summaryrefslogtreecommitdiffstats
path: root/src/common (follow)
Commit message (Expand)AuthorAgeFilesLines
* Set: Allow setting device nicknameChloe Marcec2022-12-142-0/+2
* Merge pull request #9398 from liamwhite/failbunnei2022-12-121-4/+7
|\
| * general: improve handling of system startup failureLiam2022-12-061-4/+7
* | Merge pull request #9415 from liamwhite/dcMai2022-12-113-88/+0
|\ \
| * | memory: correct semantics of data cache management operationsLiam2022-12-113-88/+0
* | | video_core: Integrate SMAALiam2022-12-081-1/+2
|/ /
* | Merge pull request #9370 from liamwhite/break-unmappedmerry2022-12-061-0/+1
|\ \ | |/ |/|
| * core: add option to break on unmapped accessLiam2022-12-021-0/+1
* | Merge pull request #6833 from abouvier/unbundleliamwhite2022-12-051-12/+2
|\ \
| * | cmake: prefer system librariesAlexandre Bouvier2022-12-041-12/+2
* | | Merge pull request #9273 from ameerj/per-game-profileliamwhite2022-12-041-0/+1
|\ \ \ | |/ / |/| |
| * | Configuration: Add per-game input profilesameerj2022-11-201-0/+1
* | | Merge pull request #9344 from liamwhite/nullbunnei2022-12-031-1/+2
|\ \ \
| * | | video_core: add null backendLiam2022-11-291-1/+2
* | | | Merge pull request #9300 from ameerj/pchliamwhite2022-12-034-2/+28
|\ \ \ \
| * | | | CMake: Consolidate common PCH headersameerj2022-12-013-8/+16
| * | | | string_util: Fix Mingw compile errorameerj2022-12-011-2/+2
| * | | | CMake: Use precompiled headersameerj2022-11-302-0/+18
| | |_|/ | |/| |
* | | | Merge pull request #9289 from liamwhite/fruit-companyliamwhite2022-12-039-4/+865
|\ \ \ \ | |/ / / |/| | |
| * | | general: fix compile for Apple ClangLiam2022-11-239-4/+865
* | | | Merge pull request #9339 from lioncash/cacheheaderMorph2022-11-282-4/+3
|\ \ \ \
| * | | | common/cache_management: Amend header includesLioncash2022-11-282-4/+3
| | |/ / | |/| |
* | | | common/input: Add helpers functions for creating input and output devicesLioncash2022-11-281-0/+34
* | | | common/input: Pass ParamPackage by const reference in CreateDeviceLioncash2022-11-281-3/+3
|/ / /
* | | Merge pull request #9276 from goldenx86/fsrSliderbunnei2022-11-272-0/+3
|\ \ \
| * | | settings: Reset FSR sharpening global state with the otherslat9nq2022-11-261-0/+1
| * | | FSR Sharpening Slider part 1 - only a global sliderMatías Locatti2022-11-242-0/+2
| |/ /
* | | OopsMatías Locatti2022-11-261-1/+1
* | | Replace GLSL as the default OpenGL shader backendMatías Locatti2022-11-261-1/+1
|/ /
* | Merge pull request #9234 from liamwhite/data-cash-moneybunnei2022-11-183-0/+89
|\ \
| * | common: add cache management functionsLiam2022-11-123-0/+89
* | | Merge pull request #9229 from Docteh/achy_breaky_heartMorph2022-11-181-0/+1
|\ \ \ | |_|/ |/| |
| * | Add break for default casesKyle Kienapfel2022-11-141-0/+1
| |/
* / Add CPU core count to log filesMatías Locatti2022-11-122-3/+60
|/
* Merge pull request #9198 from liamwhite/arm64bunnei2022-11-112-1/+9
|\
| * Initial ARM64 supportLiam2022-11-092-1/+9
* | Add break statement in default casesEnrico Mancuso2022-11-091-0/+1
|/
* concepts: Use the std::contiguous_iterator conceptMorph2022-10-262-19/+9
* Merge pull request #9107 from german77/gidoly_rulesliamwhite2022-10-251-1/+4
|\
| * input_common: cache vibration testsgerman772022-10-211-1/+4
* | CMakeLists: Disable C4100 and C4324Morph2022-10-221-9/+0
* | CMakeLists: Remove redundant warningsMorph2022-10-221-2/+0
* | CMakeLists: Treat MSVC warnings as errorsMorph2022-10-221-1/+0
* | general: Enforce C4800 everywhere except in video_coreMorph2022-10-222-4/+17
* | CMakeLists: Remove all redundant warningsMorph2022-10-221-2/+0
|/
* fixed_point: Mark default constructor as constexprLioncash2022-10-181-2/+2
* fixed_point: Mark copy/move assignment operators and constructors as constexprLioncash2022-10-181-3/+6
* fixed_point: Mark std::swap and move constructor as noexceptLioncash2022-10-181-2/+2
* fixed_point: Mark relevant member function [[nodiscard]]Lioncash2022-10-181-14/+14
* fixed_point: Make to_uint() non-constLioncash2022-10-181-2/+2
* fixed_point: Use defaulted comparisonsLioncash2022-10-181-23/+1
* fixed_point: Use variable templates and concepts where applicableLioncash2022-10-182-72/+56
* Merge pull request #9054 from Docteh/just_lz4bunnei2022-10-181-1/+5
|\
| * CMake: Try add library "LZ4::lz4_shared" if "lz4::lz4" is unavailableKyle Kienapfel2022-10-141-1/+5
* | fixed_point: Replace CONSTEXPR14 with constexprMorph2022-10-171-50/+42
* | general: Add missing pragma onceMorph2022-10-171-4/+1
|/
* settings: Update aspect_ratio rangeMorph2022-10-131-1/+1
* input_common: have an unique vector in callback statusgerman772022-10-091-2/+3
* General: address feedbackFernando Sahmkow2022-10-061-4/+4
* general: rework usages of UNREACHABLE macroLiam2022-10-061-15/+16
* address_space: Rename va_start to virt_startMorph2022-10-062-5/+5
* address_space: Address feedbackMorph2022-10-062-191/+233
* general: Format licenses as per SPDX guidelinesMorph2022-10-066-14/+13
* General: Fix clang format.Fernando Sahmkow2022-10-061-2/+2
* Common: Fix variable shadowing.Fernando Sahmkow2022-10-061-5/+5
* General: Fix compilation for GCCLiam White2022-10-065-17/+14
* DMA & InlineToMemory Engines Rework.bunnei2022-10-061-0/+8
* MemoryManager: initial multi paging system implementation.Fernando Sahmkow2022-10-061-0/+3
* Refactor VideoCore to use AS sepparate from Channel.Fernando Sahmkow2022-10-061-0/+7
* NVDRV: Remake ASGPUFernando Sahmkow2022-10-064-0/+485
* VideoCore: Update MemoryManagerFernando Sahmkow2022-10-062-4/+4
* Common: implement MultiLevelPageTable.Fernando Sahmkow2022-10-064-0/+171
* NVDRV: Refactor and add new NvMap.Fernando Sahmkow2022-10-061-5/+8
* common: remove "yuzu:" prefix from thread namesLiam2022-10-041-1/+1
* service: nfp: address commentsgerman772022-10-021-1/+1
* input_common: Create virtual amiibo drivergerman772022-10-021-0/+27
* Merge pull request #8920 from abouvier/cmake-gitbunnei2022-09-251-27/+2
|\
| * cmake: fix git detectionAlexandre Bouvier2022-09-181-27/+2
* | yuzu qt: Add option to disable startup Vulkan checklat9nq2022-09-191-0/+1
|/
* Merge pull request #8650 from Kelebek1/vsyncbunnei2022-09-171-0/+4
|\
| * Make coretiming waiting more accurateKelebek12022-08-021-0/+4
* | Merge pull request #8649 from lat9nq/common-position-independentMorph2022-09-161-3/+3
|\ \
| * | common: Use PROJECT_SOURCE_DIR to find CMakeModuleslat9nq2022-08-021-3/+3
* | | Merge pull request #8682 from lat9nq/dumpyMorph2022-09-161-0/+1
|\ \ \
| * | | yuzu: Use a debugger to generate minidumpslat9nq2022-09-051-0/+1
* | | | common: do not link to xbyak on non-amd64 architecturesliushuyu2022-09-141-1/+2
* | | | Merge pull request #8864 from german77/toggle_analogbunnei2022-09-101-0/+5
|\ \ \ \
| * | | | input_common: Add support for analog toggleNarr the Reg2022-09-061-0/+5
* | | | | Merge pull request #8819 from liamwhite/cash-moneylat9nq2022-09-092-0/+2
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | video_core: add option for pessimistic flushingLiam2022-08-252-0/+2
* | | | | Merge pull request #8822 from FearlessTobi/multiplayer-fixesbunnei2022-09-021-0/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | yuzu: Display current game version in multiplayer roomFearlessTobi2022-08-271-0/+1
| |/ / /
* / / / Silence std::aligned_storage warnings as it's deprecated in C++23,Kelebek12022-09-011-1/+1
|/ / /
* | | Merge pull request #8784 from Docteh/nosnekliamwhite2022-08-211-9/+0
|\ \ \
| * | | code: dodge PAGE_SIZE #defineKyle Kienapfel2022-08-201-9/+0
* | | | common: remove unneeded x86-specific headerliushuyu2022-08-161-1/+0
|/ / /
* | | Make copyright headers SPDX-compliantFearlessTobi2022-08-151-3/+2
* | | core, network: Add ability to proxy socket packetsFearlessTobi2022-08-153-7/+56
* | | Allow audio volume up to 200%Kelebek12022-08-122-2/+2
| |/ |/|
* | common: move forwarded value into SPSCQueueLiam2022-07-291-1/+1
* | Revert Coretiming PRs 8531 and 7454 (#8591)Maide2022-07-282-6/+1
* | chore: make yuzu REUSE compliantAndrea Pappacoda2022-07-2731-106/+68
|/
* network, yuzu: Make copyright headers SPDX-compliantFearlessTobi2022-07-251-3/+2
* network, yuzu: Improve variable naming and style consistencyFearlessTobi2022-07-251-1/+1
* common: multiplayer: Use GameInfo typegerman772022-07-251-19/+16
* Address second part of review commentsFearlessTobi2022-07-251-21/+30
* common, core: fix -Wmissing-field-initializersFearlessTobi2022-07-251-2/+2
* yuzu: Add ui files for multiplayer roomsFearlessTobi2022-07-252-0/+139
* yuzu: Add webcam support and rebase to latest masterNarr the Reg2022-07-241-2/+2
* input_common: Add camera drivergerman772022-07-242-1/+31
* Merge pull request #8545 from Kelebek1/Audioliamwhite2022-07-236-2/+2447
|\
| * Project AndioKelebek12022-07-226-2/+2447
* | ci,CMake: Drop Conan support for vcpkglat9nq2022-07-231-2/+3
|/
* Merge pull request #8508 from yuzu-emu/mc-speed-limitbunnei2022-07-172-3/+0
|\
| * yuzu: settings: Remove framerate cap and merge unlocked framerate setting.bunnei2022-07-172-3/+0
* | Merge pull request #8543 from BreadFish64/use_tsc_from_capsbunnei2022-07-173-1/+22
|\ \ | |/ |/|
| * guard against div-by-zeroMarshall Mohror2022-07-061-2/+5
| * common/x64: Use TSC clock rate from CPUID when availableMarshall Mohror2022-07-063-1/+19
* | Merge pull request #8593 from merryhime/ranged-setting-Tbunnei2022-07-171-34/+33
|\ \
| * | common/setting: Make ranged a property of the typemerry2022-07-151-34/+33
* | | Merge pull request #8511 from german77/hbmenubunnei2022-07-162-2/+2
|\ \ \
| * | | service: ptm: Rewrite PSM and add TSgerman772022-06-292-2/+2
* | | | Merge pull request #8560 from liamwhite/bitfield-may-aliasbunnei2022-07-161-0/+9
|\ \ \ \ | |_|/ / |/| | |
| * | | common: fix bitfield aliasing on GCC/ClangLiam2022-07-101-0/+9
* | | | common_funcs: Mark padding as [[maybe_unused]]Merry2022-07-151-4/+6
|/ / /
* | | Merge pull request #8522 from lat9nq/consolidate-settingsMorph2022-07-071-270/+182
|\ \ \ | |_|/ |/| |
| * | settings: Consolidate RangedSetting's with regular oneslat9nq2022-06-301-270/+182
| |/
* | common/fiber: make fibers easier to useLiam2022-07-022-20/+8
* | Adress Feedback.Fernando Sahmkow2022-06-301-1/+0
* | Native clock: Use atomic ops as before.Fernando Sahmkow2022-06-282-24/+29
* | Native Clock: remove inaccuracy mask.Fernando Sahmkow2022-06-282-6/+1
* | Core: Fix tests.Fernando Sahmkow2022-06-282-2/+2
* | Core/Common: Corrections to core timing and add critical priority.Fernando Sahmkow2022-06-282-4/+10
* | Common: improve native clock.Fernando Sahmkow2022-06-283-29/+29
|/
* Merge pull request #8432 from liamwhite/watchpointbunnei2022-06-221-0/+3
|\
| * core/debugger: memory breakpoint supportLiam2022-06-161-0/+3
* | Merge pull request #8472 from german77/taceMorph2022-06-161-3/+3
|\ \ | |/ |/|
| * common: param_package: Demote DEBUG to TRACE for gettersNarr the Reg2022-06-161-3/+3
* | Merge pull request #8460 from Morph1984/bounded-qliamwhite2022-06-161-86/+73
|\ \
| * | bounded_threadsafe_queue: Use constexpr capacity and maskMorph2022-06-151-86/+73
* | | Merge pull request #8383 from Morph1984/shadow-of-the-pastMai2022-06-151-2/+2
|\ \ \ | |_|/ |/| |
| * | common: Eliminate variable shadowingMorph2022-06-141-2/+2
| |/
* | common/assert: rework ASSERT handling to avoid std::function usageLiam2022-06-142-35/+20
* | common/assert: add unlikelyLiam2022-06-141-1/+1
* | common: Don't test ASSERT conditions inlineLiam2022-06-142-32/+36
* | common: Change semantics of UNREACHABLE to unconditionally crashLiam2022-06-143-3/+18
|/
* Merge pull request #8413 from behunin/bounded-queuebunnei2022-06-111-0/+180
|\
| * gpu_thread: Move to bounded queueLevi Behunin2022-06-031-0/+180
* | Merge pull request #8393 from lat9nq/default-vulkanbunnei2022-06-111-1/+1
|\ \
| * | settings: Set Vulkan to the default renderer backendlat9nq2022-05-301-1/+1
* | | common: consolidate ELF structure definitionsLiam2022-06-052-0/+334
| |/ |/|
* | core/debugger: Implement new GDB stub debuggerLiam2022-06-012-1/+2
|/
* Merge pull request #8374 from german77/asnycvibrationsbunnei2022-05-281-0/+1
|\
| * input_common: Make vibration request asyncNarr the Reg2022-05-231-0/+1
* | path_util: Resolve `-Wpointer-bool-conversion` warninglat9nq2022-05-271-3/+1
|/
* string_util: Add U16StringFromBufferlat9nq2022-05-162-0/+6
* VideoCore: Add option to dump the macros.Fernando Sahmkow2022-05-091-0/+1
* Merge pull request #8280 from Tachi107/spdx-fixupMai M2022-04-2919-172/+59
|\
| * chore: add missing SPDX tagsAndrea Pappacoda2022-04-2819-172/+59
* | GCC 12 fixesLiam2022-04-281-1/+1
|/
* general: Convert source file copyright comments over to SPDXMorph2022-04-2367-211/+136
* yuzu: Add custom ringcon configurationgerman772022-04-162-0/+4
* hle: kernel: Use std::mutex instead of spin locks for most kernel locking.bunnei2022-04-121-2/+3
* common: Replace lock_guard with scoped_lockMerry2022-04-073-5/+5
* Merge pull request #8143 from merryhime/rdtscFernando S2022-04-071-14/+35
|\
| * native_clock: Internal linkage for FencedRDTSCMerry2022-04-031-2/+4
| * native_clock: Use lfence with rdtscmerry2022-04-031-14/+33
* | service: jit: stub JIT serviceLiam2022-04-072-0/+2
* | Merge pull request #8089 from merryhime/paranoiabunnei2022-04-041-1/+2
|\ \ | |/ |/|
| * configuration: Add Paranoid CPU accuracy levelmerry2022-03-261-1/+2
* | native_clock: Use writeback from CAS to avoid double-loadingmerry2022-04-021-4/+6
* | atomic_ops: Implement AtomicCompareAndSwap with writebackmerry2022-04-021-0/+73
* | native_clock: Use AtomicLoad128Merry2022-04-021-2/+2
* | atomic_ops: Implement AtomicLoad128Merry2022-04-021-0/+17
|/
* hle: nvflinger: Merge Rect with Common::Rectangle.bunnei2022-03-251-5/+45
* common: logging: Add a logger for NVFlinger.bunnei2022-03-252-0/+2
* general: Fix clang/gcc build errorsameerj2022-03-207-0/+9
* common: Reduce unused includesameerj2022-03-1925-32/+1
* common: Reduce unused includesameerj2022-03-198-12/+0
* common: tree: Various updates.bunnei2022-03-151-284/+341
* common: intrusive_red_black_tree: Various updates.bunnei2022-03-151-181/+210
* cpu_detect: Add additional x86 flags and telemetryWunkolo2022-03-113-27/+84
* common/telemetry: Update `AddField` name type to `string_view`Wunkolo2022-03-111-3/+4
* backend: Ensure backend_thread is destructed before message_queueMerry2022-03-101-1/+1
* cpu_detect: Revert `__cpuid{ex}` array-type argumentWunkolo2022-03-101-6/+6
* cpu_detect: Add missing `lzcnt` detectionWunkolo2022-03-091-0/+1
* cpu_detect: Refactor cpu/manufacturer identificationWunkolo2022-03-092-24/+38
* cpu_detect: Update array-types to `span` and `array`Wunkolo2022-03-091-11/+13
* cpu_detect: Utilize `Bit<N>` utility functionWunkolo2022-03-091-32/+20
* cpu_detect: Compact capability fieldsWunkolo2022-03-091-20/+21
* bit_util: Add `bit` utility functionWunkolo2022-03-091-0/+7
* Merge pull request #7973 from Morph1984/debug-crashFernando S2022-03-061-2/+2
|\
| * host_memory: Fix fastmem crashes in debug buildsMorph2022-03-031-2/+2
* | Merge pull request #7935 from Wunkolo/logging-join-fixbunnei2022-03-031-13/+5
|\ \ | |/ |/|
| * logging: Convert `backend_thread` into an `std::jthread`Wunkolo2022-02-281-13/+5
* | dynarmic: Inline exclusive memory accessesmerry2022-02-272-0/+4
|/
* settings: Add a new "use_extended_memory_layout" setting.bunnei2022-02-212-0/+2
* fixup! core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-192-16/+16
* core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-192-6/+76
* common: Add NullVisitor default constructorWunkolo2022-02-171-0/+3
* Merge pull request #7878 from german77/mnppbunnei2022-02-172-0/+2
|\
| * service/mnpp: Stub mnpp_appNarr the Reg2022-02-112-0/+2
* | common: fs_util: Add buffer to string view utility functionsMorph2022-02-142-0/+26
* | common: uuid: Use sizeof(u64) instead of 8 in Hash()Morph2022-02-101-5/+5
* | common: uuid: Return an invalid UUID if conversion from string failsMorph2022-02-051-14/+39
* | general: Rename NewUUID to UUID, and remove the previous UUID implMorph2022-02-056-434/+256
* | common: uuid: Add AsU128()Morph2022-02-052-0/+9
* | input/hid: Migrate to the new UUID implementationMorph2022-02-051-4/+4
* | common: Implement NewUUIDMorph2022-02-053-0/+322
|/
* common_types: Remove NonCopyable structLioncash2022-02-021-10/+0
* general: Replace NonCopyable struct with equivalentsLioncash2022-02-021-9/+17
* Merge pull request #7807 from german77/moar-buttonsbunnei2022-02-021-0/+2
|\
| * input_common: Add home and hard touch press buttons to UDP controllersgerman772022-01-301-0/+2
* | Merge pull request #7809 from Morph1984/clock-constantsbunnei2022-02-023-11/+19
|\ \
| * | common: wall_clock: Check precision against the emulated CPU and CNTFRQMorph2022-01-302-8/+12
| * | common: wall_clock: Utilize constants for ms, us, and ns ratiosMorph2022-01-303-5/+9
| |/
* / common/file: Remove [[nodiscard]] from Open()Lioncash2022-02-011-3/+2
|/
* Merge pull request #7791 from german77/wall_clockMorph2022-01-291-1/+3
|\
| * wall_clock: use standard wall clock if rtsc frequency is too lowgerman772022-01-281-1/+3
* | common/xbyak_api: Make BuildRegSet() constexprLioncash2022-01-261-8/+8
* | yuzu: Add setting to disable controller navigationgerman772022-01-241-0/+1
|/
* Merge pull request #7695 from Morph1984/is-pow2bunnei2022-01-211-0/+6
|\
| * common: bit_util: Add IsPow2 helper functionMorph2022-01-111-0/+6
* | Merge pull request #7725 from german77/mouse_in_motionbunnei2022-01-191-0/+7
|\ \
| * | input_common: Reintroduce motion from mouse and use button namesgerman772022-01-171-0/+7
| |/
* / common: fiber: YieldTo: Avoid hard crash on nullptr previous_fiber.bunnei2022-01-151-1/+4
|/
* logging/log.h: move enum class formatter to a separate file ...liushuyu2022-01-103-15/+25
* logging/log: use `underlying_type` instead of hardcoding typesliushuyu2022-01-091-2/+4
* logging: adapt to changes in fmt 8.1liushuyu2022-01-081-1/+14
* ShaderDecompiler: Add a debug option to dump the game's shaders.Fernando Sahmkow2022-01-041-0/+1
* Allow overriding SCM version infoAndrew Udvare2021-12-211-0/+5
* Merge pull request #7558 from Morph1984/unused-cpu-family-modelMai M2021-12-151-12/+0
|\
| * common/cpu_detect: Remove CPU family and modelMorph2021-12-141-12/+0
* | common/input: Avoid numerous large copies of CallbackStatusLioncash2021-12-141-2/+2
* | common/input: Remove unnecessary returnsLioncash2021-12-141-6/+2
* | input_engine: Pass LedStatus by const referenceLioncash2021-12-131-1/+1
* | input_engine: Pass VibrationStatus by const reference in SetRumble()Lioncash2021-12-131-4/+2
|/
* Merge pull request #7525 from german77/notifabunnei2021-12-082-0/+2
|\
| * service/notif: Add notif:a and stub ListAlarmSettings,Initializegerman772021-12-062-0/+2
* | general: Add missing copyright noticesameerj2021-12-051-0/+4
|/
* native_clock: Wait for less time in EstimateRDTSCFrequencyMorph2021-12-041-18/+18
* general: Replace high_resolution_clock with steady_clockMorph2021-12-021-3/+3
* settings: Add debug setting to enable all controllersgerman772021-11-282-0/+6
* config: Remove vibration configurationgerman772021-11-271-2/+0
* input_common: Fully implement UDP controllersNarr the Reg2021-11-262-0/+15
* input_common: Move button names to the frontendgerman772021-11-251-0/+22
* core/hid: Fully implement native mousegerman772021-11-252-5/+11
* input_common: Allow keyboard to be backwards compatiblegerman772021-11-251-2/+0
* core/hid: Improve accuracy of the keyboard implementationgerman772021-11-251-12/+23
* config: Cleanup and documentationgerman772021-11-252-6/+31
* core/hid: Prevent Emulated controller from flapping with multiple inputs devicesgerman772021-11-251-0/+4
* core/hid: Fully emulate motion from buttongerman772021-11-251-0/+5
* second commit lion reviewgerman772021-11-251-1/+1
* settings: Fix Debug controller type optionsgerman772021-11-251-2/+2
* kraken: Address comments from reviewgerman772021-11-252-3/+2
* core/hid: Add TAS inputgerman772021-11-251-1/+0
* input_common: Add manual update options to input devicesgerman772021-11-251-0/+10
* core/hid: Fix rumble too strong at 1%german772021-11-251-0/+7
* core/hid: Only signal when neededgerman772021-11-251-0/+1
* core/hid: Add output devicesgerman772021-11-251-0/+39
* settings: Cleanup settingsgerman772021-11-252-4/+12
* common: Rewrite and move core/frontend/input.h to commongerman772021-11-252-0/+243
* configure_general: Allow framerate cap to be used in custom game configsKewlan2021-11-212-1/+2
* TextureCache: Refactor and fix linux compiling.Fernando Sahmkow2021-11-201-0/+7
* TextureCache: Add automatic anisotropic filtering and refactor code.Fernando Sahmkow2021-11-161-1/+1
* Yuzu UI: Add button for Anti AliasFernando Sahmkow2021-11-161-0/+1
* Settings: Add anti-aliasing method settingMarshall Mohror2021-11-162-0/+7
* QtGUI: Add buttton to toggle the filter.FernandoS272021-11-161-0/+1
* VideoCore: Add gaussian filtering.FernandoS272021-11-161-2/+3
* VideoCore: Add more rescaling option.FernandoS272021-11-162-4/+20
* Video Core: fix building for GCC.Fernando Sahmkow2021-11-161-2/+2
* Presentation: add Nearest Neighbor filter.Fernando Sahmkow2021-11-161-4/+5
* vulkan: Implement FidelityFX Super ResolutionMarshall Mohror2021-11-161-0/+1
* Texture Cahe: Fix downscaling on SMO.Fernando Sahmkow2021-11-162-0/+3
* video_core: Refactor resolution scale functionameerj2021-11-161-0/+14
* video_core: Misc resolution scaling related refactoringameerj2021-11-161-1/+1
* Renderer: Implement Bicubic and ScaleForce filters.Fernando Sahmkow2021-11-162-15/+12
* common/settings: Remove unused scaling optionsReinUsesLisp2021-11-162-18/+7
* Settings: eliminate rescaling_factor.Fernando Sahmkow2021-11-162-2/+2
* Settings: Add resolution scaling to settings.Fernando Sahmkow2021-11-162-4/+60
* VideoCore: Initial Setup for the Resolution Scaler.Fernando Sahmkow2021-11-162-0/+19
* Merge pull request #7272 from behunin/the-courteous-loggerbunnei2021-11-133-28/+39
|\
| * Refactor Logging ImplLevi Behunin2021-11-023-28/+39
* | common: Implement a subset of P0323 (std::expected)Morph2021-11-022-0/+988
|/
* common/alignment: Fix VS2022 compilationameerj2021-10-201-1/+6
* settings: Remove std::chrono usageameerj2021-10-171-3/+2
* string_util: Make use of std::string_view and add bounds checkingMorph2021-10-142-5/+5
* string_util: Prevent out of bounds access in u16string_view bufferMorph2021-10-141-2/+2
* common/fs/path_util: Slightly refactor PathManagerImpl's constructorCreak2021-10-121-12/+15
* Merge pull request #7115 from ameerj/log-compilebunnei2021-10-057-18/+39
|\
| * common/logging: Reduce scope of fmt includeameerj2021-10-022-1/+2
| * common/logging: Move Log::Entry declaration to a separate headerameerj2021-10-026-17/+37
* | Merge pull request #7102 from Morph1984/remove-boxcatbunnei2021-10-022-4/+0
|\ \ | |/ |/|
| * settings: Remove BCAT settingsMorph2021-09-292-4/+0
* | Fixed invalid iterator usageAndrew Strelsky2021-09-291-1/+1
|/
* general: Update style to clang-format-12ameerj2021-09-244-22/+28
* common/uuid: Add validity checking functions to interfaceLioncash2021-09-221-0/+7
* Merge pull request #7019 from ameerj/videocore-jthreadbunnei2021-09-191-5/+22
|\
| * threadsafe_queue: Add std::stop_token overload to PopWaitameerj2021-09-161-5/+22
* | input_common/tas: Document the main classgerman772021-09-181-7/+4
* | input_common/tas: Add swap controllergerman772021-09-181-1/+1
* | input_common/tas: Fallback to simple updateMonsterDruide12021-09-181-4/+3
* | config: Move TAS options to it's own menugerman772021-09-183-4/+3
* | core: Hacky TAS syncing & load pausingMonsterDruide12021-09-183-7/+6
* | settings: File selector & other settingsMonsterDruide12021-09-183-0/+7
* | input_common/tas: Base playback & recording systemMonsterDruide12021-09-181-0/+7
* | Merge pull request #7020 from Moonlacer/remove_audio_stretchingbunnei2021-09-182-3/+0
|\ \
| * | fix_accidental_deletionMoonlacer2021-09-161-1/+2
| * | remove-audio-stretching-settingMoonlacer2021-09-162-5/+1
| |/
* | Merge pull request #6950 from german77/multiplaybunnei2021-09-182-3/+6
|\ \ | |/ |/|
| * input_common: Enable steam controllers and 8 player supportgerman772021-09-102-3/+6
* | common_funcs: Add enum flag bitwise shift operator overloadsMorph2021-09-131-0/+16
* | common_funcs: Replace <algorithm> with <iterator>Morph2021-09-111-1/+1
* | common: Move error handling to error.cpp/hMorph2021-09-115-16/+31
* | Merge pull request #6846 from ameerj/nvdec-gpu-decodeFernando S2021-09-112-3/+9
|\ \ | |/ |/|
| * configure_graphics: Add GPU nvdec decoding as an optionameerj2021-08-162-3/+9
* | common/logging: Add missing includegerman772021-09-021-0/+1
* | Merge pull request #6897 from FernandoS27/pineapple-does-not-belong-in-pizzabunnei2021-08-313-3/+140
|\ \
| * | Garbage Collection: Adress Feedback.Fernando Sahmkow2021-08-291-12/+11
| * | Garbage Collection: enable as default, eliminate option.Fernando Sahmkow2021-08-282-3/+0
| * | VideoCore: Rework Garbage Collection.Fernando Sahmkow2021-08-281-0/+141
* | | Merge pull request #6927 from german77/ngctMorph2021-08-292-0/+2
|\ \ \ | |/ / |/| |
| * | ngct: Stub NGCT:U servicegerman772021-08-272-0/+2
* | | Revert "logging: Display backtrace on crash"Morph2021-08-272-114/+1
|/ /
* | Merge pull request #6870 from yzct12345/trace-back-stack-back-stack-backbunnei2021-08-272-1/+114
|\ \
| * | logging: Display backtrace on crashyzct123452021-08-132-1/+114
* | | logging: Fix log filter during initializationameerj2021-08-241-4/+5
* | | Merge pull request #6869 from yzct12345/shiny-logs-in-the-fireplacebunnei2021-08-232-245/+218
|\| |
| * | logging: Simplify and make thread-safeyzct123452021-08-132-245/+218
| |/
* | settings: Amend language_index maximum setting rangeMorph2021-08-211-1/+1
* | Merge pull request #6877 from MerryMage/dyn-ignore-assertsbunnei2021-08-202-2/+2
|\ \
| * | xbyak: Update include pathMerry2021-08-152-2/+2
* | | Merge pull request #6863 from spholz/fix-lan-playFernando S2021-08-161-1/+2
|\ \ \ | |/ / |/| |
| * | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-122-28/+164
| |\|
| * | configuration: add option to select network interfacespholz2021-08-121-1/+2
* | | threadsafe_queue: Fix deadlockyzct123452021-08-131-6/+4
| |/ |/|
* | settings: Fix MSVC issueslat9nq2021-08-111-7/+22
* | Merge pull request #6776 from lat9nq/ranged-settingsbunnei2021-08-111-26/+136
|\ \
| * | settings: Use std::clamp where possiblelat9nq2021-07-311-39/+9
| * | settings: Remove unnecessary std::move usageslat9nq2021-07-311-12/+12
| * | settings: Fix function virtualizationlat9nq2021-07-301-12/+18
| * | settings: Implement setting rangeslat9nq2021-07-301-18/+152
* | | Merge pull request #6827 from Morph1984/uuid-hashbunnei2021-08-081-0/+11
|\ \ \ | |_|/ |/| |
| * | common: uuid: Add hash function for UUIDMorph2021-08-061-0/+11
* | | Merge pull request #6822 from yzct12345/clion-assertbunnei2021-08-061-2/+6
|\ \ \ | |/ / |/| |
| * | assert: Verify formattingyzct123452021-08-051-2/+6
| * | assert: Avoid empty macrosyzct123452021-08-051-2/+2
* | | Merge pull request #6813 from Morph1984/hex-string-to-uuidbunnei2021-08-052-0/+73
|\ \ \ | |/ / |/| |
| * | common: uuid: Add hex string to UUID constructorMorph2021-08-042-0/+73
* | | hex_util: Fix incorrect array size in AsArrayMorph2021-08-051-1/+1
|/ /
* | Merge pull request #6759 from ReinUsesLisp/pipeline-statisticsbunnei2021-07-301-0/+1
|\ \ | |/ |/|
| * renderer_vulkan: Add setting to log pipeline statisticsReinUsesLisp2021-07-281-0/+1
* | Merge pull request #6742 from Morph1984/uuidbunnei2021-07-291-1/+1
|\ \
| * | common: uuid: Return a lower-case hex string in FormatMorph2021-07-271-1/+1
* | | Merge pull request #6758 from jbeich/fastmembunnei2021-07-281-2/+7
|\ \ \
| * | | host_memory: Add workaround for FreeBSD 12Jan Beich2021-07-271-0/+5
| * | | host_memory: Enable Linux implementation on FreeBSDJan Beich2021-07-271-2/+2
| | |/ | |/|
* | | Merge pull request #6700 from lat9nq/fullscreen-enumbunnei2021-07-281-3/+8
|\ \ \
| * \ \ Merge branch 'master' into fullscreen-enumlat9nq2021-07-257-70/+24
| |\ \ \ | | | |/ | | |/|
| * | | general: Implement FullscreenMode enumerationlat9nq2021-07-231-3/+8
* | | | common: fs: fs_util: Add BufferToUTF8StringMorph2021-07-272-0/+15
| |_|/ |/| |
* | | Merge pull request #6696 from ameerj/speed-limit-renamebunnei2021-07-272-6/+6
|\ \ \
| * | | general: Rename "Frame Limit" references to "Speed Limit"ameerj2021-07-242-6/+6
| |/ /
* | | Merge pull request #6697 from ameerj/fps-capbunnei2021-07-261-0/+1
|\ \ \ | |_|/ |/| |
| * | config, nvflinger: Add FPS cap settingameerj2021-07-241-0/+1
| |/
* | Merge pull request #6585 from ameerj/hadesbunnei2021-07-257-69/+23
|\ \
| * | cmake: Remove shader cache versionReinUsesLisp2021-07-232-11/+1
| * | general: Add setting shader_backendlat9nq2021-07-232-3/+9
| * | shader: Add loggingReinUsesLisp2021-07-232-0/+8
| * | shader: Add shader loop safety check settingslat9nq2021-07-231-0/+3
| * | shader_recompiler,video_core: Cleanup some GCC and Clang errorslat9nq2021-07-231-0/+1
| * | shader: Remove old shader managementReinUsesLisp2021-07-231-55/+1
| * | thread_worker: Fix compile time errorameerj2021-07-231-1/+1
| |/
* / common: Publically link to pthreadslat9nq2021-07-231-1/+1
|/
* uuid: Directly compare UUID instead of checking per elementChloe Marcec2021-07-201-3/+2
* input_common: Fix mouse panning behaivourgerman772021-07-171-1/+1
* Merge pull request #6579 from ameerj/float-settingsbunnei2021-07-162-6/+6
|\
| * configure_input: Use u8 for mouse sensitivityameerj2021-07-091-1/+1
| * configure_graphics: Use u8 for bg_color valuesameerj2021-07-091-3/+3
| * configure_audio: Use u8 for volume valueameerj2021-07-092-2/+2
* | Merge pull request #6576 from ameerj/unlock-fps-settingMorph2021-07-111-1/+1
|\ \
| * | settings: Disable FPS unlimit setting between title launchesameerj2021-07-101-1/+1
| |/
* | Merge pull request #6573 from lat9nq/cpu-settings-cleanup-2Fernando S2021-07-092-5/+8
|\ \
| * | settings, arm_dynarmic, yuzu qt: Move CPU debugging optionlat9nq2021-07-082-2/+2
| * | settings, yuzu qt: Add migration code for CPU accuracylat9nq2021-07-081-0/+2
| * | core,common,yuzu qt: Add CPU accuracy option 'Auto'lat9nq2021-07-081-4/+5
| |/
* | common/thread_worker: Stop workers on stop_token when waitingReinUsesLisp2021-07-091-18/+20
* | common/thread_worker: Add support for stateful threadsReinUsesLisp2021-07-093-78/+86
* | common/thread_worker: Simplify logicFernandoS272021-07-091-8/+1
* | common/thread_worker: Fix data raceFernandoS272021-07-092-1/+18
* | common/thread_worker: Use unique functionReinUsesLisp2021-07-092-28/+24
* | common: Add unique functionReinUsesLisp2021-07-092-0/+63
* | common/thread_worker: Add wait for requests methodReinUsesLisp2021-07-092-0/+11
|/
* Merge pull request #6539 from lat9nq/default-settingAmeer J2021-07-082-123/+303
|\
| * general: Code formatting improvementslat9nq2021-07-081-2/+1
| * settings: Set resolution_factor default to 1lat9nq2021-07-011-1/+1
| * general: Make most settings a BasicSettinglat9nq2021-06-282-127/+295
| * common: Force defaults for Settings::Setting'slat9nq2021-06-261-44/+57
* | common: logging: backend: Close the file after exceeding the write limitMorph2021-07-061-8/+11
* | common: fs: file: Revert Flush to its previous behavior and add CommitMorph2021-07-062-3/+34
* | common: fs: file: Flush the file in GetSizeMorph2021-07-061-0/+3
|/
* Merge pull request #6519 from Wunkolo/mem-size-literalbunnei2021-06-254-49/+39
|\
| * common: Replace common_sizes into user-literalsWunkolo2021-06-244-49/+39
* | general: Add missing #pragma once directivesMorph2021-06-241-0/+2
* | Merge pull request #6517 from lioncash/fmtlibbunnei2021-06-241-1/+2
|\ \ | |/ |/|
| * General: Resolve fmt specifiers to adhere to 8.0.0 API where applicableLioncash2021-06-231-1/+2
* | Merge pull request #6465 from FernandoS27/sex-on-the-beachMai M2021-06-233-0/+4
|\ \ | |/ |/|
| * Reaper: Address Feedback.Fernando Sahmkow2021-06-161-0/+1
| * Reaper: Setup settings and final tuning.Fernando Sahmkow2021-06-162-0/+3
* | Merge pull request #6512 from ReinUsesLisp/wait-detached-stasksMai M2021-06-231-0/+2
|\ \
| * | common/detached_tasks: Wait for tasks before shutting downRodrigo Locatti2021-06-221-0/+2
* | | common: fs: Add a description of a regular file in IsFileMorph2021-06-221-4/+6
* | | common: fs: Amend IsFile check in FileOpen / (Write/Append)StringToFileMorph2021-06-224-9/+12
* | | common: fs: file: Remove [[nodiscard]] attribute from FlushMorph2021-06-222-3/+3
* | | common: fs: Remove [[nodiscard]] attribute on Remove* functionsMorph2021-06-222-9/+9
|/ /
* | Merge pull request #6499 from FernandoS27/we-were-on-a-breakbunnei2021-06-212-0/+2
|\ \
| * | Update dynarmic and add new unsafe CPU option.Fernando Sahmkow2021-06-202-0/+2
* | | Merge pull request #6475 from ameerj/unlimit-fpsbunnei2021-06-211-0/+1
|\ \ \ | |/ / |/| |
| * | nvflinger: Add toggle to disable buffer swap interval limitsameerj2021-06-171-0/+1
| |/
* / host_memory: Correct MEM_RESERVE_PLACEHOLDERlat9nq2021-06-191-1/+1
|/
* Merge pull request #6464 from ameerj/disable-astcbunnei2021-06-162-0/+3
|\
| * configure_graphics: Add Accelerate ASTC decoding settingameerj2021-06-162-0/+3
* | Merge pull request #6460 from Morph1984/fs-access-log-fixMorph2021-06-163-6/+2
|\ \
| * | common: fs: file: Remove redundant call to WriteStringToFileMorph2021-06-162-6/+1
| * | fsp_srv: Fix filesystem access loggingMorph2021-06-161-0/+1
| |/
* | Merge pull request #6462 from Morph1984/proper-flushbunnei2021-06-161-1/+5
|\ \ | |/ |/|
| * common: fs: file: Flush the file to the disk when Flush() is calledMorph2021-06-131-1/+5
* | Merge pull request #6448 from Morph1984/recursive-dir-iteratorFernando Sahmkow2021-06-141-2/+16
|\ \
| * | common: fs: Use the normal directory iterator in *Recursively functionsMorph2021-06-121-2/+16
| |/
* | common: logging: Restructure backend codeMorph2021-06-138-278/+288
* | common: logging: backend: Wrap IOFile in a unique_ptrMorph2021-06-132-6/+27
|/
* common/host_memory: Implement a fallback if fastmem fails.Markus Wick2021-06-112-14/+49
* common/host_shader: Load Windows 10 functions dynamicallyReinUsesLisp2021-06-111-29/+88
* host_memory: Support staged VirtualProtect callsReinUsesLisp2021-06-111-3/+12
* General: Add settings for fastmem and disabling adress space check.FernandoS272021-06-112-0/+12
* common/host_memory: Optimize for huge tables.Markus Wick2021-06-112-11/+24
* core: Make use of fastmemMarkus Wick2021-06-111-0/+2
* common/host_memory: Add Linux implementationMarkus Wick2021-06-111-10/+120
* common/host_memory: Add interface and Windows implementationReinUsesLisp2021-06-113-0/+384
* src/common/CMakeLists.txt: fix variable escapingliushuyu2021-06-091-8/+9
* common/fs/path_util: Remove [[nodiscard]] from function with void returnLioncash2021-06-091-1/+1
* Merge pull request #6395 from lioncash/result-moveMorph2021-06-021-25/+0
|\
| * common_funcs: Move R_ macros to result.hLioncash2021-05-311-25/+0
* | common: fs: fs_util: Move PathToUTF8String to fs_utilMorph2021-06-024-15/+14
* | common: fs: fs_util: Add more string conversion functionsMorph2021-06-022-0/+33
|/
* Merge pull request #6385 from degasus/save_memory_accessbunnei2021-05-312-0/+7
|\
| * core/memory: Check our memory fallbacks for out-of-bound behavior.Markus Wick2021-05-292-0/+7
* | common: Extract point into a common structLioncash2021-05-282-0/+58
|/
* common/fs/file: Explicitly delete copy constructorsLioncash2021-05-281-1/+4
* common/fs/file: Devirtualize destructorLioncash2021-05-281-1/+1
* common/fs/file: Default initialize IOFile membersLioncash2021-05-281-2/+2
* common: fs: Rework the Common Filesystem interface to make use of std::filesystem (#6270)Morph2021-05-2620-1432/+2963
* Merge pull request #6357 from lioncash/compressionbunnei2021-05-254-7/+8
|\
| * zstd_compression: Make use of std::spanLioncash2021-05-242-3/+4
| * lz4_compression: Make use of std::spanLioncash2021-05-242-4/+4
* | common: tree: Avoid a crash on nullptr dereference.bunnei2021-05-211-0/+11
|/
* Merge pull request #6321 from lat9nq/per-game-cpubunnei2021-05-212-7/+12
|\
| * general: Demote custom_rtc to regular settinglat9nq2021-05-172-2/+1
| * configuration: Add CPU tab to game propertieslat9nq2021-05-161-0/+6
| * general: Make CPU accuracy and related a Settings::Settinglat9nq2021-05-162-5/+5
* | Merge pull request #6297 from lioncash/common-convbunnei2021-05-201-1/+2
|\ \
| * | parent_of_member: Make sign conversion explicit in OffsetOfImpl()Lioncash2021-05-101-1/+2
| |/
* / common: tree: Avoid a nullptr dereference.bunnei2021-05-121-1/+1
|/
* fixup! common: bit_util: Add BIT macro.bunnei2021-05-061-2/+0
* common: parent_of_member: Fix build for OffsetOf().bunnei2021-05-061-4/+4
* fixup! common: intrusive_red_black_tree: Disable static_assert that will not evaluate as constant on MSVC.bunnei2021-05-061-5/+0
* common: Rename NON_COPYABLE/NON_MOVABLE with YUZU_ prefix.bunnei2021-05-061-2/+2
* common: common_funcs: Add Size helper function.bunnei2021-05-061-0/+15
* common: bit_util: Add BIT macro.bunnei2021-05-061-0/+2
* common: intrusive_red_black_tree: Disable static_assert that will not evaluate as constant on MSVC.bunnei2021-05-061-0/+4
* common: common_funcs: Add helper macros for non-copyable and non-moveable.bunnei2021-05-061-0/+8
* log/backend: Use in-class initializer for FileBackendLioncash2021-04-202-6/+8
* log/backend: Make use of erase_ifLioncash2021-04-201-4/+4
* Merge pull request #6199 from lioncash/log-nsbunnei2021-04-157-35/+44
|\
| * log/backend: Correct order of const in copy constructorLioncash2021-04-151-2/+5
| * common/log: Move Log namespace into the Common namespaceLioncash2021-04-157-33/+39
* | common: Move settings to common from core.bunnei2021-04-157-2/+830
* | core: settings: Add setting for debug assertions and disable by default.bunnei2021-04-151-2/+5
* | nvidia_flags: Add missing header guardLioncash2021-04-131-0/+2
|/
* Merge pull request #6099 from bunnei/derive-membunnei2021-04-102-0/+44
|\
| * common: common_sizes: Move sizes to the Common namespace.bunnei2021-03-241-0/+4
| * common: common_sizes: Move Invalid to Size_* prefix and add missing values.bunnei2021-03-211-1/+7
| * hle: kernel: board: k_system_control: Extend to include memory region sizes.bunnei2021-03-211-0/+10
| * common: Move common sizes to their own header for code reuse.bunnei2021-03-212-0/+24
* | Merge pull request #6162 from degasus/no_spin_loopsbunnei2021-04-091-1/+9
|\ \
| * | common/threadsafe_queue: Provide Wait() method.Markus Wick2021-04-071-1/+9
* | | bgtc: Update to 12.x and implement OpenTaskServiceMorph2021-04-092-0/+2
|/ /
* / common: Move assert failure handling into a cpp file.Markus Wick2021-04-043-6/+20
|/
* fiber: Double default stack sizeMerryMage2021-03-101-1/+1
* common: Fiber: use a reference for YieldTo.bunnei2021-03-072-8/+6
* common: fiber: Use weak_ptr when yielding.bunnei2021-03-062-8/+13
* Revert "core: Switch to unique_ptr for usage of Common::Fiber."bunnei2021-03-062-9/+9
* Merge pull request #6006 from bunnei/fiber-unique-ptrbunnei2021-03-052-9/+9
|\
| * core: Switch to unique_ptr for usage of Common::Fiber.bunnei2021-02-272-9/+9
* | [network] Error handling reformcomex2021-02-282-16/+34
* | Merge pull request #5984 from jbeich/gcc-freebsdbunnei2021-02-271-0/+1
|\ \ | |/ |/|
| * common: add missing header after f3805376f726Jan Beich2021-02-231-0/+1
* | Merge pull request #5953 from bunnei/memory-refactor-1bunnei2021-02-273-0/+256
|\ \ | |/ |/|
| * common: Add implementation of TinyMT (Mersenne Twister RNG).bunnei2021-02-192-0/+251
| * common: alignment: Add DivideUp utility method.bunnei2021-02-191-0/+5
* | common: wall_clock: Fix integer overflow with StandardWallClock.bunnei2021-02-202-7/+28
|/
* common/cityhash: Use common typesReinUsesLisp2021-02-182-114/+98
* common: wall_clock: Optimize GetClockCycles/GetCPUCycles to use a single MUL instruction.bunnei2021-02-151-8/+9
* common: Merge uint128 to a single header file with inlines.bunnei2021-02-154-135/+84
* common: Add -fsized-deallocation as a Clang flaglat9nq2021-02-101-0/+2
* string_util: Remove MSVC workaround for converting between UTF8/UTF16Morph2021-02-081-14/+0
* Merge pull request #5885 from MerryMage/ring_buffer-granularitybunnei2021-02-061-11/+10
|\
| * ring_buffer: Remove granularity template argumentMerryMage2021-02-061-11/+10
* | hle: kernel: Drop R_UNLESS_NOLOG in favor of expanded if-statement.bunnei2021-02-051-8/+0
* | common: scope_exit: Add a cancellable ScopeExit macro.bunnei2021-02-051-0/+6
* | common: common_funcs: Add R_UNLESS_NOLOG for scenarios that should not log.bunnei2021-02-051-0/+8
|/
* common: common_funcs: Change R_UNLESS to LOG_ERROR.bunnei2021-01-291-1/+1
* common: common_funcs: Log error on R_UNLESS.bunnei2021-01-291-0/+3
* common: common_funcs: Add useful kernel macro R_SUCCEED_IF.bunnei2021-01-291-0/+3
* common: common_funcs: Add a few more useful macros for kernel code.bunnei2021-01-291-0/+11
* Merge pull request #5778 from ReinUsesLisp/shader-dirbunnei2021-01-273-0/+39
|\
| * renderer_opengl: Avoid precompiled cache and force NV GL cache directoryReinUsesLisp2021-01-213-0/+39
* | common: Add missing include to bit_util.hbunnei2021-01-221-0/+1
* | bit_util: Unify implementations of MostSignificantBit32/MostSignificantBit64Lioncash2021-01-211-35/+13
|/
* Merge pull request #5360 from ReinUsesLisp/enforce-memclass-accessbunnei2021-01-171-2/+2
|\
| * core: Silence Wclass-memaccess warningsReinUsesLisp2021-01-151-2/+2
* | Merge pull request #5275 from FernandoS27/fast-native-clockbunnei2021-01-165-104/+174
|\ \
| * | X86/NativeClock: Reimplement RTDSC access to be lock free.Fernando Sahmkow2021-01-025-103/+107
| * | X86/NativeClock: Improve performance of clock calculations on hot path.Fernando Sahmkow2021-01-022-5/+71
* | | Merge pull request #5336 from lioncash/treebunnei2021-01-162-841/+668
|\ \ \
| * | | common/tree: Convert defines over to templatesLioncash2021-01-122-592/+666
| * | | common/tree: Remove unused splay tree definesLioncash2021-01-121-249/+2
* | | | Merge pull request #5358 from ReinUsesLisp/rename-insert-paddingLC2021-01-151-4/+4
|\ \ \ \ | | |_|/ | |/| |
| * | | common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINITReinUsesLisp2021-01-151-4/+4
* | | | Merge pull request #5355 from lioncash/timerbunnei2021-01-153-202/+0
|\ \ \ \
| * | | | common/timer: RemoveLioncash2021-01-153-202/+0
| |/ / /
* | | | Merge pull request #5357 from ReinUsesLisp/alignment-log2LC2021-01-151-17/+12
|\ \ \ \
| * | | | common/alignment: Upgrade to use constraints instead of static assertsReinUsesLisp2021-01-151-13/+9
| * | | | common/alignment: Rename AlignBits to AlignUpLog2ReinUsesLisp2021-01-151-5/+4
* | | | | common/bit_util: Replace CLZ/CTZ operations with standardized onesLioncash2021-01-151-76/+0
| |/ / / |/| | |
* | | | common/color: RemoveReinUsesLisp2021-01-152-272/+0
|/ / /
* | | Merge pull request #5280 from FearlessTobi/port-5666bunnei2021-01-131-4/+12
|\ \ \ | |/ / |/| |
| * | Address review commentsFearlessTobi2021-01-041-5/+5
| * | Delete the old log file before rotating (#5675)xperia642021-01-041-0/+3
| * | Fix the old log file to work with the log parser.bunnei2021-01-031-1/+1
| * | Rotate previous log file to '.old' if it existsxperia642021-01-031-4/+9
* | | common/parent_of_member: Replace TYPED_STORAGE define with template aliasLioncash2021-01-122-8/+10
* | | common: common_funcs: Add R_UNLESS macro.bunnei2021-01-111-0/+8
* | | common: Introduce useful tree structures.bunnei2021-01-114-0/+1641
* | | common/div_ceil: Return numerator typeReinUsesLisp2021-01-091-5/+5
|/ /
* / general: Fix various spelling errorsMorph2021-01-022-3/+3
|/
* memory: Remove MemoryHookMerryMage2021-01-014-78/+0
* Merge pull request #5249 from ReinUsesLisp/lock-free-pagesbunnei2021-01-013-23/+65
|\
| * core/memory: Read and write page table atomicallyReinUsesLisp2020-12-303-23/+65
* | Merge pull request #5208 from bunnei/service-threadsbunnei2020-12-313-0/+90
|\ \
| * | common: ThreadWorker: Add class to help do asynchronous work.bunnei2020-12-303-0/+90
| |/
* / k_priority_queue: Fix concepts usecomex2020-12-291-0/+4
|/
* Merge pull request #5131 from bunnei/scheduler-rewritebunnei2020-12-213-346/+100
|\
| * common: BitSet: Various style fixes based on code review feedback.bunnei2020-12-061-23/+22
| * hle: kernel: Separate KScheduler from GlobalSchedulerContext class.bunnei2020-12-062-346/+0
| * common: Port BitSet from Mesosphere.bunnei2020-12-062-0/+101
* | cmake: Fix generating CMake configs and linking with Boostlat9nq2020-12-131-1/+1
* | common: Update CMakeList to fix build issue with Boost.bunnei2020-12-121-2/+1
* | Revert "Merge pull request #5173 from lioncash/common-fs"Morph2020-12-122-112/+396
* | Revert "Merge pull request #5174 from ReinUsesLisp/fs-fix"Morph2020-12-122-36/+4
* | Revert "Merge pull request #5179 from ReinUsesLisp/fs-path"Morph2020-12-121-1/+1
* | Revert "Merge pull request #5181 from Morph1984/5174-review"Morph2020-12-121-3/+9
* | common/file_util: Simplify the behavior of CreateFullPathMorph2020-12-101-9/+3
* | common/file_util: Let std::filesystem cast from UTF16 to std::stringReinUsesLisp2020-12-091-1/+1
* | common/file_util: Fix and deprecate CreateFullPath, add CreateDirsReinUsesLisp2020-12-092-4/+31
* | common/file_util: Succeed on CreateDir when the directory existsReinUsesLisp2020-12-091-0/+5
* | file_util: Migrate remaining file handling functions over to std::filesystemLioncash2020-12-092-340/+100
* | file_util: Migrate Exists() and IsDirectory() over to std::filesystemLioncash2020-12-092-57/+13
* | Merge pull request #5136 from lioncash/video-shadow3LC2020-12-072-3/+3
|\ \
| * | video_core: Resolve more variable shadowing scenarios pt.3Lioncash2020-12-052-3/+3
| |/
* | xbyak_abi: Shorten std::size_t to size_tLioncash2020-12-051-8/+8
* | xbyak_abi: Avoid implicit sign conversionsLioncash2020-12-051-2/+2
|/
* Merge pull request #4996 from bunnei/use-4jitsbunnei2020-12-042-115/+11
|\
| * common: fiber: Use VirtualBuffer for stack memory.bunnei2020-11-291-2/+5
| * common: fiber: Use boost::context instead of native fibers on Windows.bunnei2020-11-292-115/+8
* | Merge pull request #5000 from lioncash/audio-errorbunnei2020-12-034-10/+11
|\ \
| * | audio_core: Make shadowing and unused parameters errorsLioncash2020-12-034-10/+11
| |/
* / common: Add Common::DivCeil and Common::DivCeilLog2ReinUsesLisp2020-11-262-0/+27
|/
* Merge pull request #4451 from slashiee/extended-loggingbunnei2020-11-231-2/+12
|\
| * logging/settings: Increase maximum log size to 100 MB and add extended logging optionM&M2020-08-251-2/+12
* | Merge pull request #4951 from bunnei/olsc-stubbunnei2020-11-202-0/+2
|\ \
| * | hle: service: Stub OLSC Initialize and SetSaveDataBackupSettingEnabled functions.bunnei2020-11-192-0/+2
* | | common/bit_cast: Add function matching std::bit_cast without constexprReinUsesLisp2020-11-202-0/+23
* | | virtual_buffer: Do nothing on resize() calls with same sizesLioncash2020-11-191-1/+6
|/ /
* | virtual_buffer: Add compile-time type-safety guarantees with VirtualBufferLioncash2020-11-181-0/+6
* | page_table: Allow page tables to be movedLioncash2020-11-184-9/+30
* | page_table: Add missing doxygen parameters to Resize()Lioncash2020-11-181-0/+2
* | page_table: Remove unnecessary header inclusionsLioncash2020-11-181-4/+0
* | common/fiber: Move all member variables into impl classLioncash2020-11-072-89/+86
* | General: Fix clang buildLioncash2020-11-052-2/+10
* | common: Enable warnings as errorsLioncash2020-11-029-31/+49
* | Merge pull request #4868 from lioncash/discard-errorbunnei2020-10-302-5/+12
|\ \
| * | General: Make ignoring a discarded return value an errorLioncash2020-10-302-5/+12
* | | common/stream: Be explicit with copy and move operatorsLioncash2020-10-301-3/+9
|/ /
* | common/fiber: Take shared_ptr<Fiber> by copy in YieldToReinUsesLisp2020-10-282-3/+3
* | video_core: NVDEC Implementationameerj2020-10-273-0/+99
* | core: Fix clang build pt.3Lioncash2020-10-221-2/+2
* | Revert "core: Fix clang build"bunnei2020-10-217-22/+13
* | Merge pull request #4796 from lioncash/clangLC2020-10-217-13/+22
|\ \
| * | core: Fix clang buildLioncash2020-10-187-13/+22
* | | input_common/CMakeLists: Make some warnings errorsLioncash2020-10-162-11/+68
|/ /
* | core/CMakeLists: Make some warnings errorsLioncash2020-10-131-5/+5
* | Merge pull request #4731 from lat9nq/mingw-zstd-fixbunnei2020-10-081-1/+6
|\ \
| * | CMakeLists: use system zstd on Linuxlat9nq2020-09-291-1/+6
| * | CMakeLists: fix for finding zstd on linux-mingwlat9nq2020-09-291-1/+1
* | | common/wall_clock: Add virtual destructorsReinUsesLisp2020-09-303-2/+4
|/ /
* | Merge pull request #4611 from lioncash/xbyak2bunnei2020-09-041-16/+16
|\ \
| * | externals: Update Xbyak to 5.96Lioncash2020-08-301-16/+16
* | | Merge pull request #4578 from lioncash/xorbunnei2020-09-031-4/+10
|\ \ \
| * | | common_funcs: Add missing XOR operators to DECLARE_ENUM_FLAG_OPERATORSLioncash2020-08-241-4/+10
| | |/ | |/|
* | | input_common/motion_input: Make use of Common::PI constantMorph2020-09-021-1/+1
* | | Merge pull request #4570 from german77/motionInputbunnei2020-09-021-0/+30
|\ \ \
| * | | Implement a basic class for motion devicesgerman2020-08-281-0/+30
| | |/ | |/|
* | | Merge pull request #4588 from ReinUsesLisp/tsan-eventbunnei2020-09-011-4/+5
|\ \ \
| * | | common/thread: Fix data race in is_setReinUsesLisp2020-08-261-4/+5
* | | | Merge pull request #4461 from comex/thread-namesLC2020-08-311-0/+12
|\ \ \ \ | |_|/ / |/| | |
| * | | Fix thread naming on Linux, which limits names to 15 bytes.comex2020-08-061-0/+12
* | | | Merge pull request #4530 from Morph1984/mjolnir-p1bunnei2020-08-271-1/+1
|\ \ \ \
| * | | | Project Mjölnir: Part 1Morph2020-08-261-1/+1
| | |/ / | |/| |
* | | | Merge pull request #4577 from lioncash/assertsbunnei2020-08-271-3/+4
|\ \ \ \ | |/ / / |/| | |
| * | | common/assert: Make use of C++ attribute syntaxLioncash2020-08-241-3/+4
| | |/ | |/|
* | | Merge pull request #4548 from lioncash/colorbunnei2020-08-251-2/+2
|\ \ \ | |/ / |/| |
| * | common/color: Migrate code over to the Common namespaceLioncash2020-08-181-2/+2
* | | web_service: Move web_result.h into web_serviceLioncash2020-08-232-26/+0
* | | Merge pull request #4546 from lioncash/telemetrybunnei2020-08-202-4/+4
|\ \ \
| * | | common/telemetry: Migrate namespace into the Common namespaceLioncash2020-08-182-4/+4
| |/ /
* | | Merge pull request #4547 from lioncash/header-conceptbunnei2020-08-201-2/+2
|\ \ \
| * | | common/concepts: Move <type_traits> include out of the Common namespaceLioncash2020-08-181-2/+2
| |/ /
* | | Revert "common/time_zone: Simplify GetOsTimeZoneOffset()"bunnei2020-08-201-5/+9
* | | Merge pull request #4539 from lioncash/discbunnei2020-08-192-3/+3
|\ \ \ | |/ / |/| |
| * | common: Silence two discarded result warningsLioncash2020-08-162-3/+3
* | | Merge pull request #4535 from lioncash/fileutilbunnei2020-08-183-41/+49
|\ \ \
| * | | common/fileutil: Convert namespace to Common::FSLioncash2020-08-163-41/+49
| |/ /
* / / common/time_zone: Simplify GetOsTimeZoneOffset()Lioncash2020-08-161-9/+5
|/ /
* | common/compression: Roll back std::span changesLioncash2020-08-154-37/+43
* | common: Make use of [[nodiscard]] where applicableLioncash2020-08-1534-358/+343
* | Merge pull request #4416 from lioncash/spanbunnei2020-08-154-28/+23
|\ \
| * | lz4_compression: Make use of std::span in interfacesLioncash2020-07-252-17/+14
| * | zstd_compression: Make use of std::span in interfacesLioncash2020-07-252-11/+9
* | | Merge pull request #4511 from lioncash/build2LC2020-08-133-4/+3
|\ \ \
| * | | General: Tidy up clang-format warnings part 2Lioncash2020-08-133-4/+3
* | | | Merge pull request #4493 from jbeich/dragonflybunnei2020-08-111-9/+0
|\ \ \ \ | |/ / / |/| | |
| * | | common/virtual_buffer: drop unused includesJan Beich2020-08-051-9/+0
* | | | General: Tidy up clang-format warningsLioncash2020-08-091-1/+1
* | | | common/concepts: Rename IsBaseOf to DerivedFromLioncash2020-08-071-4/+6
* | | | Merge pull request #4483 from lioncash/constexpr-hexbunnei2020-08-072-40/+23
|\ \ \ \ | |_|_|/ |/| | |
| * | | partition_data_manager: Make data arrays constexprLioncash2020-08-062-40/+23
* | | | Merge pull request #4477 from lioncash/log-desigbunnei2020-08-062-21/+15
|\ \ \ \ | |_|/ / |/| | |
| * | | logging/backend: Make use of designated initializersLioncash2020-08-032-21/+15
| |/ /
* | | Merge pull request #4444 from lioncash/volatilebunnei2020-08-052-21/+26
|\ \ \ | |/ / |/| |
| * | common/atomic_ops: Don't cast away volatile from pointersLioncash2020-07-282-21/+26
* | | ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer (#4465)David2020-08-032-0/+33
* | | Merge pull request #4263 from lat9nq/fix-screencaps-2David2020-08-033-0/+3
|\ \ \ | |/ / |/| |
| * | common: Add a screenshots directorylat9nq2020-07-213-0/+3
| |/
* | Merge pull request #4415 from lioncash/maybebunnei2020-07-261-1/+1
|\ \
| * | virtual_buffer: Mark size parameter of FreeMemoryPages() as [[maybe_unused]]Lioncash2020-07-251-1/+1
| |/
* / common/string_util: Remove unimplemented function prototype (#4414)LC2020-07-251-12/+0
|/
* alignment: explicitly include <new> after 723edb4c0659Jan Beich2020-07-191-0/+1
* alignment: Simplify AlignmentAllocator implementationLioncash2020-07-171-43/+4
* common/swap: Make use of std::endianLioncash2020-07-141-42/+4
* common/alignment: Fix compilation errors (#4303)Tobias2020-07-121-1/+3
* Revert "Port citra-emu/citra#5441: "Common: remove a mod from AlignUp""bunnei2020-07-121-3/+1
* Common: remove a mod from AlignUp (#5441)Marshall Mohror2020-07-111-1/+3
* cmake: Fix libfmt linking errorsDavid Marcec2020-07-101-5/+1
* cmake: fix fmt linking when foundJohn Galt2020-07-091-1/+5
* Revert "cmake: fix fmt linking"bunnei2020-07-031-1/+1
* Merge pull request #4206 from RealJohnGalt/linkfixbunnei2020-07-031-1/+1
|\
| * cmake: fix fmt linkingJohn Galt2020-06-291-1/+1
* | common: switch to nullptr for sysctl's empty new valueJan Beich2020-07-011-4/+4
* | common: add sysconf() fallbackJan Beich2020-06-301-3/+16
|/
* Core/Common: Address Feedback.Fernando Sahmkow2020-06-284-12/+13
* Common/Kernel: Corrections and small bug fixing.Fernando Sahmkow2020-06-271-6/+1
* Common/NativeClockx86: Reduce native clock accuracy further.Fernando Sahmkow2020-06-271-1/+1
* Common/AtomicOps: Correct GCC Intrinsic argument ordering.Fernando Sahmkow2020-06-271-5/+5
* Clang Format.Fernando Sahmkow2020-06-273-23/+23
* General: Tune the priority of main emulation threads so they have higher priority than less important helper threads.Fernando Sahmkow2020-06-272-0/+55
* X64 Clock: Reduce accuracy to be less or equal to guest accuracy.Fernando Sahmkow2020-06-272-1/+7
* ARM/Memory: Correct Exclusive Monitor and Implement Exclusive Memory Writes.Fernando Sahmkow2020-06-273-0/+89
* HostTiming: Pause the hardware clock on pause.Fernando Sahmkow2020-06-274-0/+15
* General: Recover Prometheus project from harddrive failure Fernando Sahmkow2020-06-271-0/+6
* Merge pull request #3396 from FernandoS27/prometheus-1David2020-06-2714-3/+758
|\
| * Common: Fix non-conan buildFernando Sahmkow2020-06-261-1/+2
| * Common/Fiber: Address Feedback and Correct Memory leaks.Fernando Sahmkow2020-06-182-34/+41
| * Common/Fiber: Implement Rewind on Boost Context.Fernando Sahmkow2020-06-182-2/+39
| * Common/uint128: Correct MSVC Compilation in old versions.Fernando Sahmkow2020-06-181-0/+4
| * Common/Fiber: Document fiber interexchange.Fernando Sahmkow2020-06-181-1/+4
| * Common/Fiber: Implement Rewinding.Fernando Sahmkow2020-06-182-2/+38
| * Common/Fiber: Additional corrections to f_context.Fernando Sahmkow2020-06-181-4/+4
| * Common/Fiber: Correct f_context based Fibers.Fernando Sahmkow2020-06-181-6/+8
| * Core/HostTiming: Allow events to be advanced manually.Fernando Sahmkow2020-06-182-5/+6
| * Common/Tests: Address FeedbackFernando Sahmkow2020-06-183-8/+8
| * Common: Make MinGW build use Windows Fibers instead of fcontext_tFernando Sahmkow2020-06-182-4/+4
| * Common/Tests: Clang Format.Fernando Sahmkow2020-06-184-18/+21
| * Common: Correct fcontext fibers.Fernando Sahmkow2020-06-181-5/+4
| * Common: Refactor & Document Wall clock.Fernando Sahmkow2020-06-185-49/+49
| * Common: Implement WallClock Interface and implement a native clock for x64Fernando Sahmkow2020-06-187-0/+348
| * Tests: Add base tests to host timingFernando Sahmkow2020-06-181-2/+2
| * Common: Polish Fiber class, add comments, asserts and more tests.Fernando Sahmkow2020-06-184-24/+53
| * Tests: Add tests for fibers and refactor/fix Fiber classFernando Sahmkow2020-06-182-19/+32
| * Common: Implement a basic Fiber class.Fernando Sahmkow2020-06-183-0/+204
| * Common: Implement a basic SpinLock classFernando Sahmkow2020-06-183-0/+68
* | common/telemetry: Add AVX512 to telemetryMorph2020-06-201-0/+1
* | common/cpu_detect: Add AVX512 detectionMorph2020-06-202-0/+6
|/
* Merge pull request #4086 from MerryMage/abibunnei2020-06-171-66/+29
|\
| * xbyak_abi: Prefer returning a struct to using out parameters in ABI_CalculateFrameSizeMerryMage2020-06-151-17/+19
| * xbyak_abi: Register indexes should be unsignedMerryMage2020-06-151-11/+12
| * xbyak_abi: Remove *GPS variants of stack manipulation functionsMerryMage2020-06-151-36/+0
| * xbyak_abi: Fix ABI_PushRegistersAndAdjustStackMerryMage2020-06-151-6/+2
* | gl_arb_decompiler: Implement an assembly shader decompilerReinUsesLisp2020-06-121-0/+2
|/
* Add xbyak externalDavid Marcec2020-05-303-1/+316
* Fix macOS code and change "Swapfile" to "Swap"Morph2020-05-271-2/+5
* main: Log host system memory parametersMorph2020-05-173-0/+81
* time_zone: Use std::chrono::seconds for strong typing.bunnei2020-05-132-3/+4
* common: Add module to get the current time zone.bunnei2020-05-113-0/+68
* Replace externals with Conan (#3735)James Rowe2020-05-081-2/+2
* acc: Return a unique value per account for GetAccountIdDavid Marcec2020-04-291-0/+5
* Fix -Werror=conversion error.Markus Wick2020-04-241-1/+1
* Merge pull request #3630 from benru/open-windows-network-filesbunnei2020-04-181-1/+8
|\
| * common/file_util: Allow access to files on network sharesBen Russell2020-04-091-1/+8
* | Merge pull request #3672 from lioncash/nullFernando Sahmkow2020-04-172-9/+33
|\ \
| * | file_util: Early-exit in WriteArray and ReadArray if specified lengths are zeroLioncash2020-04-152-9/+33
* | | common: page_table: Update to use VirtualBuffer and simplify.bunnei2020-04-172-53/+18
* | | common: Add VirtualBuffer class, to abstract memory virtualization.bunnei2020-04-173-0/+112
* | | common: scope_exit: Implement mechanism for canceling a scope exit.bunnei2020-04-171-1/+8
* | | common: alignment: Add a helper function for generic alignment checking.bunnei2020-04-171-0/+7
* | | common: common_funcs: Add a macro for defining enum flag operators.bunnei2020-04-171-0/+32
|/ /
* | Merge pull request #3594 from ReinUsesLisp/vk-instancebunnei2020-04-113-0/+183
|\ \ | |/ |/|
| * common/dynamic_library: Import and adapt helper from DolphinReinUsesLisp2020-04-073-0/+183
* | common: Port some changes from dolphin (#5127)Vitor K2020-04-012-15/+16
|/
* Merge pull request #3508 from FernandoS27/page-tablebunnei2020-03-142-3/+24
|\
| * PageTable: move backing addresses to a children class as the CPU page table does not need them.Fernando Sahmkow2020-03-142-3/+24
* | shader/transform_feedback: Add host API friendly TFB builderReinUsesLisp2020-03-131-0/+2
* | video_core: Rename "const buffer locker" to "registry"ReinUsesLisp2020-03-091-2/+2
* | gl_shader_cache: Rework shader cache and remove post-specializationsReinUsesLisp2020-03-091-2/+0
|/
* common/math_util: Support float type rectanglesReinUsesLisp2020-02-281-2/+14
* Merge pull request #3326 from FearlessTobi/port-5039bunnei2020-01-254-36/+23
|\
| * common/logging: don't use regex for path trimmingBreadFish642020-01-234-36/+23
* | Address second part of review commentsFearlessTobi2020-01-231-1/+1
* | Input: UDP Client to provide motion and touch controlsfearlessTobi2020-01-231-0/+9
|/
* Remove unused CPU Vendor string and telemtry fieldJames Rowe2020-01-183-114/+0
* Fix git version in scm_rev.cppJames Rowe2020-01-161-0/+5
* common: SPSCQueue: Notify after incrementing queue size.bunnei2019-12-171-2/+9
* fix clang-format and lambda captureWeiyi Wang2019-11-231-1/+2
* unfold UNREACHABLE implementation for dumb compilersWeiyi Wang2019-11-231-2/+2
* common/logging: Silence no return value warningsReinUsesLisp2019-11-151-2/+6
* common_funcs: Remove semicolons from INSERT_PADDING_* macrosLioncash2019-11-141-4/+6
* common/hash: Remove unused HashableStructLioncash2019-11-131-35/+0
* common_funcs: silence sign-conversion warnings in MakeMagic()Lioncash2019-11-131-1/+1
* ci: Populate build repository from Azure environmentZach Hilman2019-11-061-11/+2
* common_func: Use std::array for INSERT_PADDING_* macros.bunnei2019-11-042-12/+17
* common/bit_field: Remove FORCE_INLINE calls Tobias2019-11-031-2/+2
* Merge pull request #2971 from FernandoS27/new-scheduler-v2David2019-10-281-0/+7
|\
| * Kernel Scheduler: Make sure the global scheduler shutdowns correctly.Fernando Sahmkow2019-10-151-0/+7
* | Shader_IR: Address Feedback.Fernando Sahmkow2019-10-261-1/+1
* | VideoCore: Unify const buffer accessing along engines and provide ConstBufferLocker class to shaders.Fernando Sahmkow2019-10-252-2/+15
* | common/algorithm: Add description comment indicating intended algorithmsLioncash2019-10-151-0/+5
* | common: Rename binary_find.h to algorithm.hLioncash2019-10-152-1/+2
|/
* alignment: Resolve allocator construction issues on debugLioncash2019-10-071-0/+5
* alignment: Specify trait definitions within the allocatorLioncash2019-10-071-0/+5
* Merge pull request #2942 from ReinUsesLisp/clang-warningsbunnei2019-10-061-1/+2
|\
| * common/file_util: Silence -WswitchReinUsesLisp2019-10-051-1/+2
* | Merge pull request #2943 from DarkLordZach/azure-titlebars-v2bunnei2019-10-063-0/+21
|\ \
| * | common: Add additional SCM revision fieldsZach Hilman2019-10-053-0/+21
| |/
* | Shader_Ir: Refactor Decompilation process and allow multiple decompilation modes.Fernando Sahmkow2019-10-051-0/+2
* | shader_ir: Corrections to outward movements and misc stuffsFernando Sahmkow2019-10-051-0/+4
|/
* cmake: Add SCM detection for AzureZach Hilman2019-09-221-0/+3
* log: Add logging class for Cheat EngineZach Hilman2019-09-222-0/+2
* shader_ir: Implement VOTEReinUsesLisp2019-08-211-0/+1
* Common/Alignment: Add noexcept where required.Fernando Sahmkow2019-07-201-5/+5
* Kernel: Address FeedbackFernando Sahmkow2019-07-191-3/+2
* Common: Correct alignment allocator to work on C++14 or higher.Fernando Sahmkow2019-07-191-37/+19
* VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-191-0/+79
* shader_ir: Implement a new shader scannerFernando Sahmkow2019-07-091-0/+2
* texture_cache: Address FeedbackFernando Sahmkow2019-07-053-10/+22
* common/alignment: Address feedbackReinUsesLisp2019-06-241-2/+3
* shader: Decode SUST and implement backing image functionalityReinUsesLisp2019-06-211-0/+1
* texture_cache: Optimize GetMipBlockHeight and GetMipBlockDepthFernando Sahmkow2019-06-211-0/+44
* video_core: Use un-shifted block sizes to avoid integer divisionsReinUsesLisp2019-06-211-0/+5
* Reduce amount of size calculations.Fernando Sahmkow2019-06-211-0/+11
* common/hex_util: Reserve std::string memory ahead of timeLioncash2019-06-121-0/+5
* common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-122-11/+7
* cmake: Add missing shader hash file entriesReinUsesLisp2019-06-071-0/+3
* common/math_util: Provide a template deduction guide for Common::RectangleLioncash2019-05-311-0/+3
* Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-303-0/+83
|\
| * mii: Implement Delete and Destroy fileZach Hilman2019-04-251-5/+6
| * mii_manager: Cleanup and optimizationZach Hilman2019-04-252-3/+5
| * common: Extract UUID to its own classZach Hilman2019-04-253-0/+80
* | common/file_util: Remove unnecessary return at end of void StripTailDirSlashes()Lioncash2019-05-231-6/+8
* | common/file_util: Make GetCurrentDir() return a std::optionalLioncash2019-05-232-3/+4
* | common/file_util: Remove duplicated documentation commentsLioncash2019-05-231-25/+0
* | common/file_util: Make ReadFileToString and WriteStringToFile consistentLioncash2019-05-232-5/+5
* | common/file_util: Remove unnecessary c_str() callsLioncash2019-05-231-2/+2
* | common/file_util: Make IOFile's WriteString take a std::string_viewLioncash2019-05-231-2/+2
* | common/zstd_compression: Remove #pragma once directive from source fileLioncash2019-05-041-2/+0
|/
* common/{lz4_compression, zstd_compression}: Add missing header guardsLioncash2019-04-152-0/+4
* Merge pull request #2391 from lioncash/scopebunnei2019-04-131-1/+1
|\
| * common/scope_exit: Replace std::move with std::forward in ScopeExit()Lioncash2019-04-121-1/+1
* | common/swap: Improve codegen of the default swap fallbacksLioncash2019-04-121-3/+7
* | common/swap: Mark byte swapping free functions with [[nodiscard]] and noexceptLioncash2019-04-121-11/+11
* | common/swap: Simplify swap function ifdefsLioncash2019-04-121-48/+15
* | common/swap: Remove 32-bit ARM pathLioncash2019-04-121-13/+0
|/
* Merge pull request #2300 from FernandoS27/null-shaderbunnei2019-04-071-0/+18
|\
| * Permit a Null Shader in case of a bad host_ptr.Fernando Sahmkow2019-04-071-0/+18
* | Merge pull request #2098 from FreddyFunk/disk-cache-zstdbunnei2019-04-073-1/+98
|\ \
| * | common/zstd_compression: simplify decompression interfaceunknown2019-03-292-10/+9
| * | common/zstd_compression: Add Zstandard wrapperunknown2019-03-293-0/+98
| * | common: Link libzstd_staticunknown2019-03-291-1/+1
* | | common/multi_level_queue: Silence truncation warning in iterator operator++Lioncash2019-04-051-1/+1
* | | common/bit_util: Make CountLeading/CountTrailing functions have the same return typesLioncash2019-04-051-8/+8
* | | common/lz4_compression: Remove #pragma once directive from the cpp fileLioncash2019-04-041-2/+0
* | | Merge pull request #2093 from FreddyFunk/disk-cache-better-compressionbunnei2019-04-043-0/+136
|\| |
| * | Addressed feedbackunknown2019-03-295-81/+135
| * | gl_shader_disk_cache: Use better compression for transferable and precompiled shader disk chache filesunknown2019-03-292-8/+24
| * | data_compression: Move LZ4 compression from video_core/gl_shader_disk_cache to common/data_compressionunknown2019-03-293-0/+66
* | | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-014-14/+14
* | | Merge pull request #2303 from lioncash/threadbunnei2019-03-312-41/+0
|\ \ \ | |/ / |/| |
| * | common/thread: Remove unused functionsLioncash2019-03-292-41/+0
| |/
* | Fixes and corrections on formatting.Fernando Sahmkow2019-03-272-5/+10
* | Fixes to multilevelqueue's iterator.Fernando Sahmkow2019-03-271-1/+5
* | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-271-12/+10
* | Implement intrinsics CountTrailingZeroes and test it.Fernando Sahmkow2019-03-271-12/+33
* | Implement a MultiLevelQueueFernando Sahmkow2019-03-273-0/+349
|/
* Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-223-5/+10
|\
| * gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-212-1/+7
| * gpu: Move GPUVAddr definition to common_types.bunnei2019-03-211-4/+3
* | common/bit_util: Fix bad merge duplicating the copy constructorLioncash2019-03-211-2/+0
* | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-212-38/+150
|\ \
| * | Make bitfield assignment operator publicfearlessTobi2019-02-131-6/+2
| * | common/bitfield: make it endianness-awareWeiyi Wang2019-02-061-3/+9
| * | common/swap: remove default value for swap type internal storageWeiyi Wang2019-02-061-1/+1
| * | common/swap: use template and tag for LE/BE specificationWeiyi Wang2019-02-061-39/+91
| * | common/swap: add swap template for enumWeiyi Wang2019-02-061-0/+52
* | | common/uint128: Add missing header guardLioncash2019-03-211-0/+2
* | | common/uint128: Add missing top-file source textLioncash2019-03-212-0/+7
| |/ |/|
* | common/CMakeLists: Amend boost dependencyLioncash2019-03-211-1/+1
* | Merge pull request #2247 from lioncash/includebunnei2019-03-212-4/+4
|\ \
| * | common/thread_queue_list: Remove unnecessary dependency on boostLioncash2019-03-162-4/+4
* | | core: Move PageTable struct into Common.bunnei2019-03-175-0/+171
* | | Merge pull request #2129 from FernandoS27/cntpctbunnei2019-03-173-0/+57
|\ \ \ | |/ / |/| |
| * | Corrections, documenting and fixes.Fernando Sahmkow2019-02-162-9/+11
| * | Use u128 on Clock Cycles calculation.Fernando Sahmkow2019-02-162-21/+26
| * | Implement 128 bits Unsigned Integer Multiplication and Division.Fernando Sahmkow2019-02-163-0/+50
* | | Merge pull request #2147 from ReinUsesLisp/texture-cleanbunnei2019-03-101-0/+1
|\ \ \
| * | | shader/decode: Split memory and texture instructions decodingReinUsesLisp2019-02-261-0/+1
* | | | common/bit_field: Make BitField trivially copyableLioncash2019-03-071-9/+7
* | | | logging/backend: Make time_origin a class variable instead of a local staticLioncash2019-03-021-2/+1
* | | | logging/backend: Move CreateEntry into the Impl classLioncash2019-03-022-29/+26
* | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-271-2/+2
* | | | common/vector_math: Move Vec[x] types into the Common namespaceLioncash2019-02-273-25/+25
* | | | common/quaternion: Move Quaternion into the Common namespaceLioncash2019-02-271-2/+2
|/ / /
* | | Remove GCC version checkstgsm2019-02-241-3/+3
* | | Adressed review commentsB3n302019-02-152-7/+9
* | | threadsafe_queue: Add WaitIfEmpty and use it in loggingB3n302019-02-153-14/+26
|/ /
* | Merge pull request #2113 from ReinUsesLisp/vulkan-basebunnei2019-02-142-0/+2
|\ \
| * | logging: Add Vulkan backend logging class typeReinUsesLisp2019-02-122-0/+2
* | | threadsafe_queue: Use std::size_t for representing sizeLioncash2019-02-131-7/+6
* | | threadsafe_queue: Remove NeedSize template parameterLioncash2019-02-131-13/+11
|/ /
* | cmake: Fix title bar issueReinUsesLisp2019-02-071-1/+14
* | cmake: Use CMAKE_COMMAND instead of "cmake"Frederic L2019-02-071-1/+1
* | gl_shader_disk_cache: Invalidate shader cache changes with CMake hashReinUsesLisp2019-02-073-39/+56
* | file_util: Add shader directoryReinUsesLisp2019-02-073-0/+3
|/
* Merge pull request #1928 from lioncash/capsbunnei2018-12-272-0/+62
|\
| * common: Add basic bit manipulation utility function to CommonLioncash2018-12-212-0/+62
* | common/quaternion: Ensure that w is always initializedLioncash2018-12-211-1/+1
|/
* Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-151-0/+16
|\
| * scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-221-2/+2
| * svc: Implement yield types 0 and -1Zach Hilman2018-11-191-0/+16
* | Backport review comment from citra-emu/citra#4418Tobias2018-12-071-2/+2
* | Merge pull request #1773 from lioncash/threadbunnei2018-11-232-41/+14
|\ \
| * | common/thread: Drop Hungarian notation on SetCurrentThreadName's parameterLioncash2018-11-221-7/+7
| * | common/thread: Make Barrier's 'count' member non-constLioncash2018-11-221-1/+1
| * | common/thread: Initialize class member variables where applicableLioncash2018-11-221-6/+4
| * | common/thread: Group non-member functions togetherLioncash2018-11-221-3/+2
| * | common/thread: Remove SleepCurrentThread()Lioncash2018-11-222-12/+0
| * | common/thread: Remove unused CurrentThreadId()Lioncash2018-11-222-12/+0
* | | common: Remove bit_set.hLioncash2018-11-222-245/+0
|/ /
* | Merge pull request #1758 from lioncash/rectbunnei2018-11-211-11/+5
|\ \
| * | common/math_util: Simplify std::make_signed usages to std::make_signed_tLioncash2018-11-211-2/+2
| * | common/math_util: Make Rectangle's constructors constexprLioncash2018-11-211-2/+2
| * | common/math_util: Remove unnecessary static from PILioncash2018-11-211-1/+1
| * | common/math_util: Remove unused IntervalsIntersect() functionLioncash2018-11-211-6/+0
* | | common: Remove dependency on xbyakLioncash2018-11-213-274/+0
|/ /
* | common/assert: Add UNIMPLEMENTED_IF and UNIMPLEMENTED_IF_MSG for conditional assertionsLioncash2018-11-211-0/+3
* | common/assert: Make the UNIMPLEMENTED macro properly assertLioncash2018-11-201-1/+1
* | am: Deglobalize software keyboard appletZach Hilman2018-11-182-4/+4
* | string_util: Implement buffer to UTF-16 string helper functionZach Hilman2018-11-182-0/+17
|/
* Common/Bitfield: store value as unsigned typeWeiyi Wang2018-11-161-9/+10
* string_util: Remove ArrayToString()Lioncash2018-11-142-21/+0
* string_util: Remove TryParse()Lioncash2018-11-142-54/+3
* string_util: Remove ThousandSeparate()Lioncash2018-11-131-14/+0
* Merge pull request #1441 from CarlKenner/DebuggerLogbunnei2018-11-052-2/+23
|\
| * logging: Add DebuggerBackend for logging to Visual StudioCarl Kenner2018-10-072-2/+23
* | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-281-0/+4
* | logging/backend: Add missing services to the log filtersLioncash2018-10-242-0/+5
* | common: Remove memory_util.cpp/.hLioncash2018-10-233-200/+0
* | only redefine 64 bit file operation for MSVCWeiyi Wang2018-10-231-5/+8
* | service: Add skeleton for psm serviceZach Hilman2018-10-211-0/+1
* | common: Add function for checking word alignment to alignment.hLioncash2018-10-181-0/+6
* | common: Move Is4KBAligned() to alignment.hLioncash2018-10-181-0/+6
* | web_backend: Make Client use the PImpl idiomLioncash2018-10-111-0/+1
* | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-082-0/+24
|\ \
| * | ips_layer: Deduplicate resource usageZach Hilman2018-10-042-2/+2
| * | hex_util: Add HexVectorToString and HexStringToVectorZach Hilman2018-10-042-0/+24
* | | Merge pull request #1453 from FearlessTobi/port-4311bunnei2018-10-071-1/+1
|\ \ \
| * | | Remove "#" in the version numberfearlessTobi2018-10-061-1/+1
| | |/ | |/|
* / | citra_qt/configuration: misc input tab improvementszhupengfei2018-10-062-1/+19
|/ /
* | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-064-0/+108
|\ \
| * | Review comments - part 5fearlessTobi2018-10-021-0/+1
| * | Address a bunch of review commentsfearlessTobi2018-10-021-1/+1
| * | Port web_service from CitrafearlessTobi2018-10-024-0/+107
* | | Merge pull request #1442 from lioncash/formatbunnei2018-10-051-1/+1
|\ \ \ | |_|/ |/| |
| * | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()Lioncash2018-10-051-1/+1
| |/
* | string_util: unify UTF8<->UTF16 conversion to codecvtWeiyi Wang2018-10-021-109/+6
* | string_util: remove TString conversion for windowsWeiyi Wang2018-10-022-19/+1
* | string_util: remove ShiftJIS/CP1252 conversion functionWeiyi Wang2018-10-022-22/+0
|/
* Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-253-0/+6
|\
| * common_paths: Add Load and Dump dirsZach Hilman2018-09-223-0/+6
* | Stubbed IRS (#1349)David2018-09-242-0/+2
* | common/thread: remove YieldCPU()Weiyi Wang2018-09-221-8/+0
|/
* ring_buffer: Use std::atomic_size_t in a static assertLioncash2018-09-191-1/+1
* ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharingLioncash2018-09-191-2/+10
* Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1523-135/+140
* common: Implement a ring bufferMerryMage2018-09-082-0/+112
* Better Title Bar DisplayCaptV0rt3x2018-09-073-5/+25
* common/logging: Amend documentation commentsLioncash2018-09-042-6/+6
* common/logging/filter: Replace C-style case with C++ static_castLioncash2018-09-041-1/+1
* common/logging/filter: Make constructor explicitLioncash2018-09-041-1/+1
* Merge pull request #1170 from lioncash/retbunnei2018-08-281-1/+1
|\
| * file_util: Correct return value in early exit of ReadFileToString()Lioncash2018-08-241-1/+1
* | hex_util: Replace logic_errors with LOG_CRITICALZach Hilman2018-08-231-5/+17
|/
* logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instanceLioncash2018-08-211-1/+1
* bit_field: Convert ToBool() into explicit operator boolLioncash2018-08-211-2/+1
* Merge pull request #1064 from lioncash/telemetrybunnei2018-08-212-0/+77
|\
| * common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-152-0/+77
* | common: Namespace hex_util.h/.cppLioncash2018-08-162-0/+8
* | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-165-0/+74
|\ \
| * | file_sys: Comply to style guidelinesZach Hilman2018-08-121-0/+2
| * | file_util: Add getter for NAND registration directoryZach Hilman2018-08-122-0/+8
| * | common: Move hex string processing to separate fileZach Hilman2018-08-123-0/+64
* | | Merge pull request #1063 from lioncash/inlinebunnei2018-08-152-15/+11
|\ \ \
| * | | common/xbyak_abi: Mark defined functions in header as inlineLioncash2018-08-151-7/+7
| * | | common/xbyak: Use nested namespace specifiers where applicableLioncash2018-08-152-8/+4
| | |/ | |/|
* | | Merge pull request #1054 from zhaowenlan1779/misc-fixupbunnei2018-08-151-1/+1
|\ \ \
| * | | common/misc: use windows.hZhu PengFei2018-08-131-1/+1
* | | | common: Remove unused old breakpoint source filesLioncash2018-08-153-141/+0
| |/ / |/| |
* | | logging/backend: Use const reference to refer to log filterLioncash2018-08-141-2/+3
* | | thread_queue_list: Make contains() and get_first() const member functionsLioncash2018-08-121-4/+4
* | | thread_queue_list: Convert typedef to a type aliasLioncash2018-08-121-1/+1
| |/ |/|
* | Merge pull request #989 from lioncash/logbunnei2018-08-102-0/+16
|\ \
| * | common/logging: Add missing service log categoriesLioncash2018-08-082-0/+16
* | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-102-5/+19
|\ \ \
| * | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-092-6/+9
| * | | file_util: Add platform-specific slash option to SanitizePathZach Hilman2018-08-092-5/+16
| |/ /
* | | Merge pull request #988 from lioncash/colorbunnei2018-08-091-19/+31
|\ \ \
| * | | common/color: Remove unnecessary const qualifiers on return typesLioncash2018-08-081-7/+7
| * | | common/color: Get rid of undefined behaviorLioncash2018-08-081-12/+24
| |/ /
* / / vector_math: Use variable template version of is_signed in Vec classesLioncash2018-08-081-3/+3
|/ /
* | Merge pull request #966 from lioncash/modernizebunnei2018-08-085-11/+11
|\ \
| * | common: Convert type traits templates over to variable template versions where applicableLioncash2018-08-085-11/+11
* | | Merge pull request #968 from lioncash/vecbunnei2018-08-081-180/+182
|\ \ \
| * | | vector_math: Remove unimplemented function prototypesLioncash2018-08-081-23/+0
| * | | vector_math: Make functions constexpr where applicableLioncash2018-08-081-154/+179
| * | | vector_math: Convert typedefs to type aliasesLioncash2018-08-081-3/+3
| |/ /
* / / file_util: Avoid sign-conversions in WriteArray() and ReadArray()Lioncash2018-08-071-4/+8
|/ /
* / service: Add usb servicesLioncash2018-08-072-0/+2
|/
* service: Add arp servicesLioncash2018-08-052-0/+2
* Merge pull request #849 from DarkLordZach/xcibunnei2018-08-045-0/+20
|\
| * Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-013-0/+3
| * Use SHGetKnownFolderPath instead of SHGetFolderPathAZach Hilman2018-08-011-3/+4
| * Extract mbedtls to cpp fileZach Hilman2018-08-011-1/+1
| * Remove files that are not usedZach Hilman2018-08-014-0/+16
* | Merge pull request #898 from lioncash/migbunnei2018-08-032-0/+2
|\ \
| * | service: Add migration servicesLioncash2018-08-022-0/+2
* | | Merge pull request #900 from lioncash/initbunnei2018-08-031-5/+5
|\ \ \
| * | | math_util: Always initialize members of RectangleLioncash2018-08-021-5/+5
| |/ /
* | | logging/log: Remove incorrect description in PCV doc commentLioncash2018-08-021-1/+1
* | | service: Add psc servicesLioncash2018-08-022-0/+2
|/ /
* | Merge pull request #888 from lioncash/capsbunnei2018-08-022-0/+2
|\ \
| * | service: Add capture servicesLioncash2018-08-012-0/+2
| |/
* / service: Add bpc and pcv servicesLioncash2018-08-012-0/+4
|/
* Merge pull request #864 from FearlessTobi/port-3973bunnei2018-07-311-2/+30
|\
| * remove polymorphism issueB3n302018-07-291-2/+30
* | Merge pull request #875 from lioncash/fgmbunnei2018-07-312-0/+2
|\ \
| * | service: Add fgm servicesLioncash2018-07-312-0/+2
* | | service: Add the pcie serviceLioncash2018-07-312-0/+2
|/ /
* | Port #3758 from Citra (#852): Add missing std::string import in text_formatterTobias2018-07-311-0/+1
* | Merge pull request #861 from FearlessTobi/port-3972bunnei2018-07-302-81/+31
|\ \
| * | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"zhupengfei2018-07-292-81/+31
| |/
* | Merge pull request #862 from FearlessTobi/port-3997bunnei2018-07-301-3/+5
|\ \
| * | common/string_utils: replace boost::transform with std counterpartzhupengfei2018-07-291-3/+5
| |/
* | Merge pull request #865 from FearlessTobi/port-3732bunnei2018-07-302-4/+2
|\ \
| * | Port #3732 from Citra: "common: Fix compilation on ARM"Cameron Cawley2018-07-292-4/+2
| |/
* | Merge pull request #857 from lioncash/wlanbunnei2018-07-302-0/+2
|\ \
| * | service: Add wlan servicesLioncash2018-07-292-0/+2
| |/
* / service: Add btm servicesLioncash2018-07-292-0/+2
|/
* Merge pull request #847 from lioncash/ncmbunnei2018-07-282-0/+2
|\
| * service: Add ncm servicesLioncash2018-07-272-0/+2
* | Merge pull request #846 from lioncash/miibunnei2018-07-282-0/+2
|\ \ | |/ |/|
| * service: Add mii servicesLioncash2018-07-272-0/+2
* | Merge pull request #845 from lioncash/nfcbunnei2018-07-272-0/+2
|\ \
| * | service: Add nfc servicesLioncash2018-07-272-0/+2
| |/
* / service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-272-0/+2
|/
* service: Add ldn servicesLioncash2018-07-262-0/+2
* VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-242-1/+13
* string_util: Get rid of separate resize() in CPToUTF16(), UTF16ToUTF8(), CodeToUTF8() and UTF8ToUTF16()Lioncash2018-07-221-20/+22
* string_util: Use emplace_back() in SplitString() instead of push_back()Lioncash2018-07-221-2/+3
* string_util: Remove unnecessary std::string instance in TabsToSpaces()Lioncash2018-07-222-8/+7
* Merge pull request #768 from lioncash/string-viewbunnei2018-07-222-40/+55
|\
| * file_util, vfs: Use std::string_view where applicableLioncash2018-07-222-40/+55
* | Merge pull request #765 from lioncash/filebunnei2018-07-221-24/+14
|\ \ | |/ |/|
| * file_util: Remove goto usages from Copy()Lioncash2018-07-221-24/+14
* | file_util: Use a u64 to represent number of entriesLioncash2018-07-222-13/+13
* | file_util: std::move FST entries in ScanDirectoryTree()Lioncash2018-07-221-1/+1
|/
* Merge pull request #759 from lioncash/redundantbunnei2018-07-221-2/+1
|\
| * file_util: Remove explicit type from std::min() in GetPathWithoutTop()Lioncash2018-07-211-1/+1
| * file_util: Remove redundant duplicate return in GetPathWithoutTop()Lioncash2018-07-211-1/+0
* | Merge pull request #758 from lioncash/syncbunnei2018-07-222-86/+0
|\ \
| * | common: Remove synchronized_wrapper.hLioncash2018-07-212-86/+0
| |/
* / file_util: Use an enum class for GetUserPath()Lioncash2018-07-213-50/+51
|/
* Merge pull request #743 from lioncash/viewbunnei2018-07-214-57/+56
|\
| * logging/filter: Use std::string_view in ParseFilterString()Lioncash2018-07-202-41/+40
| * logging/backend: Add missing standard includesLioncash2018-07-202-4/+3
| * logging/backend: Use std::string_view in RemoveBackend() and GetBackend()Lioncash2018-07-202-12/+13
* | param_package: Take std::string by value in string-based Set() functionLioncash2018-07-202-4/+6
* | param_package: Use std::unordered_map's insert_or_assign instead of map indexingLioncash2018-07-201-3/+3
* | param_package: Get rid of file-static std::string constructionLioncash2018-07-201-3/+4
|/
* Merge pull request #711 from lioncash/swapbunnei2018-07-191-50/+50
|\
| * common/swap: Remove unnecessary const on return value of swap()Lioncash2018-07-191-1/+1
| * common/swap: Use static_cast where applicableLioncash2018-07-191-16/+16
| * common/swap: Use using aliases where applicableLioncash2018-07-191-33/+33
* | Merge pull request #710 from lioncash/unusedbunnei2018-07-191-38/+0
|\ \
| * | common/common_funcs: Remove unused rotation functionsLioncash2018-07-191-38/+0
| |/
* | Merge pull request #709 from lioncash/thread-localbunnei2018-07-192-12/+8
|\ \
| * | common/misc: Deduplicate code in GetLastErrorMsg()Lioncash2018-07-192-12/+8
| |/
* | Merge pull request #705 from lioncash/string-refbunnei2018-07-192-2/+2
|\ \
| * | file_util: return string by const reference for GetExeDirectory()Lioncash2018-07-192-2/+2
| |/
* / string_util: Remove AsciiToHex()Lioncash2018-07-192-15/+0
|/
* Merge pull request #686 from lioncash/fmtbunnei2018-07-191-1/+1
|\
| * externals: update fmt to version 5.1.0Lioncash2018-07-181-1/+1
* | Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-192-57/+116
|/
* telemetry: Remove unnecessary Field constructorLioncash2018-07-181-4/+1
* telemetry: Make operator== and operator!= const member functions of FieldLioncash2018-07-181-2/+2
* telemetry: Default copy/move constructors and assignment operatorsLioncash2018-07-181-14/+4
* Merge pull request #664 from jroweboy/logging-stuffbunnei2018-07-153-4/+17
|\
| * Logging: Dump all logs in the queue on close in debug modeJames Rowe2018-07-153-1/+12
| * Logging: Don't lock the queue for the duration of the writeJames Rowe2018-07-141-3/+5
* | More improvements to GDBStub (#653)Hedges2018-07-131-1/+1
|/
* Merge pull request #633 from FearlessTobi/port-definesbunnei2018-07-103-7/+7
|\
| * Port #3579 from CitrafearlessTobi2018-07-073-7/+7
* | Merge pull request #635 from FearlessTobi/port-crashfixbunnei2018-07-101-1/+1
|\ \
| * | Port #3474 from CitrafearlessTobi2018-07-071-1/+1
| |/
* / Revert "Virtual Filesystem (#597)"bunnei2018-07-082-99/+57
|/
* Merge pull request #630 from FearlessTobi/remove-citra-referencesbunnei2018-07-062-2/+2
|\
| * Remove some references to CitrafearlessTobi2018-07-062-2/+2
* | Virtual Filesystem (#597)Zach Hilman2018-07-062-57/+99
|/
* Fix build and address review feedbackbunnei2018-07-031-4/+4
* Add configurable logging backendsJames Rowe2018-07-035-18/+257
* Update clang formatJames Rowe2018-07-033-14/+11
* Rename logging macro back to LOG_*James Rowe2018-07-037-70/+70
* Common/string_util: add StringFromBuffer functionmailwl2018-06-072-0/+6
* Service/MM: add service and stub some functionsmailwl2018-06-052-0/+2
* Service/BCAT: add module and servicesmailwl2018-05-282-0/+2
* vector_math: Ensure members are always initializedLioncash2018-05-021-9/+9
* Merge pull request #424 from lioncash/stringbunnei2018-04-304-91/+9
|\
| * string_util: Remove StringFromFormat() and related functionsLioncash2018-04-304-91/+9
* | file_util: Make move constructor/assignment operator and related functions noexceptLioncash2018-04-302-6/+6
* | file_util: Add static assertions to ReadBytes() and WriteBytes()Lioncash2018-04-301-2/+6
|/
* file_util: Remove compiler version checks around is_trivially_copyable()Lioncash2018-04-281-8/+0
* log: Remove old logging macros and functionsLioncash2018-04-272-54/+1
* general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-272-5/+6
* Merge pull request #380 from ogniK5377/service-implbunnei2018-04-272-0/+2
|\
| * Switched to NGLOG_WARNINGDavid Marcec2018-04-271-1/+1
| * Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-263-792/+0
| |\
| * | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-261-0/+1
| * | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-231-0/+1
* | | common: Move logging macros over to new fmt-capable macros where applicableLioncash2018-04-274-67/+67
| |/ |/|
* | common: Remove chunk_file.h and linear_disk_cache.hLioncash2018-04-263-792/+0
|/
* Merge pull request #367 from lioncash/clampbunnei2018-04-201-5/+0
|\
| * math_util: Remove the Clamp() functionLioncash2018-04-201-5/+0
* | Merge pull request #361 from lioncash/commonbunnei2018-04-201-18/+12
|\ \
| * | common_types: Convert typedefs to using aliasesLioncash2018-04-201-12/+12
| * | common_types: Remove unnecessary check for whether or not__func__ is definedLioncash2018-04-201-6/+0
| |/
* | Merge pull request #364 from lioncash/thread-localbunnei2018-04-201-19/+0
|\ \
| * | common/thread: Remove unnecessary feature checking for thread_localLioncash2018-04-201-19/+0
| |/
* | Merge pull request #362 from lioncash/snprintfbunnei2018-04-201-5/+0
|\ \
| * | common_funcs: Remove check for VS versions that we don't even supportLioncash2018-04-201-5/+0
| |/
* | Merge pull request #363 from lioncash/array-sizebunnei2018-04-201-2/+0
|\ \
| * | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-201-2/+0
| |/
* | Merge pull request #366 from lioncash/vecbunnei2018-04-201-30/+0
|\ \
| * | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]Lioncash2018-04-201-30/+0
| |/
* / common: Remove code_block.hLioncash2018-04-202-86/+0
|/
* bit_field: Remove is_pod check, add is_trivially_copyable_v.bunnei2018-04-181-6/+1
* common: Port cityhash code from Citra.bunnei2018-04-145-147/+502
* bit_field: Make all methods constexpr.bunnei2018-04-141-5/+5
* Update fmtlib to fix msvc warningsJames Rowe2018-04-062-5/+8
* logging: Change FmtLogMessage to use variadic template instead of FMT_VARIADICDaniel Lim Wee Soong2018-04-032-5/+11
* Merge pull request #262 from daniellimws/fmtlib-macrosbunnei2018-04-0310-67/+111
|\
| * Remove dependency chronoDaniel Lim Wee Soong2018-03-221-1/+0
| * Logging: Create logging macros based on fmtlibDaniel Lim Wee Soong2018-03-2210-67/+112
* | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-031-1/+1
|\ \
| * | telemetry.h: Reword comment from citra to yuzuN00byKing2018-03-271-1/+1
* | | common: fix swap functions on Bitrig and OpenBSDDaniel Lim Wee Soong2018-04-021-1/+13
* | | service: Add NFP module interface.bunnei2018-03-302-0/+2
|/ /
* | log.h: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
* | file_util.h: Update Comment from citra to yuzuN00byKing2018-03-261-1/+1
* | cpu_detect.cpp: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
* | Service/SSL: add ssl servicemailwl2018-03-232-0/+2
* | Service/spl: add module and servicesmailwl2018-03-222-0/+2
* | CMake: Set EMU_ARCH_BITS in CMakeLists.txtN00byKing2018-03-212-35/+0
* | Service: add fatal:u, fatal:p servicesmailwl2018-03-202-0/+2
|/
* Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-0/+2
|\
| * Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-0/+2
* | logging: Add category for Friend service.bunnei2018-02-192-0/+2
|/
* log: Add logging category for NS services.bunnei2018-02-152-0/+2
* logger: Add Time service logging category.bunnei2018-02-052-0/+2
* logger: Add SET service logging category.bunnei2018-02-052-15/+11
* logger: Add PCTL service logging category.bunnei2018-02-052-0/+2
* logger: Add LM service logging category.bunnei2018-02-052-0/+2
* logger: Add APM service logging category.bunnei2018-02-052-0/+2
* logger: Add NIFM service logging category.bunnei2018-02-052-0/+2
* logger: Add VI service logging category.bunnei2018-02-052-0/+2
* logger: Add AM service logging category.bunnei2018-02-042-0/+2
* logger: Add "account" service logging category.bunnei2018-02-042-0/+2
* audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-0/+2
* logging: add missing NVDRV subclass to macro listRozlette2018-01-241-0/+1
* Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-211-0/+1
* Fix spelling error in CMakeListsMatthew Brener2018-01-211-1/+1
* Format: Run the new clang format on everythingJames Rowe2018-01-2119-43/+87
* Merge pull request #84 from lioncash/cmakebunnei2018-01-181-63/+57
|\
| * CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-181-63/+57
* | telemetry: Silence initialization order warningsLioncash2018-01-181-2/+2
|/
* loggin: Add IPC logging category.bunnei2018-01-172-1/+3
* Minor cleanupMerryMage2018-01-141-1/+1
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-131-5/+1
* fix macos buildMerryMage2018-01-091-1/+1
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-092-0/+123
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-232-2/+2
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-151-0/+8
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-152-2/+2
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-102-42/+0
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-107-18/+27
|\
| * Fixed type conversion ambiguityHuw Pascoe2017-09-303-11/+5
| * Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.Subv2017-09-271-4/+8
| * Merge pull request #2822 from wwylele/sw_lighting-2Weiyi Wang2017-08-092-4/+8
| |\
| | * vector_math: remove dead template parameterwwylele2017-07-111-1/+1
| | * vector_math: remove broken SFINAE stuffwwylele2017-07-111-3/+2
| | * SwRasterizer: Flip the vertex quaternions before clipping (if necessary).Subv2017-07-111-1/+1
| | * SwRasterizer: Corrected the light LUT lookups.Subv2017-07-111-0/+5
| * | common: Add build timestamp to scm_rev.bunnei2017-08-042-0/+3
* | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-301-2/+2
|/ /
* / logging: Add WebService as a log cateogry.bunnei2017-07-102-1/+3
|/
* Implement basic virtual Room support based on enet (#2803)B3n302017-07-072-0/+2
* Remove unnecessary WIN32_LEAN_AND_MEAN macro definitionKloen2017-06-301-1/+0
* Remove unused import in break_points.cpp (#2763)Kloen Lansfiel2017-06-091-1/+0
* CMake: Create INTERFACE targets for microprofile and nihstroYuri Kunde Schlesner2017-05-281-1/+1
* CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-281-0/+1
* CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-281-1/+1
* Common: Fix some out-of-style includesYuri Kunde Schlesner2017-05-283-5/+5
* Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-283-214/+0
* Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-261-23/+42
|\
| * Common: Clean up meta-template logic in BitFieldYuri Kunde Schlesner2017-05-251-3/+3
| * Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-251-23/+42
* | Merge pull request #2697 from wwylele/proctexYuri Kunde Schlesner2017-05-251-0/+10
|\ \
| * | pica/swrasterizer: implement procedural texturewwylele2017-05-201-0/+10
| |/
* / common: Add a generic interface for logging telemetry fields.bunnei2017-05-253-0/+238
|/
* Remove unused symbols codeYuri Kunde Schlesner2017-05-083-78/+0
* Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-222-0/+27
|\
| * Add custom layout settings.SonofUgly2017-02-232-0/+27
* | Merge pull request #2497 from wwylele/input-2bunnei2017-03-175-0/+164
|\ \
| * | Input: add device and factory templatewwylele2017-03-012-0/+2
| * | Common: add ParamPackagewwylele2017-03-013-0/+162
* | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-171-9/+9
|\ \ \
| * | | file_util: Log when using local user directorywwylele2017-03-111-0/+2
| * | | file_util: lower logging level for harmless caseswwylele2017-03-081-9/+7
| |/ /
* / / common/cpu_detect: Add missing include and fix namespace scopeYuri Kunde Schlesner2017-03-131-5/+7
|/ /
* | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-274-204/+25
|\ \
| * | Remove built-in (non-Microprofile) profilerYuri Kunde Schlesner2017-02-273-186/+0
| * | SynchronizedWrapper: Add Lock convenience methodYuri Kunde Schlesner2017-02-271-18/+25
* | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-253-0/+3
|\ \ \
| * | | HW: add AES engine & implement AES-CCMwwylele2017-02-213-0/+3
* | | | Gui: Change title bar to include build nameJames Rowe2017-02-233-0/+26
| |/ / |/| |
* | | applied the change suggested by @wwylelenoah the goodra2017-02-141-0/+1
* | | added http service enum to the log.h filenoah the goodra2017-02-141-0/+1
|/ /
* | Merge pull request #2476 from yuriks/shader-refactor3Yuri Kunde Schlesner2017-02-041-14/+19
|\ \
| * | Common: Optimize BitSet iteratorYuri Kunde Schlesner2017-01-301-14/+19
| |/
* | Common/x64: remove legacy emitter and abi (#2504)Weiyi Wang2017-01-315-4201/+1
* | file_util: Fixed implicit type conversion warning (#2503)noah the goodra2017-01-311-2/+2
|/
* common: add <cstddef> to hash.hKloen2017-01-281-0/+1
* common: switch ComputeHash64 len param to size_t instead of int, fix warning on MSVC on dsp_dsp.cppKloen2017-01-282-6/+6
* Merge pull request #1951 from wwylele/motion-sensorbunnei2017-01-075-0/+76
|\
| * Common: add Quaternionwwylele2016-12-262-0/+45
| * vector math: add implementation of Length and Normalizewwylele2016-12-261-0/+19
| * MathUtil: add PI constantwwylele2016-12-261-0/+2
| * Common::Event: add WaitUntilwwylele2016-12-261-0/+10
* | Service/NFC: stub GetTagInRangeEventmailwl2016-12-302-0/+2
|/
* Merge pull request #2369 from MerryMage/core-frontendbunnei2016-12-235-646/+0
|\
| * core: Move emu_window and key_map into coreMerryMage2016-12-235-646/+0
* | file_util: fix missing sysdata pathwwylele2016-12-231-3/+1
|/
* Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-223-87/+3
|\
| * file_util: Remove unused paths.bunnei2016-12-223-87/+3
* | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-222-0/+2
|\ \ | |/ |/|
| * csnd:SND reformat source codemailwl2016-12-122-0/+2
* | Fixed GPLv2 license text in the start.Vamsi Krishna2016-12-181-1/+1
* | Merge pull request #2316 from endrift/macos-gccbunnei2016-12-161-0/+11
|\ \
| * | Common: Fix gcc build on macOSJeffrey Pfau2016-12-131-0/+11
| |/
* / VideoCore: Convert x64 shader JIT to use Xbyak for assemblyYuri Kunde Schlesner2016-12-153-1/+234
|/
* Support mingw cross-compileJannik Vogel2016-12-055-5/+6
* Merge pull request #2228 from freiro/winver_fixYuri Kunde Schlesner2016-12-011-3/+0
|\
| * WINVER definition moved to CMake and cleanupfreiro2016-11-301-3/+0
* | Set client SDK version to Service APIsmailwl2016-11-301-3/+2
|/
* Build: Fixed a few warnings.Subv2016-11-291-4/+4
* Merge pull request #2168 from mailwl/micSebastian Valle2016-11-272-0/+2
|\
| * MIC_U: Stub service funcionsmailwl2016-11-252-0/+2
* | Move to AppData/Roaming/Citra/freiro2016-11-261-1/+1
* | Removed /user/ from pathfreiro2016-11-261-2/+1
* | Switch to AppData/Roamingfreiro2016-11-242-4/+4
* | Return by value and other fixesfreiro2016-11-192-14/+8
* | Win32 move default user folder location to AppDatafreiro2016-11-192-0/+24
|/
* Merge pull request #2172 from jroweboy/fix-mingwbunnei2016-11-161-2/+3
|\
| * Add mingw compile supportJames Rowe2016-11-141-2/+3
* | Round the rectangle size to prevent float to int casting issuesJames Rowe2016-11-123-8/+9
* | Add default hotkey to swap primary screens.James Rowe2016-11-054-7/+10
* | Rework frame layouts to use a max rectangle instead of hardcoded calculationsJames Rowe2016-11-052-250/+100
* | LargeFrameLayout + SwappedSonofUgly2016-11-051-50/+36
* | Support additional screen layouts.James Rowe2016-11-055-73/+382
|/
* common: use system bswap* functions on more BSDsJan Beich2016-10-281-2/+5
* common: use system CPUID routine on DragonFly as wellJan Beich2016-10-281-2/+2
* common: some FreeBSD headers are incomplete to avoid namespace pollutionJan Beich2016-10-281-1/+3
* common: convert to standard stat()/fstat() interfacesAnthony J. Bentley2016-10-281-15/+10
* common: stat64 is non-standard, hide on a random UnixJan Beich2016-10-281-1/+1
* common: only FreeBSD has thread affinity compatible with LinuxJan Beich2016-10-281-1/+5
* common: define routines to set thread name on more BSDsJan Beich2016-10-281-2/+4
* Fix typosRicardo de Almeida Gonzaga2016-10-202-2/+2
* Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-082-0/+2
|\
| * Update the stub code of BOSSJamePeng2016-10-022-0/+2
* | Common: Remove dangerous Vec[234] array constructorsYuri Kunde Schlesner2016-09-301-3/+0
|/
* Remove special rules for Windows.h and library includesYuri Kunde Schlesner2016-09-213-1/+3
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-2110-11/+11
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-2132-54/+13
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-1915-61/+32
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-1851-3389/+4172
* microprofile: Double buffer size to 16MB.bunnei2016-09-151-1/+1
* Common: readdir_r() is deprecated, switch to readdir().Emmanuel Gil Peyrot2016-09-131-6/+2
* Protection against a resize of size 0Alexandre LittleWhite Laurent2016-07-231-4/+3
* Remove superfluous std::move in return std::move(local_var)scurest2016-06-251-1/+1
* Fix recursive scanning of directoriesYuri Kunde Schlesner2016-06-192-17/+12
* Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-114-23/+232
|\
| * fixup! fixup! Refactor input systemwwylele2016-05-152-7/+7
| * fixup! Refactor input systemwwylele2016-05-152-20/+24
| * implement circle pad modifierwwylele2016-05-152-4/+22
| * Refactor input subsystemwwylele2016-05-154-23/+210
* | Merge pull request #1751 from linkmauve/no-recursive-readdirbunnei2016-05-312-24/+36
|\ \
| * | Common: Make recursive FileUtil functions take a maximum recursionEmmanuel Gil Peyrot2016-05-212-24/+36
| |/
* / common_funcs: Provide rotr and rotl for MSVCMerryMage2016-05-271-12/+18
|/
* swap: Get rid of pointer casting for swapping structsLioncash2016-05-091-5/+5
* swap: Get rid of undefined behavior in swapf and swapdLioncash2016-05-091-14/+18
* swap: Remove unused methodsLioncash2016-05-091-28/+0
* Merge pull request #1736 from MerryMage/sdl2-sinkbunnei2016-05-072-1/+3
|\
| * AudioCore: SDL2 SinkMerryMage2016-05-072-1/+3
* | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-306-5/+14
|/
* Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-295-259/+6
* Make Citra build with MICROPROFILE_ENABLED set to 0 (#1709)Henrik Rydgård2016-04-291-0/+4
* assert: Allow UNREACHABLE_MSG to have just one argumentSam Spilsbury2016-04-241-1/+1
* Merge pull request #1576 from smspillaz/fix-build-errors-03272016bunnei2016-04-241-0/+2
|\
| * assert: Add _MSG variations for UNREACHABLE and UNIMPLEMENTEDSam Spilsbury2016-04-231-0/+2
* | Protect use of std::is_trivially_copyable to compile with GCC 4.9LittleWhite2016-04-231-0/+4
|/
* Merge pull request #1672 from wwylele/win-driver-fixbunnei2016-04-191-3/+12
|\
| * fix driver root identification on Windowswwylele2016-04-151-3/+12
* | Merge pull request #1666 from MerryMage/barrierbunnei2016-04-151-24/+22
|\ \
| * | Thread: Make Barrier reusableMerryMage2016-04-141-5/+5
| * | common/thread: Correct code styleMerryMage2016-04-141-21/+19
| |/
* | Merge pull request #1665 from lioncash/filebunnei2016-04-142-47/+22
|\ \
| * | file_util: In-class initialize data membersLioncash2016-04-142-6/+4
| * | file_util: const qualify IOFile's Tell and GetSize functionsLioncash2016-04-142-8/+8
| * | file_util: Don't expose IOFile internals through the APILioncash2016-04-142-30/+4
| * | file_util: Check for is_trivially_copyableLioncash2016-04-141-3/+5
| * | file_util: Make IOFile data members privateLioncash2016-04-141-0/+1
| |/
* | emitter: Add CALL that can be fixed up.bunnei2016-04-142-0/+13
* | emitter: Support arbitrary FixupBranch targets.bunnei2016-04-142-0/+17
|/
* FileUtil: Missing #include, Add const to IOFile methodsMerryMage2016-04-121-6/+7
* cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-081-1/+1
* Merge pull request #1435 from mailwl/frd_ubunnei2016-04-062-0/+2
|\
| * frd:u: Initial stub some functionsmailwl2016-03-272-0/+2
* | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-062-18/+0
|\ \
| * | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-052-18/+0
* | | Merge pull request #1620 from LFsWang/pathbunnei2016-04-053-26/+43
|\ \ \
| * | | remove debug codeLFsWang2016-03-311-1/+1
| * | | fix unicode url problem on windowsLFsWang2016-03-311-6/+18
| * | | Fix encode problem On WindowsLFsWang2016-03-313-21/+26
| | |/ | |/|
* | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-032-0/+2
|\ \ \
| * | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-022-0/+2
| | |/ | |/|
* | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-312-0/+2
| |/ |/|
* | remove unnecessary constwwylele2016-03-261-2/+2
* | implement accel and gyro backendwwylele2016-03-221-0/+48
|/
* vector_math: Add missing member in Vec4's SetZero functionLioncash2016-03-181-1/+4
* Reorganize the ndm service path for dummy implement functionJamePeng2016-03-142-0/+2
* Merge pull request #1509 from lioncash/noncopybunnei2016-03-131-3/+3
|\
| * common_types: Make NonCopyable constructor constexprLioncash2016-03-131-1/+1
| * common_types: Specify const in deleted copy constructor/assignment operatorLioncash2016-03-131-2/+2
* | PICA: Align vertex attributesJannik Vogel2016-03-132-0/+23
|/
* Merge pull request #1476 from lioncash/emitbunnei2016-03-101-59/+54
|\
| * emitter: templatize ImmPtrLioncash2016-03-091-2/+6
| * emitter: constexpr-ify helper functionsLioncash2016-03-091-19/+17
| * emitter: Get rid of CanDoOpWithLioncash2016-03-091-7/+0
| * emitter: constexpr-ify OpArgLioncash2016-03-091-30/+30
| * emitter: friend class OpArg with XEmitterLioncash2016-03-091-3/+4
| * emitter: Remove unimplemented prototypeLioncash2016-03-091-1/+0
* | Common: Get rid of alignment macrosLioncash2016-03-091-9/+1
|/
* Merge pull request #1297 from Subv/savesbunnei2016-03-011-1/+1
|\
| * DiskDirectory: Initialize the directory member with valid info.Subv2016-01-161-1/+1
* | Merge pull request #1427 from MerryMage/emit-lbitYuri Kunde Schlesner2016-02-281-2/+2
|\ \
| * | x64 Emitter: Fix L bit in VEX prefixMerryMage2016-02-271-2/+2
* | | Initial implementation ir:usermailwl2016-02-262-0/+2
|/ /
* | AudioCore: Skeleton ImplementationMerryMage2016-02-213-1/+5
* | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-122-26/+22
* | backend: defaulted move constructor/assignmentLioncash2016-02-051-18/+2
* | color: Make trivial helpers constexprLioncash2016-01-281-8/+8
* | key_map: Use std::tie for comparisonsLioncash2016-01-251-7/+7
|/
* Add missing return values in ForeachDirectoryEntryLFsWang2015-12-231-4/+14
* Merge pull request #1252 from Subv/cambunnei2015-12-042-0/+2
|\
| * Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-232-0/+2
* | Refactor ScanDirectoryTreeAndCallback to separate errors and retvalsarchshift2015-11-272-50/+53
|/
* fix failure on gcc and clangwwylele2015-11-121-3/+3
* disable unary minus when the type is not signedwwylele2015-11-121-0/+4
* Implement gdbstubpolaris-2015-10-042-0/+2
* Merge pull request #1176 from lioncash/vs2015-code-junking-daybunnei2015-10-031-11/+0
|\
| * bit_field: Re-enable code on MSVCLioncash2015-10-011-11/+0
* | Merge pull request #1095 from archshift/game-listbunnei2015-10-022-103/+83
|\ \
| * | Split up FileUtil::ScanDirectoryTree to be able to use callbacks for custom behaviorarchshift2015-10-012-103/+83
* | | symbols: Replace an insert call with emplaceLioncash2015-09-301-1/+1
* | | symbols: Get rid of initial underscores in variable namesLioncash2015-09-302-20/+20
* | | symbols: Directly initialize TSymbol membersLioncash2015-09-301-8/+3
* | | symbols: Simplify GetSymbolLioncash2015-09-301-8/+5
| |/ |/|
* | hash: Get rid of unused functionsLioncash2015-09-161-16/+0
* | general: Silence some warnings when using clangLioncash2015-09-161-2/+2
|/
* memory_util: Remove unnecessary assignment in FreeMemoryPagesLioncash2015-09-121-3/+0
* memory_util: Remove commented out printf statementsLioncash2015-09-121-10/+0
* general: Replace 0 literals with nullptr where applicableLioncash2015-09-122-6/+6
* synchronized_wrapper: Add missing return in SynchronizedRef move assignment operatorLioncash2015-09-121-0/+1
* Merge pull request #1144 from lioncash/removebunnei2015-09-114-176/+0
|\
| * common: Get rid of debug_interface.hLioncash2015-09-114-176/+0
* | common: Get rid of a cast in swap.hLioncash2015-09-111-2/+2
|/
* x64: Proper stack alignment in shader JIT function callsaroulin2015-09-013-424/+90
* Common: Import BitSet from Dolphinaroulin2015-09-012-0/+190
* Common: Fix MicroProfile compilation in MSVC2015Yuri Kunde Schlesner2015-08-281-0/+5
* Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-254-0/+51
* x64-emitter: add RCPSS SSE instructionaroulin2015-08-232-0/+2
* Merge pull request #1058 from lioncash/ptrLioncash2015-08-232-4/+27
|\
| * emitter: Remove pointer castsLioncash2015-08-212-4/+27
* | Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-221-8/+7
|\ \ | |/ |/|
| * VMManager: Make LogLayout log level configurable as a parameterYuri Kunde Schlesner2015-08-161-8/+7
* | emitter: Remove unnecessary definesLioncash2015-08-201-5/+1
* | emitter: Remove unnecessary else keywordsLioncash2015-08-201-7/+7
* | emitter: Remove unused codeLioncash2015-08-202-44/+0
* | emitter: Remove unimplemented JMP prototypeLioncash2015-08-201-1/+0
* | emitter: Pass OpArg by reference where possibleLioncash2015-08-202-763/+763
* | emitter: Remove unnecessary inline specifiersLioncash2015-08-201-33/+33
* | Merge pull request #1035 from darkf/mingw-fixbunnei2015-08-202-4/+10
|\ \
| * | Fix building under MinGWdarkf2015-08-182-4/+10
| |/
* / videocore: Added RG8 texture supportPatrick Martin2015-08-161-0/+18
|/
* Merge pull request #1031 from bbarenblat/masterYuri Kunde Schlesner2015-08-161-1/+2
|\
| * Handle invalid `Log::Class`Benjamin Barenblat2015-08-151-1/+2
* | Rename ARCHITECTURE_X64 definition to ARCHITECTURE_x86_64.bunnei2015-08-168-14/+14
* | Common: Cleanup CPU capability detection code.bunnei2015-08-164-198/+141
* | Common: Move cpu_detect to x64 directory.bunnei2015-08-164-5/+5
* | x64: Refactor to remove fake interfaces and general cleanups.bunnei2015-08-1610-516/+26
* | Common: Added MurmurHash3 hash function for general-purpose use.bunnei2015-08-155-2/+158
* | Common: Ported over boilerplate x86 JIT code from Dolphin/PPSSPP.bunnei2015-08-159-4/+4380
* | Common: Ported over Dolphin's code for x86 CPU capability detection.bunnei2015-08-154-17/+273
|/
* Stop defining GCC always_inline attributes as __forceinlinearchshift2015-08-122-7/+8
* Merge pull request #1018 from bbarenblat/masterbunnei2015-08-052-1/+8
|\
| * Use UNREACHABLE macro for impossible cases in previous commitBenjamin Barenblat2015-08-032-4/+3
| * Handle invalid `Log::Level::Count`Benjamin Barenblat2015-08-022-1/+9
* | Common: Work around bug in MSVC2015 standard libraryYuri Kunde Schlesner2015-08-031-0/+14
|/
* Common : Fix Conversion Warningszawata2015-07-191-1/+1
* Common: Remove the unused and commented GetThemeDir prototype from FileUtil.Emmanuel Gil Peyrot2015-07-181-3/+0
* Pica: Implement stencil testing.Tony Wasserka2015-07-131-1/+26
* FileUtil: Add a WriteObject method for writing a single, POD-type object.Tony Wasserka2015-07-131-0/+10
* don´t define snprintf on Visual Studio 2015Apology112015-07-121-2/+4
* Merge pull request #914 from yuriks/bitfield-maskYuri Kunde Schlesner2015-07-121-2/+2
|\
| * Common: Remove redundant masking in BitFieldYuri Kunde Schlesner2015-07-101-1/+1
| * Common: Fix mask generation in BitFieldYuri Kunde Schlesner2015-07-101-1/+1
* | Common: Remove thunk.hLioncash2015-07-112-43/+0
* | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-1126-236/+86
|\ \ | |/ |/|
| * Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-281-0/+1
| * Core: Cleanup core includes.Emmanuel Gil Peyrot2015-06-281-1/+2
| * CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-282-1/+1
| * Common: Cleanup emu_window includes.Emmanuel Gil Peyrot2015-06-282-3/+15
| * Common: Remove unused ROUND_UP_POW2 macro.Emmanuel Gil Peyrot2015-06-281-7/+0
| * Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-281-0/+1
| * Common: Cleanup memory and misc includes.Emmanuel Gil Peyrot2015-06-287-22/+18
| * Common: Cleanup profiler includes.Emmanuel Gil Peyrot2015-06-284-7/+10
| * Common: Cleanup thread includes.Emmanuel Gil Peyrot2015-06-282-18/+15
| * Common: Fix string_util includes.Emmanuel Gil Peyrot2015-06-282-3/+9
| * Common: Fix FileUtil includes, and everything relying on those.Emmanuel Gil Peyrot2015-06-283-7/+14
| * Common: Remove now-unused EMU_PLATFORM define, fixes issue #373.Emmanuel Gil Peyrot2015-06-271-30/+0
| * Common: Remove unused SSE version checking and a GCC macro.Emmanuel Gil Peyrot2015-06-271-25/+0
| * Common: Remove unused fifo_queue.h.Emmanuel Gil Peyrot2015-06-272-112/+0
* | Common: Remove unused type unions breaking aliasing rules in horrible ways.Emmanuel Gil Peyrot2015-06-281-26/+0
|/
* Merge pull request #855 from purpasmart96/service_rearrangmentbunnei2015-06-212-2/+4
|\
| * Services: Continue separation of services into their own folderspurpasmart962015-06-122-2/+4
* | Render-to-texture flush, interval math fixtfarley2015-06-091-1/+1
|/
* Move video_core/color.h to common/color.harchshift2015-05-302-0/+215
* Move video_core/math.h to common/vector_math.harchshift2015-05-302-0/+641
* Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-293-3/+3
* OpenGL renderertfarley2015-05-231-0/+4
* Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-222-0/+2
* Merge pull request #758 from yuriks/sync-loggingYuri Kunde Schlesner2015-05-1610-381/+35
|\
| * Remove unused concurrent_ring_buffer.hYuri Kunde Schlesner2015-05-162-164/+0
| * Common: Use the log system to print assert messagesYuri Kunde Schlesner2015-05-121-7/+3
| * Common: Remove async loggingYuri Kunde Schlesner2015-05-127-210/+32
* | Common: Remove unused cruft from math_util, and remove a duplicated Rect class in common_types.Emmanuel Gil Peyrot2015-05-144-409/+3
|/
* Common: Remove the BIT macroYuri Kunde Schlesner2015-05-091-2/+0
* Common: Add BIT macroYuri Kunde Schlesner2015-05-091-0/+2
* Common: Add StringFromFixedZeroTerminatedBufferYuri Kunde Schlesner2015-05-082-0/+14
* Merge pull request #725 from yuriks/remove-common-crapYuri Kunde Schlesner2015-05-085-1009/+0
|\
| * Common: Remove mem_arena.cpp/hYuri Kunde Schlesner2015-05-083-466/+0
| * Common: Remove hash.cpp/hYuri Kunde Schlesner2015-05-073-543/+0
* | Merge pull request #723 from lioncash/commonstrbunnei2015-05-082-127/+0
|\ \
| * | string_util: Get rid of UriDecode/UriEncodeLioncash2015-05-072-127/+0
* | | Profiler: Fix off-by-one error when computing average.Yuri Kunde Schlesner2015-05-081-2/+1
| |/ |/|
* | Common: Add proper macros to test for architecture pointer sizeYuri Kunde Schlesner2015-05-075-17/+11
|/
* Common: Remove common.hYuri Kunde Schlesner2015-05-0729-56/+43
* Common: Move alignment macros to common_funcs.hYuri Kunde Schlesner2015-05-072-21/+21
* Common: Move SSE detection ifdefs to platform.hYuri Kunde Schlesner2015-05-073-16/+21
* Common: Remove more unused compatibility definesYuri Kunde Schlesner2015-05-071-45/+0
* Common: Move IO-specific compatibility macros to file_util.cppYuri Kunde Schlesner2015-05-072-26/+26
* Common: Remove many unnecessary cross-platform compatibility macrosYuri Kunde Schlesner2015-05-075-88/+10
* Clean-up includesYuri Kunde Schlesner2015-05-071-0/+1
* Move typedefs from kernel.h to more appropriate placesYuri Kunde Schlesner2015-05-071-0/+5
* Common: Move NonCopyable to common_types.hYuri Kunde Schlesner2015-05-072-10/+10
* Common: Use C++11 deleted functions for NonCopyableYuri Kunde Schlesner2015-05-071-8/+6
* Common: Remove unused enumsYuri Kunde Schlesner2015-05-071-17/+0
* EmuWindow: Clip mouse input coordinates to emulated screen dimensions.Zaneo2015-05-022-6/+21
* Common: thread.h cleanupsYuri Kunde Schlesner2015-04-161-65/+16
* Thread: Implement priority boost for starved threads.bunnei2015-04-101-0/+18
* Merge pull request #641 from purpasmart96/service_stubsbunnei2015-04-042-0/+4
|\
| * Services: Stubs and minor changespurpasmart962015-04-032-0/+4
* | disassembler: Get rid of a const_castLioncash2015-03-302-4/+4
|/
* Common: Fix logic for setting EMU_DATA_DIR.Emmanuel Gil Peyrot2015-03-161-6/+5
* Common: Make a #else more apparent.Emmanuel Gil Peyrot2015-03-161-5/+1
* EmuWindow: Fixed a reference to a temporary variableSubv2015-03-141-1/+1
* Merge pull request #642 from bunnei/touchpadbunnei2015-03-122-19/+101
|\
| * HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-112-68/+63
| * EmuWindow: Made pad/touch functions non-static.bunnei2015-03-102-11/+6
| * EmuWindow: Added infrastructure code to enable touchpad support.bunnei2015-03-102-1/+93
* | Merge pull request #629 from archshift/lcdfbbunnei2015-03-102-0/+2
|\ \ | |/ |/|
| * Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-092-0/+2
* | Merge pull request #634 from linkmauve/logging-performancesbunnei2015-03-095-7/+17
|\ \
| * | Logging: check for filter before sending to the queue, to skip all heavy formatting on the other thread.Emmanuel Gil Peyrot2015-03-065-7/+17
* | | Merge pull request #584 from yuriks/outline-assertsbunnei2015-03-091-6/+25
|\ \ \
| * | | Asserts: Use lambdas to keep assertion code away from the main code pathYuri Kunde Schlesner2015-02-181-6/+25
* | | | Fixed EmuWindow typo (fixes OSX build)bunnei2015-03-082-2/+2
* | | | Merge pull request #636 from bunnei/refactor-screen-winbunnei2015-03-082-7/+75
|\ \ \ \
| * | | | Set framebuffer layout from EmuWindow.bunnei2015-03-072-7/+75
| | |_|/ | |/| |
* | | | Merge pull request #538 from yuriks/perf-statTony Wasserka2015-03-076-0/+534
|\ \ \ \ | |_|_|/ |/| | |
| * | | Profiler: Implement QPCClock to get better precision on Win32Yuri Kunde Schlesner2015-03-022-1/+42
| * | | Add profiling infrastructure and widgetYuri Kunde Schlesner2015-03-026-0/+493
| |/ /
* / / Removed swap code redundancy and moved common swap code to swap.harchshift2015-03-063-127/+97
|/ /
* | Common: Switch to the XDG Base Directory Specification for directory selection.Emmanuel Gil Peyrot2015-02-252-10/+69
* | Merge pull request #581 from archshift/tfebunnei2015-02-233-2/+2
|\ \
| * | Added information reporting from ThrowFatalErrorarchshift2015-02-223-2/+2
* | | Common: Change names containing “Dolphin” or “PPSSPP” to something more generic.Emmanuel Gil Peyrot2015-02-202-8/+8
* | | Misc cleanup of common and related functionsarchshift2015-02-203-79/+28
* | | Remove duplication of INSERT_PADDING_WORDS between pica.h and gpu.harchshift2015-02-202-3/+3
* | | Remove "super lame/broken" file_search compilation unit that was leftover from Dolphinarchshift2015-02-193-128/+0
* | | Remove redundant utf8 compilation unit that was leftover from Dolphinarchshift2015-02-193-528/+0
* | | Remove useless extended_trace compilation unit that was leftover from Dolphinarchshift2015-02-193-480/+0
* | | Remove the useless msg_handler compilation unit that was left over from Dolphinarchshift2015-02-197-178/+11
|/ /
* | Merge pull request #570 from purpasmart96/config_membunnei2015-02-181-0/+7
|\ \ | |/ |/|
| * ConfigMem: Clean up the Config memory to be more like the shared page and movedpurpasmart962015-02-171-0/+7
* | Merge pull request #529 from Subv/masterbunnei2015-02-141-3/+3
|\ \ | |/ |/|
| * Build: Fixed some warningsSubv2015-02-121-3/+3
* | backend: Add logging subentry for ldrLioncash2015-02-131-0/+1
|/
* Asserts: break/crash program, fit to style guide; log.h->assert.harchshift2015-02-1115-105/+73
* Merge pull request #526 from purpasmart96/citra_stubsbunnei2015-02-111-0/+1
|\
| * Services: Stub some functionspurpasmart962015-02-081-0/+1
* | Fix a wrong file name in a commentchinhodado2015-02-071-1/+1
|/
* Common: Fix SCOPE_EXIT to actually create unique identifiers.Yuri Kunde Schlesner2015-01-302-1/+7
* Added HID_SPVR service and split HID_U implementation into service/hid/hid.xxxarchshift2015-01-213-10/+10
* Logging: Log all called service functions (under trace). Compile out all trace logs under release for performance.archshift2015-01-103-24/+8
* Merge pull request #431 from yuriks/thread-queue-cleanupbunnei2015-01-071-144/+74
|\
| * Common: Clean up ThreadQueueListYuri Kunde Schlesner2015-01-071-144/+74
* | Merge pull request #425 from Subv/coretimingbunnei2015-01-072-0/+2
|\ \ | |/ |/|
| * CoreTiming: Ported the CoreTiming namespace from PPSSPPSubv2015-01-072-0/+2
* | Merge pull request #421 from linkmauve/remove-dead-platformsbunnei2015-01-075-101/+2
|\ \
| * | Common: Remove dead platform #ifdefs to make the code more readable.Emmanuel Gil Peyrot2015-01-065-101/+2
* | | Merge pull request #376 from Subv/arc_reorderbunnei2015-01-073-32/+20
|\ \ \ | |/ / |/| |
| * | Archives: Changed the way paths are built for the archives.Subv2015-01-043-20/+4
| * | SaveDataCheck: Move the files to nand/titleSubv2015-01-041-1/+1
| * | Archives: Change the folder layout of some archives.Subv2015-01-033-20/+24
| |/
* | Common: Use std::abs instead of abs, using abs with cmath fails on some systems.Emmanuel Gil Peyrot2015-01-051-2/+3
* | Common: Remove the unused x86-specific 128-bit float type.Emmanuel Gil Peyrot2015-01-051-11/+0
|/
* Archives: Reduced duplicate code in RomFS and SaveCheck.Subv2015-01-033-0/+4
* SOC_U: Preliminary implementation of sockets.Subv2014-12-312-0/+2
* Merge pull request #369 from darkf/mingw_bunnei2014-12-317-21/+38
|\
| * Fix MSVC-related #defines and add CMakeLists commentdarkf2014-12-305-10/+10
| * Fix merge conflictsdarkf2014-12-3059-1092/+1296
| |\
| * | Fix MinGW builddarkf2014-11-297-21/+34
* | | Archives: Implemented ExtSaveData and SharedExtSaveDataSubv2014-12-303-0/+4
| |/ |/|
* | Merge pull request #322 from chinhodado/masterbunnei2014-12-221-0/+6
|\ \
| * | More warning cleanupsChin2014-12-211-0/+6
* | | Merge pull request #291 from purpasmart96/licensebunnei2014-12-2146-74/+74
|\ \ \ | |/ / |/| |
| * | License changepurpasmart962014-12-2146-74/+74
* | | BitField: Add an explicit Assign method.Tony Wasserka2014-12-201-1/+5
* | | Common: Add a clone of std::make_uniqueYuri Kunde Schlesner2014-12-202-0/+17
|/ /
* | SaveData: Implemented the SystemSaveData archive.Subv2014-12-183-0/+4
* | Filesystem/Archives: Implemented the SaveData archiveSubv2014-12-183-0/+4
* | Restore the original console color after logging a message.Yuri Kunde Schlesner2014-12-142-13/+25
* | Remove old logging systemYuri Kunde Schlesner2014-12-136-850/+2
* | Add configurable per-class log filteringYuri Kunde Schlesner2014-12-135-3/+205
* | Convert old logging calls to new logging macrosYuri Kunde Schlesner2014-12-138-71/+94
* | Implement text path trimming for shorter paths.Yuri Kunde Schlesner2014-12-133-1/+53
* | Re-add coloring to the console logging output.Yuri Kunde Schlesner2014-12-131-0/+50
* | New logging systemYuri Kunde Schlesner2014-12-1311-66/+716
* | Add SCOPE_EXIT macro to conveniently execute cleanup actionsYuri Kunde Schlesner2014-12-132-0/+38
* | Added missing include in common_funcs.hYuri Kunde Schlesner2014-12-131-0/+1
* | Remove redundant include from common_funcs.hYuri Kunde Schlesner2014-12-131-2/+0
* | Merge pull request #267 from bunnei/apt-shared-fontbunnei2014-12-133-26/+6
|\ \
| * | APT_U: Added GetSharedFont service function.bunnei2014-12-131-0/+3
| * | Common: Add "sysdata" to GetUserPath and cleanup.bunnei2014-12-123-26/+3
* | | Merge pull request #261 from neobrain/boostTony Wasserka2014-12-121-3/+3
|\ \ \ | |/ / |/| |
| * | StringUtil: Perform some minimal cleanup.Tony Wasserka2014-12-071-3/+3
* | | Explicitly specify LE strings to iconv, fixes paths in Steel Diverarchshift2014-12-101-2/+2
* | | Remove unused NDMA moduleYuri Kunde Schlesner2014-12-092-2/+0
* | | Some code cleanup.Tony Wasserka2014-12-091-0/+2
* | | Fix some headers to include their dependencies properly.Tony Wasserka2014-12-092-0/+7
|/ /
* / Change NULLs to nullptrs.Rohit Nirmal2014-12-0317-92/+92
|/
* Remove unused includes to common/thread.hEmmanuel Gil Peyrot2014-11-251-1/+0
* Remove tabs in all files except in skyeye imports and in generated GL codeEmmanuel Gil Peyrot2014-11-193-100/+100
* Remove trailing spaces in every file but the ones imported from SkyEye, AOSP or generatedEmmanuel Gil Peyrot2014-11-1923-160/+160
* Merge pull request #165 from neobrain/viewport-scalingbunnei2014-11-194-38/+101
|\
| * EmuWindow: Add some explicit documentation and set proper minimal client area size.Tony Wasserka2014-11-181-2/+4
| * EmuWindow: Add a TODO.Tony Wasserka2014-11-181-0/+1
| * MathUtil: Make Rectangle work with unsigned types.Tony Wasserka2014-11-181-4/+5
| * EmuWindow: Better document the purpose of OnMinimalClientAreaChangeRequest.Tony Wasserka2014-11-181-0/+7
| * EmuWindow: Remove window title getters/setters.Tony Wasserka2014-11-181-16/+1
| * EmuWindow: Add documentation.Tony Wasserka2014-11-181-18/+57
| * EmuWindow: Add support for specifying minimal client area sizes.Tony Wasserka2014-11-181-8/+26
| * Fixup EmuWindow interface and implementations thereof.Tony Wasserka2014-11-181-28/+33
| * Viewport scaling and display density independenceKevin Hartman2014-11-181-2/+5
| * Add a GUI logging channel.Tony Wasserka2014-11-182-0/+2
* | Remove extraneous semicolonsLioncash2014-11-182-2/+2
|/
* emu_window: Fix initializer list order.Lioncash2014-11-171-2/+2
* Use std::u16string for conversion between UTF-8 and UTF-16, FS:USER functionsarchshift2014-11-132-51/+115
* Renamed souce files of services to match port namesGareth Poole2014-10-291-1/+1
* Add `override` keyword through the code.Yuri Kunde Schlesner2014-10-262-3/+3
* Fix compile errors in ClangYuri Kunde Schlesner2014-10-261-1/+0
* Merge pull request #150 from lioncash/typoTony Wasserka2014-10-251-1/+1
|\
| * bit_field: Fix a typo in the sample usage.Lioncash2014-10-251-1/+1
* | Removed uses of raw c-string manipulation functions.archshift2014-10-244-21/+10
|/
* Merge pull request #133 from archshift/sdmc-enabledbunnei2014-10-241-2/+4
|\
| * Common: Return from CreateFullPath early if the directory creation failsarchshift2014-10-231-2/+4
* | Use std sized types instead of platform specific typedefsYuri Kunde Schlesner2014-10-232-32/+12
|/
* Merge pull request #108 from archshift/configbunnei2014-10-086-69/+73
|\
| * Added configuration file system.archshift2014-10-086-69/+73
* | Common: Add a helper function to generate a 8.3 filename from a long one.Emmanuel Gil Peyrot2014-10-062-0/+53
* | Fix warnings in core and commonLioncash2014-09-283-15/+5
|/
* Merge pull request #118 from lioncash/chunk-filebunnei2014-09-231-244/+0
|\
| * chunk_file: General cleanupLioncash2014-09-221-244/+0
* | Use the citra user path for the sdmc directoryarchshift2014-09-213-0/+4
|/
* Common: Rename the File namespace to FileUtil, to match the filename and prevent collisions.Emmanuel Gil Peyrot2014-09-174-25/+25
* Common: Return the number of items read/written in IOFile’s methods instead of a boolean.Emmanuel Gil Peyrot2014-09-171-8/+20
* Added support for multiple input device types for KeyMap and connected Qt.Kevin Hartman2014-09-125-40/+61
* Initial HID PAD work, with GLFW only.Kevin Hartman2014-09-124-0/+77
* Merge pull request #99 from archshift/ext-checkbunnei2014-09-1112-40/+44
|\
| * Moved common_types::Rect from common to Common namespacearchshift2014-09-091-1/+1
| * Added string_util to common, small changes in loader.cpparchshift2014-09-0911-32/+39
| * loader.cpp: improved file extension checking, made Upper/LowerStr usefularchshift2014-09-092-12/+9
* | Merge pull request #103 from archshift/prunebunnei2014-09-1110-34/+3
|\ \
| * | common: Prune all redundant includesarchshift2014-09-0910-34/+3
| |/
* | Merge pull request #104 from archshift/removalbunnei2014-09-102-71/+0
|\ \
| * | Removed fixed_size_queue.harchshift2014-09-092-71/+0
| |/
* | Merge pull request #101 from lioncash/inf-loopbunnei2014-09-101-3/+8
|\ \
| * | Common: Fix a potential infinite loop in StringUtil's ReplaceAllLioncash2014-09-081-3/+8
| |/
* / Common: Remove HAVE_CXX11_SYNTAX define from Common.hLioncash2014-09-081-6/+0
|/
* Removed common/std_xyz, instead using the std headerarchshift2014-09-077-856/+6
* Removed common/atomic, instead using std::atomicarchshift2014-09-034-198/+0
* Remove hand-crafted Visual Studio solution.Yuri Kunde Schlesner2014-09-014-453/+0
* Avoid LOGGING redefinition warnings.Yuri Kunde Schlesner2014-09-011-0/+2
* CMake cleanupYuri Kunde Schlesner2014-09-011-7/+16
* Merge pull request #58 from lioncash/clampbunnei2014-08-211-0/+7
|\
| * Common: Add a clamp function to math_utils.hLioncash2014-08-191-0/+7
* | Common: Get rid of an unnecessary forward declaration in symbols.hLioncash2014-08-181-2/+0
|/
* Common: Don't return a reference to a string when calling GetName in symbols.cppLioncash2014-08-182-2/+2
* Merge pull request #52 from lioncash/memorybunnei2014-08-181-5/+8
|\
| * Common: Correctly set ptr to null if mmap fails in memory_utilLioncash2014-08-171-5/+8
* | Merge pull request #48 from linkmauve/masterbunnei2014-08-181-24/+23
|\ \
| * | mem_arena: Replace insecure temporary file creation with devshm, importing Dolphin’s code.Emmanuel Gil Peyrot2014-08-161-24/+23
| |/
* | Common: Move remaining C header includes over to their C++ equivalentLioncash2014-08-178-21/+20
* | Common: Move header guards over to pragma onceLioncash2014-08-1733-146/+41
|/
* Simplified if-tree in extended_trace.cpparchshift2014-08-121-13/+9
* Merge pull request #41 from archshift/itrbunnei2014-08-122-78/+67
|\
| * break_points.cpp: return directly from conditionalsarchshift2014-08-121-6/+2
| * break_points: cleaned up, added `find_if`sarchshift2014-08-122-59/+51
| * Changed iterators to use auto, some of which using range-based loopsarchshift2014-08-121-27/+28
* | Remove the fancy RegisterSet class introduced in 4c2bff61e.Tony Wasserka2014-08-123-165/+0
|/
* Use pthread_set_name_np() on OpenBSD.Anthony J. Bentley2014-08-081-1/+3
* RegisterSet: Simplify code by using structs for register definition instead of unions.Tony Wasserka2014-07-231-6/+8
* [build] Search for the git binary in the default msysgit install dirYuri Kunde Schlesner2014-07-191-1/+8
* BitField: Cast enum values to proper integer type.Tony Wasserka2014-07-161-1/+1
* BitField: Add a static_assert.Tony Wasserka2014-07-161-0/+1
* BitField: Delete copy assignment to prevent obscure bugs.Tony Wasserka2014-07-161-0/+16
* BitField: Add an explicit evaluation method.Tony Wasserka2014-07-161-0/+5
* Merge branch 'threading' of https://github.com/bunnei/citrabunnei2014-06-144-43/+48
|\
| * log: updated MAX_LOGLEVEL to use correct log level enum typebunnei2014-06-013-5/+5
| * log: updated GenericLog __attribute__ for newly added parameterbunnei2014-06-011-1/+1
| * log: fixed to not print twice, enabled coloring, added OS print logging as its own typebunnei2014-05-304-37/+42
* | Removed definition of MAX_PATH, this is already defined in common_paths.h.bunnei2014-06-121-2/+0
* | Preprocessor: #if's out OSX-specific GL changes on other platformsarchshift2014-06-121-1/+1
* | Common: Removed duplicate "LONG" and "MAX_PATH" definitions.bunnei2014-06-121-2/+0
* | Pica: Use some template magic to define register structures efficiently.Tony Wasserka2014-06-123-3/+166
* | Rename LCD to GPU.Tony Wasserka2014-06-122-2/+2
* | Merge branch 'threading'bunnei2014-05-236-3/+228
|\|
| * added MIN, MAX, and CLAMP macros to common_funcsbunnei2014-05-171-0/+5
| * added ThreadQueueList class to common (taken from PPSSPP)bunnei2014-05-163-0/+218
| * added kernel logger to commonbunnei2014-05-102-3/+5
* | common_types: Changed BasicRect back to Rect, in the common namespacearchshift2014-05-201-4/+6
* | Improved clarity and whitespacearchshift2014-05-201-0/+1
* | CMakeLists: rename HEADS, improved commentsarchshift2014-05-201-2/+2
* | Updated cmakelistsarchshift2014-05-171-0/+1
* | Merge remote-tracking branch 'upstream/master' into issue-7-fixarchshift2014-05-175-5/+179
|\|
| * removed incorrect dolphin copyright linebunnei2014-05-081-1/+0
| * fixed include of common in bit_field.hbunnei2014-05-081-1/+1
| * logger fix for linuxbunnei2014-05-082-3/+3
| * added GSP to loggersbunnei2014-05-082-2/+2
| * added BitField to commonbunnei2014-05-083-0/+175
| * - added better SVC loggingbunnei2014-05-062-5/+5
* | Support for C++11 on OSXarchshift2014-05-011-2/+2
* | Fixed indentsarchshift2014-05-011-1/+1
* | Some more experimentationarchshift2014-04-301-3/+3
* | IT'S ALIVE!archshift2014-04-291-1/+39
* | Fix complaints about functions that could not be foundarchshift2014-04-281-1/+1
* | Problematic class with no current implementationarchshift2014-04-281-2/+2
* | Rect to BasicRectarchshift2014-04-281-4/+4
* | add missing bswap functionsbunnei2014-04-281-0/+44
|/
* fix for issue Linux build #9, not sure why this is broken but its unused code I'm just getting rid of itbunnei2014-04-281-13/+0
* Merge branch 'hle-interface-updates'bunnei2014-04-281-5/+0
|\
| * removed DISALLOW_COPY_AND_ASSIGN in favor of NonCopyable classbunnei2014-04-281-5/+0
* | Resolved undefined Common::g_scm_branch error.Thomas Edvalson2014-04-251-1/+1
|/
* made qt window title consistentbunnei2014-04-241-1/+1
* fixes to scm_rev generation to make it conistent with windows buildbunnei2014-04-242-5/+5
* updated windows scm_rev code to use new styleShizZy2014-04-245-66/+53
* added scm rev generation on Linux/cmakebunnei2014-04-246-51/+37
* fixes to build on linuxbunnei2014-04-232-14/+14
* removed duplicate rotl/rotr functionsShizZy2014-04-231-26/+0
* updated CMakeLists for missing filesShizZy2014-04-231-0/+1
* Merge branch 'hle-interface'bunnei2014-04-184-5/+27
|\
| * added NDMA hardware interfacebunnei2014-04-182-2/+2
| * added helper functions for upper/lowercase stringsbunnei2014-04-152-0/+22
| * added logger for generic HLEbunnei2014-04-112-3/+3
* | Add symbols mapMathieu Vaillancourt2014-04-134-0/+100
|/
* removed scm_rev.h from version controlbunnei2014-04-111-4/+0
* added missing const to GetWindowTitlebunnei2014-04-111-1/+1
* updated CMakeListsbunnei2014-04-101-16/+17
* - removed deprecated version.hbunnei2014-04-094-72/+52
* fixed scm_rev_genbunnei2014-04-092-5/+5
* fixed project includes to use new directory structurebunnei2014-04-0944-211/+201
* got rid of 'src' folders in each sub-projectbunnei2014-04-0954-0/+0
* added "citra" instead of "emu" to title barbunnei2014-04-071-1/+1
* added logger option specifically for the rendererbunnei2014-04-062-2/+2
* added missing includes to common_types.hbunnei2014-04-051-0/+3
* Updated common_types.h to use Gekko's version w/ Rect and some useful unionsbunnei2014-04-051-30/+102
* added DISALLOW_COPY_AND_ASSIGN macrobunnei2014-04-051-0/+5
* added LCD loggerbunnei2014-04-052-2/+2
* added a HW option to loggingbunnei2014-04-052-48/+48
* convert tabs to spacesbunnei2014-04-0247-5298/+5298
* grabbed ppsspp's MemArenabunnei2014-04-012-221/+428
* added TIME logger for core timingShizZy2013-10-022-2/+2
* renamed GC_ALIGNED* macros to MEMORY_ALIGNED*ShizZy2013-10-021-12/+12
* upgraded proj files to vs 2013ShizZy2013-09-272-2/+16
* renamed from citrus to citraShizZy2013-09-264-5/+5
* moved file_sys back to coreShizZy2013-09-265-973/+0
* removed <windows.h> include from common.h and added it only where neededShizZy2013-09-242-5/+1
* moved file_sys to commonShizZy2013-09-245-0/+973
* added localtime_r for use on windowsShizZy2013-09-241-0/+8
* added utf8 to common module, utils for dealing with utf8ShizZy2013-09-244-0/+534
* updated to chunk_file module from ppssppShizZy2013-09-201-133/+623
* added a module for loading bootable binariesShizZy2013-09-202-4/+4
* added swap types to commonShizZy2013-09-194-0/+549
* removed CORE and LOADER from LogTypesShizZy2013-09-191-2/+0
* added CORE and LOADER to LogTypesShizZy2013-09-191-0/+2
* changed log CPU from PPC to ARM11ShizZy2013-09-182-2/+3
* added default windows includeShizZy2013-09-181-0/+4
* added file platform.hShizZy2013-09-164-0/+137
* renamed project to 'citrus'ShizZy2013-09-143-3/+3
* added scm_rev_gen project to automatically create a header with the git revision on buildShizZy2013-09-134-3/+162
* cleaned up VS project filesShizZy2013-09-091-11/+9
* fixed some code warningsShizZy2013-09-091-1/+1
* removed unneeded dolphin paths code, fixed linker problems with common.libShizZy2013-09-093-132/+118
* re-enabled GetLastErrorMsgShizZy2013-09-091-19/+23
* updated common pathsShizZy2013-09-082-4/+7
* start of 3DS memory mapShizZy2013-09-063-12/+3
* various fixes to be able to build projectShizZy2013-09-051-17/+13
* added emu_window.h to define interface to drawing to a windowShizZy2013-09-053-0/+108
* updated CMakeLists.txt file for new common filesShizZy2013-09-051-9/+16
* replaced common code with dolphin commonShizZy2013-09-0551-107/+8640
* deleted gekko's common filesShizZy2013-09-0428-4543/+0
* adding initial project layoutShizZy2013-08-3031-0/+4777