summaryrefslogtreecommitdiffstats
path: root/src/core/hle/service (follow)
Commit message (Collapse)AuthorAgeFilesLines
* chore: fix some typosAndrea Pappacoda2022-09-232-3/+3
| | | | Fix some typos reported by Lintian
* Merge pull request #8915 from vonchenplus/opus_multi_streambunnei2022-09-182-1/+38
|\ | | | | core: implement HwOpus GetWorkBufferSizeForMultiStreamEx
| * core: implement HwOpus GetWorkBufferSizeForMultiStreamExFengChen2022-09-162-1/+38
| |
* | Merge pull request #8827 from german77/amiibo_releasebunnei2022-09-1710-282/+1366
|\ \ | | | | | | core: nfp: Implement amiibo encryption
| * | core: nfp: Remove magic numbersgerman772022-09-073-105/+103
| | |
| * | core: nfp: Workaround for lack of multiple nfp interfacesgerman772022-09-071-1/+3
| | |
| * | core: nfp: Correct date and amiibo nameNarr the Reg2022-09-074-18/+36
| | |
| * | core: nfp: Implement Convert and RecreateApplicationArea, accuracy fixesNarr the Reg2022-09-0710-257/+356
| | |
| * | core: nfp: Implement amiibo encryptiongerman772022-09-075-256/+1223
| |/
* | Merge pull request #8650 from Kelebek1/vsyncbunnei2022-09-172-17/+30
|\ \ | | | | | | [Coretiming/NVNFlinger] Improve multi-core vsync timing, and core timing accuracy
| * | Rework multi-core vsyncKelebek12022-08-022-17/+30
| | |
* | | audio_device: Mark member functions as const where applicableLioncash2022-09-151-2/+2
| | | | | | | | | | | | These member functions don't modify any internal state.
* | | audio_device: Make AudioDeviceName constructor constexprLioncash2022-09-151-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | These are used as read-only arrays, so we can make the data read-only and available at compile-time. Now constructing an AudioDevice no longer needs to initialize some tables
* | | Merge pull request #8842 from Kelebek1/AudOutbunnei2022-09-101-1/+6
|\ \ \ | |_|/ |/| | [audio_core] Rework audio output
| * | Don't stall with nvdecKelebek12022-09-041-1/+6
| | |
* | | Merge pull request #8855 from german77/plsliamwhite2022-09-044-23/+24
|\ \ \ | | | | | | | | core: ns: Implement pl:s service
| * | | core: ns: Implement pl:s serviceNarr the Reg2022-09-034-23/+24
| | | |
* | | | Merge pull request #8822 from FearlessTobi/multiplayer-fixesbunnei2022-09-023-6/+18
|\ \ \ \ | |/ / / |/| | | network: Fixes and improvements to the room feature
| * | | Address review commentsFearlessTobi2022-09-021-13/+6
| | | |
| * | | core/ldn_types: Minor corrections and additionsFearlessTobi2022-08-271-1/+16
| | | |
| * | | core/bsd: Correctly unbind methods in destructorFearlessTobi2022-08-271-1/+5
| | | | | | | | | | | | | | | | Prevents yuzu from crashing when the BSD service is created a second time.
| * | | core/acc: Make CheckAvailability use LOG_DEBUGFearlessTobi2022-08-271-1/+1
| |/ / | | | | | | | | | Previously it was spamming the logs in certain multiplayer games like Puyo Puyo Tetris.
* / / Demote services from warning/info to debug to reduce log spam:Kelebek12022-09-015-16/+16
|/ / | | | | | | | | | | | | | | | | | | | | GetCurrentFocusState SetClockSpeed EnableSixAxisSensorUnalteredPassthrough IsSixAxisSensorUnalteredPassthroughEnabled Get, GetOld SetAndWait, SetAndWaitOld IocParam IocFree
* | Merge pull request #8812 from Kelebek1/autobunnei2022-08-241-6/+21
|\ \ | | | | | | [Audio] Implement AudRenU:RequestUpdateAuto
| * | Implement AudRenU:RequestUpdateAuto, and use C descriptors when B reports as empty.Kelebek12022-08-241-6/+21
| | |
* | | Merge pull request #8804 from vonchenplus/speed_up_idirectory_servicesbunnei2022-08-231-1/+2
|\ \ \ | | | | | | | | core:filesystem: speed up IDirectory service
| * | | core:filesystem: speed up IDirectory servicevonchenplus2022-08-231-1/+2
| | | |
* | | | hid: core: Add missing function table namesgerman772022-08-221-0/+6
|/ / /
* / / core: implement clkrst servicevonchenplus2022-08-202-0/+184
|/ /
* | core, yuzu: Address first part of review commentsFearlessTobi2022-08-151-0/+1
| |
* | core, network: Add ability to proxy socket packetsFearlessTobi2022-08-156-172/+257
| |
* | Merge pull request #8731 from FearlessTobi/better-ldnliamwhite2022-08-125-56/+709
|\ \ | | | | | | ldn: Add better stubs and more data types
| * | core: ldn: Address review comments part 2german772022-08-122-334/+297
| | |
| * | core: ldn: Address review commentsNarr the Reg2022-08-084-56/+46
| | |
| * | ldn: Add better stubs and more data typesFearlessTobi2022-08-075-71/+771
| |/ | | | | | | | | Co-Authored-By: Narr the Reg <5944268+german77@users.noreply.github.com> Co-Authored-By: Morph <39850852+Morph1984@users.noreply.github.com>
* / hid: core: Properly emulate controller color and battery levelNarr the Reg2022-08-081-15/+62
|/
* Properly write out the command buffer when serving close requestNikita Strygin2022-07-311-2/+5
|
* Merge pull request #8636 from german77/irs_cluster_releaseliamwhite2022-07-274-6/+320
|\ | | | | service: irs: Implement clustering processor
| * Address commentsNarr the Reg2022-07-251-16/+16
| |
| * fix compiler errorsgerman772022-07-242-12/+14
| |
| * service: irs: Implement clustering processorgerman772022-07-244-6/+318
| |
* | Merge pull request #8633 from Morph1984/optional-keysliamwhite2022-07-271-0/+6
|\ \ | | | | | | applet/swkbd: Implement optional symbol keys
| * | applet/swkbd: Implement optional symbol keysMorph2022-07-241-0/+6
| | | | | | | | | | | | These are only used in the numeric keyboard, and correspond to the keys to the left and right of the "0" key on the numeric keyboard.
* | | yuzu: Add ui files for multiplayer roomsFearlessTobi2022-07-255-7/+7
| |/ |/|
* | yuzu: Add webcam support and rebase to latest masterNarr the Reg2022-07-243-4/+4
| |
* | service: irs: Move to IRS namespace and minor fixesgerman772022-07-2418-69/+66
| |
* | service: irs: Split processors and implement ImageTransferProcessorgerman772022-07-2417-291/+1077
|/
* Project AndioKelebek12022-07-2210-745/+770
|
* Merge pull request #8598 from Link4565/recv-dontwaitbunnei2022-07-221-1/+19
|\ | | | | Enable the use of MSG_DONTWAIT flag on RecvImpl
| * Enable the use of MSG_DONTWAIT flag on RecvImplLink45652022-07-161-1/+19
| |
* | implement resume messageGus Caplan2022-07-182-0/+5
| |
* | Merge pull request #8508 from yuzu-emu/mc-speed-limitbunnei2022-07-171-3/+15
|\ \ | | | | | | hle: service: nvflinger: Factor speed limit into frame time calculation.
| * | hle: service: nvflinger: Fix implicit conversion.bunnei2022-07-171-1/+4
| | |
| * | yuzu: settings: Remove framerate cap and merge unlocked framerate setting.bunnei2022-07-171-8/+10
| | | | | | | | | | | | - These were all somewhat redundant.
| * | hle: service: nvflinger: Factor speed limit into frame time calculation.bunnei2022-07-171-1/+8
| | | | | | | | | | | | | | | - This allows the %-based "Limit Speed Percent" setting to work with MC emulation. - This is already supported for SC emulation.
* | | Merge pull request #8544 from german77/14dot0bunnei2022-07-178-29/+45
|\ \ \ | |/ / |/| | service: Update some services to 14.0.0+
| * | service: fatal: Add function tablegerman772022-07-141-1/+7
| | |
| * | service: btdrv,bcat,btm: Update service tables to 14.0.0german772022-07-143-4/+13
| | |
| * | service am: Update service tables to 14.0.0german772022-07-141-0/+3
| | |
| * | service: ac: Replace intances of ProfileData with UserDatagerman772022-07-143-24/+22
| | |
* | | Merge pull request #8511 from german77/hbmenubunnei2022-07-168-83/+218
|\ \ \ | |_|/ |/| | service: ptm: Add TS, nifm: Stub GetInternetConnectionStatus
| * | service: nifm: Stub GetInternetConnectionStatusgerman772022-06-291-1/+41
| | |
| * | service: ptm: Rewrite PSM and add TSgerman772022-06-297-82/+177
| | |
* | | nvflinger: Polymorphic destructor requried for abstract class IBinderMerry2022-07-151-0/+1
| | |
* | | Merge pull request #8510 from german77/vibrationliamwhite2022-07-151-2/+2
|\ \ \ | |_|/ |/| | input_common: sdl: lower vibration frequency and use it's own unique thread
| * | input_common: sdl: lower vibration frequency and use it's own unique threadgerman772022-06-291-2/+2
| |/
* | PRKelebek12022-07-103-8/+7
| |
* | Rework CoreTimingKelebek12022-07-103-45/+26
| |
* | service: hid: Correct some mistakes and add more validationsNarr the Reg2022-06-294-40/+75
|/
* core: Replace all instances of ResultCode with Resultgerman772022-06-2776-414/+408
|
* service: am: Stub PerformSystemButtonPressingIfInFocusNarr the Reg2022-06-202-1/+24
| | | | Used by Ring Fit Adventure
* Merge pull request #8457 from liamwhite/kprocess-suspendFernando S2022-06-161-2/+2
|\ | | | | kernel: implement KProcess suspension
| * kernel: implement KProcess suspensionLiam2022-06-141-2/+2
| |
* | Merge pull request #8317 from german77/notifabunnei2022-06-152-8/+172
|\ \ | |/ |/| service: notifa: Implement most part of this service
| * service: notifa: Implement most part of this servicegerman772022-05-092-8/+172
| | | | | | | | | | Implements partially RegisterAlarmSetting, UpdateAlarmSetting, LoadApplicationParameter, DeleteAlarmSetting. Needed for Fitness `Boxing 2: Rhythm & Exercise` and `Ring Fit Adventure`.
* | common: Change semantics of UNREACHABLE to unconditionally crashLiam2022-06-1417-27/+27
| |
* | service: hid: Fix gesture regressionNarr the Reg2022-06-102-4/+3
| |
* | Merge pull request #8428 from bunnei/nvflinger-fix-timingbunnei2022-06-083-31/+3
|\ \ | | | | | | Follow-up fixes for NVFlinger rewrite (Part 3)
| * | hle: service: nvflinger: buffer_queue_consumer: Always free released buffers.bunnei2022-06-063-31/+3
| | |
* | | Merge pull request #8426 from liamwhite/elfbunnei2022-06-061-24/+8
|\ \ \ | |/ / |/| | common: consolidate ELF structure definitions
| * | common: consolidate ELF structure definitionsLiam2022-06-051-24/+8
| | |
* | | service: hid: Improve stub of IRSNarr the Reg2022-05-312-21/+460
|/ /
* | Merge pull request #8368 from german77/seventimesbunnei2022-05-305-368/+600
|\ \ | | | | | | Service: hid: Several improvements and implementations
| * | service: hid: Implement ResetIsSixAxisSensorDeviceNewlyAssignedgerman772022-05-274-6/+115
| | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | service: hid: Implement LoadSixAxisSensorCalibrationParameter and GetSixAxisSensorIcInformationgerman772022-05-274-3/+103
| | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | service: hid: Implement EnableSixAxisSensorUnalteredPassthrough and IsSixAxisSensorUnalteredPassthroughEnabledgerman772022-05-274-2/+88
| | | | | | | | | | | | Needed by Nintendo Switch Sports
| * | service: hid: Add error handling to sixaxis functionsgerman772022-05-273-31/+55
| | |
| * | service: hid: Refractor sixaxis functionsgerman772022-05-272-185/+88
| | |
| * | service: hid: Implement MergeSingleJoyAsDualJoy according to REgerman772022-05-274-65/+57
| | |
| * | service: hid: Add error handling to setNpadAssignment and variantsgerman772022-05-273-23/+27
| | |
| * | service: hid: Quick RE fixes and commentsgerman772022-05-274-54/+68
| | |
* | | Merge pull request #8332 from Morph1984/reduce_exec_sizebunnei2022-05-291-4/+3
|\ \ \ | | | | | | | | general: Use smaller array types where applicable
| * | | time_zone_manager: Use s8 for month length tablesMorph2022-05-131-4/+3
| |/ / | | | | | | | | | Using this smaller type saves 512 bytes in the compiled executable.
* / / input_common: touch: Rewrite touch driver to support multiple touch pointsgerman772022-05-231-1/+5
|/ /
* | service: hid: Fix motion refresh rateNarr the Reg2022-05-062-2/+6
| |
* | service: hid: Disable correctly motion inputgerman772022-05-061-50/+41
|/
* Merge pull request #8274 from german77/firmwareMorph2022-04-292-1/+21
|\ | | | | service: hid: Stub IsFirmwareUpdateNeededForNotification
| * service: hid: Stub IsFirmwareUpdateNeededForNotificationgerman772022-04-272-1/+21
| | | | | | | | Used in Fitness Boxing 2: Rhythm & Exercise (0100073011382000)
* | chore: add missing SPDX tagsAndrea Pappacoda2022-04-281-19/+2
| | | | | | | | Follow-up to 99ceb03a1cfcf35968cab589ea188a8c406cda52
* | Merge pull request #8229 from german77/reinterpret2bunnei2022-04-2721-350/+393
|\ \ | |/ |/| service: hid: Access shared memory directly
| * service: hid: Ensure all structs are initializedNarr the Reg2022-04-2415-68/+69
| |
| * service: hid: Access shared memory directlyNarr the Reg2022-04-2321-305/+347
| |
* | service: jit: document and clean upLiam2022-04-253-132/+225
|/
* general: Convert source file copyright comments over to SPDXMorph2022-04-23406-1200/+823
| | | | | This formats all copyright comments according to SPDX formatting guidelines. Additionally, this resolves the remaining GPLv2 only licensed files by relicensing them to GPLv2.0-or-later.
* service: hid: Improve accuracy of sixaxis functionsNarr the Reg2022-04-185-97/+360
|
* yuzu: Add custom ringcon configurationgerman772022-04-165-64/+54
|
* hidbus: Implement hidbus and ringcongerman772022-04-1611-26/+1645
|
* Merge pull request #8172 from bunnei/kernel-mutexFernando S2022-04-162-4/+4
|\ | | | | hle: kernel: Use std::mutex instead of spin locks for most kernel locking.
| * core: hle: service: Allocate a service thread.bunnei2022-04-121-1/+2
| |
| * hle: kernel: Use std::mutex instead of spin locks for most kernel locking.bunnei2022-04-121-3/+2
| |
* | service: jit: Implement the JIT serviceLiam2022-04-133-6/+774
| |
* | Merge pull request #8165 from bunnei/ensure-session-port-cleanupbunnei2022-04-122-8/+2
|\ \ | | | | | | Kernel: Track open references to KServerPort and KServerSession.
| * | hle: kernel: Unify and integrate reference tracking for KServerPort/KServerSession.bunnei2022-04-081-0/+1
| | | | | | | | | | | | - These are not managed elsewhere, and need to be tracked and closed on emulation shutdown.
| * | hle: service: sm: Remove manual tracking of KServerPorts.bunnei2022-04-082-8/+1
| | |
* | | Merge pull request #8178 from tech-ticks/skyline-icache-fixbunnei2022-04-121-11/+19
|\ \ \ | |_|/ |/| | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)
| * | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)tech-ticks2022-04-091-11/+19
| | |
* | | service: sfdnsres: add missing includes for some BSDs after 82d46a974ad4Jan Beich2022-04-121-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/sockets/sfdnsres.cpp: In function 'Service::Sockets::NetDbError Service::Sockets::AddrInfoErrorToNetDbError(s32)': src/core/hle/service/sockets/sfdnsres.cpp:66:10: error: 'EAI_NODATA' was not declared in this scope; did you mean 'EAI_NONAME'? 66 | case EAI_NODATA: | ^~~~~~~~~~ | EAI_NONAME src/core/hle/service/sockets/sfdnsres.cpp: In function 'std::vector<unsigned char> Service::Sockets::SerializeAddrInfo(const addrinfo*, s32, std::string_view)': src/core/hle/service/sockets/sfdnsres.cpp:127:53: error: 'sockaddr_in' does not name a type; did you mean 'SockAddrIn'? 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^~~~~~~~~~~ | SockAddrIn src/core/hle/service/sockets/sfdnsres.cpp:127:64: error: expected '>' before '*' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:127:64: error: expected '(' before '*' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ | ( src/core/hle/service/sockets/sfdnsres.cpp:127:65: error: expected primary-expression before '>' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:127:84: error: expected ')' before ';' token 127 | const auto addr = *reinterpret_cast<sockaddr_in*>(current->ai_addr); | ^ | ) src/core/hle/service/sockets/sfdnsres.cpp:148:53: error: 'sockaddr_in6' does not name a type; did you mean 'SockAddrIn6'? 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^~~~~~~~~~~~ | SockAddrIn6 src/core/hle/service/sockets/sfdnsres.cpp:148:65: error: expected '>' before '*' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:148:65: error: expected '(' before '*' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ | ( src/core/hle/service/sockets/sfdnsres.cpp:148:66: error: expected primary-expression before '>' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ src/core/hle/service/sockets/sfdnsres.cpp:148:85: error: expected ')' before ';' token 148 | const auto addr = *reinterpret_cast<sockaddr_in6*>(current->ai_addr); | ^ | )
* | | Merge pull request #8171 from tech-ticks/skyline-improvementsFernando S2022-04-104-5/+201
|\ \ \ | |_|/ |/| | Improvements for game modding with Skyline, DNS resolution
| * | service: sfdnsres: Implement DNS address resolutiontech-ticks2022-04-082-5/+197
| | |
| * | service: bsd: Add keepalive socket optiontech-ticks2022-04-072-0/+4
| |/
* | Merge pull request #8169 from merryhime/scoped_lockbunnei2022-04-087-26/+26
|\ \ | | | | | | Replace lock_guard with scoped_lock
| * | core/hle: Standardize scoped_lock initializersMerry2022-04-075-23/+23
| | |
| * | core/hle: Replace lock_guard with scoped_lockMerry2022-04-072-3/+3
| | |
* | | fix: remove #pragma once in .cpp fileAndrea Pappacoda2022-04-071-2/+0
|/ /
* | Merge pull request #8164 from liamwhite/jit-stubbunnei2022-04-075-1/+84
|\ \ | | | | | | service: jit: stub JIT service
| * | service: jit: stub JIT serviceLiam2022-04-075-1/+84
| |/
* | Merge pull request #8122 from bunnei/improve-thread-usagebunnei2022-04-069-20/+32
|\ \ | |/ |/| Improve usage of service host threads
| * hle: service: nvdrv: Create a service thread where appropriate.Morph2022-04-021-1/+1
| |
| * hle: service: vi: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| |
| * hle: service: bsd: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| |
| * hle: service: filesystem: Create a service thread where appropriate.bunnei2022-04-021-5/+8
| |
| * hle: service: audio: Create a service thread where appropriate.bunnei2022-04-022-4/+6
| |
| * hle: service: Add option for service interfaces to create or use the default thread.bunnei2022-04-023-8/+13
| |
* | service: hid: Partially revert #8123german772022-04-061-0/+4
| |
* | Merge pull request #8137 from bunnei/improve-nvflinger-2bunnei2022-04-069-91/+99
|\ \ | | | | | | Follow-up fixes for NVFlinger rewrite (Part 2)
| * | hle: service: nvflinger: buffer_queue_producer: Cleanup & fixes.bunnei2022-04-022-61/+42
| | |
| * | hle: service: nvflinger: consumer_base: Cleanup & fixes.bunnei2022-04-022-15/+17
| | |
| * | hle: service: nvflinger: buffer_queue_producer: Cleanup & add GetReleasedBuffers.bunnei2022-04-022-10/+38
| | |
| * | hle: service: nvflinger: buffer_queue_core: Cleanup & fixes.bunnei2022-04-022-3/+0
| | |
| * | hle: service: nvflinger: Use correct logger namespace.bunnei2022-04-021-2/+2
| |/
* | Merge pull request #8135 from Morph1984/websession-hackbunnei2022-04-031-0/+8
|\ \ | | | | | | applets/web: Keep foreground (websession) web applet open
| * | applets/web: Keep foreground (websession) web applet openMorph2022-04-021-0/+8
| |/ | | | | | | This is a hack to keep the foreground (websession) web applet open in games using these such as Super Mario 3D All-Stars.
* | Merge pull request #8123 from german77/bombslingerbunnei2022-04-033-66/+69
|\ \ | | | | | | service: hid: Remove inaccurate behavior on initialization
| * | service: npad: Default initialize shared memorygerman772022-04-031-48/+48
| | |
| * | service: hid: Remove inaccurate behavior on initializationgerman772022-03-313-18/+21
| | |
* | | fix: typosAndrea Pappacoda2022-04-022-7/+7
| |/ |/|
* | Merge pull request #8116 from ameerj/nvhost_ctrl_bad_paramFernando S2022-04-011-1/+1
|\ \ | | | | | | nvhost_ctrl: Only mark EventState::Busy as BadParameter
| * | nvhost_ctrl: Only mark EventState::Busy as BadParameterameerj2022-03-291-1/+1
| |/ | | | | | | Fixes an svc break in Kirby and the Forgotten Land with async GPU enabled.
* | Merge pull request #8120 from german77/signalbunnei2022-03-311-0/+4
|\ \ | |/ |/| service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandle
| * service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandleNarr the Reg2022-03-311-0/+4
| |
* | Merge pull request #8088 from bunnei/fixup-nvflingerFernando S2022-03-279-547/+136
|\ \ | | | | | | Follow-up fixes for NVFlinger rewrite
| * | hle: service: nvflinger: buffer_queue: Remove AutoLock and fix free buffer tracking.bunnei2022-03-265-181/+130
| | |
| * | hle: service: nvflinger: buffer_queue_consumer: Use scoped_lock instead of unique_lock.bunnei2022-03-261-2/+2
| | |
| * | hle: service: nvflinger: consumer_base: Use scoped_lock instead of unique_lock.bunnei2022-03-261-4/+4
| | |
| * | hle: service: nvflinger: Remove unused BufferQueue.bunnei2022-03-262-360/+0
| | |
* | | Merge pull request #8041 from Morph1984/inline-swkbdbunnei2022-03-263-166/+415
|\ \ \ | |/ / |/| | applets/swkbd: Add support for an updated inline software keyboard
| * | applets/swkbd: Split software keyboard initializationMorph2022-03-222-160/+349
| | | | | | | | | | | | | | | Since the CalcArg struct has been updated with a new size and fields, we have to split the initialization of the keyboard into multiple functions. This also adds support for parsing the new CalcArg struct used by updated versions of Monster Hunter Rise.
| * | applets/swkbd: Add new inline software keyboard typesMorph2022-03-221-6/+66
| |/ | | | | | | These were added in newer firmware versions.
* | hle: nvflinger: ConsumerBase: Mark ctor as explicit.bunnei2022-03-251-1/+1
| |
* | hle: vi: NativeWindow: Fix trivially copyable issues.bunnei2022-03-251-4/+4
| |
* | hle: nvdrv: nvdata: buffer_queue_producer: Minor cleanup.bunnei2022-03-251-11/+11
| |
* | hle: nvdrv: nvdata: Cleanup NvFence static assert.bunnei2022-03-251-1/+1
| |
* | hle: nvflinger: Remove unused unordered_map include.bunnei2022-03-251-1/+0
| |
* | hle: nvflinger: buffer_queue_consumer: AcquireBuffer: Fix typo.bunnei2022-03-251-1/+1
| |
* | hle: nvflinger: Merge Rect with Common::Rectangle.bunnei2022-03-254-84/+9
| |
* | hle: nvflinger: buffer_queue_core: Declare default dtor.bunnei2022-03-252-0/+3
| |
* | hle: nvflinger: buffer_queue_producer: DequeueBuffer: Remove unnecessary lock.bunnei2022-03-251-3/+1
| |
* | hle: nvflinger: consumer_base: StillTracking: Should be const.bunnei2022-03-252-2/+3
| |
* | hle: nvflinger: graphic_buffer_producer: Remove unnecessary pragma pack.bunnei2022-03-251-2/+0
| |
* | hle: nvflinger: parcel: Reserve token size.bunnei2022-03-251-1/+2
| |
* | hle: nvflinger: buffer_queue_core: StillTracking: Take const reference.bunnei2022-03-254-7/+7
| |
* | hle: nvflinger: buffer_queue_core: Cleanup locking.bunnei2022-03-251-2/+2
| |
* | hle: nvflinger: Use std::chrono for present_ns.bunnei2022-03-257-25/+30
| |
* | hle: nvflinger: Migrate android namespace -> Service::android.bunnei2022-03-2529-61/+58
| |
* | hle: nvflinger: BufferQueueProducer: Handle SetPreallocatedBuffer with empty buffer.bunnei2022-03-251-7/+10
| | | | | | | | - Used by Naruto Ultimate Ninja Storm.
* | hle: vi: Integrate new NVFlinger and HosBinderDriverServer service.bunnei2022-03-2516-723/+285
| |
* | hle: nvflinger: Add implementation for HosBinderDriverServer service.bunnei2022-03-252-0/+73
| |
* | hle: nvflinger: Add implementation for BufferQueueProducer class.bunnei2022-03-252-0/+1019
| |
* | hle: nvflinger: Add implementation for BufferQueueCore class.bunnei2022-03-252-0/+233
| |
* | hle: nvflinger: Add implementation for BufferQueueConsumer class.bunnei2022-03-252-0/+261
| |
* | hle: nvflinger: Add implementation for QueueBufferInput and QueueBufferOutput structs.bunnei2022-03-252-0/+98
| |
* | hle: nvflinger: Add implementation for BufferItemConsumer class.bunnei2022-03-252-0/+85
| |
* | hle: nvflinger: Add implementation for ConsumerBase class.bunnei2022-03-252-0/+188
| |
* | hle: nvflinger: Add implementation for BufferSlot class.bunnei2022-03-251-0/+39
| |
* | hle: nvflinger: Add implementation for BufferItem class.bunnei2022-03-251-0/+46
| |
* | hle: nvflinger: Move implementation for Parcel to its own header.bunnei2022-03-251-0/+171
| |
* | hle: nvflinger: Add android buffer queue definitions to its own header.bunnei2022-03-251-0/+21
| |
* | hle: nvflinger: Add IBinder interface.bunnei2022-03-251-0/+42
| |
* | hle: nvflinger: Add IConsumerListener interface.bunnei2022-03-251-0/+26
| |
* | hle: nvflinger: Add ProducerListener interface.bunnei2022-03-251-0/+16
| |
* | hle: nvflinger: Add android window enumerations to its own header.bunnei2022-03-251-0/+53
| |
* | hle: nvflinger: Add android Status flags to its own header.bunnei2022-03-251-0/+28
| |
* | hle: nvflinger: Move BufferTransformFlags to its own header.bunnei2022-03-252-1/+26
| |
* | hle: nvdrv: Rename Fence to NvFence to avoid naming conflicts.bunnei2022-03-254-17/+13
| |
* | hle: nvflinger: Move PixelFormat to its own header.bunnei2022-03-254-10/+30
| |
* | hle: nvflinger: Add implementation for GraphicBuffer class.bunnei2022-03-251-0/+100
| |
* | hle: nvflinger: Add implementation for Fence class.bunnei2022-03-251-0/+32
| |
* | hle: nvflinger: Add implementation for Rect class.bunnei2022-03-251-0/+75
| |
* | applets/mii: Remove unused includeMorph2022-03-221-1/+0
| |
* | applets/mii: Cleanup MiiEdit applet implementationMorph2022-03-222-44/+85
| | | | | | | | This also enables proper support for MiiEdit applets which are used in games with firmware versions prior to 10.2.0 by handling the 2 different versions of applet inputs and outputs.
* | applets/mii: Cleanup MiiEdit applet typesMorph2022-03-221-23/+44
| |
* | applets/mii: Move MiiEdit applet types into its own fileMorph2022-03-223-54/+69
| |
* | service: Move mii enums and structs into its own fileMorph2022-03-226-307/+311
| | | | | | | | Moves these into types.h, since other files also make use of these types.
* | applets: Rename Mii to MiiEditMorph2022-03-224-34/+35
|/
* common: Reduce unused includesameerj2022-03-193-0/+4
|
* core: Reduce unused includesameerj2022-03-1916-26/+2
|
* Merge pull request #8028 from v1993/patch-9bunnei2022-03-191-2/+2
|\ | | | | bsd: Allow inexact match for address length in AcceptImpl
| * bsd: Allow inexact match for address length in AcceptImplValeri2022-03-151-2/+2
| | | | | | Minecraft passes in zero for length, but this should account for all possible cases
* | Merge pull request #7964 from german77/miiiibunnei2022-03-174-5/+212
|\ \ | | | | | | applet: mii: Simple implementation of mii applet
| * | applet: mii: Simple implementation of mii appletgerman772022-03-014-5/+212
| | |
* | | core: hle: service: kernel_helpers: Use system resource limit.bunnei2022-03-151-10/+1
| | |
* | | core: hle: service: sm: Fix KPort reference count.bunnei2022-03-151-0/+2
| | |
* | | core: hle: kernel: Use weak_ptr where possible for SessionRequestHandler and SessionRequestManager.bunnei2022-03-151-2/+2
| |/ |/|
* | hle: service: ldr: Use deterministic addresses when mapping NROs.bunnei2022-03-091-19/+59
|/ | | | | - Instead of randomization, choose in-order addresses for where to map NROs into memory. - This results in predictable behavior when debugging and consistent behavior when reproducing issues.
* Merge pull request #7932 from bunnei/extended-mem-layoutbunnei2022-02-261-2/+15
|\ | | | | Add extended memory layout (6GB) support and improve KResourceLimit management
| * core: hle: kernel: KProcess: Pass in KResourceLimit on process creation.bunnei2022-02-211-1/+14
| | | | | | | | - This allows us to have a resource limit per process, rather than use the global system resource limit.
| * core: hle: kernel: KEvent: Pass in owner KProcess on event creation.bunnei2022-02-211-1/+1
| | | | | | | | - This is necessary to ensure resource limits are freed from the right process.
* | service: am: Update enum names to match documentationNarr the Reg2022-02-224-16/+51
|/
* Merge pull request #7867 from german77/amiibobunnei2022-02-192-247/+911
|\ | | | | nfp: Improve amiibo support
| * nfp: Allow files without password datagerman772022-02-132-9/+24
| |
| * nfp: Separate nfc tag from amiibo dataNarr the Reg2022-02-102-42/+69
| |
| * nfp: Address compiler issuesgerman772022-02-091-25/+26
| |
| * nfp: Validate amiibo filesNarr the Reg2022-02-082-41/+145
| |
| * nfp: Improve implementationgerman772022-02-082-189/+664
| |
| * nfp: Move IUser class to header and add missing enum and structsgerman772022-02-072-257/+299
| |
| * nfp: Sort functions by command numbergerman772022-02-071-79/+79
| |
* | Merge pull request #7878 from german77/mnppbunnei2022-02-173-0/+67
|\ \ | | | | | | service/mnpp: Stub mnpp_app
| * | service/mnpp: Stub mnpp_appNarr the Reg2022-02-113-0/+67
| |/ | | | | | | Used in Super Nintendo Entertainment System™ - Nintendo Switch Online
* | hid: Stub IsUsbFullKeyControllerEnabledlat9nq2022-02-122-1/+12
| | | | | | | | | | | | Used by Splatoon 2, when opening the inventory from a LAN battle lobby. Reference: https://switchbrew.org/wiki/HID_services
* | Merge pull request #7852 from Morph1984/new-uuidbunnei2022-02-1113-59/+50
|\ \ | |/ |/| common: Revise and fix the UUID implementation
| * general: Rename NewUUID to UUID, and remove the previous UUID implMorph2022-02-0516-108/+105
| | | | | | | | This completes the removal of the old UUID implementation.
| * profile: Migrate to the new UUID implementationMorph2022-02-057-102/+105
| |
| * service: Migrate to the new UUID implementationMorph2022-02-059-45/+36
| |
* | service: pm: Implement AtmosphereGetProcessInfotech-ticks2022-02-041-0/+45
|/
* general: Move deleted copy/move constructor/assignment operators to public interfaceLioncash2022-02-021-1/+1
| | | | | | | | This allows for better compiler errors, where the compiler will state a copy or move couldn't occur due to the relevant function being deleted. Previously a compiler would warn about the relevant function not being accessible (which, while true, isn't as informative as it could be).
* Merge pull request #7752 from Morph1984/SetCpuOverclockEnabledbunnei2022-01-221-1/+13
|\ | | | | service: apm: Stub ISession SetCpuOverclockEnabled
| * service: apm: Stub ISession SetCpuOverclockEnabledMorph2022-01-211-1/+13
| | | | | | | | | | | | Since we don't currently support CPU overclocking within the emulated system, this can be stubbed for now, like APM IsCpuOverclockEnabled. - Used by Gravity Rider Zero
* | service/wlan: Update function tablesLioncash2022-01-211-1/+1
| |
* | service/usb: Update function tablesLioncash2022-01-211-27/+15
| |
* | service/set: Update function tablesLioncash2022-01-211-0/+2
| |
* | service/ns: Update function tablesLioncash2022-01-211-0/+6
| |
* | service/nim: Update unknown function table entriesLioncash2022-01-211-0/+6
| |
* | service/friend: Update unknown function table entriesLioncash2022-01-211-6/+6
| |
* | service/filsystem: Update fsp-srv function tableLioncash2022-01-211-0/+3
| |
* | service/btm: Update function tablesLioncash2022-01-211-0/+30
| |
* | service/audio: Update audctl unknown function namesLioncash2022-01-211-8/+8
| |
* | service/am: Update omm function tablesLioncash2022-01-211-0/+1
| |
* | service/acc: Update unknown function namesLioncash2022-01-212-4/+4
|/ | | | Switchbrew has the function names now.
* service/hid: Initialize applet_resource on SetNpadAnalogStickUseCenterClampgerman772022-01-191-1/+2
|
* Merge pull request #7707 from german77/slow-updatebunnei2022-01-151-1/+2
|\ | | | | service/hid: Decrease motion update rate
| * service/hid: Decrease motion update rateNarr the Reg2022-01-131-1/+2
| | | | | | Motion stops working in Mario Tennis in swing mode if the update rate is too fast even when HW it updates at the same speed. 10ms it's the minimum period that the game needs to start working again.
* | hle: kernel: k_page_table: Update SetProcessMemoryPermission.bunnei2022-01-121-3/+4
| |
* | hle: service: ldr: UnmapCodeMemory BSS only when set.bunnei2022-01-121-3/+7
| |
* | hle: kernel: k_page_table: ReadAndWrite -> UserReadWrite.bunnei2022-01-121-1/+1
| |
* | hle: kernel: k_page_table: Rename *ProcessCodeMemory -> *CodeMemory.bunnei2022-01-121-14/+13
|/
* Remove invalid assertion statementFeng Chen2021-12-281-3/+0
|
* Implement few type in bufferqueue query methodFeng Chen2021-12-282-0/+9
|
* Merge pull request #7481 from german77/gyro-biasbunnei2021-12-212-14/+16
|\ | | | | service/hid: Improve console motion accuracy
| * service/hid: Improve console motion accuracyNarr the Reg2021-12-132-14/+16
| |
* | Merge pull request #7597 from bunnei/remove-global-lockbunnei2021-12-203-18/+1
|\ \ | | | | | | core: hle: Remove global HLE lock.
| * | core: hle: Remove global HLE lock.bunnei2021-12-183-18/+1
| | | | | | | | | | | | | | | - This was added early on as a hack to protect against some concurrency issues. - It's not clear that this serves any purpose anymore, and if it does, individual components should be fixed rather than using a global recursive mutex.
* | | core/hid: Cancel any vibration after the testNarr the Reg2021-12-163-11/+5
|/ /
* | Merge pull request #7525 from german77/notifabunnei2021-12-083-0/+73
|\ \ | | | | | | service/notif: Add notif:a and stub ListAlarmSettings, Initialize
| * | service/notif: Add notif:a and stub ListAlarmSettings,Initializegerman772021-12-063-0/+73
| | | | | | | | | | | | Used by ring fit adventure 1.2.0
* | | Merge pull request #7521 from german77/dual_single_joyconsbunnei2021-12-083-38/+161
|\ \ \ | |_|/ |/| | service/hid: Implement SetNpadJoyAssignmentMode
| * | service/hid: Implement SetNpadJoyAssignmentModegerman772021-12-053-38/+161
| |/
* | Merge pull request #7488 from vonchenplus/support_multiple_videos_playingbunnei2021-12-086-8/+29
|\ \ | | | | | | Support multiple videos playing
| * | Address feedbackFeng Chen2021-12-044-13/+22
| | |
| * | Support multiple videos playingFeng Chen2021-12-024-9/+21
| | |
* | | Merge pull request #7524 from german77/hid_stubbunnei2021-12-062-2/+35
|\ \ \ | | | | | | | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignment
| * | | service/hid: Stub SetNpadCaptureButtonAssignment and ClearNpadCaptureButtonAssignmentgerman772021-12-062-2/+35
| | |/ | |/| | | | | | | Used by ring fit adventure 1.2.0
* / | general: Add missing copyright noticesameerj2021-12-051-0/+4
|/ /
* | core/hid: Ensure only valid npad are connectedgerman772021-12-051-17/+13
| |
* | Merge pull request #7489 from Morph1984/steady-clockbunnei2021-12-041-2/+2
|\ \ | | | | | | general: Replace high_resolution_clock with steady_clock
| * | general: Replace high_resolution_clock with steady_clockMorph2021-12-021-2/+2
| |/ | | | | | | On some OSes, high_resolution_clock is an alias to system_clock and is not monotonic in nature. Replace this with steady_clock.
* / service: am: ISelfController: Stub SaveCurrentScreenshotMorph2021-12-033-2/+15
|/ | | | - Used by Disney Magical World 2: Enchanted Edition
* service: friend: Implement GetCompletionEventMorph2021-11-301-2/+21
| | | | - Used by Super Bomberman R Online
* npad: Return NpadButton in GetAndResetPressStateMorph2021-11-302-5/+5
| | | | We were previously truncating this to a u32 as there were no known buttons that used the full 64 bits of this type. Fix this now that we know they are used.
* general: Fix handheld typoMorph2021-11-291-1/+1
|
* Merge pull request #7438 from german77/homebrew2bunnei2021-11-285-2/+144
|\ | | | | Core: Stub services and functions needed for checkpoint
| * core/ns: Implement GetReadOnlyApplicationControlDataInterfaceNarr the Reg2021-11-282-1/+26
| | | | | | | | Used in checkpoint homebrew
| * core/pdm: Stub QueryPlayStatisticsByApplicationIdAndUserAccountIdNarr the Reg2021-11-283-0/+105
| | | | | | | | Used in checkpoint homebrew
| * core/hid: Stub GetUniquePadsFromNpadNarr the Reg2021-11-271-1/+13
| | | | | | | | Used in checkpoint homebrew
* | settings: Add debug setting to enable all controllersgerman772021-11-281-0/+4
|/
* service/hid: Finish converting LIFO objects and address some nitsNarr the Reg2021-11-2512-91/+46
|
* kraken: Address comments from reviewgerman772021-11-252-5/+4
| | | | Fix compiler bug
* core/hid: Improve accuary of mouse implementationgerman772021-11-256-18/+28
|
* core/hid: Fully implement native mousegerman772021-11-251-4/+5
|
* core/hid: Improve accuracy of the keyboard implementationgerman772021-11-253-4/+34
|
* core/hid: Fix keyboard alignmentgerman772021-11-251-0/+1
|
* core/hid: Remove usage of native types, fix a couple of errors with motiongerman772021-11-255-411/+544
|
* service/hid: Remove includes of core.h and settings.hgerman772021-11-2522-51/+56
|
* service/hid: Add support for new controllersgerman772021-11-251-1/+30
|
* core/hid: Rename NpadType to NpadStyleIndexgerman772021-11-253-75/+79
|
* second commit lion reviewgerman772021-11-259-5/+15
|
* kraken: Address comments from reviewgerman772021-11-254-8/+5
| | | | start lion review
* core/hid: Update structs to 13.1.0german772021-11-259-42/+89
|
* core/hid: Rework battery mappingsgerman772021-11-251-2/+9
|
* service/hid: Fix memory allocated incorrectlygerman772021-11-255-7/+7
|
* Morph review first wavegerman772021-11-2512-74/+56
|
* service/hid: Match shared memory closer to HWgerman772021-11-252-26/+75
|
* kraken: Address comments from reviewgerman772021-11-254-9/+8
| | | | review fixes
* service/hid: Use ring buffer for gesturesgerman772021-11-252-79/+52
|
* service/hid: Fix gesture inputgerman772021-11-252-61/+92
|
* configuration: Migrate controller settings to emulated controllergerman772021-11-251-11/+3
|
* core/hid: Only signal when neededgerman772021-11-251-2/+4
|
* hid: Fix controller connection/disconnectiongerman772021-11-253-26/+56
|
* kraken: Fix errors from rebase and format filesgerman772021-11-251-1/+0
|
* core/hid: Add output devicesgerman772021-11-252-40/+5
|
* core/frontend: Update appletsgerman772021-11-251-1/+1
|
* service/hid: Rewrite npad to use ring lifo and the emulated controllergerman772021-11-252-890/+605
|
* service/hid: Update console sixaxis to the emulated consolegerman772021-11-252-28/+26
|
* service/hid: Update mouse and keyboard to use ring lifo and the emulated devicegerman772021-11-254-158/+71
|
* service/hid: Update touch and gestures to use ring lifo and the emulated consolegerman772021-11-254-370/+191
|
* service/hid: Update debug pad, xpad, stubbed and controller base to use ring lifo and the emulated controllergerman772021-11-257-166/+80
|
* service/hid: Use remove duplicated code, update namesgerman772021-11-252-64/+30
|
* service/hid: Create ring LIFOgerman772021-11-251-0/+54
|
* settings: Cleanup settingsgerman772021-11-254-5/+4
|
* Merge pull request #7394 from Morph1984/svc-SetMemoryPermissionbunnei2021-11-221-4/+4
|\ | | | | kernel: svc: Implement SetProcessMemoryPermission
| * kernel: KPageTable: Rename SetCodeMemoryPermission to SetProcessMemoryPermissionMorph2021-11-211-4/+4
| |
* | service: pm: Implement AtmosphereGetProcessIdMorph2021-11-211-0/+24
| | | | | | | | - Used by Skyline modding framework
* | service: pm: Add all relevant result codesMorph2021-11-211-3/+8
| |
* | service: pm: Rename title id to program idMorph2021-11-211-6/+6
|/
* Settings: eliminate rescaling_factor.Fernando Sahmkow2021-11-162-27/+12
|
* applets/swkbd: Fix text check message encodingMorph2021-11-081-7/+15
| | | | The text check message can be encoded in UTF-8.
* applets/swkbd: Skip text checking if the text has been confirmedMorph2021-11-082-8/+15
| | | | | | | Confirm means that the text has already been checked by the application to be correct, but is asking the user for confirmation. The confirmation text itself seems to be corrupted though, this needs to be investigated. Fixes the software keyboard in Famicom Detective Club: The Missing Heir
* service/pctl: Stub EndFreeCommunicationNarr the Reg2021-11-051-1/+8
| | | - Used by Just Dance 2022
* Merge pull request #7279 from Morph1984/system-get-program-idMorph2021-11-0515-42/+28
|\ | | | | general: Get the current process program id directly from the system
| * general: Get the current process program id directly from the systemMorph2021-11-0413-43/+26
| | | | | | | | This allows us to avoid including KProcess' header file in files that only need to get the current process' program id.
| * general: Rename GetTitleID to GetProgramIDMorph2021-11-0415-29/+32
| |
* | Merge pull request #7287 from Morph1984/stub-aocFernando S2021-11-052-0/+29
|\ \ | |/ |/| service: aoc: Stub more 13.x functions used by Animal Crossing
| * service: aoc: Stub NotifyUnmountAddOnContentMorph2021-11-042-1/+9
| | | | | | | | Used by Animal Crossing: New Horizons v2.0.0 DLC
| * service: aoc: Stub NotifyMountAddOnContent and NotifyMountAddOnContentMorph2021-11-042-0/+21
| | | | | | | | Used by Animal Crossing: New Horizons v2.0.0 DLC
* | Merge pull request #7282 from ameerj/core-includesbunnei2021-11-0452-77/+3
|\ \ | |/ |/| core: Reduce unused header includes
| * core: Fix transitive include build errorsameerj2021-11-041-0/+2
| |
| * core: Remove unused includesameerj2021-11-0451-77/+1
| |
* | service/acc: Rename Unknown160 to InitializeApplicationInfoV2german772021-11-043-3/+3
| |
* | service: acc: Stub acc:u0 '160'Morph2021-11-043-0/+9
|/ | | | | | - Used by Animal Crossing: New Horizons v2.0.0 Since the name is currently unknown, '160' is used as a placeholder.
* general: Remove MakeResult helpersMorph2021-11-028-39/+38
| | | | This is made obsolete by the presence of implicit constructors.
* ns: language: Add BrazilianPortuguese to ApplicationLanguageMorph2021-10-292-1/+26
| | | | It seems that Nintendo finally filled that last empty spot in ApplicationLanguage for a total of 16 supported languages.
* Fixup channel submit IOCTL syncpoint parametersBilly Laws2021-10-242-21/+9
| | | | | | The current arguments worked by happenstance as games only ever submit one syncpoint and request one fence back, if a game were to do something other than this then the arguments would've been parsed entirely wrong.
* settings: Remove std::chrono usageameerj2021-10-171-6/+7
| | | | Alleviates the dependency on chrono for all files that include settings.h
* Merge pull request #7187 from FernandoS27/boy-i-say-boybunnei2021-10-162-0/+16
|\ | | | | NVHost_Ctrl: Force wait if the gpu falls behind too long.
| * NvHost/Core: Address Feedback.Fernando Sahmkow2021-10-161-3/+5
| |
| * Suspend temporallyFernandoS272021-10-161-1/+2
| |
| * NVHost_Ctrl: Force wait if the gpu falls behind too long.FernandoS272021-10-162-0/+13
| |
* | service/vi: Stub IHOSBinderDriver::TransactParcel GetBufferHistory (#7184)Feng Chen2021-10-161-1/+11
|/
* Merge pull request #7110 from vonchenplus/fix_extract_offline_romefs_errorMorph2021-10-111-0/+10
|\ | | | | applets/web: Fallback to loader to get the manual romfs if none is found
| * applets/web: Fallback to loader to get the manual romfs if none is foundFeng Chen2021-10-111-0/+10
| |
* | service: Reduce header include overheadMorph2021-10-0729-35/+10
| |
* | Merge pull request #7118 from ameerj/vc-gpu-implFernando S2021-10-065-52/+36
|\ \ | | | | | | gpu: Migrate implementation to the cpp file
| * | nvflinger: Use jthread and stop_token for VSync threadameerj2021-10-032-32/+8
| | | | | | | | | | | | Avoids a destruction data race that may occur on the vsync thread
| * | nvhost_ctrl: Refactor usage of gpu.LockSync()ameerj2021-10-031-15/+15
| | | | | | | | | | | | This seems to only be used to protect a later gpu function call. So we can move the lock into that call instead.
| * | gpu: Migrate implementation to the cpp fileameerj2021-10-032-5/+13
| | |
* | | Merge pull request #7115 from ameerj/log-compilebunnei2021-10-053-0/+4
|\ \ \ | | | | | | | | common/logging: Reduce dependent header include overhead
| * | | common/logging: Reduce scope of fmt includeameerj2021-10-022-0/+3
| | | |
| * | | common/logging: Move Log::Entry declaration to a separate headerameerj2021-10-021-0/+1
| |/ / | | | | | | | | | This reduces the load of requiring to include std::chrono in all files which include log.h
* | | Merge pull request #7103 from Morph1984/service-ctx-eventbunnei2021-10-0526-271/+367
|\ \ \ | | | | | | | | service: Replace all service event creation with ServiceContext::CreateEvent
| * | | service: Replace service event creation with ServiceContext::CreateEventMorph2021-10-0226-271/+367
| | | | | | | | | | | | | | | | The service context helps to manage all created events and allows us to close them upon destruction.
* | | | service: am: Make use of Exit to exit the currently running applicationMorph2021-10-021-2/+2
|/ / / | | | | | | | | | This also moves the call to the end to ensure services are properly destructed on exit.
* | | Merge pull request #7102 from Morph1984/remove-boxcatbunnei2021-10-023-619/+0
|\ \ \ | |/ / |/| | Remove Boxcat BCAT backend
| * | service: bcat: Remove BoxCat BCAT implementationMorph2021-09-293-619/+0
| | | | | | | | | | | | | | | The current implementation of BoxCat as it stands is non-functional due to the reliance on a server providing BCAT files. This implementation will eventually be replaced with one that allows the use of local BCAT files dumped from a Nintendo Switch.
* | | style: Remove extra space preceding the :: operatorMorph2021-09-294-5/+5
|/ /
* | Merge pull request #7018 from lat9nq/splat-stubsMorph2021-09-292-26/+67
|\ \ | | | | | | audin_u: stub Start, RegisterBufferEvent, AppendAudioInBufferAuto
| * | audin_u: Return a buffer event in RegisterBufferEventlat9nq2021-09-152-2/+12
| | | | | | | | | | | | Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com>
| * | audin_u: stub Start, RegisterBufferEvent, AppendAudioInBufferAutolat9nq2021-09-152-26/+57
| | | | | | | | | | | | | | | | | | This also moves IAudioIn's definition to the header. Required for Splatoon 2 LAN play.
* | | service/es: Update to 13.0.0german772021-09-271-0/+6
| | |
* | | service/npns: Update to 13.0.0german772021-09-271-0/+1
| | |
* | | service/vi: Update to 13.0.0german772021-09-272-0/+2
| | |
* | | service/am: Update to 13.0.0german772021-09-271-0/+4
| | |
* | | service/audio: Update to 13.0.0german772021-09-272-1/+10
| | |
* | | service/hid: Update to 13.0.0german772021-09-272-0/+10
| | |
* | | service/btdrv: Update to 13.0.0german772021-09-271-0/+4
| | |
* | | service/usb: Update to 13.0.0german772021-09-271-3/+3
| | |
* | | service: bsd: Stub ReadMorph2021-09-251-6/+5
| | | | | | | | | | | | - Used by Diablo II: Resurrected
* | | service: bsd: Implement ReadMorph2021-09-242-1/+15
| | | | | | | | | | | | - Used by Diablo II: Resurrected
* | | common/uuid: Add validity checking functions to interfaceLioncash2021-09-223-7/+7
| |/ |/| | | | | | | Given we have a function to invalidate, we should also have ones to query the validity. Also makes the code more straightforward to read.
* | Merge pull request #7015 from german77/NotGoodForTerrabunnei2021-09-171-1/+14
|\ \ | | | | | | ngct: Stub Match
| * | ngct: Stub MatchNarr the Reg2021-09-151-1/+14
| |/ | | | | Needed for Cruis'n Blast
* / vfs: Partially implement GetFileTimeStampRawMorph2021-09-143-1/+37
|/ | | | Gets rid of homebrew warnings using this func
* FS: Mark recursive CreateDirectory as inaccurate and temporaryMorph2021-09-121-0/+5
|
* Merge pull request #6975 from ogniK5377/acc-async-ctxMorph2021-09-123-19/+152
|\ | | | | account: EnsureTokenIdCacheAsync
| * Mark is_complete as atomicChloe Marcec2021-09-082-4/+5
| |
| * Addressed issuesChloe Marcec2021-09-083-15/+14
| |
| * address name shadowing with systemChloe Marcec2021-09-061-2/+2
| |
| * account: EnsureTokenIdCacheAsyncChloe Marcec2021-09-063-19/+152
| | | | | | | | Closes #2547, #6946
* | Merge pull request #6974 from ogniK5377/fs-recursive-createdirMorph2021-09-121-8/+13
|\ \ | | | | | | FS: Recursively create directories for CreateDirectory
| * | Addressed issuesChloe2021-09-081-1/+1
| | | | | | | | | Co-authored-by: Mai M. <mathew1800@gmail.com>
| * | FS: Recursively create directories for CreateDirectoryChloe Marcec2021-09-061-8/+13
| | | | | | | | | | | | | | | | | | Originally we only created the parent directory, this caused issues for creating directories which also contained subdirectories, eg `/Folder1/Folder2` This allows the ultimate mod manager homebrew to at least boot
* | | Merge pull request #6992 from german77/brainsMorph2021-09-125-3/+44
|\ \ \ | | | | | | | | hid/am: Stub SetTouchScreenConfiguration and implement GetNotificationStorageChannelEvent
| * | | am: Implement GetNotificationStorageChannelEventgerman772021-09-102-2/+16
| | | |
| * | | hid: Stub SetTouchScreenConfigurationgerman772021-09-103-1/+28
| | | |
* | | | Merge pull request #6981 from ameerj/nvflinger-hb-formatFernando S2021-09-113-7/+8
|\ \ \ \ | |/ / / |/| | | nvflinger: Use external surface format for framebuffer creation
| * | | nvflinger: Use external surface format for framebuffer creationameerj2021-09-073-7/+8
| | |/ | |/| | | | | | | | | | | | | The format member the IGBPBuffer may not always specify the correct desired format. Using the external format member ensures a valid format is provided when creating the framebuffer. Fixes homebrew using the wrong framebuffer format.
* / | core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-09-053-14/+24
|/ /
* / core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-09-044-16/+30
|/
* Merge pull request #6905 from Morph1984/nifm-miscbunnei2021-08-291-55/+58
|\ | | | | nifm/network_interface: Cleanup and populate fields in GetCurrentNetworkProfile
| * service: nifm: Populate fields in GetCurrentNetworkProfileMorph2021-08-271-29/+37
| | | | | | | | Populates the current_address, subnet_mask, and gateway fields from the selected network interface.
| * service: nifm: Cleanup GetCurrentIpConfigInfoMorph2021-08-271-26/+21
| |
* | ngct: Stub NGCT:U servicegerman772021-08-273-0/+68
|/
* Revert "kernel: Various improvements to scheduler"bunnei2021-08-266-54/+30
|
* applet_error: Fix 64-bit error code conversionMorph2021-08-191-6/+25
|
* Fix crash in logging in CreateStrayLayerValeri2021-08-191-1/+1
| | | It was trying to log value of layer_id which is specifically known not to exist, potentially leading to segfault. Log display_id instead.
* Merge pull request #6832 from bunnei/scheduler-improvementsbunnei2021-08-196-30/+54
|\ | | | | kernel: Various improvements to scheduler
| * core: hle: service: buffer_queue: Improve management of KEvent.bunnei2021-08-073-14/+24
| |
| * core: hle: service: nvflinger/vi: Improve management of KEvent.bunnei2021-08-074-16/+30
| |
* | network: retrieve subnet mask and gateway infoSönke Holz2021-08-161-8/+16
| |
* | nifm: use operator*() instead of .value() to get value of std::optionalSönke Holz2021-08-131-2/+2
| |
* | nifm: treat a missing host IP address as a non-critical errorSönke Holz2021-08-131-2/+2
| |
* | configuration: add option to select network interfacespholz2021-08-121-15/+21
| | | | | | | | This commit renames the "Services" tab to "Network" and adds a combobox that allows the user to select the network interface that yuzu should use. This new setting is now used to get the local IP address in Network::GetHostIPv4Address. This prevents yuzu from selecting the wrong network interface and thus using the wrong IP address. The return type of Network::GetHostIPv4Adress has also been changed.
* | Merge branch 'yuzu-emu:master' into fix-lan-playspholz2021-08-072-99/+4
|\|
| * Merge pull request #6799 from ameerj/vp9-fixesbunnei2021-08-072-99/+4
| |\ | | | | | | nvdec: Fix VP9 reference frame refreshes
| | * nvhost_nvdec_common: Remove BufferMapameerj2021-08-072-76/+0
| | | | | | | | | | | | This was mainly used to keep track of mapped buffers for later unmapping. Since unmap is no longer implemented, this no longer seves a valuable purpose.
| | * nvhost_nvdec_common: Stub UnmapBuffer Ioctlameerj2021-08-071-23/+4
| | | | | | | | | | | | Skip unmapping nvdec buffers to avoid breaking the continuity of the VP9 reference frame addresses, and the risk of invalidating data before the async GPU thread is done with it.
* | | network: GetCurrentIpConfigInfo: return host IP addressSönke Holz2021-08-071-1/+4
|/ / | | | | | | Service::NIFM::IGeneralService::GetCurrentIpConfigInfo currently hardcodes 192.168.1.100 as the IP address, which prevents LAN play from working correctly.
* | applet_swkbd: Include the null terminator in the buffer size calculationMorph2021-08-051-2/+4
| | | | | | | | Some games may interpret the read string as a null-terminated string instead of just reading the string up to buffer_size.
* | service: set: Correct copy amount in GetAvailableLanguageCodesMorph2021-08-011-1/+2
|/
* Merge pull request #6752 from Morph1984/pt-brbunnei2021-07-303-10/+14
|\ | | | | service: ns, set: Add PT_BR (Brazilian Portuguese)
| * service: set: Correct 4.0.0 max_entries to 0x40 (64) instead of 17Morph2021-07-301-8/+8
| |
| * service: ns, set: Add PT_BR (Brazilian Portuguese)Morph2021-07-303-2/+6
| |
* | applet_swkbd: Correct string buffer size calculationMorph2021-07-301-2/+2
|/ | | | The buffer size here does not include the initial 8 bytes.
* Merge pull request #6751 from Morph1984/languagecodeAmeer J2021-07-292-42/+2
|\ | | | | service: ns: Map ZH_TW and ZH_CN to Traditional/Simplified Chinese
| * service: ns: Remove unused ns_language headerMorph2021-07-271-42/+0
| |
| * service: ns: Map ZH_TW and ZH_CN to Traditional/Simplified ChineseMorph2021-07-271-0/+2
| |
* | Merge pull request #6742 from Morph1984/uuidbunnei2021-07-292-14/+14
|\ \ | |/ |/| common: uuid: Return a lower-case hex string in Format
| * common: uuid: Return a lower-case hex string in FormatMorph2021-07-272-14/+14
| |
* | Merge pull request #6696 from ameerj/speed-limit-renamebunnei2021-07-271-1/+1
|\ \ | | | | | | general: Rename "Frame Limit" references to "Speed Limit"
| * | general: Rename "Frame Limit" references to "Speed Limit"ameerj2021-07-241-1/+1
| | | | | | | | | | | | | | | This setting is best referred to as a speed limit, as it involves the limits of all timing based aspects of the emulator, not only framerate. This allows us to differentiate it from the fps unlocker setting.
* | | Merge pull request #6697 from ameerj/fps-capbunnei2021-07-261-5/+6
|\ \ \ | |_|/ |/| | config, nvflinger: Add FPS cap setting
| * | config, nvflinger: Add FPS cap settingameerj2021-07-241-5/+6
| |/ | | | | | | Allows finer tuning of the FPS limit.
* | Merge pull request #6551 from bunnei/improve-kernel-objbunnei2021-07-2412-67/+189
|\ \ | |/ |/| Improve management of kernel objects
| * hle: service: kernel_helpers: Remove unnecessary pragma once.bunnei2021-07-211-2/+0
| |
| * hle: service: nvdrv: Remove unused kernel reference.bunnei2021-07-211-1/+0
| |
| * hle: service: hid: npad: Remove unused kernel reference.bunnei2021-07-211-1/+0
| |
| * hle: service: sm: Refactor to better manage ports.bunnei2021-07-214-45/+47
| |
| * hle: service: Add a helper module for managing kernel objects.bunnei2021-07-219-20/+144
| |
* | applet_controller: Add preliminary support for version 8Morph2021-07-202-3/+33
|/ | | | Version 8 adds support for key remapping introduced in FW 11.0, we will not be implementing this for now.
* Merge pull request #6525 from ameerj/nvdec-fixesFernando S2021-07-151-45/+40
|\ | | | | nvdec: Fix Submit Ioctl data source, vic frame dimension computations
| * nvhost_nvdec_common: Read Submit ioctl data from object addrameerj2021-07-151-8/+2
| | | | | | | | Fixes Mario Golf intro video decoding.
| * nvhost_nvdec_common: Fix {Slice/Write}Vectors returnameerj2021-07-151-37/+38
| | | | | | | | Plus some minor cleanup for consistency.
* | applets/web: Resolve Nintendo CDN URLsMorph2021-07-151-0/+13
| | | | | | | | This fixes the hint videos in New Super Mario Bros. U Deluxe
* | service: Append service name prefix to common filenamesMorph2021-07-1438-31/+31
| |
* | applets: Append applet_ prefix to backend appletsMorph2021-07-1416-17/+17
| |
* | Merge pull request #6599 from german77/disable_rumbleAmeer J2021-07-131-0/+5
|\ \ | | | | | | npad: Disable vibration check if disabled
| * | npad: Disable vibration check if disabledgerman772021-07-111-0/+5
| | |
* | | boxcat: Silence -Wmaybe-uninitialized in httplib.hReinUsesLisp2021-07-121-0/+3
|/ /
* | Merge pull request #6539 from lat9nq/default-settingAmeer J2021-07-085-7/+8
|\ \ | | | | | | general: Move most settings' defaults and labels into their definition
| * | core, input_common: Miscellaneous fixeslat9nq2021-06-291-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | bcat: Fix settings access telemetry_session: Fix settings accesses So this is what I get for testing with the web service disabled. touch_from_button: Fix settings access for clang
| * | general: Make most settings a BasicSettinglat9nq2021-06-284-6/+7
| |/ | | | | | | | | | | | | | | | | | | | | Creates a new BasicSettings class in common/settings, and forces setting a default and label for each setting that uses it in common/settings. Moves defaults and labels from both frontends into common settings. Creates a helper function in each frontend to facillitate reading the settings now with the new default and label properties. Settings::Setting is also now a subclass of Settings::BasicSetting. Also adds documentation for both Setting and BasicSetting.
* | Report 2 channels active. Fixes Tales of Vesperia's mono channel audio.Kelebek12021-07-061-1/+1
| |
* | service: mii: Retrieve the correct default miis.Morph2021-07-041-2/+3
| | | | | | | | We were including the first 2 default miis which are not meant to be shown in games. With this change, we properly retrieve the 6 default miis shown in games, with 3 of each gender.
* | Merge pull request #6498 from Kelebek1/Audiobunnei2021-07-031-5/+7
|\ \ | | | | | | [audio_core] Decouple audio update and processing, and process at variable rate
| * | Fix XC2/VOEZ crashing, add audio looping and a few misc fixesKelebek12021-07-011-1/+1
| | |
| * | Decouple audio processing and run at variable rateKelebek12021-06-271-4/+6
| | | | | | | | | | | | | | | | | | Currently, processing of audio samples is called from AudioRenderer's Update method, using a fixed 4 buffers to process the given samples. Games call Update at variable rates, depending on framerate and/or sample count, which causes inconsistency in audio processing. From what I've seen, 60 FPS games update every ~0.004s, but 30 FPS/160 sample games update somewhere between 0.02 and 0.04, 5-10x slower. Not enough samples get fed to the backend, leading to a lot of audio skipping. This PR seeks to address this by de-coupling the audio consumption and the audio update. Update remains the same without calling for buffer queuing, and the consume now schedules itself to run based on the sample rate and count.
* | | filesystem: Open a read-only directory for SDMC modsMorph2021-06-281-5/+9
| | | | | | | | | | | | This prevents mod files from being locked due to the read-only share flag in Windows.
* | | core: Simplify SDMC mod loadinglat9nq2021-06-281-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If someone else wants to support other mod formats in the SDMC directory, that can be added later. For now, just allow RomFS modding here and force people to do other types of mods the old way. Addresses review comments. Co-authored-by: LC <mathew1800@gmail.com>
* | | core: Support LayeredFS mod from SDMC directorylat9nq2021-06-282-0/+10
|/ / | | | | | | | | | | Enables loading a mod directly from `[yuzu data directory]/sdmc/atmosphere/contents/[title_id]`. For use with some homebrew mod managers.
* | hle: service: hwopus: OpenHardwareOpusDecoderEx: Remove unused buffer size.bunnei2021-06-261-1/+30
| |
* | hle: service: hwopus: Implement GetWorkBufferSizeEx and OpenHardwareOpusDecoderEx.bunnei2021-06-252-5/+15
| | | | | | | | - This is used by the latest update of Doom Eternal.
* | hle: service: aoc: Stub GetAddOnContentListChangedEventWithProcessId.bunnei2021-06-252-1/+10
|/ | | | - This is used by the latest update of Doom Eternal.
* Merge pull request #6522 from Morph1984/pragmabunnei2021-06-242-0/+4
|\ | | | | general: Add missing #pragma once directives
| * general: Add missing #pragma once directivesMorph2021-06-242-0/+4
| |
* | Add missing includes (#6521)Chloe2021-06-241-0/+2
|/ | | | | * Add missing includes * Add array
* Merge pull request #6517 from lioncash/fmtlibbunnei2021-06-241-3/+3
|\ | | | | externals: Update fmt to 8.0.0
| * General: Resolve fmt specifiers to adhere to 8.0.0 API where applicableLioncash2021-06-231-3/+3
| | | | | | | | Also removes some deprecated API usages.
* | Merge pull request #6504 from Kelebek1/samples-playedbunnei2021-06-231-1/+9
|\ \ | |/ |/| [audout] Implement GetAudioOutPlayedSampleCount
| * Implement audout GetAudioOutPlayedSampleCountKelebek12021-06-221-1/+9
| | | | | | | | Used in Ninja Gaiden games.
* | Merge pull request #6510 from ReinUsesLisp/npad-data-raceMai M2021-06-232-0/+8
|\ \ | | | | | | npad: Fix data race when updating devices
| * | npad: Fix data race when updating devicesRodrigo Locatti2021-06-222-0/+8
| | | | | | | | | | | | | | | Add a lock to avoid data races. This reduces the number of -fsanitize=thread errors significantly.
* | | Merge pull request #6493 from Morph1984/fs-nodiscardbunnei2021-06-231-2/+2
|\ \ \ | | | | | | | | common: fs: Miscellaneous changes
| * | | common: fs: Remove [[nodiscard]] attribute on Remove* functionsMorph2021-06-221-2/+2
| |/ / | | | | | | | | | | | | | | | There are a lot of scenarios where we don't particularly care whether or not the removal operation and just simply attempt a removal. As such, removing the [[nodiscard]] attribute is best for these functions.
* | | Merge pull request #6472 from Morph1984/splbunnei2021-06-236-45/+437
|\ \ \ | | | | | | | | service: spl: Implement general SPL service
| * | | spl: Mark the other functions as unimplementedMorph2021-06-161-5/+30
| | | |
| * | | spl: Implement spl::GetConfigMorph2021-06-162-1/+90
| | | |
| * | | spl: Add the general SPL interfaceMorph2021-06-164-45/+64
| | | |
| * | | spl: Add SPL typesMorph2021-06-161-0/+230
| | | |
| * | | spl: Add SPL result codesMorph2021-06-161-0/+29
| | | |
* | | | Merge pull request #6483 from Morph1984/get-tz-filebunnei2021-06-221-1/+1
|\ \ \ \ | |_|/ / |/| | | service: time: Use GetFileRelative to get files within subdirectories
| * | | service: time: Use GetFileRelative to get files within subdirectoriesMorph2021-06-181-1/+1
| | |/ | |/| | | | | | | The timezone info file can be within subdirectories (such as Asia/Tokyo), use GetFileRelative instead of GetFile to get files within subdirectories.
* / | nvflinger: Add toggle to disable buffer swap interval limitsameerj2021-06-171-0/+3
|/ / | | | | | | | | Enabling this setting will allow some titles to present more frames to the screen as they become available in the nvflinger buffer queue.
* / fsp_srv: Fix filesystem access loggingMorph2021-06-162-12/+15
|/ | | | | | | | This introduces a new setting Enable FS Access Log which saves the filesystem access log to sdmc:/FsAccessLog.txt If this setting is not enabled, this will indicate to FS to not call OutputAccessLogToSdCard. Fixes softlocks during loading in Xenoblade Chronicles 2 when certain DLC is enabled.
* lm: Demote guest logs to LOG_DEBUGameerj2021-06-151-27/+20
| | | | Guest logs are not very useful, as they are intended for use by the game developers during development. As such, they provide little meaning to be logged by yuzu and tend to overwhelm the log output at times.
* general: Remove extraneous includesMorph2021-06-131-1/+0
|
* hid: Stub IsFirmwareUpdateAvailableForSixAxisSensorgerman772021-06-112-1/+23
|
* hle: service: sm: Remove redundant session reservation, etc.bunnei2021-06-102-18/+13
| | | | - We were double-reserving, causing us to run out of sessions in Pokemon Sword & Shield.
* hle: service: Increase arbitrary max sessions limit.bunnei2021-06-101-4/+1
| | | - Pokemon Sword/Shield are still hitting this for some reason, causing an svcBreak.
* hle: service: sm: Fix GetService setup of session & port.bunnei2021-06-101-4/+4
|
* hle: service: Use correct size for ServerSessionCountMax.bunnei2021-06-101-4/+6
|
* hle: kernel: KServerSession: Fix client disconnected.bunnei2021-06-101-1/+1
| | | | | - Prevents a cloned session's handler from being overwritten by another disconnected session. - Fixes session handler nullptr asserts with Pokemon Sword & Shield.
* hle: service: Increase arbitrary max sessions limit.bunnei2021-06-091-1/+1
| | | - Pokemon Sword/Shield are still hitting this for some reason, causing an svcBreak.
* hle: kernel: Refactor to allocate a ServiceThread per service handler.bunnei2021-06-055-35/+17
| | | | | | - Previously, we would allocate a thread per session, which adds new threads on CloneCurrentObject. - This results in race conditions with N sessions queuing requests to the same service interface. - Fixes Pokken Tournament DX crashes/softlocks, which were regressed by #6347.
* fsp-srv: Replace one last instance of RESULT_SUCCESSMorph2021-06-031-1/+1
|
* fspsrv: Implement DisableAutoSaveDataCreation (#6355)Chloe2021-06-034-1/+17
| | | - Used by Mii Edit
* general: Replace RESULT_UNKNOWN with ResultUnknownMorph2021-06-029-36/+36
| | | | Transition to PascalCase for result names.
* general: Replace RESULT_SUCCESS with ResultSuccessMorph2021-06-0285-766/+764
| | | | Transition to PascalCase for result names.
* Merge pull request #6377 from lioncash/pointbunnei2021-05-303-39/+17
|\ | | | | common: Extract Point struct into common
| * touchscreen: Make use of common point structLioncash2021-05-282-10/+10
| |
| * common: Extract point into a common structLioncash2021-05-281-29/+7
| | | | | | | | | | This is generic enough that it can be moved into the Common class for reuse.
* | Merge pull request #6374 from Morph1984/swkbd-textcheck-encodingMai M2021-05-301-10/+15
|\ \ | | | | | | applets/swkbd: Only read the text check message on Failure/Confirm
| * | applets/swkbd: Make use of std::move where applicableMorph2021-05-281-8/+8
| | | | | | | | | | | | Avoids redundant string copies
| * | applets/swkbd: Only read the text check message on Failure/ConfirmMorph2021-05-281-2/+7
| |/ | | | | | | | | | | Applications may leave this region of memory uninitialized when the text check result is not either Failure or Confirm. Attempting to read uninitialized memory may cause an exception within the UTF16 to UTF8 string converter. Fix this by only reading the text check message on Failure or Confirm.
* | Merge pull request #6364 from german77/stub-lp2pMai M2021-05-301-0/+141
|\ \ | | | | | | | | | | | | | | | | | | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkService Mario Kart Live: Home Circuit needs lp2p:sys lp2p:app INetworkServiceMonitor INetworkService to be able to progress. Note: The game still fails to boot from unimplemented LDN and BSD services.
| * | ldn: Add and stub lp2p:sys lp2p:app INetworkServiceMonitor INetworkServicegerman772021-05-261-0/+141
| |/
* | Merge pull request #6356 from ogniK5377/ApplyNpadSystemCommonPolicybunnei2021-05-281-1/+10
|\ \ | |/ |/| hid: ApplyNpadSystemCommonPolicy
| * hid: ApplyNpadSystemCommonPolicyChloe Marcec2021-05-241-1/+10
| | | | | | | | We already do this specifically for homebrew, so we can keep it stubbed out for the time being
* | Merge pull request #6331 from lioncash/gestureMorph2021-05-262-67/+79
|\ \ | | | | | | hid/gesture: Simplify point related code
| * | hid/gesture: Factor out last gesture retrieval into its own functionLioncash2021-05-182-14/+23
| | | | | | | | | | | | Deduplicates a commonly repeated expression.
| * | hid/gesture: Ensure all ID arrays are initializedLioncash2021-05-181-4/+4
| | | | | | | | | | | | Makes for deterministic initial state.
| * | hid/gesture: Make Point a templateLioncash2021-05-182-38/+46
| | | | | | | | | | | | | | | We can now use this in a generic context to reuse it with the finger position.
| * | hid/gesture: Replace x,y members of GestureState with a PointLioncash2021-05-182-6/+4
| | | | | | | | | | | | Simplifies assignments.
| * | hid/gesture: Add default comparators to PointLioncash2021-05-182-10/+7
| | | | | | | | | | | | Simplifies some comparisons.
| * | hid/gesture: Rename Points to PointLioncash2021-05-181-5/+5
| | | | | | | | | | | | This only represents a single point
* | | common: fs: Rework the Common Filesystem interface to make use of std::filesystem (#6270)Morph2021-05-269-95/+111
| |/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * common: fs: fs_types: Create filesystem types Contains various filesystem types used by the Common::FS library * common: fs: fs_util: Add std::string to std::u8string conversion utility * common: fs: path_util: Add utlity functions for paths Contains various utility functions for getting or manipulating filesystem paths used by the Common::FS library * common: fs: file: Rewrite the IOFile implementation * common: fs: Reimplement Common::FS library using std::filesystem * common: fs: fs_paths: Add fs_paths to replace common_paths * common: fs: path_util: Add the rest of the path functions * common: Remove the previous Common::FS implementation * general: Remove unused fs includes * string_util: Remove unused function and include * nvidia_flags: Migrate to the new Common::FS library * settings: Migrate to the new Common::FS library * logging: backend: Migrate to the new Common::FS library * core: Migrate to the new Common::FS library * perf_stats: Migrate to the new Common::FS library * reporter: Migrate to the new Common::FS library * telemetry_session: Migrate to the new Common::FS library * key_manager: Migrate to the new Common::FS library * bis_factory: Migrate to the new Common::FS library * registered_cache: Migrate to the new Common::FS library * xts_archive: Migrate to the new Common::FS library * service: acc: Migrate to the new Common::FS library * applets/profile: Migrate to the new Common::FS library * applets/web: Migrate to the new Common::FS library * service: filesystem: Migrate to the new Common::FS library * loader: Migrate to the new Common::FS library * gl_shader_disk_cache: Migrate to the new Common::FS library * nsight_aftermath_tracker: Migrate to the new Common::FS library * vulkan_library: Migrate to the new Common::FS library * configure_debug: Migrate to the new Common::FS library * game_list_worker: Migrate to the new Common::FS library * config: Migrate to the new Common::FS library * configure_filesystem: Migrate to the new Common::FS library * configure_per_game_addons: Migrate to the new Common::FS library * configure_profile_manager: Migrate to the new Common::FS library * configure_ui: Migrate to the new Common::FS library * input_profiles: Migrate to the new Common::FS library * yuzu_cmd: config: Migrate to the new Common::FS library * yuzu_cmd: Migrate to the new Common::FS library * vfs_real: Migrate to the new Common::FS library * vfs: Migrate to the new Common::FS library * vfs_libzip: Migrate to the new Common::FS library * service: bcat: Migrate to the new Common::FS library * yuzu: main: Migrate to the new Common::FS library * vfs_real: Delete the contents of an existing file in CreateFile Current usages of CreateFile expect to delete the contents of an existing file, retain this behavior for now. * input_profiles: Don't iterate the input profile dir if it does not exist Silences an error produced in the log if the directory does not exist. * game_list_worker: Skip parsing file if the returned VfsFile is nullptr Prevents crashes in GetLoader when the virtual file is nullptr * common: fs: Validate paths for path length * service: filesystem: Open the mod load directory as read only
* | hle: kernel: Implement CloneCurrentObject and improve session management.bunnei2021-05-214-16/+41
| |
* | Revert "WORKAROUND: temp. disable session resource limits while we work out issues"bunnei2021-05-211-4/+4
| | | | | | | | This reverts commit fc086f93b2165b5c210cb7dcd6c18ebe17f1fd7b.
* | Merge pull request #6317 from ameerj/fps-fixbunnei2021-05-191-1/+0
|\ \ | |/ |/| perf_stats: Rework FPS counter to be more accurate
| * perf_stats: Rework FPS counter to be more accurateameerj2021-05-161-1/+0
| | | | | | | | | | | | | | | | | | The FPS counter was based on metrics in the nvdisp swapbuffers call. This metric would be accurate if the gpu thread/renderer were synchronous with the nvdisp service, but that's no longer the case. This commit moves the frame counting responsibility onto the concrete renderers after their frame draw calls. Resulting in more meaningful metrics. The displayed FPS is now made up of the average framerate between the previous and most recent update, in order to avoid distracting FPS counter updates when framerate is oscillating between close values. The status bar update frequency was also changed from 2 seconds to 500ms.
* | Merge pull request #6284 from ameerj/shantae-fixbunnei2021-05-162-5/+35
|\ \ | | | | | | nvflinger: Create layers when they are queried but not found
| * | nvflinger: Create layers when they are queried but not foundameerj2021-05-062-5/+35
| | | | | | | | | | | | Fixes Shantae softlock on boot.
* | | Merge pull request #6296 from lioncash/shadow-errorbunnei2021-05-1645-152/+169
|\ \ \ | | | | | | | | core: Make variable shadowing a compile-time error
| * | | core: Make variable shadowing a compile-time errorLioncash2021-05-1645-152/+169
| | | | | | | | | | | | | | | | | | | | | | | | Now that we have most of core free of shadowing, we can enable the warning as an error to catch anything that may be remaining and also eliminate this class of logic bug entirely.
* | | | Merge pull request #6307 from Morph1984/fix-response-push-sizebunnei2021-05-162-2/+2
|\ \ \ \ | |/ / / |/| | | nifm, ssl: Fix incorrect response sizes
| * | | nifm, ssl: Fix incorrect response sizesMorph2021-05-162-2/+2
| | |/ | |/|
* | | Merge pull request #6299 from bunnei/ipc-improvementsbunnei2021-05-167-85/+177
|\ \ \ | |/ / |/| | Various improvements to IPC and session management
| * | WORKAROUND: temp. disable session resource limits while we work out issuesbunnei2021-05-111-4/+4
| | |
| * | audrenbunnei2021-05-112-25/+16
| | |
| * | hle: service: sm: Add TIPC support.bunnei2021-05-112-41/+66
| | | | | | | | | | | | - Fixes our error checking of names as well.
| * | hle: service: sm: GetService: Reserve session resource when we create a KSession.bunnei2021-05-111-0/+7
| | |
| * | hle: service: Add support for dispatching TIPC requests.bunnei2021-05-112-1/+52
| | |
| * | hle: service: Implement IPC::CommandType::Close.bunnei2021-05-112-9/+13
| | | | | | | | | | | | - This was not actually closing sessions before.
| * | hle: service: sm: Use RegisterNamedService to register the service.bunnei2021-05-111-1/+1
| | |
| * | hle: service: sm: Improve Initialize implementation.bunnei2021-05-112-0/+3
| | |
| * | hle: kernel: Implement named service ports using service interface factory.bunnei2021-05-112-5/+8
| | | | | | | | | | | | - This allows us to create a new interface each time ConnectToNamedPort is called, removing the assumption that these are static.
| * | hle: kernel: KSession: Improve implementation of CloneCurrentObject.bunnei2021-05-111-2/+10
| | |
| * | hle: service: sm: Increase point buffer size.bunnei2021-05-111-1/+1
| | |
* | | ssl: Stub Import(Client/Server)PkiMorph2021-05-131-2/+40
| | | | | | | | | | | | - Used in JUMP FORCE Deluxe Edition
* | | Merge pull request #6267 from german77/gestureRewriteMorph2021-05-122-76/+340
|\ \ \ | |/ / |/| | hid: Improve hardware accuracy of gestures
| * | hid: Improve hardware accuracy of gesturesgerman772021-05-052-76/+340
| | |
* | | Merge pull request #6266 from bunnei/kautoobject-refactorbunnei2021-05-0861-462/+426
|\ \ \ | | | | | | | | Kernel Rework: Migrate kernel objects to KAutoObject
| * | | fixup! hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-061-2/+2
| | | |
| * | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| | | |
| * | | fixup! hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-061-2/+0
| | | |
| * | | common: Rename NON_COPYABLE/NON_MOVABLE with YUZU_ prefix.bunnei2021-05-061-2/+2
| | | |
| * | | hle: kernel: Rename Process to KProcess.bunnei2021-05-0616-25/+26
| | | |
| * | | hle: kernel: Remove deprecated Object class.bunnei2021-05-068-8/+2
| | | |
| * | | hle: kernel: Migrate KPort, KClientPort, and KServerPort to KAutoObject.bunnei2021-05-063-26/+27
| | | |
| * | | hle: kernel: Migrate KServerPort to KAutoObject.bunnei2021-05-063-13/+12
| | | |
| * | | hle: kernel: Migrate KClientPort to KAutoObject.bunnei2021-05-066-12/+16
| | | |
| * | | hle: kernel: Migrate KTransferMemory to KAutoObject.bunnei2021-05-063-13/+15
| | | |
| * | | hle: kernel: Migrate KSession, KClientSession, and KServerSession to KAutoObject.bunnei2021-05-068-28/+16
| | | |
| * | | hle: kernel: Migrate KReadableEvent and KWritableEvent to KAutoObject.bunnei2021-05-0626-93/+86
| | | |
| * | | hle: kernel: Refactor several threads/events/sharedmemory to use slab heaps.bunnei2021-05-064-7/+11
| | | |
| * | | hle: kernel: Ensure all kernel objects with KAutoObject are properly created.bunnei2021-05-0618-0/+47
| | | |
| * | | hle: kernel: Migrate KEvent to KAutoObject.bunnei2021-05-0631-247/+213
| | | |
| * | | hle: kernel: Migrate KSharedMemory to KAutoObject.bunnei2021-05-067-42/+12
| | | |
| * | | hle: kernel: Migrate KProcess to KAutoObject.bunnei2021-05-061-7/+5
| | | |
| * | | hle: kernel: Refactor IPC interfaces to not use std::shared_ptr.bunnei2021-05-0622-32/+33
| | | |
| * | | hle: kernel: Refactor out various KThread std::shared_ptr usage.bunnei2021-05-061-4/+4
| | |/ | |/|
* | | Merge pull request #6287 from lioncash/ldr-copybunnei2021-05-071-5/+3
|\ \ \ | |/ / |/| | ldr: Simplify memory copy within LoadNro()
| * | ldr: Simplify memory copy within LoadNro()Lioncash2021-05-071-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | We can use the dedicated memory function for performing copies instead of reading into a temporary buffer and then immediately writing it back out to memory. Eliminates a bit of heap memory churn.
* | | Merge pull request #6279 from ogniK5377/nvhost-profbunnei2021-05-061-3/+14
|\ \ \ | |/ / |/| | nvdrv: /dev/nvhost-prof-gpu for production
| * | Update src/core/hle/service/nvdrv/interface.cppbunnei2021-05-061-1/+1
| | | | | | | | | Co-authored-by: Ameer J <52414509+ameerj@users.noreply.github.com>
| * | nvdrv: /dev/nvhost-prof-gpu for productionChloe Marcec2021-05-031-3/+14
| | | | | | | | | | | | | | | While we're at it, we can fix the is_initialized error code. This fixes the crashes on Shante
* | | service: Remove unused class variablesLioncash2021-05-053-7/+4
| |/ |/| | | | | Prevents some warnings from occurring.
* | service: Resolve cases of member field shadowingLioncash2021-05-0456-101/+103
|/ | | | | Now all that remains is for kernel code to be 'shadow-free' and then -Wshadow can be turned into an error.
* hid: Fix touch not initializing properly if disabledgerman772021-05-032-2/+10
|
* Merge pull request #6265 from Morph1984/snap-save-fixbunnei2021-05-021-2/+7
|\ | | | | service: filesystem: Return proper error codes for CreateFile
| * service: filesystem: Return proper error codes for CreateFileMorph2021-05-011-2/+7
| | | | | | | | | | | | This improves the accuracy of CreateFile by returning the correct error codes on certain conditions (parent directory does not exist, path already exists). This fixes saving and the loading of existing saves in New Pokemon Snap
* | Disable touch if setting is not enabledgerman772021-05-012-2/+2
|/
* Merge pull request #6226 from german77/sevensixbunnei2021-04-305-12/+194
|\ | | | | hid: Implement SevenSixAxis and ConsoleSixAxisSensor
| * address commentsgerman772021-04-272-5/+5
| |
| * hid: Implement SevenSixAxis and ConsoleSixAxisSensorgerman772021-04-245-12/+194
| |
* | service: Eliminate cases of member shadowingLioncash2021-04-2615-76/+81
| | | | | | | | | | Resolves a few localized instances of member variable shadowing. Brings us a little closer to turning shadowing warnings into errors.
* | nvhost_vic: Fix device closureameerj2021-04-252-10/+8
| | | | | | | | | | | | Implements the OnClose method of the nvhost_vic device, and removes the remnants of an older implementation. Also cleans up some of the surrounding code.
* | Merge pull request #6234 from Morph1984/stub-amMat M2021-04-242-1/+10
|\ \ | | | | | | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabled
| * | ICommonStateGetter: Stub SetRequestExitToLibraryAppletAtExecuteNextProgramEnabledMorph2021-04-242-1/+10
| | | | | | | | | | | | - Used by Pixel Game Maker Series Werewolf Princess Kaguya
* | | Merge pull request #6235 from german77/ectx_awMat M2021-04-243-0/+47
|\ \ \ | | | | | | | | glue: Add ectx:aw service placeholder
| * | | glue: Add ectx:aw placeholdergerman772021-04-243-0/+47
| | |/ | |/|
* | | Merge pull request #6228 from lioncash/semibunnei2021-04-241-6/+7
|\ \ \ | |_|/ |/| | lm: Resolve -Wextra-semi warning
| * | lm: Make use of insert_or_assign() in Log()Lioncash2021-04-231-1/+1
| | | | | | | | | | | | | | | Avoids unnecessary default construction of an entry in cases where no entry exists before overwriting the created entry.
| * | lm: Prevent redundant map lookups in Log()Lioncash2021-04-231-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | We can perform the lookup and then do the contains check by checking the end iterator. The benefit of this is that if we *do* find an entry, then we aren't hashing into the map again to find it. We can also get rid of an unused std::vector temporary while we're at it.
| * | lm: Resolve -Wextra-semi warningLioncash2021-04-231-1/+1
| | | | | | | | | | | | Resolves a trivial warning with clang.
* | | Merge pull request #6229 from lioncash/unused-varbunnei2021-04-242-6/+0
|\ \ \ | |_|/ |/| | acc/lbl: Remove unused variables
| * | acc/lbl: Remove unused variablesLioncash2021-04-232-6/+0
| |/
* / service: hid: Get transfer memory for InitializeSevenSixAxisSensorMorph2021-04-221-1/+38
|/
* Merge pull request #6214 from Morph1984/time-fix-kirby-clashbunnei2021-04-211-3/+5
|\ | | | | time: Fix GetClockSnapshotFromSystemClockContext
| * time: Write buffer before pushing RESULT_SUCCESS in GetClockSnapshotMorph2021-04-191-1/+2
| |
| * time: Fix GetClockSnapshotFromSystemClockContextMorph2021-04-191-2/+3
| | | | | | | | | | | | This removes an incorrect alignment usage and corrects the positions of the popped parameters. - Fixes Super Kirby Clash crashing on boot
* | Merge pull request #6217 from Morph1984/consistent-writebuffersbunnei2021-04-203-5/+12
|\ \ | | | | | | general: Write buffers before pushing raw arguments
| * | general: Write buffers before pushing raw argumentsMorph2021-04-193-5/+12
| |/ | | | | | | For consistency with the rest of the service implementations
* | Merge pull request #6215 from lioncash/duplicatebunnei2021-04-202-2/+1
|\ \ | | | | | | npad: Remove duplicated class member variable
| * | npad: Remove duplicated class member variableLioncash2021-04-192-2/+1
| |/ | | | | | | | | | | ControllerBase already has a System reference that can be accessed from this class, so we can get rid of this to make the class layout a little more straightforward.
* | arp: Use type alias for issue functionLioncash2021-04-191-4/+4
| | | | | | | | Reduces some verbosity and centralizes the function details in one spot.
* | arp: Prevent uninitialized read of launch member variableLioncash2021-04-191-1/+1
|/ | | | | | | | | If anything happened to call arp functions in the wrong order and called IRegistrar's Issue function before SetApplicationLaunchProperty, we'd read from an uninitialized ApplicationLaunchProperty instance. Instead, we can always initialize it so if this does happen, then the outcome of doing such a thing is at least consistently reproducible.
* applets: Send focus state change message on applet state changeMorph2021-04-1710-22/+56
| | | | Fixes the softlock after the controller applet exits in Mario Kart 8 Deluxe.
* applets: Make the applet mode a protected property of AppletMorph2021-04-1714-22/+20
|
* Merge pull request #6125 from ogniK5377/nvdec-close-devbunnei2021-04-171-6/+4
|\ | | | | nvdrv: Cleanup CDMA Processor on device closure
| * nvdrv: Cleanup CDMA Processor on device closureChloe Marcec2021-03-301-6/+4
| | | | | | | | Brings us a step closer to unifying all channels to share a common interface.
* | applets/swkbd: Implement the Normal and Inline Software Keyboard AppletMorph2021-04-153-13/+1487
| |
* | ILibraryAppletCreator: Implement CreateHandleStorageMorph2021-04-152-6/+64
| | | | | | | | Used by Monster Hunter Generations Ultimate
* | ILibraryAppletAccessor: Demote from ERROR to DEBUG for null storage logsMorph2021-04-151-2/+2
| | | | | | | | Avoids unnecessary console spam when the inline software keyboard is used.
* | applets: Pass in the LibraryAppletMode each applet's constructorMorph2021-04-1513-33/+58
| |
* | applets: Remove the previous software keyboard applet implementationMorph2021-04-152-227/+6
| |
* | common: Move settings to common from core.bunnei2021-04-1527-27/+27
| | | | | | | | - Removes a dependency on core and input_common from common.
* | Merge pull request #6170 from Morph1984/more-time-fixesbunnei2021-04-116-21/+38
|\ \ | | | | | | service: time: Setup the network clock with the local clock context
| * | service: time: Setup the network clock with the local clock contextMorph2021-04-086-21/+38
| | | | | | | | | | | | Setting the network time allows some time based events using the network clock to not reset.
* | | Merge pull request #6167 from Morph1984/time-fixbunnei2021-04-111-3/+8
|\ \ \ | | | | | | | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUser
| * | | service: time: Fix CalculateStandardUserSystemClockDifferenceByUserMorph2021-04-081-3/+8
| | | | | | | | | | | | | | | | CalculateStandardUserSystemClockDifferenceByUser passes in the ClockSnapshots through 2 input buffers and not as raw arguments. Fix this by reading the 2 input buffers instead of popping raw arguments.
* | | | Merge pull request #6112 from ogniK5377/pctlbunnei2021-04-114-31/+244
|\ \ \ \ | | | | | | | | | | pctl: Rework how pctl works to be more accurate
| * | | | Addressed issuesChloe Marcec2021-03-302-21/+22
| | | | |
| * | | | pctl: Rework how pctl works to be more accurateChloe Marcec2021-03-264-31/+243
| | | | | | | | | | | | | | | | | | | | Introduces the usage of compatibilities to allow it the module to be closer to how it works on hardware.
* | | | | Merge pull request #6171 from german77/servicesbunnei2021-04-1030-97/+137
|\ \ \ \ \ | | | | | | | | | | | | service: Update service function tables and use proper names
| * | | | | wlan: Update to 12.xgerman772021-04-091-0/+7
| | | | | |
| * | | | | usb: Use proper namesgerman772021-04-091-21/+21
| | | | | |
| * | | | | ITimeZoneService: Update to 12.xgerman772021-04-091-0/+1
| | | | | |
| * | | | | spl: Update to 12.xgerman772021-04-091-0/+3
| | | | | |
| * | | | | sfdnsres: Use proper namesgerman772021-04-091-2/+2
| | | | | |
| * | | | | nsd: Update to 12.xgerman772021-04-091-0/+1
| | | | | |
| * | | | | ethc: Update to 12.xgerman772021-04-091-0/+1
| | | | | |
| * | | | | sm: Use proper names, update to 12.xgerman772021-04-091-4/+5
| | | | | |
| * | | | | set_sys: Update to 12.xgerman772021-04-091-0/+6
| | | | | |
| * | | | | pctl_module: Update to 12.xgerman772021-04-091-0/+3
| | | | | |
| * | | | | pcie: Use proper namesgerman772021-04-091-1/+1
| | | | | |
| * | | | | olsc: Update to 12.xgerman772021-04-091-0/+1
| | | | | |
| * | | | | pl_u: Update to 12.xgerman772021-04-091-0/+4
| | | | | |
| * | | | | ldr: Use proper namesgerman772021-04-091-16/+16
| | | | | |
| * | | | | arp: Use proper names, update to 12.xgerman772021-04-092-3/+10
| | | | | |
| * | | | | caps_u: Update to 12.xgerman772021-04-091-0/+1
| | | | | |
| * | | | | caps_a: Update to 12.xgerman772021-04-091-0/+1
| | | | | |
| * | | | | bpc: Use proper namesgerman772021-04-091-2/+2
| | | | | |
| * | | | | bcat_module: Update to 12.xgerman772021-04-091-0/+2
| | | | | |
| * | | | | codecctl: Use proper namesgerman772021-04-091-13/+13
| | | | | |
| * | | | | audren_u: Use proper namesgerman772021-04-092-4/+4
| | | | | |
| * | | | | audren_a: Use proper namesgerman772021-04-091-6/+6
| | | | | |
| * | | | | audrec_u: Use proper names, update to 12.xgerman772021-04-091-3/+4
| | | | | |
| * | | | | audrec_a: Use proper namesgerman772021-04-091-2/+2
| | | | | |
| * | | | | audout_u: Use proper namesgerman772021-04-091-3/+3
| | | | | |
| * | | | | audout_a: Use proper namesgerman772021-04-091-6/+6
| | | | | |
| * | | | | audin_u: Use proper namesgerman772021-04-091-7/+7
| | | | | |
| * | | | | audin_a: Use proper namesgerman772021-04-091-4/+4
| | | | | |
* | | | | | Merge pull request #6113 from german77/playhistorybunnei2021-04-101-1/+13
|\ \ \ \ \ \ | | | | | | | | | | | | | | Friend: Stub GetPlayHistoryRegistrationKey
| * | | | | | Friend: Stub GetPlayHistoryRegistrationKeygerman772021-03-271-1/+13
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #6158 from german77/hidServiceTablesbunnei2021-04-102-0/+85
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Update service function tables
| * | | | | | hid: Update service function tablesgerman772021-04-072-0/+85
| | | | | | |
* | | | | | | ns: Update to 12.xMorph2021-04-091-3/+38
| | | | | | |
* | | | | | | aoc_u: Update to 12.xMorph2021-04-091-0/+2
| | | | | | |
* | | | | | | nim: Update to 12.xMorph2021-04-091-44/+55
| | | | | | |
* | | | | | | npns: Update to 12.xMorph2021-04-091-0/+3
| | | | | | |
* | | | | | | bgtc: Update to 12.x and implement OpenTaskServiceMorph2021-04-092-1/+34
| | | | | | |
* | | | | | | vi: Update to 12.xMorph2021-04-091-0/+8
| | | | | | |
* | | | | | | erpt: Update to 12.xMorph2021-04-091-1/+6
| | | | | | |
* | | | | | | btm: Update to 12.xMorph2021-04-091-0/+1
| | | | | | |
* | | | | | | btdrv: Update to 12.xMorph2021-04-091-0/+19
| | | | | | |
* | | | | | | Merge pull request #6168 from Morph1984/stub-SetNpadAnalogStickUseCenterClampbunnei2021-04-094-1/+29
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | service: hid: Stub SetAnalogStickUseCenterClamp
| * | | | | | service: hid: Stub SetAnalogStickUseCenterClampMorph2021-04-084-1/+29
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | - Used by eBASEBALLパワフルプロ野球2020
* | | | | | Merge pull request #6157 from Morph1984/am-update-12.xbunnei2021-04-091-0/+22
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: am: Update service function tables
| * | | | | | ISelfController: Update to 11.xMorph2021-04-071-0/+1
| | | | | | |
| * | | | | | IApplicationFunctions: Update to 11.xMorph2021-04-071-0/+6
| | | | | | |
| * | | | | | IDebugFunctions: Update to 12.xMorph2021-04-071-0/+2
| | | | | | |
| * | | | | | ICommonStateGetter: Update to 12.xMorph2021-04-071-0/+9
| | | | | | |
| * | | | | | IGlobalStateController: Update to 12.xMorph2021-04-071-0/+1
| | | | | | |
| * | | | | | IHomeMenuFunctions: Update to 12.xMorph2021-04-071-0/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #6062 from ameerj/auto-stubbunnei2021-04-091-0/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Add a toggle for auto stub fallback
| * | | | | | configuration: Add auto stub toggle that resets on bootameerj2021-03-301-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Auto-stub is an experimental debugging feature that may cause unforseen bugs. This adds a toggle to only allow auto-stubbing unimplemented functions when explicitly enabled when yuzu is launched.
| * | | | | | service: Auto stub fallbackameerj2021-03-301-0/+4
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | For simple services we can implement an automatic stub fallback to help with compatibility until a proper implementation is done. Co-Authored-By: Chloe <25727384+ognik5377@users.noreply.github.com>
* | | | | | Merge pull request #6145 from lat9nq/nvhost_empty_memcpybunnei2021-04-081-6/+11
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | nvhost_nvdec_common: Avoid memcpy with null pointers
| * | | | | nvhost_nvdec_common: Avoid memcpy with null pointerslat9nq2021-04-051-6/+11
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoid sending null pointer to memcpy as reported by Undefined Behavious Sanitizer. Co-authored-by: LC <mathew1800@gmail.com>
* | | | | Merge pull request #6160 from Morph1984/fs-update-12.xbunnei2021-04-082-6/+15
|\ \ \ \ \ | |_|_|_|/ |/| | | | service: fs: Update service function tables
| * | | | IFile: Update to 12.xMorph2021-04-071-3/+7
| | | | |
| * | | | fsp-srv: Update to 12.xMorph2021-04-072-3/+8
| |/ / /
* | | | Merge pull request #6143 from lat9nq/nvhost_null_memcpybunnei2021-04-081-1/+7
|\ \ \ \ | | | | | | | | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpy
| * | | | nvhost_ctrl_gpu: Avoid sending null pointer to memcpylat9nq2021-04-051-1/+7
| |/ / / | | | | | | | | | | | | | | | | | | | | Undefined Behaviour Sanitizer reports a null pointer is being sent to memcpy, thought it's "guaranteed to never be null". Guard it with an if statement, and log when the action has been averted.
* | | | Merge pull request #6159 from Morph1984/acc-update-12.xbunnei2021-04-073-36/+45
|\ \ \ \ | | | | | | | | | | service: acc: Update service function tables
| * | | | dauth_o: Update to 11.xMorph2021-04-071-6/+11
| | | | |
| * | | | acc_u1: Update to 12.xMorph2021-04-071-13/+15
| | | | |
| * | | | acc_su: Update to 12.xMorph2021-04-071-17/+19
| |/ / /
* / / / hwopus: Update to 12.xMorph2021-04-071-0/+4
|/ / /
* | | Merge pull request #6131 from german77/rightjoyconSLSRMorph2021-04-021-2/+6
|\ \ \ | | | | | | | | HID: Fix SL and SR buttons for right joycon
| * | | HID: Fix SL and SR buttons for right joycongerman772021-04-021-2/+6
| | |/ | |/|
* | | ISelfController: Stub SetAlbumImageTakenNotificationEnabledMorph2021-03-302-1/+17
| |/ |/| | | | | | | This service call sets an internal flag whether a notification is shown when an image is captured. Currently we do not support capturing images via the capture button, so this can be stubbed for now.
* | Merge pull request #6109 from german77/gestureIDbunnei2021-03-302-3/+13
|\ \ | | | | | | HID: Initialize correctly the gesture finger_id and filter invalid inputs
| * | HID: Initialize correctly the gesture finger_id and filter invalid resultsNarr the Reg2021-03-262-3/+13
| |/
* | Merge pull request #6102 from ogniK5377/fd-passbunnei2021-03-2920-78/+161
|\ \ | | | | | | nvdrv: Pass device fd and handle device create methods for device opening and closing
| * | nvdrv: Pass device fd and handle device create methods for device opening and closingChloe Marcec2021-03-2520-78/+161
| |/ | | | | | | We pass the fd to the ioctl as well as alert the device when it's opened or closed to allow for fd unique actions to take place
* / service: friend: Change logging class from ACC to FriendMorph2021-03-271-11/+12
|/
* nvdrv: Change InitializeEx to AllocAsExChloe Marcec2021-03-222-27/+49
| | | | Wee also report the correct "big page size" now in GetVARegions & fix up the struct for IoctlAllocAsEx
* Merge pull request #6052 from Morph1984/vi-getindirectlayerimagemapbunnei2021-03-201-1/+27
|\ | | | | IApplicationDisplayService: Stub GetIndirectLayerImageMap
| * IApplicationDisplayService: Stub GetIndirectLayerImageMapMorph2021-03-171-1/+27
| | | | | | | | Used by games invoking the inline software keyboard such as GNOSIA
* | Merge pull request #6056 from zkitX/spl-updatesbunnei2021-03-183-9/+178
|\ \ | |/ |/| service: Refactor spl
| * Fix casing on DeallocateAesKeySlotzkitx2021-03-111-3/+3
| |
| * Update SPL to fit N's service refactor (4.0.0+) which split into new services.zkitx2021-03-113-9/+178
| |
* | bsd: Avoid writing empty buffersMorph2021-03-161-2/+6
| | | | | | | | Silences log spam on empty buffer writes
* | Merge pull request #6054 from Morph1984/time-GetClockSnapshotbunnei2021-03-141-0/+2
|\ \ | | | | | | time: Assign the current time point to the ClockSnapshot
| * | time: Assign the current time point to the ClockSnapshotMorph2021-03-101-0/+2
| |/ | | | | | | Fixes the timer in Super Smash Bros Ultimate's Spirit Board.
* / time: Fix CalculateSpanBetween implementationMorph2021-03-101-3/+9
|/ | | | | | CalculateSpanBetween passes in the ClockSnapshots through 2 input buffers and not as raw arguments. Fix this by reading the 2 input buffers instead of popping raw arguments. Partially fixes Super Smash Bros. Ultimate's Spirit Board
* Merge pull request #6007 from bunnei/ldn-errorbunnei2021-02-281-1/+1
|\ | | | | core: hle: ldn: Error out on call to Initialization.
| * core: hle: ldn: Error out on call to Initialization.bunnei2021-02-271-1/+1
| | | | | | | | - Since we do not emulate LDN, returning an error here makes more sense.
* | Merge pull request #5276 from german77/gesturesMorph2021-02-282-11/+240
|\ \ | |/ |/| HID: Implement gestures
| * Implements touch, pan, pinch and rotation gesturesgerman2021-02-282-11/+240
| |
* | Merge pull request #5953 from bunnei/memory-refactor-1bunnei2021-02-278-28/+26
|\ \ | | | | | | Kernel Rework: Memory updates and refactoring (Part 1)
| * | hle: kernel: Migrate PageHeap/PageTable to KPageHeap/KPageTable.bunnei2021-02-191-4/+3
| | |
| * | hle: kernel: Migrate to KMemoryBlock, KMemoryBlockManager, and others.bunnei2021-02-191-11/+10
| | |
| * | hle: kernel: KSystemControl does not belong in Memory namespace.bunnei2021-02-191-2/+2
| | |
| * | hle: kernel: Rename SharedMemory to KSharedMemory.bunnei2021-02-197-12/+12
| | |
* | | Merge pull request #5944 from Morph1984/gc-vibrationsbunnei2021-02-272-3/+130
|\ \ \ | | | | | | | | hid: Implement GameCube Controller Vibrations
| * | | hid: Implement GameCube Controller VibrationsMorph2021-02-212-3/+130
| | | | | | | | | | | | | | | | Implements both SendVibrationGcErmCommand and GetActualVibrationGcErmCommand, and modifies GetVibrationDeviceInfo to account for additional controllers.
* | | | acc: Stub GetNintendoAccountUserResourceCacheForApplicationMorph2021-02-211-1/+17
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | This command returns a Nintendo Account ID and writes 2 output buffers. The first output buffer is a NasUserBaseForApplication and the second output buffer is currently empty. Used by: - Pokken Tournament DX - Super Smash Bros. Ultimate - Super Nintendo Entertainment System - Nintendo Switch Online - Mario Kart 8 Deluxe
* / / kernel: Fix resource release exception on exitameerj2021-02-212-0/+6
|/ / | | | | | | | | After rewriting the resource limit, objects releasing reserved resources require a live kernel instance. This commit fixes exceptions that occur due to the kernel being destroyed before some objects released their resources, allowing for a graceful exit.
* | Merge pull request #4973 from ameerj/nvdec-optbunnei2021-02-192-3/+7
|\ \ | | | | | | nvdec: Reuse allocated buffers and general cleanup
| * | Address PR feedbackameerj2021-02-132-4/+2
| | | | | | | | | | | | Co-Authored-By: LC <712067+lioncash@users.noreply.github.com>
| * | nvdec cleanupameerj2021-02-131-1/+7
| | |
* | | Merge pull request #4940 from german77/nativeGCbunnei2021-02-152-1/+88
|\ \ \ | | | | | | | | HID: Implement GC controller in game
| * | | hid: Implement GC controllergerman2021-02-082-1/+88
| | |/ | |/|
* | | hle: service: ldn: IUserLocalCommunicationService: Improve the stub.bunnei2021-02-141-5/+29
| | |
* | | hle: service: ldn: IUserLocalCommunicationService: Indicate that LDN is disabled.bunnei2021-02-142-3/+18
| | | | | | | | | | | | - Fixes crash on Pokemon Sword/Shield when pressing 'Y'.
* | | hle: service: am: IStorageAccessor: Fix out of bounds error handling.bunnei2021-02-141-6/+7
| |/ |/|
* | kernel: Unify result codes (#5890)Chloe2021-02-131-3/+3
| | | | | | | | | | | | | | | | | | * kernel: Unify result codes Drop the usage of ERR_NAME convention in kernel for ResultName. Removed seperation between svc_results.h & errors.h as we mainly include both most of the time anyways. * oops * rename errors to svc_results
* | Merge pull request #5902 from lioncash/core-warnbunnei2021-02-123-4/+7
|\ \ | | | | | | core: Silence various warnings on Clang 12
| * | bsd: Remove usage of optional emplace() with no argumentsLioncash2021-02-091-2/+4
| | | | | | | | | | | | Clang 12 currently falls over in the face of this.
| * | am/controller: Remove [[fallthrough]] from unreachable pathLioncash2021-02-091-1/+2
| | | | | | | | | | | | | | | Prevents warnings on clang 12. This path is reachable on other variations of the build that disable the unreachable macro.
| * | nfp: Correct uninitialized size being used within GetTagInfo()Lioncash2021-02-091-1/+1
| |/ | | | | | | | | We were previously the name of the object being initialized within its own initializer, which results in uninitialized data being read.
* | software_keyboard: Implement Finalize request commandMorph2021-02-111-0/+4
| |
* | Merge pull request #5892 from german77/backupbunnei2021-02-091-1/+12
|\ \ | | | | | | olsc: Stub GetSaveDataBackupSetting
| * | olsc: Stub GetSaveDataBackupSettinggerman2021-02-081-1/+12
| |/
* | Merge pull request #5868 from german77/HandheldFixbunnei2021-02-081-0/+1
|\ \ | |/ |/| Prevent over scheduling audio events and add motion update unschedule event
| * Prevent over scheduling audio events and terminate properly the motion update eventgerman2021-02-021-0/+1
| |
* | Merge pull request #5887 from ogniK5377/lm-fixbunnei2021-02-071-7/+9
|\ \ | | | | | | lm: Fix ReadLeb128
| * | lm: Fix ReadLeb128Chloe Marcec2021-02-071-7/+9
| | | | | | | | | | | | | | | | | | Fixes assertion on Bloodstained Ritual of the Night. We would over read sometimes, this is fixed by checking if the top bit is set in the first iteration. We also lock the loop off to be only the max size of the type we can fit. Finally we changed an incorrect print of "DEBUG" to "TRACE" to reflect the proper log severity
* | | Merge pull request #5878 from aleasto/masterMorph2021-02-071-2/+7
|\ \ \ | |/ / |/| | pl_u: Fix read out of bounds
| * | pl_u: Fix read out of boundsAlessandro Astone2021-02-061-2/+7
| | |
* | | Merge pull request #5326 from german77/hidUpdate1bunnei2021-02-0610-168/+406
|\ \ \ | | | | | | | | HID: Update the HID service to match more closely to switchbrew part 1
| * | | Add footer types and address commentsgerman2021-02-047-58/+106
| | | |
| * | | Fix npad struct to match switchbrewgerman2021-02-043-105/+134
| | | |
| * | | Adds missing controller types and propertiesgerman2021-02-049-30/+191
| |/ /
* | | hle: kernel: Reimplement KReadableEvent and KWritableEvent.bunnei2021-02-0529-194/+259
| | |
* | | hle: kernel: Rename WritableEvent to KWritableEvent.bunnei2021-02-0537-78/+78
| | |
* | | hle: kernel: Rename ReadableEvent to KReadableEvent.bunnei2021-02-0532-51/+52
| | |
* | | Merge pull request #5867 from Morph1984/am-GetHealthWarningDisappearedSystemEventbunnei2021-02-052-1/+14
|\ \ \ | |/ / |/| | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEvent
| * | IApplicationFunctions: Implement GetHealthWarningDisappearedSystemEventMorph2021-02-022-1/+14
| | |
* | | Merge pull request #5842 from german77/userfixbunnei2021-02-031-2/+8
|\ \ \ | |/ / |/| | acc: Fix error when second user is selected
| * | Fix user changing to 0 if validgerman2021-01-291-2/+8
| | |
* | | Merge pull request #5861 from german77/HandheldFixbunnei2021-02-021-2/+11
|\ \ \ | | |/ | |/| hid: Only update motion for npad and prevent over scheduling events
| * | Only update motion for npad and prevent over scheduling eventsgerman2021-02-011-2/+11
| | |
* | | Merge pull request #5859 from Morph1984/nifmbunnei2021-02-011-2/+157
|\ \ \ | | | | | | | | nifm: Stub GetCurrentNetworkProfile and GetCurrentIpConfigInfo
| * | | nifm: Stub GetCurrentIpConfigInfoMorph2021-01-311-1/+29
| | | | | | | | | | | | | | | | - Used by Lets Sing 12
| * | | nifm: Stub GetCurrentNetworkProfileMorph2021-01-311-1/+41
| | | | | | | | | | | | | | | | | | | | - Used by Minecraft Bedrock Edition - Used by Bloons TD 5
| * | | nifm: Add several structsMorph2021-01-311-0/+87
| | | |
* | | | Merge pull request #5856 from Morph1984/nifm-fix-getappletinfo-stubAmeer J2021-02-011-1/+5
|\ \ \ \ | | | | | | | | | | nifm: Fix GetAppletInfo stub
| * | | | nifm: Fix GetAppletInfo stubMorph2021-01-311-1/+5
| | | | |
* | | | | Merge pull request #5858 from Morph1984/IsGamePlayRecordingSupported-stubbunnei2021-02-012-1/+12
|\ \ \ \ \ | | | | | | | | | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupported
| * | | | | am/IApplicationFunctions: Stub IsGamePlayRecordingSupportedMorph2021-01-312-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | Used by RetroArch
* | | | | | prepo: Stub GetTransmissionStatusMorph2021-01-311-1/+11
| | | | | |
* | | | | | prepo: Stub RequestImmediateTransmissionMorph2021-01-311-1/+8
| |_|/ / / |/| | | | | | | | | | | | | | - Used by Animal Crossing: New Horizons
* | | | | bsd: Fix EventFd stubMorph2021-01-311-3/+3
|/ / / /
* | | | Merge pull request #5855 from Morph1984/bsd-fix-getsockopt-stubbunnei2021-01-311-1/+5
|\ \ \ \ | |/ / / |/| | | bsd: Fix GetSockOpt stub
| * | | bsd: Fix GetSockOpt stubMorph2021-01-311-1/+5
| | | |
* | | | Merge pull request #5851 from ameerj/pop-inv-stubMorph2021-01-312-1/+10
|\ \ \ \ | |/ / / |/| | | am: Stub TryPopFromFriendInvitationStorageChannel
| * | | am: Stub TryPopFromFriendInvitationStorageChannelameerj2021-01-312-1/+10
| | | | | | | | | | | | | | | | Used by Family Feud
* | | | bsd: Stub EventFdameerj2021-01-312-1/+12
|/ / / | | | | | | | | | Used by Family Feud
* | | Merge pull request #5779 from bunnei/kthread-rewritebunnei2021-01-308-8/+8
|\ \ \ | | | | | | | | Rewrite KThread to be more accurate
| * | | core: hle: kernel: Rename Thread to KThread.bunnei2021-01-298-8/+8
| | | |
* | | | Merge pull request #5838 from german77/prepostubMorph2021-01-301-1/+10
|\ \ \ \ | | | | | | | | | | prepo: Stub GetSystemSessionId
| * | | | Stub GetSystemSessionIdgerman2021-01-301-1/+10
| | |_|/ | |/| |
* | | | Merge pull request #5809 from ogniK5377/FlushAudioOutBuffersbunnei2021-01-291-1/+9
|\ \ \ \ | |_|/ / |/| | | audout: FlushAudioOutBuffers
| * | | audout: FlushAudioOutBuffersChloe Marcec2021-01-241-1/+9
| | | | | | | | | | | | | | | | Fixes Devil May Cry
* | | | Merge pull request #5837 from german77/socketstubbunnei2021-01-292-1/+17
|\ \ \ \ | | | | | | | | | | sockets: Stub GetSockOpt
| * | | | Stub GetSockOptgerman2021-01-282-1/+17
| | |/ / | |/| |
* | | | Merge pull request #5840 from Morph1984/prepo-fixLC2021-01-281-24/+42
|\ \ \ \ | | | | | | | | | | prepo: Fix BufferDescriptorX invalid buffer index errors and add New variants of SaveReport
| * | | | prepo: Fix BufferDescriptorX invalid buffer errors and add "New" variants of SaveReportMorph2021-01-281-24/+42
| |/ / / | | | | | | | | | | | | The second input buffer could be optional when prepo/srepo is called, test for the availability of the second buffer prior to reading from it.
* | | | hid: Add static_assert for Parameter sizeMorph2021-01-281-15/+19
| | | |
* | | | npad: Remove unused device handle parameterMorph2021-01-273-11/+9
|/ / /
* | | Merge pull request #5812 from german77/StubSixaxisFusionbunnei2021-01-274-3/+104
|\ \ \ | | | | | | | | HID: Stub Set/Get/Reset SixaxisSensorFusionParameters
| * | | Stub Set/Get/Reset SixaxisSensorFusionParametersgerman2021-01-244-3/+104
| |/ /
* | | Merge pull request #5810 from ogniK5377/stereo-visionbunnei2021-01-273-7/+60
|\ \ \ | | | | | | | | hle: Implement remaining services for Stereo Vision
| * | | hle: Implement remaining services for Stereo VisionChloe Marcec2021-01-243-7/+60
| |/ / | | | | | | | | | Used by Zelda Breath of the Wild, Super Mario Odyssey and Nintendo Labo
* | | Merge pull request #5824 from ogniK5377/IPsmSessionbunnei2021-01-261-1/+112
|\ \ \ | | | | | | | | psm: IPsmSession
| * | | Omit system referenceChloe Marcec2021-01-251-2/+1
| | | |
| * | | psm: IPsmSessionChloe Marcec2021-01-251-2/+114
| | | | | | | | | | | | | | | | Used by homebrew menu
* | | | Merge pull request #5774 from ogniK5377/mii-raw-randombunnei2021-01-264-2274/+1657
|\ \ \ \ | | | | | | | | | | mii: Fix BuildRandomStoreData & Cleanup raw_data
| * | | | mii: Fix BuildRandomStoreData & Cleanup raw_dataChloe Marcec2021-01-204-2274/+1657
| | | | | | | | | | | | | | | | | | | | | | | | | Cleaned up mii raw data to reflect the underlying values instead of just a chunk of bytes. Fixed BuildRandomStoreData not actually generating random miis properly. "values" should be a u32, not a u8.
* | | | | Merge pull request #5771 from ogniK5377/lm-reworkbunnei2021-01-253-271/+288
|\ \ \ \ \ | |_|/ / / |/| | | | lm: Recode LM service
| * | | | Print Process ID and Thread ID as hexChloe Marcec2021-01-241-2/+2
| | | | |
| * | | | Clamp string reads to buffer sizeChloe Marcec2021-01-231-3/+5
| | | | |
| * | | | Mark DestinationToString as staticChloe Marcec2021-01-201-1/+1
| | | | |
| * | | | Mark LogPacketHeaderEntry hash as noexceptChloe Marcec2021-01-201-1/+1
| | | | |
| * | | | lm: Recode LM serviceChloe Marcec2021-01-203-271/+286
| |/ / / | | | | | | | | | | | | Rework the service to spit out to logs instead of a seperate file as well as fix any crashes caused by lm.
* | | | Merge pull request #5799 from ogniK5377/event-register-unregisterbunnei2021-01-251-1/+7
|\ \ \ \ | |_|/ / |/| | | nvdrv: Unregister already registered events
| * | | Simplify conditionChloe Marcec2021-01-231-2/+1
| | | |
| * | | nvdrv: Unregister already registered eventsChloe Marcec2021-01-231-1/+8
| | | |
* | | | Merge pull request #5806 from bunnei/am-stubbunnei2021-01-241-1/+8
|\ \ \ \ | |/ / / |/| | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.
| * | | hle: service: am: Stub ILibraryAppletAccessor::PresetLibraryAppletGpuTimeSliceZero.bunnei2021-01-211-1/+8
| |/ / | | | | | | | | | - Used by Monster Hunter Rise demo.
* | | Merge pull request #5776 from ogniK5377/lblbunnei2021-01-231-22/+261
|\ \ \ | | | | | | | | lbl: Implement most of lbl
| * | | lbl: Implement most of lblChloe Marcec2021-01-201-22/+261
| |/ / | | | | | | | | | Pretty basic service, only thing left to do is handle setting applying once set:sys is implemented
* | | Merge pull request #5765 from ogniK5377/StoreSaveDataThumbnail-stubbunnei2021-01-235-6/+66
|\ \ \ | | | | | | | | acc: Stub StoreSaveDataThumbnail
| * | | acc: Stub StoreSaveDataThumbnailChloe Marcec2021-01-195-6/+66
| |/ / | | | | | | | | | Fixes ACA NEOGEO METAL SLUG hanging on boot.
* | | Merge pull request #5270 from german77/multiTouchbunnei2021-01-212-29/+130
|\ \ \ | |/ / |/| | HID: Add multitouch support
| * | Always initialize keyboard inputgerman2021-01-151-5/+1
| | |
| * | Add mutitouch support for touch screensgerman2021-01-152-19/+25
| | |
| * | Allow to return up to 16 touch inputs per enginegerman2021-01-152-55/+75
| | |
| * | Allow all touch inputs at the same time and remove config options that are not longer necesarygerman2021-01-152-11/+20
| | |
| * | Add multitouch supportgerman2021-01-152-23/+93
| | |
* | | npad: Add check for HANDHELD_INDEX in UpdateControllerAt()Morph2021-01-181-1/+1
| | |
* | | core: Silence Wclass-memaccess warningsReinUsesLisp2021-01-1511-177/+187
| |/ |/| | | | | | | This requires making several types trivial and properly initialize them whenever they are called.
* | common/common_funcs: Rename INSERT_UNION_PADDING_{BYTES,WORDS} to _NOINITReinUsesLisp2021-01-151-5/+5
|/ | | | INSERT_PADDING_BYTES_NOINIT is more descriptive of the underlying behavior.
* core: hle: Add missing calls to MicroProfileOnThreadExit.bunnei2021-01-111-0/+4
|
* core: hle: kernel: Update KSynchronizationObject.bunnei2021-01-111-3/+0
|
* hle: service: nfp: Remove incorrect signaling behavior in GetDeviceState.bunnei2021-01-111-6/+0
|
* Merge pull request #5312 from german77/overclockenabledbunnei2021-01-102-1/+10
|\ | | | | apm: Stub IsCpuOverclockEnabled
| * Stub IsCpuOverclockEnabledgerman2021-01-082-1/+10
| |
* | core: Silence unhandled enum in switch warningsReinUsesLisp2021-01-091-2/+4
|/
* fix for nvdec disabled, cleanup host1xameerj2021-01-071-11/+14
|
* nvdec syncpt incorporationameerj2021-01-077-20/+43
| | | | laying the groundwork for async gpu, although this does not fully implement async nvdec operations
* core: Silence warnings when compiling without assertsReinUsesLisp2021-01-051-0/+1
|
* buffer_queue: Protect queue_sequence list access with a mutexameerj2021-01-042-13/+21
| | | | fixes a data race as this is an unprotected variable manipulated by multiple threads
* hle: service: nvflinger: buffer_queue: Do not reset id/layer_id on Connect.bunnei2021-01-031-2/+0
| | | | - This behavior is a mistake, fixes Katana Zero.
* general: Fix various spelling errorsMorph2021-01-022-4/+4
|
* Merge pull request #5208 from bunnei/service-threadsbunnei2020-12-3136-540/+259
|\ | | | | Service threads
| * hle: service: Acquire and release a lock on requests.bunnei2020-12-295-25/+35
| | | | | | | | - This makes it such that we can safely access service members from CoreTiming thread.
| * hle: service: vi: Refactor to grab buffer only once.bunnei2020-12-291-15/+4
| |
| * service: nvflinger: Improve synchronization for BufferQueue.bunnei2020-12-295-19/+72
| | | | | | | | | | - Use proper mechanisms for blocking on DequeueBuffer. - Ensure service thread terminates on emulation Shutdown.
| * hle: service: Ensure system is powered on before writing IPC result.bunnei2020-12-291-1/+5
| |
| * hle: service: bsd: Update to work with service threads, removing SleepClientThread.bunnei2020-12-293-249/+45
| |
| * hle: service: nvdrv: Revert #4981 to remove usage of SleepClientThread.bunnei2020-12-2923-211/+83
| | | | | | | | - Note, this always processes the ioctl right away, which fixes BotW 1.0.0 issues.
| * hle: service: nvflinger: Refactor locking and interfaces.bunnei2020-12-293-45/+31
| |
| * hle: service: vi: Remove usage of SleepClientThread.bunnei2020-12-291-34/+43
| |
* | service/pcie: Fix invalid initialization argumentReinUsesLisp2020-12-301-1/+1
|/
* Merge pull request #5042 from Morph1984/project-aetherbunnei2020-12-2210-527/+643
|\ | | | | Project Aether: Reimplementation of the Web Browser Applet
| * applets/web: Implement the online web browser appletMorph2020-12-182-3/+11
| |
| * main, applets/web: Re-add progress dialog for RomFS extractionMorph2020-12-182-32/+44
| |
| * pl_u, applets/web: Decrypt shared fonts to TTF filesMorph2020-12-183-18/+117
| |
| * ns_vm: Stub NeedsUpdateVulnerabilityMorph2020-12-181-1/+10
| | | | | | | | This is used to force system updates on launching the web browser. We do not care about system updates so this can be set to false.
| * controllers/npad: Make press_state atomicMorph2020-12-182-2/+3
| |
| * applets/web: Implement the default web browser applet frontendMorph2020-12-181-1/+4
| |
| * applets/web: Implement the offline browser applet backendMorph2020-12-182-13/+143
| |
| * applets/web: Initial implementation of the web browser appletMorph2020-12-183-2/+428
| |
| * applets: Remove the previous web browser applet implementationMorph2020-12-184-609/+37
| |
* | Merge pull request #5131 from bunnei/scheduler-rewritebunnei2020-12-211-1/+1
|\ \ | | | | | | Rewrite Kernel scheduler based on Atmosphere
| * | hle: kernel: Rewrite scheduler implementation based on Mesopshere.bunnei2020-12-061-1/+1
| | |
* | | buffer_queue: better use of std::arrayameerj2020-12-181-59/+46
| | |
* | | Overwrite slots instead of queuing them, add disconnect signalameerj2020-12-173-27/+33
| |/ |/| | | | | Fix for Katana Zero and Yoshi's Crafted World
* | Merge pull request #5190 from Morph1984/validate_device_handlebunnei2020-12-162-0/+45
|\ \ | | | | | | controllers/npad: Validate device handles before use
| * | controllers/npad: Validate device handles before useMorph2020-12-122-0/+45
| | | | | | | | | | | | Some games such as NEKOPARA Vol. 3 send invalid device handles when calling InitializeVibrationDevice. Introduce a check to validate the device handle before use.
* | | Merge pull request #5119 from Morph1984/fs-opendatastoragewithprogramindexbunnei2020-12-155-8/+62
|\ \ \ | | | | | | | | fsp_srv: Implement OpenDataStorageWithProgramIndex
| * | | fsp_srv: Implement OpenDataStorageWithProgramIndexMorph2020-12-084-1/+57
| | | | | | | | | | | | | | | | - Used by RollerCoaster Tycoon 3: Complete Edition
| * | | file_sys: Consolidate common Title ID operationsMorph2020-12-081-7/+5
| | | |
* | | | Merge pull request #5168 from Morph1984/aoc-PurchaseEventManagerbunnei2020-12-152-2/+76
|\ \ \ \ | |_|/ / |/| | | aoc_u: Stub IPurchaseEventManager and its service commands
| * | | IPurchaseEventManager: Implement GetPurchasedEventReadableHandleMorph2020-12-081-1/+14
| | | | | | | | | | | | | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
| * | | IPurchaseEventManager: Stub Set(Default)DeliveryTargetMorph2020-12-081-2/+27
| | | | | | | | | | | | | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
| * | | aoc_u: Stub Create(Permanent)EcPurchasedEventManagerMorph2020-12-082-2/+38
| |/ / | | | | | | | | | | | | - Used by Pokémon Café Mix - Used by DOOM: Eternal
* | | Merge pull request #5123 from Morph1984/nim-IsLargeResourceAvailablebunnei2020-12-101-1/+13
|\ \ \ | | | | | | | | nim: Stub IsLargeResourceAvailable
| * | | nim: Stub IsLargeResourceAvailableMorph2020-12-041-1/+13
| | |/ | |/| | | | | | | - Used by Immortals Fenyx Rising
* | | Merge pull request #5142 from comex/xx-poll-eventsRodrigo Locatti2020-12-094-40/+45
|\ \ \ | | | | | | | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`
| * | | network, sockets: Replace `POLL_IN`, `POLL_OUT`, etc. constants with an `enum class PollEvents`comex2020-12-074-40/+45
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Actually, two enum classes, since for some reason there are two separate yet identical `PollFD` types used in the codebase. I get that one is ABI-compatible with the Switch while the other is an abstract type used for the host, but why not use `WSAPOLLFD` directly for the latter? Anyway, why make this change? Because on Apple platforms, `POLL_IN`, `POLL_OUT`, etc. (with an underscore) are defined as macros in <sys/signal.h>. (This is inherited from FreeBSD.) So defining a variable with the same name causes a compile error. I could just rename the variables, but while I was at it I thought I might as well switch to an enum for stronger typing. Also, change the type used for values copied directly to/from the `events` and `revents` fields of the host *native* `pollfd`/`WSASPOLLFD`, from `u32` to `short`, as `short` is the correct canonical type on both Unix and Windows.
* | | Merge pull request #5166 from lioncash/log-castbunnei2020-12-0918-71/+63
|\ \ \ | | | | | | | | core: Remove unnecessary enum casts in log calls
| * | | core: Remove unnecessary enum casts in log callsLioncash2020-12-0818-71/+63
| | | | | | | | | | | | | | | | | | | | Follows the video core PR. fmt doesn't require casts for enum classes anymore, so we can remove quite a few casts.
* | | | Merge pull request #5135 from Morph1984/applets-shadowbunnei2020-12-091-1/+1
|\ \ \ \ | |_|_|/ |/| | | applets: Resolve variable shadowing
| * | | applets: Resolve variable shadowingMorph2020-12-051-1/+1
| | |/ | |/|
* | | controller: Use std::move within ConvertToFrontendParameters()Lioncash2020-12-081-3/+3
| | | | | | | | | | | | Avoids unnecessary copies.
* | | controller: Avoid unnecessary copies in ConfigurationComplete()Lioncash2020-12-081-9/+8
| |/ |/| | | | | | | Avoids unnecessary 1072 byte copies when querying info about controllers.
* | Merge pull request #5148 from comex/xx-unused-fieldsbunnei2020-12-071-1/+1
|\ \ | | | | | | core: Mark unused fields as [[maybe_unused]]
| * | core: Mark unused fields as [[maybe_unused]]comex2020-12-071-1/+1
| |/
* | Merge pull request #5154 from comex/xx-ipcbunnei2020-12-071-2/+2
|\ \ | | | | | | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cpp
| * | hle: Type check ResponseBuilder::Push arguments, and fix use in vi.cppcomex2020-12-071-2/+2
| |/ | | | | | | | | | | | | | | | | | | | | | | - Add a type check so that calling Push with an invalid type produces a compile error rather than a linker error. - vi.cpp was calling Push with a variable of type `std::size_t`. There's no explicit overload for `size_t`, but there is one for `u64`, which on most platforms is the same type as `size_t`. On macOS, however, it isn't: both types are 64 bits, but `size_t` is `unsigned long` and `u64` is `unsigned long long`. Regardless, it makes more sense to explicitly use `u64` here instead of `size_t`.
* | Merge pull request #5147 from comex/xx-purevirtLC2020-12-071-33/+0
|\ \ | | | | | | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclass
| * | nvdrv: Remove useless re-declaration of pure virtual methods that were already declared in the superclasscomex2020-12-071-33/+0
| |/
* / boxcat: Avoid unnecessary object copycomex2020-12-071-1/+1
|/
* core: arm: Implement InvalidateCacheRange for CPU cache invalidation.bunnei2020-11-291-5/+0
|
* Merge pull request #4998 from Morph1984/bioshock-patchbunnei2020-11-291-2/+4
|\ | | | | hid: Check if applet_resource exists in InitializeVibrationDevice
| * hid: Check if applet_resource exists in InitializeVibrationDeviceMorph2020-11-251-2/+4
| |
* | Add missing types to NpadCommunicationModegerman2020-11-291-0/+2
| |
* | Merge pull request #5021 from german77/StubCommunicationModebunnei2020-11-294-2/+50
|\ \ | | | | | | HID: Stub set and get NpadCommunicationMode
| * | Stub set and get NpadCommunicationModegerman2020-11-274-2/+50
| | |
* | | savedata_factory: Eliminate usage of the global system instanceLioncash2020-11-271-1/+2
| | | | | | | | | | | | Now there's only two meaningful instances left in core.
* | | service: Eliminate usages of the global system instanceLioncash2020-11-27219-897/+1207
|/ / | | | | | | | | Completely removes all usages of the global system instance within the services code by passing in the using system instance to the services.
* | Merge pull request #4975 from comex/invalid-syncpoint-idbunnei2020-11-261-2/+2
|\ \ | | | | | | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint ID
| * | nvdrv, video_core: Don't index out of bounds when given invalid syncpoint IDcomex2020-11-241-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | - Use .at() instead of raw indexing when dealing with untrusted indices. - For the special case of WaitFence with syncpoint id UINT32_MAX, instead of crashing, log an error and ignore. This is what I get when running Super Mario Maker 2.
* | | Merge pull request #4981 from ogniK5377/ioctl-ctrlbunnei2020-11-2624-91/+214
|\ \ \ | |_|/ |/| | nvservices: Reintroducee IoctlCtrl
| * | nvservices: Reintroducee IoctlCtrlChloe Marcec2020-11-2424-91/+214
| |/ | | | | | | Fixes regression caused by #4907 which caused games like Breath of the Wild 1.0.0 not to boot.
* | service: am: Implement ExecuteProgram and required stubs.bunnei2020-11-252-3/+34
| | | | | | | | - This is used by Super Mario 3D All-Stars.
* | hle: services: Fix a crash with improper NVFlinger lifetime management. (#4977)bunnei2020-11-2416-97/+98
|/ | | | | | * hle: services: Fix a crash with improper NVFlinger lifetime management. - This crash would happen when attempting to shutdown yuzu early on in boot.
* Merge pull request #4944 from lioncash/system-rembunnei2020-11-228-31/+66
|\ | | | | patch_manager: Remove usages of the global system instance
| * patch_manager: Remove usages of the global system instanceLioncash2020-11-188-31/+66
| | | | | | | | | | | | | | With this, only 19 usages of the global system instance remain within the core library. We're almost there.
* | Merge pull request #4907 from ogniK5377/nvdrv-cleanupbunnei2020-11-2126-898/+1220
|\ \ | | | | | | core: Make nvservices more standardized
| * | Addressed issuesChloe Marcec2020-11-1010-17/+86
| | |
| * | core: Make nvservices more standardizedChloe Marcec2020-11-1026-903/+1156
| | |
* | | olsc: Move member initialization to after member functions.bunnei2020-11-201-2/+2
| | |
* | | hle: service: Stub OLSC Initialize and SetSaveDataBackupSettingEnabled functions.bunnei2020-11-193-0/+87
| |/ |/| | | | | - Used by Animal Cross: New Horizons v1.6.0 update, minimal stub gets this update working.
* | hid: Reimplement Begin/EndPermitVibrationSessionMorph2020-11-163-5/+17
| | | | | | | | Upon further investigation, these commands allow temporary vibrations even when the "Controller Vibration" system setting is disabled. As a result, vibrations are allowed when either the system setting or this flag is set to true. Therefore, we can only block vibrations when both flags are set to false.
* | controllers/npad: Load input devices on initMorph2020-11-161-0/+2
| |
* | general: Fix compiler warnings on linux and miscellaneous changesMorph2020-11-162-8/+11
| |
* | controllers/npad: Remove the old vibration filterMorph2020-11-163-50/+64
| | | | | | | | Previously we used a vibration filter that filters out amplitudes close to each other. It turns out there are cases where this results into vibrations that are too inaccurate. Remove this and move the 100Hz vibration filter (Only allowing a maximum of 100 vibrations per second) from sdl_impl to npad when enable_accurate_vibrations is set to false.
* | hid: Implement InitializeVibrationDevice and IsVibrationDeviceMountedMorph2020-11-163-12/+66
| |
* | input_common: Add VibrationDevice and VibrationDeviceFactoryMorph2020-11-163-33/+27
| | | | | | | | | | | | A vibration device is an input device that returns an unsigned byte as status. It represents whether the vibration device supports vibration or not. If the status returns 1, it supports vibration. Otherwise, it does not support vibration.
* | configure_input: Add per-player vibrationMorph2020-11-161-2/+11
| | | | | | | | | | | | | | Allows for enabling and modifying vibration and vibration strength per player. Also adds a toggle for enabling/disabling accurate vibrations. Co-authored-by: Its-Rei <kupfel@gmail.com>
* | settings: Remove global vibration strength modifierMorph2020-11-161-3/+1
| | | | | | | | This will be replaced in favor of per-player vibration strength modifiers.
* | hid: Mark Begin/EndPermitVibrationSession as stubsMorph2020-11-163-18/+4
| | | | | | | | The implementation of these commands seem incomplete and causes rumble in Super Mario Party to stop working since only EndPermitVibrationSession is called. Thus, these are better off being marked as a stub until this can be investigated more thoroughly.
* | controllers/npad: Send an empty vibration on destruction/deactivationMorph2020-11-163-22/+38
| | | | | | | | This stops all controllers from continuously vibrating when emulation is stopped.
* | hid: Stub IsVibrationDeviceMountedMorph2020-11-162-1/+23
| | | | | | | | - Used in Super Mario Odyssey
* | controllers/npad: Add heuristics to reduce rumble state changesMorph2020-11-161-5/+46
| | | | | | | | | | Sending too many state changes in a short period of time can cause massive performance issues. As a result, we have to use several heuristics to reduce the number of state changes to minimize/eliminate this performance impact while maintaining the quality of these vibrations as much as possible.
* | configure_input: Hook up the vibration percentage spinboxMorph2020-11-161-1/+2
| | | | | | | | | | This allows setting the vibration strength percentage anywhere from 1% to 100%. Also hooks up the remaining motion button and checkbox in the Controller Applet.
* | controllers/npad: Stop games from vibrating incorrect controllersMorph2020-11-161-0/+10
| | | | | | | | Fixes vibration in 1-2 Switch and potentially other games where they would vibrate both players' joycons at the same time.
* | hid: Fix controller rumble based on new researchMorph2020-11-163-43/+69
| | | | | | | | | | This fixes the issue where rumble is only sent to the first controller. Now, individual controllers can receive their own rumble commands.
* | hid: Pop a struct of parameters instead of popping individual parametersMorph2020-11-161-103/+237
| | | | | | | | | | Some parameters need to be doubleword aligned due to the presence of the applet_resource_user_id. Previously, this value was invalid in many commands where it was not doubleword aligned when popped.
* | hid: Reorder all HID commandsMorph2020-11-164-215/+230
| | | | | | | | Reorders all HID commands in command id order.
* | hid: Implement GetVibrationDeviceInfoMorph2020-11-162-3/+39
| | | | | | | | | | | | | | | | | | | | The first u32 describes the vibration device type which is a Linear Resonant Actuator used in Nintendo Switch controller hardware. The second u32 describes the vibration device position, in this case distinguishing between left and right vibration actuators. Pro Controllers have 2 LRAs each that can vibrate independently of each other, which means they have 2 distinct vibration device handles to distinguish between the two actuators. Similarly for joycons, the left joycon can be distinguished from the right joycon through the vibration device handle since each joycon has 1 LRA.
* | hid: Stub InitializeVibrationDeviceMorph2020-11-161-3/+11
| |
* | controllers/npad: Rename NPadType to NpadStyleSetMorph2020-11-163-9/+9
| | | | | | | | This more accurately represents the underlying type and avoids confusion with NpadType
* | controllers/npad: Add DeviceHandle structMorph2020-11-161-27/+50
| | | | | | | | A DeviceHandle describes a vibration device or six-axis sensor based on the npad type, npad id, and device index/position
* | settings: Preparation for per-game input settingsMorph2020-11-166-25/+32
| |
* | controllers/npad: Connect a controller on init if none are connectedMorph2020-11-161-0/+13
| |
* | Merge pull request #4895 from Morph1984/cave-story-plus-applet-fixbunnei2020-11-132-26/+80
|\ \ | | | | | | applets/controller: Introduce additional checks for mode and caller
| * | applets: Rename LibraryAppletVersion to ControllerAppletVersionMorph2020-11-082-15/+15
| | |
| * | applets/controller: Pop normal data for StrapGuide and FirmwareUpdateMorph2020-11-082-6/+19
| | |
| * | applets/controller: Introduce additional checks for mode and callerMorph2020-11-082-5/+39
| | | | | | | | | | | | | | | Some games like Cave Story+ set invalid values in the ControllerPrivateArg's mode and caller fields. Use other fields to determine the appropriate mode and caller should either or both fields be invalid.
| * | applets/controller: Add ControllerUpdateFirmwareArg structMorph2020-11-081-0/+7
| | |
* | | Merge pull request #4901 from bunnei/caps-stubbunnei2020-11-102-9/+17
|\ \ \ | |_|/ |/| | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.
| * | hle: service: caps_u: Stub GetAlbumFileList3AaeAruid.bunnei2020-11-072-9/+17
| | | | | | | | | | | | | | | | | | - This works similiar to GetAlbumContentsFileListForApplication. - Since we do not implement the album, this should be safe to stub for now. - Used by Super Smash Bros. Ultimate (newer updates) in World of Light.
* | | ipc_helpers: Remove usage of the global system instanceLioncash2020-11-0814-1/+14
| |/ |/| | | | | | | | | | | | | | | Resolves numerous deprecation warnings throughout the codebase due to inclusion of this header. Now building core should be significantly less noisy (and also relying on less global state). This also uncovered quite a few modules that were relying on indirect includes, which have also been fixed.
* | video_core: dma_pusher: Remove integrity check on command lists.bunnei2020-11-071-1/+0
|/ | | | - This seems to cause softlocks in Breath of the Wild.
* Merge pull request #4858 from lioncash/initializerbunnei2020-11-041-0/+4
|\ | | | | General: Resolve a few missing initializer warnings
| * General: Resolve a few missing initializer warningsLioncash2020-10-301-0/+4
| | | | | | | | Resolves a few -Wmissing-initializer warnings.
* | Merge pull request #4869 from bunnei/improve-gpu-syncChloe2020-11-049-60/+291
|\ \ | | | | | | Improvements to GPU synchronization & various refactoring
| * | fixup! hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-012-3/+11
| | |
| * | hle service: nvdrv: nvhost_gpu: Update to use SyncpointManager and other improvements.bunnei2020-11-013-46/+106
| | | | | | | | | | | | | | | - Refactor so that SubmitGPFIFO and KickoffPB use shared functionality. - Implement add_wait and add_increment flags.
| * | service: hle: nvflinger: Fix potential shutdown crash when GPU is destroyed.bunnei2020-11-011-0/+4
| | |
| * | hle service: nvdrv: nvhost_ctrl: Update to use SyncpointManager.bunnei2020-11-013-9/+31
| | |
| * | hle service: nvdrv: Update to instantiate SyncpointManager.bunnei2020-11-012-5/+18
| | |
| * | hle: service: nvdrv: Implement SyncpointManager, to manage syncpoints.bunnei2020-11-013-1/+125
| | |
* | | Merge pull request #4878 from bunnei/unload-nrrbunnei2020-11-031-1/+15
|\ \ \ | |/ / |/| | hle: service: ldr: Implement UnloadNrr.
| * | hle: service: ldr: Implement UnloadNrr.bunnei2020-10-311-1/+15
| | | | | | | | | | | | - Used by Final Fantasy X/X-2 HD Remaster.
* | | Rename to align with switchbrew and remove gpu function (#4714)Levi Behunin2020-11-012-16/+10
|/ / | | | | | | | | * Rename to align with switchbrew * Rename to align with switchbrew and remove gpu function that checks if clearing should be done.
* / video_core: unbreak -Werror in NVDEC with ClangJan Beich2020-10-301-1/+1
|/ | | | | | src/core/hle/service/nvdrv/devices/nvhost_nvdec_common.cpp:41:15: error: unused variable 'OutOfMemory' [-Werror,-Wunused-const-variable] constexpr u32 OutOfMemory{static_cast<u32>(-12)}; ^
* service: Update function tablesLioncash2020-10-285-1/+7
| | | | Updates function tables according to info on SwitchBrew.
* Merge pull request #4729 from ameerj/nvdec-prodbunnei2020-10-278-288/+468
|\ | | | | video_core: NVDEC Implementation
| * video_core: NVDEC Implementationameerj2020-10-278-288/+468
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit aims to implement the NVDEC (Nvidia Decoder) functionality, with video frame decoding being handled by the FFmpeg library. The process begins with Ioctl commands being sent to the NVDEC and VIC (Video Image Composer) emulated devices. These allocate the necessary GPU buffers for the frame data, along with providing information on the incoming video data. A Submit command then signals the GPU to process and decode the frame data. To decode the frame, the respective codec's header must be manually composed from the information provided by NVDEC, then sent with the raw frame data to the ffmpeg library. Currently, H264 and VP9 are supported, with VP9 having some minor artifacting issues related mainly to the reference frame composition in its uncompressed header. Async GPU is not properly implemented at the moment. Co-Authored-By: David <25727384+ogniK5377@users.noreply.github.com>
* | hle: services: TimeZoneContentManager: This can be made explicit.bunnei2020-10-271-1/+1
|/
* Merge pull request #4828 from lioncash/lockguardRodrigo Locatti2020-10-251-1/+1
|\ | | | | general: Use template deduction guides for lock_guard
| * general: Use template deduction guides for lock_guardLioncash2020-10-251-1/+1
| | | | | | | | Same behavior, less code.
* | Merge pull request #4792 from bunnei/rtc-fixbunnei2020-10-236-188/+302
|\ \ | |/ |/| service: time: Update current time with changes to RTC setting.
| * service: time: Update current time with changes to RTC setting.bunnei2020-10-136-188/+302
| | | | | | | | - This can be used to advance time, e.g. for Pokemon Sword/Shield pokejobs.
* | core: Fix clang build pt.3Lioncash2020-10-222-13/+3
| | | | | | | | Should finally resolve building with clang.
* | Revert "core: Fix clang build"bunnei2020-10-2135-317/+246
| |
* | Merge pull request #4796 from lioncash/clangLC2020-10-2135-246/+317
|\ \ | | | | | | core: Fix clang build
| * | core: Fix clang buildLioncash2020-10-1835-246/+317
| | | | | | | | | | | | | | | | | | | | | Recent changes to the build system that made more warnings be flagged as errors caused building via clang to break. Fixes #4795
* | | Added remaining paramsDavid Marcec2020-10-201-1/+4
| | |
* | | nifm: GetAppletInfo stubDavid Marcec2020-10-201-1/+8
| | | | | | | | | | | | Fixes crash for Catherine Full Body
* | | Merge pull request #4785 from Morph1984/fs-hadesbunnei2020-10-201-2/+3
|\ \ \ | | | | | | | | filesystem: Fix CreateDirectory and DeleteFile
| * | | filesystem: Fix CreateDirectory and DeleteFileMorph2020-10-131-2/+3
| | |/ | |/| | | | | | | | | | | | | Add a check if dir is nullptr (does not exist) Fixes save game creation in Hades
* | | Merge pull request #4783 from bunnei/nvdrv-freespacebunnei2020-10-182-0/+25
|\ \ \ | | | | | | | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.
| * | | hle: service: nvdrv: Implement nvhost_as_gpu::FreeSpace.bunnei2020-10-132-0/+25
| |/ / | | | | | | | | | - This is used by Super Mario 3D All-Stars.
* | | Merge pull request #4801 from lioncash/missing-boundbunnei2020-10-181-1/+1
|\ \ \ | | | | | | | | mii/manager: Make use of unused lower bound in GetRandomValue()
| * | | mii/manager: Make use of unused lower bound in GetRandomValue()Lioncash2020-10-171-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the lower bound wasn't being used and zero was being used as the lower bound every time this function was called. This affects the outcome of some of the randomized entries a little bit, for example, the lower-bound for beard and mustache flags was supposed to be 1, not 0. Aside from these cases, the bug didn't affect anything else.
* | | | service: bcat: Check client connection before interacting with socket.bunnei2020-10-171-0/+10
|/ / / | | | | | | | | | - Fixes a crash when BCAT service is offline.
* | | Merge pull request #4784 from bunnei/cancelbufferbunnei2020-10-163-14/+53
|\ \ \ | | | | | | | | hle: service: vi: Implement BufferQueue::CancelBuffer.
| * | | hle: service: vi: Implement BufferQueue::CancelBuffer.bunnei2020-10-143-14/+53
| | |/ | |/| | | | | | | - This is used by Super Mario 3D All-Stars.
* / | service: acc: Stub IManagerForApplication::StoreOpenContext.bunnei2020-10-151-1/+7
|/ / | | | | | | - Used by Super Mario 3D All-Stars.
* / core/CMakeLists: Make some warnings errorsLioncash2020-10-139-52/+36
|/ | | | | | | | | Makes our error coverage a little more consistent across the board by applying it to Linux side of things as well. This also makes it more consistent with the warning settings in other libraries in the project. This also updates httplib to 0.7.9, as there are several warning cleanups made that allow us to enable several warnings as errors.
* Merge pull request #4736 from Morph1984/home-button-input-protection-stubbunnei2020-10-074-2/+50
|\ | | | | hid: Stub HomeButtonInputProtection service commands
| * hid: Stub HomeButtonInputProtection service commandsMorph2020-09-304-2/+50
| | | | | | | | - Used in 1-2 Switch. Given that we do not emulate the functionality of the home button yet, we can stub this for now.
* | Merge pull request #4737 from Morph1984/setshimlibraryversion-stubbunnei2020-10-075-4/+38
|\ \ | | | | | | capsrv: Stub 3 variants of SetShimLibraryVersion
| * | caps_c: Stub SetShimLibraryVersionMorph2020-09-302-1/+18
| | | | | | | | | | | | - Used by caps_su SetShimLibraryVersion
| * | caps_u: Stub SetShimLibraryVersionMorph2020-09-302-2/+14
| | | | | | | | | | | | - Used in Super Smash Bros. Ultimate
| * | caps_su: Properly stub SetShimLibraryVersionMorph2020-09-301-1/+6
| |/
* | Merge pull request #4742 from german77/InputFilterbunnei2020-10-061-49/+58
|\ \ | | | | | | HID: Only use inputs corresponding to controller type
| * | Only use inputs corresponding to controller typegerman2020-10-021-49/+58
| | |
* | | Merge pull request #4734 from german77/motionfusionbunnei2020-10-022-1/+15
|\ \ \ | |/ / |/| | HID: Add Stub for EnableSixAxisSensorFusion
| * | Stubbed EnableSixAxisSensorFusiongerman2020-09-302-1/+15
| | |
* | | Merge pull request #4291 from german77/ImplementControllerRumbleDavid2020-09-303-13/+22
|\ \ \ | | | | | | | | input_common: First implementation of controller rumble
| * | | First implementation of controller rumblegerman2020-09-293-13/+22
| | | |
* | | | Merge pull request #4726 from lioncash/appletDavid2020-09-301-1/+2
|\ \ \ \ | |_|_|/ |/| | | frontend/controller: Eliminate dependency on the global system instance
| * | | frontend/controller: Eliminate dependency on the global system instanceLioncash2020-09-261-1/+2
| |/ /
* | | Merge pull request #4705 from german77/SplitMotionPollerbunnei2020-09-305-76/+157
|\ \ \ | |_|/ |/| | HID: Use different timing for motion
| * | Use different timing for motiongerman2020-09-245-76/+157
| | |
* | | Merge pull request #1703 from DarkLordZach/nvdec-ioctlbunnei2020-09-304-3/+256
|\ \ \ | |_|/ |/| | nvdrv: Stub nvdec/vic ioctls to bypass nvdec movies
| * | service: nvhost_vic: Ignore Submit commands.bunnei2020-06-052-1/+18
| | |
| * | nvdrv: Stub nvdec/vic ioctls to bypass nvdec moviesZach Hilman2020-06-054-3/+239
| | |
* | | Merge pull request #4717 from lioncash/debugLC2020-09-251-0/+17
|\ \ \ | | | | | | | | service: Restore "unused" function
| * | | service: Restore "unused" functionLioncash2020-09-251-0/+17
| | |/ | |/| | | | | | | Turns out this function is actually used, but within a trace log.
* | | Merge pull request #4678 from Morph1984/LoadOpenContext-partial-implbunnei2020-09-243-1/+13
|\ \ \ | |/ / |/| | acc: Partially implement LoadOpenContext
| * | acc: Stub LoadOpenContextMorph2020-09-213-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is used in multiple games such as: - Clubhouse Games: 51 Worldwide Classics - Grandia HD Collection - XCOM 2 Collection - Baldur's Gate 1/2 - Dr Kawashima's Brain Training - Super Mario 3D All-Stars
* | | General: Make use of std::nullopt where applicableLioncash2020-09-224-7/+7
|/ / | | | | | | | | | | | | | | Allows some implementations to avoid completely zeroing out the internal buffer of the optional, and instead only set the validity byte within the structure. This also makes it consistent how we return empty optionals.
* | Merge pull request #4683 from Morph1984/NpadHandheldActivationMode-implbunnei2020-09-203-5/+28
|\ \ | | | | | | hid: Implement Get/SetNpadHandheldActivationMode
| * | hid: Implement Get/SetNpadHandheldActivationModeMorph2020-09-183-5/+28
| | | | | | | | | | | | - Used in Clubhouse Games: 51 Worldwide Classics
* | | Merge pull request #4643 from FearlessTobi/decrease-pad-update-intervalbunnei2020-09-191-1/+1
|\ \ \ | | | | | | | | Test: Decrease pad_update_ns
| * | | Test: Decrease pad_update_nsFearlessTobi2020-09-101-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | There have been reports of quite heavy input lag in the past. Compared to Citra for example, our pad_update_ns value is very high. So let's decrease it and see if it helps with this problem.
* | | | am: Stub GetPreviousProgramIndexMorph2020-09-182-1/+11
| | | | | | | | | | | | | | | | - Used in Super Mario 3D All-Stars
* | | | Merge pull request #4665 from lioncash/sm-kernelRodrigo Locatti2020-09-172-8/+10
|\ \ \ \ | | | | | | | | | | service/sm: Eliminate dependency on the global system instance
| * | | | service/sm: Slightly more efficient string name validationLioncash2020-09-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | We can check the end of the string first for null-termination, rather than the beginning of the string.
| * | | | service/sm: Eliminate dependency on the global system instanceLioncash2020-09-172-6/+8
| | | | |
* | | | | Merge pull request #4666 from lioncash/unused-funcRodrigo Locatti2020-09-171-22/+0
|\ \ \ \ \ | | | | | | | | | | | | service: Remove unused funcation
| * | | | | service: Remove unused funcationLioncash2020-09-171-22/+0
| |/ / / / | | | | | | | | | | | | | | | This is now completely unused, so it can be removed.
* | | | | Merge pull request #4671 from lioncash/nfp-copyRodrigo Locatti2020-09-171-10/+13
|\ \ \ \ \ | | | | | | | | | | | | command_generator/nfp: Eliminate unnecessary copies
| * | | | | nfp: Eliminate two unnecessary copiesLioncash2020-09-171-10/+13
| |/ / / / | | | | | | | | | | | | | | | | | | | | GetAmiiboBuffer() returns by const reference, so we can use a reference instead of taking the returned buffer by value.
* | | | | Merge pull request #4594 from german77/MotionHIDbunnei2020-09-174-15/+184
|\ \ \ \ \ | |/ / / / |/| | | | hid/configuration: Implement motion controls to HID
| * | | | configure_input: Hook up the motion button and checkboxMorph2020-09-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | This allows toggling motion on or off, and allows access to the motion configuration. Also changes the [waiting] text for motion buttons to Shake! as this is how motion is connected to a player.
| * | | | Add cemu hook changes related to PR #4609german2020-09-051-2/+1
| | | | |
| * | | | Remove RealMotionDevicegerman2020-09-052-7/+8
| | | | |
| * | | | controllers/npad: Simplify motion entry assignmentMorph2020-09-051-29/+18
| | | | | | | | | | | | | | | | | | | | Simplifies the motion assignment in the Dual Joycon entry and assigns index 1 of the motion entry (Motion 2) for the right joycon.
| * | | | Include HID and configuration changes related to motiongerman2020-09-054-15/+195
| | | | |
* | | | | file_sys/bis_factory: Eliminate usage of the global system accessorLioncash2020-09-171-1/+1
| | | | |
* | | | | Merge pull request #4636 from lioncash/kernel-hlebunnei2020-09-143-7/+5
|\ \ \ \ \ | |_|_|/ / |/| | | | service: Remove two usages of the global system accessor
| * | | | service: Remove two usages of the global system accessorLioncash2020-09-073-7/+5
| | |/ / | |/| | | | | | | | | | Removes more instances of reliance on global state.
* | | | Merge pull request #4634 from lioncash/blockingbunnei2020-09-123-19/+19
|\ \ \ \ | | | | | | | | | | bsd: Resolve a few warnings
| * | | | bsd: Resolve unused value within SendToImplLioncash2020-09-071-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Previously the address provided to SendToImpl would never be propagated to SendTo(). This fixes that.
| * | | | bsd: Resolve sign comparison warningsLioncash2020-09-071-3/+3
| | | | |
| * | | | sockets_translate: Make use of designated initializersLioncash2020-09-071-12/+12
| | | | | | | | | | | | | | | | | | | | Same behavior, less typing.
| * | | | blocking_worker: Make use of templated lambdaLioncash2020-09-071-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | We can simplify this a little by explicitly specifying the typename for the lambda function.
| * | | | blocking_worker: Resolve -Wdocumentation warningLioncash2020-09-071-1/+1
| |/ / /
* | | | Merge pull request #4310 from ogniK5377/apollo-1-prodbunnei2020-09-111-72/+77
|\ \ \ \ | | | | | | | | | | audio_core: Apollo Part 1, AudioRenderer refactor
| * | | | audio_core: Apollo Part 1, AudioRenderer refactorDavid Marcec2020-07-251-72/+77
| | | | |
* | | | | Merge pull request #4597 from Morph1984/mjolnir-p2bunnei2020-09-116-131/+415
|\ \ \ \ \ | |_|/ / / |/| | | | Project Mjölnir: Part 2 - Controller Applet
| * | | | Address feedbackMorph2020-09-042-0/+7
| | | | |
| * | | | applets/controller: Set min_players to have a minimum value of 1.Morph2020-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | - Some games like Shipped have a minimum requirement of 0 connected players and is undesired behavior. We must require a minimum of 1 player connected regardless of what games may ask.
| * | | | applets/controller: Implement fallback applet for the SDL frontendMorph2020-09-042-89/+0
| | | | | | | | | | | | | | | | | | | | Implement the fallback applet for the SDL frontend, connecting only the minimum amount of players required.
| * | | | applets/controller: Implement "Explain Text"Morph2020-09-042-16/+26
| | | | | | | | | | | | | | | | | | | | "Explain Text" is additional text that is shown for each player in the controller applet.
| * | | | Project Mjölnir: Part 2 - Controller AppletMorph2020-09-046-42/+398
| | | | | | | | | | | | | | | | | | | | Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | | | Merge pull request #4397 from ReinUsesLisp/bsdbunnei2020-09-069-56/+1384
|\ \ \ \ \ | |_|_|/ / |/| | | | services: Implement most of bsd:s and GetCurrentIpAddress from nifm
| * | | | service/bsd: Handle Poll with no entries accuratelyReinUsesLisp2020-07-281-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | Testing shows that Poll called with zero entries returns -1 and signals an errno of zero.
| * | | | services/bsd: Implement most of bsd:sReinUsesLisp2020-07-285-55/+911
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This implements: Socket, Poll, Accept, Bind, Connect, GetPeerName, GetSockName, Listen, Fcntl, SetSockOpt, Shutdown, Recv, RecvFrom, Send, SendTo, Write, and Close The implementation was done referencing: SwIPC, switchbrew, testing with libnx and inspecting its code, general information about bsd sockets online, and analysing official software. Not everything from these service calls is implemented, but everything that is not implemented will be logged in some way.
| * | | | service/sockets: Add worker pool abstractionReinUsesLisp2020-07-281-0/+30
| | | | | | | | | | | | | | | | | | | | | | | | | Manage worker threads with an easy to use abstraction. We can expand this to support thread deletion in the future.
| * | | | service/sockets: Add worker abstraction to execute blocking calls asynchronouslyReinUsesLisp2020-07-281-0/+132
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This abstraction allows executing blocking functions (like recvfrom on a socket configured for blocking) without blocking the service thread. It is intended to be used with SleepClientThread.
| * | | | service/sockets: Add translate functionsReinUsesLisp2020-07-282-0/+213
| | | | | | | | | | | | | | | | | | | | | | | | | These functions translate from Network enumerations/structures to guest enumerations/structures and viceversa.
| * | | | service/sockets: Add enumerations and structuresReinUsesLisp2020-07-282-0/+81
| | | | | | | | | | | | | | | | | | | | Add guest enumerations and structures used in socket services
| * | | | services/nifm: Implement GetCurrentIpAddressReinUsesLisp2020-07-281-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is trivially implemented using the Network abstraction - Used by ftpd
* | | | | hid: Implement MergeSingleJoyasDualJoyMorph2020-09-043-5/+24
| |/ / / |/| | | | | | | | | | | - Used in multiple games such as Super Mario Odyssey.
* | | | Merge pull request #4568 from lioncash/fspbunnei2020-09-031-3/+13
|\ \ \ \ | | | | | | | | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()
| * | | | fsp_srv: Resolve -Wunused-but-set-variable warningLioncash2020-08-231-1/+8
| | | | | | | | | | | | | | | | | | | | We can just log out the parameters in the meantime.
| * | | | fsp_srv: Resolve -Wmaybe_uninitialized warning in OpenSaveDataFileSystem()Lioncash2020-08-231-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | Initialize id to a deterministic value and also mark the unreachable cases in the switch with UNREACHABLE().
* | | | | Merge pull request #4564 from lioncash/file-includebunnei2020-09-031-0/+1
|\ \ \ \ \ | | | | | | | | | | | | file_sys: Replace inclusions with forward declarations where applicable
| * | | | | file_sys: Replace inclusions with forward declarations where applicableLioncash2020-08-231-0/+1
| |/ / / / | | | | | | | | | | | | | | | Same behavior, minus unnecessary inclusions where not necessary.
* | | | | yuzu: Add motion and touch configurationFearlessTobi2020-08-292-1/+12
| | | | |
* | | | | controllers/npad: Fix inconsistencies with controller connection statusesMorph2020-08-261-1/+7
| | | | |
* | | | | controllers/npad: Fix LibNX controller connection statusesMorph2020-08-261-1/+9
| | | | | | | | | | | | | | | | | | | | This allows homebrew applications to be able to properly detect connected controllers.
* | | | | controllers/npad: Fix LedPattern for P1-4Morph2020-08-261-3/+3
| | | | |
* | | | | Project Mjölnir: Part 1Morph2020-08-263-127/+111
|/ / / / | | | | | | | | | | | | | | | | Co-authored-by: James Rowe <jroweboy@gmail.com> Co-authored-by: Its-Rei <kupfel@gmail.com>
* | | | common/fileutil: Convert namespace to Common::FSLioncash2020-08-165-73/+73
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Migrates a remaining common file over to the Common namespace, making it consistent with the rest of common files. This also allows for high-traffic FS related code to alias the filesystem function namespace as namespace FS = Common::FS; for more concise typing.
* | | | Merge pull request #4526 from lioncash/core-semibunnei2020-08-152-3/+4
|\ \ \ \ | | | | | | | | | | core: Resolve several -Wextra-semi warnings
| * | | | core: Resolve several -Wextra-semi warningsLioncash2020-08-142-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | We can amend one of the cascade macros to require semicolons in order to compile. In other cases, we can just remove the superfluous semicolons.
* | | | | Merge pull request #4527 from lioncash/pessimizing2bunnei2020-08-151-2/+1
|\ \ \ \ \ | | | | | | | | | | | | software_keyboard: Resolve a pessimizing move warning
| * | | | | software_keyboard: Resolve a pessimizing move warningLioncash2020-08-141-2/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | A std::vector created in place like this is already an rvalue and doesn't need to be moved.
* / / / / time_zone_content_manager: Collapse auto and default caseLioncash2020-08-141-3/+1
|/ / / / | | | | | | | | | | | | Prevents a useless self-assignment from occurring.
* | | | General: Tidy up clang-format warnings part 2Lioncash2020-08-134-10/+11
| | | |
* | | | Merge pull request #4457 from ogniK5377/SetScreenShotPermissionbunnei2020-08-072-1/+12
|\ \ \ \ | | | | | | | | | | am: Unstub SetScreenShotPermission
| * | | | am: Unstub SetScreenShotPermissionDavid Marcec2020-07-312-1/+12
| |/ / /
* | | | common/concepts: Rename IsBaseOf to DerivedFromLioncash2020-08-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes it more inline with its currently unavailable standardized analogue std::derived_from. While we're at it, we can also make the template match the requirements of the standardized variant as well.
* | | | Merge pull request #4475 from lioncash/bqueuebunnei2020-08-051-10/+11
|\ \ \ \ | | | | | | | | | | buffer_queue: Make use of designated initializers/std::nullopt where applicable
| * | | | buffer_queue: Make use of std::nulloptLioncash2020-08-031-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | Allows compilers to eliminate unnecessary zeroing out of the optional's buffer.
| * | | | buffer_queue: Make use of designated initializersLioncash2020-08-031-5/+5
| |/ / /
* | | | Merge pull request #4401 from ogniK5377/GetIndirectLayerImageRequiredMemoryInfobunnei2020-08-051-1/+19
|\ \ \ \ | | | | | | | | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfo
| * | | | vi: IApplicationDisplayService:GetIndirectLayerImageRequiredMemoryInfoDavid Marcec2020-07-211-1/+19
| | |/ / | |/| | | | | | | | | | Needed for dark souls and monster hunter
* | | | Merge pull request #4430 from bunnei/new-gpu-vmmbunnei2020-08-054-93/+227
|\ \ \ \ | | | | | | | | | | hle: nvdrv: Rewrite of GPU memory management.
| * | | | Update src/core/hle/service/nvdrv/devices/nvmap.cppbunnei2020-07-281-1/+1
| | | | | | | | | | | | | | | Co-authored-by: LC <mathew1800@gmail.com>
| * | | | hle: nvdrv: Rewrite of GPU memory management.bunnei2020-07-264-93/+227
| | | | |
* | | | | Merge pull request #4481 from lioncash/cpp-depDavid2020-08-043-21/+21
|\ \ \ \ \ | | | | | | | | | | | | yuzu: Resolve C++20 deprecation warnings related to lambda captures
| * | | | | yuzu: Resolve C++20 deprecation warnings related to lambda capturesLioncash2020-08-033-21/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | C++20 deprecates capturing the this pointer via the '=' capture. Instead, we replace it or extend the capture specification.
* | | | | | Merge pull request #4474 from lioncash/hle-profileDavid2020-08-041-17/+26
|\ \ \ \ \ \ | | | | | | | | | | | | | | profile_manager: Make use of designated initializers
| * | | | | | profile_manager: Make use of std::nulloptLioncash2020-08-031-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows some implementations to completely avoid unnecessarily zeroing out the internal buffer.
| * | | | | | profile_manager: Make use of designated initializersLioncash2020-08-031-13/+22
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | More compact code.
* | | | | | Merge pull request #4456 from Morph1984/stub-really-long-fs-funcbunnei2020-08-045-34/+69
|\ \ \ \ \ \ | | | | | | | | | | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttribute
| * | | | | | minor nitsMorph2020-07-311-1/+3
| | | | | | |
| * | | | | | fsp-srv: Stub Read/WriteSaveDataFileSystemExtraDataWithMaskBySaveDataAttributeMorph2020-07-302-23/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Stub these 2 service commands required for Animal Crossing: New Horizons Update 1.4.0
| * | | | | | fs: Rename SaveDataDescriptor to SaveDataAttributeMorph2020-07-303-12/+12
| |/ / / / /
* | | | | | Merge pull request #4482 from lioncash/ldr-signbunnei2020-08-031-3/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/ldr: Resolve sign mismatch warnings
| * | | | | | service/ldr: Resolve sign mismatch warningsLioncash2020-08-031-3/+2
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | We were performing an int < size_t comparison. We can just correct the type of the induction variable.
* / | | | | sm: Make use of IsBaseOf for GetServiceDavid Marcec2020-08-031-3/+2
|/ / / / /
* / / / / ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer (#4465)David2020-08-038-16/+14
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * ipc: Allow all trivially copyable objects to be passed directly into WriteBuffer With the support of C++20, we can use concepts to deduce if a type is an STL container or not. * More agressive concept for stl containers * Add -fconcepts * Move to common namespace * Add Common::IsBaseOf
* | | | core_timing: Make use of uintptr_t to represent user_dataLioncash2020-07-283-5/+7
| | | | | | | | | | | | | | | | Makes the interface future-proofed for supporting other platforms in the event we ever support platforms with differing pointer sizes. This way, we have a type in place that is always guaranteed to be able to represent a pointer exactly.
* | | | remove unused variable;CrazyMax2020-07-271-1/+0
| | | |
* | | | nvflinger: Mark interface functions with return values as [[nodiscard]]Lioncash2020-07-261-16/+14
| | | | | | | | | | | | | | | | | | | | | | | | Not using the return value of these functions are undeniably the source of a bug. This way we allow compilers to loudly make any future misuses evident.
* | | | nvflinger: Use return value of Lock()Lioncash2020-07-263-4/+4
|/ / / | | | | | | | | | | | | comex reported in #4424 that we were incorrectly discarding the return value of Lock() which is correct.
* | | Merge pull request #4350 from ogniK5377/hid-update-connectedbunnei2020-07-252-33/+37
|\ \ \ | | | | | | | | hid: Only update keyboard & debug pad inputs if enabled
| * | | hid: Only update keyboard & debug pad inputs if enabledDavid Marcec2020-07-162-33/+37
| | | | | | | | | | | | | | | | Previously we would ignore this setting and would update the states regardless of the user setting
* | | | Address issuesDavid Marcec2020-07-201-2/+2
| | | |
* | | | swkbd: Return result for Calc request for inlined swkbdDavid Marcec2020-07-192-13/+49
| |/ / |/| | | | | | | | Fixes random swkbd popups in monster hunter
* | | Merge pull request #4348 from lioncash/nanobunnei2020-07-183-20/+23
|\ \ \ | | | | | | | | core_timing: Make usage of nanoseconds more consistent in the interface
| * | | core_timing: Make TimedCallback take std::chrono::nanosecondsLioncash2020-07-163-12/+10
| | | | | | | | | | | | | | | | Enforces our desired time units directly with a concrete type.
| * | | core_timing: Make use of std::chrono with ScheduleEventLioncash2020-07-162-11/+16
| |/ /
* | | Merge pull request #4345 from Morph1984/fix-createfilebunnei2020-07-181-0/+4
|\ \ \ | | | | | | | | filesystem: Create subdirectories prior to creating a file
| * | | Add comment to clarify the nullptr checkMorph2020-07-161-0/+1
| | | |
| * | | filesystem: Create subdirectories prior to creating a fileMorph2020-07-161-0/+3
| |/ / | | | | | | | | | | | | If subdirectories exist in the given path parameter and don't exist in the real filesystem create them prior to creating the files within. This fixes the softlocks upon save creation in The Legend of Zelda: Breath of the Wild
* | | Merge pull request #4365 from lioncash/miibunnei2020-07-181-53/+54
|\ \ \ | | | | | | | | mii/manager: Make use of designated initializers
| * | | mii/manager: Make use of designated initializersLioncash2020-07-171-53/+54
| | | | | | | | | | | | | | | | Allows returning the structure in a more concise manner.
* | | | mii/manager: Resolve sign mismatch warningsLioncash2020-07-171-3/+3
|/ / / | | | | | | | | | | | | Previously the loop termination condition was testing variables of different signedness.
* | | Merge pull request #4292 from bunnei/mii-rewritebunnei2020-07-178-912/+3265
|\ \ \ | |/ / |/| | hle: service: mii: Rewrite service to properly support creation of random and default miis.
| * | hle: service: mii: Rewrite service to properly support creation of random and default miis.bunnei2020-07-128-912/+3265
| | |
* | | Merge pull request #4275 from CrazyMax/desired_languagebunnei2020-07-121-1/+13
|\ \ \ | | | | | | | | AM: fix GetDesiredLanguage:
| * | | AM: fix GetDesiredLanguage:CrazyMax2020-07-081-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | try to get a control metadata from application update when is failed to get from the basic version. Tested on Kirby Star Allies
* | | | Merge pull request #4203 from VolcaEM/servicesbunnei2020-07-1126-154/+282
|\ \ \ \ | |_|/ / |/| | | service: Update function tables
| * | | Rename two functions in NSVolcaEM2020-07-021-2/+2
| | | | | | | | | | | | | | | | - Rename "GetShellEvent" to "GetShellEventHandle" - Rename "LaunchApplicationFromHost" to "LaunchApplication"
| * | | Rename GetApplicationArea2 to GetApplicationAreaSizeVolcaEM2020-07-021-2/+2
| | | |
| * | | Remove duplicate functionsVolcaEM2020-06-291-2/+0
| | | |
| * | | Use decimal instead of hexadecimalVolcaEM2020-06-291-3/+5
| | | | | | | | | | | | Co-authored-by: David <25727384+ogniK5377@users.noreply.github.com>
| * | | Fix typoVolcaEM2020-06-291-1/+1
| | | |
| * | | Clang-formatVolcaEM2020-06-291-1/+1
| | | |
| * | | service: Update function tablesVolcaEM2020-06-2927-157/+285
| | | |
* | | | configuration: implement per-game configurations (#4098)lat9nq2020-07-105-21/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Switch game settings to use a pointer In order to add full per-game settings, we need to be able to tell yuzu to switch to using either the global or game configuration. Using a pointer makes it easier to switch. * configuration: add new UI without changing existing funcitonality The new UI also adds General, System, Graphics, Advanced Graphics, and Audio tabs, but as yet they do nothing. This commit keeps yuzu to the same functionality as originally branched. * configuration: Rename files These weren't included in the last commit. Now they are. * configuration: setup global configuration checkbox Global config checkbox now enables/disables the appropriate tabs in the game properties dialog. The use global configuration setting is now saved to the config, defaulting to true. This also addresses some changes requested in the PR. * configuration: swap to per-game config memory for properties dialog Does not set memory going in-game. Swaps to game values when opening the properties dialog, then swaps back when closing it. Uses a `memcpy` to swap. Also implements saving config files, limited to certain groups of configurations so as to not risk setting unsafe configurations. * configuration: change config interfaces to use config-specific pointers When a game is booted, we need to be able to open the configuration dialogs without changing the settings pointer in the game's emualtion. A new pointer specific to just the configuration dialogs can be used to separate changes to just those config dialogs without affecting the emulation. * configuration: boot a game using per-game settings Swaps values where needed to boot a game. * configuration: user correct config during emulation Creates a new pointer specifically for modifying the configuration while emulation is in progress. Both the regular configuration dialog and the game properties dialog now use the pointer Settings::config_values to focus edits to the correct struct. * settings: split Settings::values into two different structs By splitting the settings into two mutually exclusive structs, it becomes easier, as a developer, to determine how to use the Settings structs after per-game configurations is merged. Other benefits include only duplicating the required settings in memory. * settings: move use_docked_mode to Controls group `use_docked_mode` is set in the input settings and cannot be accessed from the system settings. Grouping it with system settings causes it to be saved with per-game settings, which may make transferring configs more difficult later on, especially since docked mode cannot be set from within the game properties dialog. * configuration: Fix the other yuzu executables and a regression In main.cpp, we have to get the title ID before the ROM is loaded, else the renderer will reflect only the global settings and now the user's game specific settings. * settings: use a template to duplicate memory for each setting Replaces the type of each variable in the Settings::Values struct with a new class that allows basic data reading and writing. The new struct Settings::Setting duplicates the data in memory and can manage global overrides per each setting. * configuration: correct add-ons config and swap settings when apropriate Any add-ons interaction happens directly through the global values struct. Swapping bewteen structs now also includes copying the necessary global configs that cannot be changed nor saved in per-game settings. General and System config menus now update based on whether it is viewing the global or per-game settings. * settings: restore old values struct No longer needed with the Settings::Setting class template. * configuration: implement hierarchical game properties dialog This sets the apropriate global or local data in each setting. * clang format * clang format take 2 can the docker container save this? * address comments and style issues * config: read and write settings with global awareness Adds new functions to read and write settings while keeping the global state in focus. Files now generated per-game are much smaller since often they only need address the global state. * settings: restore global state when necessary Upon closing a game or the game properties dialog, we need to restore all global settings to the original global state so that we can properly open the configuration dialog or boot a different game. * configuration: guard setting values incorrectly This disables setting values while a game is running if the setting is overwritten by a per game setting. * config: don't write local settings in the global config Simple guards to prevent writing the wrong settings in the wrong files. * configuration: add comments, assume less, and clang format No longer assumes that a disabled UI element means the global state is turned off, instead opting to directly answer that question. Still however assumes a game is running if it is in that state. * configuration: fix a logic error Should not be negated * restore settings' global state regardless of accept/cancel Fixes loading a properties dialog and causing the global config dialog to show local settings. * fix more logic errors Fixed the frame limit would set the global setting from the game properties dialog. Also strengthened the Settings::Setting member variables and simplified the logic in config reading (ReadSettingGlobal). * fix another logic error In my efforts to guard RestoreGlobalState, I accidentally negated the IsPowered condition. * configure_audio: set toggle_stretched_audio to tristate * fixed custom rtc and rng seed overwriting the global value * clang format * rebased * clang format take 4 * address my own review Basically revert unintended changes * settings: literal instead of casting "No need to cast, use 1U instead" Thanks, Morph! Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> * Revert "settings: literal instead of casting " This reverts commit 95e992a87c898f3e882ffdb415bb0ef9f80f613f. * main: fix status buttons reporting wrong settings after stop emulation * settings: Log UseDockedMode in the Controls group This should have happened when use_docked_mode was moved over to the controls group internally. This just reflects this in the log. * main: load settings if the file has a title id In other words, don't exit if the loader has trouble getting a title id. * use a zero * settings: initalize resolution factor with constructor instead of casting * Revert "settings: initalize resolution factor with constructor instead of casting" This reverts commit 54c35ecb46a29953842614620f9b7de1aa9d5dc8. * configure_graphics: guard device selector when Vulkan is global Prevents the user from editing the device selector if Vulkan is the global renderer backend. Also resets the vulkan_device variable when the users switches back-and-forth between global and Vulkan. * address reviewer concerns Changes function variables to const wherever they don't need to be changed. Sets Settings::Setting to final as it should not be inherited from. Sets ConfigurationShared::use_global_text to static. Co-Authored-By: VolcaEM <volcaem@users.noreply.github.com> * main: load per-game settings after LoadROM This prevents `Restart Emulation` from restoring the global settings *after* the per-game settings were applied. Thanks to BSoDGamingYT for finding this bug. * Revert "main: load per-game settings after LoadROM" This reverts commit 9d0d48c52d2dcf3bfb1806cc8fa7d5a271a8a804. * main: only restore global settings when necessary Loading the per-game settings cannot happen after the ROM is loaded, so we have to specify when to restore the global state. Again thanks to BSoD for finding the bug. * configuration_shared: address reviewer concerns except operator overrides Dropping operator override usage in next commit. Co-Authored-By: LC <lioncash@users.noreply.github.com> * settings: Drop operator overrides from Setting template Requires using GetValue and SetValue explicitly. Also reverts a change that broke title ID formatting in the game properties dialog. * complete rebase * configuration_shared: translate "Use global configuration" Uses ConfigurePerGame to do so, since its usage, at least as of now, corresponds with ConfigurationShared. * configure_per_game: address reviewer concern As far as I understand, it prevents the program from unnecessarily copying strings. Co-Authored-By: LC <lioncash@users.noreply.github.com> Co-authored-by: Morph <39850852+Morph1984@users.noreply.github.com> Co-authored-by: VolcaEM <volcaem@users.noreply.github.com> Co-authored-by: LC <lioncash@users.noreply.github.com>
* | | | Merge pull request #4248 from Morph1984/CreateManagedDisplaySeparableLayerbunnei2020-07-102-1/+20
|\ \ \ \ | |_|/ / |/| | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayer
| * | | AM/ISelfController: Stub CreateManagedDisplaySeparableLayerMorph2020-07-052-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | Stub this by sending 1 layer id instead of 2 as yuzu does not support multiple layers per display. No adverse side effects have been observed. - Used by Animal Crossing: New Horizons Update 1.3.0
* | | | GetDisplayVersion should return a null-terminated version string.CrazyMax2020-07-071-4/+16
|/ / / | | | | | | | | | also, in case of failed to get of the basic version, we will try get it from application update.
* | | Merge pull request #3924 from ogniK5377/GetKeyCodeMapbunnei2020-07-032-2/+72
|\ \ \ | | | | | | | | Implement GetKeyCodeMap & GetKeyCodeMap2
| * | | Move GetKeyCodeMapImpl to an anonymous namespaceDavid Marcec2020-06-241-19/+19
| | | |
| * | | Fixed logging outputDavid Marcec2020-06-241-1/+1
| | | |
| * | | Implement GetKeyCodeMap & GetKeyCodeMap2David Marcec2020-06-242-2/+72
| | | | | | | | | | | | | | | | Closes #3919
* | | | Merge pull request #4193 from ogniK5377/GetIndirectLayerConsumerHandle-stubbunnei2020-07-031-1/+13
|\ \ \ \ | | | | | | | | | | am: Stub GetIndirectLayerConsumerHandle
| * | | | am: Stub GetIndirectLayerConsumerHandleDavid Marcec2020-06-281-1/+13
| | | | | | | | | | | | | | | | | | | | Needed by Monster Hunter Generations Ultimate
* | | | | Merge pull request #4192 from ogniK5377/acc-ListOpenContextStoredUsers-stubbunnei2020-07-035-4/+14
|\ \ \ \ \ | | | | | | | | | | | | acc: ListOpenContextStoredUsers partial stub
| * | | | | acc: ListOpenContextStoredUsers partial stubDavid Marcec2020-06-285-4/+14
| |/ / / / | | | | | | | | | | | | | | | Needed by Baldur's Gate 1/2
* | | | | key_manager: Correct casing of instance()Lioncash2020-07-011-1/+1
| | | | | | | | | | | | | | | | | | | | Our codebase uppercases member function names.
* | | | | Merge pull request #3967 from FearlessTobi/keys-singletonDavid2020-07-011-1/+1
|\ \ \ \ \ | | | | | | | | | | | | crypto: Make KeyManager a singleton class
| * | | | | crypto: Make KeyManager a singleton classFearlessTobi2020-05-201-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we were reading the keys everytime a KeyManager object was created, causing yuzu to reread the keys file multiple hundreds of times when loading the game list. With this change, it is only loaded once. On my system, this decreased game list loading times by a factor of 20.
* | | | | | Merge pull request #4153 from ogniK5377/prepo-multibufbunnei2020-07-011-1/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | prepo: : Don't read extra buffer from report unless passed
| * | | | | | prepo: : Don't read extra buffer from report unless passedDavid Marcec2020-06-241-1/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prepo doesn't always pass a secondary buffer, we assume it always does which leads to a bad read.
* | | | | | | Merge pull request #3955 from FernandoS27/prometheus-2bbunnei2020-06-2819-43/+103
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Remake Kernel Scheduling, CPU Management & Boot Management (Prometheus)
| * | | | | | | NvFlinger: Clang Format.Fernando Sahmkow2020-06-271-1/+1
| | | | | | | |
| * | | | | | | Services/NvFlinger: Do vSync in a sepparate thread on Multicore.Fernando Sahmkow2020-06-272-3/+60
| | | | | | | |
| * | | | | | | General: Cleanup legacy code.Fernando Sahmkow2020-06-271-1/+1
| | | | | | | |
| * | | | | | | FrameLimiting: Enable frame limiting for single core.Fernando Sahmkow2020-06-271-0/+1
| | | | | | | |
| * | | | | | | NVDRV: Remove frame limiting as Host Timing already takes care.Fernando Sahmkow2020-06-271-1/+0
| | | | | | | |
| * | | | | | | NVFlinger: Lock race condition between CPU, Host Timing, VSync.Fernando Sahmkow2020-06-273-0/+11
| | | | | | | |
| * | | | | | | General: Recover Prometheus project from harddrive failure Fernando Sahmkow2020-06-2716-39/+31
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit: Implements CPU Interrupts, Replaces Cycle Timing for Host Timing, Reworks the Kernel's Scheduler, Introduce Idle State and Suspended State, Recreates the bootmanager, Initializes Multicore system.
* | | | | | | ldr: Cleanup NRO & NRR structsDavid Marcec2020-06-281-8/+8
| | | | | | |
* | | | | | | Merge pull request #4026 from VolcaEM/ldrDavid2020-06-281-38/+73
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ldr: Update NRR/NRO structs
| * | | | | | | Move SHA256Hash to its original positionVolcaEM2020-06-181-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | It's not needed to have it in its previous position anymore
| * | | | | | | Remove unnecessary pragmasVolcaEM2020-06-161-8/+0
| | | | | | | |
| * | | | | | | Revert IsValidNRO refactor but make it more readableVolcaEM2020-06-161-26/+13
| | | | | | | |
| * | | | | | | Update assert stringVolcaEM2020-06-161-1/+1
| | | | | | | |
| * | | | | | | Clang-format againVolcaEM2020-06-141-2/+2
| | | | | | | |
| * | | | | | | Use consistent variable namesVolcaEM2020-06-141-4/+4
| | | | | | | |
| * | | | | | | Clang-formatVolcaEM2020-06-141-1/+2
| | | | | | | |
| * | | | | | | Make assert strings consistentVolcaEM2020-06-141-3/+3
| | | | | | | |
| * | | | | | | Attempt to fix crashes in SSBU and refactor IsValidNROVolcaEM2020-06-141-36/+59
| | | | | | | |
| * | | | | | | Address review commentsVolcaEM2020-06-021-4/+4
| | | | | | | |
| * | | | | | | Add comment to nrr_kindVolcaEM2020-05-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | According to Atmosphére (https://github.com/Atmosphere-NX/Atmosphere/blob/c7026b90940a1d88f9c10a6d98263bf22e654fa5/libraries/libstratosphere/include/stratosphere/ro/ro_types.hpp), nrr_kind (Atmosphére calls it "type") is 7.0.0+
| * | | | | | | ldr: Update NRR/NRO structs VolcaEM2020-05-311-40/+72
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew pages: https://switchbrew.org/wiki/NRR https://switchbrew.org/wiki/NRO
* | | | | | | Merge pull request #4184 from VolcaEM/patch-9David2020-06-281-0/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | grc: Update function table
| * | | | | | | Oops (fix typo)VolcaEM2020-06-271-1/+1
| | | | | | | |
| * | | | | | | grc: Update function tableVolcaEM2020-06-271-0/+3
| | |/ / / / / | |/| | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/GRC_services
* | | | | | | Merge pull request #4185 from VolcaEM/patch-10David2020-06-281-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | lbl: Update function table
| * | | | | | | lbl: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Backlight_services
* | | | | | | Merge pull request #4186 from VolcaEM/patch-11David2020-06-281-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ldn: Update function table
| * | | | | | | ldn: Update function tableVolcaEM2020-06-271-0/+1
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/LDN_services
* | | | | | | Merge pull request #4187 from VolcaEM/patch-12David2020-06-281-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | mig: Update function table
| * | | | | | | mig: Update function tableVolcaEM2020-06-271-0/+6
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Migration_services
* | | | | | | Merge pull request #4188 from VolcaEM/patch-13David2020-06-281-16/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | mm: Update function table
| * | | | | | | mm: Update function tableVolcaEM2020-06-271-16/+16
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Display_services
* | | | | | | Merge pull request #4189 from VolcaEM/patch-14David2020-06-281-10/+10
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ncm: Update function table
| * | | | | | | ncm: Update function tableVolcaEM2020-06-271-10/+10
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/NCM_services ILocationResolver's 16, 17, 18 and 19 have unofficial names
* | | | | | | Merge pull request #4190 from VolcaEM/patch-15David2020-06-281-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nfc: Update function table
| * | | | | | | nfc: Update function tableVolcaEM2020-06-271-3/+3
| |/ / / / / / | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/NFC_services
* / / / / / / friend: Update function tableVolcaEM2020-06-271-0/+6
|/ / / / / /
* | | | | | Merge pull request #4158 from Morph1984/capsbunnei2020-06-2714-57/+69
|\ \ \ \ \ \ | | | | | | | | | | | | | | caps: Use enum classes and check struct sizes on compile time
| * | | | | | caps_u: Fix GetAlbumContentsFileListForApplication stubMorph2020-06-261-9/+15
| | | | | | |
| * | | | | | caps: Use enum classes and check struct sizes on compile timeMorph2020-06-261-34/+40
| | | | | | |
| * | | | | | caps: Update copyright headersMorph2020-06-2614-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated to "yuzu Emulator Project"
* | | | | | | Merge pull request #4154 from ogniK5377/swkbd-nullptrbunnei2020-06-271-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Prevent nullptr dereference on swkbd error case
| * | | | | | | Prevent nullptr dereference on swkbd error caseDavid Marcec2020-06-241-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #4178 from VolcaEM/patch-6David2020-06-271-4/+43
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | es: Update function table
| * | | | | | | Use better names for "Unknown"sVolcaEM2020-06-271-39/+39
| | | | | | | |
| * | | | | | | Update function namesVolcaEM2020-06-271-4/+4
| | | | | | | |
| * | | | | | | es: Update function tableVolcaEM2020-06-271-2/+41
| | |/ / / / / | |/| | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/ETicket_services
* | | | | | | btm: Give better names for unknown functionsDavid Marcec2020-06-271-5/+5
| | | | | | |
* | | | | | | btdrv: Update function table (#4174)VolcaEM2020-06-271-83/+84
| | | | | | | | | | | | | | | | | | | | | * btdrv: Update function table
* | | | | | | bpc: Update function tables (#4173)VolcaEM2020-06-271-7/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bpc: Update function tables This was based on Switchbrew page: https://switchbrew.org/wiki/PCV_services
* | | | | | | bcat: Update function tables and add missing classes (#4172)VolcaEM2020-06-272-0/+5
| | | | | | | | | | | | | | | | | | | | | * bcat: Update function tables and add missing classes
* | | | | | | am: Update function tables and add missing classes (#4169)VolcaEM2020-06-273-17/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * am: Update function tables and add missing classes * Remove comments (1/5) * Remove comments (2/5) * Remove comments (3/5) * Remove comments (4/5) * Remove comments (5/5) * Remove unused classes (1/2) * Remove unused classes (2/2)
* | | | | | | aoc: Update function table (#4170)VolcaEM2020-06-271-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * aoc: Update function table * Remove comments
* | | | | | | Merge pull request #4177 from VolcaEM/patch-5LC2020-06-271-71/+76
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | btm: Update function tables
| * | | | | | | btm: Update function tablesVolcaEM2020-06-271-71/+76
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/BTM_services "No comment" edition
* / / / / / / eupld: Update function tableVolcaEM2020-06-271-0/+1
|/ / / / / / | | | | | | | | | | | | This was based on Switchbrew page: https://switchbrew.org/wiki/Error_Upload_services
* | | | | | Merge pull request #4141 from Morph1984/SevenSixAxisSensorDavid2020-06-252-21/+85
|\ \ \ \ \ \ | |/ / / / / |/| | | | | hid: Stub a series of "SevenSixAxisSensor" service commands
| * | | | | hid: Stub a series of "SevenSixAxisSensor" service commandsMorph2020-06-242-21/+85
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | - Used by Captain Toad: Treasure Tracker Update 1.3.0 While we're at it, fix the input parameters for SetIsPalmaAllConnectable and SetPalmaBoostMode
* | | | | Merge pull request #4138 from Morph1984/GyroscopeZeroDriftModebunnei2020-06-244-6/+56
|\ \ \ \ \ | | | | | | | | | | | | hid: Implement Get/ResetGyroscopeZeroDriftMode
| * | | | | hid: Implement Get/ResetGyroscopeZeroDriftModeMorph2020-06-214-6/+56
| |/ / / / | | | | | | | | | | | | | | | - Used by Captain Toad Treasure Tracker
* | | | | Merge pull request #4128 from lioncash/move2bunnei2020-06-241-2/+2
|\ \ \ \ \ | | | | | | | | | | | | software_keyboard: Eliminate trivial redundant copies
| * | | | | software_keyboard: Eliminate trivial redundant copiesLioncash2020-06-201-2/+2
| |/ / / / | | | | | | | | | | | | | | | We can just make use of moves here to get rid of two redundant copies
* | | | | lm: Silence no return value warningMorph2020-06-231-1/+2
| | | | |
* | | | | account: Update function tables and add missing classes (#4145)VolcaEM2020-06-225-42/+384
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * account: Update function tables and add missing classes * clang-format * Add missing "public" * Add missing public again * Add missing final
* | | / nvdrv: Fix GetTPCMasks for ioctl3David Marcec2020-06-102-21/+22
| |_|/ |/| | | | | | | | Fixes animal crossing svcBreak on launch
* | | Clang-formatVolcaEM2020-06-011-2/+1
| | |
* | | hid: Stub GetXpadIDsVolcaEM2020-06-012-1/+14
|/ / | | | | Allows Minecraft: Nintendo Switch Edition (a.k.a. old Minecraft) to boot and go ingame
* | clang-formatVolcaEM2020-05-211-1/+2
| |
* | nifm: correct assert in CreateTemporaryNetworkProfileVolcaEM2020-05-211-1/+1
| | | | | | | | | | | | | | | | | | This has been wrong since https://github.com/yuzu-emu/yuzu/commit/0432af5ad1ec34f02071f6fdc5fc78149b059f18 I haven't found a game that called this function (and I haven't tried this on a real Switch), and because of this I haven't been able to check if the number in assert OR the string in the assert is wrong, but one of the two is wrong: NetworkProfileData is 0x18E, while SfNetworkProfileData is 0x17C, according to Switchbrew Switchbrew doesn't officially say that NetworkProfileData's size is 0x18E but it's possible to calculate its size since Switchbrew provides the size and the offset of all the components of NetworkProfileData (which isn't currently implemented in yuzu, alongside SfNetworkProfileData) NetworkProfileData documentation: https://switchbrew.org/wiki/Network_Interface_services#NetworkProfileData SfNetworkProfileData documentation: https://switchbrew.org/wiki/Network_Interface_services#SfNetworkProfileData Since I trust ogniK's work on reversing NIFM, I'd assume this was just a typo in the string
* | Merge pull request #3926 from ogniK5377/keyboard-statesbunnei2020-05-191-3/+4
|\ \ | | | | | | hid: Clear keyboard states & fix logic issue
| * | hid: Clear keyboard states & fix logic issueDavid Marcec2020-05-121-3/+4
| | | | | | | | | | | | Previously we never cleared the states of the entries and the key would stay held down, also looping over the key bytes for each key lead to setting every bit for the key state instead of the key we wanted
* | | Merge pull request #3665 from bunnei/device-savebunnei2020-05-162-1/+38
|\ \ \ | | | | | | | | FS: Improve emulation of device saves
| * | | service: fsp_srv: Stub implementation of OpenMultiCommitManager.bunnei2020-05-112-1/+38
| |/ /
* | | nv_flinger: Use enum for pixel format instead of u32David Marcec2020-05-162-3/+11
| | |
* | | time_zone: Use std::chrono::seconds for strong typing.bunnei2020-05-131-1/+1
| | |
* | | hle: service: time_zone_manager: Use current time zone setting.bunnei2020-05-112-3/+32
| | |
* | | Stub SendKeyboardLockKeyEventDavid Marcec2020-05-112-1/+11
|/ / | | | | | | Needed for Puchikon 4 SmileBASIC 1.0.0
* / Replace externals with Conan (#3735)James Rowe2020-05-081-1/+1
|/ | | | | | | | | | | | | | | | | | | | | * Remove git submodules that will be loaded through conan * Move custom Find modules to their own folder * Use conan for downloading missing external dependencies * CI: Change the yuzu source folder user to the user that the containers run on * Attempt to remove dirty mingw build hack * Install conan on the msvc build * Only set release build type when using not using multi config generator * Re-add qt bundled to workaround an issue with conan qt not downloading prebuilt binaries * Add workaround for submodules that use legacy CMAKE variables * Re-add USE_BUNDLED_QT on the msvc build bot
* Merge pull request #3843 from ogniK5377/GetPopFromGeneralChannelEventbunnei2020-05-043-4/+20
|\ | | | | am: IHomeMenuFunctions:GetPopFromGeneralChannelEvent
| * am: IHomeMenuFunctions:GetPopFromGeneralChannelEventDavid Marcec2020-05-013-4/+20
| | | | | | | | QLaunch 1.0.0
* | Merge pull request #3822 from ogniK5377/GetAccountIdbunnei2020-05-041-5/+8
|\ \ | | | | | | acc: Return a unique value per account for GetAccountId
| * | acc: Return a unique value per account for GetAccountIdDavid Marcec2020-04-291-5/+8
| | |
* | | Merge pull request #3824 from ogniK5377/GetDisplayVersionbunnei2020-05-031-3/+14
|\ \ \ | | | | | | | | am: Properly implement GetDisplayVersion
| * | | Update src/core/hle/service/am/am.cppbunnei2020-05-031-1/+1
| | | | | | | | | | | | Co-authored-by: Mat M. <mathew1800@gmail.com>
| * | | am: Properly implement GetDisplayVersionDavid Marcec2020-04-291-3/+14
| |/ / | | | | | | | | | Properly implement IApplicationFunctions::GetDisplayVersion
* | | Merge pull request #3811 from ogniK5377/audin-initbunnei2020-05-022-5/+94
|\ \ \ | | | | | | | | audin:u: ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecified
| * | | marked stubsDavid Marcec2020-04-281-4/+5
| | | |
| * | | Audin:u ListAudioIns, OpenAudioIn, ListAudioInsAuto, OpenAudioInAuto, ListAudioInsAutoFiltered, OpenAudioInProtocolSpecifiedDavid Marcec2020-04-282-5/+93
| | | | | | | | | | | | | | | | Closes #2874
* | | | Merge pull request #3833 from qwell/caps_su-32-stubbunnei2020-05-022-1/+13
|\ \ \ \ | | | | | | | | | | Add stub for caps:su SetShimLibraryVersion
| * | | | caps:su Stub out SetShimLibraryVersionJason Parker2020-04-302-1/+13
| | | | | | | | | | | | | | | | | | | | Used by Animal Crossing: New Horizons when trying to take a picture.
* | | | | Merge pull request #3821 from ogniK5377/InitializeApplicationInfo-fixbunnei2020-05-022-22/+15
|\ \ \ \ \ | | | | | | | | | | | | acc: Fix InitializeApplicationInfo
| * | | | | acc: Fix InitializeApplicationInfoDavid Marcec2020-04-292-22/+15
| | |_|/ / | |/| | | | | | | | | | | | | We're not suppose to pop a u64, should just read the sent pid and check that
* | | | | Merge pull request #3812 from ogniK5377/lisst-qualified-usersbunnei2020-05-025-3/+15
|\ \ \ \ \ | | | | | | | | | | | | account: ListQualifiedUsers
| * | | | | Updated comment to reflect ListQualifiedUsers betterDavid Marcec2020-04-281-1/+3
| | | | | |
| * | | | | account: ListQualifiedUsersDavid Marcec2020-04-285-3/+13
| | |_|/ / | |/| | | | | | | | | | | | | Closes #2844
* | | | | nvdrv: Fix GetGpuTime stack corruptionDavid Marcec2020-05-011-2/+3
| |_|_|/ |/| | | | | | | | | | | IoctlGetGpuTime should be 16 bytes, not 8.
* | | | Merge pull request #3823 from ogniK5377/setvrmodeMat M2020-04-302-16/+6
|\ \ \ \ | | | | | | | | | | am: IsVrModeEnabled & SetVrModeEnabled fixes
| * | | | am: IsVrModeEnabled & SetVrModeEnabled fixesDavid Marcec2020-04-292-16/+6
| | |/ / | |/| | | | | | | | | | | | | | Return the proper state of vr mode for IsVrModeEnabled We should not return an error for SetVrModeEnabled. When VR Mode is turned on, it signals to lbl to turn vr mode on, not return an error code
* | | | Merge pull request #3830 from ogniK5377/GetFriendInvitationStorageChannelEventMat M2020-04-302-1/+14
|\ \ \ \ | | | | | | | | | | am: GetFriendInvitationStorageChannelEvent
| * | | | am: GetFriendInvitationStorageChannelEventDavid Marcec2020-04-302-1/+14
| |/ / / | | | | | | | | | | | | Closes #3829
* | | | Merge pull request #3835 from ogniK5377/GetFreeSpaceSize-GetTotalSpaceSizeMat M2020-04-301-2/+2
|\ \ \ \ | | | | | | | | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSize
| * | | | fs-srv: GetFreeSpaceSize & GetTotalSpaceSizeDavid Marcec2020-04-301-2/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | Closes #3533 Turns out the functions were already implemented but just never added
* | | | Merge pull request #3832 from ogniK5377/nim-eca-CreateServerInterfaceMat M2020-04-301-1/+69
|\ \ \ \ | | | | | | | | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterface
| * | | | nim: CreateServerInterface, CreateAccessorInterface, CreateAsyncInterfaceDavid Marcec2020-04-301-1/+69
| |/ / / | | | | | | | | | | | | Closes #3026
* | | | Merge pull request #3831 from ogniK5377/caps-su-namesMat M2020-04-301-0/+3
|\ \ \ \ | | |_|/ | |/| | caps: Add missing service names to caps:su
| * | | caps: Add missing service names to caps:suDavid Marcec2020-04-301-0/+3
| |/ / | | | | | | | | | SetShimLibraryVersion, SaveScreenShotEx1 & SaveScreenShotEx2 were missing
* / / psm: Mark as debug instead of warningDavid Marcec2020-04-291-7/+14
|/ / | | | | | | No point to emulate battery life. However options are broken out if we ever want to add a setting for it
* | Don't fail silently for vi, sm, set and ns servicesDavid Marcec2020-04-294-3/+27
| |
* | style: Change AMs & Glues error codes to be dec instead of hexDavid Marcec2020-04-282-7/+7
|/ | | | Consistency for the rest of the error codes in the codebase
* Merge pull request #3785 from ogniK5377/set-buffer-count-unitbunnei2020-04-271-1/+9
|\ | | | | vi: Don't let uninitialized data pass as a response for SetBufferCount
| * vi: Don't let uninitialized data pass as a response for SetBufferCountDavid Marcec2020-04-241-1/+9
| | | | | | | | Currently SetBufferCount doesn't write to the out buffer which then contains uninitialized data. This leads to non-zero data which leads to responding with different error codes
* | Merge pull request #3797 from slashiee/hid-stubMat M2020-04-272-1/+13
|\ \ | | | | | | services: hid: Stub StopSevenSixAxisSensor.
| * | services: hid: Stub StopSevenSixAxisSensor.M&M2020-04-262-1/+13
| |/ | | | | | | - Used by The Legend of Zelda: Breath of the Wild v1.6.0
* | Merge pull request #3744 from lioncash/table2bunnei2020-04-2618-7/+107
|\ \ | |/ |/| service: Update function tables
| * service: Update function tablesLioncash2020-04-2018-7/+107
| | | | | | | | | | | | Keeps the service function tables up to date. Updated based off information on SwitchBrew.
* | Merge pull request #3730 from lioncash/timebunnei2020-04-231-24/+26
|\ \ | | | | | | service/time: Remove reliance on the global system accessor
| * | service/time: Remove reliance on the global system accessorLioncash2020-04-191-24/+26
| | | | | | | | | | | | | | | Eliminates usages of the global system accessor and instead passes the existing system instance into the interfaces.
* | | Merge pull request #3697 from lioncash/declarationsbunnei2020-04-232-6/+2
|\ \ \ | | | | | | | | CMakeLists: Enable -Wmissing-declarations on Linux builds
| * | | General: Resolve warnings related to missing declarationsLioncash2020-04-172-6/+2
| | | |
* | | | Merge pull request #3698 from lioncash/warningbunnei2020-04-211-2/+2
|\ \ \ \ | | | | | | | | | | General: Resolve minor assorted warnings
| * | | | time_zone_manager: Resolve sign conversion warningsLioncash2020-04-171-2/+2
| |/ / / | | | | | | | | | | | | | | | | ttis and ats will never exceed the length of INT32_MAX in our case, so this is safe.
* | | / audio_renderer: Preliminary BehaviorInfo (#3736)David2020-04-211-2/+7
| |_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * audio_renderer: Preliminary BehaviorInfo * clang format * Fixed IsRevisionSupported * fixed IsValidRevision * Fixed logic error & spelling errors & crash * Addressed issues
* | | npad: Lower log level for VibrateController to DebugFearlessTobi2020-04-201-1/+1
| | |
* | | audren: Lower log level for RequestUpdateImpl to DebugFearlessTobi2020-04-201-1/+1
| | |
* | | Merge pull request #3712 from lioncash/removebunnei2020-04-202-3/+0
|\ \ \ | | | | | | | | service: Remove unused RequestParser instances
| * | | service: Remove unused RequestParser instancesLioncash2020-04-182-3/+0
| | | | | | | | | | | | | | | | | | | | These aren't used, so they should be removed to reduce compilation warnings.
* | | | Merge pull request #3709 from lioncash/ambunnei2020-04-201-2/+2
|\ \ \ \ | |_|_|/ |/| | | am: Resolve ineffective moves
| * | | am: Resolve ineffective movesLioncash2020-04-181-2/+2
| |/ / | | | | | | | | | | | | Previously const objects were being std::moved, which results in no move actually occurring. This resolves that.
* | | Merge pull request #3715 from bunnei/fix-impl-fallthroughMat M2020-04-181-0/+2
|\ \ \ | | | | | | | | service: hid: npad: Fix implicit fallthrough errors.
| * | | service: hid: npad: Fix implicit fallthrough errors.bunnei2020-04-181-0/+2
| |/ /
* | | time/system_clock_core: Remove unnecessary initializerLioncash2020-04-181-1/+1
| | | | | | | | | | | | This is already initialized within the class body.
* | | service/time: Mark IsStandardNetworkSystemClockAccuracySufficient as constLioncash2020-04-181-1/+1
| | | | | | | | | | | | This doesn't modify internal member state.
* | | service/time: Add virtual destructors where applicableLioncash2020-04-183-2/+3
|/ / | | | | | | | | | | Many of these implementations are used to implement a polymorphic interface. While not directly used polymorphically, this prevents virtual destruction from ever becoming an issue.
* | core: hle: Address various feedback & code cleanup.bunnei2020-04-171-8/+5
| | | | | | | | - Should be no functional changes.
* | service: ldr: Updates for new VMM.bunnei2020-04-171-150/+215
| | | | | | | | - Includes removing some service impls. that are untested.
* | service: pl_u: Update for new shared memory layout.bunnei2020-04-171-7/+5
| |
* | service: time: Update for new shared memory layout.bunnei2020-04-171-3/+2
| |
* | service: hid: Update for new shared memory layout.bunnei2020-04-171-3/+2
| |
* | service: irs: Update for new shared memory layout.bunnei2020-04-171-3/+3
| |
* | core: memory: Move to Core::Memory namespace.bunnei2020-04-172-5/+5
|/ | | | - helpful to disambiguate Kernel::Memory namespace.
* Merge pull request #3673 from lioncash/extrabunnei2020-04-175-11/+15
|\ | | | | CMakeLists: Specify -Wextra on linux builds
| * CMakeLists: Specify -Wextra on linux buildsLioncash2020-04-165-11/+15
| | | | | | | | | | | | | | | | | | | | | | Allows reporting more cases where logic errors may exist, such as implicit fallthrough cases, etc. We currently ignore unused parameters, since we currently have many cases where this is intentional (virtual interfaces). While we're at it, we can also tidy up any existing code that causes warnings. This also uncovered a few bugs as well.
* | Merge pull request #3659 from bunnei/time-calc-standard-userRodrigo Locatti2020-04-163-1/+25
|\ \ | |/ |/| service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.
| * service: time: Implement CalculateStandardUserSystemClockDifferenceByUser.bunnei2020-04-153-1/+25
| | | | | | | | - Used by Animal Crossing: New Horizons.
* | service: friend: Stub IFriendService::GetBlockedUserListIds.bunnei2020-04-141-1/+10
|/ | | | - This is safe to stub, as there should be no adverse consequences from reporting no blocked users.
* Merge pull request #3606 from ReinUsesLisp/nvflingerbunnei2020-04-123-10/+44
|\ | | | | service/vi: Partially implement BufferQueue disconnect
| * service/vi: Partially implement BufferQueue disconnectReinUsesLisp2020-04-103-10/+44
| |
* | Buffer queue: Correct behavior of free buffer.Fernando Sahmkow2020-04-102-9/+33
|/ | | | | | This corrects the behavior of free buffer after witnessing it in an unrelated hardware test. I haven't found any games affected by it but in name of better accuracy we'll correct such behavior.
* Merge pull request #3563 from bunnei/fix-ldr-memstateFernando Sahmkow2020-04-031-5/+15
|\ | | | | services: ldr: Fix MemoryState for read/write regions of NROs.
| * services: ldr: Fix MemoryState for read/write regions of NROs.bunnei2020-03-261-5/+15
| | | | | | | | - Fixes #3541, used by Final Fantasy VIII Remastered.
* | capsrv: Split Capture services into individual files and stub GetAlbumContentsFileListForApplication (#3571)Morph2020-04-0114-151/+524
| | | | | | | | | | | | | | * Organize capture services into individual files * Stub GetAlbumContentsFileListForApplication * Address feedback
* | Merge pull request #3568 from bunnei/time-calcspanbunnei2020-03-293-1/+31
|\ \ | | | | | | services: time: Implement CalculateSpanBetween.
| * | services: time: Implement CalculateSpanBetween.bunnei2020-03-273-1/+31
| |/ | | | | | | - Used by Super Smash Bros. Ultimate.
* | Merge pull request #3562 from perillamint/vrsvcbunnei2020-03-282-3/+42
|\ \ | | | | | | am: Implement VR related APIs
| * | am: Implement VR related APIsperillamint2020-03-272-3/+42
| |/ | | | | | | | | | | Implement (and stub) VR related APIs in AM sysmodule. This fixes issue #2938
* / services: hid: Stub InitializeSevenSixAxisSensor.bunnei2020-03-272-1/+9
|/ | | | - Used by Super Smash Bros. Ultimate v7.0.0.
* sm/controller: Increase PointerBufferSizeFearlessTobi2020-03-231-1/+1
| | | | | | | This increases the PointerBufferSize as a lager one is required by some services. This change is still not hw-accurate, but it is proven to work in Ryujinx. Instead of using a hardcoded size, we should figure out the specific values for each service in the future. Some of them can be taken from Atmosphere: https://github.com/Atmosphere-NX/Atmosphere/search?q=PointerBufferSize.
* Merge pull request #3477 from FearlessTobi/webapplet-shitbunnei2020-03-221-0/+6
|\ | | | | core/web_browser: Allow WebApplet to exit gracefully when an error occurs
| * core/web_browser: Allow WebApplet to exit gracefully when an error occursFearlessTobi2020-03-221-0/+6
| | | | | | | | | | | | | | | | Currently, yuzu just freezes when an error occurs while Initializing the WebApplet. From a user perspective, this obviously isn't great as the game just softlocks. With this change, yuzu will call the Finalize method, so to the game it seems like as the user just exited the WebApplet normally. This works around https://github.com/yuzu-emu/yuzu/issues/2852.
* | set: implement GetRegionCodeDan2020-03-192-1/+10
| |
* | time_zone_content_manager: Fix out of bounds readReinUsesLisp2020-03-181-1/+1
| | | | | | | | | | | | | | There were cases where raw_data didn't contain enough space to hold the zero terminator. This was caught with -fsanitize=address.
* | NVFlinger: Do the microprofile Flip after processing a valid frame.Fernando Sahmkow2020-03-121-2/+2
|/
* AM/ICommonStateGetter: Stub SetLcdBacklighOffEnabled (#3454)Morph2020-02-272-2/+14
| | | | | | | | | * Stub SetLcdBacklighOffEnabled Used by Super Smash Bros. Ultimate We require backlight services to be implemented to turn on/off the backlight. * Address feedback
* Merge pull request #3431 from CJBok/npad-fixbunnei2020-02-261-5/+5
|\ | | | | InputCommon: analog_from_button get direction implementation
| * analog_from_button get direction implementationCJBok2020-02-181-5/+5
| |
* | httplib compatibilityBrian Clinkenbeard2020-02-191-3/+4
|/
* Merge pull request #3420 from namkazt/master2bunnei2020-02-172-0/+20
|\ | | | | nvhost_gpu: implement ChannelSetTimeslice
| * nvhost_gpu: implement ChannelSetTimeslicenamkazy2020-02-162-0/+20
| |
* | IUserLocalCommunicationService: add function Initialize2Nguyen Dac Nam2020-02-161-1/+9
| |
* | HLE: correct function name of IUserLocalCommunicationServiceNguyen Dac Nam2020-02-161-1/+1
|/ | | | 402: function name should be Initialize2 (7.0.0+) not SetOperationMode Follow by: https://switchbrew.org/wiki/LDN_services#IUserLocalCommunicationService
* Merge pull request #3401 from FernandoS27/synchronizationbunnei2020-02-146-10/+16
|\ | | | | Set of refactors for Kernel Synchronization and Hardware Constants
| * Core: Set all hardware emulation constants in a single file.Fernando Sahmkow2020-02-126-10/+16
| |
* | Merge pull request #3400 from makigumo/patch-1bunnei2020-02-141-2/+4
|\ \ | | | | | | update hwopus DecodeInterleaved for FW 7.0.0+
| * | update hwopus DecodeInterleaved for FW 7.0.0+makigumo2020-02-111-2/+4
| |/ | | | | | | trivial change, see https://switchbrew.org/wiki/Audio_services#IHardwareOpusDecoder
* | bcat/backend: Make formatting of passphrase consistent in NullBackend::SetPassphrase()Lioncash2020-02-121-1/+1
| | | | | | | | | | Aligns the '=' to be consistent with the rest of the logs within this source file.
* | bcat/backend: Prevent fmt exception in debug log within NullBackend::Clear()Lioncash2020-02-121-1/+1
|/ | | | | A formatting specifier within Clear wasn't being used, which will cause fmt to throw an exception. This fixes that.
* hle: services: Use std::shared_ptr instead of copy by value.bunnei2020-02-089-50/+52
|
* Merge pull request #3381 from bunnei/ipc-fixbunnei2020-02-071-15/+15
|\ | | | | hle: services: Fix prepo IPC, and add better error checking.
| * services: prepo: Fix IPC interface with SaveReport/SaveReportWithUser.bunnei2020-02-061-15/+15
| |
* | am: Correct IPC object count mismatch.bunnei2020-02-061-6/+4
| |
* | services: am: Clear events on PopOutData and PopInteractiveOutData.bunnei2020-02-061-0/+2
| |
* | am: Refactor IStorage interface.bunnei2020-02-067-43/+81
| |
* | applets: software_keyboard: Signal state change on end of interactive session.bunnei2020-02-061-0/+1
| |
* | applets: software_keyboard: Minor cleanup.bunnei2020-02-061-2/+2
|/
* Merge pull request #3284 from CJBok/hid-fixbunnei2020-02-011-13/+26
|\ | | | | hid: Fix analog sticks directional states
| * Moved analog direction logic to sdl_implCJBok2020-01-151-9/+22
| |
| * Corrected directional states sensitivityCJBok2020-01-141-9/+9
| |
| * hid: Fix analog sticks directional statesCJBok2020-01-091-12/+12
| |
* | bsd: Stub several more functions.bunnei2020-01-252-4/+48
| | | | | | | | - Required for Little Town Hero to boot further.
* | service: time: Implement ToPosixTimeWithMyRule.bunnei2020-01-234-1/+34
| | | | | | | | - Used by Pokemon Mystery Dungeon.
* | time: Fix month off-by-one error.bunnei2020-01-201-2/+2
| | | | | | | | - Fixes timestamp in ZLA and Astral Chain saves.
* | Merge pull request #3271 from bunnei/time-rewritebunnei2020-01-2039-533/+2962
|\ \ | |/ |/| service: time: Rewrite implementation of glue services.
| * service: time: Implement GetStandardLocalSystemClock.bunnei2020-01-053-1/+9
| |
| * time: Remove overflow error checking (currently breaks ADO builds).bunnei2020-01-042-18/+2
| |
| * service: time: Implement GetClockSnapshotFromSystemClockContext.bunnei2020-01-043-3/+27
| |
| * service: time: Implement IsStandardNetworkSystemClockAccuracySufficient.bunnei2020-01-045-1/+51
| |
| * service: time: Rewrite implementation of glue services.bunnei2020-01-0434-444/+2806
| |
| * core: Initialize several structs that make use of Common::UUID.bunnei2020-01-045-100/+101
| |
* | Merge pull request #3272 from bunnei/vi-close-layerbunnei2020-01-075-11/+48
|\ \ | | | | | | service: vi: Implement CloseLayer.
| * | service: vi: Implement CloseLayer.bunnei2020-01-045-11/+48
| |/ | | | | | | - Needed for Undertale.
* | Merge pull request #3257 from degasus/no_busy_loopsbunnei2020-01-061-1/+1
|\ \ | | | | | | video_core: Block in WaitFence.
| * | video_core: Block in WaitFence.Markus Wick2019-12-301-1/+1
| | | | | | | | | | | | | | | | | | | | | This function is called rarely and blocks quite often for a long time. So don't waste power and let the CPU sleep. This might also increase the performance as the other cores might be allowed to clock higher.
* | | Merge pull request #2945 from FernandoS27/fix-bcatbunnei2020-01-051-3/+17
|\ \ \ | |_|/ |/| | nifm: Only return that there's an internet connection when there's a BCATServer
| * | nifm: Only return that there's an internet connection when there's a BCATServerFernando Sahmkow2019-11-071-3/+17
| | | | | | | | | | | | | | | This helps games that need internet for other purposes boot as the rest of our internet infrastructure is incomplete.
* | | NvServices: Correct Ioctl Remap.Fernando Sahmkow2019-12-252-3/+5
| |/ |/| | | | | | | This commit corrects a padding value in Ioctl Remap that was actually an offset to the mapping address.
* | kernel: Implement a more accurate IPC dispatch.bunnei2019-11-285-22/+28
| |
* | Merge pull request #3169 from lioncash/memorybunnei2019-11-286-22/+28
|\ \ | | | | | | core/memory: Deglobalize memory management code
| * | core/memory: Migrate over Read{8, 16, 32, 64, Block} to the Memory classLioncash2019-11-274-11/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With all of the trivial parts of the memory interface moved over, we can get right into moving over the bits that are used. Note that this does require the use of GetInstance from the global system instance to be used within hle_ipc.cpp and the gdbstub. This is fine for the time being, as they both already rely on the global system instance in other functions. These will be removed in a change directed at both of these respectively. For now, it's sufficient, as it still accomplishes the goal of de-globalizing the memory code.
| * | core: Prepare various classes for memory read/write migrationLioncash2019-11-273-11/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends a few interfaces to be able to handle the migration over to the new Memory class by passing the class by reference as a function parameter where necessary. Notably, within the filesystem services, this eliminates two ReadBlock() calls by using the helper functions of HLERequestContext to do that for us.
* | | Merge pull request #3170 from lioncash/enumbunnei2019-11-281-2/+2
|\ \ \ | |/ / |/| | file_sys/directory: Make EntryType an enum class
| * | file_sys/directory: Make EntryType an enum classLioncash2019-11-271-2/+2
| | | | | | | | | | | | | | | This can trivially be an enum class rather than a regular enum, making it more strongly typed.
* | | core_timing: Use better reference tracking for EventType. (#3159)bunnei2019-11-274-7/+6
|/ / | | | | | | | | | | | | * core_timing: Use better reference tracking for EventType. - Moves ownership of the event to the caller, ensuring we don't fire events for destroyed objects. - Removes need for unique names - we won't be using this for save states anyways.
* | Merge pull request #3094 from lioncash/tablesbunnei2019-11-2533-7/+192
|\ \ | | | | | | service: Update function tables
| * | service: Update function tablesLioncash2019-11-1233-7/+192
| |/ | | | | | | | | | | Keeps the function tables up to date. Updated based off information from Switchbrew.
* | kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. (#3154)bunnei2019-11-2532-57/+55
| | | | | | | | | | | | * kernel: Replace usage of boost::intrusive_ptr with std::shared_ptr for kernel objects. - See https://github.com/citra-emu/citra/pull/4710 for details.
* | Merge pull request #3112 from lioncash/skipbunnei2019-11-211-8/+16
|\ \ | | | | | | service/am: Remove unnecessary Skip calls
| * | service/am: Remove unnecessary Skip callsLioncash2019-11-141-8/+16
| | | | | | | | | | | | | | | We can simplify these by wrapping the necessary members in structs and then simply reading out the whole struct.
* | | Merge pull request #3111 from lioncash/querybunnei2019-11-212-5/+14
|\ \ \ | | | | | | | | am: Stub QueryApplicationPlayStatistics
| * | | am: Stub QueryApplicationPlayStatisticsLioncash2019-11-142-5/+14
| |/ / | | | | | | | | | | | | | | | | | | | | | Maintains implementation parity between QueryApplicationPlayStatistics and QueryApplicationPlayStatisticsByUid. These function the same behaviorally underneath the hood, with the only difference being that one allows specifying a UID.
* | | Merge pull request #3091 from lioncash/core-conversionbunnei2019-11-1515-58/+55
|\ \ \ | |/ / |/| | core: Make most implicit type conversion warnings errors on MSVC
| * | service: Resolve sign conversion errorsLioncash2019-11-1215-58/+55
| |/ | | | | | | | | These are fairly trivial to resolve and most of the changes entail using RESULT_UNKNOWN over ResultCode(-1).
* | Merge pull request #3089 from SciresM/play_statisticsbunnei2019-11-142-0/+10
|\ \ | | | | | | Implement stub for IApplicationFunctions::QueryApplicationPlayStatisticsByUid
| * | Implement stub for QueryApplicationPlayStatisticsByUidMichael Scire2019-11-112-0/+10
| |/
* / core: Migrate off deprecated mbedtls functionsLioncash2019-11-123-3/+3
|/ | | | | These functions are marked for deprecation and it's recommended that the *_ret variants be used instead.
* Merge pull request #3062 from bunnei/event-improvebunnei2019-11-0616-55/+44
|\ | | | | kernel: Improve events
| * kernel: events: Remove ResetType::Automatic.bunnei2019-11-0316-55/+44
| | | | | | | | | | | | | | | | - This does not actually seem to exist in the real kernel - games reset these automatically. # Conflicts: # src/core/hle/service/am/applets/applets.cpp # src/core/hle/service/filesystem/fsp_srv.cpp
* | Merge pull request #2859 from Morph1984/hidDavid2019-11-062-92/+126
|\ \ | | | | | | hid: Stub SetNpadJoyAssignmentModeSingle and GetNpadHandheldActivationMode
| * | hid: Stub SetNpadJoyAssignmentModeSingle and reorganize service commandsMorph2019-10-072-92/+126
| | |
* | | common_func: Use std::array for INSERT_PADDING_* macros.bunnei2019-11-042-6/+7
| | | | | | | | | | | | - Zero initialization here is useful for determinism.
* | | core/am: Stub InitializeApplicationCopyrightFrameBuffer, SetApplicationCopyrightImage and SetApplicationCopyrightVisibilityFearlessTobi2019-11-032-3/+31
| |/ |/| | | | | These commands require Screenshots to be implemented anyway, so they are safe to stub for now.
* | Merge pull request #2991 from lioncash/npadbunnei2019-10-232-51/+23
|\ \ | | | | | | hid/npad: Minor cleanup
| * | hid/npad: Fix incorrect connection boolean value in ConnectAllDisconnectedControllers()Lioncash2019-10-181-1/+1
| | | | | | | | | | | | | | | | | | We should be setting the connection state to true, otherwise we aren't actually making the controllers connected like the function name indicates.
| * | hid/npad: Add missing break in default caseLioncash2019-10-181-0/+1
| | | | | | | | | | | | | | | | | | | | | While not an issue, it does prevent fallthrough from occurring if anything is ever added after this case (unlikely to occur, but this turns a trivial "should not cause issues" into a definite "won't cause issues).
| * | hid/npad: Replace std::for_each with ranged for loopsLioncash2019-10-181-13/+12
| | | | | | | | | | | | | | | | | | Performs the same behavior, but is built into the core language itself. No functional change.
| * | hid/npad: Remove redundant non-const variant of IsControllerSupported()Lioncash2019-10-182-34/+5
| | | | | | | | | | | | | | | | | | The const qualified variant can also be called in non-const contexts, so we can remove the non-const variant to eliminate a bit of code duplication.
| * | hid/npad: Move function declarationsLioncash2019-10-181-5/+6
| | | | | | | | | | | | | | | Clearly separate these from the variable declarations to make them more visible.
* | | apm/controller: Make SetPerformanceConfiguration() use an array of pairs over a mapLioncash2019-10-171-14/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While a map is an OK way to do lookups (and usually recommended in most cases), this is a map that lives for the entire duration of the program and only deallocates its contents when the program terminates. Given the total size of the map is quite small, we can simply use a std::array of pairs and utilize std::find_if to perform the same behavior without loss of performance. This eliminates a static constructor and places the data into the read-only segment. While we're at it, we can also handle malformed inputs instead of directly dereferencing the resulting iterator.
* | | apm/controller: Make GetCurrentPerformanceMode() a const member functionLioncash2019-10-172-2/+2
|/ / | | | | | | This doesn't modify instance state, so it can be made const qualified.
* | Merge pull request #2912 from FernandoS27/async-fixesbunnei2019-10-165-28/+27
|\ \ | | | | | | General fixes to Async GPU
| * | NvFlinger: Remove leftover from corrections and clang format.Fernando Sahmkow2019-10-051-4/+0
| | |
| * | Nvdrv: Correct Event setup in NvdrvFernando Sahmkow2019-10-052-23/+14
| | | | | | | | | | | | Events are supposed to be cleared on quering. This fixes that issue.
| * | NVFlinger: Reverse the change that only signaled events on buffer acquire.Fernando Sahmkow2019-10-052-20/+1
| | | | | | | | | | | | | | | This has been hardware tested and it seems that NVFlinger will still signal even if there are no buffers to present.
| * | Nvdrv: Do framelimiting only in the CPU ThreadFernando Sahmkow2019-10-051-0/+4
| | |
| * | NvFlinger: Don't swap buffers if a frame is missing and always trigger event in sync gpu.Fernando Sahmkow2019-10-051-1/+3
| | |
| * | GPU_Async: Correct fences, display events and more.Fernando Sahmkow2019-10-052-2/+21
| | | | | | | | | | | | | | | | | | | | | This commit uses guest fences on vSync event instead of an articial fake fence we had. It also corrects to keep signaling display events while loading the game as the OS is suppose to send buffers to vSync during that time.
| * | Nvdrv: Correct Async regression and avoid signaling empty buffer vsyncsFernando Sahmkow2019-10-052-3/+9
| | |
* | | Merge pull request #2972 from lioncash/systembunnei2019-10-159-33/+63
|\ \ \ | | | | | | | | {bcat, gpu, nvflinger}: Remove trivial usages of the global system accessor
| * | | bcat: Remove use of global system accessorsLioncash2019-10-156-29/+55
| | | | | | | | | | | | | | | | | | | | Removes all uses of the global system accessor within the BCAT interface.
| * | | nvflinger/buffer_queue: Remove use of a global system accessorLioncash2019-10-123-4/+8
| | | |
* | | | pl_u: Fix mismatched rebase size error in font encryptionZach Hilman2019-10-132-11/+11
| | | |
* | | | pl_u: Use kernel physical memoryZach Hilman2019-10-131-0/+1
| | | |
* | | | pl_u: Remove excess static qualifierZach Hilman2019-10-131-1/+1
| | | |
* | | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-10-131-110/+47
|/ / /
* | | Merge pull request #2921 from FreddyFunk/compiler-warnings-corebunnei2019-10-091-6/+6
|\ \ \ | | | | | | | | Services::ES fix casting warnings
| * | | Services::ES fix casting warningsFreddyFunk2019-09-291-6/+6
| | | |
* | | | Merge pull request #2654 from DarkLordZach/lm-log-rewritebunnei2019-10-095-156/+278
|\ \ \ \ | | | | | | | | | | lm: Rewrite logger to use core reporting services
| * | | | lm: Flush manager output on core shutdownZach Hilman2019-09-222-5/+11
| | | | |
| * | | | lm: Rename Initialize to Log and implement with manager/reporterZach Hilman2019-09-221-140/+22
| | | | | | | | | | | | | | | Allows saving and clearer output of data.
| * | | | lm: Implement manager class to output to reporterZach Hilman2019-09-222-0/+233
| | | | |
| * | | | core: Add LM::Manager to systemZach Hilman2019-09-223-16/+17
| |/ / / | | | | | | | | Allows centralized control over logging mechanisms.
* | | / hid: Implement DeactivateNpadMorph2019-10-072-1/+13
| |_|/ |/| | | | | | | | Makes use of the already existing DeactivateController function.
* | | Merge pull request #2951 from lioncash/globalZach Hilman2019-10-0710-43/+65
|\ \ \ | | | | | | | | core: Remove Core::CurrentProcess()
| * | | hle/service: Replace global system instance calls with instance-based onesLioncash2019-10-0610-43/+65
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Migrates the HLE service code off the use of directly accessing the global system instance where trivially able to do so. This removes all usages of Core::CurrentProcess from the service code, only 8 occurrences of this function exist elsewhere. There's still quite a bit of "System::GetInstance()" being used, however this was able to replace a few instances.
* | | | bcat/module: Silence truncation warningsLioncash2019-10-061-3/+3
| | | | | | | | | | | | | | | | | | | | We need to perform explicit casts here, otherwise we're implicitly truncating a 64-bit type to a 32-bit one.
* | | | bcat: Take std::function instance by value in NullBackend's constructorLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | | | | | Without this, the std::move within the constructor initializer list won't be able to actually perform a move.
* | | | bcat: In-class initialize ProgressServiceBackend's impl memberLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | Allows us to remove a constructor initializer list.
* | | | bcat: Make ProgressServiceBackend's constructor take a std::string_viewLioncash2019-10-062-3/+7
| | | | | | | | | | | | | | | | | | | | Given the string is appended to another, we can make it a view so a redundant full copy of the string isn't made.
* | | | bcat: Make ProgressServiceBackend's GetEvent() constLioncash2019-10-062-2/+2
| | | | | | | | | | | | | | | | | | | | This member function doesn't modify internal member state, so it can be marked const.
* | | | boxcat: Silence an unused variable warningLioncash2019-10-061-1/+2
|/ / / | | | | | | | | | | | | | | | On parse errors, we can log out the explanatory string indicating what the parsing error was, rather than just ignoring the variable and returning an overly broad error code.
* | | audio/audout_u: Change formatting for old clang-format versionsReinUsesLisp2019-10-051-1/+1
| | |
* | | service/nvdrv: Silence -WswitchReinUsesLisp2019-10-054-4/+10
| | |
* | | service/nfp: Silence -Wunused and -WswitchReinUsesLisp2019-10-051-4/+5
| | |
* | | service/hid: Silence -Wunused and -WswitchReinUsesLisp2019-10-0515-23/+18
| | |
* | | service/am: Silence -WreorderReinUsesLisp2019-10-051-2/+1
| | |
* | | service/hid: Remove unused system referenceReinUsesLisp2019-10-052-2/+1
| | |
* | | service/friend: Remove unused fieldReinUsesLisp2019-10-051-1/+0
| | |
* | | service/filesystem: Silence -Wunused-variableReinUsesLisp2019-10-051-1/+1
| | |
* | | service/bcat: Silence -Wreorder and -WunusedReinUsesLisp2019-10-052-2/+2
| | |
* | | service/audio: Silence -WunusedReinUsesLisp2019-10-051-1/+1
| | |
* | | service/apm: Silence -Wunused and -WreorderReinUsesLisp2019-10-052-4/+5
| |/ |/|
* | Merge pull request #2539 from DarkLordZach/bcatDavid2019-10-0316-40/+1497
|\ \ | | | | | | bcat: Implement BCAT service and connect to yuzu Boxcat server
| * | qt: Add service dialogZach Hilman2019-10-021-6/+5
| | |
| * | boxcat: Use updated game-asset API URL and tagsZach Hilman2019-10-011-6/+6
| | |
| * | bcat: Add FSC accessors for BCAT dataZach Hilman2019-10-0110-31/+51
| | | | | | | | | Ports BCAT to use FSC interface
| * | boxcat: Implement events global fieldZach Hilman2019-09-303-12/+14
| | |
| * | bcat: Implement DeliveryCacheProgressImpl structureZach Hilman2019-09-305-84/+310
| | | | | | | | | Huge thanks to lioncash for re-ing this for me.
| * | boxcat: Use Etag header names for file digestZach Hilman2019-09-301-10/+11
| | |
| * | boxcat: Add downloading and client for launch parameter dataZach Hilman2019-09-302-16/+77
| | |
| * | bcat: Add backend function for BCAT Indirect (launch parameter)Zach Hilman2019-09-302-0/+11
| | | | | | | | | | | | Returns the data that should be returned by PopLaunchParameter kind=ApplicationSpecific.
| * | bcat: Expose CreateBackendFromSettings helper functionZach Hilman2019-09-302-2/+2
| | |
| * | am: Unstub PopLaunchParameter and add bcat connection for app-specific dataZach Hilman2019-09-302-16/+52
| | | | | | | | | | | | Previously we were simply returning the account-preselect structure all times but if passed with a different mode the game expects application-specific data. This also adds a hook for BCAT into this allowing us to send the launch parameter through bcat,
| * | bcat: Implement cmd 90201 ClearDeliveryCacheStorageZach Hilman2019-09-301-1/+23
| | | | | | | | | | | | Takes a title ID and simply deletes all the data for that title ID's bcat. Invokes the respective backend command.
| * | bcat: Implement cmd 30100 SetPassphraseZach Hilman2019-09-301-1/+33
| | | | | | | | | | | | Takes a title ID and passphrase (0x40 byte string) and passes it to the backend.
| * | bcat: Implement cmd RequestSyncDeliveryCache and variantZach Hilman2019-09-301-2/+70
| | | | | | | | | | | | Variant also supports only updating a single directory. These just both invoke backend commands.
| * | bcat: Implement IDeliveryCacheProgressService commandsZach Hilman2019-09-301-0/+131
| | | | | | | | | | | | Used to query completion status and events for the current delivery task.
| * | bcat: Implement IDeliveryCacheFileService commandsZach Hilman2019-09-301-0/+117
| | | | | | | | | | | | Used to read the contents of files and access their metadata.
| * | bcat: Implement IDeliveryCacheDirectoryService commandsZach Hilman2019-09-301-0/+99
| | | | | | | | | | | | Used to list and get directories at the root level.
| * | bcat: Implement IDeliveryCacheStorageService commandsZach Hilman2019-09-301-0/+58
| | | | | | | | | | | | Used to create subclasses to manage files and directories and to list directories.
| * | bcat: Add commands to create IDeliveryCacheStorageServiceZach Hilman2019-09-303-2/+32
| | | | | | | | | | | | Used to access contents of download.
| * | module: Create BCAT backend based upon Settings value on constructionZach Hilman2019-09-302-1/+16
| | |
| * | bcat: Add BCAT backend for Boxcat serviceZach Hilman2019-09-302-0/+407
| | | | | | | | | | | | Downloads content from yuzu servers and unpacks it into the temporary directory provided. Fully supports all Backend features except passphrase.
| * | bcat: Add backend class to generify the functions of BCATZach Hilman2019-09-302-0/+100
| | | | | | | | | | | | Provides the most abstract simplified functions of BCAT as functions. Also includes a NullBackend class which is just a no-op.
| * | nifm: Signal to applications that internet access is availableZach Hilman2019-09-301-3/+10
| | |
| * | applets: Add accessor for AppletFrontendSetZach Hilman2019-09-302-0/+6
| | | | | | | | | | | | Allows other services to call applets without using LLE.
| * | filesystem: Add getter for BCAT temporary directoryZach Hilman2019-09-301-0/+9
| |/
* / Signal styleset changes at a better timeDavid Marcec2019-09-241-8/+2
|/ | | | We should signal when a net controller is added and our event should be manual, not automatic.
* Merge pull request #2683 from DarkLordZach/lock-exitDavid2019-09-224-7/+33
|\ | | | | am: Implement exit locking and self exit commands
| * qt: Prompt user for confirmation if exit lock is activeZach Hilman2019-09-221-1/+1
| |
| * am: Implement ISelfController ExitLock commandsZach Hilman2019-09-221-2/+6
| |
| * am: Implement ISelfController ExitZach Hilman2019-09-224-4/+20
| | | | | | | | Closes the current application.
| * am: Add RequestExit event to AppletMessageQueueZach Hilman2019-09-222-0/+6
| | | | | | | | Tested against libnx, signals to games to begin cleanup.
* | Merge pull request #2876 from ogniK5377/AcquireNpadStyleSetUpdateEventHandle-fixZach Hilman2019-09-223-11/+18
|\ \ | | | | | | AcquireNpadStyleSetUpdateEventHandle should have a separate event for each controller type
| * | removed commentDavid Marcec2019-09-221-1/+0
| | |
| * | RebasedDavid Marcec2019-09-223-11/+19
| | |
* | | Merge pull request #2895 from FearlessTobi/debug-logsDavid2019-09-221-7/+7
|\ \ \ | | | | | | | | service/acc: Lower log severity from INFO to DEBUG
| * | | service/acc: Lower log severity from INFO to DEBUGFearlessTobi2019-09-221-7/+7
| | | | | | | | | | | | | | | | According to ogniK, this should have always been Debug and not Info.
* | | | Merge pull request #2873 from ogniK5377/new-ioctlsFernando Sahmkow2019-09-2224-73/+153
|\ \ \ \ | |_|/ / |/| | | Initial implementation of Ioctl2 & Ioctl3
| * | | server side clang format fix2David Marcec2019-09-221-18/+18
| | | |
| * | | Use clang-format provided by build serverDavid Marcec2019-09-221-20/+18
| | | |
| * | | disable clang-format tempDavid Marcec2019-09-201-0/+2
| | | |
| * | | Initial implementation of Ioctl2 & Ioctl3David Marcec2019-09-1924-63/+143
| | | | | | | | | | | | | | | | Purpose of Ioctl2 and Ioctl3 is to prevent the passing of raw pointers through ioctls
* | | | Merge pull request #2884 from ogniK5377/deglobal-sys-servicesFernando Sahmkow2019-09-2264-212/+291
|\ \ \ \ | | | | | | | | | | Remove usage of System::CurrentInterface() from most services
| * | | | removed unneeded semicolonDavid Marcec2019-09-221-1/+1
| | | | |
| * | | | Removed reference to core timing to nvflinger and used system insteadDavid Marcec2019-09-221-1/+1
| | | | |
| * | | | marked controller constructors as explicitDavid Marcec2019-09-228-8/+8
| | | | |
| * | | | RebaseDavid Marcec2019-09-2225-62/+75
| | | | |
| * | | | RebaseDavid Marcec2019-09-225-20/+21
| | | | |
| * | | | Deglobalize System: ViDavid Marcec2019-09-223-8/+8
| | | | |
| * | | | Deglobalize System: TimeDavid Marcec2019-09-224-14/+21
| | | | |
| * | | | RebaseDavid Marcec2019-09-222-8/+12
| | | | |
| * | | | Deglobalize System: NvFlingerDavid Marcec2019-09-222-6/+7
| | | | |
| * | | | RebaseDavid Marcec2019-09-224-8/+12
| | | | |
| * | | | Deglobalize System: NimDavid Marcec2019-09-222-7/+12
| | | | |
| * | | | Deglobalize System: NifmDavid Marcec2019-09-222-13/+23
| | | | |
| * | | | Deglobalize System: NFPDavid Marcec2019-09-224-14/+16
| | | | |
| * | | | Deglobalize System: LDRDavid Marcec2019-09-222-6/+7
| | | | |
| * | | | Deglobalize System: IRSDavid Marcec2019-09-223-5/+6
| | | | |
| * | | | Deglobalize System: HidDavid Marcec2019-09-2220-37/+44
| | | | |
| * | | | Deglobalize System: FriendDavid Marcec2019-09-224-22/+24
| | | | |
| * | | | Deglobalize System: FatalDavid Marcec2019-09-226-20/+29
| | | | |
| * | | | Deglobalize System: BtmDavid Marcec2019-09-222-7/+13
| | | | |
| * | | | Deglobalize System: BtdrvDavid Marcec2019-09-222-5/+9
| | | | |
| * | | | Deglobalize System: AocDavid Marcec2019-09-222-11/+13
| | | | |
| * | | | Deglobalize System: AmDavid Marcec2019-09-221-1/+1
| | | | |
* | | | | Revert "Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1"David Marcec2019-09-222-50/+117
|/ / / / | | | | | | | | | | | | | | | | This reverts commit fa1c60c33ef88c6cd0b72da46842dc9098db712d, reversing changes made to e34899067b60a69bca02761bd1290c6824bb559a.
* | | | Merge pull request #2709 from DarkLordZach/oss-ext-fonts-1David2019-09-222-117/+50
|\ \ \ \ | |_|_|/ |/| | | system_archive: Move shared font data to system_archive and fix extended font data
| * | | pl_u: Use kernel physical memoryZach Hilman2019-09-221-0/+1
| | | |
| * | | pl_u: Remove excess static qualifierZach Hilman2019-09-221-1/+1
| | | |
| * | | pl_u: Use OSS system archives if real archives don't existZach Hilman2019-09-222-109/+41
| | | |
| * | | pl_u: Expose method to encrypt TTF to BFTTFZach Hilman2019-09-222-14/+14
| | |/ | |/|
* | | Merge pull request #2612 from DarkLordZach/prepo-newDavid2019-09-223-25/+84
|\ \ \ | | | | | | | | prepo: Implement New, System, and Non-User variants of SaveReport
| * | | prepo: Remove system global accessorsZach Hilman2019-09-223-15/+18
| | | |
| * | | prepo: Implement SaveReport New and System variantsZach Hilman2019-09-221-15/+71
| |/ /
* | | configure_debug: Move reporting option to loggingZach Hilman2019-09-228-14/+15
| | |
* | | filesystem: Add const qualification to various accessorsZach Hilman2019-09-213-68/+76
| | |
* | | yuzu: Port old usages of Filesystem namespace to FilesystemControllerZach Hilman2019-09-214-15/+38
| | |
* | | services: Pass FileSystemController as reference to services that need itZach Hilman2019-09-2111-20/+47
| | |
* | | am: Unstub IApplicationFunctions EnsureSaveData (20)Zach Hilman2019-09-211-8/+14
| | | | | | | | | Creates a default save data for the application given a user ID.
* | | filesystem: Pass Size Getter functions to IFileSystem for sizesZach Hilman2019-09-213-20/+31
| | |
* | | filesystem: Add FileSystemController to deglobalize FS servicesZach Hilman2019-09-212-58/+359
|/ /
* / Mark KickOffPb & SubmitGPFIFO as traceDavid Marcec2019-09-211-4/+4
|/ | | | These functions are not stubbed and are called fairly often. Due to the nature of how often they're called, we should keep them marked as LOG_TRACE instead of LOG_DEBUG or LOG_WARNING
* Merge pull request #2667 from DarkLordZach/profile-editorbunnei2019-09-145-10/+130
|\ | | | | acc: Implement IProfileEditor interface and 'Store'/'StoreWithImage' commands
| * acc_su: Implement GetProfileEditor (205)Zach Hilman2019-07-033-1/+13
| | | | | | Takes a UUID of a user and provides and interface that allows RW access to user data/settings.
| * acc: Implement IProfileEditor-specific commands 'Store' and 'StoreWithImage'Zach Hilman2019-07-031-1/+73
| | | | | | Verified with IDA
| * profile_manager: Add setter for ProfileBase and ProfileDataZach Hilman2019-07-032-0/+13
| | | | | | Needed by IProfileEditor 'Store' and 'StoreWithImage'
| * acc: Add IProfileCommon for IProfile and IProfileEditorZach Hilman2019-07-031-8/+31
| | | | | | Since 2/3 of the commands are shared, this is likely how its done on HW.
* | Merge pull request #2716 from lioncash/hle-globalDavid2019-09-0916-96/+141
|\ \ | | | | | | service/am: Remove usages of global system accessors
| * | service/am: Remove usages of global system accessorsLioncash2019-09-0516-96/+141
| | | | | | | | | | | | | | | | | | Avoids the use of global accessors, removing the reliance on global state. This also makes dependencies explicit in the interface, as opposed to being hidden
* | | Merge pull request #2418 from DarkLordZach/srv-esDavid2019-09-051-10/+220
|\ \ \ | |/ / |/| | es: Implement various ticket accessor commands from IEticketService
| * | key_manager: Convert Ticket union to std::variantZach Hilman2019-07-081-2/+2
| | |
| * | es: Populate/synthesize tickets on constructionZach Hilman2019-07-081-2/+3
| | |
| * | key_manager: Add structure for Ticket parsingZach Hilman2019-07-081-9/+9
| | |
| * | es: Implement ETicket GetPersonalizedTicketData (17)Zach Hilman2019-07-081-1/+21
| | | | | | | | | Copies the raw personal ticket data into the buffer provided.
| * | es: Implement ETicket GetCommonTicketData (16)Zach Hilman2019-07-081-1/+20
| | | | | | | | | Copies the raw common ticket data for the specified rights ID into the buffer provided.
| * | es: Implement ETicket GetPersonalizedTicketSize (15)Zach Hilman2019-07-081-1/+17
| | | | | | | | | Returns the size of the buffer needed to hold the personal ticket associated with the rights ID.
| * | es: Implement ETicket GetCommonTicketSize (14)Zach Hilman2019-07-081-1/+17
| | | | | | | | | Returns the size of the buffer needed to hold the common ticket associated with the rights ID.
| * | es: Implement ETicket ListPersonalizedTicket (12)Zach Hilman2019-07-081-1/+24
| | | | | | | | | Returns an application-specific number of entries of personal tickets, starting at offset 0.
| * | es: Implement ETicket ListCommonTicket (11)Zach Hilman2019-07-081-1/+24
| | | | | | | | | Returns an application specified count of entries of common tickets, starting at offset 0.
| * | es: Implement ETicket CountPersonalizedTicket (10)Zach Hilman2019-07-081-1/+12
| | | | | | | | | Returns the number of personalized (console/user-unique) tickets in the KeyManager.
| * | es: Implement ETicket CountCommonTicket (9)Zach Hilman2019-07-081-1/+12
| | | | | | | | | Returns the number of common (non-console-unique) tickets in the KeyManager.
| * | es: Implement ETicket GetTitleKey (8)Zach Hilman2019-07-081-1/+27
| | | | | | | | | Takes a rights ID as input and returns the associated title key, if it exists.
| * | es: Implement ETicket ImportTicket (1)Zach Hilman2019-07-081-1/+45
| | | | | | | | | Takes a ticket and certificate and installs it to the KeyManager.
* | | Merge pull request #2834 from Morph1984/audrenu_QueryAudioDeviceInputEventDavid2019-09-051-1/+15
|\ \ \ | | | | | | | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEvent
| * | | Add Kernel::EventPair audio_input_device_switch_event;Morph19842019-09-041-0/+1
| | | |
| * | | audren_u: Stub IAudioDevice::QueryAudioDeviceInputEventMorph19842019-09-041-1/+14
| | | |
* | | | Merge pull request #2836 from Morph1984/hid_vibrationDavid2019-09-054-2/+32
|\ \ \ \ | | | | | | | | | | hid: Implement PermitVibration and IsVibrationPermitted
| * | | | dittoMorph19842019-09-041-1/+1
| | | | | | | | | | | | | | | Co-Authored-By: David <25727384+ogniK5377@users.noreply.github.com>
| * | | | IsVibrationEnabled() as a const member funcMorph19842019-09-041-1/+1
| | | | |
| * | | | clang-formatMorph19842019-09-041-2/+2
| | | | |
| * | | | Update npad.hMorph19842019-09-041-0/+1
| | | | |
| * | | | Update npad.cppMorph19842019-09-041-0/+6
| | | | |
| * | | | Update hid.hMorph19842019-09-041-0/+2
| | | | |
| * | | | Update hid.cppMorph19842019-09-041-2/+23
| |/ / /
* | | | Merge pull request #2818 from MysticExile/fmtDavid2019-09-051-1/+1
|\ \ \ \ | | | | | | | | | | externals: update fmt to 6.0.0
| * | | | accommodate for fmt updateEthan2019-08-291-1/+1
| |/ / /
* | | | AM: Stub IApplicationFunctions::GetGpuErrorDetectedSystemEvent (#2827)mailwl2019-09-042-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * AM: Implement IApplicationFunctions::GetGpuErrorDetectedSystemEvent * Remove unneeded event clear * Fix event name
* | | | Merge pull request #2829 from Morph1984/audiobunnei2019-09-041-2/+15
|\ \ \ \ | | | | | | | | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolume
| * | | | remove <f32>Morph19842019-09-041-1/+1
| | | | | | | | | | | | | | | We can remove this since its already a f32 value
| * | | | explicitly represent 1 as a float (1.0f instead of 1)Morph19842019-09-041-1/+1
| | | | |
| * | | | Change u32 -> f32Morph19842019-09-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Volume is a f32 value. (SwIPC describes it as a u32, but it is actually f32 as corroborated by switchbrew docs and SetAudioDeviceOutputVolume) ```cpp const f32 volume = rp.Pop<f32>(); ```
| * | | | service/audio/audren_u: Stub IAudioDevice::GetAudioDeviceOutputVolumeMorph19842019-09-031-2/+15
| |/ / /
* | | | Merge pull request #2708 from DarkLordZach/mii-db-source-crashDavid2019-09-041-0/+4
|\ \ \ \ | | | | | | | | | | mii: Handle logging of unknown database source
| * | | | mii: Handle logging of unknown database sourceZach Hilman2019-07-101-0/+4
| | | | |
* | | | | Merge pull request #2793 from ReinUsesLisp/bgr565bunnei2019-09-041-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | renderer_opengl: Implement RGB565 framebuffer format
| * | | | gpu: Change optional<reference_wrapper<T>> to T* for FramebufferConfigReinUsesLisp2019-08-211-1/+1
| | | | |
* | | | | Merge pull request #2748 from FernandoS27/align-memorybunnei2019-08-211-6/+6
|\ \ \ \ \ | |/ / / / |/| | | | VM_Manager: Align allocated host physical memory to 256bytes
| * | | | VM_Manager: Align allocated memory to 256bytesFernando Sahmkow2019-07-191-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit ensures that all backing memory allocated for the Guest CPU is aligned to 256 bytes. This due to how gpu memory works and the heavy constraints it has in the alignment of physical memory.
* | | | | Merge pull request #2747 from lioncash/audiobunnei2019-08-187-108/+179
|\ \ \ \ \ | | | | | | | | | | | | service/audren_u: Unstub ListAudioDeviceName
| * | | | | service/audren_u: Handle audio USB output revision queries in ListAudioDeviceName()Lioncash2019-07-192-16/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Audio devices use the supplied revision information in order to determine if USB audio output is able to be supported. In this case, we can only really handle using this revision information in ListAudioDeviceName(), where it checks if USB audio output is supported before supplying it as a device name. A few other scenarios exist where the revision info is checked, such as: - Early exiting from SetAudioDeviceOutputVolume if USB audio is attempted to be set when that device is unsupported. - Early exiting and returning 0.0f in GetAudioDeviceOutputVolume when USB output volume is queried and it's an unsupported device. - Falling back to AHUB headphones in GetActiveAudioDeviceName when the device type is USB output, but is unsupported based off the revision info. In order for these changes to also be implemented, a few other changes to the interface need to be made. Given we now properly handle everything about ListAudioDeviceName(), we no longer need to describe it as a stubbed function.
| * | | | | service/audren_u: Move revision testing code out of AudRenULioncash2019-07-192-63/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The revision querying facilities are used by more than just audren. e.g. audio devices can use this to test whether or not USB audio output is supported. This will be used within the following change.
| * | | | | service/audio: Remove global system accessorsLioncash2019-07-197-34/+54
| | | | | | | | | | | | | | | | | | | | | | | | Trims out the lingering reliance on global state out of the audio code.
| * | | | | service/audren_u: Remove unnecessary return value from GetActiveAudioDeviceName()Lioncash2019-07-191-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | This service function only ever returns a result and nothing more.
| * | | | | service/audren_u: Report proper device namesLioncash2019-07-191-6/+29
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | AudioDevice and AudioInterface aren't valid device names on the Switch. We should also be returning consistent names in GetActiveAudioDeviceName(). While we're at it, we can also handle proper name output in ListAudioDeviceName, by returning all the available devices on the Switch.
* | | | | Merge pull request #2592 from FernandoS27/sync1bunnei2019-07-2630-169/+542
|\ \ \ \ \ | |/ / / / |/| | | | Implement GPU Synchronization Mechanisms & Correct NVFlinger
| * | | | NVServices: Correct delayed responses.Fernando Sahmkow2019-07-051-24/+19
| | | | |
| * | | | Nv_Host_Ctrl: Correct difference calculationFernando Sahmkow2019-07-051-5/+7
| | | | |
| * | | | NVServices: Address FeedbackFernando Sahmkow2019-07-058-21/+38
| | | | |
| * | | | NVServices: Styling, define constructors as explicit and correctionsFernando Sahmkow2019-07-0518-36/+31
| | | | |
| * | | | NVFlinger: Correct GCC compile errorFernando Sahmkow2019-07-056-17/+16
| | | | |
| * | | | NVServices: Make NVEvents Automatic according to documentation.Fernando Sahmkow2019-07-052-4/+7
| | | | |
| * | | | NVServices: Correct CtrlEventWaitSync to block the ipc until timeout.Fernando Sahmkow2019-07-0523-31/+104
| | | | |
| * | | | GPU: Correct Interrupts to interrupt on syncpt/value instead of event, mirroring hardwareFernando Sahmkow2019-07-055-14/+14
| | | | |
| * | | | nvflinger: Make the force 30 fps still force 30 fpsFernando Sahmkow2019-07-051-1/+1
| | | | |
| * | | | nv_services: Fixes to event liberation.Fernando Sahmkow2019-07-051-6/+14
| | | | |
| * | | | nvflinger: Acquire buffers in the same order as they were queued.Fernando Sahmkow2019-07-052-3/+11
| | | | |
| * | | | nv_services: Deglobalize NvServicesFernando Sahmkow2019-07-0523-51/+65
| | | | |
| * | | | nv_host_ctrl: Make Sync GPU variant always return synced result.Fernando Sahmkow2019-07-051-0/+5
| | | | |
| * | | | nvhost_ctrl: Corrections to event handlingFernando Sahmkow2019-07-052-8/+12
| | | | |
| * | | | Gpu: Mark areas as protected.Fernando Sahmkow2019-07-051-0/+6
| | | | |
| * | | | nv_services: Stub CtrlEventSignalFernando Sahmkow2019-07-052-12/+34
| | | | |
| * | | | Gpu: Implement Hardware Interrupt Manager and manage GPU interruptsFernando Sahmkow2019-07-053-8/+1
| | | | |
| * | | | nv_services: Implement NvQueryEvent, NvCtrlEventWait, NvEventRegister, NvEventUnregisterFernando Sahmkow2019-07-057-17/+192
| | | | |
| * | | | nv_services: Create GPU channels correctlyFernando Sahmkow2019-07-052-2/+5
| | | | |
| * | | | video_core: Implement GPU side SyncpointsFernando Sahmkow2019-07-053-7/+33
| | | | |
| * | | | nv_services: Correct buffer queue fencing and GPFifo fencingFernando Sahmkow2019-07-057-57/+69
| | | | |
| * | | | nvflinger: Implement swap intervalsFernando Sahmkow2019-07-055-8/+21
| | | | |
* | | | | Clang formatDavid Marcec2019-07-121-2/+4
| | | | |
* | | | | "AudioRenderer" thread should have a unique nameDavid Marcec2019-07-122-4/+4
| | | | | | | | | | | | | | | | | | | | Creating multiple "AudioRenderer" threads cause the previous thread to be overwritten. The thread will name be renamed to AudioRenderer-InstanceX, where X is the current instance number.
* | | | | Merge pull request #2717 from SciresM/unmirror_memorybunnei2019-07-111-6/+26
|\ \ \ \ \ | | | | | | | | | | | | Restore memory perms on svcUnmapMemory/UnloadNro
| * | | | | Restore memory perms on svcUnmapMemory/UnloadNroMichael Scire2019-07-111-6/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prior to PR, Yuzu did not restore memory to RW- on unmap of mirrored memory or unloading of NRO. (In fact, in the NRO case, the memory was unmapped instead of reprotected to --- on Load, so it was actually lost entirely...) This PR addresses that, and restores memory to RW- as it should. This fixes a crash in Super Smash Bros when creating a World of Light save for the first time, and possibly other games/circumstances.
* | | | | | service/am: Implement IsAutoSleepDisabledLioncash2019-07-112-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This simply queries whether or not auto-sleep facilities are disabled and has no special handling. It's a basic getter function.
* | | | | | service/am: Implement SetAutoSleepDisabledLioncash2019-07-112-1/+23
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides a basic implementation of SetAutoSleepDisabled. Until idle handling is implemented, this is about the best we can do. In the meantime, provide a rough documenting of specifics that occur when this function is called on actual hardware.
* | | | | Merge pull request #2700 from ogniK5377/GetFriendListbunnei2019-07-101-1/+34
|\ \ \ \ \ | | | | | | | | | | | | IFriendService::GetFriendList
| * | | | | IFriendService::GetFriendListDavid Marcec2019-07-091-1/+34
| | |/ / / | |/| | | | | | | | | | | | | We don't have any friends implemented in Yuzu yet so it doesn't make sense to return any friends. For now we'll be returning 0 friends however the information provided will allow a proper implementation of this cmd when needed.
* | | | | Merge pull request #2611 from DarkLordZach/pm-info-cmdbunnei2019-07-103-16/+116
|\ \ \ \ \ | | | | | | | | | | | | pm: Implement various pm commands for finding process and title IDs
| * | | | | pm: Implement pm:shell and pm:dmnt GetApplicationPidZach Hilman2019-06-273-7/+33
| | | | | | | | | | | | | | | | | | | | | | | | Returns the process ID of the current application or 0 if no app is running.
| * | | | | pm: Implement pm:dmnt GetTitlePidZach Hilman2019-06-271-7/+36
| | | | | | | | | | | | | | | | | | | | | | | | Takes a title ID and searches for a matching process, returning error if it doesn't exist, otherwise the process ID.
| * | | | | pm: Implement pm:info GetTitleIdZach Hilman2019-06-271-2/+47
| | | | | | | | | | | | | | | | | | | | | | | | Searches the process list for a process with the specified ID, returning the title ID if it exists.
* | | | | | Merge pull request #2650 from DarkLordZach/mii-iface-verbunnei2019-07-101-1/+15
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | mii: Implement IDatabaseService SetInterfaceVersion
| * | | | | mii: Implement IDatabaseService SetInterfaceVersionZach Hilman2019-07-071-1/+15
| |/ / / / | | | | | | | | | | Appears to set a member variable used to affect the API that games access, and the method used to store data.
* | | | | Merge pull request #2657 from ogniK5377/npad-assignmentsZach Hilman2019-07-085-3/+99
|\ \ \ \ \ | | | | | | | | | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignment
| * | | | | addressed issuesDavid Marcec2019-07-081-6/+7
| | | | | |
| * | | | | hid:StartLrAssignmentMode, hid:StopLrAssignmentMode, hid:SwapNpadAssignmentDavid Marcec2019-07-015-3/+98
| |/ / / / | | | | | | | | | | | | | | | StartLrAssignmentMode and StopLrAssignmentMode don't require any implementation as it's just used for showing the screen of changing the controller orientation if the user wishes to do so. Ever since #1634 this has not been needed as users can specify the controller orientation from the config and swap at any time. We store a private member just in case this gets used for anything extra in the future
* | | | | Merge pull request #2651 from DarkLordZach/apm-boost-mode-1bunnei2019-07-0811-57/+236
|\ \ \ \ \ | | | | | | | | | | | | apm: Initial implementation of performance config and boost mode
| * | | | | am: Implement SetCpuBoostMode in terms of APMZach Hilman2019-06-295-13/+26
| | | | | |
| * | | | | apm: Implement SetCpuBoostModeZach Hilman2019-06-292-0/+14
| | | | | |
| * | | | | apm: Add getters for performance config and modeZach Hilman2019-06-292-33/+49
| | | | | |
| * | | | | apm: Add apm:am serviceZach Hilman2019-06-292-11/+9
| | | | | | | | | | | | | | | | | | | | | | | | 8.0.0+ identical version of apm
| * | | | | apm: Add Controller class to manage speed data and applicationZach Hilman2019-06-292-0/+138
| |/ / / /
* | | | | Merge pull request #2642 from DarkLordZach/fsp-log-2bunnei2019-07-086-27/+73
|\ \ \ \ \ | |_|_|/ / |/| | | | fsp-srv: Implement Access Logging Functionality
| * | | | fsp-srv: Implement GetAccessLogVersionInfoZach Hilman2019-06-292-3/+14
| | | | | | | | | | | | | | | | | | | | Returns some misc. data about logging to help the game determine if it should log.
| * | | | fsp-srv: Implement OutputAccessLogToSdCardZach Hilman2019-06-296-26/+61
| |/ / / | | | | | | | | | | | | Allows games to log data to the SD.
* | | | clang-format fixesMichael Scire2019-07-061-4/+5
| | | |
* | | | am: Implement GetAccumulatedSuspendedTickValueMichael Scire2019-07-062-7/+19
| |/ / |/| |
* | | Merge pull request #2658 from ogniK5377/QueryAudioDeviceOutputEventbunnei2019-07-041-3/+16
|\ \ \ | | | | | | | | IAudioDevice::QueryAudioDeviceOutputEvent
| * | | IAudioDevice::QueryAudioDeviceOutputEventDavid Marcec2019-07-011-3/+16
| |/ / | | | | | | | | | The event should only be signaled when an output audio device gets changed. Example, Speaker to USB headset. We don't identify different devices internally yet so there's no need to signal the event yet.
* | | Merge pull request #2638 from DarkLordZach/quest-flagbunnei2019-07-042-1/+10
|\ \ \ | | | | | | | | set: Implement GetQuestFlag with config option
| * | | set: Implement GetQuestFlagZach Hilman2019-06-292-1/+10
| |/ / | | | | | | Simply returns a true/false value indicating if the system is a kiosk system. This has been mapped to a config option for the purposes of yuzu.
* | | Merge pull request #2613 from ogniK5377/InitalizeApplicationInfoZach Hilman2019-07-044-6/+109
|\ \ \ | | | | | | | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestricted
| * | | Addressed issuesDavid Marcec2019-06-282-17/+12
| | | |
| * | | Implemented InitializeApplicationInfo & InitializeApplicationInfoRestrictedDavid Marcec2019-06-274-6/+114
| |/ / | | | | | | | | | InitializeApplicationInfoRestricted will need further implementation as it's checking for other user requirements about the game. As we're emulating, we're assuming the user owns the game so we skip these checks currently, implementation will need to be added further on
* | | Merge pull request #2608 from ogniK5377/Time_GetSharedMemoryNativeHandleZach Hilman2019-07-047-28/+258
|\ \ \ | | | | | | | | Implement Time::GetSharedMemoryNativeHandle
| * | | Addressed issuesDavid Marcec2019-06-265-37/+53
| | | |
| * | | Implement Time::GetSharedMemoryNativeHandleDavid Marcec2019-06-257-29/+243
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This PR attempts to implement the shared memory provided by GetSharedMemoryNativeHandle. There is still more work to be done however that requires a rehaul of the current time module to handle clock contexts. This PR is mainly to get the basic functionality of the SharedMemory working and allow the use of addition to it whilst things get improved on. Things to note: Memory Barriers are used in the SharedMemory and a better solution would need to be done to implement this. Currently in this PR I’m faking the memory barriers as everything is sync and single threaded. They work by incrementing the counter and just populate the two data slots. On data reading, it will read the last added data. Specific values in the shared memory would need to be updated periodically. This isn't included in this PR since we don't actively do this yet. In a later PR when time is refactored this should be done. Finally, as we don't handle clock contexts. When time is refactored, we will need to update the shared memory for specific contexts. This PR does this already however since the contexts are all identical and not separated. We're just updating the same values for each context which in this case is empty. Tiime:SetStandardUserSystemClockAutomaticCorrectionEnabled, Time:IsStandardUserSystemClockAutomaticCorrectionEnabled are also partially implemented in this PR. The reason the implementation is partial is because once again, a lack of clock contexts. This will be improved on in a future PR. This PR closes issue #2556
* | | | Merge pull request #2604 from ogniK5377/INotificationServicebunnei2019-07-034-1/+129
|\ \ \ \ | |_|_|/ |/| | | Implemented INotificationService
| * | | Attemp clang format fix?David Marcec2019-06-281-1/+0
| | | | | | | | | | | | | | | | Seems to be an issue with clang format
| * | | Addressed issuesDavid Marcec2019-06-282-13/+13
| | | |
| * | | SizedNotificationInfo should be 0x10 bytes, user_uuid is incorrect, this should be the users account idDavid Marcec2019-06-251-1/+3
| | | |
| * | | fixed spelling errors and fixed issue with Pop not returning the SizedNotificationInfoDavid Marcec2019-06-251-6/+8
| | | |
| * | | Implemented INotificationServiceDavid Marcec2019-06-244-1/+126
| |/ /
* | / file_sys: Rename other ContentRecordType membersBakugo2019-07-021-2/+2
| |/ |/|
* | Merge pull request #2548 from DarkLordZach/applet-shopnbunnei2019-06-2613-112/+690
|\ \ | | | | | | applets: Implement backend and default frontend for Parental Controls and EShop (ShopN) applets
| * | applets: Pass current process title ID to appletsZach Hilman2019-06-2511-41/+59
| | | | | | | | | | | | Avoids using system accessor to get current process in applet code.
| * | general_frontend: Add documentation for parental controls and ecommerce appletsZach Hilman2019-06-252-16/+16
| | |
| * | web_browser: Only delete temporary directory if it was createdZach Hilman2019-06-251-1/+3
| | | | | | | | | | | | Prevents crashes with ShopN applet occasionally.
| * | web_browser: Take ECommerce applet frontend optionally in constructorZach Hilman2019-06-251-1/+6
| | | | | | | | | If it is needed but wasn't passed (or passed nullptr), the Shop handling code will alert and throw an error.
| * | web_browser: Use function tables for execute and initializeZach Hilman2019-06-252-7/+285
| | | | | | | | | Allows easy handling of multiple shim types, as they have enough in common to be the same backend but not enough to share init/exec.
| * | web_browser: Correct structures and properly parse TLVs/ShimKindZach Hilman2019-06-252-61/+168
| | | | | | | | | Much, much more HW-accurate and allows us to easily support all of the different web 'shim' types.
| * | applets: Track ECommerce and Parental Control applet frontendsZach Hilman2019-06-252-7/+29
| | |
| * | applets: Implement Auth applet backendZach Hilman2019-06-252-0/+146
| |/ | | | | This is responsible for parental controls and supports verifying, changing, and registering PIN codes.
* | glue: Correct missing bytes in ApplicationLaunchParameterZach Hilman2019-06-264-28/+61
| |
* | glue: Implement arp:w and arp:r servicesZach Hilman2019-06-253-2/+330
| | | | | | | | These keep track of running process' launch properties and control properties and allows for issuing and reading them by process and title ID.
* | glue: Add errors for glue/arp servicesZach Hilman2019-06-253-0/+58
| |
* | glue: Add scaffolding for bgtc:t and bgtc:sc servicesZach Hilman2019-06-252-0/+73
| |
* | arp: Move to glue servicesZach Hilman2019-06-252-91/+0
| | | | | | | | Glue is the name of the sysmodule that contains both arp and bgtc.
* | glue: Add manager to keep track of application registryZach Hilman2019-06-252-0/+119
|/ | | | Manages mapping between title IDs and application launch and control properties.
* Merge pull request #2602 from lioncash/castbunnei2019-06-211-3/+3
|\ | | | | service/acc: Silence truncation warnings
| * service/acc: Silence truncation warningsLioncash2019-06-211-3/+3
| | | | | | | | | | The sanitizing function ensures that the returned type is always the correct type. This eliminates warnings without extra casts.
* | Merge pull request #2482 from DarkLordZach/prepobunnei2019-06-218-43/+95
|\ \ | |/ |/| core: Add detailed local reporting feature for development
| * loader: Move NSO module tracking to AppLoaderZach Hilman2019-05-263-6/+7
| | | | | | Also cleanup of general stuff
| * prepo: Save reports from PlayReport serviceZach Hilman2019-05-251-2/+23
| | | | | | | | Logs a lot of seemingly innocuous telemetry games generate.
| * fatal: Save report on fatal:u callZach Hilman2019-05-251-21/+5
| | | | | | | | Matches offical behavior with creport and replaces old log/text based report system.
| * service: Save report on unimplemented function callZach Hilman2019-05-251-0/+3
| |
| * applets/error: Save report on error appletZach Hilman2019-05-251-5/+14
| | | | | | | | This matches official behavior with the erpt/eclct/eupld service chain.
| * applets: Save report on stubbed appletZach Hilman2019-05-254-15/+49
| | | | | | | | This also reworks the applet data storage to be peekable.
* | Revert PR 2590.Fernando Sahmkow2019-06-201-1/+1
| | | | | | | | | | | | | | | | | | Even though it has been proven that IAudioRenderer:SystemEvent is actually an automatic event. The current implementation of such event is all thought to be manual. Thus it's implementation needs to be corrected when doing such change. As it is right now this PR introduced a series of regressions on softlocks on multiple games. Therefore, this pr reverts such change until a correct implementation is made.
* | Merge pull request #2590 from lioncash/eventbunnei2019-06-201-1/+1
|\ \ | | | | | | service/audio/audren_u: Correct event reset type for the system event
| * | service/audio/audren_u: Correct event reset type for the system eventLioncash2019-06-181-1/+1
| | | | | | | | | | | | | | | This is actually an auto-reset event in the audio service itself, not a manual one.
* | | Addressed issuesDavid Marcec2019-06-173-8/+13
| | |
* | | Signalled accumulated_suspended_tick_changed_event on creation based on REDavid Marcec2019-06-161-0/+1
| | |
* | | CleanupDavid Marcec2019-06-1611-29/+38
| | |
* | | Impl'd IsUserAccountSwitchLocked, SetAudioOutVolume, GetAudioOutVolume & Partial impl of GetAccumulatedSuspendedTickChangedEventDavid Marcec2019-06-166-7/+72
| | | | | | | | | | | | IPC-100 was changed to InitializeApplicationInfoOld instead of InitializeApplicationInfo. IPC-150 makes an indentical call to IPC-100 however does extra processing. They should not have the same name as it's quite confusing to debug.
* | | common/hex_util: Combine HexVectorToString() and HexArrayToString()Lioncash2019-06-122-7/+7
|/ / | | | | | | | | | | These can be generified together by using a concept type to designate them. This also has the benefit of not making copies of potentially very large arrays.
* | constants: Extract backup JPEG used by account servicesZach Hilman2019-06-071-16/+4
| |
* | Merge pull request #2551 from lioncash/dtorbunnei2019-06-061-9/+9
|\ \ | | | | | | service/ns: Add missing override specifiers
| * | service/ns: Add missing override specifiersLioncash2019-06-051-9/+9
| | |
* | | Merge pull request #2419 from DarkLordZach/srv-lr-ifacebunnei2019-06-061-3/+77
|\ \ \ | |/ / |/| | lr: Add command handler skeletons for Open*LocationResolver
| * | ncm: Implement LR OpenAddOnContentLocationResolver (2)Zach Hilman2019-05-271-24/+21
| | | | | | | | | Returns an object of type IAddOnContentLocationResolver for the provided StorageId.
| * | ncm: Implement LR OpenRegisteredLocationResolver (1)Zach Hilman2019-05-271-0/+27
| | | | | | | | | Returns an object of type IRegisteredLocationResolver for the StorageId.
| * | ncm: Implement LR OpenLocationResolver (0)Zach Hilman2019-05-271-0/+50
| | | | | | | | | Returns an object of type ILocationResolver with the provided StorageId.
* | | Merge pull request #2526 from lioncash/globalZach Hilman2019-06-052-5/+37
|\ \ \ | | | | | | | | core/telemetry_session: Remove usages of the global system accessor
| * | | core/core: Remove unnecessary includesLioncash2019-05-292-5/+37
| |/ / | | | | | | | | | | | | The contents of these includes aren't used anywhere in this translation unit.
* | | Merge pull request #2545 from lioncash/timingZach Hilman2019-06-052-5/+7
|\ \ \ | | | | | | | | core/core_timing_util: Use std::chrono types for specifying time units
| * | | core/core_timing_util: Amend casing of cyclesTo* functionsLioncash2019-06-052-3/+3
| | | | | | | | | | | | | | | | | | | | Makes the casing consistent with all of our general function naming conventions.
| * | | core/core_timing_util: Use std::chrono types for specifying time unitsLioncash2019-06-052-5/+7
| | | | | | | | | | | | | | | | | | | | Makes the interface more type-safe and consistent in terms of return values.
* | | | Merge pull request #2510 from SciresM/desired_languageZach Hilman2019-06-057-402/+1073
|\ \ \ \ | |/ / / |/| | | Implement/Fix IApplicationFunctions::GetDesiredLanguage
| * | | Fix bitmask logic inversionMichael Scire2019-05-231-2/+1
| | | |
| * | | fix introduced clang-format errorsMichael Scire2019-05-231-3/+2
| | | |
| * | | Address review commentsMichael Scire2019-05-235-45/+118
| | | |
| * | | clang-format fixesMichael Scire2019-05-234-31/+32
| | | |
| * | | Implement IApplicationFunctions::GetDesiredLanguageMichael Scire2019-05-236-403/+1002
| | | |
* | | | Merge pull request #1931 from DarkLordZach/mii-database-1bunnei2019-05-308-104/+1051
|\ \ \ \ | |_|/ / |/| | | mii: Implement MiiManager backend and several mii service commands
| * | | mii_manager: Fix incorrect loop condition in mii UUID generation codeZach Hilman2019-04-253-2/+3
| | | |
| * | | profile_select: Port Service::Account::UUID to Common::UUIDZach Hilman2019-04-253-6/+6
| | | |
| * | | mii: Implement Delete and Destroy fileZach Hilman2019-04-253-8/+116
| | | |
| * | | mii: Implement IsUpdated command (IPC 0)Zach Hilman2019-04-253-9/+34
| | | |
| * | | mii_manager: Cleanup and optimizationZach Hilman2019-04-253-36/+50
| | | |
| * | | mii: Implement IDatabaseService commands using MiiManagerZach Hilman2019-04-251-15/+242
| | | | | | | | | | | | Since the MiiManager was designed around the IPC interface, this is quite easy. Only functions that were clearly defined were implemented.
| * | | mii: Add MiiManager class to manage Mii databaseZach Hilman2019-04-252-0/+622
| | | | | | | | | | | | Provides serialization/deserialization to the database in system save files, accessors for database state and proper handling of both major Mii formats (MiiInfo and MiiStoreData)
| * | | common: Extract UUID to its own classZach Hilman2019-04-253-78/+28
| | | | | | | | | | | | Since the Mii database uses UUIDs very similar to the Accounts database, it makes no sense to not share code between them.
* | | | Merge pull request #2509 from lioncash/aocbunnei2019-05-261-19/+50
|\ \ \ \ | |_|_|/ |/| | | service/aoc_u: Minor cleanup
| * | | service/aoc: Avoid allocating and discarding dataLioncash2019-05-231-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the code was accumulating data into a std::vector and then tossing all of it away if a setting was disabled. Instead, we can just check if it's disabled and do no work at all if possible. If it's enabled, then we can append to the vector and allocate. Unlikely to impact usage much, but it is slightly less sloppy with resources.
| * | | service/aoc: Remove unnecessary includesLioncash2019-05-231-2/+0
| | | | | | | | | | | | | | | | | | | | Removes two header dependencies related to file handling that aren't actually used within the source file.
| * | | service/aoc: Pop all passed values where applicableLioncash2019-05-231-12/+45
| | |/ | |/| | | | | | | | | | | | | A few of the aoc service stubs/implementations weren't fully popping all of the parameters passed to them. This ensures that all parameters are popped and, at minimum, logged out.
* | | Merge pull request #2489 from FearlessTobi/port-4716bunnei2019-05-251-1/+1
|\ \ \ | |/ / |/| | Port citra-emu/citra#4716: "HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThread"
| * | HLE/IPC: HLEContext can memorize the client thread and use it for SleepClientThreadWeiyi Wang2019-05-181-1/+1
| | | | | | | | | | | | This reduces the boilerplate that services have to write out the current thread explicitly. Using current thread instead of client thread is also semantically incorrect, and will be a problem when we implement multicore (at which time there will be multiple current threads)
* | | Merge pull request #2439 from lioncash/audrenHexagon122019-05-192-51/+299
|\ \ \ | | | | | | | | service/audren_u: Get rid of magic values within GetAudioRendererWorkBufferSize
| * | | service/audren_u: Handle variadic command buffers in GetWorkBufferSize()Lioncash2019-05-012-17/+93
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also introduced in REV5 was a variable-size audio command buffer. This also affects how the size of the work buffer should be determined, so we can add handling for this as well. Thankfully, no other alterations were made to how the work buffer size is calculated in 7.0.0-8.0.0. There were indeed changes made to to how some of the actual audio commands are generated though (particularly in REV7), however they don't apply here.
| * | | service/audren_u: Handle version 2 of performance frame info in GetWorkBufferSize()Lioncash2019-05-012-6/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Introduced in REV5. This is trivial to add support for, now that everything isn't a mess of random magic constant values. All this is, is a change in data type sizes as far as this function cares.
| * | | service/audren_u: Clean up work buffer calculationsLioncash2019-05-011-49/+214
| | |/ | |/| | | | | | | | | | | | | "Unmagics" quite a few magic constants within this code, making it much easier to understand. Particularly given this factors out specific sections into their own self-contained lambda functions.
* | | Merge pull request #2463 from lioncash/setHexagon122019-05-191-34/+22
|\ \ \ | | | | | | | | service/set: Correct and simplify behavior related to copying language codes
| * | | service/set: Correct and simplify behavior related to copying language codesLioncash2019-05-101-34/+22
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This corrects cases where it was possible to write more entries into the write buffer than were requested. Now, we check the size of the buffer before actually writing into them. We were also returning the wrong value for GetAvailableLanguageCodeCount2(). This was previously returning 64, but only 17 should have been returned. 64 entries is the size of the static array used in MakeLanguageCode() within the service binary itself, but isn't the actual total number of language codes present.
* | | Merge pull request #2487 from lioncash/service-returnHexagon122019-05-191-0/+2
|\ \ \ | | | | | | | | service/am: Add missing return in error case for IStorageAccessor's Read/Write()
| * | | service/am: Add missing return in error case for IStorageAccessor's Read()/Write().Lioncash2019-05-191-0/+2
| |/ / | | | | | | | | | | | | Previously this would fall through and return successfully, despite being an out of bounds read or write.
* / / core/kernel/object: Rename ResetType enum membersLioncash2019-05-1814-26/+26
|/ / | | | | | | | | | | | | | | | | | | | | | | | | Renames the members to more accurately indicate what they signify. "OneShot" and "Sticky" are kind of ambiguous identifiers for the reset types, and can be kind of misleading. Automatic and Manual communicate the kind of reset type in a clearer manner. Either the event is automatically reset, or it isn't and must be manually cleared. The "OneShot" and "Sticky" terminology is just a hold-over from Citra where the kernel had a third type of event reset type known as "Pulse". Given the Switch kernel only has two forms of event reset types, we don't need to keep the old terminology around anymore.
* / service/audctl: Update documentation comments to be relative to 8.0.0Lioncash2019-04-281-2/+2
|/ | | | The state of these service calls are still the same in version 8.0.0.
* Merge pull request #2228 from DarkLordZach/applet-manager-p1bunnei2019-04-2514-63/+487
|\ | | | | applets: Add AppletManager and implement PhotoViewer and Error applets
| * web_browser: Make OpenPage non-constZach Hilman2019-04-178-15/+20
| |
| * main: Add GMainWindow hooks for Error displayZach Hilman2019-04-171-2/+2
| |
| * general_backend: Move StubApplet and add backend PhotoViewerZach Hilman2019-04-172-1/+102
| |
| * applets: Add Error appletZach Hilman2019-04-173-24/+224
| | | | | | Responsible for displaying error codes and messages
| * applets: Port current applets to take frontend in constructorZach Hilman2019-04-176-14/+16
| | | | | | As opposed to using Core::System::GetInstance()
| * am: Delegate applet creation to AppletManagerZach Hilman2019-04-171-24/+3
| |
| * applets: Add AppletManager class to control lifetimeZach Hilman2019-04-172-0/+137
| |
* | service/audctl: Implement GetTargetVolumeMin() and GetTargetVolumeMax()Lioncash2019-04-182-2/+32
|/ | | | | These two service functions are literally hardcoded to always return these values without any other error checking.
* Merge pull request #2382 from lioncash/tablebunnei2019-04-1627-57/+262
|\ | | | | service: Update service function tables
| * service: Update service function tablesLioncash2019-04-1127-57/+262
| | | | | | | | Updates function tables based off information from SwitchBrew.
* | Merge pull request #2378 from lioncash/robunnei2019-04-141-65/+85
|\ \ | | | | | | ldr: Minor amendments to IPC-related parameters
| * | ldr: Mark IsValidNROHash() as a const member functionLioncash2019-04-101-5/+4
| | | | | | | | | | | | This doesn't modify instance state, so it can be made const.
| * | ldr: Amend parameters for LoadNro/UnloadNro LoadNrr/UnloadNrrLioncash2019-04-101-60/+81
| |/ | | | | | | | | The initial two words indicate a process ID. Also UnloadNro only specifies one address, not two.
* | Merge pull request #2357 from zarroboogs/force-30fps-modebunnei2019-04-141-6/+10
|\ \ | | | | | | Add a toggle to force 30FPS mode
| * | added a toggle to force 30fps modezarroboogs2019-04-091-6/+10
| | |
* | | fsp_srv: Remove unnecessary parameter popping in IDirectory's Read()Lioncash2019-04-101-4/+1
| | | | | | | | | | | | | | | IDirectory's Read() function doesn't take any input parameters. It only uses the output parameters that we already provide.
* | | fsp_srv: Log out option values in IFile's Read and Write functionsLioncash2019-04-101-4/+6
| |/ |/| | | | | | | | | | | | | These indicate options that alter how a read/write is performed. Currently we don't need to handle these, as the only one that seems to be used is for writes, but all the custom options ever seem to do is immediate flushing, which we already do by default.
* | Merge pull request #1957 from DarkLordZach/title-providerbunnei2019-04-104-10/+9
|\ \ | |/ |/| file_sys: Provide generic interface for accessing game data
| * patch_manager: Dump NSO name with build IDZach Hilman2019-03-281-2/+1
| |
| * game_list: Register content with ContentProviderZach Hilman2019-03-271-2/+3
| |
| * core: Port current uses of RegisteredCache to ContentProviderZach Hilman2019-03-273-9/+8
| |
* | Merge pull request #2334 from lioncash/overridebunnei2019-04-069-18/+5
|\ \ | | | | | | core: Add missing override specifiers where applicable
| * | core: Add missing override specifiers where applicableLioncash2019-04-049-18/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | Applies the override specifier where applicable. In the case of destructors that are defaulted in their definition, they can simply be removed. This also removes the unnecessary inclusions being done in audin_u and audrec_u, given their close proximity.
* | | Merge pull request #2339 from lioncash/rankbunnei2019-04-063-12/+15
|\ \ \ | | | | | | | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structs
| * | | service/fsp_srv: Don't pass SaveDataDescriptor instances by value.Lioncash2019-04-052-4/+4
| | | | | | | | | | | | | | | | | | | | Passing around a 64 byte data struct by value is kind of wasteful, instead pass a reference to the struct.
| * | | service/fsp_srv: Remove unnecessary unknown member in OpenSaveDataFileSystemLioncash2019-04-051-7/+8
| | | | | | | | | | | | | | | | | | | | The unknown member here is actually padding due to being passed as a struct. We can do the same, and remove the need to pop a padding word.
| * | | service/fsp_srv: Update SaveDataInfo and SaveDataDescriptor structsLioncash2019-04-051-1/+3
| |/ / | | | | | | | | | | | | I realized that I updated the documentation on SwitchBrew a while ago, but never actually updated the structs within yuzu.
* | | Merge pull request #2338 from lioncash/fsbunnei2019-04-051-5/+8
|\ \ \ | | | | | | | | filesystem: Use a std::string_view in OpenFile()
| * | | filesystem: Use a std::string_view in OpenFile()Lioncash2019-04-051-5/+8
| |/ / | | | | | | | | | | | | | | | Rather than make a full copy of the path, we can just use a string view and truncate the viewed portion of the string instead of creating a totally new truncated string.
* / / hle/service: Resolve unused variable warningsLioncash2019-04-048-62/+58
|/ / | | | | | | | | | | | | | | | | In several places, we have request parsers where there's nothing to really parse, simply because the HLE function in question operates on buffers. In these cases we can just remove these instances altogether. In the other cases, we can retrieve the relevant members from the parser and at least log them out, giving them some use.
* | Merge pull request #2328 from lioncash/transferbunnei2019-04-041-6/+6
|\ \ | | | | | | service/am: Correct behavior of CreateTransferMemoryStorage()
| * | service/am: Correct behavior of CreateTransferMemoryStorage()Lioncash2019-04-031-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | For whatever reason, shared memory was being used here instead of transfer memory, which (quite clearly) will not work based off the name of the function. This corrects this wonky usage of shared memory.
* | | Merge pull request #2294 from lioncash/fatalbunnei2019-04-032-36/+63
|\ \ \ | |/ / |/| | service/am: Implement EnterFatalSection/LeaveFatalSection
| * | service/am: Implement EnterFatalSection and LeaveFatalSectionLioncash2019-03-262-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These functions act in tandem similar to how a lock or mutex require a balanced lock()/unlock() sequence. EnterFatalSection simply increments a counter for how many times it has been called, while LeaveFatalSection ensures that a previous call to EnterFatalSection has occured. If a previous call has occurred (the counter is not zero), then the counter gets decremented as one would expect. If a previous call has not occurred (the counter is zero), then an error code is returned.
| * | service/am: Sort ISelfController's member functions according to table orderLioncash2019-03-262-36/+36
| |/ | | | | | | | | Makes the declaration order of the handling functions consistent with the handler table itself.
* | Merge pull request #2301 from FearlessTobi/remove-amiibo-settingbunnei2019-04-011-1/+1
|\ \ | | | | | | core/yuzu: Remove enable_nfc setting
| * | core/yuzu: Remove enable_nfc settingfearlessTobi2019-03-291-1/+1
| |/ | | | | | | This was initially added to prevent problems from stubbed/not implemented NFC services, but as we never encountered such and as it's only used in a deprecated function anyway, I guess we can just remove it to prevent more clutter of the settings.
* | general: Use deducation guides for std::lock_guard and std::unique_lockLioncash2019-04-011-1/+1
| | | | | | | | | | | | | | Since C++17, the introduction of deduction guides for locking facilities means that we no longer need to hardcode the mutex type into the locks themselves, making it easier to switch mutex types, should it ever be necessary in the future.
* | service/fatal: Mark local variables as const where applicableLioncash2019-03-301-6/+6
| |
* | service/fatal: Remove unnecessary semicolonLioncash2019-03-301-1/+1
| | | | | | | | Resolves a -Wextra-semi warning.
* | service/fatal: Name FatalInfo structure membersLioncash2019-03-301-31/+44
|/ | | | | | | | | | | | Based off RE, most of these structure members are register values, which makes, sense given this service is used to convey fatal errors. One member indicates the program entry point address, one is a set of bit flags used to determine which registers to print, and one member indicates the architecture type. The only member that still isn't determined is the final member within the data structure.
* core/core_timing: Make callback parameters consistentLioncash2019-03-243-8/+8
| | | | | | | | | | | In some cases, our callbacks were using s64 as a parameter, and in other cases, they were using an int, which is inconsistent. To make all callbacks consistent, we can just use an s64 as the type for late cycles, given it gets rid of the need to cast internally. While we're at it, also resolve some signed/unsigned conversions that were occurring related to the callback registration.
* Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-232-2/+79
|\ | | | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversion
| * set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| |
| * set_sys: Use official nintendo version stringZach Hilman2019-03-111-11/+7
| |
| * set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| |
| * set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-102-2/+63
| | | | | | Uses the synthesized system archive 9 (SystemVersion) and reports v5.1.0-0.0
* | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-221-12/+4
|\ \ | | | | | | gpu: Rewrite MemoryManager based on the VMManager implementation.
| * | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-211-10/+2
| | |
| * | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-211-2/+2
| | |
* | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-221-5/+3
|\ \ \ | | | | | | | | kernel/vm_manager: Amend flag value for code data
| * | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-211-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it more evident that one is for actual code and one is for actual data. Mutable and static are less than ideal terms here, because read-only data is technically not mutable, but we were mapping it with that label.
* | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ | | | | | | | | | | service/am: Add function table for IDebugFunctions
| * | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / | | | | | | | | | | | | | | | | We already have the service related stuff set up for this, however, it's missing the function table.
* | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-221-0/+3
|\ \ \ \ | |/ / / |/| | | file_sys: Implement parser and interpreter for game memory cheats
| * | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-051-0/+2
| | | |
| * | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
| | | | | | | | | | | | | | | | Allows frontend/features to access pressed buttons conveniently as possible
* | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-215-74/+74
|\ \ \ \ | |_|/ / |/| | | Port citra-emu/citra#4244 and citra-emu/citra#4599: Changes to BitField
| * | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-065-74/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit it automatically generated by command in zsh: sed -i -- 's/BitField<\(.*\)_le>/BitField<\1>/g' **/*(D.) BitField is now aware to endianness and default to little endian. It expects a value representation type without storage specification for its template parameter.
* | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ | | | | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packets
| * | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | After doing a little more reading up on the Opus codec, it turns out that the multistream API that is part of libopus can handle regular packets. Regular packets are just a degenerate case of multistream Opus packets, and all that's necessary is to pass the number of streams as 1 and provide a basic channel mapping, then everything works fine for that case. This allows us to get rid of the need to use both APIs in the future when implementing multistream variants in a follow-up PR, greatly simplifying the code that needs to be written.
* | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ | | | | | | | | | | | | service/am: Supply remaining missing IAudioController functions
| * | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All this does is supply a new volume level and a fade time in nanoseconds for the volume transition to occur within.
| * | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Like the other volume setter, this mainly just sets a data member within the service, nothing too special.
| * | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function passes in the desired main applet and library applet volume levels. We can then just pass those values back within the relevant volume getter functions, allowing us to unstub those as well. The initial values for the library and main applet volumes differ. The main applet volume is 0.25 by default, while the library applet volume is initialized to 1.0 by default in the services themselves.
* | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
|/ / / / / | | | | | | | | | | | | | | | | | | | | This just acts as a basic setter for a given PID value and performs no further checking, so we can just store the passed in value.
* | | | | gpu: Use host address for caching instead of guest address.bunnei2019-03-151-1/+2
| | | | |
* | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-131-1/+1
|\ \ \ \ \ | | | | | | | | | | | | kernel/server_port: Make data members private
| * | | | | kernel/server_port: Make data members privateLioncash2019-03-111-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | With this, all kernel objects finally have all of their data members behind an interface, making it nicer to reason about interactions with other code (as external code no longer has the freedom to totally alter internals and potentially messing up invariants).
* | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-131-2/+1
|\ \ \ \ \ | | | | | | | | | | | | core/hle/result: Tidy up the base error code result header.
| * | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-101-2/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Relocates the error code to where it's most related, similar to how all the other error codes are. Previously we were including a non-generic error in the main result code header.
* | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-138-40/+131
|\ \ \ \ \ | | | | | | | | | | | | service/vi: Unstub GetDisplayService
| * | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is also supposed to check its given policy type with the permission of the service itself. This implements the necessary machinery to unstub these functions. Policy::User seems to just be basic access (which is probably why vi:u is restricted to that policy), while the other policy seems to be for extended abilities regarding which displays can be managed and queried, so this is assumed to be for a background compositor (which I've named, appropriately, Policy::Compositor).
| * | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This didn't really provide much benefit here, especially since the subsequent change requires that the behavior for each service's GetDisplayService differs in a minor detail. This also arguably makes the services nicer to read, since it gets rid of an indirection in the class hierarchy.
* | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| |/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These can just be passed regularly, now that we use fmt instead of our old logging system. While we're at it, make the parameters to MakeFunctionString std::string_views.
* | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ | |_|_|_|/ |/| | | | service/audio/hwopus: Move decoder state to its own class
| * | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| | | | | | | | | | | | | | | | | | | | | | | | | Moves the non-multistream specific state to its own class. This will be necessary to support the multistream variants of opus decoding.
| * | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| | | | | | | | | | | | | | | | | | | | This indicates the entropy coder's final range.
| * | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This will be utilized by more than just that class in the future. This also renames it from OpusHeader to OpusPacketHeader to be more specific about what kind of header it is.
| * | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Makes it impossible to violate the ODR, as well as providing a place for future changes.
* | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-071-1/+1
|\ \ \ \ \ | | | | | | | | | | | | kernel/client_session, kernel/server_session: Make data members private
| * | | | | kernel/server_session: Make data members privateLioncash2019-03-061-1/+1
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | Makes it much nicer to locally reason about server session behavior, as part of its functionality isn't placed around other classes.
* | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \ | | | | | | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playing
| * | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |/ / / | |/| | | | | | | | | | | | | | | | | | The service itself only does further actions if the stream is playing. If the stream is already stopped, then it just exits successfully.
* | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-074-15/+5
|\ \ \ \ \ | | | | | | | | | | | | Asynchronous GPU command processing
| * | | | | gpu: Move command processing to another thread.bunnei2019-03-071-1/+1
| | | | | |
| * | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-073-14/+4
| |/ / / /
* | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-072-0/+4
|\ \ \ \ \ | |/ / / / |/| | | | core/hle/ipc: Remove unnecessary includes
| * | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-052-0/+4
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes a few inclusion dependencies from the headers or replaces existing ones with ones that don't indirectly include the required headers. This allows removing an inclusion of core/memory.h, meaning that if the memory header is ever changed in the future, it won't result in rebuilding the entirety of the HLE services (as the IPC headers are used quite ubiquitously throughout the HLE service implementations).
* | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
| | | | | | | | | | | | | | | | | | | | Previously we were overwriting the error case with a success code further down (which is definitely not what we should be doing here).
* | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-053-10/+20
|/ / / | | | | | | | | | | | | | | | | | | Places all error codes in an easily includable header. This also corrects the unsupported error code (I accidentally used the hex value when I meant to use the decimal one).
* | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \ | | | | | | | | service/audio: Provide an implementation of ExecuteAudioRendererRendering
| * | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function appears to do nothing noteworthy on the switch. All it does at the moment is either return an error code or abort the system. Given we obviously don't want to kill the system, we just opt for always returning the error code.
* | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / / | | | | | | | | | | | | | | | | | | This currently has the same behavior as the regular OpenAudioRenderer API function, so we can just move the code within OpenAudioRenderer to an internal function that both service functions call.
* | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
| | | | | | | | | | | | | | | The SM namespace is within the Service namespace, so this was forward declaring a type that didn't exist.
* | | Merge pull request #2169 from lioncash/namingbunnei2019-02-271-13/+13
|\ \ \ | | | | | | | | audio_core/audio_renderer: Provide names for some parameters of AudioRendererParameter
| * | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-271-13/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Provides names for previously unknown entries (aside from the two u8 that appear to be padding bytes, and a single word that also appears to be reserved or padding). This will be useful in subsequent changes when unstubbing behavior related to the audio renderer services.
* | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-275-6/+6
|/ / / | | | | | | | | | | | | These types are within the common library, so they should be within the Common namespace.
* / / service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
|/ / | | | | | | Amends it to add the 7.0.0+ CreateStrayLayer function.
* | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
| | | | | | | | | | | | | | The NVFlinger service is already passed into services that need to guarantee its lifetime, so the BufferQueue instances will already live as long as they're needed. Making them std::shared_ptr instances in this case is unnecessary.
* | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
| | | | | | | | | | | | | | Like the previous changes made to the Display struct, this prepares the Layer struct for changes to its interface. Given Layer will be given more invariants in the future, we convert it into a class to better signify that.
* | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
| | | | | | | | | | | | | | | | | | With the display and layer structures relocated to the vi service, we can begin giving these a proper interface before beginning to properly support the display types. This converts the display struct into a class and provides it with the necessary functions to preserve behavior within the NVFlinger class.
* | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-206-57/+119
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are more closely related to the vi service as opposed to the intermediary nvflinger. This also places them in their relevant subfolder, as future changes to these will likely result in subclassing to represent various displays and services, as they're done within the service itself on hardware. The reasoning for prefixing the display and layer source files is to avoid potential clashing if two files with the same name are compiled (e.g. if 'display.cpp/.h' or 'layer.cpp/.h' is added to another service at any point), which MSVC will actually warn against. This prevents that case from occurring. This also presently coverts the std::array introduced within f45c25aabacc70861723a7ca1096a677bd987487 back to a std::vector to allow the forward declaration of the Display type. Forward declaring a type within a std::vector is allowed since the introduction of N4510 (http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2015/n4510.html) by Zhihao Yuan.
* | core_timing: Convert core timing into a classLioncash2019-02-1627-60/+92
| | | | | | | | | | | | | | | | | | | | | | Gets rid of the largest set of mutable global state within the core. This also paves a way for eliminating usages of GetInstance() on the System class as a follow-up. Note that no behavioral changes have been made, and this simply extracts the functionality into a class. This also has the benefit of making dependencies on the core timing functionality explicit within the relevant interfaces.
* | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1216-38/+33
| | | | | | | | | | | | Places all of the timing-related functionality under the existing Core namespace to keep things consistent, rather than having the timing utilities sitting in its own completely separate namespace.
* | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
| | | | | | | | | | This is a leftover from the early yuzu days. We shouldn't log every time when we are drawing by default, so let's change the log level to Trace.
* | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
| | | | | | | | | | | | | | Converts many of the Find* functions to return a std::optional<T> as opposed to returning the raw return values directly. This allows removing a few assertions and handles error cases like the service itself does.
* | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
| | | | | | | | | | This member function doesn't actually modify instance state, so it can be marked as a const member function.
* | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
|/ | | | | This was missed within #2075. Renames the member function to make it consistent with the rest of the Find* functions.
* Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\ | | | | hwopus: Implement DecodeInterleaved (the newest variant)
| * hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| | | | | | | | | | | | | | | | | | | | | | | | This functions almost identically to DecodeInterleavedWithPerfOld, however this function also has the ability to reset the decoder context. This is documented as a potentially desirable thing in the libopus manual in some circumstances as it says for the OPUS_RESET_STATE ctl: "This should be called when switching streams in order to prevent the back to back decoding from giving different result from one at a time decoding."
| * hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| | | | | | | | Keeps the logic in one spot for use by both functions.
| * hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| | | | | | | | | | This doesn't really offer anything over the use of a direct pointer, so we can just use that instead.
| * hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| | | | | | | | Makes non-mutable state more explicit.
| * hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
| | | | | | | | Filled in via information provided by SwitchBrew.
* | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \ | | | | | | service: Update function tables
| * | service/ns: Update function tablesLioncash2019-01-301-14/+20
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | service/audio: Update function tablesLioncash2019-01-304-8/+23
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | service/btm: Update function tablesLioncash2019-01-301-55/+97
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew
| * | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| | | | | | | | | | | | Updates function tables based off information provided by SwitchBrew.
| * | service/psc: Update function tablesLioncash2019-01-301-8/+9
| | | | | | | | | | | | | | | Updates the function tables based off information on SwitchBrew. Gets rid of a swath of unknown names.
* | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
| | | | | | | | | | | | | | | This member function doesn't actually modify instance state, so it can be const-qualified.
* | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
| |/ |/| | | | | | | This more accurately describes what the function is actually attempting to do (it's not a simple trivial getter).
* | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
| | | | | | | | | | | | | | In addition to the default, external, EDID, and internal displays, there's also a null display provided as well, which as the name suggests, does nothing but discard all commands given to it. This is provided for completeness.
* | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
| | | | | | | | | | | | | | | | | | Opening a display isn't really a thing to warn about. It's an expected thing, so this can be a debug log. This also alters the string to indicate the display name better. Opening "Default" display reads a little nicer compared to Opening display Default.
* | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
| |
* | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
| | | | | | | | Makes non-mutable state more explicit.
* | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
|/ | | | | The built-in set of displays is fixed, so we can utilize an array instead of a vector here.
* service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
| | | | | | | This quite literally functions as a basic setter. No other error checking or anything (since there's nothing to really check against). With this, it completes the pm:bm interface in terms of functionality.
* service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
| | | | Just minor tidying of interfaces.
* service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
| | | | | | | | | | This appears to be a vestigial API function that's only kept around for compatibility's sake, given the function only returns a success error code and exits. Since that's the case, we can remove the stubbed notification from the log, since doing nothing is technically the correct behavior in this case.
* core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
| | | | Gets rid of a few indirect inclusions.
* core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-171-1/+1
| | | | | | | | This is a function that definitely doesn't always have a non-modifying behavior across all implementations, so this should be made non-const. This gets rid of the need to mark data members as mutable to work around the fact mutating data members needs to occur.
* Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-101-7/+9
|\ | | | | settings: Add support for setting the RTC manually
| * settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-081-6/+4
| |
| * time: Use custom RTC settings if applicable for gameZach Hilman2019-01-081-6/+10
| |
* | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-108-583/+898
|\ \ | |/ |/| applets: Implement HLE web browser applet (LibAppletOff)
| * travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-292-3/+2
| |
| * web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-294-132/+134
| |
| * core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-281-1/+1
| |
| * applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-283-0/+232
| |
| * hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| |
| * am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
| |
* | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \ | | | | | | service/vi: Unstub IApplicationDisplayService's SetLayerScalingMode
| * | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | These values are not equivalent, based off RE. The internal value is put into a lookup table with the following values: [3, 0, 1, 2, 4] So the values absolutely do not map 1:1 like the comment was indicating.
| * | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| | | | | | | | | | | | | | | | | | Avoids entangling the IPC buffer appending with the actual operation of converting the scaling values over. This also inserts the proper error handling for invalid scaling values.
| * | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
| | | | | | | | | | | | | | | | | | | | | | | | This appears to only check if the scaling mode can actually be handled, rather than actually setting the scaling mode for the layer. This implements the same error handling performed on the passed in values.
* | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \ | | | | | | | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()
| * | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ / | | | | | | | | | | | | | | | Within the actual service, it makes no distinguishing between docked and undocked modes. This will always return the constants values reporting 1280x720 as the dimensions.
* | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \ | | | | | | | | Return no application area when games try to open an application area
| * | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
| | | | | | | | | | | | | | | | This will prompt CreateApplicationArea
* | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ | |_|/ / |/| | | Proper no message handling for AM::PopMessage
| * | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ / | | | | | | | | | When we have no messages, we should be returning an error code.
* | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \ | | | | | | | | service/vi: Minor updates and corrections to the DisplayInfo struct
| * | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| | | | | | | | | | | | | | | | | | | | Based off RE, it appears that almost all display types seem to use 1920x1080 except for a few (null display, edid display).
| * | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | It appears that the two members indicate whether a display has a bounded number of layers (and if set, the second member indicates the total number of layers).
* | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
| |/ / |/| | | | | | | | Upon investigating the issue with #1878, I found that games are the ones who handle the vsync event resetting and not us.
* | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \ | | | | | | | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplay
| * | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| |/ / | | | | | | | | | | | | | | | Internally within the vi services, this is essentially all that OpenDefaultDisplay does, so it's trivial to just do the same, and forward the default display string into the function.
* | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
| | | | | | | | | | | | | | | | | | | | | This IPC command is simply a stub inside the actual service itself, and just returns a successful error code regardless of input. This is likely only retained in the service interface to not break older code that relied upon it succeeding in some way.
* | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \ | | | | | | | | service/vi: Log more information where applicable
| * | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| |/ / | | | | | | | | | | | | | | | In many cases, we didn't bother to log out any of the popped data members. This logs them out to the console within the logging call to provide more contextual information.
* / / core/kernel: Remove unnecessary inclusionsLioncash2019-01-014-3/+4
|/ / | | | | | | Gets rid of a few unnecessary header dependencies in some source files.
* | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-301-1/+2
|\ \ | | | | | | Print backtrace on svcBreak
| * | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-291-1/+2
| | |
* | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
| | | | | | | | | | | | Moves some variables closer to their actual usage sites.
* | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
| |/ |/|
* | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-281-11/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In all cases that these functions are needed, the VMManager can just be retrieved and used instead of providing the same functions in Process' interface. This also makes it a little nicer dependency-wise, since it gets rid of cases where the VMManager interface was being used, and then switched over to using the interface for a Process instance. Instead, it makes all accesses uniform and uses the VMManager instance for all necessary tasks. All the basic memory mapping functions did was forward to the Process' VMManager instance anyways.
* | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ | | | | | | hid: Fix SetNpadJoyHoldType and improve logging.
| * | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
| | |
* | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ | | | | | | | | npad: Remove code to invert input in horizontal mode.
| * | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
| | | | | | | | | | | | | | | | | | | | - This was incorrect, the game appears to handle this for us. - Fixes horizontal mode with Puyo Puyo Tetris and Super Mario Odyssey.
* | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-272-2/+47
| | | | | | | | | | | | These functions come in a pair and are needed by Smash Ultimate, Minecraft, and Skyrim, amongst others.
* | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
|/ / /
* | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-233-0/+131
|\ \ \ | | | | | | | | am: Implement HLE profile selector applet
| * | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-034-13/+5
| | | | | | | | | | | | | | | | Fixes bugs relating to signalling in software keyboard.
| * | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| | | |
| * | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| | | | | | | | | | | | Allows the player to select an emulated profile.
| * | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
| | | | | | | | | | | | Previously, ILibraryAppletAccessor would signal upon creation of any applet, but this is incorrect. A flag inside of the applet code determines whether or not creation should signal state change and swkbd happens to be one of these applets.
* | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ | |_|/ / |/| | | service/am: Unstub GetAppletResourceUserId
| * | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| | | | | | | | | | | | | | | | | | | | This is supposed to return the current process' ID. (0 indicates an invalid ID for both process IDs and ARU IDs).
* | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ | | | | | | | | | | Device handle should not be a random id, instead it's the current npad id
| * | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | | | | | | | | | | | | | | | | | | | Found during hardware testing
* | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ | |/ / / / |/| | | | service/sm: Improve debug log for RegisterService
| * | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | Now it also indicates the name and max session count. This also gives a name to the unknown bool. This indicates if the created port is supposed to be using light handles or regular handles internally. This is passed to the respective svcCreatePort parameter internally.
* | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ | |/ / / |/| | | applets: Correct usage of SignalStateChanged event
| * | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | | | | | | | | | | | | | | | This was causing some games (most notably Pokemon Quest) to softlock due to an event being fired when not supposed to. This also removes a hack wherein we were firing the state changed event when the game retrieves it, which is incorrect.
* | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ | | | | | | | | | | nvhost_gpu: Skip empty GPU command lists.
| * | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
| | | | |
* | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
|/ / / / | | | | | | | | | | | | | | | | | | | | Services created with the ServiceFramework base class install themselves as HleHandlers with an owning shared_ptr in the ServerPort ServiceFrameworkBase::port member variable, creating a cyclic ownership between ServiceFrameworkBase and the ServerPort, preventing deletion of the service objects. Fix that by removing the ServiceFrameworkBase::port member because that was only used to detect multiple attempts at installing a port. Instead store a flag if the port was already installed to achieve the same functionality.
* | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ | | | | | | | | | | fsp_srv: Implement IStorage::GetSize
| * | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| |/ / / | | | | | | | | | | | | Takes no input and returns the size as a u64. Needed by Katamari Damacy Reroll to boot.
* | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-111-0/+12
|\ \ \ \ | | | | | | | | | | patch_manager: Add support for disabling patches
| * | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| | |/ / | |/| |
* | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ | | | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()
| * | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, the backing code only ever seems to use 0-2 as the range of values 1 being a generic log enable, with 2 indicating logging should go to the SD card. These are used as a set of flags internally. Given we only care about receiving the log in general, we can just always signify that we want logging in general.
* | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ | | | | | | | | | | service/ldr: Amend layouts of NRO and NRR headers
| * | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The first word is just a padding byte, it's not an actual entry instruction. Also renames the rest of the entries according to SwitchBrew.
| * | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | The padding after the magic signature value should be 12 bytes rather than 28 bytes. The other 16 should be placed after the title ID pattern.
* | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ | |_|/ / / |/| | | | hle/service, hle/sm: Minor cleanup
| * | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| | | | | | | | | | | | | | | | | | | | Combines the two into one, shortening the amount of code here.
| * | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Only one usage of the specified objects made use of the lack of namespacing. Given the low usage, we can just remove these.
| * | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These auto-deduce the result based off its arguments, so there's no need to do that work for the compiler, plus, the function return value itself already indicates what we're returning.
| * | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| |/ / / | | | | | | | | | | | | | | | | Gets rid of the need to keep the variables separate from their actual initialization spots.
* / / / service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
|/ / / | | | | | | | | | We don't need to specify all of the ARM interfaces explicitly.
* | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-051-0/+10
|\ \ \ | |/ / |/| | file_sys: Implement open source system archives
| * | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| | |
* | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-033-19/+6
|\ \ \ | | | | | | | | filesystem: De-globalize registered_cache_union
| * | | filesystem: De-globalize registered_cache_unionLioncash2018-12-023-19/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just return a new instance of this when it's requested. This only ever holds pointers to the existing registed caches, so it's not a large object. Plus, this also gets rid of the need to keep around a separate member function just to properly clear out the union. Gets rid of one of five globals in the filesystem code.
* | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0324-176/+230
|\ \ \ \ | | | | | | | | | | kernel: Divide Event into ReadableEvent and WritableEvent
| * | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-294-6/+4
| | | | |
| * | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2922-186/+122
| | | | |
| * | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2924-148/+268
| | | | |
* | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-033-1/+35
|\ \ \ \ \ | | | | | | | | | | | | service/fsp_srv: Implement CleanDirectoryRecursively
| * | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-013-1/+35
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the same behavior-wise as DeleteDirectoryRecursively, with the only difference being that it doesn't delete the top level directory in the hierarchy, so given: root_dir/ - some_dir/ - File.txt - OtherFile.txt The end result is just: root_dir/
* | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ | | | | | | | | | | | | service/audio/audout_u: Amend constructor initialization list order
| * | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | Orders the constructor initializer list the same way the members of the class are declared. Prevents -Wreorder warnings
* | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ | | | | | | | | | | | | Fixed crash with SetNpadMode
| * | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|/ | |/| | | | | | | | | | | | | fixed crash due to handheld
* | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Updates the function table for IClientEpSession based off information provided by SwitchBrew.
* | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / | | | | | | | | | | | | | | | | Updates the function table according to information provided by SwitchBrew.
* | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ | |/ / / |/| | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.
| * | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
| |/ / | | | | | | | | | Assert that it is not empty before using it in the DequeueBuffer wait callback.
* | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
| | | | | | | | | | | | | | | This code was around prior to the introduction of PushEnum, so convert it over so we don't need to cast here.
* | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / | | | | | | This function simply converts a given index into a language code.
* | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2950-366/+654
|\ \ | | | | | | Changed logging to be "Log before execution", Added more error logging, all services/svc should now log on some level
| * | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-272-8/+10
| | |
| * | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| | |
| * | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| | |
| * | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2650-363/+636
| | |
* | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ | | | | | | | | npad: Use NPadIdToIndex to prevent invalid array access
| * | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
| | | |
* | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-281-5/+10
|\ \ \ \ | | | | | | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.
| * | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-281-8/+6
| | | | |
| * | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-271-3/+10
| |/ / / | | | | | | | | | | | | - More accurate impl., fixes Undertale (among other games).
* | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
| | | |
* | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ | |/ / / |/| | | profile_manager: Save and load ProfileData from disk
| * | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
| | | | | | | | | | | | | | | | The ProfileData is a 0x80-sized structure that stores various pieces of miscellaneous data for the account.
* | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ | |_|/ / |/| | | service/sm: Take std::string by const reference in UnregisterService
| * | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| |/ / | | | | | | | | | | | | | | | | | | | | | Avoids the need to create a copy of the std::string instance (potentially allocating). The only reason RegisterService takes its argument by value is because it's std::moved internally.
* | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ | |/ / |/| | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.
| * | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
| | | | | | | | | | | | - Used by Undertale.
* | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ | | | | | | | | sm: Implement RegisterService and UnregisterService
| * | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
| | | | | | | | | | | | These are needed by Edizon to boot. They are used to see if a user is using SX OS, as SX OS registers a custom service called 'tx' and attempting to register a service of the same name lets the application know if it is present.
* | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ | | | | | | | | | | filesystem: Clear registered union paths on factory creation
| * | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | | | |
* | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-242-13/+31
|\ \ \ \ \ | |_|_|/ / |/| | | | Report resolution scaling support for vi and am
| * | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| | | | |
| * | | | Report resolution scaling support for vi and amDavid Marcec2018-11-162-13/+29
| | | | | | | | | | | | | | | | | | | | Specifying an internal resolution in yuzu now will report the scaled changes to vi and am.
* | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-233-4/+100
|\ \ \ \ \ | | | | | | | | | | | | applets: Add StubApplet and use it as fallback when AppletId is not implemented
| * | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| | | | | |
| * | | | | applets: Add StubAppletZach Hilman2018-11-222-0/+96
| | | | | | | | | | | | | | | | | | | | | | | | This will log all data it receives, log all calls to its methods and push dummy data into both channels on execution.
* | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.
| * | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents memory exceptions when the debug pad is enabled.
* | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | audout_u: Add support for multiple IAudioOut streams.
| * | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Undertale.
* | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ | |/ / / / / |/| | | | | am/applets: Minor cleanup
| * | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The accessor should be doing just that, accessing, rather than retaining the lifetime of the data broker as well.
| * | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also resolve places where includes should have been provided, but weren't.
| * | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
| | | | | | | | | | | | | | | | | | | | | | | | Avoids wonky wrapping and makes it nicer to read.
* | | | | | am: Correct build failureLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The interface for shared memory was changed, but another commit was merged that relied on the (previously public) internals of SharedMemory. This amends that discrepancy.
* | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ | |/ / / / / |/| | | | | ldr: Clean up error codes
| * | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | The separate enum isn't particularly necessary here, and the values can just be directly put into the ResultCode instances, given the names are also self-documenting here.
* | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-206-103/+696
|\ \ \ \ \ | | | | | | | | | | | | am: Implement HLE software keyboard applet
| * | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| | | | | |
| * | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| | | | | |
| * | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| | | | | | | | | | | | | | | | | | | | | | | | This cleans up most of the callbacks and such in the Applets::Applet interface, while also properly implementing all four data channels.
| * | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| | | | | |
| * | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| | | | | |
| * | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| | | | | |
| * | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| | | | | |
| * | | | | applet: Add operation completed callbackZach Hilman2018-11-182-3/+5
| | | | | |
| * | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| | | | | |
| * | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-183-6/+20
| | | | | | | | | | | | | | | | | | | | | | | | a
| * | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-184-36/+34
| | | | | |
| * | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-181-4/+8
| | | | | |
| * | | | | am: Implement text check software keyboard modeZach Hilman2018-11-183-14/+95
| | | | | | | | | | | | | | | | | | | | | | | | Allows the game to verify and send a message to the frontend.
| * | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-186-27/+44
| | | | | |
| * | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| | | | | | | | | | | | | | | | | | Allows use of software keyboard applet and future applets to be easily added by adding enum ID and a switch case.
| * | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-182-0/+128
| | | | | | | | | | | | | | | | | | Provides a middleman between the Frontend provider class and the expected AM::Applets::Applet class needed by ILibraryAppletAccessor
| * | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-182-0/+75
| | | | | | | | | | | | | | | | | | Adds an Initialize and Execute methods which are used by the ILibraryAppletAccessor to start and control the applet.
| * | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| | | | | | | | | | | | | | | | | | Now starts the applet provided in constructor.
| * | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| | | | | | | | | | | | | | | | | | Used by software keyboard applet for data transfer.
| * | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| | | | | | | | | | | | | | | | | | std::stack was no longer suitable for non-trivial operations
| * | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| | | | | | | | | | | | | | | | | | Needs to be accessible by applet files.
| * | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| | | | | | | | | | | | | | | | | | Writes to an AM::IStorage object through an IStorageAccessor will now be preserved once the accessor is destroyed.
| * | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| | | | | | | | | | | | | | | | | | Creates an AM::IStorage object with the contents of the transfer memory located at the handle provided.
* | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This service function was likely intended to be a way to redirect where the output of a log went. e.g. Firing a log over a network, dumping over a tunneling session, etc. Given we always want to see the log and not change its output. It's one of the lucky service functions where the easiest implementation is to just do nothing at all and return success.
* | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-194-174/+61
| | | | | |
* | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
| | | | | |
* | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | Including finger ID, diamater x/y, and angle. Additionally, checks if the touchscreen is enabled.
* | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
| | | | | |
* | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
| | | | | |
* | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
| | | | | | | | | | | | | | | | | | | | | | | | Used by developers to test games, not present on retail systems. Some games are known to respond to DebugPad input though, for example Kirby Star Allies.
* | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
| | | | | |
* | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
| | | | | |
* | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
| | | | | |
* | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
| | | | | |
* | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
| | | | | |
* | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
| | | | | |
* | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
| |/ / / / |/| | | |
* | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-192-14/+391
|\ \ \ \ \ | | | | | | | | | | | | ldr_ro: Complete LDR:RO implementation
| * | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-181-7/+20
| | | | | |
| * | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| | | | | | | | | | | | | | | | | | | | | | | | Includes actual unmapping and address error checking.
| * | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| | | | | | | | | | | | | | | | | | | | | | | | Includes NRO and BSS error checking, maximum loaded NRO check, NRR hash check, and proper remapping of BSS data.
| * | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| | | | | | | | | | | | | | | | | | | | | | | | Includes initialization check, proper address check, alignment check, and actual unloading of a loaded NRR.
| * | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| | | | | | | | | | | | | | | | | | | | | | | | Includes parameter error checking, hash enforcement, initialization check, and max NRR load check.
| * | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | Fixes unmapped spam in SMP and buffer size errors in some other games
* | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUser
| * | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Seems pokemon calls this sometimes and it caused "random crashes"
* | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | vi: Implement TransactParcel for Disconnect and DetachBuffer
| * | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | Used by homebrew on exit. According to switchbrew, returns an empty response parcel with one zero in it.
* | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
| | | | | |
* | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ | | | | | | | | | | | | | | Added various bluetooth based cmds for palma
| * | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | It seems palma is done through bluetooth, we need this for pokemon go however more research needs to be done when we actually get palma working. This is presumably used for transfering data between the controller and the console, it does not seem for actual input as far as I know.
* | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| |_|/ / / |/| | | | | | | | | | | | | | - Fixes audio issues with Pokemon: Let's Go Pikachu & Eevee.
* | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-162-4/+11
|\ \ \ \ \ | | | | | | | | | | | | game_list: Optimize game list refresh
| * | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | Prevents unnecessary re-reads of the metadata and unnecessary temporary objects.
* | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-162-11/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | file_sys/errors: Clean up error code values
| * | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-162-11/+11
| | |/ / / / | |/| | | | | | | | | | | | | | | | Keeps filesystem-related error codes in one spot.
* / | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / | | | | | | | | | | | | | | | Currently unclear what these do yet, will be researched at a later time when we want to implement palma.
* | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed priority switching edge case for handheld We accidently used controller index instead of npad id * Moved NPadIdToIndex
* | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ | | | | | | | | | | | | csrng: Use random integer distribution instead of raw engine
| * | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|/ / | |/| | | | | | | | | | | | | Prevents returning the same value every single call.
* | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-152-4/+22
|\ \ \ \ \ | | | | | | | | | | | | patch_manager: Add support for dumping uncompressed NSOs
| * | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-292-4/+22
| | | | | | | | | | | | | | | | | | | | | | | | Equates to yuzu_dir/dump/<title id>/
* | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdate
| * | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Based off RE, they both currently go through the same codepath with no difference in behavior.
* | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | acc/profile_manager: Minor cleanup-related changes
| * | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| | | | | | |
| * | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
| |/ / / / / | | | | | | | | | | | | | | | | | | Avoids relying on fmt always being indirectly included.
* | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()
| * | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | empty() in this case will always return false, since the returned container is a std::array. Instead, check if all given users are invalid before returning the error code.
* | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()
| * | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous expression would copy sizeof(size_t) amount of bytes (8 on a 64-bit platform) rather than the full 10 bytes comprising the uuid member. Given the source and destination types are the same, we can just use an assignment here instead.
* | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate
| * | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.
| * | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When yuzu is compiled in release mode this function is unused, however, when compiled in debug mode, it's used within a LOG_TRACE statement. This prevents erroneous compilation warnings about an unused function (that isn't actually totally unused).
* | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimit
| * | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | These appear to be a basic getter and setter pair, so these are fairly trivial to implement and get out of the way.
* | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-145-2/+227
|\ \ \ \ \ \ | |/ / / / / |/| | | | | [ns|fsp_srv]: Implement various functions to boot Checkpoint
| * | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-292-15/+73
| | | | | | | | | | | | | | | | | | Returns the raw NACP bytes and the raw icon bytes into a title-provided buffer. Pulls from Registration Cache for control data, returning all zeros should it not exist.
| * | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| | | | | | | | | | | | | | | | | | | | | | | | An object to read SaveDataInfo objects, which describe a unique save on the system. This implementation iterates through all the directories in the save data space and uses the paths to reconstruct the metadata.
| * | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | Needed by Checkpoint. Returns an object that can iterate through all savedata on the system.
| * | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-292-0/+11
| |/ / / /
* | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-132-2/+11
|\ \ \ \ \ | | | | | | | | | | | | csrng: Add config option to set RNG seed
| * | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ | |/ / / / |/| | | | Implement GetClockSnapshot, ToPosixTime & ToPosixTimeWithMyRule
| * | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| | | | |
| * | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| | | | | | | | | | | | | | | | | | | | Added instead of using a seperate PR to prevent conflicts
| * | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| | | | |
| * | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
| | | | | | | | | | | | | | | | | | | | Needed by megaman 11
* | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-106-35/+138
|\ \ \ \ \ | |/ / / / |/| | | | Ability to switch between docked and undocked mode in-game
| * | | | FixupsDavid Marcec2018-11-071-1/+1
| | | | |
| * | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-076-35/+138
| | | | | | | | | | | | | | | | | | | | Started implementation of the AM message queue mainly used in state getters. Added the ability to switch docked mode whilst in game without stopping emulation. Also removed some things which shouldn't be labelled as stubs as they're implemented correctly
* | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \ | | | | | | | | | | | | Updated npad styles on holdtype switches
| * | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| |/ / / / | | | | | | | | | | | | | | | Fixes input for megaman
* | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
| | | | |
* | | | | Added missing logDavid Marcec2018-11-071-0/+1
| | | | |
* | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
|/ / / / | | | | | | | | | | | | Needed for Shantae - Half-Genie Hero - Ultimate Edition!
* | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \ | | | | | | | | | | Fixed HID crash when launching more than 1 game & signaled styleset change event
| * | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
| | | | | | | | | | | | | | | | | | | | This should fix crashes when launching multiple games in yuzu
* | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
| |_|_|/ |/| | |
* | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / /
* | | Merge pull request #1615 from lioncash/inputbunnei2018-11-021-1/+2
|\ \ \ | | | | | | | | configure_system: Contrain profile usernames to 32 characters
| * | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-311-1/+2
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we would let a user enter an unbounded name and then silently truncate away characters that went over the 32-character limit. This is kind of bad from the UX point of view, because we're essentially not doing what the user intended in certain scenarios. Instead, we clamp it to 32 characters and make that visually apparent in the dialog box to provide a name for a user.
* | / service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
| |/ |/| | | | | Updated based off information on SwitchBrew.
* | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-306-19/+21
|/ | | | | | | | | | | | | | | | * get rid of boost::optional * Remove optional references * Use std::reference_wrapper for optional references * Fix clang format * Fix clang format part 2 * Adressed feedback * Fix clang format and MacOS build
* service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
|
* Merge pull request #1569 from lioncash/amiibobunnei2018-10-262-3/+5
|\ | | | | yuzu/main: Notify user of loading errors with Amiibo data
| * yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-242-3/+5
| | | | | | | | | | We shouldn't silently continue if loading failed, since the general assumption is that no messages showing up implicitly indicates success.
* | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
| | | | | | | | - This is an incomplete implementation. It was tested with Super Mario Party.
* | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ | | | | | | service/usb: Update service function tables
| * | service/usb: Update service function tablesLioncash2018-10-251-21/+22
| | | | | | | | | | | | Updated based off the information provided by Hexkyz on Switchbrew.
* | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ | | | | | | | | service/acc: Silence compiler truncation warnings
| * | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| | | | | | | | | | | | | | | | | | | | | | | | This is just flat data, so it doesn't really need to be in the function itself. This also allows deduplicating the constant for the backup size in GetImageSize().
| * | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| | | | | | | | | | | | | | | | | | | | Silences compiler warnings related to truncation. This also introduces a small helper function to perform the clamping of the image size.
| * | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / | | | | | | | | | Allows unindenting the other branch's code.
* | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-253-43/+48
|\ \ \ | | | | | | | | profile_manager: Use std::optional instead of boost::optional
| * | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-243-43/+48
| |/ / | | | | | | | | | | | | Now that we can actually use std::optional on macOS, we don't need to continue using boost::optional here.
* | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ | | | | | | | | npad: Remove unused controller variable from OnInit()
| * | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |/ | |/| | | | | | | | | | This also gets rid of variable shadowing related to the lambda parameter a little bit below this code as well.
* | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ | |_|/ |/| | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() function
| * | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ | | | | | | | | | | | | | | We can just call the function instead of duplicating the code here. This also prevents an unused function warning. We also don't need to take the lambda capture by reference. It's just a u64 value, so by value is fine here.
* | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-242-13/+37
| |
* | acc: Fix account UUID duplication errorZach Hilman2018-10-244-17/+47
| |
* | configure_system: Clear selection after user deleteZach Hilman2018-10-241-1/+1
| |
* | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-244-26/+129
| |
* | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| |
* | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| |
* | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
|/
* Added Amiibo support (#1390)David2018-10-243-50/+294
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixed conflict with nfp * Few fixups for nfc * Conflict 2 * Fixed AttachAvailabilityChangeEvent * Conflict 3 * Fixed byte padding * Refactored amiibo to not reside in "System" * Removed remaining references of nfc from system * used enum for Nfc GetStateOld * Added missing newline * Moved file operations to front end * Conflict 4 * Amiibos now use structs and added mutexes * Removed amiibo_path
* Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-241-1/+5
|\ | | | | patch_manager: Add support for LayeredFS on DLC RomFS
| * fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| |
* | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-223-0/+88
|\ \ | | | | | | psm: Add psm service and stub commands 0 and 1
| * | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed as connected to official Nintendo Switch dock.
| * | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| | | | | | | | | | | | Used by LovePotion Lua Homebrew. Stubbed to return 100% charge.
| * | service: Add skeleton for psm serviceZach Hilman2018-10-213-0/+72
| | | | | | | | | | | | Seems to be the power controller. Listed in switchbrew under the category PTM services.
* | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-213-2/+107
| | |
* | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-213-0/+42
| | | | | | | | | | | | Added based off information provided by Switchbrew.
* | | am: Update service function tablesLioncash2018-10-214-15/+60
| | | | | | | | | | | | Updated based off information from Switchbrew
* | | prepo: Update service function table.Lioncash2018-10-211-8/+13
| | | | | | | | | | | | | | | | | | Also introduces the new prepo:a2 service. Updated based off information provided by Switchbrew.
* | | lbl: Update service function table namesLioncash2018-10-211-28/+28
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
* | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
|/ / | | | | | | This is a subset of the better-hid-2 changes, this fixes input in various games which don't support dual joycons. This pr will search for the next best controller which is supported by the current game
* | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ | | | | | | service: Update function tables
| * | es: Update service function tablesLioncash2018-10-191-7/+11
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | audio: Update service function tablesLioncash2018-10-191-17/+20
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | omm: Update service function tablesLioncash2018-10-191-16/+18
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | nifm: Update service function tablesLioncash2018-10-191-0/+1
| | | | | | | | | | | | Updated based off information provided by switchbrew.
| * | hid: Update service function tablesLioncash2018-10-191-6/+45
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| | | | | | | | | | | | Added based off information provided by Switchbrew
| * | ns: Update service function tableLioncash2018-10-191-6/+49
| | | | | | | | | | | | Updated based off information provided by Switchbrew.
| * | set_cal: Update service function tableLioncash2018-10-191-1/+2
| | | | | | | | | | | | Updated based on information from Switchbrew.
* | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ | | | | | | | | aoc_u: Stub GetAddOnContentListChangedEvent
| * | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | | | | | | | | | | | | | | | This event signals the game when new DLC is purchased from the eShop while the game is running. Since, for the forseeable future, yuzu will not have this ability, it seems safe to stub with a dummy event that will never fire. This is needed to boot Sonic Mania Plus (update v1.04).
* | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ | |/ / / |/| | | hid: Minor cleanup-related changes
| * | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| | | | | | | | | | | | | | | | | | | | | | | | swap.h only needs to be present in the header for the type aliases and definitions, it's not actually needed in the cpp files though. input.h is just unused entirely in xpad.h
| * | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| | | | | | | | | | | | | | | | Given it's unused, we may as well toss it.
| * | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| | | |
| * | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| | | | | | | | | | | | | | | | This is only useful in headers.
| * | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| | | | | | | | | | | | | | | | | | | | This is just a lookup table, and since it's private, there's nothing really stateful about it, so we can just move it into the cpp file.
| * | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| | | | | | | | | | | | | | | | This literally does nothing.
| * | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | These classes are non-trivial and are definitely going to be changed in the future, so we default these to prevent issues with forward declarations, and to keep the compiler from inlining tear-down code.
| * | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | | | | | | | | | | | | | | | The destructor doesn't need to be a pure-virtual function.
* | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
| |/ / |/| | | | | | | | Needed by arms due to new hid rework
* | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
|/ / | | | | | | InitializeWithId needs to return an id which is a u32 which should be a non zero value
* | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1821-648/+1702
|\ \ | |/ |/| "Better Hid" Rework Part 1
| * Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| | | | | | | | Reason for the change is to allow both docked and undocked mode to work
| * WipDavid Marcec2018-10-122-3/+23
| |
| * Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| | | | | | | | Kirby input still doesn't work, should fix a lot of other games
| * Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| | | | | | | | Used by Mario Party
| * Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| | | | | | | | HandheldVariant is for specific games which expect handheld controllers to be at position 8(kirby), however this doesn't fix all games as some games require handhelds to be at position 0(snipperclips)
| * Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| |
| * Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| | | | | | | | Fixes arms
| * Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| |
| * Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| |
| * "Better Hid" rework part 1David Marcec2018-10-1021-644/+1482
| |
* | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
| | | | | | | | | | | | | | | | * Implement VI ConvertScalingMode * Fixed push enum * Scale mode now uses Nintendo scale mode as an enum as well
* | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-163-12/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The data retrieved in these cases are ultimately chiefly owned by either the RegisteredCache instance itself, or the filesystem factories. Both these should live throughout the use of their contained data. If they don't, it should be considered an interface/design issue, and using shared_ptr instances here would mask that, as the data would always be prolonged after the main owner's lifetime ended. This makes the lifetime of the data explicit and makes it harder to accidentally create cyclic references. It also makes the interface slightly more flexible than the previous API, as a shared_ptr can be created from a unique_ptr, but not the other way around, so this allows for that use-case if it ever becomes necessary in some form.
* | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-161-3/+15
|\ \ | | | | | | aoc: Fix various bugs in current AOC implementation
| * | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-151-2/+13
| | | | | | | | | Falls back to title ID + 0x1000, which is what HOS does.
| * | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
| | |
* | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-134-14/+13
|/ / | | | | | | | | | | | | Neither of these functions alter the ownership of the provided pointer, so we can simply make the parameters a reference rather than a direct shared pointer alias. This way we also disallow passing incorrect memory values like nullptr.
* | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ | | | | | | Passing an invalid nmap handle to Remap should throw an error
| * | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| | |
| * | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| |/ | | | | | | Added error for invalid nmap handles
* | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ | | | | | | Added error codes for nvmap
| * | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| | |
| * | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/
* | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ | | | | | | HwOpus, Implemented DecodeInterleavedWithPerformance
| * | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ | | | | | | Used by sonic ages
* / nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
|/
* Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ | | | | Fixed assertion due to CountAddOnContent & Casting warnings
| * Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | | | | | | | | | | | Word count should be 3 since we're pushing a result code and a u32. Also fixed up compiler warnings due to casting
* | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
|/ | | | Hardware tests show that trying to unmap an unmapped buffer already should always succeed. Hardware test was tested up to 32 iterations of attempting to unmap
* Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-072-0/+10
|\ | | | | loader: Add support for packed updates
| * romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-052-0/+10
| |
* | Ported #4296 from citraDavid Marcec2018-10-061-0/+19
|/ | | | This will allow us to easily remove the use of "NFC" in "System"
* Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ | | | | aoc_u: Fix edge case with DLC that causes breaks
| * aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| | | | | | | | In some games (Splatoon 2 and Splatoon 2 Splatfest World Premiere, notably), pass offset=0 and count=2047 into the ListAddOnContent method which should return all DLCs for the current title. The (presumably) intended behavior is to successfully return a empty array but because of a < v. <= in an if statement, a failure error code was returned causing these games to svcBreak. This fixes that if statement.
* | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ | | | | | | services/fsp_srv: Amend service function table
| * | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| | | | | | | | | | | | | | | Adds new functions that have been given names to the table. Information is based off what is provided on Switchbrew.
* | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| |/ |/| | | | | | | Amends the lbl service table to include new names of functions that were added to Switchbrew.
* | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-011-20/+26
| |
* | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-012-3/+5
| | | | | | Command #5
* | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
|/ | | | Commands #2, #3, and #7
* Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\ | | | | Implement ISystemDisplayService::GetDisplayMode
| * Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
| |
* | kernel/process: Make data member variables privateLioncash2018-09-302-4/+4
| | | | | | | | | | | | | | Makes the public interface consistent in terms of how accesses are done on a process object. It also makes it slightly nicer to reason about the logic of the process class, as we don't want to expose everything to external code.
* | Merge pull request #1394 from lioncash/streambunnei2018-09-271-1/+1
|\ \ | | | | | | stream: Preserve enum class type in GetState()
| * | stream: Preserve enum class type in GetState()Lioncash2018-09-241-1/+1
| | | | | | | | | | | | | | | | | | Preserves the meaning/type-safetiness of the stream state instead of making it an opaque u32. This makes it usable for other things outside of the service HLE context.
* | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ | | | | | | | | service: Add missing headers inclusions where applicable
| * | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
| | | | | | | | | | | | | | | | Gets rid of a few indirect inclusions.
* | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-252-1/+14
|\ \ \ \ | |/ / / |/| | | file_sys: Add support for LayeredFS mods
| * | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| | | |
* | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented fatal:u properly fatal:u now is properly implemented with all the ipc cmds. Error reports/Crash reports are also now implemented for fatal:u. Crash reports save to yuzu/logs/crash_reports/ The register dump is currently known as sysmodules send all zeros. If there are any non zero values for the "registers" or the unknown values, let me know! * Fatal:U fixups * Made fatal:u execution break more clear * Fatal fixups
* | | | Stubbed IRS (#1349)David2018-09-242-18/+167
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubbed IRS Currently we have no ideal way of implementing IRS. For the time being we should have the functions stubbed until we come up with a way to emulate IRS properly. * Added IRS to logging backend * Forward declared shared memory for irs
* | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ | |_|/ / |/| | | Corrected SSL::SetInterfaceVersion
| * | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
| | | | | | | | | | | | | | | | Should be a single u32
* | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-231-1/+8
| |/ / |/| |
* | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ | | | | | | | | Added IRequest::Submit
| * | | Fixed submitDavid Marcec2018-09-201-2/+1
| | | |
| * | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
| | | | | | | | | | | | | | | | This fixes updated versions of SMO. Currently unable to test as I don't have an updated version
* | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
|/ / / | | | | | | | | | Even though setting this value to 3 is more correct. We break more games than we fix due to missing implementations. We should keep this as 0 for the time being
* | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
| | |
* | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
| | | | | | | | | | | | Needed because of the recent nim fixes
* | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Reworked incorrect nifm stubs Need confirmation on `CreateTemporaryNetworkProfile`, unsure which game uses it but according to reversing. It should return a uuid which we currently don't do. Any 0 client id is considered an invalid client id. GetRequestState 0 is considered invalid. * Fixups for nifm
* | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ | | | | | | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevision
| * | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ / | | | | | | | | | With these, `Nintendo Entertainment System - Nintendo Switch Online` loads
* / / Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / | | | | | | Due to keeping the code style consistent in the yuzu codebase. `rb = rp.MakeBuilder(...)` was replaced with `rb{ctx, ...}`
* | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ | | | | | | Implemented IProfile::GetImageSize
| * | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
| | |
* | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ | | | | | | | | Implemented GetDefaultDisplayResolution
| * | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| |/ /
* | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ | | | | | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensor
| * | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| | | |
| * | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| | | |
| * | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| |/ /
* / / Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-191-2/+3
|/ / | | | | | | | | | | | | | | | | | | * Fix bug where default username value for yuzu_cmd create an userprofile with uninitialize data as username * Fix format * Apply code review changes * Remove nullptr check
* | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ | | | | | | service/vi: Replace includes with forward declarations where applicable
| * | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
| | |
* | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ | | | | | | | | services/sm: Amend error code constants
| * | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / | | | | | | | | | | | | | | | | | | | | | Courtesy of @ogniK5377. This also moves them into the cpp file and limits the visibility to where they're directly used. It also gets rid of unused or duplicate error codes.
* | / Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1515-50/+53
| |/ |/|
* | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-141-1/+1
|\ \ | | | | | | kernel/thread: Include thread-related enums within the kernel namespace
| * | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-131-1/+1
| |/ | | | | | | | | | | Previously, these were sitting outside of the Kernel namespace, which doesn't really make sense, given they're related to the Thread class which is within the Kernel namespace.
* | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ | | | | | | service: Use nested namespace specifiers where applicable
| * | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ | | | | | | | | | | There were a few places where nested namespace specifiers weren't being used where they could be within the service code. This amends that to make the namespacing a tiny bit more compact.
* / services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
|/ | | | Previously this wasn't using the Korean font at all.
* Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ | | | | pl_u: Eliminate mutable file-scope state
| * pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | | | | | | | | | Converts the PL_U internals to use the PImpl idiom and makes the state part of the Impl struct, eliminating mutable global/file state.
* | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ | | | | | | service/prepo: Move class into the cpp file
| * | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ | | | | | | | | | | This doesn't need to be exposed within the header and be kept in the translation unit, eliminating the need to include anything within the header.
* / service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
|/ | | | | A few headers were including other headers when a forward declaration can be used instead, allowing the include to be moved to the cpp file.
* Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ | | | | hle/service: Default constructors and destructors in the cpp file where applicable
| * hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | When a destructor isn't defaulted into a cpp file, it can cause the use of forward declarations to seemingly fail to compile for non-obvious reasons. It also allows inlining of the construction/destruction logic all over the place where a constructor or destructor is invoked, which can lead to code bloat. This isn't so much a worry here, given the services won't be created and destroyed frequently. The cause of the above mentioned non-obvious errors can be demonstrated as follows: ------- Demonstrative example, if you know how the described error happens, skip forwards ------- Assume we have the following in the header, which we'll call "thing.h": \#include <memory> // Forward declaration. For example purposes, assume the definition // of Object is in some header named "object.h" class Object; class Thing { public: // assume no constructors or destructors are specified here, // or the constructors/destructors are defined as: // // Thing() = default; // ~Thing() = default; // // ... Some interface member functions would be defined here private: std::shared_ptr<Object> obj; }; If this header is included in a cpp file, (which we'll call "main.cpp"), this will result in a compilation error, because even though no destructor is specified, the destructor will still need to be generated by the compiler because std::shared_ptr's destructor is *not* trivial (in other words, it does something other than nothing), as std::shared_ptr's destructor needs to do two things: 1. Decrement the shared reference count of the object being pointed to, and if the reference count decrements to zero, 2. Free the Object instance's memory (aka deallocate the memory it's pointing to). And so the compiler generates the code for the destructor doing this inside main.cpp. Now, keep in mind, the Object forward declaration is not a complete type. All it does is tell the compiler "a type named Object exists" and allows us to use the name in certain situations to avoid a header dependency. So the compiler needs to generate destruction code for Object, but the compiler doesn't know *how* to destruct it. A forward declaration doesn't tell the compiler anything about Object's constructor or destructor. So, the compiler will issue an error in this case because it's undefined behavior to try and deallocate (or construct) an incomplete type and std::shared_ptr and std::unique_ptr make sure this isn't the case internally. Now, if we had defaulted the destructor in "thing.cpp", where we also include "object.h", this would never be an issue, as the destructor would only have its code generated in one place, and it would be in a place where the full class definition of Object would be visible to the compiler. ---------------------- End example ---------------------------- Given these service classes are more than certainly going to change in the future, this defaults the constructors and destructors into the relevant cpp files to make the construction and destruction of all of the services consistent and unlikely to run into cases where forward declarations are indirectly causing compilation errors. It also has the plus of avoiding the need to rebuild several services if destruction logic changes, since it would only be necessary to recompile the single cpp file.
* | externals: Place font data within cpp filesLioncash2018-09-111-6/+6
|/ | | | | | | | | | | | | | | This places the font data within cpp files, which mitigates the possibility of the font data being duplicated within the binary if it's referred to in more than one translation unit in the future. It also stores the data within a std::array, which is more flexible when it comes to operating with the standard library. Furthermore, it makes the data arrays const. This is what we want, as it allows the compiler to store the data within the read-only segment. As it is, having several large sections of mutable data like this just leaves spots in memory that we can accidentally write to (via accidental overruns, what have you) and actually have it work. This ensures the font data remains the same no matter what.
* Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-111-1/+25
| | | | | | * Add open-source shared fonts * Address review comments
* video_core: Move command buffer loop.Markus Wick2018-09-102-31/+12
| | | | This moves the hot loop into video_core. This refactoring shall reduce the CPU overhead of calling ProcessCommandList.
* Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-101-4/+4
|\ | | | | hid: Implement ReloadInputDevices
| * hid: Implement ReloadInputDevicesfearlessTobi2018-09-091-4/+4
| |
* | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
|/ | | | | With the named port functionality all migrated over to the kernel, there's no need to keep this around anymore.
* core/core: Remove unnecessary sm/controller includeLioncash2018-09-064-1/+5
| | | | | | | | | | The only reason this include was necessary, was because the constructor wasn't defaulted in the cpp file and the compiler would inline it wherever it was used. However, given Controller is forward declared, all those inlined constructors would see an incomplete type, causing a compilation failure. So, we just place the constructor in the cpp file, where it can see the complete type definition, allowing us to remove this include.
* bktr: Fix bucket overlap errorZach Hilman2018-09-041-1/+1
|
* registration: Add RegisteredCacheUnionZach Hilman2018-09-042-0/+10
| | | | Aggregates multiple caches into one interface
* Merge pull request #1235 from lioncash/forward-declbunnei2018-09-041-1/+3
|\ | | | | file_sys: Replace includes with forward declarations where applicable
| * file_sys: Replace includes with forward declarations where applicableLioncash2018-09-041-1/+3
| | | | | | | | | | Cuts down on include dependencies, resulting in less files that need to be rebuilt when certain things are changed.
* | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ | |/ |/| ssl: Move SSL class to cpp file
| * ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
| | | | | | | | | | | | This isn't required to be visible to anything outside of the main source file, and will eliminate needing to rebuild anything else including the header if the SSL class needs to be changed in the future.
* | service: Migrate global named port map to the KernelCore classLioncash2018-09-022-14/+2
| | | | | | | | | | | | Now that we have a class representing the kernel in some capacity, we now have a place to put the named port map, so we move it over and get rid of another piece of global state within the core.
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-022-2/+30
|\ \ | | | | | | filesystem/maxwell_3d: Various changes to boot Project Octopath Traveller
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| | |
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* / filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/ | | | | We don't need to do the lookup if the path is considered empty currently.
* core/core: Replace includes with forward declarations where applicableLioncash2018-08-311-0/+1
| | | | | | | | | | | The follow-up to e2457418dae19b889b2ad85255bb95d4cd0e4bff, which replaces most of the includes in the core header with forward declarations. This makes it so that if any of the headers the core header was previously including change, then no one will need to rebuild the bulk of the core, due to core.h being quite a prevalent inclusion. This should make turnaround for changes much faster for developers.
* gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-311-0/+1
|
* core: Make the main System class use the PImpl idiomLioncash2018-08-312-2/+4
| | | | | | | | | | | | | core.h is kind of a massive header in terms what it includes within itself. It includes VFS utilities, kernel headers, file_sys header, ARM-related headers, etc. This means that changing anything in the headers included by core.h essentially requires you to rebuild almost all of core. Instead, we can modify the System class to use the PImpl idiom, which allows us to move all of those headers to the cpp file and forward declare the bulk of the types that would otherwise be included, reducing compile times. This change specifically only performs the PImpl portion.
* kernel: Eliminate kernel global stateLioncash2018-08-2912-23/+51
| | | | | | | | | | | | | | | | | | | | | | As means to pave the way for getting rid of global state within core, This eliminates kernel global state by removing all globals. Instead this introduces a KernelCore class which acts as a kernel instance. This instance lives in the System class, which keeps its lifetime contained to the lifetime of the System class. This also forces the kernel types to actually interact with the main kernel instance itself instead of having transient kernel state placed all over several translation units, keeping everything together. It also has a nice consequence of making dependencies much more explicit. This also makes our initialization a tad bit more correct. Previously we were creating a kernel process before the actual kernel was initialized, which doesn't really make much sense. The KernelCore class itself follows the PImpl idiom, which allows keeping all the implementation details sealed away from everything else, which forces the use of the exposed API and allows us to avoid any unnecessary inclusions within the main kernel header.
* gpu: Make memory_manager privateLioncash2018-08-281-6/+6
| | | | | | | | | | Makes the class interface consistent and provides accessors for obtaining a reference to the memory manager instance. Given we also return references, this makes our more flimsy uses of const apparent, given const doesn't propagate through pointers in the way one would typically expect. This makes our mutable state more apparent in some places.
* Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ | | | | PL:U Added SharedFonts loading via TTF
| * Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| |
| * Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
| | | | | | | | | | | | | | | | | | | | | | By having the following TTF files in your yuzu sysdata directory. You can load sharedfonts via TTF files. FontStandard.ttf FontChineseSimplified.ttf FontExtendedChineseSimplified.ttf FontChineseTraditional.ttf FontKorean.ttf FontNintendoExtended.ttf FontNintendoExtended2.ttf
* | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ | | | | | | hid: Move core include to cpp file
| * | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | | | | | | | | | | | | | | This isn't required to be in the header. Instead, directly include what this header needs and move it to the cpp file where it belongs.
* | | set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rightnow, in games use GetAvailableLanguageCodes(), there is a WriteBuffer() with size larger than the buffer_size. (Core Critical core\hle\kernel\hle_ipc.cpp:WriteBuffer:296: size (0000000000000088) is greater than buffer_size (0000000000000078)) 0x88 = 17(languages) * 8 0x78 = 15(languages) * 8 GetAvailableLanguageCodes() can only support 15 languages. After firmware 4.0.0 there are 17 supported language instead of 15, to enable this GetAvailableLanguageCodes2() need to be used. So GetAvailableLanguageCodes() will be caped at 15 languages. Reference: http://switchbrew.org/index.php/Settings_services
* | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ | | | | | | | | filesystem: Fix typo in log message
| * | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ /
* | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-252-12/+36
|\ \ \ | |/ / |/| | file_sys: Add support for NAX archives
| * | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-232-8/+11
| | | | | | | | | | | | Allows frontend to create registration caches for use before a game has booted.
| * | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| |/
* / Added GetBootMode (#1107)David2018-08-244-3/+25
|/ | | | | | | | * Added GetBootMode Used by homebrew * Added enum for GetBootMode
* Added missing include for pl:uDavid Marcec2018-08-221-0/+1
| | | | Should fix any compile errors
* PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
| | | | | | | | | | | | * Added bfttf loading We can now load system bfttf fonts from system archives AND shared memory dumps. This allows people who have installed their system nand dumps to yuzu to automatically get shared font support. We also now don't hard code the offsets or the sizes of the shared fonts and it's all calculated for us now. * Addressed plu fixups * Style changes for plu * Fixed logic error for plu and added more error checks.
* Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-223-2/+3
|\ | | | | vfs: Replace mode.h include with forward declarations where applicable
| * vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-213-2/+3
| | | | | | | | | | Avoids the need to rebuild these source files if the mode header changes.
* | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
|/ | | | | | Gets rid of the potential for C array-to-pointer decay, and also makes pointer arithmetic to get the end of the copy range unnecessary. We can just use std::array's begin() and end() member functions.
* Merge pull request #1129 from lioncash/headerbunnei2018-08-213-5/+19
|\ | | | | romfs_factory, service/filesystem: Use forward declarations where applicable
| * service/filesystem: Use forward declarations where applicableLioncash2018-08-213-5/+19
| | | | | | | | | | | | | | | | Avoids the need to rebuild multiple source files if the filesystem code headers change. This also gets rid of a few instances of indirect inclusions being relied upon
* | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ | |/ |/| acc/profile_manager: General cleanup
| * acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| | | | | | | | This is only used in a shared_ptr, so we can forward declare it.
| * acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| | | | | | | | | | | | We have an overload of WriteBuffer that accepts containers that satisfy the ContiguousContainer concept, which std::array does, so we only need to pass in the array itself.
| * acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| | | | | | | | Arranges them in the order the members would be initialized
| * acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| | | | | | | | This is no longer used, so it can be removed.
| * profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| | | | | | | | Makes it a little bit more self-documenting.
| * profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| | | | | | | | | | Given the source and destination types are the same std::array type, we can simply use regular assignment to perform the same behavior.
| * profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| | | | | | | | | | Avoids the need to repeatedly specify the whole array type in multiple places.
| * profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| | | | | | | | | | | | ProfileInfo is quite a large struct in terms of data, and we don't need to perform a copy in these instances, so we can just pass constant references instead.
| * profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| | | | | | | | | | This doesn't modify the passed in array, so this can be a const reference.
| * profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| | | | | | | | This can just be constexpr like the others
| * profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| | | | | | | | | | | | We can use the constructor initializer list and just compare the contained u128's together instead of comparing each element individually. Ditto for comparing against an invalid UUID.
| * profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| | | | | | | | | | This avoids needing to dump the contents of <random> into other files that include the profile manager header.
| * profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | | | | | | | | | | | Moving a const reference isn't possible, so this just results in a copy (and given ProfileInfo is composed of trivial types and aggregates, a move wouldn't really do anything).
* | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-214-16/+50
|\ \ | |/ |/| filesystem: Add support for loading of system archives
| * filesystem: Add support for loading of system archivesZach Hilman2018-08-194-16/+50
| |
* | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ | | | | | | Added CheckFreeCommunicationPermission
| * | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| |/ | | | | | | This fixes save files not loading in splatoon 2
* | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2012-74/+438
|\ \ | |/ |/| New account backend to allow for future extended support
| * Better UUID randomnessDavid Marcec2018-08-111-2/+7
| |
| * Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| |
| * Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| |
| * Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| |
| * Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| |
| * fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| |
| * Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| |
| * Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| |
| * Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| |
| * If statement style changeDavid Marcec2018-08-111-11/+19
| |
| * Second round of account changesDavid Marcec2018-08-113-18/+21
| |
| * First round of account changesDavid Marcec2018-08-113-49/+55
| |
| * Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| |
| * Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1115-34/+76
| |\
| * | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| | |
| * | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| | |
| * | Open first user addedDavid Marcec2018-08-081-1/+3
| | |
| * | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| | | | | | | | | | | | This commit verified working on puyo
| * | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| | |
| * | began initial implementation of "ProfileManager"David Marcec2018-08-084-44/+200
| | |
| * | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
| | |
* | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
| | | | | | | | | * Used by Mario Tennis Aces
* | | correct coding stylegreggameplayer2018-08-161-1/+1
| | |
* | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
| | | | | | | | | | | | Require by Toki Tori and Toki Tori 2+
* | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-162-4/+23
|\ \ \ | | | | | | | | file_sys: Add support for registration format
| * | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| | | |
* | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ | | | | | | | | | | lm: Handle threads and modules within the logger
| * | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using LOG_TRACE here isn't a good idea because LOG_TRACE is only enabled when yuzu is compiled in debug mode. Debug mode is also quite slow, and so we're potentially throwing away logging messages that can provide value when trying to boot games.
| * | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The thread field serves to indicate which thread a log is related to and provides the length of the thread's name, so we can print that out, ditto for modules. Now we can know what threads are potentially spawning off logging messages (for example Lydie & Suelle bounces between MainThread and LoadingThread when initializing the game).
* | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ | | | | | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSize
| * | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| |/ / / / | | | | | | | | | | | | | | | This should be returning a u16 according to Switch Brew.
* / / / / kernel/server_session: Add IsSession() member functionLioncash2018-08-151-1/+1
|/ / / / | | | | | | | | | | | | | | | | | | | | Allows querying the inverse of IsDomain() to make things more readable. This will likely also be usable in the event of implementing ConvertDomainToSession().
* | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ | | | | | | | | | | mm_u: Move interface class into the cpp file
| * | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| | | | | | | | | | | | | | | | | | | | | | | | | Ensures both variants go through the same interface, and while we're at it, add Finalize to provide the inverse of Initialize for consistency.
| * | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
| | | | | | | | | | | | | | | | | | | | | | | | | Now if changes are ever made to the behavior of the class, it doesn't involve rebuilding everything that includes the mm_u header.
* | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ | | | | | | | | | | | | audout_u: Correct IAudioOut initializer list order
| * | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / | | | | | | | | | | | | | | | Orders elements in the precise order they'll be initialized.
* | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| | | | |
* | | | | Added missing channel devicesDavid Marcec2018-08-134-0/+140
|/ / / /
* | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | struct should be used when the data type is very simple or otherwise has no invariants associated with it. Given these are used to form a hierarchy, class should be used instead.
* | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ | | | | | | | | | | GetAudioDeviceServiceWithRevisionInfo (Used by Bloodstained: Curse of the Moon)
| * | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | | | | | | | | | | | | | | | | | | | As we're not handling any anything about the revision data for GetAudioDeviceServiceWithRevisionInfo, it's currently marked as stubbed. However for games this shouldn't affect the result. Proper revision info would be more for homebrew.
* | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-121-5/+26
|\ \ \ \ \ | | | | | | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCount
| * | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-121-4/+2
| | | | | |
| * | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-121-5/+28
| | |/ / / | |/| | | | | | | | | | | | | GetAudioRendererSampleRate is set as a "STUB" as a game could check if the sample rate it sent and the sample rate it wants don't match. Just a thought of something which could happen so keeping it as stub for the mean time
* | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
| | | | | | | | | | | | | | | | | | | | Prevents clang-format from butchering them.
* | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| |/ / / |/| | | | | | | | | | | This is required by ARMS.
* | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
|/ / / | | | | | | | | | Needed for Retro City Rampage to go in game
* | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| | | | | | | | | | | | - Used by Splatoon 2.
* | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| | |
* | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-111-0/+1
| |/ |/| | | | | | | | | | | | | | | Instead, we make a struct for renderer settings and allow the renderer to update all of these settings, getting rid of the need for global-scoped variables. This also uncovered a few indirect inclusions for certain headers, which this commit also fixes.
* | Merge pull request #997 from lioncash/const-funcbunnei2018-08-102-2/+2
|\ \ | | | | | | core: Make function reference parameters const where applicable
| * | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | This is simply copied by value, so there's no need to make it a modifiable reference. While we're at it, make the names of the parameters match its definition.
* | | Merge pull request #990 from lioncash/entrybunnei2018-08-101-6/+3
|\ \ \ | | | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing last
| * | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-091-5/+1
| | | | | | | | | | | | | | | | | | | | | | | | Given elements inserted into a vector are zeroed out, we can just copy MAX_LEN - 1 elements and the data will already be properly null terminated.
| * | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current way were doing it would require copying a 768 character buffer (part of the Entry struct) to the new element in the vector. Given it's a plain array, std::move won't eliminate that. Instead, we can emplace an instance directly into the destination buffer and then fill it out, avoiding the need to perform any unnecessary copies. Given this is done in a loop, we can request the destination to allocate all of the necessary memory ahead of time, avoiding the need to potentially keep reallocating over and over on every few insertions into the vector.
* | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-104-12/+17
|\ \ \ \ | |_|/ / |/| | | vfs: Add VfsFilesystem and fix RealVfs* implementations
| * | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-094-11/+16
| | | |
| * | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
| | | |
* | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ | |/ / / |/| | | Service/Account: stub LoadImage function
| * | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |/ | |/|
* | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ | | | | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.
| * | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| | | |
* | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ | |_|_|/ |/| | | am: Stub SetScreenShotImageOrientation.
| * | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / | | | | | | | | | - Used by Super Mario Odyssey.
* | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ | |_|/ |/| | nvdrv: Get rid of global std::weak_ptr
| * | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| |/ | | | | | | | | Rather than use global state, we can simply pass the instance into the NVFlinger instance directly.
* | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ | | | | | | acc: Add missing function table entries for GetUserCount
| * | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
| | | | | | | | | | | | | | | Given this is stubbed within the common module in 5ac7b84, it should be added to the other relevant tables as well.
* | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ /
* / acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
|/ | | - Used by Pokken Tournament DX.
* Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ | | | | nvflinger: Correct typo in name of composition event
| * nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| |
* | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info array
| * | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ | | | | | | Updated based off the information on Switch Brew.
* | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ | | | | | | service/apm: Add the apm:sys service
| * | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ | | | | | | | | Adds the basic skeleton of the apm:sys service based off the information on Switch Brew.
* | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ | | | | | | nvflinger: Use std::string_view in OpenDisplay()
| * | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| | |
| * | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| |/ | | | | | | | | | | We don't need to use a std::string here, given all that's done is comparing the character sequence against another. This allows passing regular const char* without needing to heap allocate.
* | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()
| * | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ | | | | | | Updates the ID of these based off the information on Switch Brew.
* | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ | | | | | | nvdrv: Get rid of indirect inclusions
| * | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| | | | | | | | | | | | | | | The only reason this wasn't a compilation error is because we use little-endian systems.
| * | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/
* / service: Add usb servicesLioncash2018-08-073-0/+255
|/ | | | Adds basic skeleton for the usb services based off the information provided by Switch Brew.
* Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
|
* Merge pull request #925 from bunnei/audrenbunnei2018-08-064-233/+16
|\ | | | | Implement audren audio output
| * audio_core: Implement audren_u audio playback.bunnei2018-08-052-218/+9
| |
| * audio_core: Use s16 where possible for audio samples.bunnei2018-08-051-3/+3
| |
| * audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-052-11/+3
| |
| * audio_core: Streams need unique names for CoreTiming.bunnei2018-08-041-1/+1
| |
* | Merge pull request #912 from lioncash/global-varbunnei2018-08-053-10/+13
|\ \ | | | | | | video_core: Eliminate the g_renderer global variable
| * | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-041-2/+2
| | | | | | | | | | | | | | | | | | | | | All calling code assumes that the rasterizer will be in a valid state, which is a totally fine assumption. The only way the rasterizer wouldn't be is if initialization is done incorrectly or fails, which is checked against in System::Init().
| * | video_core: Eliminate the g_renderer global variableLioncash2018-08-043-10/+13
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | We move the initialization of the renderer to the core class, while keeping the creation of it and any other specifics in video_core. This way we can ensure that the renderer is initialized and doesn't give unfettered access to the renderer. This also makes dependencies on types more explicit. For example, the GPU class doesn't need to depend on the existence of a renderer, it only needs to care about whether or not it has a rasterizer, but since it was accessing the global variable, it was also making the renderer a part of its dependency chain. By adjusting the interface, we can get rid of this dependency.
* | Merge pull request #924 from lioncash/arpbunnei2018-08-053-0/+93
|\ \ | | | | | | service: Add arp services
| * | service: Add arp servicesLioncash2018-08-053-0/+93
| |/ | | | | | | | | Adds the basic skeleton of the arp services based off the information provided by Switch Brew.
* / service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ | | | | These don't do anything within .cpp files (we don't include cpp files, so...)
* Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-034-5/+45
|
* Merge pull request #898 from lioncash/migbunnei2018-08-033-0/+51
|\ | | | | service: Add migration services
| * service: Add migration servicesLioncash2018-08-023-0/+51
| | | | | | | | | | Adds the basic skeleton for the mig:usr service based off information provided by Switch Brew.
* | Merge pull request #894 from lioncash/objectbunnei2018-08-033-8/+8
|\ \ | | | | | | kernel: Move object class to its own source files
| * | kernel: Move object class to its own source filesLioncash2018-08-023-8/+8
| |/ | | | | | | | | | | General moving to keep kernel object types separate from the direct kernel code. Also essentially a preliminary cleanup before eliminating global kernel state in the kernel code.
* | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ | | | | | | service/ns: Add missing ns services
| * | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | | | | | | | | | | | | | | | | | Implements the basic skeleton of ns:am2, ns:ec, ns:rid, ns:rt, ns:su, ns:vm, and ns:web based off the information provided by Switch Brew and SwIPC.
* | | service: Add psc servicesLioncash2018-08-023-0/+94
| |/ |/| | | | | | | Adds the basic skeleton for the psc services based off the information provided by Switch Brew.
* | Merge pull request #888 from lioncash/capsbunnei2018-08-023-0/+169
|\ \ | | | | | | service: Add capture services
| * | service: Add capture servicesLioncash2018-08-013-0/+169
| |/ | | | | | | | | Adds the basic skeleton for the capture services based off information provided by Switch Brew.
* | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ | | | | | | lm: Amend name of ILogger
| * | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ | | | | | | | | Previously this was being registered with the name "Logger". While we're at it, also change the name of the class to match it.
* | Merge pull request #889 from lioncash/fspbunnei2018-08-025-0/+85
|\ \ | | | | | | service/filesystem: Add fsp:ldr and fsp:pr services
| * | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-015-0/+85
| |/ | | | | | | | | Adds the basic skeleton for the remaining fsp services based off information provided by Switch Brew.
* / service: Add bpc and pcv servicesLioncash2018-08-015-0/+175
|/ | | | | Adds the basic skeleton for the remaining pcv-related services based off information on Switch Brew.
* Merge pull request #880 from lioncash/audiobunnei2018-08-0113-0/+277
|\ | | | | service/audio: Add missing services
| * service/audio: Add missing servicesLioncash2018-08-0113-0/+277
| | | | | | | | | | Adds the missing audctl service, as well as the :a and :d services for audin, audout, audrec, and audren.
* | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ | |/ |/| audout_u: Remove std::move in OpenAudioOutImpl()
| * audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
| | | | | | | | | | | | | | Previously the code was using the values from params further below after it was std::moved. Thankfully, given AudoutParams is a trivially copyable struct, the values would have simply been copied in this instance and not invalidated to garbage values.
* | Merge pull request #869 from Subv/ubsanbunnei2018-07-312-6/+17
|\ \ | | | | | | Corrected a few error cases detected by asan/ubsan
| * | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| | |
| * | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
| | | | | | | | | | | | Passing nullptr to memcpy is undefined behavior.
* | | Merge pull request #875 from lioncash/fgmbunnei2018-07-313-0/+92
|\ \ \ | | | | | | | | service: Add fgm services
| * | | service: Add fgm servicesLioncash2018-07-313-0/+92
| | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the fgm services based off the information provided by Switch Brew.
* | | | Merge pull request #874 from lioncash/ambunnei2018-07-317-0/+150
|\ \ \ \ | |_|_|/ |/| | | service/am: Add missing am services
| * | | service/am: Add missing am servicesLioncash2018-07-317-0/+150
| |/ / | | | | | | | | | | | | Adds the basic skeleton for missing am services idle:sys, omm, and spsm based off the information provided by Switch Brew.
* / / service: Add the pcie serviceLioncash2018-07-313-0/+81
|/ / | | | | | | | | Adds the basic skeleton of the pcie service based off information on Switch Brew.
* | audio_core: Move to audout_u impl.bunnei2018-07-312-4/+6
| | | | | | | | - This is necessary so streams are created on the same thread.
* | Implemented various hwopus functions (#853)David2018-07-312-5/+131
| |
* | Merge pull request #857 from lioncash/wlanbunnei2018-07-303-1/+190
|\ \ | | | | | | service: Add wlan services
| * | service: Add wlan servicesLioncash2018-07-293-1/+190
| | | | | | | | | | | | | | | Adds the basic skeleton for the wlan services based off the information on Switch Brew.
* | | Merge pull request #856 from lioncash/btmbunnei2018-07-303-0/+138
|\ \ \ | | | | | | | | service: Add btm services
| * | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| | | | | | | | | | | | | | | | Based off information on SwIPC and Switch Brew.
| * | | service: Add btm servicesLioncash2018-07-293-0/+104
| |/ / | | | | | | | | | | | | Adds the skeleton for the btm services based off the information on Switch Brew.
* / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ / | | | | | | | | | | * Added some HID commands * Addressed comments
* | Merge pull request #847 from lioncash/ncmbunnei2018-07-283-0/+76
|\ \ | | | | | | service: Add ncm services
| * | service: Add ncm servicesLioncash2018-07-273-0/+76
| | | | | | | | | | | | | | | Adds the basic skeleton for the ncm services based off information on Switch Brew.
* | | Merge pull request #846 from lioncash/miibunnei2018-07-283-0/+124
|\ \ \ | | | | | | | | service: Add mii services
| * | | service: Add mii servicesLioncash2018-07-273-0/+124
| | | | | | | | | | | | | | | | | | | | Adds the skeleton for the mii services based off information provided by Switch Brew
* | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| |/ / |/| |
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-273-0/+239
|\ \ \ | | | | | | | | service: Add nfc services
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| | | | | | | | | | | | | | | | These simply return the respective interface.
| * | | service: Add nfc servicesLioncash2018-07-273-0/+200
| |/ / | | | | | | | | | | | | Adds the skeleton of the nfc service based off the information provided on Switch Brew.
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-273-0/+107
|\ \ \ | | | | | | | | service: Add the lbl service
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-271-3/+35
| | | | | | | | | | | | | | | | | | | | Implements these functions according to the information available on Switch Brew.
| * | | service: Add the lbl serviceLioncash2018-07-273-0/+75
| |/ / | | | | | | | | | | | | Adds the skeleton of the lbl service based off the information provided by Switch Brew.
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-273-1/+91
|\ \ \ | |/ / |/| | service: Add the btdrv service
| * | service: Add the btdrv serviceLioncash2018-07-273-1/+91
| | | | | | | | | | | | Adds the skeleton for the btdrv service based off the information provided by Switch Brew
* | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
| | |
* | | service/hid: Add the xcd:sys serviceLioncash2018-07-263-0/+55
| | |
* | | service/hid: Add irs servicesLioncash2018-07-263-0/+73
|/ /
* | Merge pull request #834 from lioncash/grcbunnei2018-07-263-0/+48
|\ \ | | | | | | service: Add the grc:c service
| * | service: Add the grc:c serviceLioncash2018-07-263-0/+48
| | | | | | | | | | | | | | | Adds the basic skeleton for the grc:c service based off the information provided by Switch Brew.
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-263-0/+141
|\ \ \ | | | | | | | | service: Add the nim services
| * | | service: Add the nim servicesLioncash2018-07-263-0/+141
| |/ / | | | | | | | | | | | | Adds the skeleton for the nim services based off information from Switch Brew.
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-263-0/+160
|\ \ \ | | | | | | | | service: Add ldn services
| * | | service: Add ldn servicesLioncash2018-07-263-0/+160
| |/ / | | | | | | | | | Adds ldn services based off information provided by Switch Brew.
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-265-0/+93
|\ \ \ | |_|/ |/| | service/sockets: Add missing socket services
| * | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-263-0/+64
| | |
| * | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/
* | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ | |/ |/| service/lm: Minor changes
| * lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| | | | | | | | | | This isn't used directly outside of this translation unit, so we can hide it from external use.
| * lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| | | | | | | | Amends these to match the information on Switch Brew.
| * lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
| |
* | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-263-0/+99
|\ \ | | | | | | service: Add ldr services
| * | service: Add ldr servicesLioncash2018-07-263-0/+99
| | | | | | | | | | | | | | | Adds the skeleton for the ldr-related services based off the information provided on Switch Brew.
* | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-265-0/+139
|\ \ \ | | | | | | | | service: Add erpt and eupld services
| * | | service: Add eupld servicesLioncash2018-07-263-0/+70
| | | | | | | | | | | | | | | | | | | | Adds the skeleton for the eupld services based off information on Switch Brew.
| * | | service: Add the erpt servicesLioncash2018-07-263-0/+69
| | |/ | |/| | | | | | | | | | Adds the basic skeleton of the erpt service based off information on Switch Brew.
* | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-268-135/+30
|\ \ \ | |_|/ |/| | service/nifm: Deduplicate interface code
| * | service/nifm: Deduplicate interface codeLioncash2018-07-258-135/+30
| | | | | | | | | | | | | | | Rather than having the same code for each nifm service variant, we can centralize it on one class and get rid of a bit of extra code.
* | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ | | | | | | | | service/nvdrv: Minor changes
| * | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids copies from being made, since the string is only ever used for lookup, the data is never transfered anywhere. Ideally, we'd use a std::string_view here, but devices is a std::unordered_map, not a std::map, so we can't use heterogenous lookup here.
| * | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / | | | | | | | | | | | | | | | | | | Avoids unnecessary reference count increments and decrements. In one case, we don't need to make a shared_ptr copy at all, just to call a member function.
* | | Merge pull request #822 from lioncash/pmbunnei2018-07-263-0/+88
|\ \ \ | |_|/ |/| | service: Add pm services
| * | service: Add pm servicesLioncash2018-07-253-0/+88
| |/ | | | | | | | | Adds the skeleton for the process management services based off information on Switch Brew.
* / service: Add the es serviceLioncash2018-07-253-0/+75
|/ | | | | Adds the skeleton for the ETicket service based off the information on Switch Brew
* Merge pull request #801 from lioncash/timeMat M2018-07-255-60/+14
|\ | | | | time: Add the time:a service
| * time: Add the time:a serviceLioncash2018-07-253-10/+11
| | | | | | | | Given we already have time:s and time:u, we should also have time:a
| * time: Simplify interface creationLioncash2018-07-245-60/+13
| | | | | | | | We can use one instance of the interface instead of duplicating code.
* | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-255-0/+5
|\ \ | | | | | | core_timing: Split off utility functions into core_timing_util
| * | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-245-0/+5
| |/
* | Merge pull request #800 from lioncash/setbunnei2018-07-252-5/+25
|\ \ | | | | | | set_sys: Implement SetColorSetId()
| * | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| |/
* | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| | | | | | | | | | Given we already have friend:a and friend:u, we should add the remaining services as well.
* | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| |
* | friend: Deduplicate interfacesLioncash2018-07-245-44/+9
| |
* | Merge pull request #797 from lioncash/explicitbunnei2018-07-242-2/+2
|\ \ | | | | | | core: Make converting constructors explicit where applicable
| * | core: Make converting constructors explicit where applicableLioncash2018-07-242-2/+2
| |/ | | | | | | | | Avoids unwanted implicit conversions. Thankfully, given the large amount of cleanup in past PRs, only this tiny amount is left over to cover.
* / apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
|/ | | | This is already declared in apm/apm.h
* VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-241-16/+29
| | | | | | | | | | | | | | | | * Regression and Mode Fixes * Review Fixes * string_view correction * Add operator& for FileSys::Mode * Return std::string from SanitizePath * Farming Simulator Fix * Use != With mode operator&
* Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ | | | | vi: Minor changes
| * vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| | | | | | | | | | | | It's undefined behavior to memcpy an object that isn't considered trivially copyable, so put a compile-time check in to make sure this doesn't occur.
| * vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| | | | | | | | | | | | | | Allows avoiding unnecessary copies of the vector depending on the calling code. While we're at it, remove a redundant no-parameter base constructor call
* | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
|/ | | | Forgot to include this in 22f448b6327044076959e338811ee576f3dcf093
* set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| | | | This just returns the size of the language code buffer.
* set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| | | | The return code should be 32-bit in size.
* file_util, vfs: Use std::string_view where applicableLioncash2018-07-221-1/+1
| | | | | Avoids unnecessary construction of std::string instances where applicable.
* Merge pull request #760 from lioncash/pathbunnei2018-07-222-3/+3
|\ | | | | file_util: Use an enum class for GetUserPath()
| * file_util: Use an enum class for GetUserPath()Lioncash2018-07-212-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | Instead of using an unsigned int as a parameter and expecting a user to always pass in the correct values, we can just convert the enum into an enum class and use that type as the parameter type instead, which makes the interface more type safe. We also get rid of the bookkeeping "NUM_" element in the enum by just using an unordered map. This function is generally low-frequency in terms of calls (and I'd hope so, considering otherwise would mean we're slamming the disk with IO all the time) so I'd consider this acceptable in this case.
* | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ | | | | This behaves quite similarly to the SubmitGPFIFO command. Referenced from Ryujinx. Many thanks to @gdkchan for investigating this!
* apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
|
* Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ | | | | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.
| * HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| | | | | | | | | | | | And make IManagerForApplication::CheckAvailability always return false. Returning a bogus id from GetAccountId causes games to crash on boot. We should investigate this with a hwtest and either stub it properly or implement it.
* | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ | |/ |/| audout_u/audren_u: Ensure null terminators are written out in ListAudioOutsImpl(), ListAudioDeviceName(), and GetActiveAudioDeviceName()
| * audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| | | | | | | | | | std::string doesn't include the null-terminator in its data() + size() range. This ensures that the null-terminator will also be written to the buffer
| * audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| | | | | | | | | | | | Uses a type that doesn't potentially dynamically allocate, and ensures that the name of the interface is properly null-terminated when writing it to the buffer.
* | pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/ | | | With the new overload, we can simply pass the container directly.
* Merge pull request #726 from lioncash/overloadbunnei2018-07-203-4/+4
|\ | | | | hle_ipc: Introduce generic WriteBuffer overload for multiple container types
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-193-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This introduces a slightly more generic variant of WriteBuffer(). Notably, this variant doesn't constrain the arguments to only accepting std::vector instances. It accepts whatever adheres to the ContiguousContainer concept in the C++ standard library. This essentially means, std::array, std::string, and std::vector can be used directly with this interface. The interface no longer forces you to solely use containers that dynamically allocate. To ensure our overloads play nice with one another, we only enable the container-based WriteBuffer if the argument is not a pointer, otherwise we fall back to the pointer-based one.
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \ | | | | | | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/ | | | | | | | | This WriteBuffer overload expects its size argument to be in bytes, not elements.
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \ | | | | | | HLE/ACC: Change the default user id and small improvements to the way we handle profiles
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| | | | | | | | | | | | | | | The default username for now is "yuzu". We should eventually allow the creation of users in the emulator and have the ability to modify their parameters.
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
| | | | | | | | | | | | In IApplicationFunctions::PopLaunchParameter we tell the games that they were launched as user id 1.
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \ | | | | | | | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ / | | | | | | | | | We only emulate a single user id for now.
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/| | | | | | | This can just use the fmt specifiers and be type-agnostic.
* | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ | | | | | | | | hid: Resolve a signed/unsigned comparison warning
| * | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| | | | | | | | | | | | | | | | | | | | Modernizes the loops themselves while also getting rid of a signed/unsigned comparison in a loop condition.
| * | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | Gets rid of the use of a magic constant
* | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ | | | | | | | | | | hle/service: Make constructors explicit where applicable
| * | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit construction and makes these lingering non-explicit constructors consistent with the rest of the other classes in services.
* | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ | | | | | | | | | | | | nvflinger: Emplace Display instances directly
| * | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use emplace_back to construct the Display instances directly, instead of constructing them separately and copying them, avoiding the need to copy std::string and std::vector instances that are part of the Display struct.
* | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | | nvdrv: Take std::string by const reference in GetDevice()
| * | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / | | | | | | | | | | | | | | | | This is only ever used as a lookup into the device map, so we don't need to take the std::string instance by value here.
* | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ | |_|_|/ |/| | | Filesystem: Return EntryType::Directory for the root directory.
| * | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
| |/ / | | | | | | | | | It is unknown if this is correct behavior, but it makes sense and fixes a regression with Stardew Valley.
* | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ | |_|/ |/| | fsp_srv: Misc individual changes
| * | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| | | | | | | | | | | | | | | | | | | | | We can avoid constructing a std::vector here by simply passing a pointer to the original data and the size of the copy we wish to perform to the backend's Write() function instead, avoiding copying the data where it's otherwise not needed.
| * | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were using a second std::vector as a buffer to convert another std::vector's data into a byte sequence, however we can just use pointers to the original data and use them directly with WriteBuffer, which avoids copying the data at all into a separate std::vector. We simply cast the pointers to u8* (which is allowed by the standard, given std::uint8_t is an alias for unsigned char on platforms that we support).
| * | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| | | | | | | | | | | | Prevents implicit conversions.
| * | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| | | | | | | | | | | | Gets rid of relying on indirect inclusions.
| * | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| | |
| * | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ | | | | | | | | | | | | | | | | | | | | Previously we were just copying the data whole-sale, even if the length was less than the total data size. This effectively makes the actual_data vector useless, which is likely not intended. Instead, amend this to only copy the given length amount of data. At the same time, we can avoid zeroing out the data before using it by passing iterators to the constructor instead of a size.
* | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| | | | | | | | Avoids unnecessary atomic reference count incrementing and decrementing
* | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| | | | | | | | | | This is simply a basic value check as opposed to potentially doing string based operations (unlikely, but still, avoiding it is free).
* | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
|/ | | | This was just an artifact missed during PR review.
* Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ | | | | service/prepo: Add missing header guard
| * service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| |
* | Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-195-116/+383
|/ | | | | | | | | | * Virtual Filesystem * Fix delete bug and documentate * Review fixes + other stuff * Fix puyo regression
* Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
|
* Single touch supportZach Hilman2018-07-181-4/+19
|
* vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
|
* vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
|
* vi: Partially implement buffer crop parameters.bunnei2018-07-186-10/+26
|
* General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-175-101/+130
|
* nvflinger: Fix for BufferQueue event handling.bunnei2018-07-174-29/+10
|
* HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
|
* Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
|
* We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
|
* initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
|
* Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ | | | | Let games/application know that we're offline
| * Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
| | | | | | | | Since we have no socket implementation we should be returning 0 to indicate we're currently offline.
* | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
|/ | | | Audout autos are identical to their counterpart except for the buffer type which yuzu already handles for us.
* Merge pull request #559 from Subv/mount_savedatabunnei2018-07-121-2/+11
|\ | | | | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.
| * Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-191-2/+11
| |
* | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
| | | | | | | | - This fixes user input in SMO.
* | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
| | | | | | | | | | Settings are only used when RMOS_SET_PRODUCTION_MODE is set to 0. If production mode is set, the error code 0x30006 is returned instead
* | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
| |
* | Revert "Virtual Filesystem (#597)"bunnei2018-07-085-405/+71
| | | | | | | | This reverts commit 77c684c1140f6bf3fb7d4560d06d2efb1a2ee5e2.
* | Virtual Filesystem (#597)Zach Hilman2018-07-065-71/+405
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add VfsFile and VfsDirectory classes * Finish abstract Vfs classes * Implement RealVfsFile (computer fs backend) * Finish RealVfsFile and RealVfsDirectory * Finished OffsetVfsFile * More changes * Fix import paths * Major refactor * Remove double const * Use experimental/filesystem or filesystem depending on compiler * Port partition_filesystem * More changes * More Overhaul * FSP_SRV fixes * Fixes and testing * Try to get filesystem to compile * Filesystem on linux * Remove std::filesystem and document/test * Compile fixes * Missing include * Bug fixes * Fixes * Rename v_file and v_dir * clang-format fix * Rename NGLOG_* to LOG_* * Most review changes * Fix TODO * Guess 'main' to be Directory by filename
* | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
| | | | | | | | | | | | | | | | * voice section updating * fixed slight offset miscalculation * fixed overflow
* | Update clang formatJames Rowe2018-07-0311-37/+35
| |
* | Rename logging macro back to LOG_*James Rowe2018-07-0343-322/+322
| |
* | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| |
* | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
| | | | | | | | This behavior is confirmed by reverse engineering.
* | Merge pull request #588 from mailwl/hwopusbunnei2018-06-283-0/+51
|\ \ | | | | | | Service/Audio: add hwopus service, stub GetWorkBufferSize function
| * | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-253-0/+51
| | |
* | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / | | | | | | | | | | | | | | * We should be returning our revision instead of what is requested. Hardware test on a 5.1.0 console * Added sysversion comment
* | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
| | | | | | | | | | | | | | | | | | | | * Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader According to game symbols(SMO), there's references to UpdateDataHeader which seems to be what AudioRendererResponse actually is * oops * AudioRendererParameters should be AudioRendererParameter according to SMO
* | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
| | | | | | | | | | * Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly This fixes RequestUpdateAudioRenderer deadlocks in games like Puyo Puyo Tetris and games which require a proper section size in games such as Retro City Rampage. This fixes causes various games to start rendering or trying to render
* | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |
* | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-202-2/+3
| |
* | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | * Implement GetAvailableLanguageCodes2 * Revert "Implement GetAvailableLanguageCodes2" This reverts commit caadd9eea3497ae2a13382aecb8ca29e1c02c5af. * Implement GetAvailableLanguageCodes2 * Implement GetAvailableLanguageCodes2
* | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| |
* | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| |
* | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
| |
* | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
|/
* Common/string_util: add StringFromBuffer functionmailwl2018-06-071-22/+9
| | | | convert input buffer (std::vector<u8>) to string, stripping zero chars
* Merge pull request #522 from mailwl/mm-ubunnei2018-06-073-0/+81
|\ | | | | Service/MM: add service and stub some functions
| * Remove unused header filesmailwl2018-06-061-2/+0
| |
| * Small fixesmailwl2018-06-052-6/+8
| |
| * Service/MM: add service and stub some functionsmailwl2018-06-053-0/+81
| |
* | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ | | | | | | Service/nfp:user : stub some functions.
| * | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| | |
| * | Correct function resultsmailwl2018-06-041-4/+16
| | |
| * | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
| | | | | | | | | | | | Used by Zelda: BoTW
* | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add IoctlCommands with their params in nvidia_ctrl_gpu.h * add function related to the changes done previously * fix clang-format * delete trailing whitespace * correct mistake
* | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| | |
* | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| |/ |/|
* | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add some IoctlCommand with their params to nvhost_gpu * fix clang-format * delete trailing whitespace * fix some clang-format * delete one other trailing whitespace * last clang-format fix
* | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
| |
* | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
| |
* | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
|/
* am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
|
* am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
|
* am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
|
* am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
|
* Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-033-0/+72
|\ | | | | Services/nvdrv: add '/dev/nvhost-nvdec' device
| * Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-303-0/+72
| |
* | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
| |
* | add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-301-0/+30
| | | | | | | | | | | | | | | | | | | | * add some CommandType * add some hid FunctionInfo * add some other HID FunctionInfo * delete non useful comments
* | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| |
* | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
|/
* Service/BCAT: add module and servicesmailwl2018-05-285-0/+114
|
* Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ | | | | NvOsGetConfigU32 should return null instead of 0 for default output value
| * NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| |
* | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
|/
* Add & correct miscellaneous things (#470)greggameplayer2018-05-263-4/+52
| | | | | | | | | | | | * add some InfoType * correct OpenApplicationProxy cmd number * add IDisplayController functions * fix clang-format * add more system languages
* Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ | | | | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUT
| * Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
| | | | | | | | Used in Nintendo Labo ToyCon 1&2
* | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetAudioRendererWorkBufferSize impl Impl of GetAudioRendererWorkBufferSize based on RE, if this can be cleaned up, please contribute! * Naming conventions * Removed unneeded placeholder * lioncache changes * fixed const * switched to Common::AlignUp
* | Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ | | We have no clue on what this actually does yet so stubbing it since it's just input only should be fine for now
* Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
| | | | Games such as SMO deadlock if we have more than 2 layouts
* change some functionsgreggameplayer2018-05-231-6/+6
| | | according to the changes made previously
* correct placement and add size checkgreggameplayer2018-05-231-21/+25
|
* Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
|
* Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
| | | | | | | | | | * Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE struct + 4 seems to be hard coded at 0 and struct + 0 seems to be ignored? * IocGetWaitbase -> IocChannelGetWaitbaseCommand * Added super late fixes
* Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-214-1/+98
|\ | | | | Implemented nvhost-as-gpu's UnmapBuffer and nvmap's Free ioctls.
| * GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| | | | | | | | It releases a reference to an nvmap object
| * GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-202-0/+50
| | | | | | | | It removes a mapping previously created with the MapBufferEx ioctl.
* | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add unknown function at the number command 2 * correct audout:u commands numbers * correct audrec:u cmd number & add Unknown function * correct IAudioDevice command numbers * correct codecctl cmd numbers & rename the 8 function * correct place of unknown function & fix clang-format
* | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ | | | | | | Properly rename functions of Fatal Module & add ThrowFatal to this module
| * | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| | |
| * | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| | |
| * | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/
* | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-201-0/+2
|\ \ | | | | | | Added IPC RequestWithContext & ControlWithContext
| * | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-171-0/+2
| |/
* / Updated nfp with more service namesHexagon122018-05-131-24/+24
|/
* More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|
* Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
| | | | | | | | | | * Stubs for QLaunch * Wiped unrelated stuff * Addressed comment * Dropped GetPopFromGeneralChannelEvent
* hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-072-68/+220
| | | | | | | | | | | | | | * hid: Update mouse/keyboard state * hid: Working analog sticks * hid: Nits * hid: Nits * hid: Update mystery sections * hid: Tweaks
* general: Make formatting of logged hex values more straightforwardLioncash2018-05-0214-24/+24
| | | | | | This makes the formatting expectations more obvious (e.g. any zero padding specified is padding that's entirely dedicated to the value being printed, not any pretty-printing that also gets tacked on).
* Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ | | | | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.
| * GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
| |
* | GetSharedFontInOrderOfPriority (#381)David2018-05-012-1/+27
|/ | | | | | | | | | | | | | | | | | | | * GetSharedFontInOrderOfPriority * Update pl_u.cpp * Ability to use ReadBuffer and WriteBuffer with different buffer indexes, fixed up GetSharedFontInOrderOfPriority * switched to NGLOG * Update pl_u.cpp * Update pl_u.cpp * language_code is actually language code and not index * u32->u64 * final cleanups
* core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-305-7/+8
| | | | All of these variables and functions are related to timings and should be within the namespace.
* string_util: Remove StringFromFormat() and related functionsLioncash2018-04-301-3/+2
| | | | Given we utilize fmt, we don't need to provide our own functions for formatting anymore
* am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
|
* set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
|
* general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-272-3/+3
|
* Switched to NGLOG_WARNINGDavid Marcec2018-04-273-4/+4
|
* Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-2643-341/+455
|\
| * Service/PCTL: convert to module, add services, stubmailwl2018-04-256-37/+69
| | | | | | | | PCTL::CreateServiceWithoutInitialize and IParentalControlService::Initialize, required by Kirby Star Allies
| * service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| |
| * vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| |
| * time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| |
| * ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| |
| * spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| |
| * sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| |
| * sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| |
| * set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| |
| * pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| |
| * nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| |
| * nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| |
| * ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| |
| * nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| |
| * nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| |
| * lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| |
| * hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| |
| * friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| |
| * filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| |
| * fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| |
| * audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| |
| * apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| |
| * aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| |
| * am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| |
| * acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
| |
| * Service/FS: implement IFileSystem::RenameFilemailwl2018-04-241-1/+21
| |
| * Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-232-4/+8
| |\ | | | | | | Kernel: Reworked the new kernel synchronization primitives.
| | * Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-212-4/+8
| | |
| * | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
| |\ \ | | | | | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.
| | * | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| | | | | | | | | | | | | | | | Also added a consistency check and a comment for the case when the object id is different than its handle. The real nvservices doesn't make a distinction between ids and handles, each object gets an unique handle which doubles as its id.
| | * | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | | | | | | | | | | | | | | | It takes a previously-reserved (AllocateSpace) GPU memory address and maps it to the address of the nvmap object passed to Remap.
| * | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ /
* | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-262-13/+2
| | |
* | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-239-25/+63
| | |
* | | lioncash proposed changesDavid2018-04-221-2/+2
| | |
* | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2210-11/+107
|/ /
* | core: Relocate g_service_manager to the System classLioncash2018-04-214-32/+32
| | | | | | | | | | Converts the service manager from a global into an instance-based variable.
* | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ | |/ |/| Service/VI: stub SetLayerVisibility, fix GetDisplayResolution output
| * Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
| | | | | | | | | | both SetLayerVisibility() functions used in Lego games, GetDisplayResolution() fixed according switchbrew.org
* | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ | | | | | | service: Use nested namespace specifiers where applicable
| * | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| | | | | | | | | | | | Tidies up namespace declarations
* | | vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ /
* / nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
|/
* Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1712-3/+199
| | | | | | | | | | | | | | | | * Updated ACC with more service names * Updated SVC with more service names * Updated set with more service names * Updated sockets with more service names * Updated SPL with more service names * Updated time with more service names * Updated vi with more service names
* Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ | | | | pl_u: Use empty shared font if none is available.
| * pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
| | | | | | | | - Makes games work in lieu of shared_font.bin.
* | fsp_srv: Implement DeleteFile.bunnei2018-04-151-1/+15
|/ | | | - Used by Binding of Isaac.
* fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
|
* Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ | | | | Service/HID: Stubbed out GetPlayerLedPattern
| * Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
| |
* | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
|/
* Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ | | | | Various service name fixes - part 1
| * Various fixes and clangHexagon122018-04-116-115/+108
| |
| * Decimal changeHexagon122018-04-101-4/+4
| |
| * Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| |
| * Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| |
| * Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| |
| * Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| |
| * Updated hid with more service names.Hexagon122018-04-101-0/+50
| |
| * Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| |
| * Updated the unknown nameHexagon122018-04-101-1/+1
| |
| * Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| |
| * Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| |
| * Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| |
| * Updated audren with more service names.Hexagon122018-04-101-10/+14
| |
| * Updated audrec with more service names.Hexagon122018-04-101-7/+9
| |
| * Updated audout with more service names.Hexagon122018-04-101-13/+16
| |
| * Updated audin with more service names.Hexagon122018-04-101-9/+16
| |
| * Updated AOC with more service names.Hexagon122018-04-101-0/+1
| |
| * Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| |
| * Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| |
| * Updated AM with more service names.Hexagon122018-04-101-2/+82
| |
* | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
| |
* | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1010-127/+336
|/
* Fix spelling of InitializeJames Rowe2018-04-072-3/+3
|
* audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
|
* audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
|
* nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
|
* vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
|
* service: Add friend:u interface.bunnei2018-04-033-0/+39
|
* externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-021-6/+6
| | | | | | | | | | | Versions prior to this didn't compile on OpenBSD due to unconditional use of the non-standard strtod_l() function. The fmt::MemoryWriter API has been removed in the intervening versions, so replace its use with fmt::memory_buffer and fmt::format_to. The library also no longer provides the fmt::fmt ALIAS, so define it in externals/CMakeLists.txt.
* Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ | | | | hid: Write empty touch screen state.
| * hid: Write empty touch screen state.bunnei2018-04-011-5/+21
| |
* | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-011-2/+2
| |
* | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| |
* | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-311-2/+21
|/
* audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
|
* service: Add NFP module interface.bunnei2018-03-305-0/+95
| | | | | | service: Initialize NFP service. Log: Add NFP service as a log subtype.
* config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-271-5/+5
|
* config: Add setting for whether the system is docked or not.bunnei2018-03-271-2/+6
|
* Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ | | | | Minor changes to VI, PL, HID, and AUDREN
| * audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| |
| * hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| |
| * pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
| |
* | Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-257-30/+92
|/
* Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-242-6/+7
|\ | | | | Tegra progress 2
| * renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-231-6/+0
| |
| * renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-232-3/+3
| |
| * nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| | | | | | | | - Workaround for texture forwarding until we have a better place.
| * video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-231-3/+3
| |
* | Merge pull request #255 from Subv/sd_cardbunnei2018-03-243-2/+106
|\ \ | | | | | | FS: Implemented access to the SD card
| * | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-211-0/+15
| | |
| * | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| | | | | | | | | | | | Note that the filter parameter is not yet implemented.
| * | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| | |
| * | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| | |
| * | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-202-0/+6
| | |
* | | Service/SSL: add ssl servicemailwl2018-03-233-0/+41
| | |
* | | Service/spl: add module and servicesmailwl2018-03-227-0/+168
| |/ |/|
* | Service/vi: convert services to modulemailwl2018-03-218-212/+160
| |
* | Service: add fatal:u, fatal:p servicesmailwl2018-03-207-0/+138
| |
* | Clang FixesN00byKing2018-03-191-2/+2
| |
* | oopsN00byKing2018-03-191-3/+3
| |
* | Clean Warnings (?)N00byKing2018-03-195-7/+7
|/
* vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
|
* hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-191-2/+1
|
* nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
|
* IGeneralService: fix function listmailwl2018-03-161-2/+3
|
* Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
|
* Service/NIFM: convert to modulemailwl2018-03-168-122/+75
|
* core: Move process creation out of global state.bunnei2018-03-142-6/+7
|
* Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-045-2/+55
|\ | | | | FS: Make EnsureSaveData create the save data if it doesn't already exist.
| * FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| |
| * FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-043-2/+40
| |
* | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/
* Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called
| * Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
| | | | | | | | | | This prevents a thread starvation issue in Puyo Puyo Tetris. We should hwtest this behavior and figure out where exactly this event is signaled.
* | Service/Set: add more servicesmailwl2018-03-0311-10/+340
|/
* FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
|
* Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-022-2/+10
|
* Merge pull request #212 from mailwl/stubsbunnei2018-02-248-7/+99
|\ | | | | Stub some functions
| * Stub more functionsmailwl2018-02-226-7/+79
| |
| * Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-224-0/+20
| |
* | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
|/
* time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
|
* Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-2/+26
|\ | | | | Service/AOC: stub ListAddOnContent function
| * Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-2/+26
| |
* | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
| |
* | service: Add Friend service interface.bunnei2018-02-195-0/+96
|/
* AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
| | | | | The values are still unknown and the function is still considered a stub. Puyo Puyo Tetris now tries to call fsp-srv:MountSaveData.
* Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ | | | | Make the fence handling in Vi a little less of a hack.
| * nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| | | | | | | | Games like Puyo Puyo Tetris and BOTW seem to depend on the buffer always having the same handle
| * Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| |
| * Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| |
| * Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| | | | | | | | This may break libnx homebrew due to a bug in libnx but is required by official games since they always assume that the buffer will be there.
| * nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| |
| * Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| |
| * Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| |
| * Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| |
| * Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
| |
* | Service/hid: stub some functionsmailwl2018-02-162-1/+45
| |
* | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-155-0/+178
| |
* | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/
* Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-158-108/+39
|\ | | | | Refactor IPC buffer descriptor interface
| * service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| |
| * audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| |
| * vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| |
| * nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| |
| * vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| |
| * vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
| |
* | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
| |
* | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| |
* | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| |
* | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
| |
* | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
| |
* | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| |
* | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
|/
* audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
| | | | | | * audren_u: Schedule reoccuring event. * audren_u: Stub GetAudioRenderersProcessMasterVolume, and misc. changes.
* Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\ | | | | VI cleanup and add a hack for booting games
| * vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| |
| * vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| |
| * TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
| |
* | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
|/
* Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\ | | | | Stub RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer
| * Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
| |
* | Merge pull request #178 from Subv/command_buffersbunnei2018-02-127-172/+18
|\ \ | |/ |/| GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines
| * Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-127-181/+15
| | | | | | | | Also moved the GPU MemoryManager class to video_core since it makes more sense for it to be there.
| * GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-123-3/+5
| |
| * nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
| |
* | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
| |
* | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/
* fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
|
* apm: Refactor service impl. to support multiple ports.bunnei2018-02-104-58/+100
|
* vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
|
* nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
|
* IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
| | | | - Another fix for libnx.
* IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
|
* nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
|
* IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
|
* nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
|
* acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
|
* nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
|
* nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-082-0/+160
|
* nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
|
* nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
|
* Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
|
* Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
|
* Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-063-2/+22
|\ | | | | Stubs for HID, AM, and a mutex fix
| * hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| |
| * IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
| |
* | Extra nvdrv support (#162)David2018-02-0616-37/+761
|/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * FinishInitalize needed for 3.0.1+ games * nvdrv:s and nvdrv:t both use NVDRV * Most settings return 0 on hardware, disabled NV_MEMORY_PROFILER for now. NVN_THROUGH_OPENGL & NVRM_GPU_PREVENT_USE are a few interesting settings to look at. Carefully choosing settings can help with drawing graphics later on * Initial /dev/nvhost-gpu support * ZCullBind * Stubbed SetErrorNotifier * Fixed SetErrorNotifier log, Added SetChannelPriority * Allocate GPFIFO Ex2, Allocate Obj Ctx, Submit GPFIFO * oops * Fixed up naming/structs/enums. Used vector instead of array for "gpfifo_entry" * Added missing fixes * /dev/nvhost-ctrl-gpu * unneeded struct * Forgot u32 in enum class * Automatic descriptor swapping for ioctls, fixed nvgpu_gpu_get_tpc_masks_args being incorrect size * nvdrv#QueryEvent * Renamed logs for nvdrv * Refactor ioctl so nv_result isn't needed * /dev/nvhost-as-gpu * Fixed Log service naming, CtxObjects now u32, renamed all structs, added static_asserts to structs, used INSERT_PADDING_WORDS instead of u32s * nvdevices now uses "Ioctl" union, * IoctlGpfifoEntry now uses bit field * final changes
* Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
|
* set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
|
* nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
| | | | - This gets BOTW booting.
* logger: Add Time service logging category.bunnei2018-02-051-10/+10
|
* logger: Add SET service logging category.bunnei2018-02-051-1/+1
|
* logger: Add PCTL service logging category.bunnei2018-02-051-1/+1
|
* logger: Add LM service logging category.bunnei2018-02-051-2/+2
|
* logger: Add APM service logging category.bunnei2018-02-051-2/+3
|
* lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
|
* logger: Add NIFM service logging category.bunnei2018-02-054-11/+11
|
* logger: Add VI service logging category.bunnei2018-02-054-21/+20
|
* hid: Stub out several functions.bunnei2018-02-051-1/+39
|
* hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
|
* logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
|
* logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
|
* logger: Add AM service logging category.bunnei2018-02-043-42/+42
|
* logger: Add "account" service logging category.bunnei2018-02-041-8/+8
|
* acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
|
* acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|
* Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\ | | | | controller: DuplicateSession should return a ClientSession.
| * controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
| |
* | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-039-0/+370
|/
* Service/am: Add AppletAE service (#153)mailwl2018-02-026-379/+569
| | | | | | * Add AppletAE, step 1: move common interfaces to am.h * Add AppletAE, step 2
* Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\ | | | | vi::CreateStrayLayer : add padding to request
| * vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
| |
* | Services/vi: add vi:s and vi:u servicesmailwl2018-02-025-0/+124
|/
* [WIP] sfdnsres: stub (#146)mailwl2018-01-304-2/+51
| | | sfdnsres: Add several stubs
* time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
|
* audout_u: Various cleanups.bunnei2018-01-251-29/+17
|
* ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-252-2/+3
|
* time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
|
* hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2517-107/+107
|
* service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
|
* hle: Integrate Domain handling into ServerSession.bunnei2018-01-251-7/+5
|
* hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-251-1/+0
|
* audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-14/+166
| | | | | | | | | | | | | | | | | | | | | | * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * audout:u OpenAudioOut implementation and IAudioOut cmd 1,2,3,4,5 implementation * using an enum for audio_out_state as well as changing its initialize to member initializer list * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * added missing Audio loggin subclass, minor fixes, clang comment breakline * Solving backend logging conflict * minor fix * Fixed duplicated Service NVDRV in backend.cpp, my bad
* Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
|
* Merge pull request #135 from Subv/no_portsbunnei2018-01-234-61/+62
|\ | | | | IPC: Don't create unnecessary ports when returning sub interfaces.
| * Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| |
| * Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| |
| * HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| |
| * LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| |
* | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ | |/ |/| AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the default display.
| * AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| | | | | | | | This function is used by libnx to obtain a new layer.
| * AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| | | | | | | | It'll be needed when we implement CreateManagedDisplayLayer.
| * Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
| | | | | | | | It is now created during Service initialization and passed to all the services that need it.
* | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ | |/ |/| Stub OpenAudioOut and fix a issue with HID IAppletResource
| * Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
| |
* | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-228-363/+448
|/
* Added stubs for audio services. (#116)st4rk2018-01-2211-5/+299
| | | | | | * stubs for audout:u, audin:u, audrec:u, audren:u, codecctl and decoding tables with nullptr for future implementations * fixing the changes requested (remove private, explicit)
* Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ | | | | nvmap: Make IoctlCommands an enum class
| * nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| | | | | | | | This macro resolves to an empty macro in release builds.
| * nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
| | | | | | | | Prevents the enum values from polluting the surrounding scope
* | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-217-5/+158
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid * used clang-format-3.9 instead * lowercase pid * Moved nvmemp handlers to cpp * Removed unnecessary logging for NvOsGetConfigU32. Cleaned up log and changed to LOG_DEBUG * using std::arrays instead of c arrays * nvhost get config now uses std::array completely * added pid logging back * updated cmakelist * missing includes * added array, removed memcpy * clang-format6.0
* | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ | | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.
| * | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| |/
* | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-213-48/+72
| |
* | filesystem: Implement basic IStorage functionality.David Marcec2018-01-215-0/+254
|/
* service/time: remove accidental #pragmastgsm2018-01-212-4/+0
|
* Format: Run the new clang format on everythingJames Rowe2018-01-214-5/+7
|
* Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-201-0/+1
| | | | | | | | | | | | * Added svcCreateSharedMemory * Services which are not implemented now throw UNIMPLEMENTED() * clang-format * changed perms to u32 * removed camelcase
* Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-201-1/+1
| | | | | | | | * Fixes some cast warnings, partially fixes citra #3064 * Converted casts to uint32_t to u32 * Ran clang-format
* Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ | | | | ISelfController: Stub LockExit and UnlockExit
| * ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
| |
* | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-197-0/+159
|/ | | | | | | | | | | | | | * Stubs for various acc:u0 funcs needed * Stub for GetDesiredLanguage in IApplicationFunctions * Add set service + stubs needed for games * Fix formatting * Implement IProfile, IManagerForApplication, return bool in CheckAvailability, style fixes * Remove IProfile::Get(needs more research), fix IPC response sizes
* Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-192-0/+13
|\ | | | | Fix svcGetInfo for libnx
| * nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| |
* | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ | | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.
| * | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
| | |
* | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
| | |
* | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ /
* / Fix dispdrv typogdkchan2018-01-191-1/+1
|/
* Merge pull request #100 from Rozelette/masterbunnei2018-01-196-32/+109
|\ | | | | time: Refactor time:* to use a single shared module
| * time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| |
| * time: Refactor time:* to use a single shared moduleRozlette2018-01-186-26/+103
| |
* | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-181-0/+86
| | | | | | | | | | | | | | | | | | | | * Stub PopLaunchParameter and implement Buffer C Descriptors reading * Address PR feedback * Ensure we push a u64 not a size_t * Fix formatting
* | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-186-0/+154
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * run clang-format (2)
* | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ | |/ |/| lm: Minor logging fix to skip a byte.
| * lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
| |
* | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ | | | | | | vi: Minor clean up/correctness changes
| * | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| | | | | | | | | | | | Prevents implicit conversions.
| * | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| | |
* | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ | |_|/ |/| | vi: Copy data directly into the std::vector within Parcel's ReadBlock function
| * | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ | | | | | | | | Previously this would unnecessarily zero-initialize the vector before copying the actual data into the vector instance.
* / controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
|/
* TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-174-83/+164
|
* Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ | | | | hid: Adjust timing based on actual hardware
| * hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
| |
* | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
|/
* Merge pull request #60 from jroweboy/game-framebunnei2018-01-171-0/+3
|\ | | | | UI: Fix frame rate perf stats
| * UI: Fix frame rate perf statsJames Rowe2018-01-171-0/+3
| | | | | | | | Adds in a missing EndGameFrame when nvdrv swaps buffers
* | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ | |/ |/| hid: Write to all layouts, implement circular buffers, set up controller metadata.
| * hid: clang-formatshinyquagsire232018-01-171-3/+3
| |
| * hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| |
| * hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
| |
* | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-175-0/+82
| |
* | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
| |
* | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-173-14/+16
| |
* | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
| |
* | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
| |
* | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
| | | | | | | | | | | | # Conflicts: # src/core/hle/service/am/applet_oe.cpp # src/core/hle/service/apm/apm.cpp
* | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
| |
* | Merge pull request #52 from ogniK5377/fspbunnei2018-01-171-0/+53
|\ \ | | | | | | added more svcGetInfo pairs for 3.0.0+ support, Changed HEAP_SIZE and TLS_AREA_VADDR. changed mem usage & heap usage stub added, ISelfController, IApplication function stubs. Added SetThreadCoreMask
| * | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| |/
* / clang-formatMerryMage2018-01-162-2/+2
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
|
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
|
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
|
* Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-152-0/+398
|\ | | | | HID Sharedmem Impl Start
| * hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| |
| * hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| |
| * hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
| |
* | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/
* Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
|
* renderer: Render previous frame when no new one is available.bunnei2018-01-151-1/+4
|
* lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
|
* time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-155-1/+117
|
* audio: Add files to CMake.bunnei2018-01-151-1/+0
|
* hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
|
* audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
|
* hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
|
* yuzu: Update license text to be consistent across project.bunnei2018-01-1335-35/+35
|
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-131-2/+0
|
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-134-249/+0
|
* core: Include <algorithm> where used.bunnei2018-01-122-0/+4
|
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
|
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
|
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
|
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1110-166/+423
|
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
| | | | This prevents missing frames if the vblank fires between the DequeueBuffer and Wait(vsync) calls
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
|
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
| | | | | | NVFlinger will call into the nvdisp_disp0 device to perform screen flips, bypassing the ioctl interface. We now have the address of the framebuffer to draw, we just need to actually put it on the screen.
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
| | | | | | Don't try to draw buffers that the guest application is using, only queued buffers are eligible for drawing. Drawing actual pixels is still not implemented.
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
|
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
|
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
|
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-115-0/+718
| | | | The homebrew display test application now properly writes graphics data to the graphics buffer but we still don't have a way to compose the display layers.
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
|
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
|
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
|
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
|
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
|
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
|
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-071-2/+2
|
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
|
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-071-2/+2
| | | | They should have 32 bits of padding after the error code now.
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-074-4/+4
| | | | Popping objects from the buffer is still not implemented.
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-071-14/+3
| | | | Service code now doesn't have to deal with this.
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
|
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
|
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
|
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
|
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
|
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-293-24/+9
|
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
|
* service: Add empty interface for pctl:a.bunnei2017-12-295-0/+86
|
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
|
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
|
* service: Add empty interface for aoc:u.bunnei2017-12-283-0/+42
|
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-012-3/+5
|
* hle: Use Switch formatted result codes.bunnei2017-11-011-13/+5
|
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
|
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
|
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
|
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-155-27/+40
|
* hle: Add service stubs for apm and appletOE.bunnei2017-10-159-2/+130
|
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1510-432/+283
|
* Remove more 3DS-specific code.bunnei2017-10-134-45/+0
|
* Remove more 3DS-specific code.bunnei2017-10-135-1411/+1
|
* Remove more 3DS-specific code.bunnei2017-10-131-9/+0
|
* Remove lots more 3DS-specific code.bunnei2017-10-1324-4161/+6
|
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10173-20703/+2
|
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-1038-408/+1544
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/CMakeLists.txt # src/core/arm/dynarmic/arm_dynarmic.cpp # src/core/arm/dyncom/arm_dyncom.cpp # src/core/hle/kernel/process.cpp # src/core/hle/kernel/thread.cpp # src/core/hle/kernel/thread.h # src/core/hle/kernel/vm_manager.cpp # src/core/loader/3dsx.cpp # src/core/loader/elf.cpp # src/core/loader/ncch.cpp # src/core/memory.cpp # src/core/memory.h # src/core/memory_setup.h
| * Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| |
| * Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ | | | | | | HLE/APT: Always set up the APT parameter when starting a library applet.
| | * HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| | | | | | | | | | | | | | | | | | | | | | | | Only use the HLE interface if an HLE applet with the desired id was started. This commit reorganizes the APT code surrounding parameter creation and delivery to make it easier to support LLE applets in the future. As future work, the HLE applet interface can be reworked to utilize the same facilities as the LLE interface.
| * | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| | | | | | | | | | | | | | | Implementation verified by reverse engineering. This lets the Home Menu boot without crashing on startup.
| * | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| | | | | | | | | Services/UDS: Handle the rest of the connection sequence.
| * | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ | | | | | | | | Implement PrepareToStartNewestHomeMenu and fixed an APT regression.
| | * | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | | | | | | | | | | | | | | | | | | | As per 3dbrew: "During Home Menu start-up it uses APT:PrepareToStartNewestHomeMenu. If that doesn't return an error(normally NS returns 0xC8A0CFFC for that), Home Menu starts a hardware reboot with APT:StartNewestHomeMenu etc. "
| | * | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | |/ | | | | | | | | | | | | We need to know what is being run so we can set the APT parameter destination AppId correctly. Delaying the preparation of the parameter until we know which AppId is running lets us support booting both the Home Menu and normal game Applications.
| * | Fixed type conversion ambiguityHuw Pascoe2017-09-309-19/+21
| | |
| * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-252-1/+24
| | | | | | | | | | | | | | | | | | | | | | | | The loaders now register each loaded ROM with the SelfNCCH factory, which keeps the data around for the duration of the emulation session. When opening the SelfNCCH archive, the factory queries the current program's programid and uses that as a key to the map that contains the NCCHData structure (RomFS, Icon, Banner, etc). 3dsx files do not have a programid and will use a default of 0 for this value, thus, only 1 3dsx file with RomFS is loadable at the same time.
| * | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \ | | | | | | | | HLE/SRV: Implemented RegisterService.
| | * | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | |/ | | | | | | | | | Now system modules can do more than just crash immediately on startup.
| * / Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Added a function to generate the EAPoL-Start packet body. * Services/UDS: Added filter for beacons. * Services/UDS: Lock a mutex when accessing connection_status from both the emulation and network thread. * Services/UDS: Handle the Association Response frame and respond with the EAPoL-Start frame. * fixup: make use of current_node, changed received_beacons into a list, mutex and assert corrections * fixup: fix damn clang-format
| * Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-166-40/+73
| |\ | | | | | | Services/NS: Port ns:s to the new service framework.
| | * Services/NS: Port ns:s to the new service framework.Subv2017-09-166-40/+73
| | |
| * | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ | | | | | | | | APT: load different shared font depending on the region
| | * | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| | | |
| * | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-056-53/+287
| |\ \ \ | | |/ / | |/| | Services/UDS: Handle beacon frames and the basic AP connection sequence frames.
| | * | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | | |
| | * | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | | | | | | | | | | | | | | | There is currently no stage tracking, a client is considered "Connected" when it receives the EAPoL Logoff packet from the server, this is not yet implemented.
| | * | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | | |
| | * | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-274-11/+142
| | | |
| * | | HID: use TouchDevice for touch padwwylele2017-08-241-4/+8
| | |/ | |/|
| * | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-201-5/+27
| |\ \ | | | | | | | | Refactor MotionEmu into a InputDevice
| | * | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | | |
| | * | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-111-5/+27
| | | |
| * | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ | | | | | | | | | | dsp_dsp: Remove size assertion in LoadComponent
| | * | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| | | | |
| * | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ | | |_|/ / | |/| | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System)
| | * | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | | | |
| | * | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / | | | | | | | | | | | | This gives each applet type its own set of events as per the real NS module.
| * | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ | | | | | | | | | | HID: zero unused PadState bits
| | * | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | |/ /
| * | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-091-1/+1
| |\ \ \ | | | | | | | | | | Update CryptoPP (byte ambiguity)
| | * | | Update cryptoppJames2017-08-081-1/+1
| | |/ /
| * / / Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ /
| * | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| | |
| * | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ | | | | | | | | Services/APT: Corrected the behavior of the Receive/Send/Glance/CancelParameter functions
| | * | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | | |
| | * | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | | |
| | * | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | | |
| | * | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | | |
| | * | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | | |
| | * | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | | |
* | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-301-1/+1
|/ / /
* | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-223-9/+8
|\ \ \ | |/ / |/| | Add address conversion functions returning optional, Add function to flush virtual region from rasterizer cache
| * | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-222-8/+7
| | | | | | | | | | | | | | | | | | This is slightly more ergonomic to use, correctly handles virtual regions which are disjoint in physical addressing space, and checks only regions which can be cached by the rasterizer.
| * | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-221-1/+1
| | | | | | | | | | | | And fix a few places in the code to take advantage of that.
* | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
| | |
* | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-162-22/+138
|\ \ \ | | | | | | | | load shared font from system archive
| * | | apt: load shared font from system archivewwylele2017-06-261-20/+134
| | | |
| * | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| |/ /
* | / Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| |/ |/|
* | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-273-1/+432
|\ \ | |/ |/| Services/UDS: Stub SendTo to generate the unencrypted data frames with the right headers
| * UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| |
| * UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-261-4/+1
| |
| * UDS: Run clang-format.Subv2017-06-263-51/+55
| |
| * UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| | | | | | | | The responsibility of encryption and encapsulation into an 802.11 MAC frame will fall into the callers of GenerateDataPayload.
| * UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| | | | | | | | It is likely that these 4 bytes are actually a different header, part of some protocol that encapsulates the SecureData protocol.
| * UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| |
| * UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-153-1/+259
| |
* | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2119-46/+46
|\ \ | | | | | | Remove ResultVal::MoveFrom
| * | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1919-46/+46
| |/ | | | | | | | | Replace it with std::move(result_val).Unwrap(), or Foo().Unwrap() in case you already have an rvalue.
* | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \ | | | | | | UDS: Added a hook for updating the connection status when a client connects to the network.
| * | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| |/
* / Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-191-2/+1
|/
* Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
| | | | | | | | | | * Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. This lets the application know that the host was successfully added to the session. * Services/UDS: Reset the connection status when destroying the network * Services/UDS: Reset the connection status's bitmask of changed nodes after reporting it to the game.
* Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-111-12/+5
|
* Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
|
* ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-111-6/+20
| | | | | | Copy the IPC command buffer to/from the request context before/after the handler is invoked. This is part of a move away from using global data for handling IPC requests.
* Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-096-57/+312
|\ | | | | New service framework
| * Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| |
| * Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| |
| * Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-082-1/+232
| | | | | | | | | | | | | | | | | | | | | | | | The old "Interface" class had a few problems such as using free functions (Which didn't allow you to write the service handler as if it were a regular class.) which weren't very extensible. (Only received one parameter with a pointer to the Interface object.) The new ServiceFramework aims to solve these problems by working with member functions and passing a generic context struct as parameter. This struct can be extended in the future without having to update all existing service implementations.
* | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ | |/ |/| Services/UDS: Implement DecryptBeaconData.
| * Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
| | | | | | | | This function decrypts the encrypted data tags contained in the 802.11 beacon frames.
* | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0631-12/+79
| | | | | | | | | | This has a huge fallout in terms of needing to fix other files because all service implementations included that file.
* | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-065-24/+145
| | | | | | | | Also enhances the GetServiceHandle implementation to be more accurate.
* | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
| | | | | | | | | | An Event was used way back then when we didn't have proper working semaphores. Our Semaphore implementation is good enough now.
* | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-063-7/+8
| | | | | | | | | | This will contain the implementation of the sm (Service Manager) system module.
* | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-064-29/+37
| | | | | | | | | | | | This allows attaching a HLE handle to a ServerPort at any point after it is created, allowing port/session creation to be generic between HLE and regular services.
* | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-065-58/+8
| | | | | | | | | | Most of the code that works with this is or will be in the kernel, so it's a more appropriate place for it to be.
* | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-031-1/+2
| | | | | | | | | | - Deleted GetStatus() because it wasn't used anywhere outside of Core::System. - Fixed design flaw where the message bar status could be set despite the game being stopped.
* | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-031-2/+1
| |
* | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-031-52/+2
| |
* | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-032-7/+53
| |
* | Made some changes from review comments:TheKoopaKingdom2017-06-032-9/+6
| | | | | | | | | | | | | | | | - Made LoadKernelSystemMode return a pair consisting of a system mode and a result code (Could use review). - Deleted ErrorOpenGL error code in favor of just having ErrorVideoCore. - Made dialog messages more clear. - Compared archive ID in fs_user.cpp to ArchiveIdCode::NCCH as opposed to hex magic. - Cleaned up some other stuff.
* | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-033-2/+12
| |
* | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \ | | | | | | CAM: use IPCHelper
| * | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| | |
| * | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| | |
| * | cam: use IPCHelperwwylele2017-05-241-278/+238
| | |
* | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-302-1/+2
| |/ |/|
* | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-281-1/+1
| |
* | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| |
* | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-255-14/+5
| |
* | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-251-14/+23
| |
* | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-254-23/+19
| |
* | result: Make error description a generic integerYuri Kunde Schlesner2017-05-252-3/+4
|/ | | | | | | | | It is now known that result code description vary depending on the module, and so they're best defined on a per-module basis. To support this, allow passing in an arbitrary integer instead of limiting to the ones in the ErrorDescription enum. These will be gradually migrated to their individual users, but a few will be kept as "common" codes shared by all modules.
* Merge pull request #2661 from Subv/uds5bunnei2017-05-194-33/+600
|\ | | | | Services/UDS: Generate 802.11 beacon frames when a network is open.
| * Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| |
| * Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| | | | | | | | | | This allows the applications to retrieve 802.11 beacon frames from nearby UDS networks. Note that the networks are still not announced anywhere.
| * Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-154-7/+535
| |
* | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
| |
* | Merge pull request #2676 from wwylele/irrstbunnei2017-05-108-23/+207
|\ \ | | | | | | ir: implement new 3ds HID via ir:rst
| * | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| | |
| * | ir: implement new 3ds HID via ir:rstwwylele2017-05-048-23/+206
| | |
* | | Create a random console_unique_id (#2668)B3n302017-05-062-5/+71
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Create a random console_id when config save_file is created Added button in system config to refresh the console unique id * Moved the connect for the button from .ui file to constructor of ConfigureSystem * Added warning and info dialog Fixup: Make use of qt5 style connects, renamed the refresh button, removed some duplicate code, changed random device and moved all to the generate function * Changed the random generator to reflect what a real 3DS stores as console unique id Fixup: Changed the warning message * Fixup: Set and Create * Fixup: Added console id label, therfore removed second message box * Fixup: fixed the endianess * Fixup: more endianness fixes * Fixup: Endianness the 3rd
* | Merge pull request #2606 from wwylele/irbunnei2017-05-044-44/+757
|\ \ | | | | | | ir: implement circle pad pro
| * | ir: implement circle pad prowwylele2017-05-034-44/+757
| | |
* | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ | | | | | | | | ldr_ro: use IPC helper
| * | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| |/ /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | |_|/ |/| | dsp_dsp: Messages are modified by service before being sent to DSP
| * | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
| | |
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | |_|/ |/| | Services/UDS: Initial support for hosting local-wlan networks.
| * | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| | |
| * | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| | |
| * | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| | |
| * | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| | |
| * | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| | |
| * | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| | | | | | | | | | | | It will be needed when generating the beacon frames.
| * | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
| | | | | | | | | | | | Currently it will let games create a network as hosts, but will not broadcast it anywhere and will not allow clients to connect.
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-064-208/+258
|\ \ \ | | | | | | | | IpcHelper enhancement and APT refactor
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| | | |
| * | | address more commentsLectem2017-03-191-20/+20
| | | |
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| | | |
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-182-37/+39
| | | |
| * | | fix #2560 and other commentsLectem2017-03-182-20/+20
| | | |
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-182-6/+4
| | | |
| * | | refactor APT service to use the new IPC helpersLectem2017-03-183-195/+246
| | | |
* | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
| | | |
* | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
| | | |
* | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / /
* | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-172-37/+56
|\ \ \ | | | | | | | | Refactor input emulation & add SDL gamepad support
| * | | Input: remove unused stuff & clean upwwylele2017-03-011-34/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | 1. removed zl, zr and c-stick from HID::PadState. They are handled by IR, not HID 2. removed button handling in EmuWindow 3. removed key_map 4. cleanup #include
| * | | HID: use AnalogDevicewwylele2017-03-011-2/+9
| | | |
| * | | HID: use ButtonDevicewwylele2017-03-012-1/+47
| |/ /
* / / cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
|/ /
* | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ | | | | | | IR: separate functions of each port to their own files
| * | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
| | |
* | | Doxygen: Amend minor issues (#2593)Mat M2017-02-273-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects a few issues with regards to Doxygen documentation, for example: - Incorrect parameter referencing. - Missing @param tags. - Typos in @param tags. and a few minor other issues.
* | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-272-0/+3
|\ \ \ | |/ / |/| | Replace built-in Profiler with indicators in status bar
| * | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-271-2/+1
| | | | | | | | | | | | More ergonomic to use and will be required for upcoming changes.
| * | Add performance statistics to status barYuri Kunde Schlesner2017-02-271-0/+3
| | |
| * | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-271-0/+1
| | |
* | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-255-6/+149
|\ \ \ | |/ / |/| | APT: implemented Wrap and Unwrap
| * | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| | |
* | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
| | | | | | | | | Fixes #2556
* | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
| | |
* | | turned clang format back onnoah the goodra2017-02-141-1/+1
|/ /
* | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-131-1/+1
|\ \ | | | | | | file_sys: change RomFS archive to Self NCCH archive
| * | loader: use self NCCH archivewwylele2017-02-131-1/+1
| | |
* | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-111-4/+0
|/ /
* | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-053-35/+40
|\ \ | | | | | | IPC helper
| * | IPC helpers exampleLectem2016-12-263-35/+40
| | |
* | | GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
| |/ |/|
* | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-303-172/+1242
|\ \ | | | | | | CAM: build the service framework with a dummy implementation
| * | CAM: implement basic camera functions with a blank camerawwylele2017-01-113-172/+1242
| |/
* | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \ | | | | | | CFG: move language override to the boot process
| * | CFG: override language setting on bootwwylele2017-01-191-36/+38
| | |
* | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
| | |
* | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \ | | | | | | | | Service/NFC: stub some functions
| * | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
| | | | | | | | | | | | | | | | Tested on: Mini-Mario & Friends - amiibo Challenge
* | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
| | | |
* | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
| | | |
* | | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-161-3/+3
| | | |
* | | | HID: manages updating itself using correct tickswwylele2017-01-162-58/+93
|/ / /
* / / GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ /
* | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-121-1/+3
|\ \ | | | | | | Implement some TODOs in the code.
| * | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
| | |
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-128-295/+418
|\ \ \ | |/ / |/| | Service/AC: add ac:i service
| * | Service/AC: add ac:i servicemailwl2016-12-308-295/+418
| | |
* | | Fix some warnings (#2399)Jonathan Hao2017-01-044-8/+6
| | |
* | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-305-0/+42
|/ / | | | | | | Fix Fatal Error in Mini-Mario & Friends - amiibo Challenge
* | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-302-2/+62
|\ \ | |/ |/| Config: auto-select region and language
| * Config: auto-select region and languagewwylele2016-12-072-2/+62
| |
* | core: Move emu_window and key_map into coreMerryMage2016-12-231-1/+1
| | | | | | | | * Removes circular dependences (common should not depend on core)
* | Service/NWM: add nwm servicesmailwl2016-12-2217-8/+301
| |
* | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-225-12/+11
|\ \ | | | | | | Core: Top-level consolidate & misc cleanup
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-221-4/+4
| | |
| * | Address clang-format issues.bunnei2016-12-221-2/+2
| | |
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-225-9/+7
| | |
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-221-4/+4
| | |
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-222-49/+92
|\ \ \ | |/ / |/| | csnd:SND: Reformat source code
| * | csnd:SND reformat source codemailwl2016-12-122-49/+92
| | |
* | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ | | | | | | | | Fix debug build from #2249
| * | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
| | | |
* | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-167-13/+79
|\ \ \ \ | | | | | | | | | | Service/CECD: Add cecd:ndm service
| * | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-157-13/+79
| | | | |
* | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ | | | | | | | | | | | | hid: Get rid of a double -> float truncation warning
| * | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / | |/| | | | | | | | | | | | | float literals need to have the 'f' prefix.
* | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-152-0/+4
|\ \ \ \ \ | | | | | | | | | | | | core: Add missing #pragma once directives where applicable
| * | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-152-0/+4
| |/ / / /
* / / / / act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / | | | | | | | | | | | | These aren't the AM services.
* | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-157-6/+38
|\ \ \ \ | |/ / / |/| | | Service/ACT: move ACT services to folder
| * | | Service/ACT: move ACT services to foldermailwl2016-12-147-6/+38
| | | |
* | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1511-64/+196
|\ \ \ \ | |/ / / |/| | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.
| * | | Fixed the codestyle to match our clang-format rules.Subv2016-12-147-32/+52
| | | |
| * | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-094-45/+15
| | | |
| * | | Kernel/IPC: Small codestyle cleanupSubv2016-12-091-1/+1
| | | |
| * | | Added a framework for partially handling Session disconnections.Subv2016-12-084-0/+32
| | | | | | | | | | | | | | | | | | | | | | | | Further implementation will happen in a future commit. Fixes a regression.
| * | | Use std::move where appropriate.Subv2016-12-084-165/+10
| | | |
| * | | Return an error code when connecting to a saturated port.Subv2016-12-051-2/+6
| | | | | | | | | | | | | | | | The error code was taken from the 3DS kernel.
| * | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| | | |
| * | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-054-22/+57
| | | | | | | | | | | | | | | | HandleSyncRequest now takes care of calling the command buffer translate function before actually invoking the command handler for HLE services.
| * | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-053-21/+21
| | | |
| * | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-011-1/+2
| | | |
| * | | Fixed the rebase mistakes.Subv2016-12-013-31/+30
| | | |
| * | | A bit of a redesign.Subv2016-12-016-46/+233
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Sessions and Ports are now detached from each other. HLE services are handled by means of a SessionRequestHandler class, Interface now inherits from this class. The File and Directory classes are no longer kernel objects, but SessionRequestHandlers instead, bound to a ServerSession when requested. File::OpenLinkFile now creates a new session pair and binds the File instance to it.
| * | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-012-4/+6
| | | | | | | | | | | | | | | | Pass the triggering ServerSession to the HLE command handler to differentiate which session caused the request.
| * | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-012-16/+8
| | | | | | | | | | | | | | | | Interface is now used by aggregation in ClientPort, to forward service commands to their HLE implementation if needed.
| * | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-011-1/+1
| | | |
| * | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-017-27/+62
| | | | | | | | | | | | | | | | | | | | | | | | | | | | All handles obtained via srv::GetServiceHandle or svcConnectToPort are references to ClientSessions. Service modules will wait on the counterpart of those ClientSessions (Called ServerSessions) using svcReplyAndReceive or svcWaitSynchronization[1|N], and will be awoken when a SyncRequest is performed. HLE Interfaces are now ClientPorts which override the HandleSyncRequest virtual member function to perform command handling immediately.
* | | | Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
| |/ / |/| |
* | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
| | |
* | | Add all services to the Service namespaceLioncash2016-12-1141-471/+376
| | | | | | | | | | | | | | | Previously there was a split where some of the services were in the Service namespace and others were not.
* | | Merge pull request #2291 from lioncash/svcbunnei2016-12-099-12/+59
|\ \ \ | | | | | | | | service: Add the cfg:nor service
| * | | service: Add cfg:nor serviceLioncash2016-12-093-0/+47
| | | |
| * | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
| | | |
* | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ | |/ / / |/| | | ptm: Use boolean instead of integral value
| * | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
| | | | | | | | | | | | | | | | The third parameter of Write is actually a bool type, not an int.
* | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
| | | | | | | | | | | | | | | | 3dbrew documents this as being the exact same as ptm:sysm
* | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
| | | | | | | | | | | | | | | | | | | | 3dbrew indicates that all services have access to these commands except for ptm:sets.
* | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
| | | | | | | | | | | | | | | | Inheriting from Service::Interface makes this obvious.
* | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-085-0/+86
| | | |
* | | | service: Add mvd and qtm servicesLioncash2016-12-0813-0/+259
| | | | | | | | | | | | | | | | | | | | | | | | Adds the two New3DS-only modules. 3dbrew was used for command information.
* | | | service: Add nfc servicesLioncash2016-12-087-30/+193
| | | | | | | | | | | | | | | | 3dbrew was used for the command information.
* | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew
* | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | nim: Update function tablesLioncash2016-12-082-0/+2
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | http_c: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| | | |
* | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew
* | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| | | |
* | | | act: Update function tablesLioncash2016-12-082-0/+10
| | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
|/ / / | | | | | | | | | Updated based off information from 3dbrew.
* | / Update AM service function tablesLioncash2016-12-086-113/+246
| |/ |/| | | | | Updated based off information from 3dbrew.
* | Merge pull request #2232 from wwylele/other-savebunnei2016-12-072-2/+14
|\ \ | | | | | | FS: implement archives for other game save data
| * | FileSys: Implement OtherSaveDatawwylele2016-11-292-0/+11
| | |
| * | FS: add missing MediaTypewwylele2016-11-291-1/+1
| | |
| * | FileSys: abstract SD save data archive sourcewwylele2016-11-291-1/+2
| | |
* | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| |/ |/| | | | | | | This function doesn't need to do anything for HLE and some games call it quite often, spamming up the logs.
* | Set client SDK version to Service APIsmailwl2016-11-307-13/+86
|/
* Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-284-43/+28
|\ | | | | Correct FS error codes & add path boundary checks
| * FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-192-6/+5
| | | | | | | | According to the observation from game and 3dbrew "Used for accessing general NCCH data"
| * PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| |
| * FileSys: add SDMCWriteOnlyArchivewwylele2016-11-191-0/+8
| |
| * FileSys: make Archive interfaces return error codewwylele2016-11-011-32/+9
| | | | | | | | and make the mode parameter a reference since it is a BitField union
* | Output parameters to logmailwl2016-11-251-4/+6
| |
* | MIC_U: Stub service funcionsmailwl2016-11-252-16/+305
| |
* | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Bravely Default/Second stuck #1822 CancelLibraryApplet stub * Log parameter. * Taking care of comments * Sync with 3DBrew * White space ? * lower case
* | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ | | | | | | cfg: add config block 0x00090000
| * | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
| | |
* | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \ | | | | | | | | Rework the code of err:f service!
| * | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
| | | |
* | | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-192-7/+18
| |/ / |/| | | | | | | | Names now make sense and match 3dbrew.
* | | Style fixmailwl2016-11-021-2/+2
| | |
* | | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
| | |
* | | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
| |/ |/|
* | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \ | | | | | | NWM: stub Initialize with an error
| * | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| |/
* | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/soc_u.cpp:107:6: error: 'ENODATA' was not declared in this scope {ENODATA, 43}, ^ src/core/hle/service/soc_u.cpp:117:6: error: 'ENOSR' was not declared in this scope {ENOSR, 53}, ^ src/core/hle/service/soc_u.cpp:118:6: error: 'ENOSTR' was not declared in this scope {ENOSTR, 54}, ^ src/core/hle/service/soc_u.cpp:139:6: error: 'ETIME' was not declared in this scope {ETIME, 75}, ^
* | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
| |
* | Fix typosRicardo de Almeida Gonzaga2016-10-201-1/+1
| |
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-083-4/+1808
|\ \ | |/ |/| Update the stub code of BOSS
| * Update the stub code of BOSSJamePeng2016-10-023-4/+1808
| |
* | fs: clean up log formatwwylele2016-10-021-22/+24
| |
* | fs: implement DeleteDirectoryRecursivelywwylele2016-10-023-1/+51
|/
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-2151-51/+51
|
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-2139-107/+47
| | | | | | | This makes clang-format useful on those. Also add a bunch of forgotten transitive includes, which otherwise prevented compilation.
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-1949-282/+339
|
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-1885-2639/+2865
|
* Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\ | | | | Auto-detect original shared_font.bin memory base
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
| | | | | | | | | | This allows a file dumped from either an o3DS or a n3DS (and potentially even an original unrebased file) to be used.
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-298-97/+3007
|\ \ | | | | | | Implemented CRO
| * | LDR: Implement CROwwylele2016-08-278-97/+3007
| |/
* / fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-024-7/+7
|/
* Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\ | | | | Correct APT::0x00550040 and APT::0x00560000 function
| * Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
| |
* | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
|/
* Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-106-37/+253
|\ | | | | Implement config savegame editing & clean up
| * Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| |
| * Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| |
| * Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| |
| * Service::CFG: add missing languagewwylele2016-07-021-1/+2
| |
| * Service::CFG: name sound output modeswwylele2016-07-022-2/+7
| |
* | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-071-10/+14
|\ \ | | | | | | Fix the errorcode of archive handle
| * | Fix the errorcode of archive handleJamePeng2016-07-041-10/+14
| |/
* | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ | | | | | | HLE/FS: Document some command parameters and implemented command 0x08560240
| * | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
| | |
* | | HLE/Applets: Implement ErrEula appletmailwl2016-07-041-0/+8
| |/ |/|
* | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-291-15/+121
|\ \ | |/ |/| srv: Update according 3dbrew
| * Fix parameter name in EnableNotificationmailwl2016-05-311-2/+2
| |
| * Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| |
| * remove ugly functionmailwl2016-05-311-35/+3
| |
| * srv: Update according 3dbrewmailwl2016-05-311-15/+137
| |
* | hid: add missing headerwwylele2016-06-111-0/+2
| |
* | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-112-35/+36
|\ \ | | | | | | Refactor input mapping & implement circle pad modifier
| * | fixup! fixup! Refactor input systemwwylele2016-05-151-1/+1
| | |
| * | Refactor input subsystemwwylele2016-05-152-35/+36
| | |
* | | service: Add other DLP servicesLioncash2016-06-059-21/+142
| | | | | | | | | | | | | | | | | | Specifically, dlp::CLNT and dlp::FKCL Moves them to their own folder like with other services.
* | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-011-15/+21
| |/ |/|
* | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-309-107/+179
|\ \ | | | | | | Memory: Remove most usages of GetPointer
| * | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-281-1/+0
| | |
| * | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-282-13/+11
| | |
| * | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| | |
| * | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| | |
| * | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| | |
| * | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| | |
| * | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| | |
| * | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| | |
| * | APT: Remove use of Memory::GetPointerMerryMage2016-05-212-16/+15
| | |
* | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \ | | | | | | | | Config block: clean up
| * | | clean up config blockwwylele2016-05-031-29/+13
| | | |
* | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-241-2/+2
| | | |
* | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-248-10/+135
|\ \ \ \ | |_|/ / |/| | | Implement CheckNew3DS and CheckNew3DSApp
| * | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-208-10/+135
| | | | | | | | | | | | | | | | | | | | | | | | Append an item[is_new3ds] to config file[System] group Implement APT::SetNSStateField,it will update the unknown NS_state_field
* | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-184-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Update ACT_U * Create act_a.h * Create act_a.cpp * Add service ACT:A * Add ACT:A source and header * Fix wrong header
* | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|/ |/| |
* | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-133-66/+165
| | |
* | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
| | |
* | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-135-37/+29
| | | | | | | | | | | | | | | | | | | | | Applications can request the kernel to allocate a piece of the linear heap for them when creating a shared memory object. Shared memory areas are now properly mapped into the target processes when calling svcMapMemoryBlock. Removed the APT Shared Font hack as it is no longer needed.
* | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-071-2/+2
|\ \ \ | | | | | | | | fixup simple type conversions where possible
| * | | fixup simple type conversions where possibleAlexander Laties2016-05-071-2/+2
| | |/ | |/|
* / | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-071-0/+15
|/ /
* | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \ | | | | | | add config block 0x00170000; remove duplicated content
| * | remove duplicated function declarationwwylele2016-05-011-13/+0
| | |
| * | add config block 0x00170000wwylele2016-04-291-0/+4
| | |
* | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-301-0/+1
| | |
* | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \ | | | | | | | | Update the stub code of NDM service!
| * | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
| | | |
* | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-301-1/+25
|\ \ \ \ | | | | | | | | | | ac:u: stub CloseAsync; align memory size in svc:GetProcessInfo(type=2)
| * | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-211-1/+25
| |/ / /
* | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ | |_|/ / |/| | | gsp::Gpu: implement AcquireRight, ReleaseRight functions
| * | | return checks if event and memory createdmailwl2016-04-231-1/+8
| | | |
| * | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
| | | |
* | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-291-1/+0
| | | | | | | | | | | | | | | | This has been entirely superseded by MicroProfile. The rest of the code can go when a simpler frametime/FPS meter is added to the GUI.
* | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-272-59/+151
|\ \ \ \ | | | | | | | | | | DSP Service: Cleanup
| * | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| | | | |
| * | | | DSP_DSP: Add return IPC headersMerryMage2016-04-271-4/+26
| | | | |
| * | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-272-42/+106
| | | | |
| * | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
| | | | |
* | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
| | | | |
* | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \ | | | | | | | | | | | | Update the code of service y2r!
| * | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|/ / | |/| | |
* | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
| |/ / / |/| | |
* | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
| |/ / |/| |
* | | HWRasterizer: Texture forwardingtfarley2016-04-213-24/+18
|/ /
* | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ | |/ |/| SOC:U GetSockOpt/SetSockOpt
| * Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| |
| * Code styleRyan Loebs2016-03-301-2/+2
| |
| * Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| | | | | | | | Filter out and translate invalid sockopt names.
| * Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| |
| * But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| |
| * Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| |
| * Formatting...Ryan Loebs2016-03-291-1/+1
| |
| * Addressing PR commentsRyan Loebs2016-03-291-4/+4
| |
| * SOC UpdatesRyan Loebs2016-03-291-3/+46
| | | | | | | | | | | | -Implement GetSockOpt / SetSockOpt -Fix bug in RecvFrom where sending from localhost does not fill in src_addr/src_addr_len on Linux
* | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
| |
* | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-083-0/+28
| |
* | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \ | | | | | | Append the missing function name"GetAppletInfo", "SetAppCpuTimeLimit" and "GetAppCpuTimeLimit" to APT:A
| * | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| | |
| * | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| | |
| * | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
| | |
* | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-064-55/+234
|\ \ \ | | | | | | | | frd:u: Initial stub some functions
| * | | frd:u: Initial stub some functionsmailwl2016-03-274-55/+234
| | |/ | |/|
* | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-061-7/+6
|\ \ \ | |_|/ |/| | Common: Remove Common::make_unique, use std::make_unique
| * | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-051-7/+6
| | |
* | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-033-0/+61
|\ \ \ | | | | | | | | Dummy implementation dlp:SRVR Service.
| * | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-023-0/+61
| | | |
* | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-023-3/+54
|\ \ \ \ | | | | | | | | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandle
| * | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-313-3/+54
| | | | |
* | | | | Merge pull request #1390 from purpasmart96/citra_gsp_error_codesbunnei2016-04-012-80/+96
|\ \ \ \ \ | | | | | | | | | | | | GSP: Return proper error codes for register writes
| * | | | | GSP: Return proper error codes for register writespurpasmart962016-03-312-80/+96
| |/ / / /
* | | | | Merge pull request #1419 from mailwl/branch-gspbunnei2016-03-311-6/+41
|\ \ \ \ \ | |/ / / / |/| | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueue
| * | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueuemailwl2016-03-311-6/+41
| | |_|/ | |/| |
* / | | Add common methods to all cfg:* portsRyan Loebs2016-03-293-0/+21
|/ / /
* | | use reference instead of pointerwwylele2016-03-261-9/+9
| | |
* | | Merge pull request #1549 from wwylele/acc_gyrobunnei2016-03-264-23/+187
|\ \ \ | |/ / |/| | hid: implement accelerometer and gyroscope back-end
| * | implement GyroscopeCalibrateParamwwylele2016-03-252-9/+20
| | |
| * | implement accel and gyro backendwwylele2016-03-224-23/+176
| | |
* | | soc_u: Get rid of explicit delete and newLioncash2016-03-211-8/+5
| |/ |/|
* | HLE/FS: Change the error code returned when an ExtSaveData archive is not found.Subv2016-03-201-4/+8
| | | | | | | | This allows Fire Emblem to boot again.
* | HLE/FS: Corrected some style concerns.Subv2016-03-204-6/+4
| |
* | HLE/FS: Fixed creating the config savefile when it doesn't exist.Subv2016-03-201-1/+1
| | | | | | | | This fixes a regression.
* | HLE/FS: Implemented GetFormatInfoSubv2016-03-205-48/+126
| | | | | | | | Format information is currently only implemented for the ExtSaveData, SharedExtSaveData and SaveData archives, the information is stored in a file alongside the root folder of the archive.
* | HLE/FS: Don't return an error when deleting the ExtSaveData if it does not exist.Subv2016-03-201-1/+1
| |
* | HLE/FS: Return the proper error codes when opening files.Subv2016-03-201-3/+4
| |
* | HLE/FS: Fixed the OpenDirectory error codeSubv2016-03-201-1/+1
| |
* | HLE/FS: Return the proper error codes on file Read/Write operations.Subv2016-03-201-2/+15
| | | | | | | | These operations are limited by the open flags specified while opening the file.
* | HLE/FS: Corrected the error codes for DeleteFileSubv2016-03-201-4/+1
| |
* | HLE/FS: FS::CreateFile takes an u64 for the file size.Subv2016-03-203-5/+5
|/
* Merge pull request #1505 from pippo2931/fefbunnei2016-03-181-1/+25
|\ | | | | GetArchiveResource stub
| * Fix headerpippo29312016-03-121-1/+1
| |
| * GetArchiveResource stubpippo29312016-03-121-1/+25
| |
* | Reorganize the ndm service path for dummy implement functionJamePeng2016-03-145-24/+118
| | | | | | | | | | | | SuspendDaemons , ResumeDaemons , OverrideDefaultDaemons The NDM file move to /core/hle/service/ndm/ now!
* | hid: fix pad updatewwylele2016-03-131-1/+1
| |
* | svc: Move ResetType enum to the kernel event headerLioncash2016-03-135-6/+6
| |
* | svc: Make ResetType an enum classLioncash2016-03-128-17/+17
|/
* Merge pull request #1266 from Subv/miiappletbunnei2016-03-123-2/+36
|\ | | | | HLE/Applets: Implemented a dummy Mii Selector applet.
| * HLE/Applets: Implemented a dummy Mii Selector applet.Subv2016-03-123-2/+36
| | | | | | | | This prevents some games (like Super Mario 3D Land) from freezing when trying to launch it, however, it's not complete and won't let you go past Mii selection as the parameter structure hasn't been reverse engineered yet.
* | Merge pull request #1500 from lioncash/nullptrbunnei2016-03-121-1/+1
|\ \ | | | | | | gsp_gpu: Change 0 literal to nullptr
| * | gsp_gpu: Change 0 literal to nullptrLioncash2016-03-121-1/+1
| | |
* | | hle: Update service function tablesLioncash2016-03-124-1/+16
|/ /
* | renderer_base: Don't directly expose the rasterizer unique_ptrLioncash2016-03-092-5/+5
| | | | | | | | | | There's no reason to allow direct access to the unique_ptr instance. Only its contained pointer.
* | DSP: Implement Pipe 2MerryMage2016-03-061-43/+151
| | | | | | | | | | | | Pipe 2 is a DSP pipe that is used to initialize both the DSP hardware (the application signals to the DSP to initialize) and the application (the DSP provides the memory location of structures in the shared memory region).
* | DSP: Print hash of firmware to consoleMerryMage2016-03-061-8/+21
| |
* | Merge pull request #1429 from mailwl/branch-acubunnei2016-03-051-2/+17
|\ \ | | | | | | ac:u IsConnected implemented
| * | ac:u: Stub IsConnectedmailwl2016-03-041-2/+17
| | |
* | | Merge pull request #1389 from yuriks/stub-cambunnei2016-03-043-20/+563
|\ \ \ | |/ / |/| | Stub CAM:U service
| * | Service/CAM: Add doxycomments to all service functionsYuri Kunde Schlesner2016-03-011-0/+217
| | |
| * | Service/CAM: Dummy implementation of some functionsYuri Kunde Schlesner2016-02-133-20/+346
| | | | | | | | | | | | Thanks to @mailwl for the initial version of the stubs.
* | | Service/CFG: Fix potential endianess issueYuri Kunde Schlesner2016-03-011-2/+3
| | |
* | | Service/CFG: Add block 0x000A0000 (username) to default config fileYuri Kunde Schlesner2016-03-011-1/+14
| | |
* | | Initial implementation ir:usermailwl2016-02-263-18/+142
| | |
* | | AudioCore: Skeleton ImplementationMerryMage2016-02-212-57/+90
| | | | | | | | | | | | | | | | | | | | | | | | | | | This commit: * Adds a new subproject, audio_core. * Defines structures that exist in DSP shared memory. * Hooks up various other parts of the emulator into audio core. This sets the foundation for a later HLE DSP implementation.
* | | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-125-15/+15
|/ /
* | services: Get rid of unnecessary includesLioncash2016-02-0269-132/+32
| |
* | services: Update function tablesLioncash2016-02-022-5/+11
| |
* | Merge pull request #1283 from Subv/soc_fixupbunnei2016-01-051-3/+13
|\ \ | | | | | | HLE/Sockets: Fixed the buffer offset in recvfrom.
| * | HLE/Sockets: Fixed the buffer offset in recvfrom.Subv2015-12-241-3/+13
| | | | | | | | | | | | Closes #1277
* | | services: Update some function tablesLioncash2015-12-3025-113/+369
|/ /
* | VideoCore: Unify interface to OpenGL and SW rasterizersYuri Kunde Schlesner2015-12-082-5/+5
| | | | | | | | | | | | This removes explicit checks sprinkled all over the codebase to instead just have the SW rasterizer expose an implementation with no-ops for most operations.
* | VideoCore: Rename HWRasterizer methods to be less confusingYuri Kunde Schlesner2015-12-072-5/+5
| |
* | Merge pull request #1252 from Subv/cambunnei2015-12-041-0/+156
|\ \ | |/ |/| Services/Cam: Added new log type and camera enums from 3dbrew.
| * Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-231-0/+156
| | | | | | | | | | Followup to #1102 Original author @mailwl
* | Merge pull request #1225 from lioncash/cleanbunnei2015-11-291-12/+13
|\ \ | | | | | | csnd_snd: Get rid of type punning
| * | csnd_snd: Get rid of type punningLioncash2015-10-281-12/+13
| | |
* | | Add stub functions for Initialize and GenerateRandomData in ssl:Cpolaris-2015-11-221-2/+51
| |/ |/|
* | Add Initialize and GenerateRandomData stubspolaris-2015-11-221-0/+2
|/
* Merge pull request #1165 from esoteric-programmer/masterbunnei2015-10-282-4/+66
|\ | | | | Added CSND_ExecuteType0Commands stub.
| * Added CSND stub.Matthias Ernst2015-10-282-4/+66
| |
* | Merge pull request #1208 from archshift/free-bytesbunnei2015-10-283-1/+42
|\ \ | | | | | | Implement FS_User::GetFreeBytes
| * | Implement FS_User::GetFreeBytesarchshift2015-10-283-1/+42
| | |
* | | Fix copy pasteFiliph Sandström2015-10-241-1/+1
| | |
* | | Fix wrong branchFiliph Sandström2015-10-231-0/+12
| | |
* | | Add GetTotalStepCount StubFiliph Sandström2015-10-231-1/+1
| | |
* | | Update ptm.hFiliph Sandström2015-10-231-0/+8
|/ /
* | Service/CFG: Use a constexpr function for country initializationEmmanuel Gil Peyrot2015-09-301-4/+3
| | | | | | | | This fixes a TODO left over from when we supported MSVC 2013.
* | fix some xcode 7.0 warningsMartin Lindhe2015-09-291-1/+1
| |
* | general: Silence some warnings when using clangLioncash2015-09-164-8/+8
|/
* Service/CFG: Add default entry for block 0x000A0001 (birthday)Yuri Kunde Schlesner2015-09-141-0/+6
|
* Service/CFG: Correct flags in 2 default blocksYuri Kunde Schlesner2015-09-141-2/+2
| | | | Verified against a 9.2.0-20 config save
* Service/CFG: Add additional blocks to default save dataYuri Kunde Schlesner2015-09-141-0/+34
| | | | These blocks are required by various games to boot.
* Fix narrowing conversion warningYuri Kunde Schlesner2015-09-141-1/+1
|
* Service/CFG: Move several private types from the header to the cppYuri Kunde Schlesner2015-09-142-63/+49
|
* Service/CFG: Clean up default block creationYuri Kunde Schlesner2015-09-142-27/+17
|
* GSP: Implement command 0x05, used for flushing cachesYuri Kunde Schlesner2015-09-142-13/+34
| | | | | | May fix additional texture caching issues. (Though mostly in homebrew, I haven't seen any commercial software use this to flush anything but command lists.)
* General: Replace NULL and '0' usages with nullptr where applicableLioncash2015-09-111-1/+1
|
* General: Fix up doxygen commentsLioncash2015-09-101-1/+1
|
* Add cam:u service function names to its function tablearchshift2015-09-031-3/+60
|
* Core: Improve APT Shared Font hackYuri Kunde Schlesner2015-08-271-2/+2
| | | | Should fix invalid read loops in some games
* Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-251-0/+5
| | | | | This brings goodies such as a configurable user interface and multi-threaded timeline view.
* Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-223-12/+11
|\ | | | | Kernel: Correct(er) handling of Heap and Linear Heap allocations
| * APT: Adjust shared font hack so it works with the new linear heap codeYuri Kunde Schlesner2015-08-161-10/+11
| |
| * Memory: Move address type conversion routines to memory.cpp/hYuri Kunde Schlesner2015-08-162-2/+0
| | | | | | | | | | These helpers aren't really part of the kernel, and mem_map.cpp/h is going to be moved there next.
* | GPU: Implement TextureCopy-mode display transfersYuri Kunde Schlesner2015-08-162-11/+25
|/ | | | Fixes glitchy garbage in Fire Emblem 3D scenes.
* core: Eliminate some unused variable warningsLioncash2015-07-292-3/+5
|
* core: Fix missing prototype warningsLioncash2015-07-291-0/+1
|
* Merge pull request #1009 from lioncash/tableYuri Kunde Schlesner2015-07-291-1/+2
|\ | | | | am_net: Update function table data
| * am_net: Add missing function to the function tableLioncash2015-07-291-0/+1
| |
| * am_net: Add correct function name to the function tableLioncash2015-07-291-1/+1
| |
* | Merge pull request #982 from Subv/homebunnei2015-07-295-18/+72
|\ \ | |/ |/| Service/APT: Return proper parameters in GetLockHandle.
| * Service/APT: Fixed a regression, PreloadLibraryApplet should also start an applet when called.Subv2015-07-245-4/+35
| |
| * Service/APT: Return proper parameters in GetLockHandle.Subv2015-07-242-14/+37
| | | | | | | | | | Documented some APT functions This allows applets to boot.
* | Merge pull request #899 from zawata/Winsock-Deprecationbunnei2015-07-281-2/+8
|\ \ | | | | | | SOC:U : Fix WinSock function deprecation
| * | SOC:U : Update deprecated function gethostbyname() to getaddrinfo()zawata2015-07-201-2/+8
| | |
* | | Move input values into an arrayJames Rowe2015-07-282-1/+14
| | |
* | | Merge pull request #983 from yuriks/null-memory-fillYuri Kunde Schlesner2015-07-241-13/+18
|\ \ \ | | | | | | | | GSP: Don't try to write memory fill registers if start address is 0
| * | | GSP: Don't try to write memory fill registers if start address is 0Yuri Kunde Schlesner2015-07-241-13/+18
| | |/ | |/| | | | | | | | | | Verified to be what GSP does via REing. Fixes invalid virt->phys translation error spam in some games.
* / | Qt/GPU Breakpoints: Added three more breakpoint types:Subv2015-07-231-0/+7
|/ / | | | | | | | | | | * IncomingDisplayTransfer: Triggered just before a display transfer is performed. * GSPCommandProcessed: Triggered right after a GSP command is processed. * BufferSwapped: Triggered when the frames flip
* | Merge pull request #962 from Subv/am_appbunnei2015-07-223-3/+33
|\ \ | | | | | | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.
| * | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.Subv2015-07-213-3/+33
| | | | | | | | | | | | | | | | | | Named the service functions in am:app as per 3dbrew. This fixes an illegal read loop in Steel Diver
* | | Merge pull request #966 from Subv/logbunnei2015-07-211-4/+8
|\ \ \ | | | | | | | | Services/Logging: Log more useful information when some operations fail.
| * | | Services/Logging: Log more useful information when some operations fail.Subv2015-07-211-4/+8
| |/ / | | | | | | | | | Namely OpenFileDirectly, OpenDirectory and OpenArchive
* / / Services/CFG: Added some missing functions to cfg:sSubv2015-07-211-1/+3
|/ /
* | Merge pull request #946 from archshift/update-frdubunnei2015-07-201-1/+12
|\ \ | | | | | | Add more frd:u unknown service commands from 3dbrew
| * | Add more frd:u unknown service commands from 3dbrewarchshift2015-07-191-1/+12
| | |
* | | Change trace/unimplemented service call logs to use hexarchshift2015-07-191-1/+1
|/ / | | | | | | Changes the log to use hex in the parameter list instead of decimal.
* | Ensure all kernel objects are released during shutdownYuri Kunde Schlesner2015-07-1711-1/+31
| | | | | | | | | | | | | | | | This commit fixes several kernel object leaks. The most severe of them was threads not being removed from the private handle table used for CoreTiming events. This resulted in Threads never being released, which in turn held references to Process, causing CodeSets to never be freed when loading other applications.
* | Archive: Correct a few incorrect types in function signaturesYuri Kunde Schlesner2015-07-141-1/+1
| | | | | | | | Buffer lengths should be size_t, and file offsets should be u64.
* | Add CiTrace recording support.Tony Wasserka2015-07-131-1/+1
| | | | | | | | | | | | This is exposed in the GUI as a new "CiTrace Recording" widget. Playback is implemented by a standalone 3DS homebrew application (which only runs reliably within Citra currently; on an actual 3DS it will often crash still).
* | Core: Fix applet includes using iwyu.Emmanuel Gil Peyrot2015-07-121-3/+6
| |
* | Applets: Reworked how the Applet update event is handled.Subv2015-07-123-4/+4
| | | | | | | | Applets are now cleaned up in AppletUpdateEvent after calling their respective Update method.
* | Applets: Add infrastructure to allow custom drawing and input handling in Applets.Subv2015-07-123-20/+39
| |
* | HLE/APT: Initial HLE support for applets.Subv2015-07-124-50/+173
| | | | | | | | Currently only the SWKBD is emulated, and there's currently no way to ask the user for input, so it always returns "Subv" as the text.
* | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-1112-50/+82
|\ \ | | | | | | Cleanup includes, mostly in common
| * | Core: Cleanup hw includes.Emmanuel Gil Peyrot2015-06-283-0/+7
| | |
| * | Core: Cleanup soc:U includes.Emmanuel Gil Peyrot2015-06-282-26/+36
| | |
| * | Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-283-7/+18
| | |
| * | CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-283-1/+5
| | |
| * | Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-282-8/+9
| | |
| * | Services: Use the standard _WIN32 define in soc:U instead of our own EMU_PLATFORM.Emmanuel Gil Peyrot2015-06-271-8/+7
| |/
* / Services/SOC: Added command headers to some of the soc commands.Subv2015-06-251-5/+13
|/
* Add helpers to create IPC command buffer headers and descriptorsYuri Kunde Schlesner2015-06-232-7/+9
|
* Merge pull request #860 from yuriks/y2r-colorYuri Kunde Schlesner2015-06-222-174/+348
|\ | | | | Color support for Y2R
| * Y2R: Rework conversion process, enabling support for all formatsYuri Kunde Schlesner2015-06-222-163/+309
| |
| * Y2R: Re-organize how params are stored. Support SetConversionParamsYuri Kunde Schlesner2015-06-211-72/+100
| |
* | Services: Continue separation of services into their own folderspurpasmart962015-06-1272-607/+1134
|/
* ExtSavedata: Save the icon passed to CreateExtSaveData to the correct folder.Subv2015-06-023-11/+32
| | | | Organize the ExtSaveData folders as they are stored in the console.
* Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-2916-52/+52
|
* hid: Get rid of undefined behaviorLioncash2015-05-271-2/+2
| | | | Modifying a variable twice across a sequence point.
* Service/GSP: Implemented ImportDisplayCaptureInfo.Subv2015-05-261-1/+47
|
* y2r_u: Remove unused variable in StartConversionLioncash2015-05-231-1/+0
|
* Merge pull request #801 from purpasmart96/hid_stubsbunnei2015-05-234-9/+47
|\ | | | | HID: Stub DisableAccelerometer and DisableGyroscopeLow
| * HID: Stub DisableAccelerometer and DisableGyroscopeLowpurpasmart962015-05-234-9/+47
| |
* | Flush for y2r (moflex)tfarley2015-05-231-0/+11
| |
* | OpenGL renderertfarley2015-05-231-0/+9
|/
* Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-221-35/+265
| | | | | | | | | | | | Implements unrotated planar YUV 4:2:0 -> RGB24 conversions in Y2R. Currently only the Y (luma) channel is used, so the results don't contain color. This will be added in a later PR at some point. This is enough to get all currently know Moflex videos to decode. (Some don't display on-screen due to seemingly unrelated reasons.) Thanks to @archshift for doing the initial implementation which I cleaned up and then fixed the 8x8 block mode.
* y2r_u: Stub StartConversion to prevent moflex games from hanging.bunnei2015-05-211-1/+17
|
* Merge pull request #766 from purpasmart96/cfg_service_updatebunnei2015-05-185-337/+304
|\ | | | | CFG: Update the cfg service to be like other integrated services
| * CFG: Update the cfg service to be like other integrated servicespurpasmart962015-05-165-337/+304
| |
* | APT/FS: Remove asserts that were causing false positivespurpasmart962015-05-162-5/+5
| |
* | Memmap: Re-organize memory function in two filesYuri Kunde Schlesner2015-05-151-0/+1
|/ | | | | | | memory.cpp/h contains definitions related to acessing memory and configuring the address space mem_map.cpp/h contains higher-level definitions related to configuring the address space accoording to the kernel and allocating memory.
* PTM: Changed the way the ptm services are handled to be like thepurpasmart962015-05-125-125/+112
| | | | IR, HID, and APT services.
* NWM_UDS: Fix a typo in the nwm service port namepurpasmart962015-05-121-1/+1
|
* fixup! GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-1/+1
|
* GSP: Small tweaks to shared memory initializationYuri Kunde Schlesner2015-05-111-9/+11
|
* Kernel: Capture SharedMemory attributes at creation, not when mappingYuri Kunde Schlesner2015-05-114-11/+19
|
* Memory: Re-organize and rename memory area address constantsYuri Kunde Schlesner2015-05-091-1/+1
|
* Common: Remove common.hYuri Kunde Schlesner2015-05-0721-10/+32
|
* FileSys: De-inline Path membersYuri Kunde Schlesner2015-05-071-0/+2
|
* FileSys: Clean-up includes, de-inline destructorsYuri Kunde Schlesner2015-05-074-13/+21
|
* Services: Initialize all state variables at bootup.bunnei2015-05-028-22/+38
|
* Merge pull request #692 from purpasmart96/log_improvementsbunnei2015-04-282-8/+22
|\ | | | | Services/Loader: Use more sensible log formats for certain functions along with more info being logged.
| * Services/Loader: Use more sensible log formats for certain functionspurpasmart962015-04-282-8/+22
| | | | | | | | along with more info being logged.
* | ptm_sysm: Add static specifier to IsLegacyPowerOffLioncash2015-04-251-1/+1
| |
* | De-inline functions from Interface, removing them from service.hYuri Kunde Schlesner2015-04-142-50/+48
| | | | | | | | This reduces the time for a full recompile from 65.43s to 59.53s (~9%)
* | APT: (Subv) Fix bug where start event was being incorrectly signaled.bunnei2015-04-101-6/+7
|/
* Merge pull request #676 from purpasmart96/ir_service_refcbunnei2015-04-0810-55/+180
|\ | | | | IR: Move The IR services to their own folder and implement "GetHandles"
| * IR: Move The IR services to their own folder and implement "GetHandles"purpasmart962015-04-0410-55/+180
| |
* | Clean-up mem_map constants and fix framebuffer translation errorsYuri Kunde Schlesner2015-04-061-4/+6
|/
* Services: Stubs and minor changespurpasmart962015-04-0316-67/+402
|
* Merge pull request #656 from Subv/nzbunnei2015-03-223-24/+189
|\ | | | | Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and Del...
| * Service/FS: Document and log some unknown values.Subv2015-03-191-1/+26
| | | | | | | | In CreateExtSaveData, DeleteExtSaveData and CreateSystemSaveData
| * Services/FS: Implemented DeleteExtSaveData, CreateSystemSaveData and DeleteSystemSaveDataSubv2015-03-143-24/+164
| | | | | | | | Also fixed a bug with CreateExtSaveData that made it unable to create ExtSaveData archives in the SDMC directory.
* | Merge pull request #655 from purpasmart96/hid_fixesbunnei2015-03-174-12/+72
|\ \ | | | | | | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow along with a stub for GetSoundVolume
| * | HID: Proper Signal Interrupts for EnableAccelerometer & EnableGyroscopeLow alongpurpasmart962015-03-174-12/+72
| |/ | | | | | | with a stub for GetSoundVolume
* / arm_interface: Get rid of GetTicks.Lioncash2015-03-161-3/+3
|/ | | | Removes a TODO.
* Merge pull request #642 from bunnei/touchpadbunnei2015-03-123-130/+136
|\ | | | | Touchpad support
| * hid_user: Removed unnecessary includes.bunnei2015-03-111-2/+0
| |
| * HID: Removed unnecessary global variables.bunnei2015-03-112-58/+42
| |
| * HID: Added additional variable comments and some code cleanups.bunnei2015-03-112-20/+29
| |
| * HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-112-111/+28
| |
| * HID: Cleanup how `next_touch_index` is calculated for Pad and touch.bunnei2015-03-101-2/+2
| |
| * HID: Changed TouchDataEntry `valid` to a BitField and added some doc strings.bunnei2015-03-102-4/+4
| |
| * HID: Added static asserts to check register position in shared memory.bunnei2015-03-101-2/+16
| |
| * HID: Added functions to emulate the touchpad.bunnei2015-03-102-0/+61
| |
| * HID: Moved some docstrings to the header.bunnei2015-03-102-24/+16
| |
| * HID: Refactored shared memory decoding for touchpad support.bunnei2015-03-102-33/+64
| |
* | Merge pull request #629 from archshift/lcdfbbunnei2015-03-101-6/+38
|\ \ | |/ |/| Implement SetLcdForceBlack and add implementation for color filling in the GPU code
| * Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-091-17/+15
| |
| * Implement SetLcdForceBlack, move register enum to hw.harchshift2015-03-061-5/+39
| |
* | Merge pull request #589 from kevinhartman/config-errorsbunnei2015-03-091-5/+10
|\ \ | |/ |/| Fix errorcodes for bad config block request
| * Fix error message for bad config block request.Kevin Hartman2015-02-211-5/+10
| |
* | Services: Moved the PTM and APT services to their own folderSubv2015-03-0438-1089/+1186
| | | | | | | | | | | | This coincidentally fixes an issue about the PTM service failing to create its SharedExtSaveData archive due to the FS service not being initialized by the time the creating code runs. Ideally I'd like to move each process to its own folder, and have a single file per process that registers the service classes, which would be in their own files inside that folder. Then each service class would just call functions from the process to complete the commands.
* | Merge pull request #622 from Subv/titlesYuri Kunde Schlesner2015-03-021-8/+45
|\ \ | | | | | | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.
| * | Services/AM: Stubbed TitleIDListGetTotal and GetTitleIDList.Subv2015-03-021-8/+45
| | | | | | | | | | | | | | | They will always return 0 titles for every media type for now. This is needed to boot Home Menu further
* | | Merge pull request #623 from Subv/cardbunnei2015-03-021-1/+25
|\ \ \ | | | | | | | | Services/FS: Stubbed CardSlotIsInserted to always return false
| * | | Services/FS: Stubbed CardSlotIsInserted to always return falseSubv2015-03-011-1/+25
| |/ / | | | | | | | | | We won't be emulating this for the foreseeable future and it is needed for Home Menu to boot further
* / / Services/PTM: Stubbed PTM_Sysm::IsLegacyPowerOff.Subv2015-03-011-1/+13
|/ / | | | | | | This allows the Home Menu to boot further
* | Merge pull request #604 from Subv/arc_ssdYuri Kunde Schlesner2015-02-262-26/+42
|\ \ | | | | | | Archives: Properly implemented the SystemSaveData archive.
| * | Archives: Properly implemented the SystemSaveData archive.Subv2015-02-262-26/+42
| | | | | | | | | | | | Ported to the new factory pattern we have for archives.
* | | Services: Implemented Y2R_U::GetTransferEndEventSubv2015-02-241-1/+18
|/ / | | | | | | Aero Porter was throwing an "Invalid Handle" fatal error without this.
* | Merge pull request #595 from linkmauve/new-3ds-inputbunnei2015-02-241-0/+19
|\ \ | | | | | | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.
| * | Frontends, HID: Add New 3DS specific pad buttons, and stub the touch one.Emmanuel Gil Peyrot2015-02-221-0/+19
| |/
* / Added information reporting from ThrowFatalErrorarchshift2015-02-221-1/+164
|/ | | | This was RE'd from the errdisp applet.
* GPU: Properly implement memory fills.Tony Wasserka2015-02-182-17/+21
|
* Services: Fixed "Tried to connect to named port err:f".Subv2015-02-161-1/+1
| | | | err:f is a named port, not a service
* Merge pull request #529 from Subv/masterbunnei2015-02-143-36/+52
|\ | | | | Build: Fixed some warnings
| * Build: Fixed some warningsSubv2015-02-123-36/+52
| |
* | core: Apply static to local functionsLioncash2015-02-133-15/+15
|/
* Implemented WriteHWRegsWithMask for GSP.Kevin Hartman2015-02-111-6/+91
|
* Asserts: break/crash program, fit to style guide; log.h->assert.harchshift2015-02-1142-52/+10
| | | | | | | Involves making asserts use printf instead of the log functions (log functions are asynchronous and, as such, the log won't be printed in time) As such, the log type argument was removed (printf obviously can't use it, and it's made obsolete by the file and line printing) Also removed some GEKKO cruft.
* GSP: Fixed typo in SignalInterruptbunnei2015-02-111-1/+1
|
* Merge pull request #552 from bunnei/setbufferswap-fixbunnei2015-02-111-4/+3
|\ | | | | GSP SetBufferSwap fix
| * GSP: Call SetBufferSwap for each screen on corresponding signal interrupt.bunnei2015-02-111-4/+3
| |
* | Merge pull request #526 from purpasmart96/citra_stubsbunnei2015-02-113-8/+188
|\ \ | | | | | | Services: Stub some functions
| * | Services: Stub some functionspurpasmart962015-02-083-8/+188
| | |
* | | PTM: Fixed a problem with the gamecoin PTM file.Subv2015-02-101-21/+13
| | |
* | | Archives: Made the Format function more generic.Subv2015-02-103-9/+10
| | |
* | | Archives: Expose the File and Directory classes to HLESubv2015-02-103-58/+62
| | |
* | | FS: Allow multiple instances of the same archive type to be open at onceYuri Kunde Schlesner2015-02-103-29/+35
| | |
* | | FS: Get rid of completely useless Archive classYuri Kunde Schlesner2015-02-101-36/+26
| |/ |/|
* | Kernel: Stop creating useless Handles during object creationYuri Kunde Schlesner2015-02-025-14/+13
| | | | | | | | | | They're finally unnecessary, and will stop cluttering the application's handle table.
* | HID: Fix crash when pressing a key when the emulator is stoppedYuri Kunde Schlesner2015-02-021-0/+2
| |
* | FS: Remove use of GetHandleYuri Kunde Schlesner2015-02-021-1/+1
| |
* | Service: Store function names as const char* instead of std::stringYuri Kunde Schlesner2015-02-021-6/+6
| | | | | | | | | | Uses less memory (strings and function table is stored in constant data) and speeds up start up (no need to allocate and copy strings).
* | Service: Clean-up InterfaceYuri Kunde Schlesner2015-02-0246-67/+54
| |
* | Make Port/Service registration and querying more HW-accurateYuri Kunde Schlesner2015-02-023-102/+64
| |
* | Filesys: Move creation of Handles for File/Directory to service handlersYuri Kunde Schlesner2015-02-023-32/+33
|/
* archive: Fix initializer list order for the File class.Lioncash2015-01-301-1/+1
|
* apt_u: Fix missing printf specifiersLioncash2015-01-301-2/+2
|
* Remove result.h InvalidHandleYuri Kunde Schlesner2015-01-301-9/+14
| | | | | It was only being used in two places, where it was replaced by a local constant.
* Kernel: Convert Event to not use HandlesYuri Kunde Schlesner2015-01-307-58/+71
|
* Kernel: Convert Mutex to not use HandlesYuri Kunde Schlesner2015-01-302-8/+9
|
* Kernel: Convert SharedMemory to not use HandlesYuri Kunde Schlesner2015-01-305-16/+24
|
* Merge pull request #345 from purpasmart96/apt_stubsbunnei2015-01-271-91/+276
|\ | | | | APT_U: Stub some functions & misc changes
| * APT_U: Stub some functions & misc changespurpasmart962015-01-231-91/+276
| |
* | Merge pull request #485 from Subv/more_servsbunnei2015-01-2618-1/+393
|\ \ | | | | | | Services: Stubbed more services.
| * | Services/HID: Removed some files due to a rebase errorSubv2015-01-243-267/+0
| | |
| * | Services: Stubbed more services.Subv2015-01-2421-1/+660
| | | | | | | | | | | | Implemented FSUser::CreateExtSaveData
* | | cam_u.h: fix indentationarchshift2015-01-221-2/+2
|/ / | | | | Withholding my profanity towards Xcode.
* | Merge pull request #493 from archshift/ptmplaybunnei2015-01-225-0/+102
|\ \ | | | | | | Stubbed some services
| * | Stubbed cam:u servicearchshift2015-01-213-0/+49
| | |
| * | Stubbed ptm:play servicearchshift2015-01-213-0/+53
| | |
* | | Event: Fixed some bugs and cleanup (Subv)bunnei2015-01-222-3/+3
| | |
* | | Added HID_SPVR service and split HID_U implementation into service/hid/hid.xxxarchshift2015-01-218-217/+324
|/ /
* | core: Fix a few docstringsLioncash2015-01-202-2/+2
| |
* | Expose GetSharedFont and NotifyToWait to APT:A and APT:S respectivelyarchshift2015-01-192-1/+4
|/
* APT: Fix typo in setting return code for NotifyToWaitbunnei2015-01-161-1/+1
|
* DSP: Removed useless spam log for SignalInterruptbunnei2015-01-161-5/+2
|
* Merge pull request #482 from yuriks/fix-vblankbunnei2015-01-162-35/+25
|\ | | | | Correctness fixes for GPU flipping and interrupts
| * GSP: Fix appending of interrupts to the shared memory bufferYuri Kunde Schlesner2015-01-142-17/+12
| | | | | | | | | | The code was previously appending the interrupt to after the end of the buffer, instead of at the end.
| * GSP: Update framebuffer info on all interruptsYuri Kunde Schlesner2015-01-141-12/+13
| | | | | | | | | | | | | | | | | | | | Hardware testing determined that the GSP processes shared memory framebuffer update info even when no memory transfer or filling GX commands are used. They are now updated on every interrupt, which isn't confirmed correct but matches hardware behaviour more closely. This also reverts the hack introduced in #404. It made a few games behave better, but I believe it's incorrect and also breaks other games.
| * GPU: Fire GPU interrupts at the correct places.Yuri Kunde Schlesner2015-01-141-6/+0
| | | | | | | | | | | | | | | | | | | | | | | | PDC0 and PDC1 are both VBlank interrupts. PDC0 was being treated as a HBlank interrupt and fired many more times than it should. They now both fire together at 60 Hz. This puzzlingly *improves* apparent framerate on many applications. A few other interrupts were being fired inside the GSP command processing instead of on the actual GPU register writes, so they were moved there, which should cover direct writes tho those registers not going through the GX command queue.
* | APT: Fixed the comment style in some variablesSebastian Valle2015-01-141-2/+2
| |
* | APTU: Stubbed NotifyToWait, taken from 3dmoo.Subv2015-01-141-7/+21
|/ | | | | Also renamed some handles in the APT:U service to be more descriptive. Fixed a typo in InquireNotification
* Services: Added some missing services.Subv2015-01-138-1/+358
| | | | | cfg:s, ptm:sysm, apt:s. apt:s is almost exactly the same as apt:u as per 3dbrew
* Fix building on MinGWdarkf2015-01-121-0/+13
|
* Stubbed y2r:u IsBusyConversionarchshift2015-01-111-1/+16
| | | | | There is no documentation available on this function, but we set the result to false as a stub. This allows Super Little Acorns to move all the way in game with pp3c.
* Added Archive ID to fs:USER debug logs involving opening the archive.archshift2015-01-101-3/+3
|
* Logging: Log all called service functions (under trace). Compile out all trace logs under release for performance.archshift2015-01-107-30/+20
|
* Kernel: Start using boost::intrusive_ptr for lifetime managementYuri Kunde Schlesner2015-01-091-1/+2
|
* Move ThreadContext to core/core.h and deal with the falloutYuri Kunde Schlesner2015-01-091-0/+1
|
* Merge pull request #404 from bunnei/more-frame-synch-fixesbunnei2015-01-081-1/+4
|\ | | | | GPU: Toggle active framebuffer each frame
| * GSP: Toggle active framebuffer each framebunnei2015-01-081-1/+4
| |
* | Fix double-free in Service manager during shutdownYuri Kunde Schlesner2015-01-072-25/+4
| | | | | | | | Fixes #423.
* | Merge pull request #376 from Subv/arc_reorderbunnei2015-01-074-18/+23
|\ \ | |/ |/| Archives: Change the folder layout of some archives.
| * Archives: Changed the unimplemented archives comment.Subv2015-01-061-1/+1
| | | | | | | | It now refers to me as the PoC
| * Archives: Addressed some commentsSubv2015-01-061-2/+2
| |
| * Archives: Make SYSTEM_ID and SDCARD_ID stringsSubv2015-01-042-4/+4
| |
| * Archives: Changed the way paths are built for the archives.Subv2015-01-044-15/+20
| | | | | | | | Each archive now takes a mount point of either NAND or SDMC, and builds its own directory structure there, trying to simulate an HLE-friendly hardware layout
| * Archives: Change the folder layout of some archives.Subv2015-01-032-2/+2
| | | | | | | | This is to better represent the hardware layout, they are still aren't quite accurate, but this better and will help a bit when implementing the other archives like NAND-RO and NAND-RW
* | Merge pull request #413 from purpasmart96/serv_cleanbunnei2015-01-067-33/+36
|\ \ | | | | | | Services: Clean up a few things and add a few function names
| * | Services: Clean up a few things and add a few function namespurpasmart962015-01-067-33/+36
| | |
* | | Merge pull request #272 from rohit-n/sign-comparebunnei2015-01-061-4/+4
|\ \ \ | | | | | | | | Silence some -Wsign-compare warnings.
| * | | Silence some -Wsign-compare warnings.Rohit Nirmal2015-01-011-4/+4
| |/ /
* | | DSP: Signal (faked) interrupt on every frame.bunnei2015-01-052-4/+21
| | | | | | | | | | | | - Hack to work around games checking that the DSP event has been signaled by a real DSP interrupt.
* | | Merge pull request #386 from archshift/y2rubunnei2015-01-053-0/+70
|\ \ \ | |_|/ |/| | Stub the y2r:u service
| * | Stub the y2r:u servicearchshift2015-01-033-0/+70
| |/
* | Archives: Reduced duplicate code in RomFS and SaveCheck.Subv2015-01-032-4/+5
| | | | | | | | Fixed a few warnings and cleaned up the code
* | SaveDataCheck: Preliminary work in this archive.Subv2015-01-032-3/+35
| | | | | | | | | | | | This allows Steel Diver to boot further, some files are needed. This is still not ready and needs a big cleanup, this will possibly be delayed until the way we handle archives is fixed (with factory classes instead of ahead-of-time creation of archives)
* | Merge pull request #391 from lioncash/pedanticbunnei2015-01-031-3/+3
|\ \ | | | | | | archive/elf: Minor misc changes.
| * | archive: Fix initializer list orderLioncash2015-01-031-3/+3
| |/
* / soc_u: Fix a missing formatting argumentLioncash2015-01-031-1/+1
|/
* SOC_U: Preliminary implementation of sockets.Subv2014-12-312-21/+701
| | | | | | | | | | | | | Stubbed CreateMemoryBlock Using Berkeley sockets, and Winsock2.2 on Windows. So far ftpony creates the socket and accepts incoming connections SOC_U: Renamed functions to maintain consistency Also prevents possible scope errors / conflicts with the actual Berkeley socket functions SOCU: Close all the opened sockets when cleaning up SOCU
* APT:A: Some style changesSubv2014-12-301-12/+12
|
* Archives: Implemented ExtSaveData and SharedExtSaveDataSubv2014-12-305-45/+94
| | | | | | | | They will be stored in /extsavedata/SDMC and /extsavedata/NAND respectively. Also redirect some APT_A functions to their APT_U equivalents. Implemented the gamecoin.dat file in SharedExtSaveData in the PTM module. Implemented formatting the savegame. Retake a previous savegame if it exists instead of reporting them as not formatted every time a game is loaded.
* Kernel: New handle managerYuri Kunde Schlesner2014-12-283-7/+11
| | | | | | | | | | | This handle manager more closely mirrors the behaviour of the CTR-OS one. In addition object ref-counts and support for DuplicateHandle have been added. Note that support for DuplicateHandle is still experimental, since parts of the kernel still use Handles internally, which will likely cause troubles if two different handles to the same object are used to e.g. wait on a synchronization primitive.
* Rename ObjectPool to HandleTableYuri Kunde Schlesner2014-12-283-8/+8
|
* Merge pull request #330 from purpasmart96/new_srvbunnei2014-12-2660-305/+355
|\ | | | | More services & small clean ups
| * More services & small clean upspurpasmart962014-12-2660-305/+355
| |
* | Stubbed IsSdmcWriteable to always return writeable.archshift2014-12-241-1/+18
| |
* | Merge pull request #322 from chinhodado/masterbunnei2014-12-221-2/+2
|\ \ | |/ |/| More warning cleanups
| * More warning cleanupsChin2014-12-211-2/+2
| |
* | CFG: Fixed some warnings and errors in ClangSubv2014-12-222-4/+4
| |
* | CFG: More style changesSubv2014-12-221-5/+5
| |
* | CFGU: IndentationSubv2014-12-211-4/+3
| |
* | CFG: Some indentationSubv2014-12-211-11/+13
| |
* | CFG: Changed the CreateConfigInfoBlk search loopSubv2014-12-211-7/+4
| |
* | CFG: Corrected the licenses in cfg_i.cpp and cfg_u.cppSubv2014-12-212-2/+2
| |
* | CFG: Create a new subfolder cfg inside service to handle cfgSubv2014-12-218-485/+607
| | | | | | | | Moved most of the shared CFG code there, implemented a few CFG:I functions
* | CFGU: Some changesSubv2014-12-211-12/+33
| |
* | CFGU: Addressed some issues.Subv2014-12-211-43/+55
| |
* | CFGU: Addressed some comments.Subv2014-12-211-11/+13
| |
* | Style: Addressed some commentsSubv2014-12-211-4/+5
| |
* | CFG_U: Use Common::make_unique instead of the std versionSubv2014-12-211-1/+2
| |
* | CFG:U: Implemented some more blocksSubv2014-12-211-4/+30
| |
* | CFG: Implemented block 0x00070001 in the config savefileSubv2014-12-211-0/+5
| |
* | CFGU: Use an absolute offset in the config savefile blocksSubv2014-12-211-1/+3
| |
* | CFG: Load the Config savedata file if it already exists.Subv2014-12-211-3/+4
| |
* | CFGU: Added block 0x000A0002 to the default savegame fileSubv2014-12-211-0/+18
| | | | | | | | That's the language id block, we're using LANGUAGE_EN for now. This block allows some games to boot further
* | CFG: Refactored how the config file works.Subv2014-12-211-55/+126
| | | | | | | | It is now kept in memory as per 3dbrew, all updates happen on memory, then they can be saved using UpdateConfigNANDSavegame.
* | CFG:U: Add some data to the 0x00050005 config block.Subv2014-12-211-6/+11
| | | | | | | | Seems to allow some games to boot further, thanks @Normmatt for sharing this information
* | CFG: Implemented the GetConfigInfoBlk2 function.Subv2014-12-212-12/+188
| | | | | | | | | | | | Added a "config" file to the CFG process service (CFG:U), and added a few default blocks to it. Implemented GetSystemModel and GetModelNintendo2DS
* | Merge pull request #291 from purpasmart96/licensebunnei2014-12-2158-59/+59
|\ \ | | | | | | License change
| * | License changepurpasmart962014-12-2158-59/+59
| | |
* | | Added CreateFile to the FS_USER servicearchshift2014-12-213-1/+47
| |/ |/| | | | | Tested with hwtests.
* | Common: Add a clone of std::make_uniqueYuri Kunde Schlesner2014-12-201-6/+7
| |
* | Merge pull request #306 from Subv/even_more_savedatabunnei2014-12-201-2/+31
|\ \ | | | | | | SaveData: Added some documentation to FormatSaveData
| * | FS_U: Added the command to the docs of SaveData functionsSubv2014-12-201-0/+2
| | |
| * | SaveData: Added some documentation to FormatSaveDataSubv2014-12-181-2/+29
| | | | | | | | | | | | | | | We still don't know what the other parameters do, but they appear to be very similar to those of FormatThisUserSaveData. Most likely FormatThisUserSaveData is just an alias for FormatSaveData with LowPathType Empty
* | | Merge pull request #302 from purpasmart96/flushshutupbunnei2014-12-191-1/+25
|\ \ \ | |_|/ |/| | GSP_GPU: Shut up FlushDataCache
| * | GSP_GPU: Shut up FlushDataCachepurpasmart962014-12-191-1/+25
| |/
* | SystemSaveData: Fixed a typo that was segfaultingSubv2014-12-191-1/+1
| |
* | SaveData: Implemented the SystemSaveData archive.Subv2014-12-181-0/+9
|/ | | | It will be stored in the /syssavedata folder. This archive is user by various Services and possibly games via the FS:U service.
* Filesystem/Archives: Implemented the SaveData archiveSubv2014-12-183-13/+86
| | | | | | | | | | The savedata for each game is stored in /savedata/<ProgramID> for NCCH files. ELF files and 3DSX files use the folder 0 because they have no ID information Got rid of the code duplication in File and Directory Files that deal with the host machine's file system now live in DiskFile, similarly for directories and DiskDirectory and archives with DiskArchive. FS_U: Use the correct error code when a file wasn't found
* Comment out empty arrays causing compile errors in MSVCYuri Kunde Schlesner2014-12-162-6/+8
|
* Merge pull request #283 from yuriks/archive-refactorbunnei2014-12-165-59/+598
|\ | | | | Archive refactor
| * Work around libstdc++'s lack of support for std::hash on enumsYuri Kunde Schlesner2014-12-161-0/+15
| |
| * FS.Archive: Clean up treatment of archives and their handlesYuri Kunde Schlesner2014-12-163-196/+175
| | | | | | | | | | | | | | - Refactor FS::Archive internals to make Archive creation and lifetime management clearer. - Remove the "Archive as a File" hack. - Implement 64-bit Archive handles.
| * Service.FS: Rename FileSys::File to FileBackendYuri Kunde Schlesner2014-12-161-1/+1
| |
| * Service.FS: Rename FileSys::Directory to DirectoryBackendYuri Kunde Schlesner2014-12-161-2/+2
| |
| * Service.FS: Rename FileSys::Archive to ArchiveBackendYuri Kunde Schlesner2014-12-162-5/+5
| |
| * Service.FS: Do archive registration using IdCode instead of nameYuri Kunde Schlesner2014-12-163-16/+27
| |
| * HLE: Rename namespaces to match move & fix initialization orderYuri Kunde Schlesner2014-12-165-31/+33
| |
| * HLE: Move kernel/archive.* to service/fs/Yuri Kunde Schlesner2014-12-165-4/+536
| |
* | Merge pull request #282 from archshift/servicesbunnei2014-12-169-0/+221
|\ \ | |/ |/| Added stubs for ldr:ro, cecd:u, nim:aoc, and am:app services
| * Added stub for nim:aoc service...archshift2014-12-163-0/+60
| |
| * Added stub for cecd:u service...archshift2014-12-163-0/+52
| | | | | | | | I couldn't find any information about this service...
| * Added stub for ldr:ro service...archshift2014-12-163-0/+57
| |
| * Added am:app service stub.archshift2014-12-163-0/+52
| | | | | | | | Apparently nothing at all is known about this service...
* | Remove SyncRequest from K::Object and create a new K::Session typeYuri Kunde Schlesner2014-12-1510-59/+49
|/ | | | | | | This is a first step at fixing the conceptual insanity that is our handling of service and IPC calls. For now, interfaces still directly derived from Session because we don't have the infrastructure to do it properly. (That is, Processes and scheduling them.)
* Convert old logging calls to new logging macrosYuri Kunde Schlesner2014-12-1311-84/+60
|
* Merge pull request #267 from bunnei/apt-shared-fontbunnei2014-12-131-34/+100
|\ | | | | APT shared font loading
| * APT_U: Added GetSharedFont service function.bunnei2014-12-131-34/+100
| |
* | DSP: Added stub for ReadPipeIfPossible.bunnei2014-12-121-1/+45
|/
* CFG:U: Store country codes as u16 instead of char pointers, and return the correct error in GetCountryCodeID.Emmanuel Gil Peyrot2014-12-101-44/+48
|
* GSP: Trigger GPU interrupts at more accurate locations.bunnei2014-12-101-7/+6
|
* GSP: Updated TriggerCmdReqQueue to return success code.bunnei2014-12-101-0/+3
|
* GSP: Updated RegisterInterruptRelayQueue to return expected magic number.bunnei2014-12-101-1/+4
|
* GPU: Fixed bug in command list size decoding.bunnei2014-12-101-1/+1
|
* Merge pull request #217 from archshift/cmd_buffbunnei2014-12-091-12/+12
|\ | | | | Log the cmd_buff arguments when citra comes across an unimplemented function
| * Log the cmd_buff arguments when citra comes across an unimplemented functionarchshift2014-11-251-12/+12
| |
* | Merge pull request #222 from archshift/renamexyzbunnei2014-12-051-5/+89
|\ \ | | | | | | Implemented RenameFile and RenameDirectory in FS:USER
| * | Updated archive.cpp functions for proper error handlingarchshift2014-12-041-5/+5
| | |
| * | Implemented RenameDirectory in FS:USERarchshift2014-11-251-1/+43
| | |
| * | Implemented RenameFile in FS:USERarchshift2014-11-251-1/+43
| |/
* | Merge pull request #247 from lioncash/constbunnei2014-12-042-4/+4
|\ \ | | | | | | hid_user: Pass by reference with PadButtonPress/PadButtonRelease
| * | hid_user: Pass by reference with PadButtonPress/PadButtonReleaseLioncash2014-12-042-4/+4
| | |
* | | Merge pull request #238 from archshift/dspbunnei2014-12-041-25/+44
|\ \ \ | | | | | | | | Add stub for ConvertProcessFromDspDram
| * | | Add stub for ConvertProcessFromDspDramarchshift2014-12-041-25/+44
| | | | | | | | | | | | | | | | Should theoretically push retail stuff further along
* | | | PTM_U: Added a stub for GetBatteryLevel & GetBatteryChargeState & GetAdapterStatepurpasmart962014-12-041-3/+72
| |/ / |/| |
* | | Merge pull request #231 from purpasmart96/serv_ac_wifi_statusbunnei2014-12-031-1/+19
|\ \ \ | | | | | | | | AC_U: Added a stub for GetWifiStatus
| * | | AC_U: Added a stub for GetWifiStatuspurpasmart962014-12-031-1/+19
| | |/ | |/|
* | | Merge pull request #219 from Subv/ptmbunnei2014-12-031-1/+18
|\ \ \ | |_|/ |/| | PTM_U: Implemented the GetShellState function.
| * | PTM_U: Implemented the GetShellState function.Subv2014-12-011-1/+18
| | |
* | | Merge pull request #224 from bunnei/dsp-service-improvementsbunnei2014-12-012-26/+107
|\ \ \ | | | | | | | | Dsp service improvements
| * | | DSP: Added stubs for several commonly used DSP service functions.bunnei2014-12-011-25/+106
| | | |
| * | | DSP: Fixed typo in port name.bunnei2014-12-011-1/+1
| | |/ | |/|
* | | CFG:U: Implemented the GetCountryCodeID and GetCountryCodeString.Subv2014-11-301-2/+86
| | |
* | | Fixed formatting and switch statement warningsvaguilar2014-11-271-3/+3
|/ /
* | Remove duplicated docs/update them for changed parameters.Yuri Kunde Schlesner2014-11-241-10/+0
| |
* | HLE: Revamp error handling throrough the HLE codeYuri Kunde Schlesner2014-11-246-62/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All service calls in the CTR OS return result codes indicating the success or failure of the call. Previous to this commit, Citra's HLE emulation of services and the kernel universally either ignored errors or returned dummy -1 error codes. This commit makes an initial effort to provide an infrastructure for error reporting and propagation which can be use going forward to make HLE calls accurately return errors as the original system. A few parts of the code have been updated to use the new system where applicable. One part of this effort is the definition of the `ResultCode` type, which provides facilities for constructing and parsing error codes in the structured format used by the CTR. The `ResultVal` type builds on `ResultCode` by providing a container for values returned by function that can report errors. It enforces that correct error checking will be done on function returns by preventing the use of the return value if the function returned an error code. Currently this change is mostly internal since errors are still suppressed on the ARM<->HLE border, as a temporary compatibility hack. As functionality is implemented and tested this hack can be eventually removed.
* | Merge pull request #191 from archshift/deletexyzbunnei2014-11-241-25/+67
|\ \ | |/ |/| Added DeleteFile and DeleteDirectory functions to FS:USER and the archives.
| * Added DeleteFile and DeleteDirectory functions to FS:USER and the archives.archshift2014-11-231-25/+67
| |
* | Add more services and some fixes, along with more "override"purpasmart962014-11-2125-17/+452
| | | | | | | | in the service's headers
* | Merge pull request #211 from linkmauve/masterbunnei2014-11-1911-21/+21
|\ \ | | | | | | Remove trailing spaces from the entire project
| * | Remove trailing spaces in every file but the ones imported from SkyEye, AOSP or generatedEmmanuel Gil Peyrot2014-11-1911-21/+21
| | |
* | | Add static to some variablesLioncash2014-11-191-1/+1
|/ /
* / core: Mark some hle functions as staticLioncash2014-11-184-20/+20
|/ | | | These functions are not referred to by their linkage name outside of the translation unit, so they can be marked as static.
* FS_User: Support FileSye::Path in a more generic way.bunnei2014-11-181-42/+65
| | | | added a todo to kernel archive
* FileSys: Updated backend code to use FileSys::Path instead of string for paths.bunnei2014-11-181-4/+4
|
* Add missing boss:U service, needed according to Nintendo Zone logs.archshift2014-11-173-0/+57
|
* Merge pull request #183 from archshift/lowpathbunnei2014-11-131-83/+81
|\ | | | | Add support for UTF-16 strings for LowPaths in FS:USER
| * Use std::u16string for conversion between UTF-8 and UTF-16, FS:USER functionsarchshift2014-11-132-138/+40
| |
| * Add support for UTF-16 strings for LowPaths in FS:USERarchshift2014-11-102-86/+182
| |
* | Merge pull request #188 from bunnei/apt-fixesbunnei2014-11-121-19/+90
|\ \ | | | | | | APT_U: Various improvements and bug fixes.
| * | APT_U: Added stub for function AppletUtility.bunnei2014-11-121-1/+29
| | |
| * | APT_U: Set a valid parameter buffer size in GlanceParameter.bunnei2014-11-121-17/+39
| | | | | | | | | | | | - Also Clarified GlanceParameter/ReceiveParameter documentation.
| * | APT_U: Release service lock on initialization.bunnei2014-11-121-0/+4
| | |
| * | APT_U: Fixes for GetLockHandle to boot system titles.bunnei2014-11-121-1/+18
| |/ | | | | | | - Also added comment to GetLockHandle function.
* / Add FRD:U service and functionsarchshift2014-11-113-0/+64
|/
* Merge pull request #163 from archshift/create-directorybunnei2014-11-021-2/+38
|\ | | | | Added CreateDirectory function to service/fs.cpp, and in Archive.
| * Added CreateDirectory function to service/fs.cpp, and in Archive.archshift2014-11-021-2/+38
| |
* | Added ReceiveNotification, PublishToSubscriber unimplemented functions to SRVarchshift2014-11-021-0/+2
|/
* Added stub err:f service.archshift2014-11-023-0/+56
|
* Added a bunch of servicespurpasmart962014-11-0117-0/+581
|
* FS:USER - Implemented IsSdmcDetectedarchshift2014-10-301-1/+17
|
* Renamed souce files of services to match port namesGareth Poole2014-10-2911-10/+10
|
* Merge pull request #141 from archshift/crash-huntbunnei2014-10-281-0/+4
|\ | | | | hid.cpp: Fixed crash when updating pad data while null
| * hid.cpp: Fixed crash when updating pad data while nullarchshift2014-10-141-0/+4
| | | | | | | | Fixes #137
* | Add `override` keyword through the code.Yuri Kunde Schlesner2014-10-267-11/+11
| | | | | | | | This was automated using `clang-modernize`.
* | Don’t fail on empty filename in OpenFileDirectly, return the archive handle insteadEmmanuel Gil Peyrot2014-10-251-8/+7
|/
* APT: Added a stub for the "GlanceParameter" function.purpasmart962014-10-081-1/+31
|
* Added some more names to the function tablepurpasmart962014-10-051-0/+2
| | | Added "SetApplicationCpuTimeLimit" and "GetApplicationCpuTimeLimit" to apt.cpp
* added "StoreDataCache" to the function tablepurpasmart962014-09-301-0/+1
| | | seems simple enough
* FS: Implement OpenArchive, OpenDirectory, OpenFile and OpenFileDirectly calls.Emmanuel Gil Peyrot2014-09-171-20/+177
|
* Added support for multiple input device types for KeyMap and connected Qt.Kevin Hartman2014-09-122-113/+127
|
* Initial HID PAD work, with GLFW only.Kevin Hartman2014-09-122-24/+197
|
* Created structure for PAD.Kevin Hartman2014-09-122-0/+28
|
* core: Prune redundant includesarchshift2014-09-095-11/+0
|
* core: Pass string by reference in FetchFromPortName and DeleteServiceLioncash2014-09-062-4/+4
|
* srv::Initialize: Return "success" status code.bunnei2014-08-281-0/+4
|
* Pica/citra-qt: Replace command list view and command list debugging code with something more sophisticated.Tony Wasserka2014-08-251-5/+0
|
* GSP: Update framebuffer information when necessary.Tony Wasserka2014-08-252-2/+41
|
* GSP: Implement SetBufferSwap.Tony Wasserka2014-08-252-1/+47
|
* GSP: Add a helper function for convenience.Tony Wasserka2014-08-251-17/+22
|
* Core: Alter the kernel string functions to use std::string instead of const char*.Lioncash2014-08-187-11/+11
| | | | Most functions already operate on std::strings. This also removes the need to manually null terminate thread names.
* Merge pull request #39 from bunnei/hid-minor-improvementsbunnei2014-08-131-5/+44
|\ | | | | Hid minor improvements
| * HID: Added new function entries from 3dbrew to FunctionTable.bunnei2014-08-131-0/+5
| | | | | | | | HID: Fix typo with DisableGyroscopeLow command.
| * HID: Implemented HID_User::GetIPCHandles service function.bunnei2014-08-081-5/+39
| |
* | Pica/GPU: Change hardware registers to use physical addresses rather than virtual ones.Tony Wasserka2014-08-121-9/+9
| | | | | | | | | | This cleans up the mess that address reading/writing had become and makes the code a *lot* more sensible. This adds a physical<->virtual address converter to mem_map.h. For further accuracy, we will want to properly extend this to support a wider range of address regions. For now, this makes simply homebrew applications work in a good manner though.
* | GSP: Fix a major regression introduced in ffda035c, due to which no display transfers were triggered at all anymore.Tony Wasserka2014-08-121-4/+13
| |
* | Remove the fancy RegisterSet class introduced in 4c2bff61e.Tony Wasserka2014-08-121-18/+18
|/ | | | | While it was some nice and fancy template usage, it ultimately had many practical issues regarding length of involved expressions under regular usage as well as common code completion tools not being able to handle the structures. Instead, we now use a more conventional approach which is a lot more clean to use.
* GSP: Cleaned up command buffer decoding.bunnei2014-08-072-61/+69
| | | | | | | | GSP: Cleaned up code and added additional comments. GSP: Removed unnecessary TODO comment. GSP: Changed u32 iterators in TriggerCmdReqQueue to unsigned.
* GSP: Added reinitialization of other state objects.bunnei2014-08-061-0/+3
|
* GSP: Removed dumb GX prefixes to functions/structs in GSP namespace.bunnei2014-08-062-77/+78
| | | | - Various other cleanups.
* GSP: Removed unnecessary GX_FinishCommand function.bunnei2014-08-061-13/+5
|
* GSP: Implements preliminary command synchronization via GPU interrupts.bunnei2014-08-062-18/+109
| | | | Core: Added a comment to explain the logic for the RunLoop iterations.
* SRV: Updated GetProcSemaphore to create an event instead of a mutex.bunnei2014-08-061-8/+10
|
* FS: Fix port name (old port name was based on an unaligned memory read).bunnei2014-08-061-1/+1
|
* GSP: Add a few comments.Tony Wasserka2014-07-232-1/+15
|
* GSP: Clean up GX command processing a lot and treat command id as a u8 rather than a u32.Tony Wasserka2014-07-232-37/+79
| | | | Anonymous structs are not standard C++, hence don't use them.
* GPU: Make use of RegisterSet.Tony Wasserka2014-07-231-21/+28
|
* GPU: Emulate memory fills.Tony Wasserka2014-07-232-1/+9
|
* GSP: HLE GXCommandId::SET_DISPLAY_TRANSFER and GXCommandId::SET_TEXTURE_COPY.Tony Wasserka2014-07-231-2/+9
|
* GSP: Implement ReadHWRegs and WriteHWRegs properly.Tony Wasserka2014-07-231-27/+46
|
* GSP: Fixed to use real shared memory object, various cleanups.bunnei2014-07-051-25/+34
| | | | | | | | - Previously, used a hard-coded shared memory handle of 0x10002000 (as used by libctru homebrew) GSP: Added name for shared memory. GSP: Cleaned up assertion message.
* FileSys: Added preliminary support for applications reading the RomFS archive.bunnei2014-07-051-3/+30
| | | | | | | | | | Archive: Fixed brace ugliness for neobrain :) FS: Commented out unused local variables to prevent warnings. ...But keeping them here for future use. archive_romfs: Removed unused #include.
* APT: Added stubbed ReceiveParameter and various cleanups.bunnei2014-07-041-71/+93
| | | | | | APT: More cleanups. APT: Changed SignalType to be type u32.
* FS: Added stubbed code to intercept and decode file system service functions.bunnei2014-06-273-0/+154
| | | | FS: Added to CMakeLists.txt
* Merge branch 'threading' of https://github.com/bunnei/citrabunnei2014-06-149-148/+271
|\ | | | | | | | | | | Conflicts: src/core/hle/function_wrappers.h src/core/hle/service/gsp.cpp
| * HLE: Updated all uses of NULL to nullptr (to be C++11 compliant)bunnei2014-06-137-118/+118
| |
| * HLE: Updated various handle debug assertions to be more clear.bunnei2014-06-131-1/+1
| |
| * Kernel: Updated several member functions to be constbunnei2014-06-131-2/+2
| |
| * service: added a error log messages for unimplemented WaitSynchronizationbunnei2014-06-051-0/+1
| |
| * svc: added optional name field to Event and Mutex (used for debugging)bunnei2014-06-032-4/+4
| |
| * gsp: always pass through synchronization barrier for commandsbunnei2014-06-011-1/+16
| |
| * hle: added stubbed service for ndm_ubunnei2014-05-302-0/+65
| |
| * service: cleaned up log messagesbunnei2014-05-301-2/+2
| |
| * service: removed PT_A from, as this was just an alias for APT_Ubunnei2014-05-301-2/+0
| |
| * srv: fix to log unimplemented service (instead of crash)bunnei2014-05-301-6/+2
| |
| * hle: cleaned up log messagesbunnei2014-05-304-11/+15
| |
| * service: added additional hack to return success on unimplemented service callsbunnei2014-05-301-2/+10
| |
| * srv: changed a NOTICE_LOG to DEBUG_LOGbunnei2014-05-301-1/+1
| |
| * apt: added stubbed function for InquireNotificationbunnei2014-05-291-78/+86
| |
| * service: changed interface to return 0 (no error) when a service method is unimplemented - hack to make apps boot furtherbunnei2014-05-291-2/+2
| |
| * APT_U: added stubbed function for APT_U::Enable, fixed some log messages to be more consistentbunnei2014-05-281-3/+10
| |
| * APT_U: added event creation to Initialize methodbunnei2014-05-281-1/+11
| |
| * kernel: added WaitSynchronization method to Kernel::Objectbunnei2014-05-271-0/+10
| |
| * kernel: updated SyncRequest to take boolean thread wait result as a parameterbunnei2014-05-271-3/+4
| |
| * service: Renamed Sync to SyncRequestbunnei2014-05-271-1/+1
| |
| * srv: added a real mutex for GetProcSemaphore (instead of stubbed)bunnei2014-05-271-3/+10
| |
| * kernel: add a SyncRequest method to KernelObject for use with svcSendSyncRequestbunnei2014-05-271-6/+0
| |
* | GPU debugger: Add functionality to inspect command lists.Tony Wasserka2014-06-121-0/+4
| |
* | GPU: Cleanup register definitions.Tony Wasserka2014-06-121-3/+3
| |
* | Rename LCD to GPU.Tony Wasserka2014-06-121-8/+8
| |
* | Add initial graphics debugger interface.Tony Wasserka2014-06-121-0/+6
| |
* | GSP: Define more GX commands.Tony Wasserka2014-06-122-14/+54
| |
* | service: fixed typo that MSVC did not catch as an errorbunnei2014-05-231-1/+1
|/
* APT_U: added a debug log on calling GetLockHandlebunnei2014-05-231-0/+1
|
* mutex: refactored the interface to code to return a Mutex* handlebunnei2014-05-211-1/+2
|
* mutex: initial commit of HLE modulebunnei2014-05-211-6/+4
|
* service: removed redundant include of common_types.hbunnei2014-05-211-1/+0
|
* renamed "syscall" module to "svc" (more accurate naming)bunnei2014-05-211-1/+1
|
* - created a Kernel namespacebunnei2014-05-212-8/+8
| | | | | - cleaned up Kernel code a bit (moved stuff into namespace, fixed whitespace issues) - added handle types for all different CTROS handles
* apt: changed stubbed handle to be something other than 0xDEADBEEF (used as a magic value in other places) so that I can track how it propagates through the app codebunnei2014-05-201-1/+1
|
* - renamed NewHandle to CreateHandlebunnei2014-05-192-8/+8
| | | | - updated CreateHandle/DeleteHandle to use KernelObject's
* - updated service(s) to be KernelObject'sbunnei2014-05-196-55/+26
| | | | - various cleanups
* renamed "UID" to "Handle" where appropriatebunnei2014-05-193-22/+20
|
* - moved Handle/Result definitions to kernel.hbunnei2014-05-193-7/+9
| | | | - added ResetType enum
* added stubbed GetProcSemaphore - does nothing but avoids an exceptionbunnei2014-05-171-1/+7
|
* updated APT_U::GetLockHandle to return a valid handlebunnei2014-05-171-1/+5
|
* removed unknown fields from GX_CmdBufferHeaderbunnei2014-05-081-5/+0
|
* - removed HLE mem "hack" and replaced with kernel mem regionbunnei2014-05-084-8/+84
| | | | | - added a helper function for getting command buffer for services - fixed bug where GSP DMA was incorrectly being done in DataSynchronizationBarrier (instead of gsp_TriggerCmdReqQueue)
* removed DISALLOW_COPY_AND_ASSIGN in favor of NonCopyable classbunnei2014-04-283-9/+0
|
* fixed weird spacingbunnei2014-04-281-1/+1
|
* hackish but working way to set the framebuffer location to VRAM (used in ARM11 demos tested thus far, e.g. yeti3DS)bunnei2014-04-271-3/+9
|
* added simple GSP GPU ReadHWRegs function to support returning the framebuffer addressbunnei2014-04-261-1/+37
|
* added GSP::RegisterInterruptRelayQueue functionbunnei2014-04-251-31/+40
|
* - refactored how service functions are calledbunnei2014-04-255-19/+39
| | | | - added option to create/delete service handles
* fixed bug with printing std::string in log messagesbunnei2014-04-171-2/+2
|
* added class stub for HID:User servicebunnei2014-04-173-0/+72
|
* updated service commentsbunnei2014-04-176-5/+17
|
* - added stubbed out GSP::Gpu service interfacebunnei2014-04-167-7/+103
| | | | - various cleanups/refactors to HLE services
* removed no longer used function headerbunnei2014-04-161-2/+0
|
* restructured hle:services completely to use function lookup tablesbunnei2014-04-165-137/+215
|
* fixed naming for APT_Ubunnei2014-04-163-9/+9
|
* - extracted srv: calls from service.cpp and put in its own modulebunnei2014-04-164-106/+105
| | | | | - added function tables for service calls - lots of refactoring
* added a stub for GetLockHandlebunnei2014-04-143-9/+44
|
* added framework for APT service (application and title launching service)bunnei2014-04-134-5/+117
|
* renamed class Interface_SRV to SRVbunnei2014-04-131-6/+6
|
* added some very initial command parsing for SRV Syncbunnei2014-04-131-5/+31
|
* cleanups to service HLEbunnei2014-04-132-8/+8
|
* - added HLE to connect to "srv:" servicebunnei2014-04-132-2/+170
| | | | | | - added a manager for keeping track of services/ports - added a memory mapped region for memory accessed by HLE - added HLE for GetThreadCommandBuffer function
* - renamed hle_syscall to just syscallbunnei2014-04-121-0/+60
- added service.h as an initial service interface