summaryrefslogtreecommitdiffstats
path: root/src/core/hle/service (follow)
Commit message (Expand)AuthorAgeFilesLines
* Merge pull request #6374 from Morph1984/swkbd-textcheck-encodingMai M2021-05-301-10/+15
|\
| * applets/swkbd: Make use of std::move where applicableMorph2021-05-281-8/+8
| * applets/swkbd: Only read the text check message on Failure/ConfirmMorph2021-05-281-2/+7
* | Merge pull request #6364 from german77/stub-lp2pMai M2021-05-301-0/+141
|\ \
| * | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkServicegerman772021-05-261-0/+141
| |/
* | Merge pull request #6356 from ogniK5377/ApplyNpadSystemCommonPolicybunnei2021-05-281-1/+10
|\ \ | |/ |/|
| * hid: ApplyNpadSystemCommonPolicyChloe Marcec2021-05-241-1/+10
* | Merge pull request #6331 from lioncash/gestureMorph2021-05-262-67/+79
|\ \
| * | hid/gesture: Factor out last gesture retrieval into its own functionLioncash2021-05-182-14/+23
| * | hid/gesture: Ensure all ID arrays are initializedLioncash2021-05-181-4/+4
| * | hid/gesture: Make Point a templateLioncash2021-05-182-38/+46
| * | hid/gesture: Replace x,y members of GestureState with a PointLioncash2021-05-182-6/+4
| * | hid/gesture: Add default comparators to PointLioncash2021-05-182-10/+7
| * | hid/gesture: Rename Points to PointLioncash2021-05-181-5/+5
* | | common: fs: Rework the Common Filesystem interface to make use of std::filesystem (#6270)Morph2021-05-269-95/+111
| |/ |/|
* | hle: kernel: Implement CloneCurrentObject and improve session management.bunnei2021-05-214-16/+41
* | Revert "WORKAROUND: temp. disable session resource limits while we work out issues"bunnei2021-05-211-4/+4
* | Merge pull request #6317 from ameerj/fps-fixbunnei2021-05-191-1/+0
|\ \ | |/ |/|
| * perf_stats: Rework FPS counter to be more accurateameerj2021-05-161-1/+0
* | Merge pull request #6284 from ameerj/shantae-fixbunnei2021-05-162-5/+35
|\ \
| * | nvflinger: Create layers when they are queried but not foundameerj2021-05-062-5/+35
* | | Merge pull request #6296 from lioncash/shadow-errorbunnei2021-05-1645-152/+169
|\ \ \
| * | | core: Make variable shadowing a compile-time errorLioncash2021-05-1645-152/+169
* | | | Merge pull request #6307 from Morph1984/fix-response-push-sizebunnei2021-05-162-2/+2
|\ \ \ \ | |/ / / |/| | |
| * | | nifm, ssl: Fix incorrect response sizesMorph2021-05-162-2/+2
| | |/ | |/|
* | | Merge pull request #6299 from bunnei/ipc-improvementsbunnei2021-05-167-85/+177
|\ \ \ | |/ / |/| |
| * | WORKAROUND: temp. disable session resource limits while we work out issuesbunnei2021-05-111-4/+4
| * | audrenbunnei2021-05-112-25/+16
| * | hle: service: sm: Add TIPC support.bunnei2021-05-112-41/+66
| * | hle: service: sm: GetService: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+7
| * | hle: service: Add support for dispatching TIPC requests.bunnei2021-05-112-1/+52
| * | hle: service: Implement IPC::CommandType::Close.bunnei2021-05-112-9/+13
| * | hle: service: sm: Use RegisterNamedService to register the service.bunnei2021-05-111-1/+1
| * | hle: service: sm: Improve Initialize implementation.bunnei2021-05-112-0/+3
| * | hle: kernel: Implement named service ports using service interface factory.bunnei2021-05-112-5/+8
| * | hle: kernel: KSession: Improve implementation of CloneCurrentObject.bunnei2021-05-111-2/+10
| * | hle: service: sm: Increase point buffer size.bunnei2021-05-111-1/+1
* | | ssl: Stub Import(Client/Server)PkiMorph2021-05-131-2/+40
* | | Merge pull request #6267 from german77/gestureRewriteMorph2021-05-122-76/+340
|\ \ \ | |/ / |/| |
| * | hid: Improve hardware accuracy of gesturesgerman772021-05-052-76/+340
* | | Merge pull request #6266 from bunnei/kautoobject-refactorbunnei2021-05-0861-462/+426
|\ \ \
| * | | fixup! hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-061-2/+2
| * | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| * | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| * | | common: Rename NON_COPYABLE/NON_MOVABLE with YUZU_ prefix.bunnei2021-05-061-2/+2
| * | | hle: kernel: Rename Process to KProcess.bunnei2021-05-0616-25/+26
| * | | hle: kernel: Remove deprecated Object class.bunnei2021-05-068-8/+2
| * | | hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-063-26/+27
| * | | hle: kernel: Migrate KServerPort to KAutoObject.bunnei2021-05-063-13/+12
| * | | hle: kernel: Migrate KClientPort to KAutoObject.bunnei2021-05-066-12/+16
| * | | hle: kernel: Migrate KTransferMemory to KAutoObject.bunnei2021-05-063-13/+15
| * | | hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-068-28/+16
| * | | hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-0626-93/+86
| * | | hle: kernel: Refactor several threads/events/sharedmemory to use slab heaps.bunnei2021-05-064-7/+11
| * | | hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-0618-0/+47
| * | | hle: kernel: Migrate KEvent to KAutoObject.bunnei2021-05-0631-247/+213
| * | | hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-067-42/+12
| * | | hle: kernel: Migrate KProcess to KAutoObject.bunnei2021-05-061-7/+5
| * | | hle: kernel: Refactor IPC interfaces to not use std::shared_ptr.bunnei2021-05-0622-32/+33
| * | | hle: kernel: Refactor out various KThread std::shared_ptr usage.bunnei2021-05-061-4/+4
| | |/ | |/|
* | | Merge pull request #6287 from lioncash/ldr-copybunnei2021-05-071-5/+3
|\ \ \ | |/ / |/| |
| * | ldr: Simplify memory copy within LoadNro()Lioncash2021-05-071-5/+3
* | | Merge pull request #6279 from ogniK5377/nvhost-profbunnei2021-05-061-3/+14
|\ \ \ | |/ / |/| |
| * | Update src/core/hle/service/nvdrv/interface.cppbunnei2021-05-061-1/+1
| * | nvdrv: /dev/nvhost-prof-gpu for productionChloe Marcec2021-05-031-3/+14
* | | service: Remove unused class variablesLioncash2021-05-053-7/+4
| |/ |/|
* | service: Resolve cases of member field shadowingLioncash2021-05-0456-101/+103
|/
* hid: Fix touch not initializing properly if disabledgerman772021-05-032-2/+10
* Merge pull request #6265 from Morph1984/snap-save-fixbunnei2021-05-021-2/+7
|\
| * service: filesystem: Return proper error codes for CreateFileMorph2021-05-011-2/+7
* | Disable touch if setting is not enabledgerman772021-05-012-2/+2
|/
* Merge pull request #6226 from german77/sevensixbunnei2021-04-305-12/+194
|\
| * address commentsgerman772021-04-272-5/+5
| * hid: Implement SevenSixAxis and ConsoleSixAxisSensorgerman772021-04-245-12/+194
* | service: Eliminate cases of member shadowingLioncash2021-04-2615-76/+81
* | nvhost_vic: Fix device closureameerj2021-04-252-10/+8
* | Merge pull request #6234 from Morph1984/stub-amMat M2021-04-242-1/+10
|\ \
| * | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabledMorph2021-04-242-1/+10
* | | Merge pull request #6235 from german77/ectx_awMat M2021-04-243-0/+47
|\ \ \
| * | | glue: Add ectx:aw placeholdergerman772021-04-243-0/+47
| | |/ | |/|
* | | Merge pull request #6228 from lioncash/semibunnei2021-04-241-6/+7
|\ \ \ | |_|/ |/| |
| * | lm: Make use of insert_or_assign() in Log()Lioncash2021-04-231-1/+1
| * | lm: Prevent redundant map lookups in Log()Lioncash2021-04-231-4/+5
| * | lm: Resolve -Wextra-semi warningLioncash2021-04-231-1/+1
* | | Merge pull request #6229 from lioncash/unused-varbunnei2021-04-242-6/+0
|\ \ \ | |_|/ |/| |
| * | acc/lbl: Remove unused variablesLioncash2021-04-232-6/+0
| |/
* / service: hid: Get transfer memory for InitializeSevenSixAxisSensorMorph2021-04-221-1/+38
|/
* Merge pull request #6214 from Morph1984/time-fix-kirby-clashbunnei2021-04-211-3/+5
|\
| * time: Write buffer before pushing RESULT_SUCCESS in GetClockSnapshotMorph2021-04-191-1/+2
| * time: Fix GetClockSnapshotFromSystemClockContextMorph2021-04-191-2/+3
* | Merge pull request #6217 from Morph1984/consistent-writebuffersbunnei2021-04-203-5/+12
|\ \
| * | general: Write buffers before pushing raw argumentsMorph2021-04-193-5/+12
| |/
* | Merge pull request #6215 from lioncash/duplicatebunnei2021-04-202-2/+1
|\ \
| * | npad: Remove duplicated class member variableLioncash2021-04-192-2/+1
| |/
* | arp: Use type alias for issue functionLioncash2021-04-191-4/+4
* | arp: Prevent uninitialized read of launch member variableLioncash2021-04-191-1/+1
|/
* applets: Send focus state change message on applet state changeMorph2021-04-1710-22/+56
* applets: Make the applet mode a protected property of AppletMorph2021-04-1714-22/+20
* Merge pull request #6125 from ogniK5377/nvdec-close-devbunnei2021-04-171-6/+4
|\
| * nvdrv: Cleanup CDMA Processor on device closureChloe Marcec2021-03-301-6/+4
* | applets/swkbd: Implement the Normal and Inline Software Keyboard AppletMorph2021-04-153-13/+1487
* | ILibraryAppletCreator: Implement CreateHandleStorageMorph2021-04-152-6/+64
* | ILibraryAppletAccessor: Demote from ERROR to DEBUG for null storage logsMorph2021-04-151-2/+2
* | applets: Pass in the LibraryAppletMode each applet's constructorMorph2021-04-1513-33/+58
* | applets: Remove the previous software keyboard applet implementationMorph2021-04-152-227/+6
* | common: Move settings to common from core.bunnei2021-04-1527-27/+27
* | Merge pull request #6170 from Morph1984/more-time-fixesbunnei2021-04-116-21/+38
|\ \
| * | service: time: Setup the network clock with the local clock contextMorph2021-04-086-21/+38
* | | Merge pull request #6167 from Morph1984/time-fixbunnei2021-04-111-3/+8
|\ \ \
| * | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUserMorph2021-04-081-3/+8
* | | | Merge pull request #6112 from ogniK5377/pctlbunnei2021-04-114-31/+244
|\ \ \ \
| * | | | Addressed issuesChloe Marcec2021-03-302-21/+22
| * | | | pctl: Rework how pctl works to be more accurateChloe Marcec2021-03-264-31/+243
* | | | | Merge pull request #6171 from german77/servicesbunnei2021-04-1030-97/+137
|\ \ \ \ \
| * | | | | wlan: Update to 12.xgerman772021-04-091-0/+7
| * | | | | usb: Use proper namesgerman772021-04-091-21/+21
| * | | | | ITimeZoneService: Update to 12.xgerman772021-04-091-0/+1
| * | | | | spl: Update to 12.xgerman772021-04-091-0/+3
| * | | | | sfdnsres: Use proper namesgerman772021-04-091-2/+2
| * | | | | nsd: Update to 12.xgerman772021-04-091-0/+1
| * | | | | ethc: Update to 12.xgerman772021-04-091-0/+1
| * | | | | sm: Use proper names, update to 12.xgerman772021-04-091-4/+5
| * | | | | set_sys: Update to 12.xgerman772021-04-091-0/+6
| * | | | | pctl_module: Update to 12.xgerman772021-04-091-0/+3
| * | | | | pcie: Use proper namesgerman772021-04-091-1/+1
| * | | | | olsc: Update to 12.xgerman772021-04-091-0/+1
| * | | | | pl_u: Update to 12.xgerman772021-04-091-0/+4
| * | | | | ldr: Use proper namesgerman772021-04-091-16/+16
| * | | | | arp: Use proper names, update to 12.xgerman772021-04-092-3/+10
| * | | | | caps_u: Update to 12.xgerman772021-04-091-0/+1
| * | | | | caps_a: Update to 12.xgerman772021-04-091-0/+1
| * | | | | bpc: Use proper namesgerman772021-04-091-2/+2
| * | | | | bcat_module: Update to 12.xgerman772021-04-091-0/+2
| * | | | | codecctl: Use proper namesgerman772021-04-091-13/+13
| * | | | | audren_u: Use proper namesgerman772021-04-092-4/+4
| * | | | | audren_a: Use proper namesgerman772021-04-091-6/+6
| * | | | | audrec_u: Use proper names, update to 12.xgerman772021-04-091-3/+4
| * | | | | audrec_a: Use proper namesgerman772021-04-091-2/+2
| * | | | | audout_u: Use proper namesgerman772021-04-091-3/+3
| * | | | | audout_a: Use proper namesgerman772021-04-091-6/+6
| * | | | | audin_u: Use proper namesgerman772021-04-091-7/+7
| * | | | | audin_a: Use proper namesgerman772021-04-091-4/+4
* | | | | | Merge pull request #6113 from german77/playhistorybunnei2021-04-101-1/+13
|\ \ \ \ \ \
| * | | | | | Friend: Stub GetPlayHistoryRegistrationKeygerman772021-03-271-1/+13
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #6158 from german77/hidServiceTablesbunnei2021-04-102-0/+85
|\ \ \ \ \ \
| * | | | | | hid: Update service function tablesgerman772021-04-072-0/+85
* | | | | | | ns: Update to 12.xMorph2021-04-091-3/+38
* | | | | | | aoc_u: Update to 12.xMorph2021-04-091-0/+2
* | | | | | | nim: Update to 12.xMorph2021-04-091-44/+55
* | | | | | | npns: Update to 12.xMorph2021-04-091-0/+3
* | | | | | | bgtc: Update to 12.x and implement OpenTaskServiceMorph2021-04-092-1/+34
* | | | | | | vi: Update to 12.xMorph2021-04-091-0/+8
* | | | | | | erpt: Update to 12.xMorph2021-04-091-1/+6
* | | | | | | btm: Update to 12.xMorph2021-04-091-0/+1
* | | | | | | btdrv: Update to 12.xMorph2021-04-091-0/+19
* | | | | | | Merge pull request #6168 from Morph1984/stub-SetNpadAnalogStickUseCenterClampbunnei2021-04-094-1/+29
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | service: hid: Stub SetAnalogStickUseCenterClampMorph2021-04-084-1/+29
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #6157 from Morph1984/am-update-12.xbunnei2021-04-091-0/+22
|\ \ \ \ \ \
| * | | | | | ISelfController: Update to 11.xMorph2021-04-071-0/+1
| * | | | | | IApplicationFunctions: Update to 11.xMorph2021-04-071-0/+6
| * | | | | | IDebugFunctions: Update to 12.xMorph2021-04-071-0/+2
| * | | | | | ICommonStateGetter: Update to 12.xMorph2021-04-071-0/+9
| * | | | | | IGlobalStateController: Update to 12.xMorph2021-04-071-0/+1
| * | | | | | IHomeMenuFunctions: Update to 12.xMorph2021-04-071-0/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #6062 from ameerj/auto-stubbunnei2021-04-091-0/+6
|\ \ \ \ \ \
| * | | | | | configuration: Add auto stub toggle that resets on bootameerj2021-03-301-4/+6
| * | | | | | service: Auto stub fallbackameerj2021-03-301-0/+4
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #6145 from lat9nq/nvhost_empty_memcpybunnei2021-04-081-6/+11
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | nvhost_nvdec_common: Avoid memcpy with null pointerslat9nq2021-04-051-6/+11
| | |/ / / | |/| | |
* | | | | Merge pull request #6160 from Morph1984/fs-update-12.xbunnei2021-04-082-6/+15
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | IFile: Update to 12.xMorph2021-04-071-3/+7
| * | | | fsp-srv: Update to 12.xMorph2021-04-072-3/+8
| |/ / /
* | | | Merge pull request #6143 from lat9nq/nvhost_null_memcpybunnei2021-04-081-1/+7
|\ \ \ \
| * | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpylat9nq2021-04-051-1/+7
| |/ / /
* | | | Merge pull request #6159 from Morph1984/acc-update-12.xbunnei2021-04-073-36/+45
|\ \ \ \
| * | | | dauth_o: Update to 11.xMorph2021-04-071-6/+11
| * | | | acc_u1: Update to 12.xMorph2021-04-071-13/+15
| * | | | acc_su: Update to 12.xMorph2021-04-071-17/+19
| |/ / /
* / / / hwopus: Update to 12.xMorph2021-04-071-0/+4
|/ / /
* | | Merge pull request #6131 from german77/rightjoyconSLSRMorph2021-04-021-2/+6
|\ \ \
| * | | HID: Fix SL and SR buttons for right joycongerman772021-04-021-2/+6
| | |/ | |/|
* | | ISelfController: Stub SetAlbumImageTakenNotificationEnabledMorph2021-03-302-1/+17
| |/ |/|
* | Merge pull request #6109 from german77/gestureIDbunnei2021-03-302-3/+13
|\ \
| * | HID: Initialize correctly the gesture finger_id and filter invalid resultsNarr the Reg2021-03-262-3/+13
| |/
* | Merge pull request #6102 from ogniK5377/fd-passbunnei2021-03-2920-78/+161
|\ \
| * | nvdrv: Pass device fd and handle device create methods for device opening and closingChloe Marcec2021-03-2520-78/+161
| |/
* / service: friend: Change logging class from ACC to FriendMorph2021-03-271-11/+12
|/
* nvdrv: Change InitializeEx to AllocAsExChloe Marcec2021-03-222-27/+49
* Merge pull request #6052 from Morph1984/vi-getindirectlayerimagemapbunnei2021-03-201-1/+27
|\
| * IApplicationDisplayService: Stub GetIndirectLayerImageMapMorph2021-03-171-1/+27
* | Merge pull request #6056 from zkitX/spl-updatesbunnei2021-03-183-9/+178
|\ \ | |/ |/|
| * Fix casing on DeallocateAesKeySlotzkitx2021-03-111-3/+3
| * Update SPL to fit N's service refactor (4.0.0+) which split into new services.zkitx2021-03-113-9/+178
* | bsd: Avoid writing empty buffersMorph2021-03-161-2/+6
* | Merge pull request #6054 from Morph1984/time-GetClockSnapshotbunnei2021-03-141-0/+2
|\ \
| * | time: Assign the current time point to the ClockSnapshotMorph2021-03-101-0/+2
| |/
* / time: Fix CalculateSpanBetween implementationMorph2021-03-101-3/+9
|/
* Merge pull request #6007 from bunnei/ldn-errorbunnei2021-02-281-1/+1
|\
| * core: hle: ldn: Error out on call to Initialization.bunnei2021-02-271-1/+1
* | Merge pull request #5276 from german77/gesturesMorph2021-02-282-11/+240
|\ \ | |/ |/|
| * Implements touch, pan, pinch and rotation gesturesgerman2021-02-282-11/+240
* | Merge pull request #5953 from bunnei/memory-refactor-1bunnei2021-02-278-28/+26
|\ \
| * | hle: kernel: Migrate PageHeap/PageTable to KPageHeap/KPageTable.bunnei2021-02-191-4/+3
| * | hle: kernel: Migrate to KMemoryBlock, KMemoryBlockManager, and others.bunnei2021-02-191-11/+10
| * | hle: kernel: KSystemControl does not belong in Memory namespace.bunnei2021-02-191-2/+2
| * | hle: kernel: Rename SharedMemory to KSharedMemory.bunnei2021-02-197-12/+12
* | | Merge pull request #5944 from Morph1984/gc-vibrationsbunnei2021-02-272-3/+130
|\ \ \
| * | | hid: Implement GameCube Controller VibrationsMorph2021-02-212-3/+130
* | | | acc: Stub GetNintendoAccountUserResourceCacheForApplicationMorph2021-02-211-1/+17
|/ / /
* / / kernel: Fix resource release exception on exitameerj2021-02-212-0/+6
|/ /
* | Merge pull request #4973 from ameerj/nvdec-optbunnei2021-02-192-3/+7
|\ \
| * | Address PR feedbackameerj2021-02-132-4/+2
| * | nvdec cleanupameerj2021-02-131-1/+7
* | | Merge pull request #4940 from german77/nativeGCbunnei2021-02-152-1/+88
|\ \ \
| * | | hid: Implement GC controllergerman2021-02-082-1/+88
| | |/ | |/|
* | | hle: service: ldn: IUserLocalCommunicationService: Improve the stub.bunnei2021-02-141-5/+29
* | | hle: service: ldn: IUserLocalCommunicationService: Indicate that LDN is disabled.bunnei2021-02-142-3/+18
* | | hle: service: am: IStorageAccessor: Fix out of bounds error handling.bunnei2021-02-141-6/+7
| |/ |/|
* | kernel: Unify result codes (#5890)Chloe2021-02-131-3/+3
* | Merge pull request #5902 from lioncash/core-warnbunnei2021-02-123-4/+7
|\ \
| * | bsd: Remove usage of optional emplace() with no argumentsLioncash2021-02-091-2/+4
| * | am/controller: Remove [[fallthrough]] from unreachable pathLioncash2021-02-091-1/+2
| * | nfp: Correct uninitialized size being used within GetTagInfo()Lioncash2021-02-091-1/+1
| |/
* | software_keyboard: Implement Finalize request commandMorph2021-02-111-0/+4
* | Merge pull request #5892 from german77/backupbunnei2021-02-091-1/+12
|\ \
| * | olsc: Stub GetSaveDataBackupSettinggerman2021-02-081-1/+12
| |/
* | Merge pull request #5868 from german77/HandheldFixbunnei2021-02-081-0/+1
|\ \ | |/ |/|
| * Prevent over scheduling audio events and terminate properly the motion update eventgerman2021-02-021-0/+1
* | Merge pull request #5887 from ogniK5377/lm-fixbunnei2021-02-071-7/+9
|\ \
| * | lm: Fix ReadLeb128Chloe Marcec2021-02-071-7/+9
* | | Merge pull request #5878 from aleasto/masterMorph2021-02-071-2/+7
|\ \ \ | |/ / |/| |
| * | pl_u: Fix read out of boundsAlessandro Astone2021-02-061-2/+7
* | | Merge pull request #5326 from german77/hidUpdate1bunnei2021-02-0610-168/+406
|\ \ \
| * | | Add footer types and address commentsgerman2021-02-047-58/+106
| * | | Fix npad struct to match switchbrewgerman2021-02-043-105/+134
| * | | Adds missing controller types and propertiesgerman2021-02-049-30/+191
| |/ /
* | | hle: kernel: Reimplement KReadableEvent and KWritableEvent.bunnei2021-02-0529-194/+259
* | | hle: kernel: Rename WritableEvent to KWritableEvent.bunnei2021-02-0537-78/+78
* | | hle: kernel: Rename ReadableEvent to KReadableEvent.bunnei2021-02-0532-51/+52
* | | Merge pull request #5867 from Morph1984/am-GetHealthWarningDisappearedSystemEventbunnei2021-02-052-1/+14
|\ \ \ | |/ / |/| |
| * | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEventMorph2021-02-022-1/+14
* | | Merge pull request #5842 from german77/userfixbunnei2021-02-031-2/+8
|\ \ \ | |/ / |/| |
| * | Fix user changing to 0 if validgerman2021-01-291-2/+8
* | | Merge pull request #5861 from german77/HandheldFixbunnei2021-02-021-2/+11
|\ \ \ | | |/ | |/|
| * | Only update motion for npad and prevent over scheduling eventsgerman2021-02-011-2/+11
* | | Merge pull request #5859 from Morph1984/nifmbunnei2021-02-011-2/+157
|\ \ \
| * | | nifm: Stub GetCurrentIpConfigInfoMorph2021-01-311-1/+29
| * | | nifm: Stub GetCurrentNetworkProfileMorph2021-01-311-1/+41
| * | | nifm: Add several structsMorph2021-01-311-0/+87
* | | | Merge pull request #5856 from Morph1984/nifm-fix-getappletinfo-stubAmeer J2021-02-011-1/+5
|\ \ \ \
| * | | | nifm: Fix GetAppletInfo stubMorph2021-01-311-1/+5
* | | | | Merge pull request #5858 from Morph1984/IsGamePlayRecordingSupported-stubbunnei2021-02-012-1/+12
|\ \ \ \ \
| * | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupportedMorph2021-01-312-1/+12
* | | | | | prepo: Stub GetTransmissionStatusMorph2021-01-311-1/+11
* | | | | | prepo: Stub RequestImmediateTransmissionMorph2021-01-311-1/+8
| |_|/ / / |/| | | |
* | | | | bsd: Fix EventFd stubMorph2021-01-311-3/+3
|/ / / /
* | | | Merge pull request #5855 from Morph1984/bsd-fix-getsockopt-stubbunnei2021-01-311-1/+5
|\ \ \ \ | |/ / / |/| | |
| * | | bsd: Fix GetSockOpt stubMorph2021-01-311-1/+5
* | | | Merge pull request #5851 from ameerj/pop-inv-stubMorph2021-01-312-1/+10
|\ \ \ \ | |/ / / |/| | |
| * | | am: Stub TryPopFromFriendInvitationStorageChannelameerj2021-01-312-1/+10
* | | | bsd: Stub EventFdameerj2021-01-312-1/+12
|/ / /
* | | Merge pull request #5779 from bunnei/kthread-rewritebunnei2021-01-308-8/+8
|\ \ \
| * | | core: hle: kernel: Rename Thread to KThread.bunnei2021-01-298-8/+8
* | | | Merge pull request #5838 from german77/prepostubMorph2021-01-301-1/+10
|\ \ \ \
| * | | | Stub GetSystemSessionIdgerman2021-01-301-1/+10
| | |_|/ | |/| |
* | | | Merge pull request #5809 from ogniK5377/FlushAudioOutBuffersbunnei2021-01-291-1/+9
|\ \ \ \ | |_|/ / |/| | |
| * | | audout: FlushAudioOutBuffersChloe Marcec2021-01-241-1/+9
* | | | Merge pull request #5837 from german77/socketstubbunnei2021-01-292-1/+17
|\ \ \ \
| * | | | Stub GetSockOptgerman2021-01-282-1/+17
| | |/ / | |/| |
* | | | Merge pull request #5840 from Morph1984/prepo-fixLC2021-01-281-24/+42
|\ \ \ \
| * | | | prepo: Fix BufferDescriptorX invalid buffer errors and add "New" variants of SaveReportMorph2021-01-281-24/+42
| |/ / /
* | | | hid: Add static_assert for Parameter sizeMorph2021-01-281-15/+19
* | | | npad: Remove unused device handle parameterMorph2021-01-273-11/+9
|/ / /
* | | Merge pull request #5812 from german77/StubSixaxisFusionbunnei2021-01-274-3/+104
|\ \ \
| * | | Stub Set/Get/Reset SixaxisSensorFusionParametersgerman2021-01-244-3/+104
| |/ /
* | | Merge pull request #5810 from ogniK5377/stereo-visionbunnei2021-01-273-7/+60
|\ \ \
| * | | hle: Implement remaining services for Stereo VisionChloe Marcec2021-01-243-7/+60
| |/ /
* | | Merge pull request #5824 from ogniK5377/IPsmSessionbunnei2021-01-261-1/+112
|\ \ \
| * | | Omit system referenceChloe Marcec2021-01-251-2/+1
| * | | psm: IPsmSessionChloe Marcec2021-01-251-2/+114
* | | | Merge pull request #5774 from ogniK5377/mii-raw-randombunnei2021-01-264-2274/+1657
|\ \ \ \
| * | | | mii: Fix BuildRandomStoreData & Cleanup raw_dataChloe Marcec2021-01-204-2274/+1657
* | | | | Merge pull request #5771 from ogniK5377/lm-reworkbunnei2021-01-253-271/+288
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Print Process ID and Thread ID as hexChloe Marcec2021-01-241-2/+2
| * | | | Clamp string reads to buffer sizeChloe Marcec2021-01-231-3/+5
| * | | | Mark DestinationToString as staticChloe Marcec2021-01-201-1/+1
| * | | | Mark LogPacketHeaderEntry hash as noexceptChloe Marcec2021-01-201-1/+1
| * | | | lm: Recode LM serviceChloe Marcec2021-01-203-271/+286
| |/ / /
* | | | Merge pull request #5799 from ogniK5377/event-register-unregisterbunnei2021-01-251-1/+7
|\ \ \ \ | |_|/ / |/| | |
| * | | Simplify conditionChloe Marcec2021-01-231-2/+1
| * | | nvdrv: Unregister already registered eventsChloe Marcec2021-01-231-1/+8
* | | | Merge pull request #5806 from bunnei/am-stubbunnei2021-01-241-1/+8
|\ \ \ \ | |/ / / |/| | |
| * | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.bunnei2021-01-211-1/+8
| |/ /
* | | Merge pull request #5776 from ogniK5377/lblbunnei2021-01-231-22/+261
|\ \ \
| * | | lbl: Implement most of lblChloe Marcec2021-01-201-22/+261
| |/ /
* | | Merge pull request #5765 from ogniK5377/StoreSaveDataThumbnail-stubbunnei2021-01-235-6/+66
|\ \ \
| * | | acc: Stub StoreSaveDataThumbnailChloe Marcec2021-01-195-6/+66
| |/ /
* | | Merge pull request #5270 from german77/multiTouchbunnei2021-01-212-29/+130
|\ \ \ | |/ / |/| |
| * | Always initialize keyboard inputgerman2021-01-151-5/+1
| * | Add mutitouch support for touch screensgerman2021-01-152-19/+25
| * | Allow to return up to 16 touch inputs per enginegerman2021-01-152-55/+75
| * | Allow all touch inputs at the same time and remove config options that are not longer necesarygerman2021-01-152-11/+20
| * | Add multitouch supportgerman2021-01-152-23/+93
* | | npad: Add check for HANDHELD_INDEX in UpdateControllerAt()Morph2021-01-181-1/+1
* | | core: Silence Wclass-memaccess warningsReinUsesLisp2021-01-1511-177/+187
| |/ |/|
* | common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINITReinUsesLisp2021-01-151-5/+5
|/
* core: hle: Add missing calls to MicroProfileOnThreadExit.bunnei2021-01-111-0/+4
* core: hle: kernel: Update KSynchronizationObject.bunnei2021-01-111-3/+0
* hle: service: nfp: Remove incorrect signaling behavior in GetDeviceState.bunnei2021-01-111-6/+0
* Merge pull request #5312 from german77/overclockenabledbunnei2021-01-102-1/+10
|\
| * Stub IsCpuOverclockEnabledgerman2021-01-082-1/+10
* | core: Silence unhandled enum in switch warningsReinUsesLisp2021-01-091-2/+4
|/
* fix for nvdec disabled, cleanup host1xameerj2021-01-071-11/+14
* nvdec syncpt incorporationameerj2021-01-077-20/+43
* core: Silence warnings when compiling without assertsReinUsesLisp2021-01-051-0/+1
* buffer_queue: Protect queue_sequence list access with a mutexameerj2021-01-042-13/+21
* hle: service: nvflinger: buffer_queue: Do not reset id/layer_id on Connect.bunnei2021-01-031-2/+0
* general: Fix various spelling errorsMorph2021-01-022-4/+4
* Merge pull request #5208 from bunnei/service-threadsbunnei2020-12-3136-540/+259
|\
| * hle: service: Acquire and release a lock on requests.bunnei2020-12-295-25/+35
| * hle: service: vi: Refactor to grab buffer only once.bunnei2020-12-291-15/+4
| * service: nvflinger: Improve synchronization for BufferQueue.bunnei2020-12-295-19/+72
| * hle: service: Ensure system is powered on before writing IPC result.bunnei2020-12-291-1/+5
| * hle: service: bsd: Update to work with service threads, removing SleepClientThread.bunnei2020-12-293-249/+45
| * hle: service: nvdrv: Revert #4981 to remove usage of SleepClientThread.bunnei2020-12-2923-211/+83
| * hle: service: nvflinger: Refactor locking and interfaces.bunnei2020-12-293-45/+31
| * hle: service: vi: Remove usage of SleepClientThread.bunnei2020-12-291-34/+43
* | service/pcie: Fix invalid initialization argumentReinUsesLisp2020-12-301-1/+1
|/
* Merge pull request #5042 from Morph1984/project-aetherbunnei2020-12-2210-527/+643
|\
| * applets/web: Implement the online web browser appletMorph2020-12-182-3/+11
| * main, applets/web: Re-add progress dialog for RomFS extractionMorph2020-12-182-32/+44
| * pl_u, applets/web: Decrypt shared fonts to TTF filesMorph2020-12-183-18/+117
| * ns_vm: Stub NeedsUpdateVulnerabilityMorph2020-12-181-1/+10
| * controllers/npad: Make press_state atomicMorph2020-12-182-2/+3
| * applets/web: Implement the default web browser applet frontendMorph2020-12-181-1/+4
| * applets/web: Implement the offline browser applet backendMorph2020-12-182-13/+143
| * applets/web: Initial implementation of the web browser appletMorph2020-12-183-2/+428
| * applets: Remove the previous web browser applet implementationMorph2020-12-184-609/+37
* | Merge pull request #5131 from bunnei/scheduler-rewritebunnei2020-12-211-1/+1
|\ \
| * | hle: kernel: Rewrite scheduler implementation based on Mesopshere.bunnei2020-12-061-1/+1
* | | buffer_queue: better use of std::arrayameerj2020-12-181-59/+46
* | | Overwrite slots instead of queuing them, add disconnect signalameerj2020-12-173-27/+33
| |/ |/|
* | Merge pull request #5190 from Morph1984/validate_device_handlebunnei2020-12-162-0/+45
|\ \
| * | controllers/npad: Validate device handles before useMorph2020-12-122-0/+45
* | | Merge pull request #5119 from Morph1984/fs-opendatastoragewithprogramindexbunnei2020-12-155-8/+62
|\ \ \
| * | | fsp_srv: Implement OpenDataStorageWithProgramIndexMorph2020-12-084-1/+57
| * | | file_sys: Consolidate common Title ID operationsMorph2020-12-081-7/+5
* | | | Merge pull request #5168 from Morph1984/aoc-PurchaseEventManagerbunnei2020-12-152-2/+76
|\ \ \ \ | |_|/ / |/| | |
| * | | IPurchaseEventManager: Implement GetPurchasedEventReadableHandleMorph2020-12-081-1/+14
| * | | IPurchaseEventManager: Stub Set(Default)DeliveryTargetMorph2020-12-081-2/+27
| * | | aoc_u: Stub Create(Permanent)EcPurchasedEventManagerMorph2020-12-082-2/+38
| |/ /
* | | Merge pull request #5123 from Morph1984/nim-IsLargeResourceAvailablebunnei2020-12-101-1/+13
|\ \ \
| * | | nim: Stub IsLargeResourceAvailableMorph2020-12-041-1/+13
| | |/ | |/|
* | | Merge pull request #5142 from comex/xx-poll-eventsRodrigo Locatti2020-12-094-40/+45
|\ \ \
| * | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`comex2020-12-074-40/+45
| |/ /
* | | Merge pull request #5166 from lioncash/log-castbunnei2020-12-0918-71/+63
|\ \ \
| * | | core: Remove unnecessary enum casts in log callsLioncash2020-12-0818-71/+63
* | | | Merge pull request #5135 from Morph1984/applets-shadowbunnei2020-12-091-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | applets: Resolve variable shadowingMorph2020-12-051-1/+1
| | |/ | |/|
* | | controller: Use std::move within ConvertToFrontendParameters()Lioncash2020-12-081-3/+3
* | | controller: Avoid unnecessary copies in ConfigurationComplete()Lioncash2020-12-081-9/+8
| |/ |/|
* | Merge pull request #5148 from comex/xx-unused-fieldsbunnei2020-12-071-1/+1
|\ \
| * | core: Mark unused fields as [[maybe_unused]]comex2020-12-071-1/+1
| |/
* | Merge pull request #5154 from comex/xx-ipcbunnei2020-12-071-2/+2
|\ \
| * | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cppcomex2020-12-071-2/+2
| |/
* | Merge pull request #5147 from comex/xx-purevirtLC2020-12-071-33/+0
|\ \
| * | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclasscomex2020-12-071-33/+0
| |/
* / boxcat: Avoid unnecessary object copycomex2020-12-071-1/+1
|/
* core: arm: Implement InvalidateCacheRange for CPU cache invalidation.bunnei2020-11-291-5/+0
* Merge pull request #4998 from Morph1984/bioshock-patchbunnei2020-11-291-2/+4
|\
| * hid: Check if applet_resource exists in InitializeVibrationDeviceMorph2020-11-251-2/+4
* | Add missing types to NpadCommunicationModegerman2020-11-291-0/+2
* | Merge pull request #5021 from german77/StubCommunicationModebunnei2020-11-294-2/+50
|\ \
| * | Stub set and get NpadCommunicationModegerman2020-11-274-2/+50
* | | savedata_factory: Eliminate usage of the global system instanceLioncash2020-11-271-1/+2
* | | service: Eliminate usages of the global system instanceLioncash2020-11-27219-897/+1207
|/ /
* | Merge pull request #4975 from comex/invalid-syncpoint-idbunnei2020-11-261-2/+2
|\ \
| * | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint IDcomex2020-11-241-2/+2
* | | Merge pull request #4981 from ogniK5377/ioctl-ctrlbunnei2020-11-2624-91/+214
|\ \ \ | |_|/ |/| |
| * | nvservices: Reintroducee IoctlCtrlChloe Marcec2020-11-2424-91/+214
| |/
* | service: am: Implement ExecuteProgram and required stubs.bunnei2020-11-252-3/+34
* | hle: services: Fix a crash with improper NVFlinger lifetime management. (#4977)bunnei2020-11-2416-97/+98
|/
* Merge pull request #4944 from lioncash/system-rembunnei2020-11-228-31/+66
|\
| * patch_manager: Remove usages of the global system instanceLioncash2020-11-188-31/+66
* | Merge pull request #4907 from ogniK5377/nvdrv-cleanupbunnei2020-11-2126-898/+1220
|\ \
| * | Addressed issuesChloe Marcec2020-11-1010-17/+86
| * | core: Make nvservices more standardizedChloe Marcec2020-11-1026-903/+1156
* | | olsc: Move member initialization to after member functions.bunnei2020-11-201-2/+2
* | | hle: service: Stub OLSC Initialize and SetSaveDataBackupSettingEnabled functions.bunnei2020-11-193-0/+87
| |/ |/|
* | hid: Reimplement Begin/EndPermitVibrationSessionMorph2020-11-163-5/+17
* | controllers/npad: Load input devices on initMorph2020-11-161-0/+2
* | general: Fix compiler warnings on linux and miscellaneous changesMorph2020-11-162-8/+11
* | controllers/npad: Remove the old vibration filterMorph2020-11-163-50/+64
* | hid: Implement InitializeVibrationDevice and IsVibrationDeviceMountedMorph2020-11-163-12/+66
* | input_common: Add VibrationDevice and VibrationDeviceFactoryMorph2020-11-163-33/+27
* | configure_input: Add per-player vibrationMorph2020-11-161-2/+11
* | settings: Remove global vibration strength modifierMorph2020-11-161-3/+1
* | hid: Mark Begin/EndPermitVibrationSession as stubsMorph2020-11-163-18/+4
* | controllers/npad: Send an empty vibration on destruction/deactivationMorph2020-11-163-22/+38
* | hid: Stub IsVibrationDeviceMountedMorph2020-11-162-1/+23
* | controllers/npad: Add heuristics to reduce rumble state changesMorph2020-11-161-5/+46
* | configure_input: Hook up the vibration percentage spinboxMorph2020-11-161-1/+2
* | controllers/npad: Stop games from vibrating incorrect controllersMorph2020-11-161-0/+10
* | hid: Fix controller rumble based on new researchMorph2020-11-163-43/+69
* | hid: Pop a struct of parameters instead of popping individual parametersMorph2020-11-161-103/+237
* | hid: Reorder all HID commandsMorph2020-11-164-215/+230
* | hid: Implement GetVibrationDeviceInfoMorph2020-11-162-3/+39
* | hid: Stub InitializeVibrationDeviceMorph2020-11-161-3/+11
* | controllers/npad: Rename NPadType to NpadStyleSetMorph2020-11-163-9/+9
* | controllers/npad: Add DeviceHandle structMorph2020-11-161-27/+50
* | settings: Preparation for per-game input settingsMorph2020-11-166-25/+32
* | controllers/npad: Connect a controller on init if none are connectedMorph2020-11-161-0/+13
* | Merge pull request #4895 from Morph1984/cave-story-plus-applet-fixbunnei2020-11-132-26/+80
|\ \
| * | applets: Rename LibraryAppletVersion to ControllerAppletVersionMorph2020-11-082-15/+15
| * | applets/controller: Pop normal data for StrapGuide and FirmwareUpdateMorph2020-11-082-6/+19
| * | applets/controller: Introduce additional checks for mode and callerMorph2020-11-082-5/+39
| * | applets/controller: Add ControllerUpdateFirmwareArg structMorph2020-11-081-0/+7
* | | Merge pull request #4901 from bunnei/caps-stubbunnei2020-11-102-9/+17
|\ \ \ | |_|/ |/| |
| * | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.bunnei2020-11-072-9/+17
* | | ipc_helpers: Remove usage of the global system instanceLioncash2020-11-0814-1/+14
| |/ |/|
* | video_core: dma_pusher: Remove integrity check on command lists.bunnei2020-11-071-1/+0
|/
* Merge pull request #4858 from lioncash/initializerbunnei2020-11-041-0/+4
|\
| * General: Resolve a few missing initializer warningsLioncash2020-10-301-0/+4
* | Merge pull request #4869 from bunnei/improve-gpu-syncChloe2020-11-049-60/+291
|\ \
| * | fixup! hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-012-3/+11
| * | hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-013-46/+106
| * | service: hle: nvflinger: Fix potential shutdown crash when GPU is destroyed.bunnei2020-11-011-0/+4
| * | hle service: nvdrv: nvhost_ctrl: Update to use SyncpointManager.bunnei2020-11-013-9/+31
| * | hle service: nvdrv: Update to instantiate SyncpointManager.bunnei2020-11-012-5/+18
| * | hle: service: nvdrv: Implement SyncpointManager, to manage syncpoints.bunnei2020-11-013-1/+125
* | | Merge pull request #4878 from bunnei/unload-nrrbunnei2020-11-031-1/+15
|\ \ \ | |/ / |/| |
| * | hle: service: ldr: Implement UnloadNrr.bunnei2020-10-311-1/+15
* | | Rename to align with switchbrew and remove gpu function (#4714)Levi Behunin2020-11-012-16/+10
|/ /
* / video_core: unbreak -Werror in NVDEC with ClangJan Beich2020-10-301-1/+1
|/
* service: Update function tablesLioncash2020-10-285-1/+7
* Merge pull request #4729 from ameerj/nvdec-prodbunnei2020-10-278-288/+468
|\
| * video_core: NVDEC Implementationameerj2020-10-278-288/+468
* | hle: services: TimeZoneContentManager: This can be made explicit.bunnei2020-10-271-1/+1
|/
* Merge pull request #4828 from lioncash/lockguardRodrigo Locatti2020-10-251-1/+1
|\
| * general: Use template deduction guides for lock_guardLioncash2020-10-251-1/+1
* | Merge pull request #4792 from bunnei/rtc-fixbunnei2020-10-236-188/+302
|\ \ | |/ |/|
| * service: time: Update current time with changes to RTC setting.bunnei2020-10-136-188/+302
* | core: Fix clang build pt.3Lioncash2020-10-222-13/+3
* | Revert "core: Fix clang build"bunnei2020-10-2135-317/+246
* | Merge pull request #4796 from lioncash/clangLC2020-10-2135-246/+317
|\ \
| * | core: Fix clang buildLioncash2020-10-1835-246/+317
* | | Added remaining paramsDavid Marcec2020-10-201-1/+4
* | | nifm: GetAppletInfo stubDavid Marcec2020-10-201-1/+8
* | | Merge pull request #4785 from Morph1984/fs-hadesbunnei2020-10-201-2/+3
|\ \ \
| * | | filesystem: Fix CreateDirectory and DeleteFileMorph2020-10-131-2/+3
| | |/ | |/|
* | | Merge pull request #4783 from bunnei/nvdrv-freespacebunnei2020-10-182-0/+25
|\ \ \
| * | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.bunnei2020-10-132-0/+25
| |/ /
* | | Merge pull request #4801 from lioncash/missing-boundbunnei2020-10-181-1/+1
|\ \ \
| * | | mii/manager: Make use of unused lower bound in GetRandomValue()Lioncash2020-10-171-1/+1
* | | | service: bcat: Check client connection before interacting with socket.bunnei2020-10-171-0/+10
|/ / /
* | | Merge pull request #4784 from bunnei/cancelbufferbunnei2020-10-163-14/+53
|\ \ \
| * | | hle: service: vi: Implement BufferQueue::CancelBuffer.bunnei2020-10-143-14/+53
| | |/ | |/|
* / | service: acc: Stub IManagerForApplication::StoreOpenContext.bunnei2020-10-151-1/+7
|/ /
* / core/CMakeLists: Make some warnings errorsLioncash2020-10-139-52/+36
|/
* Merge pull request #4736 from Morph1984/home-button-input-protection-stubbunnei2020-10-074-2/+50
|\
| * hid: Stub HomeButtonInputProtection service commandsMorph2020-09-304-2/+50
* | Merge pull request #4737 from Morph1984/setshimlibraryversion-stubbunnei2020-10-075-4/+38
|\ \
| * | caps_c: Stub SetShimLibraryVersionMorph2020-09-302-1/+18
| * | caps_u: Stub SetShimLibraryVersionMorph2020-09-302-2/+14
| * | caps_su: Properly stub SetShimLibraryVersionMorph2020-09-301-1/+6
| |/
* | Merge pull request #4742 from german77/InputFilterbunnei2020-10-061-49/+58
|\ \
| * | Only use inputs corresponding to controller typegerman2020-10-021-49/+58
* | | Merge pull request #4734 from german77/motionfusionbunnei2020-10-022-1/+15
|\ \ \ | |/ / |/| |
| * | Stubbed EnableSixAxisSensorFusiongerman2020-09-302-1/+15
* | | Merge pull request #4291 from german77/ImplementControllerRumbleDavid2020-09-303-13/+22
|\ \ \
| * | | First implementation of controller rumblegerman2020-09-293-13/+22
* | | | Merge pull request #4726 from lioncash/appletDavid2020-09-301-1/+2
|\ \ \ \ | |_|_|/ |/| | |
| * | | frontend/controller: Eliminate dependency on the global system instanceLioncash2020-09-261-1/+2
| |/ /
* | | Merge pull request #4705 from german77/SplitMotionPollerbunnei2020-09-305-76/+157
|\ \ \ | |_|/ |/| |
| * | Use different timing for motiongerman2020-09-245-76/+157
* | | Merge pull request #1703 from DarkLordZach/nvdec-ioctlbunnei2020-09-304-3/+256
|\ \ \ | |_|/ |/| |
| * | service: nvhost_vic: Ignore Submit commands.bunnei2020-06-052-1/+18
| * | nvdrv: Stub nvdec/vic ioctls to bypass nvdec moviesZach Hilman2020-06-054-3/+239
* | | Merge pull request #4717 from lioncash/debugLC2020-09-251-0/+17
|\ \ \
| * | | service: Restore "unused" functionLioncash2020-09-251-0/+17
| | |/ | |/|
* | | Merge pull request #4678 from Morph1984/LoadOpenContext-partial-implbunnei2020-09-243-1/+13
|\ \ \ | |/ / |/| |
| * | acc: Stub LoadOpenContextMorph2020-09-213-1/+13
* | | General: Make use of std::nullopt where applicableLioncash2020-09-224-7/+7
|/ /
* | Merge pull request #4683 from Morph1984/NpadHandheldActivationMode-implbunnei2020-09-203-5/+28
|\ \
| * | hid: Implement Get/SetNpadHandheldActivationModeMorph2020-09-183-5/+28
* | | Merge pull request #4643 from FearlessTobi/decrease-pad-update-intervalbunnei2020-09-191-1/+1
|\ \ \
| * | | Test: Decrease pad_update_nsFearlessTobi2020-09-101-1/+1
* | | | am: Stub GetPreviousProgramIndexMorph2020-09-182-1/+11
* | | | Merge pull request #4665 from lioncash/sm-kernelRodrigo Locatti2020-09-172-8/+10
|\ \ \ \
| * | | | service/sm: Slightly more efficient string name validationLioncash2020-09-171-2/+2
| * | | | service/sm: Eliminate dependency on the global system instanceLioncash2020-09-172-6/+8
* | | | | Merge pull request #4666 from lioncash/unused-funcRodrigo Locatti2020-09-171-22/+0
|\ \ \ \ \
| * | | | | service: Remove unused funcationLioncash2020-09-171-22/+0
| |/ / / /
* | | | | Merge pull request #4671 from lioncash/nfp-copyRodrigo Locatti2020-09-171-10/+13
|\ \ \ \ \
| * | | | | nfp: Eliminate two unnecessary copiesLioncash2020-09-171-10/+13
| |/ / / /
* | | | | Merge pull request #4594 from german77/MotionHIDbunnei2020-09-174-15/+184
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | configure_input: Hook up the motion button and checkboxMorph2020-09-051-1/+1
| * | | | Add cemu hook changes related to PR #4609german2020-09-051-2/+1
| * | | | Remove RealMotionDevicegerman2020-09-052-7/+8
| * | | | controllers/npad: Simplify motion entry assignmentMorph2020-09-051-29/+18
| * | | | Include HID and configuration changes related to motiongerman2020-09-054-15/+195
* | | | | file_sys/bis_factory: Eliminate usage of the global system accessorLioncash2020-09-171-1/+1
* | | | | Merge pull request #4636 from lioncash/kernel-hlebunnei2020-09-143-7/+5
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | service: Remove two usages of the global system accessorLioncash2020-09-073-7/+5
| | |/ / | |/| |
* | | | Merge pull request #4634 from lioncash/blockingbunnei2020-09-123-19/+19
|\ \ \ \
| * | | | bsd: Resolve unused value within SendToImplLioncash2020-09-071-0/+1
| * | | | bsd: Resolve sign comparison warningsLioncash2020-09-071-3/+3
| * | | | sockets_translate: Make use of designated initializersLioncash2020-09-071-12/+12
| * | | | blocking_worker: Make use of templated lambdaLioncash2020-09-071-3/+2
| * | | | blocking_worker: Resolve -Wdocumentation warningLioncash2020-09-071-1/+1
| |/ / /
* | | | Merge pull request #4310 from ogniK5377/apollo-1-prodbunnei2020-09-111-72/+77
|\ \ \ \
| * | | | audio_core: Apollo Part 1, AudioRenderer refactorDavid Marcec2020-07-251-72/+77
* | | | | Merge pull request #4597 from Morph1984/mjolnir-p2bunnei2020-09-116-131/+415
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Address feedbackMorph2020-09-042-0/+7
| * | | | applets/controller: Set min_players to have a minimum value of 1.Morph2020-09-041-1/+1
| * | | | applets/controller: Implement fallback applet for the SDL frontendMorph2020-09-042-89/+0
| * | | | applets/controller: Implement "Explain Text"Morph2020-09-042-16/+26
| * | | | Project Mjölnir: Part 2 - Controller AppletMorph2020-09-046-42/+398
* | | | | Merge pull request #4397 from ReinUsesLisp/bsdbunnei2020-09-069-56/+1384
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | service/bsd: Handle Poll with no entries accuratelyReinUsesLisp2020-07-281-0/+5
| * | | | services/bsd: Implement most of bsd:sReinUsesLisp2020-07-285-55/+911
| * | | | service/sockets: Add worker pool abstractionReinUsesLisp2020-07-281-0/+30
| * | | | service/sockets: Add worker abstraction to execute blocking calls asynchronouslyReinUsesLisp2020-07-281-0/+132
| * | | | service/sockets: Add translate functionsReinUsesLisp2020-07-282-0/+213
| * | | | service/sockets: Add enumerations and structuresReinUsesLisp2020-07-282-0/+81
| * | | | services/nifm: Implement GetCurrentIpAddressReinUsesLisp2020-07-281-1/+12
* | | | | hid: Implement MergeSingleJoyasDualJoyMorph2020-09-043-5/+24
| |/ / / |/| | |
* | | | Merge pull request #4568 from lioncash/fspbunnei2020-09-031-3/+13
|\ \ \ \
| * | | | fsp_srv: Resolve -Wunused-but-set-variable warningLioncash2020-08-231-1/+8
| * | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()Lioncash2020-08-231-2/+5
* | | | | Merge pull request #4564 from lioncash/file-includebunnei2020-09-031-0/+1
|\ \ \ \ \
| * | | | | file_sys: Replace inclusions with forward declarations where applicableLioncash2020-08-231-0/+1
| |/ / / /
* | | | | yuzu: Add motion and touch configurationFearlessTobi2020-08-292-1/+12
* | | | | controllers/npad: Fix inconsistencies with controller connection statusesMorph2020-08-261-1/+7
* | | | | controllers/npad: Fix LibNX controller connection statusesMorph2020-08-261-1/+9
* | | | | controllers/npad: Fix LedPattern for P1-4Morph2020-08-261-3/+3
* | | | | Project Mjölnir: Part 1Morph2020-08-263-127/+111
|/ / / /
* | | | common/fileutil: Convert namespace to Common::FSLioncash2020-08-165-73/+73
* | | | Merge pull request #4526 from lioncash/core-semibunnei2020-08-152-3/+4
|\ \ \ \
| * | | | core: Resolve several -Wextra-semi warningsLioncash2020-08-142-3/+4
* | | | | Merge pull request #4527 from lioncash/pessimizing2bunnei2020-08-151-2/+1
|\ \ \ \ \
| * | | | | software_keyboard: Resolve a pessimizing move warningLioncash2020-08-141-2/+1
| |/ / / /
* / / / / time_zone_content_manager: Collapse auto and default caseLioncash2020-08-141-3/+1
|/ / / /
* | | | General: Tidy up clang-format warnings part 2Lioncash2020-08-134-10/+11
* | | | Merge pull request #4457 from ogniK5377/SetScreenShotPermissionbunnei2020-08-072-1/+12
|\ \ \ \
| * | | | am: Unstub SetScreenShotPermissionDavid Marcec2020-07-312-1/+12
| |/ / /
* | | | common/concepts: Rename IsBaseOf to DerivedFromLioncash2020-08-071-1/+1
* | | | Merge pull request #4475 from lioncash/bqueuebunnei2020-08-051-10/+11
|\ \ \ \
| * | | | buffer_queue: Make use of std::nulloptLioncash2020-08-031-5/+6
| * | | | buffer_queue: Make use of designated initializersLioncash2020-08-031-5/+5
| |/ / /
* | | | Merge pull request #4401 from ogniK5377/GetIndirectLayerImageRequiredMemoryInfobunnei2020-08-051-1/+19
|\ \ \ \
| * | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfoDavid Marcec2020-07-211-1/+19
| | |/ / | |/| |
* | | | Merge pull request #4430 from bunnei/new-gpu-vmmbunnei2020-08-054-93/+227
|\ \ \ \
| * | | | Update src/core/hle/service/nvdrv/devices/nvmap.cppbunnei2020-07-281-1/+1
| * | | | hle: nvdrv: Rewrite of GPU memory management.bunnei2020-07-264-93/+227
* | | | | Merge pull request #4481 from lioncash/cpp-depDavid2020-08-043-21/+21
|\ \ \ \ \
| * | | | | yuzu: Resolve C++20 deprecation warnings related to lambda capturesLioncash2020-08-033-21/+21
* | | | | | Merge pull request #4474 from lioncash/hle-profileDavid2020-08-041-17/+26
|\ \ \ \ \ \
| * | | | | | profile_manager: Make use of std::nulloptLioncash2020-08-031-4/+4
| * | | | | | profile_manager: Make use of designated initializersLioncash2020-08-031-13/+22
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #4456 from Morph1984/stub-really-long-fs-funcbunnei2020-08-045-34/+69
|\ \ \ \ \ \
| * | | | | | minor nitsMorph2020-07-311-1/+3
| * | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttributeMorph2020-07-302-23/+56
| * | | | | | fs: Rename SaveDataDescriptor to SaveDataAttributeMorph2020-07-303-12/+12
| |/ / / / /
* | | | | | Merge pull request #4482 from lioncash/ldr-signbunnei2020-08-031-3/+2
|\ \ \ \ \ \
| * | | | | | service/ldr: Resolve sign mismatch warningsLioncash2020-08-031-3/+2
| | |/ / / / | |/| | | |
* / | | | | sm: Make use of IsBaseOf for GetServiceDavid Marcec2020-08-031-3/+2
|/ / / / /
* / / / / ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer (#4465)David2020-08-038-16/+14
|/ / / /
* | | | core_timing: Make use of uintptr_t to represent user_dataLioncash2020-07-283-5/+7
* | | | remove unused variable;CrazyMax2020-07-271-1/+0
* | | | nvflinger: Mark interface functions with return values as [[nodiscard]]Lioncash2020-07-261-16/+14
* | | | nvflinger: Use return value of Lock()Lioncash2020-07-263-4/+4
|/ / /
* | | Merge pull request #4350 from ogniK5377/hid-update-connectedbunnei2020-07-252-33/+37
|\ \ \
| * | | hid: Only update keyboard & debug pad inputs if enabledDavid Marcec2020-07-162-33/+37
* | | | Address issuesDavid Marcec2020-07-201-2/+2
* | | | swkbd: Return result for Calc request for inlined swkbdDavid Marcec2020-07-192-13/+49
| |/ / |/| |
* | | Merge pull request #4348 from lioncash/nanobunnei2020-07-183-20/+23
|\ \ \
| * | | core_timing: Make TimedCallback take std::chrono::nanosecondsLioncash2020-07-163-12/+10
| * | | core_timing: Make use of std::chrono with ScheduleEventLioncash2020-07-162-11/+16
| |/ /
* | | Merge pull request #4345 from Morph1984/fix-createfilebunnei2020-07-181-0/+4
|\ \ \
| * | | Add comment to clarify the nullptr checkMorph2020-07-161-0/+1
| * | | filesystem: Create subdirectories prior to creating a fileMorph2020-07-161-0/+3
| |/ /
* | | Merge pull request #4365 from lioncash/miibunnei2020-07-181-53/+54
|\ \ \
| * | | mii/manager: Make use of designated initializersLioncash2020-07-171-53/+54
* | | | mii/manager: Resolve sign mismatch warningsLioncash2020-07-171-3/+3
|/ / /
* | | Merge pull request #4292 from bunnei/mii-rewritebunnei2020-07-178-912/+3265
|\ \ \ | |/ / |/| |
| * | hle: service: mii: Rewrite service to properly support creation of random and default miis.bunnei2020-07-128-912/+3265
* | | Merge pull request #4275 from CrazyMax/desired_languagebunnei2020-07-121-1/+13
|\ \ \
| * | | AM: fix GetDesiredLanguage:CrazyMax2020-07-081-1/+13
* | | | Merge pull request #4203 from VolcaEM/servicesbunnei2020-07-1126-154/+282
|\ \ \ \ | |_|/ / |/| | |
| * | | Rename two functions in NSVolcaEM2020-07-021-2/+2
| * | | Rename GetApplicationArea2 to GetApplicationAreaSizeVolcaEM2020-07-021-2/+2
| * | | Remove duplicate functionsVolcaEM2020-06-291-2/+0
| * | | Use decimal instead of hexadecimalVolcaEM2020-06-291-3/+5
| * | | Fix typoVolcaEM2020-06-291-1/+1
| * | | Clang-formatVolcaEM2020-06-291-1/+1
| * | | service: Update function tablesVolcaEM2020-06-2927-157/+285
* | | | configuration: implement per-game configurations (#4098)lat9nq2020-07-105-21/+22
* | | | Merge pull request #4248 from Morph1984/CreateManagedDisplaySeparableLayerbunnei2020-07-102-1/+20
|\ \ \ \ | |_|/ / |/| | |
| * | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayerMorph2020-07-052-1/+20
* | | | GetDisplayVersion should return a null-terminated version string.CrazyMax2020-07-071-4/+16
|/ / /
* | | Merge pull request #3924 from ogniK5377/GetKeyCodeMapbunnei2020-07-032-2/+72
|\ \ \
| * | | Move GetKeyCodeMapImpl to an anonymous namespaceDavid Marcec2020-06-241-19/+19
| * | | Fixed logging outputDavid Marcec2020-06-241-1/+1
| * | | Implement GetKeyCodeMap & GetKeyCodeMap2David Marcec2020-06-242-2/+72
* | | | Merge pull request #4193 from ogniK5377/GetIndirectLayerConsumerHandle-stubbunnei2020-07-031-1/+13
|\ \ \ \
| * | | | am: Stub GetIndirectLayerConsumerHandleDavid Marcec2020-06-281-1/+13
* | | | | Merge pull request #4192 from ogniK5377/acc-ListOpenContextStoredUsers-stubbunnei2020-07-035-4/+14
|\ \ \ \ \
| * | | | | acc: ListOpenContextStoredUsers partial stubDavid Marcec2020-06-285-4/+14
| |/ / / /
* | | | | key_manager: Correct casing of instance()Lioncash2020-07-011-1/+1
* | | | | Merge pull request #3967 from FearlessTobi/keys-singletonDavid2020-07-011-1/+1
|\ \ \ \ \
| * | | | | crypto: Make KeyManager a singleton classFearlessTobi2020-05-201-1/+1
* | | | | | Merge pull request #4153 from ogniK5377/prepo-multibufbunnei2020-07-011-1/+6
|\ \ \ \ \ \
| * | | | | | prepo: : Don't read extra buffer from report unless passedDavid Marcec2020-06-241-1/+6
* | | | | | | Merge pull request #3955 from FernandoS27/prometheus-2bbunnei2020-06-2819-43/+103
|\ \ \ \ \ \ \
| * | | | | | | NvFlinger: Clang Format.Fernando Sahmkow2020-06-271-1/+1
| * | | | | | | Services/NvFlinger: Do vSync in a sepparate thread on Multicore.Fernando Sahmkow2020-06-272-3/+60
| * | | | | | | General: Cleanup legacy code.Fernando Sahmkow2020-06-271-1/+1
| * | | | | | | FrameLimiting: Enable frame limiting for single core.Fernando Sahmkow2020-06-271-0/+1
| * | | | | | | NVDRV: Remove frame limiting as Host Timing already takes care.Fernando Sahmkow2020-06-271-1/+0
| * | | | | | | NVFlinger: Lock race condition between CPU, Host Timing, VSync.Fernando Sahmkow2020-06-273-0/+11
| * | | | | | | General: Recover Prometheus project from harddrive failure Fernando Sahmkow2020-06-2716-39/+31
| | |_|/ / / / | |/| | | | |
* | | | | | | ldr: Cleanup NRO & NRR structsDavid Marcec2020-06-281-8/+8
* | | | | | | Merge pull request #4026 from VolcaEM/ldrDavid2020-06-281-38/+73
|\ \ \ \ \ \ \
| * | | | | | | Move SHA256Hash to its original positionVolcaEM2020-06-181-2/+2
| * | | | | | | Remove unnecessary pragmasVolcaEM2020-06-161-8/+0
| * | | | | | | Revert IsValidNRO refactor but make it more readableVolcaEM2020-06-161-26/+13
| * | | | | | | Update assert stringVolcaEM2020-06-161-1/+1
| * | | | | | | Clang-format againVolcaEM2020-06-141-2/+2
| * | | | | | | Use consistent variable namesVolcaEM2020-06-141-4/+4
| * | | | | | | Clang-formatVolcaEM2020-06-141-1/+2
| * | | | | | | Make assert strings consistentVolcaEM2020-06-141-3/+3
| * | | | | | | Attempt to fix crashes in SSBU and refactor IsValidNROVolcaEM2020-06-141-36/+59
| * | | | | | | Address review commentsVolcaEM2020-06-021-4/+4
| * | | | | | | Add comment to nrr_kindVolcaEM2020-05-311-1/+1
| * | | | | | | ldr: Update NRR/NRO structs VolcaEM2020-05-311-40/+72
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #4184 from VolcaEM/patch-9David2020-06-281-0/+3
|\ \ \ \ \ \ \
| * | | | | | | Oops (fix typo)VolcaEM2020-06-271-1/+1
| * | | | | | | grc: Update function tableVolcaEM2020-06-271-0/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #4185 from VolcaEM/patch-10David2020-06-281-0/+1
|\ \ \ \ \ \ \
| * | | | | | | lbl: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #4186 from VolcaEM/patch-11David2020-06-281-0/+1
|\ \ \ \ \ \ \
| * | | | | | | ldn: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #4187 from VolcaEM/patch-12David2020-06-281-0/+6
|\ \ \ \ \ \ \
| * | | | | | | mig: Update function tableVolcaEM2020-06-271-0/+6
| |/ / / / / /
* | | | | | | Merge pull request #4188 from VolcaEM/patch-13David2020-06-281-16/+16
|\ \ \ \ \ \ \
| * | | | | | | mm: Update function tableVolcaEM2020-06-271-16/+16
| |/ / / / / /
* | | | | | | Merge pull request #4189 from VolcaEM/patch-14David2020-06-281-10/+10
|\ \ \ \ \ \ \
| * | | | | | | ncm: Update function tableVolcaEM2020-06-271-10/+10
| |/ / / / / /
* | | | | | | Merge pull request #4190 from VolcaEM/patch-15David2020-06-281-3/+3
|\ \ \ \ \ \ \
| * | | | | | | nfc: Update function tableVolcaEM2020-06-271-3/+3
| |/ / / / / /
* / / / / / / friend: Update function tableVolcaEM2020-06-271-0/+6
|/ / / / / /
* | | | | | Merge pull request #4158 from Morph1984/capsbunnei2020-06-2714-57/+69
|\ \ \ \ \ \
| * | | | | | caps_u: Fix GetAlbumContentsFileListForApplication stubMorph2020-06-261-9/+15
| * | | | | | caps: Use enum classes and check struct sizes on compile timeMorph2020-06-261-34/+40
| * | | | | | caps: Update copyright headersMorph2020-06-2614-14/+14
* | | | | | | Merge pull request #4154 from ogniK5377/swkbd-nullptrbunnei2020-06-271-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Prevent nullptr dereference on swkbd error caseDavid Marcec2020-06-241-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #4178 from VolcaEM/patch-6David2020-06-271-4/+43
|\ \ \ \ \ \ \
| * | | | | | | Use better names for "Unknown"sVolcaEM2020-06-271-39/+39
| * | | | | | | Update function namesVolcaEM2020-06-271-4/+4
| * | | | | | | es: Update function tableVolcaEM2020-06-271-2/+41
| | |/ / / / / | |/| | | | |
* | | | | | | btm: Give better names for unknown functionsDavid Marcec2020-06-271-5/+5
* | | | | | | btdrv: Update function table (#4174)VolcaEM2020-06-271-83/+84
* | | | | | | bpc: Update function tables (#4173)VolcaEM2020-06-271-7/+13
* | | | | | | bcat: Update function tables and add missing classes (#4172)VolcaEM2020-06-272-0/+5
* | | | | | | am: Update function tables and add missing classes (#4169)VolcaEM2020-06-273-17/+19
* | | | | | | aoc: Update function table (#4170)VolcaEM2020-06-271-0/+1
* | | | | | | Merge pull request #4177 from VolcaEM/patch-5LC2020-06-271-71/+76
|\ \ \ \ \ \ \
| * | | | | | | btm: Update function tablesVolcaEM2020-06-271-71/+76
| |/ / / / / /
* / / / / / / eupld: Update function tableVolcaEM2020-06-271-0/+1
|/ / / / / /
* | | | | | Merge pull request #4141 from Morph1984/SevenSixAxisSensorDavid2020-06-252-21/+85
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | hid: Stub a series of "SevenSixAxisSensor" service commandsMorph2020-06-242-21/+85
| | |_|/ / | |/| | |
* | | | | Merge pull request #4138 from Morph1984/GyroscopeZeroDriftModebunnei2020-06-244-6/+56
|\ \ \ \ \
| * | | | | hid: Implement Get/ResetGyroscopeZeroDriftModeMorph2020-06-214-6/+56
| |/ / / /
* | | | | Merge pull request #4128 from lioncash/move2bunnei2020-06-241-2/+2
|\ \ \ \ \
| * | | | | software_keyboard: Eliminate trivial redundant copiesLioncash2020-06-201-2/+2
| |/ / / /
* | | | | lm: Silence no return value warningMorph2020-06-231-1/+2
* | | | | account: Update function tables and add missing classes (#4145)VolcaEM2020-06-225-42/+384
|/ / / /
* | | / nvdrv: Fix GetTPCMasks for ioctl3David Marcec2020-06-102-21/+22
| |_|/ |/| |
* | | Clang-formatVolcaEM2020-06-011-2/+1
* | | hid: Stub GetXpadIDsVolcaEM2020-06-012-1/+14
|/ /
* | clang-formatVolcaEM2020-05-211-1/+2
* | nifm: correct assert in CreateTemporaryNetworkProfileVolcaEM2020-05-211-1/+1
* | Merge pull request #3926 from ogniK5377/keyboard-statesbunnei2020-05-191-3/+4
|\ \
| * | hid: Clear keyboard states & fix logic issueDavid Marcec2020-05-121-3/+4
* | | Merge pull request #3665 from bunnei/device-savebunnei2020-05-162-1/+38
|\ \ \
| * | | service: fsp_srv: Stub implementation of OpenMultiCommitManager.bunnei2020-05-112-1/+38
| |/ /
* | | nv_flinger: Use enum for pixel format instead of u32David Marcec2020-05-162-3/+11
* | | time_zone: Use std::chrono::seconds for strong typing.bunnei2020-05-131-1/+1
* | | hle: service: time_zone_manager: Use current time zone setting.bunnei2020-05-112-3/+32
* | | Stub SendKeyboardLockKeyEventDavid Marcec2020-05-112-1/+11
|/ /
* / Replace externals with Conan (#3735)James Rowe2020-05-081-1/+1
|/
* Merge pull request #3843 from ogniK5377/GetPopFromGeneralChannelEventbunnei2020-05-043-4/+20
|\
| * am: IHomeMenuFunctions:GetPopFromGeneralChannelEventDavid Marcec2020-05-013-4/+20
* | Merge pull request #3822 from ogniK5377/GetAccountIdbunnei2020-05-041-5/+8
|\ \
| * | acc: Return a unique value per account for GetAccountIdDavid Marcec2020-04-291-5/+8
* | | Merge pull request #3824 from ogniK5377/GetDisplayVersionbunnei2020-05-031-3/+14
|\ \ \
| * | | Update src/core/hle/service/am/am.cppbunnei2020-05-031-1/+1
| * | | am: Properly implement GetDisplayVersionDavid Marcec2020-04-291-3/+14
| |/ /
* | | Merge pull request #3811 from ogniK5377/audin-initbunnei2020-05-022-5/+94
|\ \ \
| * | | marked stubsDavid Marcec2020-04-281-4/+5
| * | | Audin:u ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecifiedDavid Marcec2020-04-282-5/+93
* | | | Merge pull request #3833 from qwell/caps_su-32-stubbunnei2020-05-022-1/+13
|\ \ \ \
| * | | | caps:su Stub out SetShimLibraryVersionJason Parker2020-04-302-1/+13
* | | | | Merge pull request #3821 from ogniK5377/InitializeApplicationInfo-fixbunnei2020-05-022-22/+15
|\ \ \ \ \
| * | | | | acc: Fix InitializeApplicationInfoDavid Marcec2020-04-292-22/+15
| | |_|/ / | |/| | |
* | | | | Merge pull request #3812 from ogniK5377/lisst-qualified-usersbunnei2020-05-025-3/+15
|\ \ \ \ \
| * | | | | Updated comment to reflect ListQualifiedUsers betterDavid Marcec2020-04-281-1/+3
| * | | | | account: ListQualifiedUsersDavid Marcec2020-04-285-3/+13
| | |_|/ / | |/| | |
* | | | | nvdrv: Fix GetGpuTime stack corruptionDavid Marcec2020-05-011-2/+3
| |_|_|/ |/| | |
* | | | Merge pull request #3823 from ogniK5377/setvrmodeMat M2020-04-302-16/+6
|\ \ \ \
| * | | | am: IsVrModeEnabled & SetVrModeEnabled fixesDavid Marcec2020-04-292-16/+6
| | |/ / | |/| |
* | | | Merge pull request #3830 from ogniK5377/GetFriendInvitationStorageChannelEventMat M2020-04-302-1/+14
|\ \ \ \
| * | | | am: GetFriendInvitationStorageChannelEventDavid Marcec2020-04-302-1/+14
| |/ / /
* | | | Merge pull request #3835 from ogniK5377/GetFreeSpaceSize-GetTotalSpaceSizeMat M2020-04-301-2/+2
|\ \ \ \
| * | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSizeDavid Marcec2020-04-301-2/+2
| |/ / /
* | | | Merge pull request #3832 from ogniK5377/nim-eca-CreateServerInterfaceMat M2020-04-301-1/+69
|\ \ \ \
| * | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterfaceDavid Marcec2020-04-301-1/+69
| |/ / /
* | | | Merge pull request #3831 from ogniK5377/caps-su-namesMat M2020-04-301-0/+3
|\ \ \ \ | | |_|/ | |/| |
| * | | caps: Add missing service names to caps:suDavid Marcec2020-04-301-0/+3
| |/ /
* / / psm: Mark as debug instead of warningDavid Marcec2020-04-291-7/+14
|/ /
* | Don't fail silently for vi, sm, set and ns servicesDavid Marcec2020-04-294-3/+27
* | style: Change AMs & Glues error codes to be dec instead of hexDavid Marcec2020-04-282-7/+7
|/
* Merge pull request #3785 from ogniK5377/set-buffer-count-unitbunnei2020-04-271-1/+9
|\
| * vi: Don't let uninitialized data pass as a response for SetBufferCountDavid Marcec2020-04-241-1/+9
* | Merge pull request #3797 from slashiee/hid-stubMat M2020-04-272-1/+13
|\ \
| * | services: hid: Stub StopSevenSixAxisSensor.M&M2020-04-262-1/+13
| |/
* | Merge pull request #3744 from lioncash/table2bunnei2020-04-2618-7/+107
|\ \ | |/ |/|
| * service: Update function tablesLioncash2020-04-2018-7/+107
* | Merge pull request #3730 from lioncash/timebunnei2020-04-231-24/+26
|\ \
| * | service/time: Remove reliance on the global system accessorLioncash2020-04-191-24/+26
* | | Merge pull request #3697 from lioncash/declarationsbunnei2020-04-232-6/+2
|\ \ \
| * | | General: Resolve warnings related to missing declarationsLioncash2020-04-172-6/+2
* | | | Merge pull request #3698 from lioncash/warningbunnei2020-04-211-2/+2
|\ \ \ \
| * | | | time_zone_manager: Resolve sign conversion warningsLioncash2020-04-171-2/+2
| |/ / /
* | | / audio_renderer: Preliminary BehaviorInfo (#3736)David2020-04-211-2/+7
| |_|/ |/| |
* | | npad: Lower log level for VibrateController to DebugFearlessTobi2020-04-201-1/+1
* | | audren: Lower log level for RequestUpdateImpl to DebugFearlessTobi2020-04-201-1/+1
* | | Merge pull request #3712 from lioncash/removebunnei2020-04-202-3/+0
|\ \ \
| * | | service: Remove unused RequestParser instancesLioncash2020-04-182-3/+0
* | | | Merge pull request #3709 from lioncash/ambunnei2020-04-201-2/+2
|\ \ \ \ | |_|_|/ |/| | |
| * | | am: Resolve ineffective movesLioncash2020-04-181-2/+2
| |/ /
* | | Merge pull request #3715 from bunnei/fix-impl-fallthroughMat M2020-04-181-0/+2
|\ \ \
| * | | service: hid: npad: Fix implicit fallthrough errors.bunnei2020-04-181-0/+2
| |/ /
* | | time/system_clock_core: Remove unnecessary initializerLioncash2020-04-181-1/+1
* | | service/time: Mark IsStandardNetworkSystemClockAccuracySufficient as constLioncash2020-04-181-1/+1
* | | service/time: Add virtual destructors where applicableLioncash2020-04-183-2/+3
|/ /
* | core: hle: Address various feedback & code cleanup.bunnei2020-04-171-8/+5
* | service: ldr: Updates for new VMM.bunnei2020-04-171-150/+215
* | service: pl_u: Update for new shared memory layout.bunnei2020-04-171-7/+5
* | service: time: Update for new shared memory layout.bunnei2020-04-171-3/+2
* | service: hid: Update for new shared memory layout.bunnei2020-04-171-3/+2
* | service: irs: Update for new shared memory layout.bunnei2020-04-171-3/+3
* | core: memory: Move to Core::Memory namespace.bunnei2020-04-172-5/+5
|/
* Merge pull request #3673 from lioncash/extrabunnei2020-04-175-11/+15
|\
| * CMakeLists: Specify -Wextra on linux buildsLioncash2020-04-165-11/+15
* | Merge pull request #3659 from bunnei/time-calc-standard-userRodrigo Locatti2020-04-163-1/+25
|\ \ | |/ |/|
| * service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.bunnei2020-04-153-1/+25
* | service: friend: Stub IFriendService::GetBlockedUserListIds.bunnei2020-04-141-1/+10
|/
* Merge pull request #3606 from ReinUsesLisp/nvflingerbunnei2020-04-123-10/+44
|\
| * service/vi: Partially implement BufferQueue disconnectReinUsesLisp2020-04-103-10/+44
* | Buffer queue: Correct behavior of free buffer.Fernando Sahmkow2020-04-102-9/+33
|/
* Merge pull request #3563 from bunnei/fix-ldr-memstateFernando Sahmkow2020-04-031-5/+15
|\
| * services: ldr: Fix MemoryState for read/write regions of NROs.bunnei2020-03-261-5/+15
* | capsrv: Split Capture services into individual files and stub GetAlbumContentsFileListForApplication (#3571)Morph2020-04-0114-151/+524
* | Merge pull request #3568 from bunnei/time-calcspanbunnei2020-03-293-1/+31
|\ \
| * | services: time: Implement CalculateSpanBetween.bunnei2020-03-273-1/+31
| |/
* | Merge pull request #3562 from perillamint/vrsvcbunnei2020-03-282-3/+42
|\ \
| * | am: Implement VR related APIsperillamint2020-03-272-3/+42
| |/
* / services: hid: Stub InitializeSevenSixAxisSensor.bunnei2020-03-272-1/+9
|/
* sm/controller: Increase PointerBufferSizeFearlessTobi2020-03-231-1/+1
* Merge pull request #3477 from FearlessTobi/webapplet-shitbunnei2020-03-221-0/+6
|\
| * core/web_browser: Allow WebApplet to exit gracefully when an error occursFearlessTobi2020-03-221-0/+6
* | set: implement GetRegionCodeDan2020-03-192-1/+10
* | time_zone_content_manager: Fix out of bounds readReinUsesLisp2020-03-181-1/+1
* | NVFlinger: Do the microprofile Flip after processing a valid frame.Fernando Sahmkow2020-03-121-2/+2
|/
* AM/ICommonStateGetter: Stub SetLcdBacklighOffEnabled (#3454)Morph2020-02-272-2/+14
* Merge pull request #3431 from CJBok/npad-fixbunnei2020-02-261-5/+5
|\
| * analog_from_button get direction implementationCJBok2020-02-181-5/+5
* | httplib compatibilityBrian Clinkenbeard2020-02-191-3/+4
|/
* Merge pull request #3420 from namkazt/master2bunnei2020-02-172-0/+20
|\
| * nvhost_gpu: implement ChannelSetTimeslicenamkazy2020-02-162-0/+20
* | IUserLocalCommunicationService: add function Initialize2Nguyen Dac Nam2020-02-161-1/+9
* | HLE: correct function name of IUserLocalCommunicationServiceNguyen Dac Nam2020-02-161-1/+1
|/
* Merge pull request #3401 from FernandoS27/synchronizationbunnei2020-02-146-10/+16
|\
| * Core: Set all hardware emulation constants in a single file.Fernando Sahmkow2020-02-126-10/+16
* | Merge pull request #3400 from makigumo/patch-1bunnei2020-02-141-2/+4
|\ \
| * | update hwopus DecodeInterleaved for FW 7.0.0+makigumo2020-02-111-2/+4
| |/
* | bcat/backend: Make formatting of passphrase consistent in NullBackend::SetPassphrase()Lioncash2020-02-121-1/+1
* | bcat/backend: Prevent fmt exception in debug log within NullBackend::Clear()Lioncash2020-02-121-1/+1
|/
* hle: services: Use std::shared_ptr instead of copy by value.bunnei2020-02-089-50/+52
* Merge pull request #3381 from bunnei/ipc-fixbunnei2020-02-071-15/+15
|\
| * services: prepo: Fix IPC interface with SaveReport/SaveReportWithUser.bunnei2020-02-061-15/+15
* | am: Correct IPC object count mismatch.bunnei2020-02-061-6/+4
* | services: am: Clear events on PopOutData and PopInteractiveOutData.bunnei2020-02-061-0/+2
* | am: Refactor IStorage interface.bunnei2020-02-067-43/+81
* | applets: software_keyboard: Signal state change on end of interactive session.bunnei2020-02-061-0/+1
* | applets: software_keyboard: Minor cleanup.bunnei2020-02-061-2/+2
|/
* Merge pull request #3284 from CJBok/hid-fixbunnei2020-02-011-13/+26
|\
| * Moved analog direction logic to sdl_implCJBok2020-01-151-9/+22
| * Corrected directional states sensitivityCJBok2020-01-141-9/+9
| * hid: Fix analog sticks directional statesCJBok2020-01-091-12/+12
* | bsd: Stub several more functions.bunnei2020-01-252-4/+48
* | service: time: Implement ToPosixTimeWithMyRule.bunnei2020-01-234-1/+34
* | time: Fix month off-by-one error.bunnei2020-01-201-2/+2
* | Merge pull request #3271 from bunnei/time-rewritebunnei2020-01-2039-533/+2962
|\ \ | |/ |/|
| * service: time: Implement GetStandardLocalSystemClock.bunnei2020-01-053-1/+9
| * time: Remove overflow error checking (currently breaks ADO builds).bunnei2020-01-042-18/+2
| * service: time: Implement GetClockSnapshotFromSystemClockContext.bunnei2020-01-043-3/+27
| * service: time: Implement IsStandardNetworkSystemClockAccuracySufficient.bunnei2020-01-045-1/+51
| * service: time: Rewrite implementation of glue services.bunnei2020-01-0434-444/+2806
| * core: Initialize several structs that make use of Common::UUID.bunnei2020-01-045-100/+101
* | Merge pull request #3272 from bunnei/vi-close-layerbunnei2020-01-075-11/+48
|\ \
| * | service: vi: Implement CloseLayer.bunnei2020-01-045-11/+48
| |/
* | Merge pull request #3257 from degasus/no_busy_loopsbunnei2020-01-061-1/+1
|\ \
| * | video_core: Block in WaitFence.Markus Wick2019-12-301-1/+1
* | | Merge pull request #2945 from FernandoS27/fix-bcatbunnei2020-01-051-3/+17
|\ \ \ | |_|/ |/| |
| * | nifm: Only return that there's an internet connection when there's a BCATServerFernando Sahmkow2019-11-071-3/+17
* | | NvServices: Correct Ioctl Remap.Fernando Sahmkow2019-12-252-3/+5
| |/ |/|
* | kernel: Implement a more accurate IPC dispatch.bunnei2019-11-285-22/+28
* | Merge pull request #3169 from lioncash/memorybunnei2019-11-286-22/+28
|\ \
| * | core/memory: Migrate over Read{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-274-11/+14
| * | core: Prepare various classes for memory read/write migrationLioncash2019-11-273-11/+14
* | | Merge pull request #3170 from lioncash/enumbunnei2019-11-281-2/+2
|\ \ \ | |/ / |/| |
| * | file_sys/directory: Make EntryType an enum classLioncash2019-11-271-2/+2
* | | core_timing: Use better reference tracking for EventType. (#3159)bunnei2019-11-274-7/+6
|/ /
* | Merge pull request #3094 from lioncash/tablesbunnei2019-11-2533-7/+192
|\ \
| * | service: Update function tablesLioncash2019-11-1233-7/+192
| |/
* | kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. (#3154)bunnei2019-11-2532-57/+55
* | Merge pull request #3112 from lioncash/skipbunnei2019-11-211-8/+16
|\ \
| * | service/am: Remove unnecessary Skip callsLioncash2019-11-141-8/+16
* | | Merge pull request #3111 from lioncash/querybunnei2019-11-212-5/+14
|\ \ \
| * | | am: Stub QueryApplicationPlayStatisticsLioncash2019-11-142-5/+14
| |/ /
* | | Merge pull request #3091 from lioncash/core-conversionbunnei2019-11-1515-58/+55
|\ \ \ | |/ / |/| |
| * | service: Resolve sign conversion errorsLioncash2019-11-1215-58/+55
| |/
* | Merge pull request #3089 from SciresM/play_statisticsbunnei2019-11-142-0/+10
|\ \
| * | Implement stub for QueryApplicationPlayStatisticsByUidMichael Scire2019-11-112-0/+10
| |/
* / core: Migrate off deprecated mbedtls functionsLioncash2019-11-123-3/+3
|/
* Merge pull request #3062 from bunnei/event-improvebunnei2019-11-0616-55/+44
|\
| * kernel: events: Remove ResetType::Automatic.bunnei2019-11-0316-55/+44
* | Merge pull request #2859 from Morph1984/hidDavid2019-11-062-92/+126
|\ \
| * | hid: Stub SetNpadJoyAssignmentModeSingle and reorganize service commandsMorph2019-10-072-92/+126
* | | common_func: Use std::array for INSERT_PADDING_* macros.bunnei2019-11-042-6/+7
* | | core/am: Stub InitializeApplicationCopyrightFrameBuffer, SetApplicationCopyrightImage and SetApplicationCopyrightVisibilityFearlessTobi2019-11-032-3/+31
| |/ |/|
* | Merge pull request #2991 from lioncash/npadbunnei2019-10-232-51/+23
|\ \
| * | hid/npad: Fix incorrect connection boolean value in ConnectAllDisconnectedControllers()Lioncash2019-10-181-1/+1
| * | hid/npad: Add missing break in default caseLioncash2019-10-181-0/+1
| * | hid/npad: Replace std::for_each with ranged for loopsLioncash2019-10-181-13/+12
| * | hid/npad: Remove redundant non-const variant of IsControllerSupported()Lioncash2019-10-182-34/+5
| * | hid/npad: Move function declarationsLioncash2019-10-181-5/+6
* | | apm/controller: Make SetPerformanceConfiguration() use an array of pairs over a mapLioncash2019-10-171-14/+34
* | | apm/controller: Make GetCurrentPerformanceMode() a const member functionLioncash2019-10-172-2/+2
|/ /
* | Merge pull request #2912 from FernandoS27/async-fixesbunnei2019-10-165-28/+27
|\ \
| * | NvFlinger: Remove leftover from corrections and clang format.Fernando Sahmkow2019-10-051-4/+0
| * | Nvdrv: Correct Event setup in NvdrvFernando Sahmkow2019-10-052-23/+14
| * | NVFlinger: Reverse the change that only signaled events on buffer acquire.Fernando Sahmkow2019-10-052-20/+1
| * | Nvdrv: Do framelimiting only in the CPU ThreadFernando Sahmkow2019-10-051-0/+4
| * | NvFlinger: Don't swap buffers if a frame is missing and always trigger event in sync gpu.Fernando Sahmkow2019-10-051-1/+3
| * | GPU_Async: Correct fences, display events and more.Fernando Sahmkow2019-10-052-2/+21
| * | Nvdrv: Correct Async regression and avoid signaling empty buffer vsyncsFernando Sahmkow2019-10-052-3/+9
* | | Merge pull request #2972 from lioncash/systembunnei2019-10-159-33/+63
|\ \ \
| * | | bcat: Remove use of global system accessorsLioncash2019-10-156-29/+55
| * | | nvflinger/buffer_queue: Remove use of a global system accessorLioncash2019-10-123-4/+8
* | | | pl_u: Fix mismatched rebase size error in font encryptionZach Hilman2019-10-132-11/+11
* | | | pl_u: Use kernel physical memoryZach Hilman2019-10-131-0/+1
* | | | pl_u: Remove excess static qualifierZach Hilman2019-10-131-1/+1
* | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-10-131-110/+47
|/ / /
* | | Merge pull request #2921 from FreddyFunk/compiler-warnings-corebunnei2019-10-091-6/+6
|\ \ \
| * | | Services::ES fix casting warningsFreddyFunk2019-09-291-6/+6
* | | | Merge pull request #2654 from DarkLordZach/lm-log-rewritebunnei2019-10-095-156/+278
|\ \ \ \
| * | | | lm: Flush manager output on core shutdownZach Hilman2019-09-222-5/+11
| * | | | lm: Rename Initialize to Log and implement with manager/reporterZach Hilman2019-09-221-140/+22
| * | | | lm: Implement manager class to output to reporterZach Hilman2019-09-222-0/+233
| * | | | core: Add LM::Manager to systemZach Hilman2019-09-223-16/+17
| |/ / /
* | | / hid: Implement DeactivateNpadMorph2019-10-072-1/+13
| |_|/ |/| |
* | | Merge pull request #2951 from lioncash/globalZach Hilman2019-10-0710-43/+65
|\ \ \
| * | | hle/service: Replace global system instance calls with instance-based onesLioncash2019-10-0610-43/+65
* | | | bcat/module: Silence truncation warningsLioncash2019-10-061-3/+3
* | | | bcat: Take std::function instance by value in NullBackend's constructorLioncash2019-10-062-2/+2
* | | | bcat: In-class initialize ProgressServiceBackend's impl memberLioncash2019-10-062-2/+2
* | | | bcat: Make ProgressServiceBackend's constructor take a std::string_viewLioncash2019-10-062-3/+7
* | | | bcat: Make ProgressServiceBackend's GetEvent() constLioncash2019-10-062-2/+2
* | | | boxcat: Silence an unused variable warningLioncash2019-10-061-1/+2
|/ / /
* | | audio/audout_u: Change formatting for old clang-format versionsReinUsesLisp2019-10-051-1/+1
* | | service/nvdrv: Silence -WswitchReinUsesLisp2019-10-054-4/+10
* | | service/nfp: Silence -Wunused and -WswitchReinUsesLisp2019-10-051-4/+5
* | | service/hid: Silence -Wunused and -WswitchReinUsesLisp2019-10-0515-23/+18
* | | service/am: Silence -WreorderReinUsesLisp2019-10-051-2/+1
* | | service/hid: Remove unused system referenceReinUsesLisp2019-10-052-2/+1
* | | service/friend: Remove unused fieldReinUsesLisp2019-10-051-1/+0
* | | service/filesystem: Silence -Wunused-variableReinUsesLisp2019-10-051-1/+1
* | | service/bcat: Silence -Wreorder and -WunusedReinUsesLisp2019-10-052-2/+2
* | | service/audio: Silence -WunusedReinUsesLisp2019-10-051-1/+1
* | | service/apm: Silence -Wunused and -WreorderReinUsesLisp2019-10-052-4/+5
| |/ |/|
* | Merge pull request #2539 from DarkLordZach/bcatDavid2019-10-0316-40/+1497
|\ \
| * | qt: Add service dialogZach Hilman2019-10-021-6/+5
| * | boxcat: Use updated game-asset API URL and tagsZach Hilman2019-10-011-6/+6
| * | bcat: Add FSC accessors for BCAT dataZach Hilman2019-10-0110-31/+51
| * | boxcat: Implement events global fieldZach Hilman2019-09-303-12/+14
| * | bcat: Implement DeliveryCacheProgressImpl structureZach Hilman2019-09-305-84/+310
| * | boxcat: Use Etag header names for file digestZach Hilman2019-09-301-10/+11
| * | boxcat: Add downloading and client for launch parameter dataZach Hilman2019-09-302-16/+77
| * | bcat: Add backend function for BCAT Indirect (launch parameter)Zach Hilman2019-09-302-0/+11
| * | bcat: Expose CreateBackendFromSettings helper functionZach Hilman2019-09-302-2/+2
| * | am: Unstub PopLaunchParameter and add bcat connection for app-specific dataZach Hilman2019-09-302-16/+52
| * | bcat: Implement cmd 90201 ClearDeliveryCacheStorageZach Hilman2019-09-301-1/+23
| * | bcat: Implement cmd 30100 SetPassphraseZach Hilman2019-09-301-1/+33
| * | bcat: Implement cmd RequestSyncDeliveryCache and variantZach Hilman2019-09-301-2/+70
| * | bcat: Implement IDeliveryCacheProgressService commandsZach Hilman2019-09-301-0/+131
| * | bcat: Implement IDeliveryCacheFileService commandsZach Hilman2019-09-301-0/+117
| * | bcat: Implement IDeliveryCacheDirectoryService commandsZach Hilman2019-09-301-0/+99
| * | bcat: Implement IDeliveryCacheStorageService commandsZach Hilman2019-09-301-0/+58
| * | bcat: Add commands to create IDeliveryCacheStorageServiceZach Hilman2019-09-303-2/+32
| * | module: Create BCAT backend based upon Settings value on constructionZach Hilman2019-09-302-1/+16
| * | bcat: Add BCAT backend for Boxcat serviceZach Hilman2019-09-302-0/+407
| * | bcat: Add backend class to generify the functions of BCATZach Hilman2019-09-302-0/+100
| * | nifm: Signal to applications that internet access is availableZach Hilman2019-09-301-3/+10
| * | applets: Add accessor for AppletFrontendSetZach Hilman2019-09-302-0/+6
| * | filesystem: Add getter for BCAT temporary directoryZach Hilman2019-09-301-0/+9
| |/
* / Signal styleset changes at a better timeDavid Marcec2019-09-241-8/+2
|/
* Merge pull request #2683 from DarkLordZach/lock-exitDavid2019-09-224-7/+33
|\
| * qt: Prompt user for confirmation if exit lock is activeZach Hilman2019-09-221-1/+1
| * am: Implement ISelfController ExitLock commandsZach Hilman2019-09-221-2/+6
| * am: Implement ISelfController ExitZach Hilman2019-09-224-4/+20
| * am: Add RequestExit event to AppletMessageQueueZach Hilman2019-09-222-0/+6
* | Merge pull request #2876 from ogniK5377/AcquireNpadStyleSetUpdateEventHandle-fixZach Hilman2019-09-223-11/+18
|\ \
| * | removed commentDavid Marcec2019-09-221-1/+0
| * | RebasedDavid Marcec2019-09-223-11/+19
* | | Merge pull request #2895 from FearlessTobi/debug-logsDavid2019-09-221-7/+7
|\ \ \
| * | | service/acc: Lower log severity from INFO to DEBUGFearlessTobi2019-09-221-7/+7
* | | | Merge pull request #2873 from ogniK5377/new-ioctlsFernando Sahmkow2019-09-2224-73/+153
|\ \ \ \ | |_|/ / |/| | |
| * | | server side clang format fix2David Marcec2019-09-221-18/+18
| * | | Use clang-format provided by build serverDavid Marcec2019-09-221-20/+18
| * | | disable clang-format tempDavid Marcec2019-09-201-0/+2
| * | | Initial implementation of Ioctl2 & Ioctl3David Marcec2019-09-1924-63/+143
* | | | Merge pull request #2884 from ogniK5377/deglobal-sys-servicesFernando Sahmkow2019-09-2264-212/+291
|\ \ \ \
| * | | | removed unneeded semicolonDavid Marcec2019-09-221-1/+1
| * | | | Removed reference to core timing to nvflinger and used system insteadDavid Marcec2019-09-221-1/+1
| * | | | marked controller constructors as explicitDavid Marcec2019-09-228-8/+8
| * | | | RebaseDavid Marcec2019-09-2225-62/+75
| * | | | RebaseDavid Marcec2019-09-225-20/+21
| * | | | Deglobalize System: ViDavid Marcec2019-09-223-8/+8
| * | | | Deglobalize System: TimeDavid Marcec2019-09-224-14/+21
| * | | | RebaseDavid Marcec2019-09-222-8/+12
| * | | | Deglobalize System: NvFlingerDavid Marcec2019-09-222-6/+7
| * | | | RebaseDavid Marcec2019-09-224-8/+12
| * | | | Deglobalize System: NimDavid Marcec2019-09-222-7/+12
| * | | | Deglobalize System: NifmDavid Marcec2019-09-222-13/+23
| * | | | Deglobalize System: NFPDavid Marcec2019-09-224-14/+16
| * | | | Deglobalize System: LDRDavid Marcec2019-09-222-6/+7
| * | | | Deglobalize System: IRSDavid Marcec2019-09-223-5/+6
| * | | | Deglobalize System: HidDavid Marcec2019-09-2220-37/+44
| * | | | Deglobalize System: FriendDavid Marcec2019-09-224-22/+24
| * | | | Deglobalize System: FatalDavid Marcec2019-09-226-20/+29
| * | | | Deglobalize System: BtmDavid Marcec2019-09-222-7/+13
| * | | | Deglobalize System: BtdrvDavid Marcec2019-09-222-5/+9
| * | | | Deglobalize System: AocDavid Marcec2019-09-222-11/+13
| * | | | Deglobalize System: AmDavid Marcec2019-09-221-1/+1
* | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"David Marcec2019-09-222-50/+117
|/ / / /
* | | | Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1David2019-09-222-117/+50
|\ \ \ \ | |_|_|/ |/| | |
| * | | pl_u: Use kernel physical memoryZach Hilman2019-09-221-0/+1
| * | | pl_u: Remove excess static qualifierZach Hilman2019-09-221-1/+1
| * | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-09-222-109/+41
| * | | pl_u: Expose method to encrypt TTF to BFTTFZach Hilman2019-09-222-14/+14
| | |/ | |/|
* | | Merge pull request #2612 from DarkLordZach/prepo-newDavid2019-09-223-25/+84
|\ \ \
| * | | prepo: Remove system global accessorsZach Hilman2019-09-223-15/+18
| * | | prepo: Implement SaveReport New and System variantsZach Hilman2019-09-221-15/+71
| |/ /
* | | configure_debug: Move reporting option to loggingZach Hilman2019-09-228-14/+15
* | | filesystem: Add const qualification to various accessorsZach Hilman2019-09-213-68/+76
* | | yuzu: Port old usages of Filesystem namespace to FilesystemControllerZach Hilman2019-09-214-15/+38
* | | services: Pass FileSystemController as reference to services that need itZach Hilman2019-09-2111-20/+47
* | | am: Unstub IApplicationFunctions EnsureSaveData (20)Zach Hilman2019-09-211-8/+14
* | | filesystem: Pass Size Getter functions to IFileSystem for sizesZach Hilman2019-09-213-20/+31
* | | filesystem: Add FileSystemController to deglobalize FS servicesZach Hilman2019-09-212-58/+359
|/ /
* / Mark KickOffPb & SubmitGPFIFO as traceDavid Marcec2019-09-211-4/+4
|/
* Merge pull request #2667 from DarkLordZach/profile-editorbunnei2019-09-145-10/+130
|\
| * acc_su: Implement GetProfileEditor (205)Zach Hilman2019-07-033-1/+13
| * acc: Implement IProfileEditor-specific commands 'Store' and 'StoreWithImage'Zach Hilman2019-07-031-1/+73
| * profile_manager: Add setter for ProfileBase and ProfileDataZach Hilman2019-07-032-0/+13
| * acc: Add IProfileCommon for IProfile and IProfileEditorZach Hilman2019-07-031-8/+31
* | Merge pull request #2716 from lioncash/hle-globalDavid2019-09-0916-96/+141
|\ \
| * | service/am: Remove usages of global system accessorsLioncash2019-09-0516-96/+141
* | | Merge pull request #2418 from DarkLordZach/srv-esDavid2019-09-051-10/+220
|\ \ \ | |/ / |/| |
| * | key_manager: Convert Ticket union to std::variantZach Hilman2019-07-081-2/+2
| * | es: Populate/synthesize tickets on constructionZach Hilman2019-07-081-2/+3
| * | key_manager: Add structure for Ticket parsingZach Hilman2019-07-081-9/+9
| * | es: Implement ETicket GetPersonalizedTicketData (17)Zach Hilman2019-07-081-1/+21
| * | es: Implement ETicket GetCommonTicketData (16)Zach Hilman2019-07-081-1/+20
| * | es: Implement ETicket GetPersonalizedTicketSize (15)Zach Hilman2019-07-081-1/+17
| * | es: Implement ETicket GetCommonTicketSize (14)Zach Hilman2019-07-081-1/+17
| * | es: Implement ETicket ListPersonalizedTicket (12)Zach Hilman2019-07-081-1/+24
| * | es: Implement ETicket ListCommonTicket (11)Zach Hilman2019-07-081-1/+24
| * | es: Implement ETicket CountPersonalizedTicket (10)Zach Hilman2019-07-081-1/+12
| * | es: Implement ETicket CountCommonTicket (9)Zach Hilman2019-07-081-1/+12
| * | es: Implement ETicket GetTitleKey (8)Zach Hilman2019-07-081-1/+27
| * | es: Implement ETicket ImportTicket (1)Zach Hilman2019-07-081-1/+45
* | | Merge pull request #2834 from Morph1984/audrenu_QueryAudioDeviceInputEventDavid2019-09-051-1/+15
|\ \ \
| * | | Add Kernel::EventPair audio_input_device_switch_event;Morph19842019-09-041-0/+1
| * | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEventMorph19842019-09-041-1/+14
* | | | Merge pull request #2836 from Morph1984/hid_vibrationDavid2019-09-054-2/+32
|\ \ \ \
| * | | | dittoMorph19842019-09-041-1/+1
| * | | | IsVibrationEnabled() as a const member funcMorph19842019-09-041-1/+1
| * | | | clang-formatMorph19842019-09-041-2/+2
| * | | | Update npad.hMorph19842019-09-041-0/+1
| * | | | Update npad.cppMorph19842019-09-041-0/+6
| * | | | Update hid.hMorph19842019-09-041-0/+2
| * | | | Update hid.cppMorph19842019-09-041-2/+23
| |/ / /
* | | | Merge pull request #2818 from MysticExile/fmtDavid2019-09-051-1/+1
|\ \ \ \
| * | | | accommodate for fmt updateEthan2019-08-291-1/+1
| |/ / /
* | | | AM: Stub IApplicationFunctions::GetGpuErrorDetectedSystemEvent (#2827)mailwl2019-09-042-0/+16
* | | | Merge pull request #2829 from Morph1984/audiobunnei2019-09-041-2/+15
|\ \ \ \
| * | | | remove <f32>Morph19842019-09-041-1/+1
| * | | | explicitly represent 1 as a float (1.0f instead of 1)Morph19842019-09-041-1/+1
| * | | | Change u32 -> f32Morph19842019-09-041-1/+1
| * | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolumeMorph19842019-09-031-2/+15
| |/ / /
* | | | Merge pull request #2708 from DarkLordZach/mii-db-source-crashDavid2019-09-041-0/+4
|\ \ \ \
| * | | | mii: Handle logging of unknown database sourceZach Hilman2019-07-101-0/+4
* | | | | Merge pull request #2793 from ReinUsesLisp/bgr565bunnei2019-09-041-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gpu: Change optional<reference_wrapper<T>> to T* for FramebufferConfigReinUsesLisp2019-08-211-1/+1
* | | | | Merge pull request #2748 from FernandoS27/align-memorybunnei2019-08-211-6/+6
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-191-6/+6
* | | | | Merge pull request #2747 from lioncash/audiobunnei2019-08-187-108/+179
|\ \ \ \ \
| * | | | | service/audren_u: Handle audio USB output revision queries in ListAudioDeviceName()Lioncash2019-07-192-16/+45
| * | | | | service/audren_u: Move revision testing code out of AudRenULioncash2019-07-192-63/+63
| * | | | | service/audio: Remove global system accessorsLioncash2019-07-197-34/+54
| * | | | | service/audren_u: Remove unnecessary return value from GetActiveAudioDeviceName()Lioncash2019-07-191-2/+1
| * | | | | service/audren_u: Report proper device namesLioncash2019-07-191-6/+29
| |/ / / /
* | | | | Merge pull request #2592 from FernandoS27/sync1bunnei2019-07-2630-169/+542
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | NVServices: Correct delayed responses.Fernando Sahmkow2019-07-051-24/+19
| * | | | Nv_Host_Ctrl: Correct difference calculationFernando Sahmkow2019-07-051-5/+7
| * | | | NVServices: Address FeedbackFernando Sahmkow2019-07-058-21/+38
| * | | | NVServices: Styling, define constructors as explicit and correctionsFernando Sahmkow2019-07-0518-36/+31
| * | | | NVFlinger: Correct GCC compile errorFernando Sahmkow2019-07-056-17/+16
| * | | | NVServices: Make NVEvents Automatic according to documentation.Fernando Sahmkow2019-07-052-4/+7
| * | | | NVServices: Correct CtrlEventWaitSync to block the ipc until timeout.Fernando Sahmkow2019-07-0523-31/+104
| * | | | GPU: Correct Interrupts to interrupt on syncpt/value instead of event, mirroring hardwareFernando Sahmkow2019-07-055-14/+14
| * | | | nvflinger: Make the force 30 fps still force 30 fpsFernando Sahmkow2019-07-051-1/+1
| * | | | nv_services: Fixes to event liberation.Fernando Sahmkow2019-07-051-6/+14
| * | | | nvflinger: Acquire buffers in the same order as they were queued.Fernando Sahmkow2019-07-052-3/+11
| * | | | nv_services: Deglobalize NvServicesFernando Sahmkow2019-07-0523-51/+65
| * | | | nv_host_ctrl: Make Sync GPU variant always return synced result.Fernando Sahmkow2019-07-051-0/+5
| * | | | nvhost_ctrl: Corrections to event handlingFernando Sahmkow2019-07-052-8/+12
| * | | | Gpu: Mark areas as protected.Fernando Sahmkow2019-07-051-0/+6
| * | | | nv_services: Stub CtrlEventSignalFernando Sahmkow2019-07-052-12/+34
| * | | | Gpu: Implement Hardware Interrupt Manager and manage GPU interruptsFernando Sahmkow2019-07-053-8/+1
| * | | | nv_services: Implement NvQueryEvent, NvCtrlEventWait, NvEventRegister, NvEventUnregisterFernando Sahmkow2019-07-057-17/+192
| * | | | nv_services: Create GPU channels correctlyFernando Sahmkow2019-07-052-2/+5
| * | | | video_core: Implement GPU side SyncpointsFernando Sahmkow2019-07-053-7/+33
| * | | | nv_services: Correct buffer queue fencing and GPFifo fencingFernando Sahmkow2019-07-057-57/+69
| * | | | nvflinger: Implement swap intervalsFernando Sahmkow2019-07-055-8/+21
* | | | | Clang formatDavid Marcec2019-07-121-2/+4
* | | | | "AudioRenderer" thread should have a unique nameDavid Marcec2019-07-122-4/+4
* | | | | Merge pull request #2717 from SciresM/unmirror_memorybunnei2019-07-111-6/+26
|\ \ \ \ \
| * | | | | Restore memory perms on svcUnmapMemory/UnloadNroMichael Scire2019-07-111-6/+26
* | | | | | service/am: Implement IsAutoSleepDisabledLioncash2019-07-112-1/+10
* | | | | | service/am: Implement SetAutoSleepDisabledLioncash2019-07-112-1/+23
|/ / / / /
* | | | | Merge pull request #2700 from ogniK5377/GetFriendListbunnei2019-07-101-1/+34
|\ \ \ \ \
| * | | | | IFriendService::GetFriendListDavid Marcec2019-07-091-1/+34
| | |/ / / | |/| | |
* | | | | Merge pull request #2611 from DarkLordZach/pm-info-cmdbunnei2019-07-103-16/+116
|\ \ \ \ \
| * | | | | pm: Implement pm:shell and pm:dmnt GetApplicationPidZach Hilman2019-06-273-7/+33
| * | | | | pm: Implement pm:dmnt GetTitlePidZach Hilman2019-06-271-7/+36
| * | | | | pm: Implement pm:info GetTitleIdZach Hilman2019-06-271-2/+47
* | | | | | Merge pull request #2650 from DarkLordZach/mii-iface-verbunnei2019-07-101-1/+15
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | mii: Implement IDatabaseService SetInterfaceVersionZach Hilman2019-07-071-1/+15
| |/ / / /
* | | | | Merge pull request #2657 from ogniK5377/npad-assignmentsZach Hilman2019-07-085-3/+99
|\ \ \ \ \
| * | | | | addressed issuesDavid Marcec2019-07-081-6/+7
| * | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignmentDavid Marcec2019-07-015-3/+98
| |/ / / /
* | | | | Merge pull request #2651 from DarkLordZach/apm-boost-mode-1bunnei2019-07-0811-57/+236
|\ \ \ \ \
| * | | | | am: Implement SetCpuBoostMode in terms of APMZach Hilman2019-06-295-13/+26
| * | | | | apm: Implement SetCpuBoostModeZach Hilman2019-06-292-0/+14
| * | | | | apm: Add getters for performance config and modeZach Hilman2019-06-292-33/+49
| * | | | | apm: Add apm:am serviceZach Hilman2019-06-292-11/+9
| * | | | | apm: Add Controller class to manage speed data and applicationZach Hilman2019-06-292-0/+138
| |/ / / /
* | | | | Merge pull request #2642 from DarkLordZach/fsp-log-2bunnei2019-07-086-27/+73
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | fsp-srv: Implement GetAccessLogVersionInfoZach Hilman2019-06-292-3/+14
| * | | | fsp-srv: Implement OutputAccessLogToSdCardZach Hilman2019-06-296-26/+61
| |/ / /
* | | | clang-format fixesMichael Scire2019-07-061-4/+5
* | | | am: Implement GetAccumulatedSuspendedTickValueMichael Scire2019-07-062-7/+19
| |/ / |/| |
* | | Merge pull request #2658 from ogniK5377/QueryAudioDeviceOutputEventbunnei2019-07-041-3/+16
|\ \ \
| * | | IAudioDevice::QueryAudioDeviceOutputEventDavid Marcec2019-07-011-3/+16
| |/ /
* | | Merge pull request #2638 from DarkLordZach/quest-flagbunnei2019-07-042-1/+10
|\ \ \
| * | | set: Implement GetQuestFlagZach Hilman2019-06-292-1/+10
| |/ /
* | | Merge pull request #2613 from ogniK5377/InitalizeApplicationInfoZach Hilman2019-07-044-6/+109
|\ \ \
| * | | Addressed issuesDavid Marcec2019-06-282-17/+12
| * | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestrictedDavid Marcec2019-06-274-6/+114
| |/ /
* | | Merge pull request #2608 from ogniK5377/Time_GetSharedMemoryNativeHandleZach Hilman2019-07-047-28/+258
|\ \ \
| * | | Addressed issuesDavid Marcec2019-06-265-37/+53
| * | | Implement Time::GetSharedMemoryNativeHandleDavid Marcec2019-06-257-29/+243
* | | | Merge pull request #2604 from ogniK5377/INotificationServicebunnei2019-07-034-1/+129
|\ \ \ \ | |_|_|/ |/| | |
| * | | Attemp clang format fix?David Marcec2019-06-281-1/+0
| * | | Addressed issuesDavid Marcec2019-06-282-13/+13
| * | | SizedNotificationInfo should be 0x10 bytes, user_uuid is incorrect, this should be the users account idDavid Marcec2019-06-251-1/+3
| * | | fixed spelling errors and fixed issue with Pop not returning the SizedNotificationInfoDavid Marcec2019-06-251-6/+8
| * | | Implemented INotificationServiceDavid Marcec2019-06-244-1/+126
| |/ /
* | / file_sys: Rename other ContentRecordType membersBakugo2019-07-021-2/+2
| |/ |/|
* | Merge pull request #2548 from DarkLordZach/applet-shopnbunnei2019-06-2613-112/+690
|\ \
| * | applets: Pass current process title ID to appletsZach Hilman2019-06-2511-41/+59
| * | general_frontend: Add documentation for parental controls and ecommerce appletsZach Hilman2019-06-252-16/+16
| * | web_browser: Only delete temporary directory if it was createdZach Hilman2019-06-251-1/+3
| * | web_browser: Take ECommerce applet frontend optionally in constructorZach Hilman2019-06-251-1/+6
| * | web_browser: Use function tables for execute and initializeZach Hilman2019-06-252-7/+285
| * | web_browser: Correct structures and properly parse TLVs/ShimKindZach Hilman2019-06-252-61/+168
| * | applets: Track ECommerce and Parental Control applet frontendsZach Hilman2019-06-252-7/+29
| * | applets: Implement Auth applet backendZach Hilman2019-06-252-0/+146
| |/
* | glue: Correct missing bytes in ApplicationLaunchParameterZach Hilman2019-06-264-28/+61
* | glue: Implement arp:w and arp:r servicesZach Hilman2019-06-253-2/+330
* | glue: Add errors for glue/arp servicesZach Hilman2019-06-253-0/+58
* | glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
* | arp: Move to glue servicesZach Hilman2019-06-252-91/+0
* | glue: Add manager to keep track of application registryZach Hilman2019-06-252-0/+119
|/
* Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\
| * service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
* | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-218-43/+95
|\ \ | |/ |/|
| * loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-263-6/+7
| * prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| * fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| * service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| * applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| * applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
* | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
* | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \
| * | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
* | | Addressed issuesDavid Marcec2019-06-173-8/+13
* | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
* | | CleanupDavid Marcec2019-06-1611-29/+38
* | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-166-7/+72
* | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-122-7/+7
|/ /
* | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-071-16/+4
* | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \
| * | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
* | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ | |/ / |/| |
| * | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| * | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| * | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
* | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-052-5/+37
|\ \ \
| * | | core/core: Remove unnecessary includesLioncash2019-05-292-5/+37
| |/ /
* | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-052-5/+7
|\ \ \
| * | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-052-3/+3
| * | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-052-5/+7
* | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-057-402/+1073
|\ \ \ \ | |/ / / |/| | |
| * | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| * | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| * | | Address review commentsMichael Scire2019-05-235-45/+118
| * | | clang-format fixesMichael Scire2019-05-234-31/+32
| * | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-236-403/+1002
* | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-308-104/+1051
|\ \ \ \ | |_|/ / |/| | |
| * | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| * | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-253-6/+6
| * | | mii: Implement Delete and Destroy fileZach Hilman2019-04-253-8/+116
| * | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| * | | mii_manager: Cleanup and optimizationZach Hilman2019-04-253-36/+50
| * | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-251-15/+242
| * | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| * | | common: Extract UUID to its own classZach Hilman2019-04-253-78/+28
* | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ | |_|_|/ |/| | |
| * | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| * | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| * | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| | |/ | |/|
* | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-251-1/+1
|\ \ \ | |/ / |/| |
| * | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-181-1/+1
* | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \
| * | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| * | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| * | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |/ | |/|
* | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \
| * | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
| | |/ | |/|
* | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \
| * | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ /
* / / core/kernel/object: Rename ResetType enum membersLioncash2019-05-1814-26/+26
|/ /
* / service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
|/
* Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2514-63/+487
|\
| * web_browser: Make OpenPage non-constZach Hilman2019-04-178-15/+20
| * main: Add GMainWindow hooks for Error displayZach Hilman2019-04-171-2/+2
| * general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| * applets: Add Error appletZach Hilman2019-04-173-24/+224
| * applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| * am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| * applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
* | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
|/
* Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\
| * service: Update service function tablesLioncash2019-04-1127-57/+262
* | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \
| * | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| * | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| |/
* | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-141-6/+10
|\ \
| * | added a toggle to force 30fps modezarroboogs2019-04-091-6/+10
* | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
* | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| |/ |/|
* | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-104-10/+9
|\ \ | |/ |/|
| * patch_manager: Dump NSO name with build IDZach Hilman2019-03-281-2/+1
| * game_list: Register content with ContentProviderZach Hilman2019-03-271-2/+3
| * core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-273-9/+8
* | Merge pull request #2334 from lioncash/overridebunnei2019-04-069-18/+5
|\ \
| * | core: Add missing override specifiers where applicableLioncash2019-04-049-18/+5
* | | Merge pull request #2339 from lioncash/rankbunnei2019-04-063-12/+15
|\ \ \
| * | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-052-4/+4
| * | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| * | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-051-1/+3
| |/ /
* | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \
| * | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| |/ /
* / / hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
|/ /
* | Merge pull request #2328 from lioncash/transferbunnei2019-04-041-6/+6
|\ \
| * | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
* | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ | |/ / |/| |
| * | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| * | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
| |/
* | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-011-1/+1
|\ \
| * | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-291-1/+1
| |/
* | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-011-1/+1
* | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
* | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
* | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/
* core/core_timing: Make callback parameters consistentLioncash2019-03-243-8/+8
* Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-232-2/+79
|\
| * set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| * set_sys: Use official nintendo version stringZach Hilman2019-03-111-11/+7
| * set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| * set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-102-2/+63
* | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-221-12/+4
|\ \
| * | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-211-10/+2
| * | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-211-2/+2
* | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-221-5/+3
|\ \ \
| * | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-211-5/+3
* | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \
| * | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / /
* | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-221-0/+3
|\ \ \ \ | |/ / / |/| | |
| * | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-051-0/+2
| * | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
* | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-215-74/+74
|\ \ \ \ | |_|/ / |/| | |
| * | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-065-74/+74
* | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \
| * | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
* | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \
| * | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| * | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| * | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
* | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
|/ / / / /
* | | | | gpu: Use host address for caching instead of guest address.bunnei2019-03-151-1/+2
* | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-131-1/+1
|\ \ \ \ \
| * | | | | kernel/server_port: Make data members privateLioncash2019-03-111-1/+1
| |/ / / /
* | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-131-2/+1
|\ \ \ \ \
| * | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-101-2/+1
| |/ / / /
* | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-138-40/+131
|\ \ \ \ \
| * | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| * | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
* | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| |/ / / / |/| | | |
* | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| * | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| * | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| * | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
* | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-071-1/+1
|\ \ \ \ \
| * | | | | kernel/server_session: Make data members privateLioncash2019-03-061-1/+1
| | |_|_|/ | |/| | |
* | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \
| * | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-074-15/+5
|\ \ \ \ \
| * | | | | gpu: Move command processing to another thread.bunnei2019-03-071-1/+1
| * | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-073-14/+4
| |/ / / /
* | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-072-0/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-052-0/+4
| |/ / /
* | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
* | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-053-10/+20
|/ / /
* | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \
| * | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
* | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / /
* | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
* | | Merge pull request #2169 from lioncash/namingbunnei2019-02-271-13/+13
|\ \ \
| * | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-271-13/+13
* | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-275-6/+6
|/ / /
* / / service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
|/ /
* | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
* | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
* | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
* | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-206-57/+119
* | core_timing: Convert core timing into a classLioncash2019-02-1627-60/+92
* | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1216-38/+33
* | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
* | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
* | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
* | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
|/
* Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\
| * hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| * hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| * hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| * hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| * hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
* | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \
| * | service/ns: Update function tablesLioncash2019-01-301-14/+20
| * | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| * | service/audio: Update function tablesLioncash2019-01-304-8/+23
| * | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| * | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| * | service/btm: Update function tablesLioncash2019-01-301-55/+97
| * | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| * | service/psc: Update function tablesLioncash2019-01-301-8/+9
* | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
* | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
| |/ |/|
* | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
* | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
* | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
* | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
* | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
|/
* service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
* service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
* service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
* core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
* core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-171-1/+1
* Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-101-7/+9
|\
| * settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-081-6/+4
| * time: Use custom RTC settings if applicable for gameZach Hilman2019-01-081-6/+10
* | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-108-583/+898
|\ \ | |/ |/|
| * travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-292-3/+2
| * web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-294-132/+134
| * core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-281-1/+1
| * applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-283-0/+232
| * hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| * am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
* | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \
| * | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| * | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| * | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
* | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \
| * | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ /
* | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \
| * | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
* | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ | |_|/ / |/| | |
| * | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ /
* | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \
| * | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| * | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
* | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| |/ / |/| |
* | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \
| * | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| |/ /
* | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
* | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \
| * | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| |/ /
* / / core/kernel: Remove unnecessary inclusionsLioncash2019-01-014-3/+4
|/ /
* | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-301-1/+2
|\ \
| * | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-291-1/+2
* | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
* | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
| |/ |/|
* | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-281-11/+16
* | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \
| * | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
* | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \
| * | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
* | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-272-2/+47
* | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
|/ / /
* | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-233-0/+131
|\ \ \
| * | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-034-13/+5
| * | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| * | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| * | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
* | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ | |_|/ / |/| | |
| * | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
* | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \
| * | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
* | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| |/ / /
* | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ | |/ / / |/| | |
| * | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
* | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \
| * | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
* | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
|/ / / /
* | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \
| * | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| |/ / /
* | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-111-0/+12
|\ \ \ \
| * | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| | |/ / | |/| |
* | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \
| * | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
| | |/ / | |/| |
* | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \
| * | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| * | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
* | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| * | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| * | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| * | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| |/ / /
* / / / service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
|/ / /
* | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-051-0/+10
|\ \ \ | |/ / |/| |
| * | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
* | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-033-19/+6
|\ \ \
| * | | filesystem: De-globalize registered_cache_unionLioncash2018-12-023-19/+6
* | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0324-176/+230
|\ \ \ \
| * | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-294-6/+4
| * | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2922-186/+122
| * | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2924-148/+268
* | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-033-1/+35
|\ \ \ \ \
| * | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-013-1/+35
| | |/ / / | |/| | |
* | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \
| * | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| |/ / / /
* | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \
| * | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|/ | |/| | |
* | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
* | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / /
* | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ | |/ / / |/| | |
| * | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| |/ /
* | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
* | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ /
* | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2950-366/+654
|\ \
| * | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-272-8/+10
| * | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| * | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| * | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2650-363/+636
* | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \
| * | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
* | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-281-5/+10
|\ \ \ \
| * | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-281-8/+6
| * | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-271-3/+10
| |/ / /
* | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
* | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ | |/ / / |/| | |
| * | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
* | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| |/ /
* | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ | |/ / |/| |
| * | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
* | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \
| * | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
* | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \
| * | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
* | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-242-13/+31
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| * | | | Report resolution scaling support for vi and amDavid Marcec2018-11-162-13/+29
* | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-233-4/+100
|\ \ \ \ \
| * | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| * | | | | applets: Add StubAppletZach Hilman2018-11-222-0/+96
* | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \
| * | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
* | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
* | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / /
* | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| * | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| * | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
* | | | | | am: Correct build failureLioncash2018-11-211-2/+2
* | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| | |/ / / | |/| | |
* | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-206-103/+696
|\ \ \ \ \
| * | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| * | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| * | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| * | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| * | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| * | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| * | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| * | | | | applet: Add operation completed callbackZach Hilman2018-11-182-3/+5
| * | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| * | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-183-6/+20
| * | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-184-36/+34
| * | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-181-4/+8
| * | | | | am: Implement text check software keyboard modeZach Hilman2018-11-183-14/+95
| * | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-186-27/+44
| * | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| * | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-182-0/+128
| * | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-182-0/+75
| * | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| * | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| * | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| * | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| * | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| * | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
* | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
* | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-194-174/+61
* | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
* | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
* | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
* | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
* | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
* | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
* | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
* | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
* | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
* | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
* | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
* | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / |/| | | |
* | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-192-14/+391
|\ \ \ \ \
| * | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-181-7/+20
| * | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| * | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| * | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| * | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| * | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
* | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \
| * | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
* | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|_|/ / | |/| | | |
* | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
* | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \
| * | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | |_|_|/ / | |/| | | |
* | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| |_|/ / / |/| | | |
* | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-162-4/+11
|\ \ \ \ \
| * | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
* | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-162-11/+11
|\ \ \ \ \ \
| * | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-162-11/+11
| | |/ / / / | |/| | | |
* / | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / /
* | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
* | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \
| * | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-152-4/+22
|\ \ \ \ \
| * | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-292-4/+22
* | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
* | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \
| * | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| * | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
| |/ / / / /
* | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \
| * | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / /
* | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \
| * | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
* | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \
| * | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / /
* | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \
| * | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / /
* | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-145-2/+227
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-292-15/+73
| * | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| * | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| * | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-292-0/+11
| |/ / / /
* | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-132-2/+11
|\ \ \ \ \
| * | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| * | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| * | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| * | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
* | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-106-35/+138
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | FixupsDavid Marcec2018-11-071-1/+1
| * | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-076-35/+138
* | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \
| * | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| |/ / / /
* | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
* | | | | Added missing logDavid Marcec2018-11-071-0/+1
* | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
|/ / / /
* | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \
| * | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
* | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
| |_|_|/ |/| | |
* | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / /
* | | Merge pull request #1615 from lioncash/inputbunnei2018-11-021-1/+2
|\ \ \
| * | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-311-1/+2
| |/ /
* | / service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
| |/ |/|
* | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-306-19/+21
|/
* service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
* Merge pull request #1569 from lioncash/amiibobunnei2018-10-262-3/+5
|\
| * yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-242-3/+5
* | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
* | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \
| * | service/usb: Update service function tablesLioncash2018-10-251-21/+22
* | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \
| * | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| * | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| * | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ /
* | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-253-43/+48
|\ \ \
| * | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-243-43/+48
| |/ /
* | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \
| * | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |/ | |/|
* | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ | |_|/ |/| |
| * | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/
* | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-242-13/+37
* | acc: Fix account UUID duplication errorZach Hilman2018-10-244-17/+47
* | configure_system: Clear selection after user deleteZach Hilman2018-10-241-1/+1
* | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-244-26/+129
* | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
* | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
* | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
|/
* Added Amiibo support (#1390)David2018-10-243-50/+294
* Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-241-1/+5
|\
| * fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
* | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-223-0/+88
|\ \
| * | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| * | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| * | service: Add skeleton for psm serviceZach Hilman2018-10-213-0/+72
* | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-213-2/+107
* | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
* | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-213-0/+42
* | | am: Update service function tablesLioncash2018-10-214-15/+60
* | | prepo: Update service function table.Lioncash2018-10-211-8/+13
* | | lbl: Update service function table namesLioncash2018-10-211-28/+28
* | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
|/ /
* | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \
| * | es: Update service function tablesLioncash2018-10-191-7/+11
| * | audio: Update service function tablesLioncash2018-10-191-17/+20
| * | omm: Update service function tablesLioncash2018-10-191-16/+18
| * | nifm: Update service function tablesLioncash2018-10-191-0/+1
| * | hid: Update service function tablesLioncash2018-10-191-6/+45
| * | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| * | ns: Update service function tableLioncash2018-10-191-6/+49
| * | set_cal: Update service function tableLioncash2018-10-191-1/+2
* | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \
| * | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
* | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ | |/ / / |/| | |
| * | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| * | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| * | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| * | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| * | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| * | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| * | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| * | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
* | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / |/| |
* | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
|/ /
* | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1821-648/+1702
|\ \ | |/ |/|
| * Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| * WipDavid Marcec2018-10-122-3/+23
| * Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| * Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| * Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| * Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| * Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| * Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| * Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| * "Better Hid" rework part 1David Marcec2018-10-1021-644/+1482
* | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
* | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-163-12/+11
* | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-161-3/+15
|\ \
| * | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-151-2/+13
| * | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
* | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-134-14/+13
|/ /
* | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \
| * | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| * | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| |/
* | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \
| * | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| * | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/
* | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \
| * | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/
* / nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
|/
* Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\
| * Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
* | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
|/
* Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-072-0/+10
|\
| * romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-052-0/+10
* | Ported #4296 from citraDavid Marcec2018-10-061-0/+19
|/
* Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\
| * aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
* | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \
| * | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
* | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| |/ |/|
* | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-011-20/+26
* | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-012-3/+5
* | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
|/
* Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\
| * Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
* | kernel/process: Make data member variables privateLioncash2018-09-302-4/+4
* | Merge pull request #1394 from lioncash/streambunnei2018-09-271-1/+1
|\ \
| * | stream: Preserve enum class type in GetState()Lioncash2018-09-241-1/+1
* | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \
| * | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
* | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-252-1/+14
|\ \ \ \ | |/ / / |/| | |
| * | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
* | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
* | | | Stubbed IRS (#1349)David2018-09-242-18/+167
* | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ | |_|/ / |/| | |
| * | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
* | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-231-1/+8
| |/ / |/| |
* | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \
| * | | Fixed submitDavid Marcec2018-09-201-2/+1
| * | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
* | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
|/ / /
* | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
* | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
* | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
* | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \
| * | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ /
* / / Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ /
* | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \
| * | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
* | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \
| * | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| |/ /
* | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \
| * | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| * | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| * | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| |/ /
* / / Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-191-2/+3
|/ /
* | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \
| * | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
* | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \
| * | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ /
* | / Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1515-50/+53
| |/ |/|
* | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-141-1/+1
|\ \
| * | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-131-1/+1
| |/
* | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \
| * | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/
* / services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
|/
* Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\
| * pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
* | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \
| * | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/
* / service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
|/
* Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\
| * hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
* | externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/
* Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-111-1/+25
* video_core: Move command buffer loop.Markus Wick2018-09-102-31/+12
* Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-101-4/+4
|\
| * hid: Implement ReloadInputDevicesfearlessTobi2018-09-091-4/+4
* | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
|/
* core/core: Remove unnecessary sm/controller includeLioncash2018-09-064-1/+5
* bktr: Fix bucket overlap errorZach Hilman2018-09-041-1/+1
* registration: Add RegisteredCacheUnionZach Hilman2018-09-042-0/+10
* Merge pull request #1235 from lioncash/forward-declbunnei2018-09-041-1/+3
|\
| * file_sys: Replace includes with forward declarations where applicableLioncash2018-09-041-1/+3
* | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ | |/ |/|
| * ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
* | service: Migrate global named port map to the KernelCore classLioncash2018-09-022-14/+2
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-022-2/+30
|\ \
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-311-0/+1
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-311-0/+1
* core: Make the main System class use the PImpl idiomLioncash2018-08-312-2/+4
* kernel: Eliminate kernel global stateLioncash2018-08-2912-23/+51
* gpu: Make memory_manager privateLioncash2018-08-281-6/+6
* Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\
| * Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| * Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
* | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \
| * | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
* | | set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
* | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \
| * | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ /
* | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-252-12/+36
|\ \ \ | |/ / |/| |
| * | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-232-8/+11
| * | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| |/
* / Added GetBootMode (#1107)David2018-08-244-3/+25
|/
* Added missing include for pl:uDavid Marcec2018-08-221-0/+1
* PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
* Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-223-2/+3
|\
| * vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-213-2/+3
* | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
|/
* Merge pull request #1129 from lioncash/headerbunnei2018-08-213-5/+19
|\
| * service/filesystem: Use forward declarations where applicableLioncash2018-08-213-5/+19
* | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ | |/ |/|
| * acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| * acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| * acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| * acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| * profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| * profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| * profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| * profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| * profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| * profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| * profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| * profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| * profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
* | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-214-16/+50
|\ \ | |/ |/|
| * filesystem: Add support for loading of system archivesZach Hilman2018-08-194-16/+50
* | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \
| * | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| |/
* | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2012-74/+438
|\ \ | |/ |/|
| * Better UUID randomnessDavid Marcec2018-08-111-2/+7
| * Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| * Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| * Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| * Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| * fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| * Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| * Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| * Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| * If statement style changeDavid Marcec2018-08-111-11/+19
| * Second round of account changesDavid Marcec2018-08-113-18/+21
| * First round of account changesDavid Marcec2018-08-113-49/+55
| * Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| * Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1115-34/+76
| |\
| * | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| * | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| * | Open first user addedDavid Marcec2018-08-081-1/+3
| * | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| * | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| * | began initial implementation of "ProfileManager"David Marcec2018-08-084-44/+200
| * | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
* | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
* | | correct coding stylegreggameplayer2018-08-161-1/+1
* | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
* | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-162-4/+23
|\ \ \
| * | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
* | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \
| * | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| * | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
* | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \
| * | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| |/ / / /
* / / / / kernel/server_session: Add IsSession() member functionLioncash2018-08-151-1/+1
|/ / / /
* | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \
| * | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| * | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
* | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \
| * | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / /
* | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
* | | | | Added missing channel devicesDavid Marcec2018-08-134-0/+140
|/ / / /
* | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-121-1/+1
* | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \
| * | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
* | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-121-5/+26
|\ \ \ \ \
| * | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-121-4/+2
| * | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-121-5/+28
| | |/ / / | |/| | |
* | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
* | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| |/ / / |/| | |
* | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
|/ / /
* | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
* | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
* | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-111-0/+1
| |/ |/|
* | Merge pull request #997 from lioncash/const-funcbunnei2018-08-102-2/+2
|\ \
| * | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
* | | Merge pull request #990 from lioncash/entrybunnei2018-08-101-6/+3
|\ \ \
| * | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-091-5/+1
| * | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
* | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-104-12/+17
|\ \ \ \ | |_|/ / |/| | |
| * | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-094-11/+16
| * | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
* | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ | |/ / / |/| | |
| * | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |/ | |/|
* | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \
| * | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
* | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ | |_|_|/ |/| | |
| * | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ /
* | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ | |_|/ |/| |
| * | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| |/
* | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \
| * | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
* | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ /
* / acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
|/
* Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\
| * nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
* | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \
| * | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/
* | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \
| * | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/
* | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \
| * | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| * | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/
* | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \
| * | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/
* | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \
| * | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| * | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/
* / service: Add usb servicesLioncash2018-08-073-0/+255
|/
* Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
* Merge pull request #925 from bunnei/audrenbunnei2018-08-064-233/+16
|\
| * audio_core: Implement audren_u audio playback.bunnei2018-08-052-218/+9
| * audio_core: Use s16 where possible for audio samples.bunnei2018-08-051-3/+3
| * audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-052-11/+3
| * audio_core: Streams need unique names for CoreTiming.bunnei2018-08-041-1/+1
* | Merge pull request #912 from lioncash/global-varbunnei2018-08-053-10/+13
|\ \
| * | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-041-2/+2
| * | video_core: Eliminate the g_renderer global variableLioncash2018-08-043-10/+13
| |/
* | Merge pull request #924 from lioncash/arpbunnei2018-08-053-0/+93
|\ \
| * | service: Add arp servicesLioncash2018-08-053-0/+93
| |/
* / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/
* Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-034-5/+45
* Merge pull request #898 from lioncash/migbunnei2018-08-033-0/+51
|\
| * service: Add migration servicesLioncash2018-08-023-0/+51
* | Merge pull request #894 from lioncash/objectbunnei2018-08-033-8/+8
|\ \
| * | kernel: Move object class to its own source filesLioncash2018-08-023-8/+8
| |/
* | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \
| * | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
* | | service: Add psc servicesLioncash2018-08-023-0/+94
| |/ |/|
* | Merge pull request #888 from lioncash/capsbunnei2018-08-023-0/+169
|\ \
| * | service: Add capture servicesLioncash2018-08-013-0/+169
| |/
* | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \
| * | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/
* | Merge pull request #889 from lioncash/fspbunnei2018-08-025-0/+85
|\ \
| * | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-015-0/+85
| |/
* / service: Add bpc and pcv servicesLioncash2018-08-015-0/+175
|/
* Merge pull request #880 from lioncash/audiobunnei2018-08-0113-0/+277
|\
| * service/audio: Add missing servicesLioncash2018-08-0113-0/+277
* | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ | |/ |/|
| * audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
* | Merge pull request #869 from Subv/ubsanbunnei2018-07-312-6/+17
|\ \
| * | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| * | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
* | | Merge pull request #875 from lioncash/fgmbunnei2018-07-313-0/+92
|\ \ \
| * | | service: Add fgm servicesLioncash2018-07-313-0/+92
* | | | Merge pull request #874 from lioncash/ambunnei2018-07-317-0/+150
|\ \ \ \ | |_|_|/ |/| | |
| * | | service/am: Add missing am servicesLioncash2018-07-317-0/+150
| |/ /
* / / service: Add the pcie serviceLioncash2018-07-313-0/+81
|/ /
* | audio_core: Move to audout_u impl.bunnei2018-07-312-4/+6
* | Implemented various hwopus functions (#853)David2018-07-312-5/+131
* | Merge pull request #857 from lioncash/wlanbunnei2018-07-303-1/+190
|\ \
| * | service: Add wlan servicesLioncash2018-07-293-1/+190
* | | Merge pull request #856 from lioncash/btmbunnei2018-07-303-0/+138
|\ \ \
| * | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| * | | service: Add btm servicesLioncash2018-07-293-0/+104
| |/ /
* / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ /
* | Merge pull request #847 from lioncash/ncmbunnei2018-07-283-0/+76
|\ \
| * | service: Add ncm servicesLioncash2018-07-273-0/+76
* | | Merge pull request #846 from lioncash/miibunnei2018-07-283-0/+124
|\ \ \
| * | | service: Add mii servicesLioncash2018-07-273-0/+124
* | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| |/ / |/| |
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-273-0/+239
|\ \ \
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| * | | service: Add nfc servicesLioncash2018-07-273-0/+200
| |/ /
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-273-0/+107
|\ \ \
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-271-3/+35
| * | | service: Add the lbl serviceLioncash2018-07-273-0/+75
| |/ /
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-273-1/+91
|\ \ \ | |/ / |/| |
| * | service: Add the btdrv serviceLioncash2018-07-273-1/+91
* | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
* | | service/hid: Add the xcd:sys serviceLioncash2018-07-263-0/+55
* | | service/hid: Add irs servicesLioncash2018-07-263-0/+73
|/ /
* | Merge pull request #834 from lioncash/grcbunnei2018-07-263-0/+48
|\ \
| * | service: Add the grc:c serviceLioncash2018-07-263-0/+48
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-263-0/+141
|\ \ \
| * | | service: Add the nim servicesLioncash2018-07-263-0/+141
| |/ /
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-263-0/+160
|\ \ \
| * | | service: Add ldn servicesLioncash2018-07-263-0/+160
| |/ /
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-265-0/+93
|\ \ \ | |_|/ |/| |
| * | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-263-0/+64
| * | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/
* | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ | |/ |/|
| * lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| * lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| * lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
* | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-263-0/+99
|\ \
| * | service: Add ldr servicesLioncash2018-07-263-0/+99
* | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-265-0/+139
|\ \ \
| * | | service: Add eupld servicesLioncash2018-07-263-0/+70
| * | | service: Add the erpt servicesLioncash2018-07-263-0/+69
| | |/ | |/|
* | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-268-135/+30
|\ \ \ | |_|/ |/| |
| * | service/nifm: Deduplicate interface codeLioncash2018-07-258-135/+30
* | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \
| * | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| * | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ /
* | | Merge pull request #822 from lioncash/pmbunnei2018-07-263-0/+88
|\ \ \ | |_|/ |/| |
| * | service: Add pm servicesLioncash2018-07-253-0/+88
| |/
* / service: Add the es serviceLioncash2018-07-253-0/+75
|/
* Merge pull request #801 from lioncash/timeMat M2018-07-255-60/+14
|\
| * time: Add the time:a serviceLioncash2018-07-253-10/+11
| * time: Simplify interface creationLioncash2018-07-245-60/+13
* | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-255-0/+5
|\ \
| * | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-245-0/+5
| |/
* | Merge pull request #800 from lioncash/setbunnei2018-07-252-5/+25
|\ \
| * | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| |/
* | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
* | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
* | friend: Deduplicate interfacesLioncash2018-07-245-44/+9
* | Merge pull request #797 from lioncash/explicitbunnei2018-07-242-2/+2
|\ \
| * | core: Make converting constructors explicit where applicableLioncash2018-07-242-2/+2
| |/
* / apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
|/
* VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-241-16/+29
* Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\
| * vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| * vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
* | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
|/
* set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
* set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
* file_util, vfs: Use std::string_view where applicableLioncash2018-07-221-1/+1
* Merge pull request #760 from lioncash/pathbunnei2018-07-222-3/+3
|\
| * file_util: Use an enum class for GetUserPath()Lioncash2018-07-212-3/+3
* | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/
* apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
* Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\
| * HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
* | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ | |/ |/|
| * audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| * audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
* | pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/
* Merge pull request #726 from lioncash/overloadbunnei2018-07-203-4/+4
|\
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-193-4/+4
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ /
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/|
* | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \
| * | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| * | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
* | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \
| * | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
* | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \
| * | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / /
* | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / /
* | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ | |_|_|/ |/| | |
| * | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
| |/ /
* | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ | |_|/ |/| |
| * | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| * | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| * | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| * | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| * | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| * | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/
* | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
* | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
* | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
|/
* Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\
| * service/prepo: Add missing header guardLioncash2018-07-191-0/+2
* | Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-195-116/+383
|/
* Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
* Single touch supportZach Hilman2018-07-181-4/+19
* vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
* vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
* vi: Partially implement buffer crop parameters.bunnei2018-07-186-10/+26
* General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-175-101/+130
* nvflinger: Fix for BufferQueue event handling.bunnei2018-07-174-29/+10
* HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
* Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
* We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
* initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
* Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\
| * Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
* | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
|/
* Merge pull request #559 from Subv/mount_savedatabunnei2018-07-121-2/+11
|\
| * Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-191-2/+11
* | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
* | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
* | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
* | Revert "Virtual Filesystem (#597)"bunnei2018-07-085-405/+71
* | Virtual Filesystem (#597)Zach Hilman2018-07-065-71/+405
* | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
* | Update clang formatJames Rowe2018-07-0311-37/+35
* | Rename logging macro back to LOG_*James Rowe2018-07-0343-322/+322
* | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
* | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
* | Merge pull request #588 from mailwl/hwopusbunnei2018-06-283-0/+51
|\ \
| * | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-253-0/+51
* | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ /
* | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
* | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
* | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
* | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-202-2/+3
* | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
* | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
* | Move loop condition to free functionZach Hilman2018-06-131-4/+9
* | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
* | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
|/
* Common/string_util: add StringFromBuffer functionmailwl2018-06-071-22/+9
* Merge pull request #522 from mailwl/mm-ubunnei2018-06-073-0/+81
|\
| * Remove unused header filesmailwl2018-06-061-2/+0
| * Small fixesmailwl2018-06-052-6/+8
| * Service/MM: add service and stub some functionsmailwl2018-06-053-0/+81
* | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \
| * | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| * | Correct function resultsmailwl2018-06-041-4/+16
| * | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
* | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
* | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
* | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| |/ |/|
* | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
* | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
* | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
* | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/
* am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
* am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
* am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
* am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
* Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-033-0/+72
|\
| * Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-303-0/+72
* | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
* | add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-301-0/+30
* | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
* | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
|/
* Service/BCAT: add module and servicesmailwl2018-05-285-0/+114
* Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\
| * NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
* | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
|/
* Add & correct miscellaneous things (#470)greggameplayer2018-05-263-4/+52
* Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\
| * Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
* | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
* | Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/
* Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
* change some functionsgreggameplayer2018-05-231-6/+6
* correct placement and add size checkgreggameplayer2018-05-231-21/+25
* Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
* Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
* Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-214-1/+98
|\
| * GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| * GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-202-0/+50
* | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
* | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \
| * | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| * | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| * | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/
* | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-201-0/+2
|\ \
| * | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-171-0/+2
| |/
* / Updated nfp with more service namesHexagon122018-05-131-24/+24
|/
* More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
* Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
* hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-072-68/+220
* general: Make formatting of logged hex values more straightforwardLioncash2018-05-0214-24/+24
* Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\
| * GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
* | GetSharedFontInOrderOfPriority (#381)David2018-05-012-1/+27
|/
* core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-305-7/+8
* string_util: Remove StringFromFormat() and related functionsLioncash2018-04-301-3/+2
* am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
* set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
* general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-272-3/+3
* Switched to NGLOG_WARNINGDavid Marcec2018-04-273-4/+4
* Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-2643-341/+455
|\
| * Service/PCTL: convert to module, add services, stubmailwl2018-04-256-37/+69
| * service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| * vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| * time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| * ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| * sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| * set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| * pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| * nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| * ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| * nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| * friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| * fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| * apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| * acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
| * Service/FS: implement IFileSystem::RenameFilemailwl2018-04-241-1/+21
| * Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-232-4/+8
| |\
| | * Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-212-4/+8
| * | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
| |\ \
| | * | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| | * | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| * | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ /
* | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-262-13/+2
* | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-239-25/+63
* | | lioncash proposed changesDavid2018-04-221-2/+2
* | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2210-11/+107
|/ /
* | core: Relocate g_service_manager to the System classLioncash2018-04-214-32/+32
* | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ | |/ |/|
| * Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
* | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \
| * | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
* | | vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ /
* / nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
|/
* Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1712-3/+199
* Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\
| * pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
* | fsp_srv: Implement DeleteFile.bunnei2018-04-151-1/+15
|/
* fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
* Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\
| * Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
* | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/
* Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\
| * Various fixes and clangHexagon122018-04-116-115/+108
| * Decimal changeHexagon122018-04-101-4/+4
| * Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| * Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| * Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| * Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| * Updated hid with more service names.Hexagon122018-04-101-0/+50
| * Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| * Updated the unknown nameHexagon122018-04-101-1/+1
| * Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| * Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| * Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| * Updated audren with more service names.Hexagon122018-04-101-10/+14
| * Updated audrec with more service names.Hexagon122018-04-101-7/+9
| * Updated audout with more service names.Hexagon122018-04-101-13/+16
| * Updated audin with more service names.Hexagon122018-04-101-9/+16
| * Updated AOC with more service names.Hexagon122018-04-101-0/+1
| * Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| * Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| * Updated AM with more service names.Hexagon122018-04-101-2/+82
* | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
* | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1010-127/+336
|/
* Fix spelling of InitializeJames Rowe2018-04-072-3/+3
* audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
* audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
* nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
* vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
* service: Add friend:u interface.bunnei2018-04-033-0/+39
* externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
* Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\
| * hid: Write empty touch screen state.bunnei2018-04-011-5/+21
* | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-011-2/+2
* | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
* | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-311-2/+21
|/
* audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
* service: Add NFP module interface.bunnei2018-03-305-0/+95
* config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-271-5/+5
* config: Add setting for whether the system is docked or not.bunnei2018-03-271-2/+6
* Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\
| * audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| * hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| * pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
* | Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-257-30/+92
|/
* Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-242-6/+7
|\
| * renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-231-6/+0
| * renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-232-3/+3
| * nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| * video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-231-3/+3
* | Merge pull request #255 from Subv/sd_cardbunnei2018-03-243-2/+106
|\ \
| * | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-211-0/+15
| * | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| * | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| * | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| * | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-202-0/+6
* | | Service/SSL: add ssl servicemailwl2018-03-233-0/+41
* | | Service/spl: add module and servicesmailwl2018-03-227-0/+168
| |/ |/|
* | Service/vi: convert services to modulemailwl2018-03-218-212/+160
* | Service: add fatal:u, fatal:p servicesmailwl2018-03-207-0/+138
* | Clang FixesN00byKing2018-03-191-2/+2
* | oopsN00byKing2018-03-191-3/+3
* | Clean Warnings (?)N00byKing2018-03-195-7/+7
|/
* vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
* hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-191-2/+1
* nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
* IGeneralService: fix function listmailwl2018-03-161-2/+3
* Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
* Service/NIFM: convert to modulemailwl2018-03-168-122/+75
* core: Move process creation out of global state.bunnei2018-03-142-6/+7
* Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-045-2/+55
|\
| * FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| * FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-043-2/+40
* | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/
* Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\
| * Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
* | Service/Set: add more servicesmailwl2018-03-0311-10/+340
|/
* FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
* Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-022-2/+10
* Merge pull request #212 from mailwl/stubsbunnei2018-02-248-7/+99
|\
| * Stub more functionsmailwl2018-02-226-7/+79
| * Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-224-0/+20
* | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
|/
* time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
* Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-2/+26
|\
| * Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-2/+26
* | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
* | service: Add Friend service interface.bunnei2018-02-195-0/+96
|/
* AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
* Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\
| * nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| * Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| * Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| * Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| * nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| * Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| * Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| * Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| * Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
* | Service/hid: stub some functionsmailwl2018-02-162-1/+45
* | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-155-0/+178
* | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/
* Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-158-108/+39
|\
| * service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| * audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| * vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| * nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| * vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| * vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
* | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
* | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
* | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
* | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
* | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
* | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
* | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
|/
* audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
* Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\
| * vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| * vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| * TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
* | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
|/
* Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\
| * Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
* | Merge pull request #178 from Subv/command_buffersbunnei2018-02-127-172/+18
|\ \ | |/ |/|
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-127-181/+15
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-123-3/+5
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-104-58/+100
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
* nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
* IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
* nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
* acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-082-0/+160
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-063-2/+22
|\
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
* | Extra nvdrv support (#162)David2018-02-0616-37/+761
|/
* Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
* logger: Add Time service logging category.bunnei2018-02-051-10/+10
* logger: Add SET service logging category.bunnei2018-02-051-1/+1
* logger: Add PCTL service logging category.bunnei2018-02-051-1/+1
* logger: Add LM service logging category.bunnei2018-02-051-2/+2
* logger: Add APM service logging category.bunnei2018-02-051-2/+3
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
* logger: Add NIFM service logging category.bunnei2018-02-054-11/+11
* logger: Add VI service logging category.bunnei2018-02-054-21/+20
* hid: Stub out several functions.bunnei2018-02-051-1/+39
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
* logger: Add AM service logging category.bunnei2018-02-043-42/+42
* logger: Add "account" service logging category.bunnei2018-02-041-8/+8
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
* acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-039-0/+370
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-026-379/+569
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
* | Services/vi: add vi:s and vi:u servicesmailwl2018-02-025-0/+124
|/
* [WIP] sfdnsres: stub (#146)mailwl2018-01-304-2/+51
* time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
* audout_u: Various cleanups.bunnei2018-01-251-29/+17
* ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-252-2/+3
* time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
* hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2517-107/+107
* service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
* hle: Integrate Domain handling into ServerSession.bunnei2018-01-251-7/+5
* hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-251-1/+0
* audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-14/+166
* Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
* Merge pull request #135 from Subv/no_portsbunnei2018-01-234-61/+62
|\
| * Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| * Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| * HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| * LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
* | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ | |/ |/|
| * AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| * AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| * Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
* | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ | |/ |/|
| * Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
* | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-228-363/+448
|/
* Added stubs for audio services. (#116)st4rk2018-01-2211-5/+299
* Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\
| * nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| * nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
* | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-217-5/+158
* | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \
| * | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| |/
* | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-213-48/+72
* | filesystem: Implement basic IStorage functionality.David Marcec2018-01-215-0/+254
|/
* service/time: remove accidental #pragmastgsm2018-01-212-4/+0
* Format: Run the new clang format on everythingJames Rowe2018-01-214-5/+7
* Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-201-0/+1
* Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-201-1/+1
* Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\
| * ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
* | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-197-0/+159
|/
* Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-192-0/+13
|\
| * nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
* | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \
| * | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
* | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
* | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ /
* / Fix dispdrv typogdkchan2018-01-191-1/+1
|/
* Merge pull request #100 from Rozelette/masterbunnei2018-01-196-32/+109
|\
| * time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| * time: Refactor time:* to use a single shared moduleRozlette2018-01-186-26/+103
* | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-181-0/+86
* | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-186-0/+154
* | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ | |/ |/|
| * lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
* | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \
| * | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| * | vi: Add missing override specifiersLioncash2018-01-181-7/+7
* | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ | |_|/ |/| |
| * | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/
* / controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
|/
* TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-174-83/+164
* Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\
| * hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
* | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
|/
* Merge pull request #60 from jroweboy/game-framebunnei2018-01-171-0/+3
|\
| * UI: Fix frame rate perf statsJames Rowe2018-01-171-0/+3
* | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ | |/ |/|
| * hid: clang-formatshinyquagsire232018-01-171-3/+3
| * hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| * hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
* | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-175-0/+82
* | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
* | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-173-14/+16
* | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
* | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
* | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
* | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
* | Merge pull request #52 from ogniK5377/fspbunnei2018-01-171-0/+53
|\ \
| * | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| |/
* / clang-formatMerryMage2018-01-162-2/+2
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
* Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-152-0/+398
|\
| * hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| * hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| * hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
* | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/
* Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
* renderer: Render previous frame when no new one is available.bunnei2018-01-151-1/+4
* lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
* time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-155-1/+117
* audio: Add files to CMake.bunnei2018-01-151-1/+0
* hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
* audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
* hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
* yuzu: Update license text to be consistent across project.bunnei2018-01-1335-35/+35
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-131-2/+0
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-134-249/+0
* core: Include <algorithm> where used.bunnei2018-01-122-0/+4
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1110-166/+423
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-115-0/+718
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-071-2/+2
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-071-2/+2
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-074-4/+4
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-071-14/+3
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-293-24/+9
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
* service: Add empty interface for pctl:a.bunnei2017-12-295-0/+86
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
* service: Add empty interface for aoc:u.bunnei2017-12-283-0/+42
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-012-3/+5
* hle: Use Switch formatted result codes.bunnei2017-11-011-13/+5
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-155-27/+40
* hle: Add service stubs for apm and appletOE.bunnei2017-10-159-2/+130
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1510-432/+283
* Remove more 3DS-specific code.bunnei2017-10-134-45/+0
* Remove more 3DS-specific code.bunnei2017-10-135-1411/+1
* Remove more 3DS-specific code.bunnei2017-10-131-9/+0
* Remove lots more 3DS-specific code.bunnei2017-10-1324-4161/+6
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10173-20703/+2
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-1038-408/+1544
|\
| * Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| * Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\
| | * HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| * | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| * | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| * | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \
| | * | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | * | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | |/
| * | Fixed type conversion ambiguityHuw Pascoe2017-09-309-19/+21
| * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-252-1/+24
| * | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \
| | * | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | |/
| * / Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| |/
| * Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-166-40/+73
| |\
| | * Services/NS: Port ns:s to the new service framework.Subv2017-09-166-40/+73
| * | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \
| | * | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| * | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-056-53/+287
| |\ \ \ | | |/ / | |/| |
| | * | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | * | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | * | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | * | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-274-11/+142
| * | | HID: use TouchDevice for touch padwwylele2017-08-241-4/+8
| | |/ | |/|
| * | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-201-5/+27
| |\ \
| | * | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | * | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-111-5/+27
| * | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \
| | * | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| * | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ | | |_|/ / | |/| | |
| | * | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | * | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ /
| * | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \
| | * | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | |/ /
| * | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-091-1/+1
| |\ \ \
| | * | | Update cryptoppJames2017-08-081-1/+1
| | |/ /
| * / / Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ /
| * | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| * | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \
| | * | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | * | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | * | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | * | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | * | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | * | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
* | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-301-1/+1
|/ / /
* | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-223-9/+8
|\ \ \ | |/ / |/| |
| * | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-222-8/+7
| * | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-221-1/+1
* | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
* | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-162-22/+138
|\ \ \
| * | | apt: load shared font from system archivewwylele2017-06-261-20/+134
| * | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| |/ /
* | / Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| |/ |/|
* | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-273-1/+432
|\ \ | |/ |/|
| * UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| * UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-261-4/+1
| * UDS: Run clang-format.Subv2017-06-263-51/+55
| * UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| * UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| * UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| * UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-153-1/+259
* | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2119-46/+46
|\ \
| * | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1919-46/+46
| |/
* | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \
| * | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| |/
* / Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-191-2/+1
|/
* Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
* Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-111-12/+5
* Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
* ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-111-6/+20
* Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-096-57/+312
|\
| * Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| * Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| * Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-082-1/+232
* | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ | |/ |/|
| * Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
* | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0631-12/+79
* | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-065-24/+145
* | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
* | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-063-7/+8
* | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-064-29/+37
* | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-065-58/+8
* | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-031-1/+2
* | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-031-2/+1
* | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-031-52/+2
* | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-032-7/+53
* | Made some changes from review comments:TheKoopaKingdom2017-06-032-9/+6
* | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-033-2/+12
* | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \
| * | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| * | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| * | cam: use IPCHelperwwylele2017-05-241-278/+238
* | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-302-1/+2
| |/ |/|
* | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-281-1/+1
* | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
* | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-255-14/+5
* | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-251-14/+23
* | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-254-23/+19
* | result: Make error description a generic integerYuri Kunde Schlesner2017-05-252-3/+4
|/
* Merge pull request #2661 from Subv/uds5bunnei2017-05-194-33/+600
|\
| * Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| * Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| * Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-154-7/+535
* | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
* | Merge pull request #2676 from wwylele/irrstbunnei2017-05-108-23/+207
|\ \
| * | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| * | ir: implement new 3ds HID via ir:rstwwylele2017-05-048-23/+206
* | | Create a random console_unique_id (#2668)B3n302017-05-062-5/+71
|/ /
* | Merge pull request #2606 from wwylele/irbunnei2017-05-044-44/+757
|\ \
| * | ir: implement circle pad prowwylele2017-05-034-44/+757
* | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \
| * | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| |/ /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | |_|/ |/| |
| * | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | |_|/ |/| |
| * | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| * | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| * | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| * | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| * | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| * | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| * | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-064-208/+258
|\ \ \
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| * | | address more commentsLectem2017-03-191-20/+20
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-182-37/+39
| * | | fix #2560 and other commentsLectem2017-03-182-20/+20
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-182-6/+4
| * | | refactor APT service to use the new IPC helpersLectem2017-03-183-195/+246
* | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
* | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
* | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / /
* | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-172-37/+56
|\ \ \
| * | | Input: remove unused stuff & clean upwwylele2017-03-011-34/+0
| * | | HID: use AnalogDevicewwylele2017-03-011-2/+9
| * | | HID: use ButtonDevicewwylele2017-03-012-1/+47
| |/ /
* / / cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
|/ /
* | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \
| * | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
* | | Doxygen: Amend minor issues (#2593)Mat M2017-02-273-6/+6
* | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-272-0/+3
|\ \ \ | |/ / |/| |
| * | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-271-2/+1
| * | Add performance statistics to status barYuri Kunde Schlesner2017-02-271-0/+3
| * | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-271-0/+1
* | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-255-6/+149
|\ \ \ | |/ / |/| |
| * | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
* | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
* | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
* | | turned clang format back onnoah the goodra2017-02-141-1/+1
|/ /
* | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-131-1/+1
|\ \
| * | loader: use self NCCH archivewwylele2017-02-131-1/+1
* | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-111-4/+0
|/ /
* | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-053-35/+40
|\ \
| * | IPC helpers exampleLectem2016-12-263-35/+40
* | | GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
| |/ |/|
* | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-303-172/+1242
|\ \
| * | CAM: implement basic camera functions with a blank camerawwylele2017-01-113-172/+1242
| |/
* | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \
| * | CFG: override language setting on bootwwylele2017-01-191-36/+38
* | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
* | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \
| * | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
* | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
* | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
* | | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-161-3/+3
* | | | HID: manages updating itself using correct tickswwylele2017-01-162-58/+93
|/ / /
* / / GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ /
* | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-121-1/+3
|\ \
| * | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-128-295/+418
|\ \ \ | |/ / |/| |
| * | Service/AC: add ac:i servicemailwl2016-12-308-295/+418
* | | Fix some warnings (#2399)Jonathan Hao2017-01-044-8/+6
* | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-305-0/+42
|/ /
* | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-302-2/+62
|\ \ | |/ |/|
| * Config: auto-select region and languagewwylele2016-12-072-2/+62
* | core: Move emu_window and key_map into coreMerryMage2016-12-231-1/+1
* | Service/NWM: add nwm servicesmailwl2016-12-2217-8/+301
* | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-225-12/+11
|\ \
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-221-4/+4
| * | Address clang-format issues.bunnei2016-12-221-2/+2
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-225-9/+7
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-221-4/+4
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-222-49/+92
|\ \ \ | |/ / |/| |
| * | csnd:SND reformat source codemailwl2016-12-122-49/+92
* | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \
| * | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
* | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-167-13/+79
|\ \ \ \
| * | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-157-13/+79
* | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \
| * | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-152-0/+4
|\ \ \ \ \
| * | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-152-0/+4
| |/ / / /
* / / / / act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / /
* | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-157-6/+38
|\ \ \ \ | |/ / / |/| | |
| * | | Service/ACT: move ACT services to foldermailwl2016-12-147-6/+38
* | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1511-64/+196
|\ \ \ \ | |/ / / |/| | |
| * | | Fixed the codestyle to match our clang-format rules.Subv2016-12-147-32/+52
| * | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-094-45/+15
| * | | Kernel/IPC: Small codestyle cleanupSubv2016-12-091-1/+1
| * | | Added a framework for partially handling Session disconnections.Subv2016-12-084-0/+32
| * | | Use std::move where appropriate.Subv2016-12-084-165/+10
| * | | Return an error code when connecting to a saturated port.Subv2016-12-051-2/+6
| * | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| * | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-054-22/+57
| * | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-053-21/+21
| * | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-011-1/+2
| * | | Fixed the rebase mistakes.Subv2016-12-013-31/+30
| * | | A bit of a redesign.Subv2016-12-016-46/+233
| * | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-012-4/+6
| * | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-012-16/+8
| * | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-011-1/+1
| * | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-017-27/+62
* | | | Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
| |/ / |/| |
* | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
* | | Add all services to the Service namespaceLioncash2016-12-1141-471/+376
* | | Merge pull request #2291 from lioncash/svcbunnei2016-12-099-12/+59
|\ \ \
| * | | service: Add cfg:nor serviceLioncash2016-12-093-0/+47
| * | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
* | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
* | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
* | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
* | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
* | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-085-0/+86
* | | | service: Add mvd and qtm servicesLioncash2016-12-0813-0/+259
* | | | service: Add nfc servicesLioncash2016-12-087-30/+193
* | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
* | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
* | | | pm_app: Update function tableLioncash2016-12-081-6/+9
* | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
* | | | nim: Update function tablesLioncash2016-12-082-0/+2
* | | | http_c: Update function tableLioncash2016-12-081-0/+4
* | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
* | | | fs_user: Update function tableLioncash2016-12-081-0/+2
* | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
* | | | cfg: Update function tablesLioncash2016-12-083-0/+3
* | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
* | | | boss_p: Update function tableLioncash2016-12-081-3/+68
* | | | act: Update function tablesLioncash2016-12-082-0/+10
* | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
|/ / /
* | / Update AM service function tablesLioncash2016-12-086-113/+246
| |/ |/|
* | Merge pull request #2232 from wwylele/other-savebunnei2016-12-072-2/+14
|\ \
| * | FileSys: Implement OtherSaveDatawwylele2016-11-292-0/+11
| * | FS: add missing MediaTypewwylele2016-11-291-1/+1
| * | FileSys: abstract SD save data archive sourcewwylele2016-11-291-1/+2
* | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| |/ |/|
* | Set client SDK version to Service APIsmailwl2016-11-307-13/+86
|/
* Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-284-43/+28
|\
| * FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-192-6/+5
| * PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| * FileSys: add SDMCWriteOnlyArchivewwylele2016-11-191-0/+8
| * FileSys: make Archive interfaces return error codewwylele2016-11-011-32/+9
* | Output parameters to logmailwl2016-11-251-4/+6
* | MIC_U: Stub service funcionsmailwl2016-11-252-16/+305
* | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
* | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \
| * | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
* | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \
| * | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
* | | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-192-7/+18
| |/ / |/| |
* | | Style fixmailwl2016-11-021-2/+2
* | | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
* | | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
| |/ |/|
* | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \
| * | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| |/
* | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
* | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
* | Fix typosRicardo de Almeida Gonzaga2016-10-201-1/+1
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-083-4/+1808
|\ \ | |/ |/|
| * Update the stub code of BOSSJamePeng2016-10-023-4/+1808
* | fs: clean up log formatwwylele2016-10-021-22/+24
* | fs: implement DeleteDirectoryRecursivelywwylele2016-10-023-1/+51
|/
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-2151-51/+51
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-2139-107/+47
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-1949-282/+339
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-1885-2639/+2865
* Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-298-97/+3007
|\ \
| * | LDR: Implement CROwwylele2016-08-278-97/+3007
| |/
* / fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-024-7/+7
|/
* Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\
| * Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
* | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
|/
* Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-106-37/+253
|\
| * Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| * Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| * Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| * Service::CFG: add missing languagewwylele2016-07-021-1/+2
| * Service::CFG: name sound output modeswwylele2016-07-022-2/+7
* | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-071-10/+14
|\ \
| * | Fix the errorcode of archive handleJamePeng2016-07-041-10/+14
| |/
* | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \
| * | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
* | | HLE/Applets: Implement ErrEula appletmailwl2016-07-041-0/+8
| |/ |/|
* | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-291-15/+121
|\ \ | |/ |/|
| * Fix parameter name in EnableNotificationmailwl2016-05-311-2/+2
| * Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| * remove ugly functionmailwl2016-05-311-35/+3
| * srv: Update according 3dbrewmailwl2016-05-311-15/+137
* | hid: add missing headerwwylele2016-06-111-0/+2
* | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-112-35/+36
|\ \
| * | fixup! fixup! Refactor input systemwwylele2016-05-151-1/+1
| * | Refactor input subsystemwwylele2016-05-152-35/+36
* | | service: Add other DLP servicesLioncash2016-06-059-21/+142
* | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-011-15/+21
| |/ |/|
* | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-309-107/+179
|\ \
| * | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-281-1/+0
| * | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-282-13/+11
| * | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| * | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| * | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| * | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| * | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| * | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| * | APT: Remove use of Memory::GetPointerMerryMage2016-05-212-16/+15
* | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \
| * | | clean up config blockwwylele2016-05-031-29/+13
* | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-241-2/+2
* | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-248-10/+135
|\ \ \ \ | |_|/ / |/| | |
| * | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-208-10/+135
* | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-184-0/+54
* | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|/ |/| |
* | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-133-66/+165
* | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
* | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-135-37/+29
* | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-071-2/+2
|\ \ \
| * | | fixup simple type conversions where possibleAlexander Laties2016-05-071-2/+2
| | |/ | |/|
* / | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-071-0/+15
|/ /
* | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \
| * | remove duplicated function declarationwwylele2016-05-011-13/+0
| * | add config block 0x00170000wwylele2016-04-291-0/+4
* | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-301-0/+1
* | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \
| * | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
* | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-301-1/+25
|\ \ \ \
| * | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-211-1/+25
| |/ / /
* | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ | |_|/ / |/| | |
| * | | return checks if event and memory createdmailwl2016-04-231-1/+8
| * | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
* | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-291-1/+0
* | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-272-59/+151
|\ \ \ \
| * | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| * | | | DSP_DSP: Add return IPC headersMerryMage2016-04-271-4/+26
| * | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-272-42/+106
| * | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
* | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
* | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \
| * | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|/ / | |/| | |
* | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
| |/ / / |/| | |
* | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
| |/ / |/| |
* | | HWRasterizer: Texture forwardingtfarley2016-04-213-24/+18
|/ /
* | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ | |/ |/|
| * Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| * Code styleRyan Loebs2016-03-301-2/+2
| * Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| * Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| * But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| * Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| * Formatting...Ryan Loebs2016-03-291-1/+1
| * Addressing PR commentsRyan Loebs2016-03-291-4/+4
| * SOC UpdatesRyan Loebs2016-03-291-3/+46
* | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
* | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-083-0/+28
* | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \
| * | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| * | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| * | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
* | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-064-55/+234
|\ \ \
| * | | frd:u: Initial stub some functionsmailwl2016-03-274-55/+234
| | |/ | |/|
* | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-061-7/+6
|\ \ \ | |_|/ |/| |
| * | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-051-7/+6
* | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-033-0/+61
|\ \ \
| * | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-023-0/+61
* | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-023-3/+54
|\ \ \ \
| * | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-313-3/+54
* | | | | Merge pull request #1390 from purpasmart96/citra_gsp_error_codesbunnei2016-04-012-80/+96
|\ \ \ \ \
| * | | | | GSP: Return proper error codes for register writespurpasmart962016-03-312-80/+96
| |/ / / /
* | | | | Merge pull request #1419 from mailwl/branch-gspbunnei2016-03-311-6/+41
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueuemailwl2016-03-311-6/+41
| | |_|/ | |/| |
* / | | Add common methods to all cfg:* portsRyan Loebs2016-03-293-0/+21
|/ / /
* | | use reference instead of pointerwwylele2016-03-261-9/+9
* | | Merge pull request #1549 from wwylele/acc_gyrobunnei2016-03-264-23/+187
|\ \ \ | |/ / |/| |
| * | implement GyroscopeCalibrateParamwwylele2016-03-252-9/+20
| * | implement accel and gyro backendwwylele2016-03-224-23/+176
* | | soc_u: Get rid of explicit delete and newLioncash2016-03-211-8/+5
| |/ |/|
* | HLE/FS: Change the error code returned when an ExtSaveData archive is not found.Subv2016-03-201-4/+8
* | HLE/FS: Corrected some style concerns.Subv2016-03-204-6/+4
* | HLE/FS: Fixed creating the config savefile when it doesn't exist.Subv2016-03-201-1/+1
* | HLE/FS: Implemented GetFormatInfoSubv2016-03-205-48/+126
* | HLE/FS: Don't return an error when deleting the ExtSaveData if it does not exist.Subv2016-03-201-1/+1
* | HLE/FS: Return the proper error codes when opening files.Subv2016-03-201-3/+4
* | HLE/FS: Fixed the OpenDirectory error codeSubv2016-03-201-1/+1
* | HLE/FS: Return the proper error codes on file Read/Write operations.Subv2016-03-201-2/+15
* | HLE/FS: Corrected the error codes for DeleteFileSubv2016-03-201-4/+1
* | HLE/FS: FS::CreateFile takes an u64 for the file size.Subv2016-03-203-5/+5
|/
* Merge pull request #1505 from pippo2931/fefbunnei2016-03-181-1/+25
|\
| * Fix headerpippo29312016-03-121-1/+1
| * GetArchiveResource stubpippo29312016-03-121-1/+25
* | Reorganize the ndm service path for dummy implement functionJamePeng2016-03-145-24/+118
* | hid: fix pad updatewwylele2016-03-131-1/+1
* | svc: Move ResetType enum to the kernel event headerLioncash2016-03-135-6/+6
* | svc: Make ResetType an enum classLioncash2016-03-128-17/+17
|/
* Merge pull request #1266 from Subv/miiappletbunnei2016-03-123-2/+36
|\
| * HLE/Applets: Implemented a dummy Mii Selector applet.Subv2016-03-123-2/+36
* | Merge pull request #1500 from lioncash/nullptrbunnei2016-03-121-1/+1
|\ \
| * | gsp_gpu: Change 0 literal to nullptrLioncash2016-03-121-1/+1
* | | hle: Update service function tablesLioncash2016-03-124-1/+16
|/ /
* | renderer_base: Don't directly expose the rasterizer unique_ptrLioncash2016-03-092-5/+5
* | DSP: Implement Pipe 2MerryMage2016-03-061-43/+151
* | DSP: Print hash of firmware to consoleMerryMage2016-03-061-8/+21
* | Merge pull request #1429 from mailwl/branch-acubunnei2016-03-051-2/+17
|\ \
| * | ac:u: Stub IsConnectedmailwl2016-03-041-2/+17
* | | Merge pull request #1389 from yuriks/stub-cambunnei2016-03-043-20/+563
|\ \ \ | |/ / |/| |
| * | Service/CAM: Add doxycomments to all service functionsYuri Kunde Schlesner2016-03-011-0/+217
| * | Service/CAM: Dummy implementation of some functionsYuri Kunde Schlesner2016-02-133-20/+346
* | | Service/CFG: Fix potential endianess issueYuri Kunde Schlesner2016-03-011-2/+3
* | | Service/CFG: Add block 0x000A0000 (username) to default config fileYuri Kunde Schlesner2016-03-011-1/+14
* | | Initial implementation ir:usermailwl2016-02-263-18/+142
* | | AudioCore: Skeleton ImplementationMerryMage2016-02-212-57/+90
* | | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-125-15/+15
|/ /
* | services: Get rid of unnecessary includesLioncash2016-02-0269-132/+32
* | services: Update function tablesLioncash2016-02-022-5/+11
* | Merge pull request #1283 from Subv/soc_fixupbunnei2016-01-051-3/+13
|\ \
| * | HLE/Sockets: Fixed the buffer offset in recvfrom.Subv2015-12-241-3/+13
* | | services: Update some function tablesLioncash2015-12-3025-113/+369
|/ /
* | VideoCore: Unify interface to OpenGL and SW rasterizersYuri Kunde Schlesner2015-12-082-5/+5
* | VideoCore: Rename HWRasterizer methods to be less confusingYuri Kunde Schlesner2015-12-072-5/+5
* | Merge pull request #1252 from Subv/cambunnei2015-12-041-0/+156
|\ \ | |/ |/|
| * Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-231-0/+156
* | Merge pull request #1225 from lioncash/cleanbunnei2015-11-291-12/+13
|\ \
| * | csnd_snd: Get rid of type punningLioncash2015-10-281-12/+13
* | | Add stub functions for Initialize and GenerateRandomData in ssl:Cpolaris-2015-11-221-2/+51
| |/ |/|
* | Add Initialize and GenerateRandomData stubspolaris-2015-11-221-0/+2
|/
* Merge pull request #1165 from esoteric-programmer/masterbunnei2015-10-282-4/+66
|\
| * Added CSND stub.Matthias Ernst2015-10-282-4/+66
* | Merge pull request #1208 from archshift/free-bytesbunnei2015-10-283-1/+42
|\ \
| * | Implement FS_User::GetFreeBytesarchshift2015-10-283-1/+42
* | | Fix copy pasteFiliph Sandström2015-10-241-1/+1
* | | Fix wrong branchFiliph Sandström2015-10-231-0/+12
* | | Add GetTotalStepCount StubFiliph Sandström2015-10-231-1/+1
* | | Update ptm.hFiliph Sandström2015-10-231-0/+8
|/ /
* | Service/CFG: Use a constexpr function for country initializationEmmanuel Gil Peyrot2015-09-301-4/+3
* | fix some xcode 7.0 warningsMartin Lindhe2015-09-291-1/+1
* | general: Silence some warnings when using clangLioncash2015-09-164-8/+8
|/
* Service/CFG: Add default entry for block 0x000A0001 (birthday)Yuri Kunde Schlesner2015-09-141-0/+6
* Service/CFG: Correct flags in 2 default blocksYuri Kunde Schlesner2015-09-141-2/+2
* Service/CFG: Add additional blocks to default save dataYuri Kunde Schlesner2015-09-141-0/+34
* Fix narrowing conversion warningYuri Kunde Schlesner2015-09-141-1/+1
* Service/CFG: Move several private types from the header to the cppYuri Kunde Schlesner2015-09-142-63/+49
* Service/CFG: Clean up default block creationYuri Kunde Schlesner2015-09-142-27/+17
* GSP: Implement command 0x05, used for flushing cachesYuri Kunde Schlesner2015-09-142-13/+34
* General: Replace NULL and '0' usages with nullptr where applicableLioncash2015-09-111-1/+1
* General: Fix up doxygen commentsLioncash2015-09-101-1/+1
* Add cam:u service function names to its function tablearchshift2015-09-031-3/+60
* Core: Improve APT Shared Font hackYuri Kunde Schlesner2015-08-271-2/+2
* Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-251-0/+5
* Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-223-12/+11
|\
| * APT: Adjust shared font hack so it works with the new linear heap codeYuri Kunde Schlesner2015-08-161-10/+11
| * Memory: Move address type conversion routines to memory.cpp/hYuri Kunde Schlesner2015-08-162-2/+0
* | GPU: Implement TextureCopy-mode display transfersYuri Kunde Schlesner2015-08-162-11/+25
|/
* core: Eliminate some unused variable warningsLioncash2015-07-292-3/+5
* core: Fix missing prototype warningsLioncash2015-07-291-0/+1
* Merge pull request #1009 from lioncash/tableYuri Kunde Schlesner2015-07-291-1/+2
|\
| * am_net: Add missing function to the function tableLioncash2015-07-291-0/+1
| * am_net: Add correct function name to the function tableLioncash2015-07-291-1/+1
* | Merge pull request #982 from Subv/homebunnei2015-07-295-18/+72
|\ \ | |/ |/|
| * Service/APT: Fixed a regression, PreloadLibraryApplet should also start an applet when called.Subv2015-07-245-4/+35
| * Service/APT: Return proper parameters in GetLockHandle.Subv2015-07-242-14/+37
* | Merge pull request #899 from zawata/Winsock-Deprecationbunnei2015-07-281-2/+8
|\ \
| * | SOC:U : Update deprecated function gethostbyname() to getaddrinfo()zawata2015-07-201-2/+8
* | | Move input values into an arrayJames Rowe2015-07-282-1/+14
* | | Merge pull request #983 from yuriks/null-memory-fillYuri Kunde Schlesner2015-07-241-13/+18
|\ \ \
| * | | GSP: Don't try to write memory fill registers if start address is 0Yuri Kunde Schlesner2015-07-241-13/+18
| | |/ | |/|
* / | Qt/GPU Breakpoints: Added three more breakpoint types:Subv2015-07-231-0/+7
|/ /
* | Merge pull request #962 from Subv/am_appbunnei2015-07-223-3/+33
|\ \
| * | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.Subv2015-07-213-3/+33
* | | Merge pull request #966 from Subv/logbunnei2015-07-211-4/+8
|\ \ \
| * | | Services/Logging: Log more useful information when some operations fail.Subv2015-07-211-4/+8
| |/ /
* / / Services/CFG: Added some missing functions to cfg:sSubv2015-07-211-1/+3
|/ /
* | Merge pull request #946 from archshift/update-frdubunnei2015-07-201-1/+12
|\ \
| * | Add more frd:u unknown service commands from 3dbrewarchshift2015-07-191-1/+12
* | | Change trace/unimplemented service call logs to use hexarchshift2015-07-191-1/+1
|/ /
* | Ensure all kernel objects are released during shutdownYuri Kunde Schlesner2015-07-1711-1/+31
* | Archive: Correct a few incorrect types in function signaturesYuri Kunde Schlesner2015-07-141-1/+1
* | Add CiTrace recording support.Tony Wasserka2015-07-131-1/+1
* | Core: Fix applet includes using iwyu.Emmanuel Gil Peyrot2015-07-121-3/+6
* | Applets: Reworked how the Applet update event is handled.Subv2015-07-123-4/+4
* | Applets: Add infrastructure to allow custom drawing and input handling in Applets.Subv2015-07-123-20/+39
* | HLE/APT: Initial HLE support for applets.Subv2015-07-124-50/+173
* | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-1112-50/+82
|\ \
| * | Core: Cleanup hw includes.Emmanuel Gil Peyrot2015-06-283-0/+7
| * | Core: Cleanup soc:U includes.Emmanuel Gil Peyrot2015-06-282-26/+36
| * | Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-283-7/+18
| * | CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-283-1/+5
| * | Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-282-8/+9
| * | Services: Use the standard _WIN32 define in soc:U instead of our own EMU_PLATFORM.Emmanuel Gil Peyrot2015-06-271-8/+7
| |/
* / Services/SOC: Added command headers to some of the soc commands.Subv2015-06-251-5/+13
|/
* Add helpers to create IPC command buffer headers and descriptorsYuri Kunde Schlesner2015-06-232-7/+9
* Merge pull request #860 from yuriks/y2r-colorYuri Kunde Schlesner2015-06-222-174/+348
|\
| * Y2R: Rework conversion process, enabling support for all formatsYuri Kunde Schlesner2015-06-222-163/+309
| * Y2R: Re-organize how params are stored. Support SetConversionParamsYuri Kunde Schlesner2015-06-211-72/+100
* | Services: Continue separation of services into their own folderspurpasmart962015-06-1272-607/+1134
|/
* ExtSavedata: Save the icon passed to CreateExtSaveData to the correct folder.Subv2015-06-023-11/+32
* Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-2916-52/+52
* hid: Get rid of undefined behaviorLioncash2015-05-271-2/+2
* Service/GSP: Implemented ImportDisplayCaptureInfo.Subv2015-05-261-1/+47
* y2r_u: Remove unused variable in StartConversionLioncash2015-05-231-1/+0
* Merge pull request #801 from purpasmart96/hid_stubsbunnei2015-05-234-9/+47
|\
| * HID: Stub DisableAccelerometer and DisableGyroscopeLowpurpasmart962015-05-234-9/+47
* | Flush for y2r (moflex)tfarley2015-05-231-0/+11
* | OpenGL renderertfarley2015-05-231-0/+9
|/
* Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-221-35/+265
* y2r_u: Stub StartConversion to prevent moflex games from hanging.bunnei2015-05-211-1/+17
* Merge pull request #766 from purpasmart96/cfg_service_updatebunnei2015-05-185-337/+304
|\
| * CFG: Update the cfg service to be like other integrated servicespurpasmart962015-05-165-337/+304
* | APT/FS: Remove asserts that were causing false positivespurpasmart962015-05-162-5/+5
* | Memmap: Re-organize memory function in two filesYuri Kunde Schlesner2015-05-151-0/+1
|/
* PTM: Changed the way the ptm services are handled to be like thepurpasmart962015-05-125-125/+112
* NWM_UDS: Fix a typo in the nwm service port namepurpasmart962015-05-121-1/+1
* fixup! GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-1/+1
* GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-9/+11
* Kernel: Capture SharedMemory attributes at creation, not when mappingYuri Kunde Schlesner2015-05-114-11/+19
* Memory: Re-organize and rename memory area address constantsYuri Kunde Schlesner2015-05-091-1/+1
* Common: Remove common.hYuri Kunde Schlesner2015-05-0721-10/+32
* FileSys: De-inline Path membersYuri Kunde Schlesner2015-05-071-0/+2
* FileSys: Clean-up includes, de-inline destructorsYuri Kunde Schlesner2015-05-074-13/+21
* Services: Initialize all state variables at bootup.bunnei2015-05-028-22/+38
* Merge pull request #692 from purpasmart96/log_improvementsbunnei2015-04-282-8/+22
|\
| * Services/Loader: Use more sensible log formats for certain functionspurpasmart962015-04-282-8/+22
* | ptm_sysm: Add static specifier to IsLegacyPowerOffLioncash2015-04-251-1/+1
* | De-inline functions from Interface, removing them from service.hYuri Kunde Schlesner2015-04-142-50/+48
* | APT: (Subv) Fix bug where start event was being incorrectly signaled.bunnei2015-04-101-6/+7
|/
* Merge pull request #676 from purpasmart96/ir_service_refcbunnei2015-04-0810-55/+180
|\
| * IR: Move The IR services to their own folder and implement "GetHandles"purpasmart962015-04-0410-55/+180
* | Clean-up mem_map constants and fix framebuffer translation errorsYuri Kunde Schlesner2015-04-061-4/+6
|/
* Services: Stubs and minor changespurpasmart962015-04-0316-67/+402
* Merge pull request #656 from Subv/nzbunnei2015-03-223-24/+189
|\
| * Service/FS: Document and log some unknown values.Subv2015-03-191-1/+26
| * Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and DeleteSystemSaveDataSubv2015-03-143-24/+164
* | Merge pull request #655 from purpasmart96/hid_fixesbunnei2015-03-174-12/+72
|\ \
| * | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow alongpurpasmart962015-03-174-12/+72
| |/
* / arm_interface: Get rid of GetTicks.Lioncash2015-03-161-3/+3
|/
* Merge pull request #642 from bunnei/touchpadbunnei2015-03-123-130/+136
|\
| * hid_user: Removed unnecessary includes.bunnei2015-03-111-2/+0
| * HID: Removed unnecessary global variables.bunnei2015-03-112-58/+42
| * HID: Added additional variable comments and some code cleanups.bunnei2015-03-112-20/+29
| * HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-112-111/+28
| * HID: Cleanup how `next_touch_index` is calculated for Pad and touch.bunnei2015-03-101-2/+2
| * HID: Changed TouchDataEntry `valid` to a BitField and added some doc strings.bunnei2015-03-102-4/+4
| * HID: Added static asserts to check register position in shared memory.bunnei2015-03-101-2/+16
| * HID: Added functions to emulate the touchpad.bunnei2015-03-102-0/+61
| * HID: Moved some docstrings to the header.bunnei2015-03-102-24/+16
| * HID: Refactored shared memory decoding for touchpad support.bunnei2015-03-102-33/+64
* | Merge pull request #629 from archshift/lcdfbbunnei2015-03-101-6/+38
|\ \ | |/ |/|
| * Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-091-17/+15
| * Implement SetLcdForceBlack, move register enum to hw.harchshift2015-03-061-5/+39
* | Merge pull request #589 from kevinhartman/config-errorsbunnei2015-03-091-5/+10
|\ \ | |/ |/|
| * Fix error message for bad config block request.Kevin Hartman2015-02-211-5/+10
* | Services: Moved the PTM and APT services to their own folderSubv2015-03-0438-1089/+1186
* | Merge pull request #622 from Subv/titlesYuri Kunde Schlesner2015-03-021-8/+45
|\ \
| * | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.Subv2015-03-021-8/+45
* | | Merge pull request #623 from Subv/cardbunnei2015-03-021-1/+25
|\ \ \
| * | | Services/FS: Stubbed CardSlotIsInserted to always return falseSubv2015-03-011-1/+25
| |/ /
* / / Services/PTM: Stubbed PTM_Sysm::IsLegacyPowerOff.Subv2015-03-011-1/+13
|/ /
* | Merge pull request #604 from Subv/arc_ssdYuri Kunde Schlesner2015-02-262-26/+42
|\ \
| * | Archives: Properly implemented the SystemSaveData archive.Subv2015-02-262-26/+42
* | | Services: Implemented Y2R_U::GetTransferEndEventSubv2015-02-241-1/+18
|/ /
* | Merge pull request #595 from linkmauve/new-3ds-inputbunnei2015-02-241-0/+19
|\ \
| * | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.Emmanuel Gil Peyrot2015-02-221-0/+19
| |/
* / Added information reporting from ThrowFatalErrorarchshift2015-02-221-1/+164
|/
* GPU: Properly implement memory fills.Tony Wasserka2015-02-182-17/+21
* Services: Fixed "Tried to connect to named port err:f".Subv2015-02-161-1/+1
* Merge pull request #529 from Subv/masterbunnei2015-02-143-36/+52
|\
| * Build: Fixed some warningsSubv2015-02-123-36/+52
* | core: Apply static to local functionsLioncash2015-02-133-15/+15
|/
* Implemented WriteHWRegsWithMask for GSP.Kevin Hartman2015-02-111-6/+91
* Asserts: break/crash program, fit to style guide; log.h->assert.harchshift2015-02-1142-52/+10
* GSP: Fixed typo in SignalInterruptbunnei2015-02-111-1/+1
* Merge pull request #552 from bunnei/setbufferswap-fixbunnei2015-02-111-4/+3
|\
| * GSP: Call SetBufferSwap for each screen on corresponding signal interrupt.bunnei2015-02-111-4/+3
* | Merge pull request #526 from purpasmart96/citra_stubsbunnei2015-02-113-8/+188
|\ \
| * | Services: Stub some functionspurpasmart962015-02-083-8/+188
* | | PTM: Fixed a problem with the gamecoin PTM file.Subv2015-02-101-21/+13
* | | Archives: Made the Format function more generic.Subv2015-02-103-9/+10
* | | Archives: Expose the File and Directory classes to HLESubv2015-02-103-58/+62
* | | FS: Allow multiple instances of the same archive type to be open at onceYuri Kunde Schlesner2015-02-103-29/+35
* | | FS: Get rid of completely useless Archive classYuri Kunde Schlesner2015-02-101-36/+26
| |/ |/|
* | Kernel: Stop creating useless Handles during object creationYuri Kunde Schlesner2015-02-025-14/+13
* | HID: Fix crash when pressing a key when the emulator is stoppedYuri Kunde Schlesner2015-02-021-0/+2
* | FS: Remove use of GetHandleYuri Kunde Schlesner2015-02-021-1/+1
* | Service: Store function names as const char* instead of std::stringYuri Kunde Schlesner2015-02-021-6/+6
* | Service: Clean-up InterfaceYuri Kunde Schlesner2015-02-0246-67/+54
* | Make Port/Service registration and querying more HW-accurateYuri Kunde Schlesner2015-02-023-102/+64
* | Filesys: Move creation of Handles for File/Directory to service handlersYuri Kunde Schlesner2015-02-023-32/+33
|/
* archive: Fix initializer list order for the File class.Lioncash2015-01-301-1/+1
* apt_u: Fix missing printf specifiersLioncash2015-01-301-2/+2
* Remove result.h InvalidHandleYuri Kunde Schlesner2015-01-301-9/+14
* Kernel: Convert Event to not use HandlesYuri Kunde Schlesner2015-01-307-58/+71
* Kernel: Convert Mutex to not use HandlesYuri Kunde Schlesner2015-01-302-8/+9
* Kernel: Convert SharedMemory to not use HandlesYuri Kunde Schlesner2015-01-305-16/+24
* Merge pull request #345 from purpasmart96/apt_stubsbunnei2015-01-271-91/+276
|\
| * APT_U: Stub some functions & misc changespurpasmart962015-01-231-91/+276
* | Merge pull request #485 from Subv/more_servsbunnei2015-01-2618-1/+393
|\ \
| * | Services/HID: Removed some files due to a rebase errorSubv2015-01-243-267/+0
| * | Services: Stubbed more services.Subv2015-01-2421-1/+660
* | | cam_u.h: fix indentationarchshift2015-01-221-2/+2
|/ /
* | Merge pull request #493 from archshift/ptmplaybunnei2015-01-225-0/+102
|\ \
| * | Stubbed cam:u servicearchshift2015-01-213-0/+49
| * | Stubbed ptm:play servicearchshift2015-01-213-0/+53
* | | Event: Fixed some bugs and cleanup (Subv)bunnei2015-01-222-3/+3
* | | Added HID_SPVR service and split HID_U implementation into service/hid/hid.xxxarchshift2015-01-218-217/+324
|/ /
* | core: Fix a few docstringsLioncash2015-01-202-2/+2
* | Expose GetSharedFont and NotifyToWait to APT:A and APT:S respectivelyarchshift2015-01-192-1/+4
|/
* APT: Fix typo in setting return code for NotifyToWaitbunnei2015-01-161-1/+1
* DSP: Removed useless spam log for SignalInterruptbunnei2015-01-161-5/+2
* Merge pull request #482 from yuriks/fix-vblankbunnei2015-01-162-35/+25
|\
| * GSP: Fix appending of interrupts to the shared memory bufferYuri Kunde Schlesner2015-01-142-17/+12
| * GSP: Update framebuffer info on all interruptsYuri Kunde Schlesner2015-01-141-12/+13
| * GPU: Fire GPU interrupts at the correct places.Yuri Kunde Schlesner2015-01-141-6/+0
* | APT: Fixed the comment style in some variablesSebastian Valle2015-01-141-2/+2
* | APTU: Stubbed NotifyToWait, taken from 3dmoo.Subv2015-01-141-7/+21
|/
* Services: Added some missing services.Subv2015-01-138-1/+358
* Fix building on MinGWdarkf2015-01-121-0/+13
* Stubbed y2r:u IsBusyConversionarchshift2015-01-111-1/+16
* Added Archive ID to fs:USER debug logs involving opening the archive.archshift2015-01-101-3/+3
* Logging: Log all called service functions (under trace). Compile out all trace logs under release for performance.archshift2015-01-107-30/+20
* Kernel: Start using boost::intrusive_ptr for lifetime managementYuri Kunde Schlesner2015-01-091-1/+2
* Move ThreadContext to core/core.h and deal with the falloutYuri Kunde Schlesner2015-01-091-0/+1
* Merge pull request #404 from bunnei/more-frame-synch-fixesbunnei2015-01-081-1/+4
|\
| * GSP: Toggle active framebuffer each framebunnei2015-01-081-1/+4
* | Fix double-free in Service manager during shutdownYuri Kunde Schlesner2015-01-072-25/+4
* | Merge pull request #376 from Subv/arc_reorderbunnei2015-01-074-18/+23
|\ \ | |/ |/|
| * Archives: Changed the unimplemented archives comment.Subv2015-01-061-1/+1
| * Archives: Addressed some commentsSubv2015-01-061-2/+2
| * Archives: Make SYSTEM_ID and SDCARD_ID stringsSubv2015-01-042-4/+4
| * Archives: Changed the way paths are built for the archives.Subv2015-01-044-15/+20
| * Archives: Change the folder layout of some archives.Subv2015-01-032-2/+2
* | Merge pull request #413 from purpasmart96/serv_cleanbunnei2015-01-067-33/+36
|\ \
| * | Services: Clean up a few things and add a few function namespurpasmart962015-01-067-33/+36
* | | Merge pull request #272 from rohit-n/sign-comparebunnei2015-01-061-4/+4
|\ \ \
| * | | Silence some -Wsign-compare warnings.Rohit Nirmal2015-01-011-4/+4
| |/ /
* | | DSP: Signal (faked) interrupt on every frame.bunnei2015-01-052-4/+21
* | | Merge pull request #386 from archshift/y2rubunnei2015-01-053-0/+70
|\ \ \ | |_|/ |/| |
| * | Stub the y2r:u servicearchshift2015-01-033-0/+70
| |/
* | Archives: Reduced duplicate code in RomFS and SaveCheck.Subv2015-01-032-4/+5
* | SaveDataCheck: Preliminary work in this archive.Subv2015-01-032-3/+35
* | Merge pull request #391 from lioncash/pedanticbunnei2015-01-031-3/+3
|\ \
| * | archive: Fix initializer list orderLioncash2015-01-031-3/+3
| |/
* / soc_u: Fix a missing formatting argumentLioncash2015-01-031-1/+1
|/
* SOC_U: Preliminary implementation of sockets.Subv2014-12-312-21/+701
* APT:A: Some style changesSubv2014-12-301-12/+12
* Archives: Implemented ExtSaveData and SharedExtSaveDataSubv2014-12-305-45/+94
* Kernel: New handle managerYuri Kunde Schlesner2014-12-283-7/+11
* Rename ObjectPool to HandleTableYuri Kunde Schlesner2014-12-283-8/+8
* Merge pull request #330 from purpasmart96/new_srvbunnei2014-12-2660-305/+355
|\
| * More services & small clean upspurpasmart962014-12-2660-305/+355
* | Stubbed IsSdmcWriteable to always return writeable.archshift2014-12-241-1/+18
* | Merge pull request #322 from chinhodado/masterbunnei2014-12-221-2/+2
|\ \ | |/ |/|
| * More warning cleanupsChin2014-12-211-2/+2
* | CFG: Fixed some warnings and errors in ClangSubv2014-12-222-4/+4
* | CFG: More style changesSubv2014-12-221-5/+5
* | CFGU: IndentationSubv2014-12-211-4/+3
* | CFG: Some indentationSubv2014-12-211-11/+13
* | CFG: Changed the CreateConfigInfoBlk search loopSubv2014-12-211-7/+4
* | CFG: Corrected the licenses in cfg_i.cpp and cfg_u.cppSubv2014-12-212-2/+2
* | CFG: Create a new subfolder cfg inside service to handle cfgSubv2014-12-218-485/+607
* | CFGU: Some changesSubv2014-12-211-12/+33
* | CFGU: Addressed some issues.Subv2014-12-211-43/+55
* | CFGU: Addressed some comments.Subv2014-12-211-11/+13
* | Style: Addressed some commentsSubv2014-12-211-4/+5
* | CFG_U: Use Common::make_unique instead of the std versionSubv2014-12-211-1/+2
* | CFG:U: Implemented some more blocksSubv2014-12-211-4/+30
* | CFG: Implemented block 0x00070001 in the config savefileSubv2014-12-211-0/+5
* | CFGU: Use an absolute offset in the config savefile blocksSubv2014-12-211-1/+3
* | CFG: Load the Config savedata file if it already exists.Subv2014-12-211-3/+4
* | CFGU: Added block 0x000A0002 to the default savegame fileSubv2014-12-211-0/+18
* | CFG: Refactored how the config file works.Subv2014-12-211-55/+126
* | CFG:U: Add some data to the 0x00050005 config block.Subv2014-12-211-6/+11
* | CFG: Implemented the GetConfigInfoBlk2 function.Subv2014-12-212-12/+188
* | Merge pull request #291 from purpasmart96/licensebunnei2014-12-2158-59/+59
|\ \
| * | License changepurpasmart962014-12-2158-59/+59
* | | Added CreateFile to the FS_USER servicearchshift2014-12-213-1/+47
| |/ |/|
* | Common: Add a clone of std::make_uniqueYuri Kunde Schlesner2014-12-201-6/+7
* | Merge pull request #306 from Subv/even_more_savedatabunnei2014-12-201-2/+31
|\ \
| * | FS_U: Added the command to the docs of SaveData functionsSubv2014-12-201-0/+2
| * | SaveData: Added some documentation to FormatSaveDataSubv2014-12-181-2/+29
* | | Merge pull request #302 from purpasmart96/flushshutupbunnei2014-12-191-1/+25
|\ \ \ | |_|/ |/| |
| * | GSP_GPU: Shut up FlushDataCachepurpasmart962014-12-191-1/+25
| |/
* | SystemSaveData: Fixed a typo that was segfaultingSubv2014-12-191-1/+1
* | SaveData: Implemented the SystemSaveData archive.Subv2014-12-181-0/+9
|/
* Filesystem/Archives: Implemented the SaveData archiveSubv2014-12-183-13/+86
* Comment out empty arrays causing compile errors in MSVCYuri Kunde Schlesner2014-12-162-6/+8
* Merge pull request #283 from yuriks/archive-refactorbunnei2014-12-165-59/+598
|\
| * Work around libstdc++'s lack of support for std::hash on enumsYuri Kunde Schlesner2014-12-161-0/+15
| * FS.Archive: Clean up treatment of archives and their handlesYuri Kunde Schlesner2014-12-163-196/+175
| * Service.FS: Rename FileSys::File to FileBackendYuri Kunde Schlesner2014-12-161-1/+1
| * Service.FS: Rename FileSys::Directory to DirectoryBackendYuri Kunde Schlesner2014-12-161-2/+2
| * Service.FS: Rename FileSys::Archive to ArchiveBackendYuri Kunde Schlesner2014-12-162-5/+5
| * Service.FS: Do archive registration using IdCode instead of nameYuri Kunde Schlesner2014-12-163-16/+27
| * HLE: Rename namespaces to match move & fix initialization orderYuri Kunde Schlesner2014-12-165-31/+33
| * HLE: Move kernel/archive.* to service/fs/Yuri Kunde Schlesner2014-12-165-4/+536
* | Merge pull request #282 from archshift/servicesbunnei2014-12-169-0/+221
|\ \ | |/ |/|
| * Added stub for nim:aoc service...archshift2014-12-163-0/+60
| * Added stub for cecd:u service...archshift2014-12-163-0/+52
| * Added stub for ldr:ro service...archshift2014-12-163-0/+57
| * Added am:app service stub.archshift2014-12-163-0/+52
* | Remove SyncRequest from K::Object and create a new K::Session typeYuri Kunde Schlesner2014-12-1510-59/+49
|/
* Convert old logging calls to new logging macrosYuri Kunde Schlesner2014-12-1311-84/+60
* Merge pull request #267 from bunnei/apt-shared-fontbunnei2014-12-131-34/+100
|\
| * APT_U: Added GetSharedFont service function.bunnei2014-12-131-34/+100
* | DSP: Added stub for ReadPipeIfPossible.bunnei2014-12-121-1/+45
|/
* CFG:U: Store country codes as u16 instead of char pointers, and return the correct error in GetCountryCodeID.Emmanuel Gil Peyrot2014-12-101-44/+48
* GSP: Trigger GPU interrupts at more accurate locations.bunnei2014-12-101-7/+6
* GSP: Updated TriggerCmdReqQueue to return success code.bunnei2014-12-101-0/+3
* GSP: Updated RegisterInterruptRelayQueue to return expected magic number.bunnei2014-12-101-1/+4
* GPU: Fixed bug in command list size decoding.bunnei2014-12-101-1/+1
* Merge pull request #217 from archshift/cmd_buffbunnei2014-12-091-12/+12
|\
| * Log the cmd_buff arguments when citra comes across an unimplemented functionarchshift2014-11-251-12/+12
* | Merge pull request #222 from archshift/renamexyzbunnei2014-12-051-5/+89
|\ \
| * | Updated archive.cpp functions for proper error handlingarchshift2014-12-041-5/+5
| * | Implemented RenameDirectory in FS:USERarchshift2014-11-251-1/+43
| * | Implemented RenameFile in FS:USERarchshift2014-11-251-1/+43
| |/
* | Merge pull request #247 from lioncash/constbunnei2014-12-042-4/+4
|\ \
| * | hid_user: Pass by reference with PadButtonPress/PadButtonReleaseLioncash2014-12-042-4/+4
* | | Merge pull request #238 from archshift/dspbunnei2014-12-041-25/+44
|\ \ \
| * | | Add stub for ConvertProcessFromDspDramarchshift2014-12-041-25/+44
* | | | PTM_U: Added a stub for GetBatteryLevel & GetBatteryChargeState & GetAdapterStatepurpasmart962014-12-041-3/+72
| |/ / |/| |
* | | Merge pull request #231 from purpasmart96/serv_ac_wifi_statusbunnei2014-12-031-1/+19
|\ \ \
| * | | AC_U: Added a stub for GetWifiStatuspurpasmart962014-12-031-1/+19
| | |/ | |/|
* | | Merge pull request #219 from Subv/ptmbunnei2014-12-031-1/+18
|\ \ \ | |_|/ |/| |
| * | PTM_U: Implemented the GetShellState function.Subv2014-12-011-1/+18
* | | Merge pull request #224 from bunnei/dsp-service-improvementsbunnei2014-12-012-26/+107
|\ \ \
| * | | DSP: Added stubs for several commonly used DSP service functions.bunnei2014-12-011-25/+106
| * | | DSP: Fixed typo in port name.bunnei2014-12-011-1/+1
| | |/ | |/|
* | | CFG:U: Implemented the GetCountryCodeID and GetCountryCodeString.Subv2014-11-301-2/+86
* | | Fixed formatting and switch statement warningsvaguilar2014-11-271-3/+3
|/ /
* | Remove duplicated docs/update them for changed parameters.Yuri Kunde Schlesner2014-11-241-10/+0
* | HLE: Revamp error handling throrough the HLE codeYuri Kunde Schlesner2014-11-246-62/+46
* | Merge pull request #191 from archshift/deletexyzbunnei2014-11-241-25/+67
|\ \ | |/ |/|
| * Added DeleteFile and DeleteDirectory functions to FS:USER and the archives.archshift2014-11-231-25/+67
* | Add more services and some fixes, along with more "override"purpasmart962014-11-2125-17/+452
* | Merge pull request #211 from linkmauve/masterbunnei2014-11-1911-21/+21
|\ \
| * | Remove trailing spaces in every file but the ones imported from SkyEye, AOSP or generatedEmmanuel Gil Peyrot2014-11-1911-21/+21
* | | Add static to some variablesLioncash2014-11-191-1/+1
|/ /
* / core: Mark some hle functions as staticLioncash2014-11-184-20/+20
|/
* FS_User: Support FileSye::Path in a more generic way.bunnei2014-11-181-42/+65
* FileSys: Updated backend code to use FileSys::Path instead of string for paths.bunnei2014-11-181-4/+4
* Add missing boss:U service, needed according to Nintendo Zone logs.archshift2014-11-173-0/+57
* Merge pull request #183 from archshift/lowpathbunnei2014-11-131-83/+81
|\
| * Use std::u16string for conversion between UTF-8 and UTF-16, FS:USER functionsarchshift2014-11-132-138/+40
| * Add support for UTF-16 strings for LowPaths in FS:USERarchshift2014-11-102-86/+182
* | Merge pull request #188 from bunnei/apt-fixesbunnei2014-11-121-19/+90
|\ \
| * | APT_U: Added stub for function AppletUtility.bunnei2014-11-121-1/+29
| * | APT_U: Set a valid parameter buffer size in GlanceParameter.bunnei2014-11-121-17/+39
| * | APT_U: Release service lock on initialization.bunnei2014-11-121-0/+4
| * | APT_U: Fixes for GetLockHandle to boot system titles.bunnei2014-11-121-1/+18
| |/
* / Add FRD:U service and functionsarchshift2014-11-113-0/+64
|/
* Merge pull request #163 from archshift/create-directorybunnei2014-11-021-2/+38
|\
| * Added CreateDirectory function to service/fs.cpp, and in Archive.archshift2014-11-021-2/+38
* | Added ReceiveNotification, PublishToSubscriber unimplemented functions to SRVarchshift2014-11-021-0/+2
|/
* Added stub err:f service.archshift2014-11-023-0/+56
* Added a bunch of servicespurpasmart962014-11-0117-0/+581
* FS:USER - Implemented IsSdmcDetectedarchshift2014-10-301-1/+17
* Renamed souce files of services to match port namesGareth Poole2014-10-2911-10/+10
* Merge pull request #141 from archshift/crash-huntbunnei2014-10-281-0/+4
|\
| * hid.cpp: Fixed crash when updating pad data while nullarchshift2014-10-141-0/+4
* | Add `override` keyword through the code.Yuri Kunde Schlesner2014-10-267-11/+11
* | Don’t fail on empty filename in OpenFileDirectly, return the archive handle insteadEmmanuel Gil Peyrot2014-10-251-8/+7
|/
* APT: Added a stub for the "GlanceParameter" function.purpasmart962014-10-081-1/+31
* Added some more names to the function tablepurpasmart962014-10-051-0/+2
* added "StoreDataCache" to the function tablepurpasmart962014-09-301-0/+1
* FS: Implement OpenArchive, OpenDirectory, OpenFile and OpenFileDirectly calls.Emmanuel Gil Peyrot2014-09-171-20/+177
* Added support for multiple input device types for KeyMap and connected Qt.Kevin Hartman2014-09-122-113/+127
* Initial HID PAD work, with GLFW only.Kevin Hartman2014-09-122-24/+197
* Created structure for PAD.Kevin Hartman2014-09-122-0/+28
* core: Prune redundant includesarchshift2014-09-095-11/+0
* core: Pass string by reference in FetchFromPortName and DeleteServiceLioncash2014-09-062-4/+4
* srv::Initialize: Return "success" status code.bunnei2014-08-281-0/+4
* Pica/citra-qt: Replace command list view and command list debugging code with something more sophisticated.Tony Wasserka2014-08-251-5/+0
* GSP: Update framebuffer information when necessary.Tony Wasserka2014-08-252-2/+41
* GSP: Implement SetBufferSwap.Tony Wasserka2014-08-252-1/+47
* GSP: Add a helper function for convenience.Tony Wasserka2014-08-251-17/+22
* Core: Alter the kernel string functions to use std::string instead of const char*.Lioncash2014-08-187-11/+11
* Merge pull request #39 from bunnei/hid-minor-improvementsbunnei2014-08-131-5/+44
|\
| * HID: Added new function entries from 3dbrew to FunctionTable.bunnei2014-08-131-0/+5
| * HID: Implemented HID_User::GetIPCHandles service function.bunnei2014-08-081-5/+39
* | Pica/GPU: Change hardware registers to use physical addresses rather than virtual ones.Tony Wasserka2014-08-121-9/+9
* | GSP: Fix a major regression introduced in ffda035c, due to which no display transfers were triggered at all anymore.Tony Wasserka2014-08-121-4/+13
* | Remove the fancy RegisterSet class introduced in 4c2bff61e.Tony Wasserka2014-08-121-18/+18
|/
* GSP: Cleaned up command buffer decoding.bunnei2014-08-072-61/+69
* GSP: Added reinitialization of other state objects.bunnei2014-08-061-0/+3
* GSP: Removed dumb GX prefixes to functions/structs in GSP namespace.bunnei2014-08-062-77/+78
* GSP: Removed unnecessary GX_FinishCommand function.bunnei2014-08-061-13/+5
* GSP: Implements preliminary command synchronization via GPU interrupts.bunnei2014-08-062-18/+109
* SRV: Updated GetProcSemaphore to create an event instead of a mutex.bunnei2014-08-061-8/+10
* FS: Fix port name (old port name was based on an unaligned memory read).bunnei2014-08-061-1/+1
* GSP: Add a few comments.Tony Wasserka2014-07-232-1/+15
* GSP: Clean up GX command processing a lot and treat command id as a u8 rather than a u32.Tony Wasserka2014-07-232-37/+79
* GPU: Make use of RegisterSet.Tony Wasserka2014-07-231-21/+28
* GPU: Emulate memory fills.Tony Wasserka2014-07-232-1/+9
* GSP: HLE GXCommandId::SET_DISPLAY_TRANSFER and GXCommandId::SET_TEXTURE_COPY.Tony Wasserka2014-07-231-2/+9
* GSP: Implement ReadHWRegs and WriteHWRegs properly.Tony Wasserka2014-07-231-27/+46
* GSP: Fixed to use real shared memory object, various cleanups.bunnei2014-07-051-25/+34
* FileSys: Added preliminary support for applications reading the RomFS archive.bunnei2014-07-051-3/+30
* APT: Added stubbed ReceiveParameter and various cleanups.bunnei2014-07-041-71/+93
* FS: Added stubbed code to intercept and decode file system service functions.bunnei2014-06-273-0/+154
* Merge branch 'threading' of https://github.com/bunnei/citrabunnei2014-06-149-148/+271
|\
| * HLE: Updated all uses of NULL to nullptr (to be C++11 compliant)bunnei2014-06-137-118/+118
| * HLE: Updated various handle debug assertions to be more clear.bunnei2014-06-131-1/+1
| * Kernel: Updated several member functions to be constbunnei2014-06-131-2/+2
| * service: added a error log messages for unimplemented WaitSynchronizationbunnei2014-06-051-0/+1
| * svc: added optional name field to Event and Mutex (used for debugging)bunnei2014-06-032-4/+4
| * gsp: always pass through synchronization barrier for commandsbunnei2014-06-011-1/+16
| * hle: added stubbed service for ndm_ubunnei2014-05-302-0/+65
| * service: cleaned up log messagesbunnei2014-05-301-2/+2
| * service: removed PT_A from, as this was just an alias for APT_Ubunnei2014-05-301-2/+0
| * srv: fix to log unimplemented service (instead of crash)bunnei2014-05-301-6/+2
| * hle: cleaned up log messagesbunnei2014-05-304-11/+15
| * service: added additional hack to return success on unimplemented service callsbunnei2014-05-301-2/+10
| * srv: changed a NOTICE_LOG to DEBUG_LOGbunnei2014-05-301-1/+1
| * apt: added stubbed function for InquireNotificationbunnei2014-05-291-78/+86
| * service: changed interface to return 0 (no error) when a service method is unimplemented - hack to make apps boot furtherbunnei2014-05-291-2/+2
| * APT_U: added stubbed function for APT_U::Enable, fixed some log messages to be more consistentbunnei2014-05-281-3/+10
| * APT_U: added event creation to Initialize methodbunnei2014-05-281-1/+11
| * kernel: added WaitSynchronization method to Kernel::Objectbunnei2014-05-271-0/+10
| * kernel: updated SyncRequest to take boolean thread wait result as a parameterbunnei2014-05-271-3/+4
| * service: Renamed Sync to SyncRequestbunnei2014-05-271-1/+1
| * srv: added a real mutex for GetProcSemaphore (instead of stubbed)bunnei2014-05-271-3/+10
| * kernel: add a SyncRequest method to KernelObject for use with svcSendSyncRequestbunnei2014-05-271-6/+0
* | GPU debugger: Add functionality to inspect command lists.Tony Wasserka2014-06-121-0/+4
* | GPU: Cleanup register definitions.Tony Wasserka2014-06-121-3/+3
* | Rename LCD to GPU.Tony Wasserka2014-06-121-8/+8
* | Add initial graphics debugger interface.Tony Wasserka2014-06-121-0/+6
* | GSP: Define more GX commands.Tony Wasserka2014-06-122-14/+54
* | service: fixed typo that MSVC did not catch as an errorbunnei2014-05-231-1/+1
|/
* APT_U: added a debug log on calling GetLockHandlebunnei2014-05-231-0/+1
* mutex: refactored the interface to code to return a Mutex* handlebunnei2014-05-211-1/+2
* mutex: initial commit of HLE modulebunnei2014-05-211-6/+4
* service: removed redundant include of common_types.hbunnei2014-05-211-1/+0
* renamed "syscall" module to "svc" (more accurate naming)bunnei2014-05-211-1/+1
* - created a Kernel namespacebunnei2014-05-212-8/+8
* apt: changed stubbed handle to be something other than 0xDEADBEEF (used as a magic value in other places) so that I can track how it propagates through the app codebunnei2014-05-201-1/+1
* - renamed NewHandle to CreateHandlebunnei2014-05-192-8/+8
* - updated service(s) to be KernelObject'sbunnei2014-05-196-55/+26
* renamed "UID" to "Handle" where appropriatebunnei2014-05-193-22/+20
* - moved Handle/Result definitions to kernel.hbunnei2014-05-193-7/+9
* added stubbed GetProcSemaphore - does nothing but avoids an exceptionbunnei2014-05-171-1/+7
* updated APT_U::GetLockHandle to return a valid handlebunnei2014-05-171-1/+5
* removed unknown fields from GX_CmdBufferHeaderbunnei2014-05-081-5/+0
* - removed HLE mem "hack" and replaced with kernel mem regionbunnei2014-05-084-8/+84
* removed DISALLOW_COPY_AND_ASSIGN in favor of NonCopyable classbunnei2014-04-283-9/+0
* fixed weird spacingbunnei2014-04-281-1/+1
* hackish but working way to set the framebuffer location to VRAM (used in ARM11 demos tested thus far, e.g. yeti3DS)bunnei2014-04-271-3/+9
* added simple GSP GPU ReadHWRegs function to support returning the framebuffer addressbunnei2014-04-261-1/+37
* added GSP::RegisterInterruptRelayQueue functionbunnei2014-04-251-31/+40
* - refactored how service functions are calledbunnei2014-04-255-19/+39
* fixed bug with printing std::string in log messagesbunnei2014-04-171-2/+2
* added class stub for HID:User servicebunnei2014-04-173-0/+72
* updated service commentsbunnei2014-04-176-5/+17
* - added stubbed out GSP::Gpu service interfacebunnei2014-04-167-7/+103
* removed no longer used function headerbunnei2014-04-161-2/+0
* restructured hle:services completely to use function lookup tablesbunnei2014-04-165-137/+215
* fixed naming for APT_Ubunnei2014-04-163-9/+9
* - extracted srv: calls from service.cpp and put in its own modulebunnei2014-04-164-106/+105
* added a stub for GetLockHandlebunnei2014-04-143-9/+44
* added framework for APT service (application and title launching service)bunnei2014-04-134-5/+117
* renamed class Interface_SRV to SRVbunnei2014-04-131-6/+6
* added some very initial command parsing for SRV Syncbunnei2014-04-131-5/+31
* cleanups to service HLEbunnei2014-04-132-8/+8
* - added HLE to connect to "srv:" servicebunnei2014-04-132-2/+170
* - renamed hle_syscall to just syscallbunnei2014-04-121-0/+60