applet: Make virtual destructor defaultedLioncash2016-12-071-1/+1
| * | | applet: Make constructor protectedLioncash2016-12-071-1/+2
* | | | Update AM service function tablesLioncash2016-12-086-113/+246
| |_|/ |/| |
* | | Merge pull request #2232 from wwylele/other-savebunnei2016-12-073-2/+15
|\ \ \ | |/ / |/| |
| * | FileSys: Implement OtherSaveDatawwylele2016-11-293-0/+12
| * | FS: add missing MediaTypewwylele2016-11-291-1/+1
| * | FileSys: abstract SD save data archive sourcewwylele2016-11-291-1/+2
* | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| |/ |/|
* | Set client SDK version to Service APIsmailwl2016-11-307-13/+86
|/
* Merge pull request #2196 from Subv/system_modeYuri Kunde Schlesner2016-11-282-6/+4
|\
| * Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-202-6/+4
* | Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-285-43/+37
|\ \
| * | FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-192-6/+5
| * | PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| * | FileSys: add SDMCWriteOnlyArchivewwylele2016-11-192-0/+9
| * | FileSys: add ExtSaveDataArchivewwylele2016-11-191-0/+1
| * | FileSys: add SaveDataArchivewwylele2016-11-191-0/+7
| * | FileSys: make Archive interfaces return error codewwylele2016-11-011-32/+9
* | | Output parameters to logmailwl2016-11-251-4/+6
* | | MIC_U: Stub service funcionsmailwl2016-11-252-16/+305
* | | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
* | | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ \
| * | | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
| | |/ | |/|
* | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \
| * | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
* | | | Merge pull request #2193 from Subv/pulse_eventsbunnei2016-11-202-0/+10
|\ \ \ \
| * | | | Kernel/Events: Log an error when trying to create Pulse events and timers.Subv2016-11-192-0/+10
| | |/ / | |/| |
* / | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-195-16/+27
|/ / /
* | | Style fixmailwl2016-11-021-2/+2
* | | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
* | | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
| |/ |/|
* | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \
| * | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| |/
* | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
* | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
* | Fix typosRicardo de Almeida Gonzaga2016-10-203-3/+3
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-083-4/+1808
|\ \ | |/ |/|
| * Update the stub code of BOSSJamePeng2016-10-023-4/+1808
* | Merge pull request #1652 from wwylele/kernal-toolbunnei2016-10-057-7/+26
|\ \
| * | move ResetType to kernel.hwwylele2016-09-223-7/+6
| * | name objectswwylele2016-09-221-0/+4
| * | implement wait tree widgetwwylele2016-09-224-0/+16
| |/
* | fs: clean up log formatwwylele2016-10-021-22/+24
* | fs: implement DeleteDirectoryRecursivelywwylele2016-10-023-1/+51
|/
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-2172-72/+72
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-2182-210/+71
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-1971-362/+383
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-18132-3462/+4009
* arm: ResetContext shouldn't be part of ARM_Interface.bunnei2016-09-151-1/+17
* Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-298-97/+3007
|\ \
| * | LDR: Implement CROwwylele2016-08-278-97/+3007
| |/
* / fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-025-22/+110
|/
* Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\
| * Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
* | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
* | HLE: implement system timewwylele2016-07-232-2/+60
|/
* Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-106-37/+253
|\
| * Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| * Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| * Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| * Service::CFG: add missing languagewwylele2016-07-021-1/+2
| * Service::CFG: name sound output modeswwylele2016-07-022-2/+7
* | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-072-10/+15
|\ \
| * | Fix the errorcode of archive handleJamePeng2016-07-042-10/+15
* | | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ \
| * | | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
* | | | HLE/Applets: Implement ErrEula appletmailwl2016-07-044-0/+116
| |/ / |/| |
* | | Result: fix and update ErrorModulewwylele2016-06-301-6/+19
| |/ |/|
* | Merge pull request #1869 from wwylele/dont-be-lazyYuri Kunde Schlesner2016-06-291-2/+6
|\ \
| * | Switch context on the same thread if necessarywwylele2016-05-301-2/+6
* | | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-292-15/+125
|\ \ \
| * | | Fix parameter name in EnableNotificationmailwl2016-05-312-2/+6
| * | | Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| * | | remove ugly functionmailwl2016-05-311-35/+3
| * | | srv: Update according 3dbrewmailwl2016-05-311-15/+137
| |/ /
* | | Merge pull request #1877 from wwylele/wait-fix-timeoutbunnei2016-06-181-0/+49
|\ \ \ | |_|/ |/| |
| * | Thread: update timeout when rerunning WaitSynchwwylele2016-06-041-0/+49
| |/
* | Merge pull request #1842 from Subv/portsbunnei2016-06-127-3/+174
|\ \
| * | Kernel/SVC: Implemented svcCreatePort.Subv2016-06-116-3/+41
| * | Kernel: Added ClientPort and ServerPort classes.Subv2016-06-055-2/+135
* | | hid: add missing headerwwylele2016-06-111-0/+2
* | | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-112-35/+36
|\ \ \
| * | | fixup! fixup! Refactor input systemwwylele2016-05-151-1/+1
| * | | Refactor input subsystemwwylele2016-05-152-35/+36
* | | | service: Add other DLP servicesLioncash2016-06-059-21/+142
| |/ / |/| |
* | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-012-15/+22
| |/ |/|
* | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-3013-128/+202
|\ \
| * | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-281-1/+0
| * | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-282-13/+11
| * | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| * | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| * | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| * | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| * | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| * | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| * | APT: Remove use of Memory::GetPointerMerryMage2016-05-215-35/+36
| * | Kernel/Thread: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| * | Applets/swkdb: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
* | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \
| * | | clean up config blockwwylele2016-05-031-29/+13
* | | | Merge pull request #1855 from MerryMage/memory-headers-20160526Mat M2016-05-261-0/+1
|\ \ \ \
| * | | | Memory: Added necessary headers and removed unnecessary headerMerryMage2016-05-261-0/+1
| | |/ / | |/| |
* | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-241-2/+2
* | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-248-10/+135
|\ \ \ \
| * | | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-208-10/+135
* | | | | SVC::WaitSynchronizationN: Reschedule at the endwwylele2016-05-211-2/+3
| |/ / / |/| | |
* | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-184-0/+54
* | | | Merge pull request #1800 from JayFoxRox/set-fpscrbunnei2016-05-182-0/+5
|\ \ \ \
| * | | | Set fpscr for new threadsJannik Vogel2016-05-172-0/+5
* | | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|_|/ |/| | |
* | | | Memory: Fixed a regression caused by #1695 and #1689.Subv2016-05-141-0/+3
|/ / /
* | | Merge pull request #1689 from Subv/shmembunnei2016-05-1317-128/+415
|\ \ \
| * | | HLE/Applets: Give each applet its own block of heap memory, and use that when creating the framebuffer shared memory block.Subv2016-05-135-5/+44
| * | | Kernel: Account for automatically-allocated shared memories in the amount of used linear heap memory.Subv2016-05-131-0/+5
| * | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-133-66/+165
| * | | Kernel/SharedMemory: Log an error when Map fails.Subv2016-05-131-1/+10
| * | | Kernel: Implemented shared memory permissions.Subv2016-05-134-9/+50
| * | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
| * | | Kernel/Memory: Remove the Shared Memory region from the legacy memory map.Subv2016-05-131-1/+0
| * | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-1310-118/+147
| * | | Kernel/SVC: Fixed the register order for svcCreateMemoryBlock.Subv2016-05-132-2/+3
* | | | Merge pull request #1695 from Subv/tls_allocbunnei2016-05-134-22/+74
|\ \ \ \ | |/ / / |/| | |
| * | | Kernel/Threads: Dynamically allocate the TLS region for threads in the BASE region of the linear heap.Subv2016-05-074-22/+74
* | | | Merge pull request #1766 from Subv/log_cpubunnei2016-05-082-0/+7
|\ \ \ \
| * | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1).Subv2016-05-072-0/+7
| |/ / /
* | | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-071-2/+2
|\ \ \ \
| * | | | fixup simple type conversions where possibleAlexander Laties2016-05-071-2/+2
* | | | | Merge pull request #1761 from Subv/applets_fbbunnei2016-05-075-23/+44
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-075-23/+44
| | |_|/ | |/| |
* | | | Merge pull request #1762 from bunnei/globalbunnei2016-05-063-7/+20
|\ \ \ \
| * | | | HLE: Rename RescheduleIsPending to IsReschedulePending.bunnei2016-05-062-2/+2
| * | | | hle: Get rid of global access to g_rescheduleLioncash2016-03-213-7/+20
* | | | | Layout Mii parameters input/output, and return success as result of applet workmailwl2016-05-052-0/+49
| |/ / / |/| | |
* | | | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \ \ \
| * | | | remove duplicated function declarationwwylele2016-05-011-13/+0
| * | | | add config block 0x00170000wwylele2016-04-291-0/+4
* | | | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-302-1/+1
* | | | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \ \ \
| * | | | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
* | | | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-302-1/+29
|\ \ \ \ \ \
| * | | | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-212-1/+29
| |/ / / / /
* | | | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | return checks if event and memory createdmailwl2016-04-231-1/+8
| * | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
* | | | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-292-5/+0
* | | | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-273-59/+152
|\ \ \ \ \ \
| * | | | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| * | | | | | DSP_DSP: Add return IPC headersMerryMage2016-04-272-4/+27
| * | | | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-272-42/+106
| * | | | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
* | | | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
* | | | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \ \ \
| * | | | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|/ / / / | |/| | | | |
* | | | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
| |/ / / / / |/| | | | |
* | | | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
| |/ / / / |/| | | |
* | | | | HWRasterizer: Texture forwardingtfarley2016-04-213-24/+18
|/ / / /
* | | | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ \ \ | |_|/ / |/| | |
| * | | Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| * | | Code styleRyan Loebs2016-03-301-2/+2
| * | | Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| * | | Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| * | | But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| * | | Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| * | | Formatting...Ryan Loebs2016-03-291-1/+1
| * | | Addressing PR commentsRyan Loebs2016-03-291-4/+4
| * | | SOC UpdatesRyan Loebs2016-03-291-3/+46
* | | | core: Clean out some unnecessary header includesLioncash2016-04-162-9/+0
* | | | Set Kernel config "Unknown Value" to 0x1mailwl2016-04-112-2/+7
| |_|/ |/| |
* | | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
* | | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-083-0/+28
* | | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \ \
| * | | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| * | | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| * | | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
* | | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-064-55/+234
|\ \ \ \
| * | | | frd:u: Initial stub some functionsmailwl2016-03-274-55/+234
| | |/ / | |/| |
* | | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-062-8/+8
|\ \ \ \ | |_|/ / |/| | |
| * | | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-052-8/+8
| | |/ | |/|
* | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-033-0/+61
|\ \ \
| * | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-023-0/+61
* | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-023-3/+54
|\ \ \ \
| * | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-313-3/+54
* | | | | Merge pull request #1390 from purpasmart96/citra_gsp_error_codesbunnei2016-04-013-80/+97
|\ \ \ \ \
| * | | | | GSP: Return proper error codes for register writespurpasmart962016-03-313-80/+97
| |/ / / /
* | | | | Merge pull request #1419 from mailwl/branch-gspbunnei2016-03-311-6/+41
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueuemailwl2016-03-311-6/+41
| | |_|/ | |/| |
* / | | Add common methods to all cfg:* portsRyan Loebs2016-03-293-0/+21
|/ / /
* | | use reference instead of pointerwwylele2016-03-261-9/+9
* | | Merge pull request #1549 from wwylele/acc_gyrobunnei2016-03-264-23/+187
|\ \ \ | |/ / |/| |
| * | implement GyroscopeCalibrateParamwwylele2016-03-252-9/+20
| * | implement accel and gyro backendwwylele2016-03-224-23/+176
* | | Merge pull request #1559 from lioncash/vecbunnei2016-03-211-8/+5
|\ \ \
| * | | soc_u: Get rid of explicit delete and newLioncash2016-03-211-8/+5
| | |/ | |/|
* / | session: Make helper functions constexprLioncash2016-03-211-6/+6
|/ /
* | HLE/FS: Change the error code returned when an ExtSaveData archive is not found.Subv2016-03-201-4/+8
* | HLE/FS: Corrected some style concerns.Subv2016-03-204-6/+4
* | HLE/FS: Fixed creating the config savefile when it doesn't exist.Subv2016-03-201-1/+1
* | HLE/FS: Implemented GetFormatInfoSubv2016-03-206-48/+127
* | HLE/FS: Don't return an error when deleting the ExtSaveData if it does not exist.Subv2016-03-201-1/+1
* | HLE/FS: Return the proper error codes when opening files.Subv2016-03-201-3/+4
* | HLE/FS: Fixed the OpenDirectory error codeSubv2016-03-201-1/+1
* | HLE/FS: Return the proper error codes on file Read/Write operations.Subv2016-03-202-2/+16
* | HLE/FS: Corrected the error codes for DeleteFileSubv2016-03-201-4/+1
* | HLE/FS: Corrected the error codes for CreateFileSubv2016-03-201-1/+3
* | HLE/FS: FS::CreateFile takes an u64 for the file size.Subv2016-03-203-5/+5
|/
* Merge pull request #1505 from pippo2931/fefbunnei2016-03-181-1/+25
|\
| * Fix headerpippo29312016-03-121-1/+1
| * GetArchiveResource stubpippo29312016-03-121-1/+25
* | Reorganize the ndm service path for dummy implement functionJamePeng2016-03-145-24/+118
* | hid: fix pad updatewwylele2016-03-131-1/+1
* | svc: Move ResetType enum to the kernel event headerLioncash2016-03-1310-16/+17
* | svc: Remove unused ArbitrationType enumLioncash2016-03-121-9/+0
* | svc: Make ResetType an enum classLioncash2016-03-1211-24/+23
|/
* Merge pull request #1266 from Subv/miiappletbunnei2016-03-126-2/+154
|\
| * HLE/Applets: Implemented a dummy Mii Selector applet.Subv2016-03-126-2/+154
* | Merge pull request #1500 from lioncash/nullptrbunnei2016-03-121-1/+1
|\ \
| * | gsp_gpu: Change 0 literal to nullptrLioncash2016-03-121-1/+1
* | | hle: Update service function tablesLioncash2016-03-124-1/+16
|/ /
* | renderer_base: Don't directly expose the rasterizer unique_ptrLioncash2016-03-092-5/+5
* | DSP: Implement Pipe 2MerryMage2016-03-061-43/+151
* | Memory: Do correct Phys->Virt address translation for non-APP linheapYuri Kunde Schlesner2016-03-062-2/+5
* | Merge pull request #1455 from yuriks/ResultVal-unionMathew Maidment2016-03-061-42/+16
|\ \
| * | core: Use unrestricted union to hold storage of ResultVal valueYuri Kunde Schlesner2016-03-051-42/+16
* | | DSP: Print hash of firmware to consoleMerryMage2016-03-061-8/+21
|/ /
* | Merge pull request #1429 from mailwl/branch-acubunnei2016-03-051-2/+17
|\ \
| * | ac:u: Stub IsConnectedmailwl2016-03-041-2/+17
* | | Merge pull request #1389 from yuriks/stub-cambunnei2016-03-043-20/+563
|\ \ \ | |/ / |/| |
| * | Service/CAM: Add doxycomments to all service functionsYuri Kunde Schlesner2016-03-011-0/+217
| * | Service/CAM: Dummy implementation of some functionsYuri Kunde Schlesner2016-02-133-20/+346
* | | Merge pull request #1434 from Kloen/legendbunnei2016-03-021-0/+1
|\ \ \
| * | | ThreadProcessorId_All on SVC::CreateThreadKloen2016-03-011-0/+1
* | | | Service/CFG: Fix potential endianess issueYuri Kunde Schlesner2016-03-011-2/+3
* | | | Service/CFG: Add block 0x000A0000 (username) to default config fileYuri Kunde Schlesner2016-03-011-1/+14
|/ / /
* | | Initial implementation ir:usermailwl2016-02-263-18/+142
* | | AudioCore: Skeleton ImplementationMerryMage2016-02-213-58/+94
* | | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-127-20/+20
|/ /
* | services: Get rid of unnecessary includesLioncash2016-02-0269-132/+32
* | services: Update function tablesLioncash2016-02-022-5/+11
* | Memory: Implement MMIOMerryMage2016-01-302-4/+8
* | Merge pull request #1327 from Subv/unmap_memblockbunnei2016-01-155-5/+60
|\ \
| * | HLE/SVC: Implement UnmapMemoryBlock.Subv2016-01-145-5/+60
* | | Merge pull request #1283 from Subv/soc_fixupbunnei2016-01-051-3/+13
|\ \ \
| * | | HLE/Sockets: Fixed the buffer offset in recvfrom.Subv2015-12-241-3/+13
* | | | services: Update some function tablesLioncash2015-12-3025-113/+369
| |/ / |/| |
* | | HLE/Timers: Reset OneShot timers when they are acquired instead of when they're triggered.Subv2015-12-301-3/+3
* | | Merge pull request #1300 from Subv/arbitrateaddressbunnei2015-12-292-9/+18
|\ \ \
| * | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.Subv2015-12-282-9/+18
* | | | svc: Remove superfluous printf argumentLioncash2015-12-251-1/+1
|/ / /
* / / svc: Fix compilation with LOG_TRACE enabledLioncash2015-12-131-1/+1
|/ /
* | VideoCore: Unify interface to OpenGL and SW rasterizersYuri Kunde Schlesner2015-12-082-5/+5
* | VideoCore: Rename HWRasterizer methods to be less confusingYuri Kunde Schlesner2015-12-072-5/+5
* | Merge pull request #1252 from Subv/cambunnei2015-12-041-0/+156
|\ \ | |/ |/|
| * Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-231-0/+156
* | Kernel: Implement svcGetSystemInfoYuri Kunde Schlesner2015-12-017-1/+95
* | Merge pull request #1225 from lioncash/cleanbunnei2015-11-291-12/+13
|\ \
| * | csnd_snd: Get rid of type punningLioncash2015-10-281-12/+13
* | | Add stub functions for Initialize and GenerateRandomData in ssl:Cpolaris-2015-11-221-2/+51
| |/ |/|
* | Add Initialize and GenerateRandomData stubspolaris-2015-11-221-0/+2
|/
* Merge pull request #1165 from esoteric-programmer/masterbunnei2015-10-282-4/+66
|\
| * Added CSND stub.Matthias Ernst2015-10-282-4/+66
* | Merge pull request #1208 from archshift/free-bytesbunnei2015-10-283-1/+42
|\ \
| * | Implement FS_User::GetFreeBytesarchshift2015-10-283-1/+42
* | | Fix copy pasteFiliph Sandström2015-10-241-1/+1
* | | Fix wrong branchFiliph Sandström2015-10-231-0/+12
* | | Add GetTotalStepCount StubFiliph Sandström2015-10-231-1/+1
* | | Update ptm.hFiliph Sandström2015-10-231-0/+8
|/ /
* | Silence -Wsign-compare warnings.Rohit Nirmal2015-10-071-1/+1
* | Service/CFG: Use a constexpr function for country initializationEmmanuel Gil Peyrot2015-09-301-4/+3
* | fix some xcode 7.0 warningsMartin Lindhe2015-09-291-1/+1
* | general: Silence some warnings when using clangLioncash2015-09-165-10/+12
|/
* Service/CFG: Add default entry for block 0x000A0001 (birthday)Yuri Kunde Schlesner2015-09-141-0/+6
* Service/CFG: Correct flags in 2 default blocksYuri Kunde Schlesner2015-09-141-2/+2
* Service/CFG: Add additional blocks to default save dataYuri Kunde Schlesner2015-09-141-0/+34
* Fix narrowing conversion warningYuri Kunde Schlesner2015-09-141-1/+1
* Service/CFG: Move several private types from the header to the cppYuri Kunde Schlesner2015-09-142-63/+49
* Service/CFG: Clean up default block creationYuri Kunde Schlesner2015-09-142-27/+17
* GSP: Implement command 0x05, used for flushing cachesYuri Kunde Schlesner2015-09-142-13/+34
* General: Replace NULL and '0' usages with nullptr where applicableLioncash2015-09-111-1/+1
* General: Fix up doxygen commentsLioncash2015-09-104-7/+4
* Merge pull request #1101 from archshift/camu-service-namesbunnei2015-09-031-3/+60
|\
| * Add cam:u service function names to its function tablearchshift2015-09-031-3/+60
* | Merge pull request #1072 from yuriks/GetSystemTick-advance-timebunnei2015-09-011-1/+4
|\ \ | |/ |/|
| * SVC: Advance time when calling GetSystemTick to escape busy-wait loopsYuri Kunde Schlesner2015-08-301-1/+4
* | Kernel: Fix wrong linear heap base on titles using newer kernelsYuri Kunde Schlesner2015-08-281-1/+1
* | Kernel: Fix assertion failure when ControlMemory is called with size=0Yuri Kunde Schlesner2015-08-271-0/+8
* | Core: Improve APT Shared Font hackYuri Kunde Schlesner2015-08-273-4/+29
|/
* Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-252-0/+9
* Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-2219-88/+659
|\
| * Kernel: Remove unused legacy heap MapBlock_* functionsYuri Kunde Schlesner2015-08-162-77/+0
| * APT: Adjust shared font hack so it works with the new linear heap codeYuri Kunde Schlesner2015-08-161-10/+11
| * Kernel: Implement svcGetProcessInfo in a basic wayYuri Kunde Schlesner2015-08-165-2/+70
| * Kernel: Add more infrastructure to support different memory layoutsYuri Kunde Schlesner2015-08-168-27/+139
| * HLE: Remove empty ConfigMem and SharedPage Shutdown functionsYuri Kunde Schlesner2015-08-165-10/+0
| * Move core/mem_map.{cpp,h} => core/hle/kernel/memory.{cpp,h}Yuri Kunde Schlesner2015-08-164-2/+161
| * Memory: Move address type conversion routines to memory.cpp/hYuri Kunde Schlesner2015-08-163-3/+0
| * Process: Store kernel compatibility version during loadingYuri Kunde Schlesner2015-08-162-3/+7
| * Kernel: Properly implement ControlMemory FREE and COMMITYuri Kunde Schlesner2015-08-165-36/+338
| * VMManager: Introduce names for used ResultCodesYuri Kunde Schlesner2015-08-162-6/+11
| * VMManager: Make LogLayout log level configurable as a parameterYuri Kunde Schlesner2015-08-163-5/+15
| * VMManager: Change block offsets to size_tYuri Kunde Schlesner2015-08-162-3/+3
* | GPU: Implement TextureCopy-mode display transfersYuri Kunde Schlesner2015-08-162-11/+25
|/
* core: Eliminate some unused variable warningsLioncash2015-07-292-3/+5
* core: Fix missing prototype warningsLioncash2015-07-291-0/+1
* Merge pull request #1009 from lioncash/tableYuri Kunde Schlesner2015-07-291-1/+2
|\
| * am_net: Add missing function to the function tableLioncash2015-07-291-0/+1
| * am_net: Add correct function name to the function tableLioncash2015-07-291-1/+1
* | Merge pull request #982 from Subv/homebunnei2015-07-297-18/+84
|\ \ | |/ |/|
| * Service/APT: Fixed a regression, PreloadLibraryApplet should also start an applet when called.Subv2015-07-246-5/+36
| * Service/APT: Return proper parameters in GetLockHandle.Subv2015-07-244-14/+49
* | Merge pull request #899 from zawata/Winsock-Deprecationbunnei2015-07-281-2/+8
|\ \
| * | SOC:U : Update deprecated function gethostbyname() to getaddrinfo()zawata2015-07-201-2/+8
* | | Merge pull request #873 from jroweboy/input_arrayTony Wasserka2015-07-282-1/+14
|\ \ \
| * | | Move input values into an arrayJames Rowe2015-07-282-1/+14
* | | | dyncom: Rename armdefs.h to armstate.hLioncash2015-07-261-1/+1
|/ / /
* | | Merge pull request #888 from zawata/Warning-Fixes-2Yuri Kunde Schlesner2015-07-252-3/+3
|\ \ \
| * | | Core\HLE : Fix Warningzawata2015-07-172-3/+3
| |/ /
* | | Merge pull request #983 from yuriks/null-memory-fillYuri Kunde Schlesner2015-07-241-13/+18
|\ \ \
| * | | GSP: Don't try to write memory fill registers if start address is 0Yuri Kunde Schlesner2015-07-241-13/+18
| | |/ | |/|
* / | Qt/GPU Breakpoints: Added three more breakpoint types:Subv2015-07-231-0/+7
|/ /
* | Merge pull request #962 from Subv/am_appbunnei2015-07-223-3/+33
|\ \
| * | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.Subv2015-07-213-3/+33
* | | Merge pull request #966 from Subv/logbunnei2015-07-211-4/+8
|\ \ \
| * | | Services/Logging: Log more useful information when some operations fail.Subv2015-07-211-4/+8
| |/ /
* | | Merge pull request #957 from Subv/hwtest_crashbunnei2015-07-211-0/+8
|\ \ \
| * | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.Subv2015-07-211-0/+8
| |/ /
* | | dyncom: Pass SVC immediates directly.Lioncash2015-07-212-5/+4
* | | Services/CFG: Added some missing functions to cfg:sSubv2015-07-211-1/+3
|/ /
* | Merge pull request #939 from Subv/queryprocmembunnei2015-07-202-6/+28
|\ \
| * | Kernel/SVC: Implemented svcQueryProcessMemorySubv2015-07-172-6/+28
* | | Merge pull request #946 from archshift/update-frdubunnei2015-07-201-1/+12
|\ \ \
| * | | Add more frd:u unknown service commands from 3dbrewarchshift2015-07-191-1/+12
| |/ /
* / / Change trace/unimplemented service call logs to use hexarchshift2015-07-191-1/+1
|/ /
* | Merge pull request #938 from Subv/querymemYuri Kunde Schlesner2015-07-172-4/+24
|\ \
| * | Kernel/SVC: Implemented svcQueryMemory.Subv2015-07-172-4/+24
* | | Ensure all kernel objects are released during shutdownYuri Kunde Schlesner2015-07-1712-8/+45
|/ /
* | Archive: Correct a few incorrect types in function signaturesYuri Kunde Schlesner2015-07-141-1/+1
* | Add CiTrace recording support.Tony Wasserka2015-07-131-1/+1
* | Merge pull request #921 from linkmauve/fix-appletbunnei2015-07-127-7/+32
|\ \
| * | Core: Fix applet includes using iwyu.Emmanuel Gil Peyrot2015-07-127-7/+32
* | | Kernel: Add CodeSet case to Object::IsWaitableYuri Kunde Schlesner2015-07-121-0/+1
|/ /
* | Merge pull request #823 from Subv/applets_drawingbunnei2015-07-1210-58/+563
|\ \
| * | Applets: Reworked how the Applet update event is handled.Subv2015-07-127-35/+61
| * | Applets: Add infrastructure to allow custom drawing and input handling in Applets.Subv2015-07-127-39/+162
| * | HLE/APT: Initial HLE support for applets.Subv2015-07-128-50/+406
* | | Core: Properly configure address space when loading a binaryYuri Kunde Schlesner2015-07-125-14/+88
* | | Kernel: Remove unused member from EventYuri Kunde Schlesner2015-07-122-2/+1
|/ /
* | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-1123-66/+100
|\ \
| * | Core: Cleanup hw includes.Emmanuel Gil Peyrot2015-06-283-0/+7
| * | Core: Cleanup soc:U includes.Emmanuel Gil Peyrot2015-06-282-26/+36
| * | Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-284-8/+20
| * | Core: Cleanup core includes.Emmanuel Gil Peyrot2015-06-284-7/+5
| * | CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-283-1/+5
| * | Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-288-16/+20
| * | Services: Use the standard _WIN32 define in soc:U instead of our own EMU_PLATFORM.Emmanuel Gil Peyrot2015-06-271-8/+7
| |/
* / Services/SOC: Added command headers to some of the soc commands.Subv2015-06-251-5/+13
|/
* Add helpers to create IPC command buffer headers and descriptorsYuri Kunde Schlesner2015-06-233-7/+43
* Merge pull request #860 from yuriks/y2r-colorYuri Kunde Schlesner2015-06-222-174/+348
|\
| * Y2R: Rework conversion process, enabling support for all formatsYuri Kunde Schlesner2015-06-222-163/+309
| * Y2R: Re-organize how params are stored. Support SetConversionParamsYuri Kunde Schlesner2015-06-211-72/+100
* | Merge pull request #855 from purpasmart96/service_rearrangmentbunnei2015-06-2172-607/+1134
|\ \ | |/ |/|
| * Services: Continue separation of services into their own folderspurpasmart962015-06-1272-607/+1134
* | kernel: Fix svcWaitSynch to always acquire requested wait objects.bunnei2015-06-179-113/+68
|/
* ExtSavedata: Save the icon passed to CreateExtSaveData to the correct folder.Subv2015-06-023-11/+32
* Merge pull request #810 from yuriks/memmapYuri Kunde Schlesner2015-05-302-0/+445
|\
| * Kernel: Add VMManager to manage process address spacesYuri Kunde Schlesner2015-05-272-0/+445
* | Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-2922-65/+65
* | hid: Get rid of undefined behaviorLioncash2015-05-271-2/+2
|/
* Merge pull request #821 from Subv/ImportDisplayCaptureInfobunnei2015-05-261-1/+47
|\
| * Service/GSP: Implemented ImportDisplayCaptureInfo.Subv2015-05-261-1/+47
* | Core/SVC: Map the shared memory created in CreateMemoryBlock to the specified address.Subv2015-05-251-0/+2
|/
* y2r_u: Remove unused variable in StartConversionLioncash2015-05-231-1/+0
* Merge pull request #801 from purpasmart96/hid_stubsbunnei2015-05-234-9/+47
|\
| * HID: Stub DisableAccelerometer and DisableGyroscopeLowpurpasmart962015-05-234-9/+47
* | Flush for y2r (moflex)tfarley2015-05-231-0/+11
* | OpenGL renderertfarley2015-05-231-0/+9
|/
* Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-221-35/+265
* Kernel: Fix a warning introduced with ResourceLimit, and remove the fallback code to prevent it from happening again.Emmanuel Gil Peyrot2015-05-211-2/+1
* y2r_u: Stub StartConversion to prevent moflex games from hanging.bunnei2015-05-211-1/+17
* Kernel: Move reschedules from SVCs to actual mechanisms that reschedule.bunnei2015-05-217-20/+22
* Merge pull request #766 from purpasmart96/cfg_service_updatebunnei2015-05-185-337/+304
|\
| * CFG: Update the cfg service to be like other integrated servicespurpasmart962015-05-165-337/+304
* | Merge pull request #772 from lioncash/warnbunnei2015-05-181-3/+3
|\ \
| * | process: Get rid of warningsLioncash2015-05-141-3/+3
| |/
* | Implement svcBreakarchshift2015-05-172-1/+17
* | Merge pull request #781 from archshift/deletebunnei2015-05-161-33/+0
|\ \
| * | Delete unused hle/coprocessor.cpparchshift2015-05-161-33/+0
* | | APT/FS: Remove asserts that were causing false positivespurpasmart962015-05-162-5/+5
|/ /
* | Core/ResourceLimits: Implemented the basic structure of ResourceLimits.Subv2015-05-158-14/+326
* | Memory: Read SharedPage directly from Memory::ReadYuri Kunde Schlesner2015-05-152-58/+35
* | Memory: Read ConfigMem directly from Memory::ReadYuri Kunde Schlesner2015-05-152-49/+36
* | Memmap: Re-organize memory function in two filesYuri Kunde Schlesner2015-05-1511-12/+12
* | thread: Fix a conditional check in RescheduleLioncash2015-05-141-1/+1
|/
* Merge pull request #756 from purpasmart96/ptm_service_changesbunnei2015-05-135-125/+112
|\
| * PTM: Changed the way the ptm services are handled to be like thepurpasmart962015-05-125-125/+112
* | Merge pull request #748 from Subv/tls_maxbunnei2015-05-123-7/+19
|\ \
| * | Core/Memory: Add TLS support for creating up to 300 threadsSubv2015-05-123-7/+19
* | | Merge pull request #751 from yuriks/idle-threadbunnei2015-05-122-44/+19
|\ \ \
| * | | Thread: Remove the idle threadYuri Kunde Schlesner2015-05-122-44/+19
* | | | Merge pull request #757 from Subv/schedulingbunnei2015-05-121-0/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | Core/Scheduling: Prepare the new priority in the thread queue when svcSetPriority is calledSubv2015-05-121-0/+2
| |/ /
* | | Merge pull request #750 from Subv/process_svcYuri Kunde Schlesner2015-05-126-4/+46
|\ \ \ | |_|/ |/| |
| * | fixup!Subv2015-05-123-16/+12
| * | Core/HLE: Implemented the SVCs GetProcessId and GetProcessIdOfThreadSubv2015-05-116-4/+50
* | | NWM_UDS: Fix a typo in the nwm service port namepurpasmart962015-05-121-1/+1
| |/ |/|
* | Thread: Correctly set main thread initial stack positionYuri Kunde Schlesner2015-05-113-5/+4
|/
* Merge pull request #740 from yuriks/gsp-shmemarchshift2015-05-117-34/+67
|\
| * fixup! GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-1/+1
| * GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-9/+11
| * Kernel: Zero-fill shared memory blocks when mappingYuri Kunde Schlesner2015-05-111-0/+8
| * Kernel: Capture SharedMemory attributes at creation, not when mappingYuri Kunde Schlesner2015-05-117-28/+51
* | fixup! Set the TLS address in the schedulerSubv2015-05-112-2/+7
* | Core/Memory: Give every emulated thread it's own TLS area.Subv2015-05-113-4/+22
|/
* Common: Remove the BIT macroYuri Kunde Schlesner2015-05-091-2/+2
* Memory: Re-organize and rename memory area address constantsYuri Kunde Schlesner2015-05-093-4/+5
* Kernel: Remove unused g_main_thread variableYuri Kunde Schlesner2015-05-093-5/+1
* Process: Rename StaticAddressMapping => AddressMappingYuri Kunde Schlesner2015-05-092-5/+5
* Process: Add more documentation to the class membersYuri Kunde Schlesner2015-05-091-2/+16
* Process: Use BitField to store process flagsYuri Kunde Schlesner2015-05-092-16/+24
* Process: Support parsing of exheader kernel capsYuri Kunde Schlesner2015-05-092-4/+72
* Kernel: Remove g_program_idYuri Kunde Schlesner2015-05-092-8/+0
* Kernel: Introduce skeleton Process class to hold process dataYuri Kunde Schlesner2015-05-094-19/+101
* Fix printf format warningYuri Kunde Schlesner2015-05-071-1/+1
* Common: Remove common.hYuri Kunde Schlesner2015-05-0732-18/+48
* Clean-up includesYuri Kunde Schlesner2015-05-072-2/+7
* FileSys: De-inline Path membersYuri Kunde Schlesner2015-05-071-0/+2
* FileSys: Clean-up includes, de-inline destructorsYuri Kunde Schlesner2015-05-074-13/+21
* Move typedefs from kernel.h to more appropriate placesYuri Kunde Schlesner2015-05-072-10/+8
* HLE: Clean up SVC dispatch mechanismYuri Kunde Schlesner2015-05-064-77/+38
* HLE: Properly initialize and shutdown remaining modules.bunnei2015-05-025-3/+20
* Kernel: Properly initialize and shutdown all modules.bunnei2015-05-024-9/+20
* Services: Initialize all state variables at bootup.bunnei2015-05-028-22/+38
* ConfigMem: Remove duplicate retail bitpurpasmart962015-04-291-1/+0
* Merge pull request #692 from purpasmart96/log_improvementsbunnei2015-04-282-8/+22
|\
| * Services/Loader: Use more sensible log formats for certain functionspurpasmart962015-04-282-8/+22
* | ptm_sysm: Add static specifier to IsLegacyPowerOffLioncash2015-04-251-1/+1
* | Merge pull request #696 from yuriks/interface-deinlinebunnei2015-04-153-50/+49
|\ \
| * | De-inline functions from Interface, removing them from service.hYuri Kunde Schlesner2015-04-143-50/+49
* | | Kernel: Use the correct format string for u64 hex.Emmanuel Gil Peyrot2015-04-141-1/+1
|/ /
* | SVC: Assert on unsupported CreateThread processor ID.bunnei2015-04-101-3/+9
* | SVC: Update various SVCs to cause a reschedule.bunnei2015-04-102-6/+22
* | Kernel: Implemented priority inheritance for mutexes.bunnei2015-04-103-4/+22
* | Thread: Implement priority boost for starved threads.bunnei2015-04-104-28/+74
* | SVC: Reschedule on svcCreateThread.bunnei2015-04-101-0/+2
* | APT: (Subv) Fix bug where start event was being incorrectly signaled.bunnei2015-04-101-6/+7
* | Kernel: Fixed default thread priority.bunnei2015-04-102-5/+4
* | Initialize base address to 0x0Gareth Higgins2015-04-091-0/+1
|/
* Merge pull request #676 from purpasmart96/ir_service_refcbunnei2015-04-0810-55/+180
|\
| * IR: Move The IR services to their own folder and implement "GetHandles"purpasmart962015-04-0410-55/+180
* | Clean-up mem_map constants and fix framebuffer translation errorsYuri Kunde Schlesner2015-04-061-4/+6
|/
* Merge pull request #641 from purpasmart96/service_stubsbunnei2015-04-0416-67/+402
|\
| * Services: Stubs and minor changespurpasmart962015-04-0316-67/+402
* | ConfigMem: Set the app memory to be 96MB instead of the default 64MBpurpasmart962015-03-241-2/+2
|/
* Merge pull request #656 from Subv/nzbunnei2015-03-223-24/+189
|\
| * Service/FS: Document and log some unknown values.Subv2015-03-191-1/+26
| * Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and DeleteSystemSaveDataSubv2015-03-143-24/+164
* | Merge pull request #655 from purpasmart96/hid_fixesbunnei2015-03-174-12/+72
|\ \
| * | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow alongpurpasmart962015-03-174-12/+72
| |/
* / arm_interface: Get rid of GetTicks.Lioncash2015-03-162-5/+6
|/
* Merge pull request #642 from bunnei/touchpadbunnei2015-03-123-130/+136
|\
| * hid_user: Removed unnecessary includes.bunnei2015-03-111-2/+0
| * HID: Removed unnecessary global variables.bunnei2015-03-112-58/+42
| * HID: Added additional variable comments and some code cleanups.bunnei2015-03-112-20/+29
| * HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-112-111/+28
| * HID: Cleanup how `next_touch_index` is calculated for Pad and touch.bunnei2015-03-101-2/+2
| * HID: Changed TouchDataEntry `valid` to a BitField and added some doc strings.bunnei2015-03-102-4/+4
| * HID: Added static asserts to check register position in shared memory.bunnei2015-03-101-2/+16
| * HID: Added functions to emulate the touchpad.bunnei2015-03-102-0/+61
| * HID: Moved some docstrings to the header.bunnei2015-03-102-24/+16
| * HID: Refactored shared memory decoding for touchpad support.bunnei2015-03-102-33/+64
* | Merge pull request #629 from archshift/lcdfbbunnei2015-03-101-6/+38
|\ \ | |/ |/|
| * Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-091-17/+15
| * Implement SetLcdForceBlack, move register enum to hw.harchshift2015-03-061-5/+39
* | Merge pull request #589 from kevinhartman/config-errorsbunnei2015-03-091-5/+10
|\ \
| * | Fix error message for bad config block request.Kevin Hartman2015-02-211-5/+10
* | | Merge pull request #538 from yuriks/perf-statTony Wasserka2015-03-071-0/+6
|\ \ \ | |_|/ |/| |
| * | Add profiling infrastructure and widgetYuri Kunde Schlesner2015-03-021-0/+6
* | | Services: Moved the PTM and APT services to their own folderSubv2015-03-0439-1098/+1186
* | | Merge pull request #622 from Subv/titlesYuri Kunde Schlesner2015-03-021-8/+45
|\ \ \
| * | | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.Subv2015-03-021-8/+45
| |/ /
* | | Merge pull request #623 from Subv/cardbunnei2015-03-021-1/+25
|\ \ \
| * | | Services/FS: Stubbed CardSlotIsInserted to always return falseSubv2015-03-011-1/+25
| |/ /
* | | Merge pull request #618 from lioncash/refbunnei2015-03-021-2/+2
|\ \ \
| * | | result: Make comparison operators take referencesLioncash2015-02-281-2/+2
| |/ /
* / / Services/PTM: Stubbed PTM_Sysm::IsLegacyPowerOff.Subv2015-03-011-1/+13
|/ /
* | Merge pull request #604 from Subv/arc_ssdYuri Kunde Schlesner2015-02-262-26/+42
|\ \
| * | Archives: Properly implemented the SystemSaveData archive.Subv2015-02-262-26/+42
* | | Services: Implemented Y2R_U::GetTransferEndEventSubv2015-02-241-1/+18
|/ /
* | Merge pull request #595 from linkmauve/new-3ds-inputbunnei2015-02-241-0/+19
|\ \
| * | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.Emmanuel Gil Peyrot2015-02-221-0/+19
* | | Merge pull request #581 from archshift/tfebunnei2015-02-231-1/+164
|\ \ \ | |/ / |/| |
| * | Added information reporting from ThrowFatalErrorarchshift2015-02-221-1/+164
* | | Merge pull request #588 from archshift/somebranchbunnei2015-02-201-2/+3
|\ \ \ | |_|/ |/| |
| * | Misc cleanup of common and related functionsarchshift2015-02-201-2/+3
| |/
* / Convert a few C stdlib asserts to Citra's own assertsarchshift2015-02-191-6/+4
|/
* GPU: Properly implement memory fills.Tony Wasserka2015-02-182-17/+21
* Merge pull request #570 from purpasmart96/config_membunnei2015-02-184-50/+58
|\
| * ConfigMem: Clean up the Config memory to be more like the shared page and movedpurpasmart962015-02-174-50/+58
* | Services: Fixed "Tried to connect to named port err:f".Subv2015-02-161-1/+1
* | Merge pull request #529 from Subv/masterbunnei2015-02-146-40/+56
|\ \
| * | Build: Fixed some warningsSubv2015-02-126-40/+56
| |/
* / core: Apply static to local functionsLioncash2015-02-135-17/+18
|/
* Implemented WriteHWRegsWithMask for GSP.Kevin Hartman2015-02-111-6/+91
* Asserts: break/crash program, fit to style guide; log.h->assert.harchshift2015-02-1154-72/+27
* GSP: Fixed typo in SignalInterruptbunnei2015-02-111-1/+1
* Merge pull request #552 from bunnei/setbufferswap-fixbunnei2015-02-111-4/+3
|\
| * GSP: Call SetBufferSwap for each screen on corresponding signal interrupt.bunnei2015-02-111-4/+3
* | Merge pull request #526 from purpasmart96/citra_stubsbunnei2015-02-113-8/+188
|\ \
| * | Services: Stub some functionspurpasmart962015-02-083-8/+188
* | | PTM: Fixed a problem with the gamecoin PTM file.Subv2015-02-101-21/+13
* | | Archives: Made the Format function more generic.Subv2015-02-103-9/+10
* | | Archives: Expose the File and Directory classes to HLESubv2015-02-103-58/+62
* | | ResultVal: Fixed compilation when reassigning a ResultVal.Subv2015-02-101-3/+3
* | | FS: Allow multiple instances of the same archive type to be open at onceYuri Kunde Schlesner2015-02-103-29/+35
* | | FS: Get rid of completely useless Archive classYuri Kunde Schlesner2015-02-101-36/+26
* | | Scheduler refactor Pt. 1Kevin Hartman2015-02-104-228/+267
| |/ |/|
* | Mutex: Locks should be recursive.bunnei2015-02-102-16/+20
* | WaitSynch: Always reschedule (verified behavior on hw).bunnei2015-02-101-4/+4
* | core: Fix some warnings on OSXLioncash2015-02-031-1/+0
* | Kernel: Stop creating useless Handles during object creationYuri Kunde Schlesner2015-02-0218-57/+41
* | Kernel: Make WaitObjects share ownership of Threads waiting on themYuri Kunde Schlesner2015-02-026-12/+17
* | Explicitly instantiate constructors/destructors for Kernel objectsYuri Kunde Schlesner2015-02-0216-8/+50
* | Mutex: Replace g_mutex_held_locks with a set inside ThreadYuri Kunde Schlesner2015-02-023-23/+18
* | HID: Fix crash when pressing a key when the emulator is stoppedYuri Kunde Schlesner2015-02-021-0/+2
* | SVC: Enable CloseHandle, clean up DuplicateHandleYuri Kunde Schlesner2015-02-021-9/+5
* | Kernel: Fix bug in HandleTable::CloseYuri Kunde Schlesner2015-02-021-1/+1
* | Kernel: Remove Object::GetHandle (it's not used anymore :D)Yuri Kunde Schlesner2015-02-022-9/+1
* | Kernel: Introduce unique Object ids for debuggingYuri Kunde Schlesner2015-02-024-8/+16
* | Kernel: Use separate Handle tables for CoreTiming userdataYuri Kunde Schlesner2015-02-024-18/+25
* | Kernel: Remove previous scheduled event when a Timer is re-SetYuri Kunde Schlesner2015-02-021-0/+3
* | FS: Remove use of GetHandleYuri Kunde Schlesner2015-02-021-1/+1
* | Thread: Modernize two functions that slipped through previous rebasesYuri Kunde Schlesner2015-02-024-18/+16
* | Service: Store function names as const char* instead of std::stringYuri Kunde Schlesner2015-02-021-6/+6
* | Service: Clean-up InterfaceYuri Kunde Schlesner2015-02-0246-67/+54
* | Make Port/Service registration and querying more HW-accurateYuri Kunde Schlesner2015-02-024-106/+80
* | Filesys: Move creation of Handles for File/Directory to service handlersYuri Kunde Schlesner2015-02-023-32/+33
* | arm: Clean up ARMul_StateLioncash2015-02-011-1/+1
* | Merge pull request #512 from lioncash/assignmentTony Wasserka2015-01-312-4/+4
|\ \ | |/ |/|
| * shared_memory: Fix assignments in SharedMemory::MapLioncash2015-01-302-4/+4
* | archive: Fix initializer list order for the File class.Lioncash2015-01-301-1/+1
* | apt_u: Fix missing printf specifiersLioncash2015-01-301-2/+2
|/
* Kernel: Mark all appropriate kernel objects as "final"Yuri Kunde Schlesner2015-01-307-8/+7
* SVC: Use CASCADE_RESULT in SVC handlersYuri Kunde Schlesner2015-01-302-77/+32
* Remove result.h InvalidHandleYuri Kunde Schlesner2015-01-304-30/+32
* SVC: Change return type of handlers to ResultCodeYuri Kunde Schlesner2015-01-302-132/+127
* Kernel: Convert Event to not use HandlesYuri Kunde Schlesner2015-01-3010-152/+151
* Kernel: Convert Timer to (mostly) not use HandlesYuri Kunde Schlesner2015-01-303-111/+112
* Kernel: Convert Mutex to not use HandlesYuri Kunde Schlesner2015-01-305-114/+110
* Kernel: Convert AddressArbiter to not use HandlesYuri Kunde Schlesner2015-01-303-38/+55
* Kernel: Convert Semaphore to not use HandlesYuri Kunde Schlesner2015-01-303-67/+88
* Kernel: Convert SharedMemory to not use HandlesYuri Kunde Schlesner2015-01-308-102/+107
* Additions to ResultVal to make it more convenient to use.Yuri Kunde Schlesner2015-01-301-1/+25
* Move VAddr/PAddr typedefs to kernel.hYuri Kunde Schlesner2015-01-301-0/+5
* Kernel: Remove useless/duplicated comments; mark functions staticYuri Kunde Schlesner2015-01-306-32/+8
* Merge pull request #412 from purpasmart96/svc_table_cleanupbunnei2015-01-281-7/+7
|\
| * SVC: Update the SVC function tablepurpasmart962015-01-271-7/+7
* | Merge pull request #345 from purpasmart96/apt_stubsbunnei2015-01-271-91/+276
|\ \
| * | APT_U: Stub some functions & misc changespurpasmart962015-01-231-91/+276
* | | Merge pull request #485 from Subv/more_servsbunnei2015-01-2618-1/+393
|\ \ \
| * | | Services/HID: Removed some files due to a rebase errorSubv2015-01-243-267/+0
| * | | Services: Stubbed more services.Subv2015-01-2421-1/+660
* | | | cam_u.h: fix indentationarchshift2015-01-221-2/+2
|/ / /
* | | Merge pull request #493 from archshift/ptmplaybunnei2015-01-225-0/+102
|\ \ \
| * | | Stubbed cam:u servicearchshift2015-01-213-0/+49
| * | | Stubbed ptm:play servicearchshift2015-01-213-0/+53
* | | | WaitSynchronization: Added a result code for invalid result, fixed bug.bunnei2015-01-221-3/+9
* | | | Thread: Fix WaitSynchronization1 to not set register 1 on thread wakeup.bunnei2015-01-223-25/+45
* | | | Thread: Use std::find in CheckWait_WaitObject.bunnei2015-01-221-4/+5
* | | | Mutex: Cleanup and remove redundant code.bunnei2015-01-223-47/+29
* | | | Kernel: Renamed some functions for clarity.bunnei2015-01-227-10/+10
* | | | Kernel: Changed "ShouldWait" to return bool and "Acquire" to return void.bunnei2015-01-229-71/+42
* | | | WaitObject: Renamed "Wait" to "ShouldWait", made "ShouldWait" and "Acquire" pure virtual.bunnei2015-01-229-23/+22
* | | | Event: Fix implementation of "non-sticky" events.bunnei2015-01-221-0/+4
* | | | Session: Change to a WaitObject.bunnei2015-01-223-2/+9
* | | | Kernel: Reschedule on SignalEvent and SendSyncRequest, fix some bugs.bunnei2015-01-222-1/+2
* | | | Mutex: Fix a bug where the thread should not wait if it already has the mutex.bunnei2015-01-221-1/+4
* | | | Kernel: Moved Wait and Acquire to WaitObject, added way to retrieve a WaitObject safely.bunnei2015-01-224-20/+59
* | | | SVC: Removed a Sleep that made no sensebunnei2015-01-221-6/+1
* | | | AddressArbiter: Changed to Kernel::Object, big cleanup, removed code that made no sense.bunnei2015-01-225-38/+45
* | | | Kernel: Get rid of WaitTypes and simplify lots of code, removing hacks.bunnei2015-01-229-122/+63
* | | | WaitSynchronizationN: Improved commentsbunnei2015-01-221-7/+12
* | | | WaitSynchronizationN: Refactor to fix several bugsbunnei2015-01-228-79/+76
* | | | Kernel: Separate WaitSynchronization into Wait and Acquire methods.bunnei2015-01-228-18/+59
* | | | WaitSynchronizationN: Handle case where handles=nullptr.bunnei2015-01-221-0/+4
* | | | WaitSynchronizationN: Handle case where handle_count is invalid.bunnei2015-01-221-3/+7
* | | | WaitSynchronizationN: Handle case where handle_count=0.bunnei2015-01-221-19/+29
* | | | WaitSynchronizationN: Implement return valuesbunnei2015-01-2210-83/+189
* | | | Event: Fixed some bugs and cleanup (Subv)bunnei2015-01-224-57/+16
* | | | Thread: Keep track of multiple wait objects.bunnei2015-01-223-16/+30
* | | | Event: Get rid of permanent_lock hack.bunnei2015-01-222-36/+8
* | | | WaitObject: Added RemoveWaitingThread, fixed a bug, and cleanup.bunnei2015-01-222-4/+17
* | | | Kernel: Added WaitObject and changed "waitable" objects inherit from it.bunnei2015-01-228-71/+73
* | | | Added HID_SPVR service and split HID_U implementation into service/hid/hid.xxxarchshift2015-01-219-217/+327
|/ / /
* | | core: Fix a few docstringsLioncash2015-01-204-4/+4
* | | Merge pull request #492 from archshift/aptbunnei2015-01-202-1/+4
|\ \ \
| * | | Expose GetSharedFont and NotifyToWait to APT:A and APT:S respectivelyarchshift2015-01-192-1/+4
| |/ /
* | | Merge pull request #383 from zhuowei/shared_pagebunnei2015-01-193-0/+109
|\ \ \ | |/ / |/| |
| * | Add some support for the shared page (currently 3d slider is implemented)Zhuowei Zhang2015-01-163-0/+109
* | | APT: Fix typo in setting return code for NotifyToWaitbunnei2015-01-161-1/+1
* | | DSP: Removed useless spam log for SignalInterruptbunnei2015-01-161-5/+2
* | | Merge pull request #482 from yuriks/fix-vblankbunnei2015-01-162-35/+25
|\ \ \
| * | | GSP: Fix appending of interrupts to the shared memory bufferYuri Kunde Schlesner2015-01-142-17/+12
| * | | GSP: Update framebuffer info on all interruptsYuri Kunde Schlesner2015-01-141-12/+13
| * | | GPU: Fire GPU interrupts at the correct places.Yuri Kunde Schlesner2015-01-141-6/+0
* | | | Merge pull request #481 from Subv/hm_bbunnei2015-01-151-7/+21
|\ \ \ \
| * | | | APT: Fixed the comment style in some variablesSebastian Valle2015-01-141-2/+2
| * | | | APTU: Stubbed NotifyToWait, taken from 3dmoo.Subv2015-01-141-7/+21
| |/ / /
* | | | Merge pull request #480 from Subv/arb_2bunnei2015-01-143-4/+21
|\ \ \ \ | |/ / / |/| | |
| * | | AddrArbiter: Implement arbitration types 3 and 4.Subv2015-01-133-4/+21
| | |/ | |/|