summaryrefslogtreecommitdiffstats
path: root/src/common (follow)
Commit message (Collapse)AuthorAgeFilesLines
* Merge pull request #2247 from lioncash/includebunnei2019-03-212-4/+4
|\ | | | | common/thread_queue_list: Remove unnecessary dependency on boost
| * common/thread_queue_list: Remove unnecessary dependency on boostLioncash2019-03-162-4/+4
| | | | | | | | | | | | | | | | | | We really don't need to pull in several headers of boost related machinery just to perform the erase-remove idiom (particularly with C++20 around the corner, which adds universal container std::erase and std::erase_if, which we can just use instead). With this, we don't need to link in anything boost-related into common.
* | core: Move PageTable struct into Common.bunnei2019-03-175-0/+171
| |
* | Merge pull request #2129 from FernandoS27/cntpctbunnei2019-03-173-0/+57
|\ \ | |/ |/| Correct CNTPCT from using CPU Cycles to using Clock Cycles
| * Corrections, documenting and fixes.Fernando Sahmkow2019-02-162-9/+11
| |
| * Use u128 on Clock Cycles calculation.Fernando Sahmkow2019-02-162-21/+26
| |
| * Implement 128 bits Unsigned Integer Multiplication and Division.Fernando Sahmkow2019-02-163-0/+50
| |
* | Merge pull request #2147 from ReinUsesLisp/texture-cleanbunnei2019-03-101-0/+1
|\ \ | | | | | | shader_ir: Remove "extras" from the MetaTexture
| * | shader/decode: Split memory and texture instructions decodingReinUsesLisp2019-02-261-0/+1
| | |
* | | common/bit_field: Make BitField trivially copyableLioncash2019-03-071-9/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This makes the class much more flexible and doesn't make performing copies with classes that contain a bitfield member a pain. Given BitField instances are only intended to be used within unions, the fact the full storage value would be copied isn't a big concern (only sizeof(union_type) would be copied anyways). While we're at it, provide defaulted move constructors for consistency.
* | | logging/backend: Make time_origin a class variable instead of a local staticLioncash2019-03-021-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | Moves local global state into the Impl class itself and initializes it at the creation of the instance instead of in the function. This makes it nicer for weakly-ordered architectures, given the CreateEntry() class won't need to have atomic loads executed for each individual call to the CreateEntry class.
* | | logging/backend: Move CreateEntry into the Impl classLioncash2019-03-022-29/+26
| | | | | | | | | | | | | | | This function is only ever used within this source file and makes it easier to remove static state in the following change.
* | | common/math_util: Move contents into the Common namespaceLioncash2019-02-271-2/+2
| | | | | | | | | | | | | | | These types are within the common library, so they should be within the Common namespace.
* | | common/vector_math: Move Vec[x] types into the Common namespaceLioncash2019-02-273-25/+25
| | | | | | | | | | | | | | | These types are within the common library, so they should be using the Common namespace.
* | | common/quaternion: Move Quaternion into the Common namespaceLioncash2019-02-271-2/+2
|/ / | | | | | | | | Quaternion is within the common library, so it should be using the Common namespace.
* | Remove GCC version checkstgsm2019-02-241-3/+3
| | | | | | | | Citra can't be compiled using GCC <7 because of required C++17 support, so these version checks don't need to exist anymore.
* | Adressed review commentsB3n302019-02-152-7/+9
| |
* | threadsafe_queue: Add WaitIfEmpty and use it in loggingB3n302019-02-153-14/+26
|/
* Merge pull request #2113 from ReinUsesLisp/vulkan-basebunnei2019-02-142-0/+2
|\ | | | | vulkan: Add dependencies and device abstraction
| * logging: Add Vulkan backend logging class typeReinUsesLisp2019-02-122-0/+2
| |
* | threadsafe_queue: Use std::size_t for representing sizeLioncash2019-02-131-7/+6
| | | | | | | | | | | | Makes it consistent with the regular standard containers in terms of size representation. This also gets rid of dependence on our own type aliases, removing the need for an include.
* | threadsafe_queue: Remove NeedSize template parameterLioncash2019-02-131-13/+11
|/ | | | | | The necessity of this parameter is dubious at best, and in 2019 probably offers completely negligible savings as opposed to just leaving this enabled. This removes it and simplifies the overall interface.
* cmake: Fix title bar issueReinUsesLisp2019-02-071-1/+14
|
* cmake: Use CMAKE_COMMAND instead of "cmake"Frederic L2019-02-071-1/+1
| | | Co-Authored-By: ReinUsesLisp <reinuseslisp@airmail.cc>
* gl_shader_disk_cache: Invalidate shader cache changes with CMake hashReinUsesLisp2019-02-073-39/+56
|
* file_util: Add shader directoryReinUsesLisp2019-02-073-0/+3
|
* Merge pull request #1928 from lioncash/capsbunnei2018-12-272-0/+62
|\ | | | | kernel: Handle kernel capability descriptors
| * common: Add basic bit manipulation utility function to CommonLioncash2018-12-212-0/+62
| |
* | common/quaternion: Ensure that w is always initializedLioncash2018-12-211-1/+1
|/ | | | | Previously xyz was always being zero initialized due to its constructor, but w wasn't. Ensures that we always have a deterministic initial state.
* Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-151-0/+16
|\ | | | | svc: Implement yield types 0 and -1
| * scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-221-2/+2
| |
| * svc: Implement yield types 0 and -1Zach Hilman2018-11-191-0/+16
| |
* | Backport review comment from citra-emu/citra#4418Tobias2018-12-071-2/+2
| | | | | | | | Original reason: As Windows multi-byte character codec is unspecified while we always assume std::string uses UTF-8 in our code base, this can output gibberish when the string contains non-ASCII characters. ::OutputDebugStringW combined with Common::UTF8ToUTF16W is preferred here.
* | Merge pull request #1773 from lioncash/threadbunnei2018-11-232-41/+14
|\ \ | | | | | | common/thread: Minor cleanup
| * | common/thread: Drop Hungarian notation on SetCurrentThreadName's parameterLioncash2018-11-221-7/+7
| | | | | | | | | | | | This is inconsistent with our coding style.
| * | common/thread: Make Barrier's 'count' member non-constLioncash2018-11-221-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While admirable as a means to ensure immutability, this has the unfortunate downside of making the class non-movable. std::move cannot actually perform a move operation if the provided operand has const data members (std::move acts as an operation to "slide" resources out of an object instance). Given Barrier contains move-only types such as std::mutex, this can lead to confusing error messages if an object ever contained a Barrier instance and said object was attempted to be moved.
| * | common/thread: Initialize class member variables where applicableLioncash2018-11-221-6/+4
| | | | | | | | | | | | Simplifies the constructor interfaces for Barrier and Event classes.
| * | common/thread: Group non-member functions togetherLioncash2018-11-221-3/+2
| | | | | | | | | | | | | | | Keeps the non-member interface in one spot instead of split into two places, making it nicer to locate functions.
| * | common/thread: Remove SleepCurrentThread()Lioncash2018-11-222-12/+0
| | | | | | | | | | | | | | | | | | | | | This is also unused and superceded by standard functionality. The standard library provides std::this_thread::sleep_for(), which provides a much more flexible interface, as different time units can be used with it.
| * | common/thread: Remove unused CurrentThreadId()Lioncash2018-11-222-12/+0
| | | | | | | | | | | | | | | | | | This is an old function that's no longer necessary. C++11 introduced proper threading support to the language and a thread ID can be retrieved via std::this_thread::get_id() if it's ever needed.
* | | common: Remove bit_set.hLioncash2018-11-222-245/+0
|/ / | | | | | | | | | | | | This is an analog of BitSet from Dolphin that was introduced to allow iterating over a set of bits. Given it's currently unused, and given that std::bitset exists, we can remove this. If it's ever needed in the future it can be brought back.
* | Merge pull request #1758 from lioncash/rectbunnei2018-11-211-11/+5
|\ \ | | | | | | common/math_util: Minor cleanup
| * | common/math_util: Simplify std::make_signed usages to std::make_signed_tLioncash2018-11-211-2/+2
| | | | | | | | | | | | Gets rid of the need to use typename to access the ::type alias.
| * | common/math_util: Make Rectangle's constructors constexprLioncash2018-11-211-2/+2
| | | | | | | | | | | | | | | Allows objects that contain rectangle instances to be constexpr constructible as well.
| * | common/math_util: Remove unnecessary static from PILioncash2018-11-211-1/+1
| | | | | | | | | | | | const/constexpr variables have internal linkage by default.
| * | common/math_util: Remove unused IntervalsIntersect() functionLioncash2018-11-211-6/+0
| | | | | | | | | | | | | | | This hasn't been used since the project started, so we may as well get rid of it to keep it from bit rotting.
* | | common: Remove dependency on xbyakLioncash2018-11-213-274/+0
|/ / | | | | | | | | | | | | Xbyak is currently entirely unused. Rather than carting it along, remove it and get rid of a dependency. If it's ever needed in the future, then it can be re-added (and likely be more up to date at that point in time).
* | common/assert: Add UNIMPLEMENTED_IF and UNIMPLEMENTED_IF_MSG for conditional assertionsLioncash2018-11-211-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, there's no way to specify if an assertion should conditionally occur due to unimplemented behavior. This is useful when something is only partially implemented (e.g. due to ongoing RE work). In particular, this would be useful within the graphics code. The rationale behind this is it allows a dev to disable unimplemented feature assertions (which can occur in an unrelated work area), while still enabling regular assertions, which act as behavior guards for conditions or states which must not occur. Previously, the only way a dev could temporarily disable asserts, was to disable the regular assertion macros, which has the downside of also disabling, well, the regular assertions which hold more sanitizing value, as opposed to unimplemented feature assertions.
* | common/assert: Make the UNIMPLEMENTED macro properly assertLioncash2018-11-201-1/+1
| | | | | | | | | | | | | | | | Currently, this was only performing a logging call, which doesn't actually invoke any assertion behavior. This is unlike UNIMPLEMENTED_MSG, which *does* assert. This makes the expected behavior uniform across both macros.
* | am: Deglobalize software keyboard appletZach Hilman2018-11-182-4/+4
| |
* | string_util: Implement buffer to UTF-16 string helper functionZach Hilman2018-11-182-0/+17
|/ | | Needed as most all software keyboard functions use fixed-length UTF16 string buffers.
* Common/Bitfield: store value as unsigned typeWeiyi Wang2018-11-161-9/+10
| | | | Storing signed type causes the following behaviour: extractValue can do overflow/negative left shift. Now it only relies on two implementation-defined behaviours (which are almost always defined as we want): unsigned->signed conversion and signed right shift
* string_util: Remove ArrayToString()Lioncash2018-11-142-21/+0
| | | | | | | | An old function from Dolphin. This is also unused, and pretty inflexible when it comes to printing out different data types (for example, one might not want to print out an array of u8s but a different type instead. Given we use fmt, there's no need to keep this implementation of the function around.
* string_util: Remove TryParse()Lioncash2018-11-142-54/+3
| | | | | | This is an unused hold-over from Dolphin that was primarily used to parse values out of the .ini files. Given we already have libraries that do this for us, we don't need to keep this around.
* string_util: Remove ThousandSeparate()Lioncash2018-11-131-14/+0
| | | | | This is currently unused and doesn't really provide much value to keep around either.
* Merge pull request #1441 from CarlKenner/DebuggerLogbunnei2018-11-052-2/+23
|\ | | | | logging: Add DebuggerBackend for logging to Visual Studio
| * logging: Add DebuggerBackend for logging to Visual StudioCarl Kenner2018-10-072-2/+23
| |
* | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-281-0/+4
| |
* | logging/backend: Add missing services to the log filtersLioncash2018-10-242-0/+5
| | | | | | | | Just a few overlooked services.
* | common: Remove memory_util.cpp/.hLioncash2018-10-233-200/+0
| | | | | | | | | | | | | | | | Everything from here is completely unused and also written with the notion of supporting 32-bit architecture variants in mind. Given the Switch itself is on a 64-bit architecture, we won't be supporting 32-bit architectures. If we need specific allocation functions in the future, it's likely more worthwhile to new functions for that purpose.
* | only redefine 64 bit file operation for MSVCWeiyi Wang2018-10-231-5/+8
| | | | | | | | MinGW provides POSIX functions
* | service: Add skeleton for psm serviceZach Hilman2018-10-211-0/+1
| | | | | | | | Seems to be the power controller. Listed in switchbrew under the category PTM services.
* | common: Add function for checking word alignment to alignment.hLioncash2018-10-181-0/+6
| | | | | | | | | | This will be used in a following change to svcArbitrateLock() and svcArbitrateUnlock()
* | common: Move Is4KBAligned() to alignment.hLioncash2018-10-181-0/+6
| | | | | | | | | | Aligning on 4KB pages isn't a Switch-specific thing, so this can be moved to common so it can be used with other things as well.
* | web_backend: Make Client use the PImpl idiomLioncash2018-10-111-0/+1
| | | | | | | | | | | | Like with TelemetryJson, we can make the implementation details private and avoid the need to expose httplib to external libraries that need to use the Client class.
* | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-082-0/+24
|\ \ | | | | | | ips_layer: Add support for IPSwitch executable patches
| * | ips_layer: Deduplicate resource usageZach Hilman2018-10-042-2/+2
| | |
| * | hex_util: Add HexVectorToString and HexStringToVectorZach Hilman2018-10-042-0/+24
| | | | | | | | | | | | Converts between bytes and strings when the size is not known at compile time.
* | | Merge pull request #1453 from FearlessTobi/port-4311bunnei2018-10-071-1/+1
|\ \ \ | | | | | | | | Port citra-emu/citra#4311: "Remove "#" in the version number"
| * | | Remove "#" in the version numberfearlessTobi2018-10-061-1/+1
| | |/ | |/| | | | | | | So that people can stop using it in issue/pr comments and randomly link some other issue/pr unintentionally.
* / | citra_qt/configuration: misc input tab improvementszhupengfei2018-10-062-1/+19
|/ / | | | | | | | | | | | | | | * Added a context menu on the buttons including Clear & Restore Default * Allow clearing (unsetting) inputs. Added a Clear All button * Allow restoring a single input to default (instead of all)
* | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-064-0/+108
|\ \ | | | | | | Port web_service from Citra
| * | Review comments - part 5fearlessTobi2018-10-021-0/+1
| | |
| * | Address a bunch of review commentsfearlessTobi2018-10-021-1/+1
| | |
| * | Port web_service from CitrafearlessTobi2018-10-024-0/+107
| | |
* | | Merge pull request #1442 from lioncash/formatbunnei2018-10-051-1/+1
|\ \ \ | |_|/ |/| | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()
| * | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()Lioncash2018-10-051-1/+1
| |/ | | | | | | | | | | | | | | | | operator+ for std::string creates an entirely new string, which is kind of unnecessary here if we just want to append a null terminator to the existing one. Reduces the total amount of potential allocations that need to be done in the logging path.
* | string_util: unify UTF8<->UTF16 conversion to codecvtWeiyi Wang2018-10-021-109/+6
| |
* | string_util: remove TString conversion for windowsWeiyi Wang2018-10-022-19/+1
| | | | | | | | First of all they are foundamentally broken. As our convention is that std::string is always UTF-8, these functions assume that the multi-byte character version of TString (std::string) from windows is also in UTF-8, which is almost always wrong. We are not going to build multi-byte character build, and even if we do, this dirty work should be handled by frontend framework early.
* | string_util: remove ShiftJIS/CP1252 conversion functionWeiyi Wang2018-10-022-22/+0
|/ | | | We always use unicode internally. Any dirty work of conversion with other codec should be handled by frontend framework (Qt). Further more, ShiftJIS/CP1252 are not special (they are not code set used by 3ds, or any guest/host dependencies we have), so there is no reason to specifically include them
* Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-253-0/+6
|\ | | | | file_sys: Add support for LayeredFS mods
| * common_paths: Add Load and Dump dirsZach Hilman2018-09-223-0/+6
| |
* | Stubbed IRS (#1349)David2018-09-242-0/+2
| | | | | | | | | | | | | | | | | | | | * Stubbed IRS Currently we have no ideal way of implementing IRS. For the time being we should have the functions stubbed until we come up with a way to emulate IRS properly. * Added IRS to logging backend * Forward declared shared memory for irs
* | common/thread: remove YieldCPU()Weiyi Wang2018-09-221-8/+0
|/ | | | simply use the standard library yield()
* ring_buffer: Use std::atomic_size_t in a static assertLioncash2018-09-191-1/+1
| | | | Avoids the need to repeat "std::" twice
* ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharingLioncash2018-09-191-2/+10
| | | | | | | | | | | | | | | | | | | | | | | | MSVC 19.11 (A.K.A. VS 15.3)'s C++ standard library implements P0154R1 (http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2016/p0154r1.html) which defines two new constants within the <new> header, std::hardware_destructive_interference_size and std::hardware_constructive_interference_size. std::hardware_destructive_interference_size defines the minimum recommended offset between two concurrently-accessed objects to avoid performance degradation due to contention introduced by the implementation (with the lower-bound being at least alignof(max_align_t)). In other words, the minimum offset between objects necessary to avoid false-sharing. std::hardware_constructive_interference_size on the other hand defines the maximum recommended size of contiguous memory occupied by two objects accessed wth temporal locality by concurrent threads (also defined to be at least alignof(max_align_t)). In other words the maximum size to promote true-sharing. So we can simply use this facility to determine the ideal alignment size. Unfortunately, only MSVC supports this right now, so we need to enclose it within an ifdef for the time being.
* Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-1523-135/+140
|
* common: Implement a ring bufferMerryMage2018-09-082-0/+112
|
* Better Title Bar DisplayCaptV0rt3x2018-09-073-5/+25
|
* common/logging: Amend documentation commentsLioncash2018-09-042-6/+6
| | | | | | | Multi-line doc comments still need the '<' after the ///, otherwise it's treated as a regular comment and makes the original doc comment broken in viewers, IDEs, etc. While we're at it, also fix some typos in the comments.
* common/logging/filter: Replace C-style case with C++ static_castLioncash2018-09-041-1/+1
|
* common/logging/filter: Make constructor explicitLioncash2018-09-041-1/+1
| | | | Implicit conversions aren't desirable here.
* Merge pull request #1170 from lioncash/retbunnei2018-08-281-1/+1
|\ | | | | file_util: Correct return value in early exit of ReadFileToString()
| * file_util: Correct return value in early exit of ReadFileToString()Lioncash2018-08-241-1/+1
| | | | | | | | | | While still essentially being zero, we should be returning a numeric value here, not a boolean typed value.
* | hex_util: Replace logic_errors with LOG_CRITICALZach Hilman2018-08-231-5/+17
|/ | | | Makes it so malformed hex strings do not crash the entire program.
* logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instanceLioncash2018-08-211-1/+1
| | | | | | | The previous form of initializing done here is a C-ism, an empty set of braces is sufficient for initializing (and doesn't potentially cause missing brace warnings, given the first member of the struct is a COORD struct).
* bit_field: Convert ToBool() into explicit operator boolLioncash2018-08-211-2/+1
| | | | Gets rid of a TODO that is long overdue.
* Merge pull request #1064 from lioncash/telemetrybunnei2018-08-212-0/+77
|\ | | | | common/telemetry: Migrate core-independent info gathering to common
| * common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-152-0/+77
| | | | | | | | | | | | | | | | | | | | | | | | Previously core itself was the library containing the code to gather common information (build info, CPU info, and OS info), however all of this isn't core-dependent and can be moved to the common code and use the common interfaces. We can then just call those functions from the core instead. This will allow replacing our CPU detection with Xbyak's which has better detection facilities than ours. It also keeps more architecture-dependent code in common instead of core.
* | common: Namespace hex_util.h/.cppLioncash2018-08-162-0/+8
| | | | | | | | | | It's in the common code, so it should be under the Common namespace like everything else.
* | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-165-0/+74
|\ \ | | | | | | file_sys: Add support for registration format
| * | file_sys: Comply to style guidelinesZach Hilman2018-08-121-0/+2
| | |
| * | file_util: Add getter for NAND registration directoryZach Hilman2018-08-122-0/+8
| | |
| * | common: Move hex string processing to separate fileZach Hilman2018-08-123-0/+64
| | |
* | | Merge pull request #1063 from lioncash/inlinebunnei2018-08-152-15/+11
|\ \ \ | | | | | | | | common/xbyak_abi: Mark defined functions in header as inline
| * | | common/xbyak_abi: Mark defined functions in header as inlineLioncash2018-08-151-7/+7
| | | | | | | | | | | | | | | | | | | | Avoids potential One Definition Rule violations when these are used in the future.
| * | | common/xbyak: Use nested namespace specifiers where applicableLioncash2018-08-152-8/+4
| | |/ | |/|
* | | Merge pull request #1054 from zhaowenlan1779/misc-fixupbunnei2018-08-151-1/+1
|\ \ \ | | | | | | | | common/misc: use windows.h
| * | | common/misc: use windows.hZhu PengFei2018-08-131-1/+1
| | | | | | | | | | | | linux-mingw does not really like this.
* | | | common: Remove unused old breakpoint source filesLioncash2018-08-153-141/+0
| |/ / |/| | | | | | | | | | | | | | | | | These currently aren't used and contain commented out source code that corresponds to Dolphin's JIT. Given our CPU code is organized quite differently, we shouldn't be keeping this around (at the moment it just adds to compile times marginally).
* | | logging/backend: Use const reference to refer to log filterLioncash2018-08-141-2/+3
| | | | | | | | | | | | | | | | | | The filter is returned via const reference, so this was making a pointless copy of the entire filter every time a message was being pushed into the logger instance.
* | | thread_queue_list: Make contains() and get_first() const member functionsLioncash2018-08-121-4/+4
| | | | | | | | | | | | These don't directly modify the contained data.
* | | thread_queue_list: Convert typedef to a type aliasLioncash2018-08-121-1/+1
| |/ |/|
* | Merge pull request #989 from lioncash/logbunnei2018-08-102-0/+16
|\ \ | | | | | | common/logging: Add missing service log categories
| * | common/logging: Add missing service log categoriesLioncash2018-08-082-0/+16
| | | | | | | | | | | | These weren't added when the services were introduced.
* | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-102-5/+19
|\ \ \ | | | | | | | | vfs: Add VfsFilesystem and fix RealVfs* implementations
| * | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-092-6/+9
| | | |
| * | | file_util: Add platform-specific slash option to SanitizePathZach Hilman2018-08-092-5/+16
| |/ /
* | | Merge pull request #988 from lioncash/colorbunnei2018-08-091-19/+31
|\ \ \ | | | | | | | | common/color: Minor cleanup
| * | | common/color: Remove unnecessary const qualifiers on return typesLioncash2018-08-081-7/+7
| | | | | | | | | | | | | | | | These are just superfluous and not necessesary
| * | | common/color: Get rid of undefined behaviorLioncash2018-08-081-12/+24
| |/ / | | | | | | | | | | | | Gets rid of type punning via reinterpret_cast within functions. Instead, we use memcpy to transfer the contents across types.
* / / vector_math: Use variable template version of is_signed in Vec classesLioncash2018-08-081-3/+3
|/ / | | | | | | Same behavior, less code
* | Merge pull request #966 from lioncash/modernizebunnei2018-08-085-11/+11
|\ \ | | | | | | common: Convert type traits templates over to variable template versions where applicable
| * | common: Convert type traits templates over to variable template versions where applicableLioncash2018-08-085-11/+11
| | | | | | | | | | | | Uses the C++17 inline variable variants
* | | Merge pull request #968 from lioncash/vecbunnei2018-08-081-180/+182
|\ \ \ | | | | | | | | vector_math: Minor cleanups
| * | | vector_math: Remove unimplemented function prototypesLioncash2018-08-081-23/+0
| | | |
| * | | vector_math: Make functions constexpr where applicableLioncash2018-08-081-154/+179
| | | |
| * | | vector_math: Convert typedefs to type aliasesLioncash2018-08-081-3/+3
| |/ /
* / / file_util: Avoid sign-conversions in WriteArray() and ReadArray()Lioncash2018-08-071-4/+8
|/ / | | | | | | Prevents compiler warnings.
* / service: Add usb servicesLioncash2018-08-072-0/+2
|/ | | | Adds basic skeleton for the usb services based off the information provided by Switch Brew.
* service: Add arp servicesLioncash2018-08-052-0/+2
| | | | | Adds the basic skeleton of the arp services based off the information provided by Switch Brew.
* Merge pull request #849 from DarkLordZach/xcibunnei2018-08-045-0/+20
|\ | | | | XCI and Encrypted NCA Support
| * Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-013-0/+3
| |
| * Use SHGetKnownFolderPath instead of SHGetFolderPathAZach Hilman2018-08-011-3/+4
| |
| * Extract mbedtls to cpp fileZach Hilman2018-08-011-1/+1
| |
| * Remove files that are not usedZach Hilman2018-08-014-0/+16
| |
* | Merge pull request #898 from lioncash/migbunnei2018-08-032-0/+2
|\ \ | | | | | | service: Add migration services
| * | service: Add migration servicesLioncash2018-08-022-0/+2
| | | | | | | | | | | | | | | Adds the basic skeleton for the mig:usr service based off information provided by Switch Brew.
* | | Merge pull request #900 from lioncash/initbunnei2018-08-031-5/+5
|\ \ \ | | | | | | | | math_util: Always initialize members of Rectangle
| * | | math_util: Always initialize members of RectangleLioncash2018-08-021-5/+5
| |/ / | | | | | | | | | Prevents potentially using the members uninitialized.
* | | logging/log: Remove incorrect description in PCV doc commentLioncash2018-08-021-1/+1
| | | | | | | | | | | | PCV isn't the parental control service.
* | | service: Add psc servicesLioncash2018-08-022-0/+2
|/ / | | | | | | | | Adds the basic skeleton for the psc services based off the information provided by Switch Brew.
* | Merge pull request #888 from lioncash/capsbunnei2018-08-022-0/+2
|\ \ | | | | | | service: Add capture services
| * | service: Add capture servicesLioncash2018-08-012-0/+2
| |/ | | | | | | | | Adds the basic skeleton for the capture services based off information provided by Switch Brew.
* / service: Add bpc and pcv servicesLioncash2018-08-012-0/+4
|/ | | | | Adds the basic skeleton for the remaining pcv-related services based off information on Switch Brew.
* Merge pull request #864 from FearlessTobi/port-3973bunnei2018-07-311-2/+30
|\ | | | | Port #3973 from Citra: "Remove polymorphism issue"
| * remove polymorphism issueB3n302018-07-291-2/+30
| |
* | Merge pull request #875 from lioncash/fgmbunnei2018-07-312-0/+2
|\ \ | | | | | | service: Add fgm services
| * | service: Add fgm servicesLioncash2018-07-312-0/+2
| | | | | | | | | | | | | | | Adds the basic skeleton for the fgm services based off the information provided by Switch Brew.
* | | service: Add the pcie serviceLioncash2018-07-312-0/+2
|/ / | | | | | | | | Adds the basic skeleton of the pcie service based off information on Switch Brew.
* | Port #3758 from Citra (#852): Add missing std::string import in text_formatterTobias2018-07-311-0/+1
| |
* | Merge pull request #861 from FearlessTobi/port-3972bunnei2018-07-302-81/+31
|\ \ | | | | | | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"
| * | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"zhupengfei2018-07-292-81/+31
| |/
* | Merge pull request #862 from FearlessTobi/port-3997bunnei2018-07-301-3/+5
|\ \ | | | | | | Port #3997 from Citra: "common/string_utils: replace boost::transform with std counterpart"
| * | common/string_utils: replace boost::transform with std counterpartzhupengfei2018-07-291-3/+5
| |/ | | | | | | Note: according to cppreference it is necessary to convert char to unsigned char when using std::tolower and std::toupper, otherwise the behaviour would be undefined.
* | Merge pull request #865 from FearlessTobi/port-3732bunnei2018-07-302-4/+2
|\ \ | | | | | | Port #3732 from Citra: "common: Fix compilation on ARM"
| * | Port #3732 from Citra: "common: Fix compilation on ARM"Cameron Cawley2018-07-292-4/+2
| |/
* | Merge pull request #857 from lioncash/wlanbunnei2018-07-302-0/+2
|\ \ | | | | | | service: Add wlan services
| * | service: Add wlan servicesLioncash2018-07-292-0/+2
| |/ | | | | | | | | Adds the basic skeleton for the wlan services based off the information on Switch Brew.
* / service: Add btm servicesLioncash2018-07-292-0/+2
|/ | | | | Adds the skeleton for the btm services based off the information on Switch Brew.
* Merge pull request #847 from lioncash/ncmbunnei2018-07-282-0/+2
|\ | | | | service: Add ncm services
| * service: Add ncm servicesLioncash2018-07-272-0/+2
| | | | | | | | | | Adds the basic skeleton for the ncm services based off information on Switch Brew.
* | Merge pull request #846 from lioncash/miibunnei2018-07-282-0/+2
|\ \ | |/ |/| service: Add mii services
| * service: Add mii servicesLioncash2018-07-272-0/+2
| | | | | | | | | | Adds the skeleton for the mii services based off information provided by Switch Brew
* | Merge pull request #845 from lioncash/nfcbunnei2018-07-272-0/+2
|\ \ | | | | | | service: Add nfc services
| * | service: Add nfc servicesLioncash2018-07-272-0/+2
| |/ | | | | | | | | Adds the skeleton of the nfc service based off the information provided on Switch Brew.
* / service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-272-0/+2
|/ | | | | Implements these functions according to the information available on Switch Brew.
* service: Add ldn servicesLioncash2018-07-262-0/+2
| | | | Adds ldn services based off information provided by Switch Brew.
* VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-242-1/+13
| | | | | | | | | | | | | | | | * Regression and Mode Fixes * Review Fixes * string_view correction * Add operator& for FileSys::Mode * Return std::string from SanitizePath * Farming Simulator Fix * Use != With mode operator&
* string_util: Get rid of separate resize() in CPToUTF16(), UTF16ToUTF8(), CodeToUTF8() and UTF8ToUTF16()Lioncash2018-07-221-20/+22
| | | | | | | | There's no need to perform the resize separately here, since the constructor allows presizing the buffer. Also move the empty string check before the construction of the string to make the early out more straightforward.
* string_util: Use emplace_back() in SplitString() instead of push_back()Lioncash2018-07-221-2/+3
| | | | | | | | | | | | | This is equivalent to doing: push_back(std::string("")); which is likely not to cause issues, assuming a decent std::string implementation with small-string optimizations implemented in its design, however it's still a little unnecessary to copy that buffer regardless. Instead, we can use emplace_back() to directly construct the empty string within the std::vector instance, eliminating any possible overhead from the copy.
* string_util: Remove unnecessary std::string instance in TabsToSpaces()Lioncash2018-07-222-8/+7
| | | | | | We can just use the variant of std::string's replace() function that can replace an occurrence with N copies of the same character, eliminating the need to allocate a std::string containing a buffer of spaces.
* Merge pull request #768 from lioncash/string-viewbunnei2018-07-222-40/+55
|\ | | | | file_util, vfs: Use std::string_view where applicable
| * file_util, vfs: Use std::string_view where applicableLioncash2018-07-222-40/+55
| | | | | | | | | | Avoids unnecessary construction of std::string instances where applicable.
* | Merge pull request #765 from lioncash/filebunnei2018-07-221-24/+14
|\ \ | |/ |/| file_util: Remove goto usages from Copy()
| * file_util: Remove goto usages from Copy()Lioncash2018-07-221-24/+14
| | | | | | | | | | | | We can just leverage std::unique_ptr to automatically close these for us in error cases instead of jumping to the end of the function to call fclose on them.
* | file_util: Use a u64 to represent number of entriesLioncash2018-07-222-13/+13
| | | | | | | | | | This avoids a truncating cast on size. I doubt we'd ever traverse a directory this large, however we also shouldn't truncate sizes away.
* | file_util: std::move FST entries in ScanDirectoryTree()Lioncash2018-07-221-1/+1
|/ | | | Avoids unnecessary copies when building up the FST entries.
* Merge pull request #759 from lioncash/redundantbunnei2018-07-221-2/+1
|\ | | | | file_util: Remove redundant duplicate return in GetPathWithoutTop()
| * file_util: Remove explicit type from std::min() in GetPathWithoutTop()Lioncash2018-07-211-1/+1
| | | | | | | | | | Given both operands are the same type, there won't be an issue with overload selection that requires making this explicit.
| * file_util: Remove redundant duplicate return in GetPathWithoutTop()Lioncash2018-07-211-1/+0
| |
* | Merge pull request #758 from lioncash/syncbunnei2018-07-222-86/+0
|\ \ | | | | | | common: Remove synchronized_wrapper.h
| * | common: Remove synchronized_wrapper.hLioncash2018-07-212-86/+0
| |/ | | | | | | This is entirely unused in the codebase.
* / file_util: Use an enum class for GetUserPath()Lioncash2018-07-213-50/+51
|/ | | | | | | | | | | | | Instead of using an unsigned int as a parameter and expecting a user to always pass in the correct values, we can just convert the enum into an enum class and use that type as the parameter type instead, which makes the interface more type safe. We also get rid of the bookkeeping "NUM_" element in the enum by just using an unordered map. This function is generally low-frequency in terms of calls (and I'd hope so, considering otherwise would mean we're slamming the disk with IO all the time) so I'd consider this acceptable in this case.
* Merge pull request #743 from lioncash/viewbunnei2018-07-214-57/+56
|\ | | | | logging: Use std::string_view where applicable
| * logging/filter: Use std::string_view in ParseFilterString()Lioncash2018-07-202-41/+40
| | | | | | | | | | | | | | | | Allows avoiding constructing std::string instances, since this only reads an arbitrary sequence of characters. We can also make ParseFilterRule() internal, since it doesn't depend on any private instance state of Filter
| * logging/backend: Add missing standard includesLioncash2018-07-202-4/+3
| | | | | | | | | | A few inclusions were being satisfied indirectly. To prevent breakages in the future, include these directly.
| * logging/backend: Use std::string_view in RemoveBackend() and GetBackend()Lioncash2018-07-202-12/+13
| | | | | | | | | | | | These can just use a view to a string since its only comparing against two names in both cases for matches. This avoids constructing std::string instances where they aren't necessary.
* | param_package: Take std::string by value in string-based Set() functionLioncash2018-07-202-4/+6
| | | | | | | | | | Allows avoiding string copies by letting the strings be moved into the function calls.
* | param_package: Use std::unordered_map's insert_or_assign instead of map indexingLioncash2018-07-201-3/+3
| | | | | | | | | | | | | | | | | | | | | | This avoids a redundant std::string construction if a key doesn't exist in the map already. e.g. data[key] requires constructing a new default instance of the value in the map (but this is wasteful, since we're already setting something into the map over top of it).
* | param_package: Get rid of file-static std::string constructionLioncash2018-07-201-3/+4
|/ | | | Avoids potential dynamic allocation occuring during program launch
* Merge pull request #711 from lioncash/swapbunnei2018-07-191-50/+50
|\ | | | | common/swap: Minor changes
| * common/swap: Remove unnecessary const on return value of swap()Lioncash2018-07-191-1/+1
| |
| * common/swap: Use static_cast where applicableLioncash2018-07-191-16/+16
| |
| * common/swap: Use using aliases where applicableLioncash2018-07-191-33/+33
| |
* | Merge pull request #710 from lioncash/unusedbunnei2018-07-191-38/+0
|\ \ | | | | | | common/common_funcs: Remove unused rotation functions
| * | common/common_funcs: Remove unused rotation functionsLioncash2018-07-191-38/+0
| |/ | | | | | | | | | | | | These are unused and essentially don't provide much benefit either. If we ever need rotation functions, these can be introduced in a way that they don't sit in a common_* header and require a bunch of ifdefing to simply be available
* | Merge pull request #709 from lioncash/thread-localbunnei2018-07-192-12/+8
|\ \ | | | | | | common/misc: Deduplicate code in GetLastErrorMsg()
| * | common/misc: Deduplicate code in GetLastErrorMsg()Lioncash2018-07-192-12/+8
| |/ | | | | | | | | | | | | Android and macOS have supported thread_local for quite a while, but most importantly is that we don't even really need it. Instead of using a thread-local buffer, we can just return a non-static buffer as a std::string, avoiding the need for that quality entirely.
* | Merge pull request #705 from lioncash/string-refbunnei2018-07-192-2/+2
|\ \ | | | | | | file_util: return string by const reference for GetExeDirectory()
| * | file_util: return string by const reference for GetExeDirectory()Lioncash2018-07-192-2/+2
| |/ | | | | | | | | This disallows modifying the internal string buffer (which shouldn't be modified anyhow).
* / string_util: Remove AsciiToHex()Lioncash2018-07-192-15/+0
|/ | | | Easy TODO
* Merge pull request #686 from lioncash/fmtbunnei2018-07-191-1/+1
|\ | | | | externals: update fmt to version 5.1.0
| * externals: update fmt to version 5.1.0Lioncash2018-07-181-1/+1
| | | | | | | | Previously, we were on 4.1.0, which was a major version behind.
* | Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-192-57/+116
|/ | | | | | | | | | * Virtual Filesystem * Fix delete bug and documentate * Review fixes + other stuff * Fix puyo regression
* telemetry: Remove unnecessary Field constructorLioncash2018-07-181-4/+1
| | | | | We can just take the value parameter by value which allows both moving into it, and copies at the same time, depending on the calling code.
* telemetry: Make operator== and operator!= const member functions of FieldLioncash2018-07-181-2/+2
| | | | | | | These operators don't modify internal class state, so they can be made const member functions. While we're at it, drop the unnecessary inline keywords. Member functions that are defined in the class declaration are already inline by default.
* telemetry: Default copy/move constructors and assignment operatorsLioncash2018-07-181-14/+4
| | | | | | This provides the equivalent behavior, but without as much boilerplate. While we're at it, explicitly default the move constructor, since we have a move-assignment operator defined.
* Merge pull request #664 from jroweboy/logging-stuffbunnei2018-07-153-4/+17
|\ | | | | Minor logging improvements
| * Logging: Dump all logs in the queue on close in debug modeJames Rowe2018-07-153-1/+12
| |
| * Logging: Don't lock the queue for the duration of the writeJames Rowe2018-07-141-3/+5
| |
* | More improvements to GDBStub (#653)Hedges2018-07-131-1/+1
|/ | | | | | | | | | | * More improvements to GDBStub - Debugging of threads should work correctly with source and assembly level stepping and modifying registers and memory, meaning threads and callstacks are fully clickable in VS. - List of modules is available to the client, with assumption that .nro and .nso are backed up by an .elf with symbols, while deconstructed ROMs keep N names. - Initial support for floating point registers. * Tidy up as requested in PR feedback * Tidy up as requested in PR feedback
* Merge pull request #633 from FearlessTobi/port-definesbunnei2018-07-103-7/+7
|\ | | | | Port #3579 from Citra: Clean up architecture-specific defines
| * Port #3579 from CitrafearlessTobi2018-07-073-7/+7
| |
* | Merge pull request #635 from FearlessTobi/port-crashfixbunnei2018-07-101-1/+1
|\ \ | | | | | | Port #3474 from Citra: Do not crash on unimplemented code in debug build
| * | Port #3474 from CitrafearlessTobi2018-07-071-1/+1
| |/
* / Revert "Virtual Filesystem (#597)"bunnei2018-07-082-99/+57
|/ | | | This reverts commit 77c684c1140f6bf3fb7d4560d06d2efb1a2ee5e2.
* Merge pull request #630 from FearlessTobi/remove-citra-referencesbunnei2018-07-062-2/+2
|\ | | | | Remove some references to Citra
| * Remove some references to CitrafearlessTobi2018-07-062-2/+2
| |
* | Virtual Filesystem (#597)Zach Hilman2018-07-062-57/+99
|/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add VfsFile and VfsDirectory classes * Finish abstract Vfs classes * Implement RealVfsFile (computer fs backend) * Finish RealVfsFile and RealVfsDirectory * Finished OffsetVfsFile * More changes * Fix import paths * Major refactor * Remove double const * Use experimental/filesystem or filesystem depending on compiler * Port partition_filesystem * More changes * More Overhaul * FSP_SRV fixes * Fixes and testing * Try to get filesystem to compile * Filesystem on linux * Remove std::filesystem and document/test * Compile fixes * Missing include * Bug fixes * Fixes * Rename v_file and v_dir * clang-format fix * Rename NGLOG_* to LOG_* * Most review changes * Fix TODO * Guess 'main' to be Directory by filename
* Fix build and address review feedbackbunnei2018-07-031-4/+4
|
* Add configurable logging backendsJames Rowe2018-07-035-18/+257
|
* Update clang formatJames Rowe2018-07-033-14/+11
|
* Rename logging macro back to LOG_*James Rowe2018-07-037-70/+70
|
* Common/string_util: add StringFromBuffer functionmailwl2018-06-072-0/+6
| | | | convert input buffer (std::vector<u8>) to string, stripping zero chars
* Service/MM: add service and stub some functionsmailwl2018-06-052-0/+2
|
* Service/BCAT: add module and servicesmailwl2018-05-282-0/+2
|
* vector_math: Ensure members are always initializedLioncash2018-05-021-9/+9
| | | | Ensures that values are always in a well-defined state.
* Merge pull request #424 from lioncash/stringbunnei2018-04-304-91/+9
|\ | | | | string_util: Remove StringFromFormat() and related functions
| * string_util: Remove StringFromFormat() and related functionsLioncash2018-04-304-91/+9
| | | | | | | | Given we utilize fmt, we don't need to provide our own functions for formatting anymore
* | file_util: Make move constructor/assignment operator and related functions noexceptLioncash2018-04-302-6/+6
| | | | | | | | | | | | | | Without this, it's possible to get compilation failures in the (rare) scenario where a container is used to store a bunch of live IOFile instances, as they may be using std::move_if_noexcept under the hood. Given these definitely don't throw exceptions this is also not incorrect to add either.
* | file_util: Add static assertions to ReadBytes() and WriteBytes()Lioncash2018-04-301-2/+6
|/ | | | | | Ensure that the actual types being passed in are trivially copyable. The internal call to ReadArray() and WriteArray() will always succeed, since they're passed a pointer to char* which is always trivially copyable.
* file_util: Remove compiler version checks around is_trivially_copyable()Lioncash2018-04-281-8/+0
| | | | | | The minimum clang/GCC versions we support already support this. We can also remove is_standard_layout(), as fread and fwrite only require the type to be trivially copyable.
* log: Remove old logging macros and functionsLioncash2018-04-272-54/+1
| | | | Now that the old macros are no longer used, we can remove all functionality related to them.
* general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-272-5/+6
|
* Merge pull request #380 from ogniK5377/service-implbunnei2018-04-272-0/+2
|\ | | | | Implemented some useful interfaces needed for games.
| * Switched to NGLOG_WARNINGDavid Marcec2018-04-271-1/+1
| |
| * Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-263-792/+0
| |\
| * | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-261-0/+1
| | |
| * | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-231-0/+1
| | |
* | | common: Move logging macros over to new fmt-capable macros where applicableLioncash2018-04-274-67/+67
| |/ |/|
* | common: Remove chunk_file.h and linear_disk_cache.hLioncash2018-04-263-792/+0
|/ | | | These are unused (and given chunk_file references Dolphin's >SVN< I doubt they were going to be used).
* Merge pull request #367 from lioncash/clampbunnei2018-04-201-5/+0
|\ | | | | math_util: Remove the Clamp() function
| * math_util: Remove the Clamp() functionLioncash2018-04-201-5/+0
| | | | | | | | | | C++17 adds clamp() to the standard library, so we can remove ours in favor of it.
* | Merge pull request #361 from lioncash/commonbunnei2018-04-201-18/+12
|\ \ | | | | | | common_types: Minor changes
| * | common_types: Convert typedefs to using aliasesLioncash2018-04-201-12/+12
| | | | | | | | | | | | May as well while we're making changes to this file.
| * | common_types: Remove unnecessary check for whether or not__func__ is definedLioncash2018-04-201-6/+0
| |/ | | | | | | VS has supported this for quite a while.
* | Merge pull request #364 from lioncash/thread-localbunnei2018-04-201-19/+0
|\ \ | | | | | | common/thread: Remove unnecessary feature checking for thread_local
| * | common/thread: Remove unnecessary feature checking for thread_localLioncash2018-04-201-19/+0
| |/ | | | | | | Every compiler we require already supports it.
* | Merge pull request #362 from lioncash/snprintfbunnei2018-04-201-5/+0
|\ \ | | | | | | common_funcs: Remove check for VS versions that we don't even support
| * | common_funcs: Remove check for VS versions that we don't even supportLioncash2018-04-201-5/+0
| |/ | | | | | | | | We don't support any VS versions that don't already have snprintf in the standard library implementation.
* | Merge pull request #363 from lioncash/array-sizebunnei2018-04-201-2/+0
|\ \ | | | | | | common_funcs: Remove ARRAY_SIZE macro
| * | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-201-2/+0
| |/ | | | | | | C++17 has non-member size() which we can just call where necessary.
* | Merge pull request #366 from lioncash/vecbunnei2018-04-201-30/+0
|\ \ | | | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]
| * | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]Lioncash2018-04-201-30/+0
| |/ | | | | | | These are all unused and the Write() ones should arguably not even be in the interface. There are better ways to provide this if we ever need it (like iterators).
* / common: Remove code_block.hLioncash2018-04-202-86/+0
|/ | | | | We use dynarmic, so this is unued. Anything else we need will likely use Xbyak, so this header isn't necessary any more.
* bit_field: Remove is_pod check, add is_trivially_copyable_v.bunnei2018-04-181-6/+1
|
* common: Port cityhash code from Citra.bunnei2018-04-145-147/+502
|
* bit_field: Make all methods constexpr.bunnei2018-04-141-5/+5
|
* Update fmtlib to fix msvc warningsJames Rowe2018-04-062-5/+8
| | | | | | Additionally, when updating fmtlib, there was a change in fmtlib broke how the old logging macro was overloaded, so this works around that by just naming the fmtlib macro impl something different
* logging: Change FmtLogMessage to use variadic template instead of FMT_VARIADICDaniel Lim Wee Soong2018-04-032-5/+11
| | | | Due to premature merging of #262 I think the build may be failing right now. Should merge this ASAP to fix it.
* Merge pull request #262 from daniellimws/fmtlib-macrosbunnei2018-04-0310-67/+111
|\ | | | | Logging: Add fmtlib-based macros
| * Remove dependency chronoDaniel Lim Wee Soong2018-03-221-1/+0
| | | | | | | | | | | | Earlier chrono was included but after some code changed it was no longer needed Forgot to remove it so I'm removing it now
| * Logging: Create logging macros based on fmtlibDaniel Lim Wee Soong2018-03-2210-67/+112
| | | | | | | | | | | | | | | | | | Add a new set of logging macros based on fmtlib Similar but not exactly the same as https://github.com/citra-emu/citra/pull/3533 Citra currently uses a different version of fmt, which does not support FMT_VARIADIC so make_args is used instead. On the other hand, yuzu uses fmt 4.1.0 which doesn't have make_args yet so FMT_VARIADIC is used.
* | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-031-1/+1
|\ \ | | | | | | Change Telemetry Names to yuzu and remove links to citra
| * | telemetry.h: Reword comment from citra to yuzuN00byKing2018-03-271-1/+1
| | |
* | | common: fix swap functions on Bitrig and OpenBSDDaniel Lim Wee Soong2018-04-021-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | swap{16,32,64} are defined as macros on the two, but client code tries to invoke them as Common::swap{16,32,64}, which naturally doesn't work. This hack redefines the macros as inline functions in the Common namespace: the bodies of the functions are the same as the original macros, but relying on OS-specific implementation details like this is of course brittle.
* | | service: Add NFP module interface.bunnei2018-03-302-0/+2
|/ / | | | | | | | | | | service: Initialize NFP service. Log: Add NFP service as a log subtype.
* | log.h: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| |
* | file_util.h: Update Comment from citra to yuzuN00byKing2018-03-261-1/+1
| |
* | cpu_detect.cpp: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| |
* | Service/SSL: add ssl servicemailwl2018-03-232-0/+2
| |
* | Service/spl: add module and servicesmailwl2018-03-222-0/+2
| |
* | CMake: Set EMU_ARCH_BITS in CMakeLists.txtN00byKing2018-03-212-35/+0
| |
* | Service: add fatal:u, fatal:p servicesmailwl2018-03-202-0/+2
|/
* Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-202-0/+2
|\ | | | | Service/AOC: stub ListAddOnContent function
| * Service/AOC: stub ListAddOnContent functionmailwl2018-02-202-0/+2
| |
* | logging: Add category for Friend service.bunnei2018-02-192-0/+2
|/
* log: Add logging category for NS services.bunnei2018-02-152-0/+2
|
* logger: Add Time service logging category.bunnei2018-02-052-0/+2
|
* logger: Add SET service logging category.bunnei2018-02-052-15/+11
|
* logger: Add PCTL service logging category.bunnei2018-02-052-0/+2
|
* logger: Add LM service logging category.bunnei2018-02-052-0/+2
|
* logger: Add APM service logging category.bunnei2018-02-052-0/+2
|
* logger: Add NIFM service logging category.bunnei2018-02-052-0/+2
|
* logger: Add VI service logging category.bunnei2018-02-052-0/+2
|
* logger: Add AM service logging category.bunnei2018-02-042-0/+2
|
* logger: Add "account" service logging category.bunnei2018-02-042-0/+2
|
* audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-252-0/+2
| | | | | | | | | | | | | | | | | | | | | | * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * audout:u OpenAudioOut implementation and IAudioOut cmd 1,2,3,4,5 implementation * using an enum for audio_out_state as well as changing its initialize to member initializer list * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * added missing Audio loggin subclass, minor fixes, clang comment breakline * Solving backend logging conflict * minor fix * Fixed duplicated Service NVDRV in backend.cpp, my bad
* logging: add missing NVDRV subclass to macro listRozlette2018-01-241-0/+1
|
* Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-211-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | * Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid * used clang-format-3.9 instead * lowercase pid * Moved nvmemp handlers to cpp * Removed unnecessary logging for NvOsGetConfigU32. Cleaned up log and changed to LOG_DEBUG * using std::arrays instead of c arrays * nvhost get config now uses std::array completely * added pid logging back * updated cmakelist * missing includes * added array, removed memcpy * clang-format6.0
* Fix spelling error in CMakeListsMatthew Brener2018-01-211-1/+1
| | | Minor spelling error of its --> it's
* Format: Run the new clang format on everythingJames Rowe2018-01-2119-43/+87
|
* Merge pull request #84 from lioncash/cmakebunnei2018-01-181-63/+57
|\ | | | | CMakeLists: Derive the source directory grouping from targets themselves
| * CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-181-63/+57
| | | | | | | | | | Removes the need to store to separate SRC and HEADER variables, and then construct the target in most cases.
* | telemetry: Silence initialization order warningsLioncash2018-01-181-2/+2
|/
* loggin: Add IPC logging category.bunnei2018-01-172-1/+3
|
* Minor cleanupMerryMage2018-01-141-1/+1
|
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-131-5/+1
|
* fix macos buildMerryMage2018-01-091-1/+1
|
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-092-0/+123
| | | | * CoreTiming: New CoreTiming; Add Test for CoreTiming
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-232-2/+2
|
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-151-0/+8
|
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-152-2/+2
|
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-102-42/+0
|
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-107-18/+27
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/CMakeLists.txt # src/core/arm/dynarmic/arm_dynarmic.cpp # src/core/arm/dyncom/arm_dyncom.cpp # src/core/hle/kernel/process.cpp # src/core/hle/kernel/thread.cpp # src/core/hle/kernel/thread.h # src/core/hle/kernel/vm_manager.cpp # src/core/loader/3dsx.cpp # src/core/loader/elf.cpp # src/core/loader/ncch.cpp # src/core/memory.cpp # src/core/memory.h # src/core/memory_setup.h
| * Fixed type conversion ambiguityHuw Pascoe2017-09-303-11/+5
| |
| * Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.Subv2017-09-271-4/+8
| | | | | | | | | | It is unlikely we will ever use this without first doing a Cast to a signed type. Fixes 9 "unary minus operator applied to unsigned type, result still unsigned" warnings on MSVC2017.3
| * Merge pull request #2822 from wwylele/sw_lighting-2Weiyi Wang2017-08-092-4/+8
| |\ | | | | | | Implement fragment lighting in the sw renderer (take 2)
| | * vector_math: remove dead template parameterwwylele2017-07-111-1/+1
| | |
| | * vector_math: remove broken SFINAE stuffwwylele2017-07-111-3/+2
| | | | | | | | | | | | this was originally added to eliminate warnings on MSVC, but it doesn't work for custom types.
| | * SwRasterizer: Flip the vertex quaternions before clipping (if necessary).Subv2017-07-111-1/+1
| | |
| | * SwRasterizer: Corrected the light LUT lookups.Subv2017-07-111-0/+5
| | |
| * | common: Add build timestamp to scm_rev.bunnei2017-08-042-0/+3
| | |
* | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-301-2/+2
|/ /
* / logging: Add WebService as a log cateogry.bunnei2017-07-102-1/+3
|/
* Implement basic virtual Room support based on enet (#2803)B3n302017-07-072-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added support for network with ENet lib, connecting is possible, but data can't be sent, yet. * fixup! Added support for network with ENet lib, * fixup! CLang * fixup! Added support for network with ENet lib, * fixup! Added support for network with ENet lib, * fixup! Clang format * More fixups! * Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Clang again * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes
* Remove unnecessary WIN32_LEAN_AND_MEAN macro definitionKloen2017-06-301-1/+0
|
* Remove unused import in break_points.cpp (#2763)Kloen Lansfiel2017-06-091-1/+0
|
* CMake: Create INTERFACE targets for microprofile and nihstroYuri Kunde Schlesner2017-05-281-1/+1
|
* CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-281-0/+1
|
* CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-281-1/+1
| | | | | | | | | | Modules didn't correctly define their dependencies before, which relied on the frontends implicitly including every module for linking to succeed. Also changed every target_link_libraries call to specify visibility of dependencies to avoid leaking definitions to dependents when not necessary.
* Common: Fix some out-of-style includesYuri Kunde Schlesner2017-05-283-5/+5
|
* Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-283-214/+0
| | | | | | This removes a dependency inversion between core and common. It's also the proper place for the file since it makes screen layout decisions specific to the 3DS.
* Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-261-23/+42
|\ | | | | Decentralize ResultCode
| * Common: Clean up meta-template logic in BitFieldYuri Kunde Schlesner2017-05-251-3/+3
| |
| * Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-251-23/+42
| |
* | Merge pull request #2697 from wwylele/proctexYuri Kunde Schlesner2017-05-251-0/+10
|\ \ | | | | | | Implemented Procedural Texture (Texture Unit 3)
| * | pica/swrasterizer: implement procedural texturewwylele2017-05-201-0/+10
| |/
* / common: Add a generic interface for logging telemetry fields.bunnei2017-05-253-0/+238
|/
* Remove unused symbols codeYuri Kunde Schlesner2017-05-083-78/+0
|
* Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-222-0/+27
|\ | | | | Add custom layout settings.
| * Add custom layout settings.SonofUgly2017-02-232-0/+27
| |
* | Merge pull request #2497 from wwylele/input-2bunnei2017-03-175-0/+164
|\ \ | | | | | | Refactor input emulation & add SDL gamepad support
| * | Input: add device and factory templatewwylele2017-03-012-0/+2
| | |
| * | Common: add ParamPackagewwylele2017-03-013-0/+162
| | |
* | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-171-9/+9
|\ \ \ | | | | | | | | Reduce host file name and path logging
| * | | file_util: Log when using local user directorywwylele2017-03-111-0/+2
| | | |
| * | | file_util: lower logging level for harmless caseswwylele2017-03-081-9/+7
| |/ /
* / / common/cpu_detect: Add missing include and fix namespace scopeYuri Kunde Schlesner2017-03-131-5/+7
|/ /
* | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-274-204/+25
|\ \ | | | | | | Replace built-in Profiler with indicators in status bar
| * | Remove built-in (non-Microprofile) profilerYuri Kunde Schlesner2017-02-273-186/+0
| | |
| * | SynchronizedWrapper: Add Lock convenience methodYuri Kunde Schlesner2017-02-271-18/+25
| | |
* | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-253-0/+3
|\ \ \ | | | | | | | | APT: implemented Wrap and Unwrap
| * | | HW: add AES engine & implement AES-CCMwwylele2017-02-213-0/+3
| | | |
* | | | Gui: Change title bar to include build nameJames Rowe2017-02-233-0/+26
| |/ / |/| | | | | | | | | | | Nightly builds now have "Citra Nightly" in the titlebar Bleeding edge builds now have "Citra Bleeding Edge" in the titlebar
* | | applied the change suggested by @wwylelenoah the goodra2017-02-141-0/+1
| | |
* | | added http service enum to the log.h filenoah the goodra2017-02-141-0/+1
|/ /
* | Merge pull request #2476 from yuriks/shader-refactor3Yuri Kunde Schlesner2017-02-041-14/+19
|\ \ | | | | | | Oh No! More shader changes!
| * | Common: Optimize BitSet iteratorYuri Kunde Schlesner2017-01-301-14/+19
| |/
* | Common/x64: remove legacy emitter and abi (#2504)Weiyi Wang2017-01-315-4201/+1
| | | | | | These are not used any more since we moved shader JIT to xbyak.
* | file_util: Fixed implicit type conversion warning (#2503)noah the goodra2017-01-311-2/+2
|/
* common: add <cstddef> to hash.hKloen2017-01-281-0/+1
|
* common: switch ComputeHash64 len param to size_t instead of int, fix warning on MSVC on dsp_dsp.cppKloen2017-01-282-6/+6
|
* Merge pull request #1951 from wwylele/motion-sensorbunnei2017-01-075-0/+76
|\ | | | | Emulate motion sensor in frontend
| * Common: add Quaternionwwylele2016-12-262-0/+45
| |
| * vector math: add implementation of Length and Normalizewwylele2016-12-261-0/+19
| |
| * MathUtil: add PI constantwwylele2016-12-261-0/+2
| |
| * Common::Event: add WaitUntilwwylele2016-12-261-0/+10
| |
* | Service/NFC: stub GetTagInRangeEventmailwl2016-12-302-0/+2
|/ | | | Fix Fatal Error in Mini-Mario & Friends - amiibo Challenge
* Merge pull request #2369 from MerryMage/core-frontendbunnei2016-12-235-646/+0
|\ | | | | core: Move emu_window and key_map into core
| * core: Move emu_window and key_map into coreMerryMage2016-12-235-646/+0
| | | | | | | | * Removes circular dependences (common should not depend on core)
* | file_util: fix missing sysdata pathwwylele2016-12-231-3/+1
|/
* Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-223-87/+3
|\ | | | | Core: Top-level consolidate & misc cleanup
| * file_util: Remove unused paths.bunnei2016-12-223-87/+3
| |
* | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-222-0/+2
|\ \ | |/ |/| csnd:SND: Reformat source code
| * csnd:SND reformat source codemailwl2016-12-122-0/+2
| |
* | Fixed GPLv2 license text in the start.Vamsi Krishna2016-12-181-1/+1
| |
* | Merge pull request #2316 from endrift/macos-gccbunnei2016-12-161-0/+11
|\ \ | | | | | | Common: Fix gcc build on macOS
| * | Common: Fix gcc build on macOSJeffrey Pfau2016-12-131-0/+11
| |/
* / VideoCore: Convert x64 shader JIT to use Xbyak for assemblyYuri Kunde Schlesner2016-12-153-1/+234
|/
* Support mingw cross-compileJannik Vogel2016-12-055-5/+6
|
* Merge pull request #2228 from freiro/winver_fixYuri Kunde Schlesner2016-12-011-3/+0
|\ | | | | Move WINVER definition to cmake and a bit of cleanup
| * WINVER definition moved to CMake and cleanupfreiro2016-11-301-3/+0
| |
* | Set client SDK version to Service APIsmailwl2016-11-301-3/+2
|/
* Build: Fixed a few warnings.Subv2016-11-291-4/+4
|
* Merge pull request #2168 from mailwl/micSebastian Valle2016-11-272-0/+2
|\ | | | | MIC_U: Stub service funcions
| * MIC_U: Stub service funcionsmailwl2016-11-252-0/+2
| |
* | Move to AppData/Roaming/Citra/freiro2016-11-261-1/+1
| |
* | Removed /user/ from pathfreiro2016-11-261-2/+1
| |
* | Switch to AppData/Roamingfreiro2016-11-242-4/+4
| |
* | Return by value and other fixesfreiro2016-11-192-14/+8
| |
* | Win32 move default user folder location to AppDatafreiro2016-11-192-0/+24
|/
* Merge pull request #2172 from jroweboy/fix-mingwbunnei2016-11-161-2/+3
|\ | | | | Fix mingw compilation support
| * Add mingw compile supportJames Rowe2016-11-141-2/+3
| |
* | Round the rectangle size to prevent float to int casting issuesJames Rowe2016-11-123-8/+9
| | | | | | | | And other minor style changes
* | Add default hotkey to swap primary screens.James Rowe2016-11-054-7/+10
| | | | | | | | Also minor style changes
* | Rework frame layouts to use a max rectangle instead of hardcoded calculationsJames Rowe2016-11-052-250/+100
| |
* | LargeFrameLayout + SwappedSonofUgly2016-11-051-50/+36
| | | | | | Make small screen stay at 1x, and large screen maintain its aspect ratio.
* | Support additional screen layouts.James Rowe2016-11-055-73/+382
|/ | | | | Allows users to choose a single screen layout or a large screen layout. Adds a configuration option to change the prominent screen.
* common: use system bswap* functions on more BSDsJan Beich2016-10-281-2/+5
|
* common: use system CPUID routine on DragonFly as wellJan Beich2016-10-281-2/+2
|
* common: some FreeBSD headers are incomplete to avoid namespace pollutionJan Beich2016-10-281-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | In file included from src/common/x64/cpu_detect.cpp:16: /usr/include/machine/cpufunc.h:66:17: error: unknown type name 'u_int' static __inline u_int ^ /usr/include/machine/cpufunc.h:67:6: error: unknown type name 'u_int' bsfl(u_int mask) ^ /usr/include/machine/cpufunc.h:69:2: error: unknown type name 'u_int' u_int result; ^ /usr/include/machine/cpufunc.h:75:17: error: unknown type name 'u_long'; did you mean 'long'? static __inline u_long ^ /usr/include/machine/cpufunc.h:76:6: error: unknown type name 'u_long'; did you mean 'long'? bsfq(u_long mask) ^ /usr/include/machine/cpufunc.h:78:2: error: use of undeclared identifier 'u_long'; did you mean 'long'? u_long result; ^ [...]
* common: convert to standard stat()/fstat() interfacesAnthony J. Bentley2016-10-281-15/+10
| | | | | | | | | | | | | Most modern Unix environments use 64-bit off_t by default: OpenBSD, FreeBSD, OS X, and Linux libc implementations such as Musl. glibc is the lone exception; it can default to 32 bits but this is configurable by setting _FILE_OFFSET_BITS. Avoiding the stat64()/fstat64() interfaces is desirable because they are nonstandard and not implemented on many systems (including OpenBSD and FreeBSD), and using 64 bits for stat()/fstat() is either the default or trivial to set up.
* common: stat64 is non-standard, hide on a random UnixJan Beich2016-10-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | src/common/file_util.cpp:79:19: error: variable has incomplete type 'struct stat64' struct stat64 file_info; ^ src/common/file_util.cpp:79:12: note: forward declaration of 'stat64' struct stat64 file_info; ^ src/common/file_util.cpp:99:19: error: variable has incomplete type 'struct stat64' struct stat64 file_info; ^ src/common/file_util.cpp:99:12: note: forward declaration of 'stat64' struct stat64 file_info; ^ src/common/file_util.cpp:342:19: error: variable has incomplete type 'struct stat64' struct stat64 buf; ^ src/common/file_util.cpp:342:12: note: forward declaration of 'stat64' struct stat64 buf; ^ src/common/file_util.cpp:359:19: error: variable has incomplete type 'struct stat64' struct stat64 buf; ^ src/common/file_util.cpp:359:12: note: forward declaration of 'stat64' struct stat64 buf; ^ 4 errors generated.
* common: only FreeBSD has thread affinity compatible with LinuxJan Beich2016-10-281-1/+5
| | | | | | | | | | | src/common/thread.cpp:90:5: error: unknown type name 'cpu_set_t'; did you mean 'cpuset_t'? cpu_set_t cpu_set; ^~~~~~~~~ cpuset_t /usr/include/sys/_cpuset.h:48:24: note: 'cpuset_t' declared here typedef struct _cpuset cpuset_t; ^ 1 error generated.
* common: define routines to set thread name on more BSDsJan Beich2016-10-281-2/+4
| | | | | | | src/common/thread.cpp:123:5: error: use of undeclared identifier 'pthread_setname_np' pthread_setname_np(pthread_self(), szThreadName); ^ 1 error generated.
* Fix typosRicardo de Almeida Gonzaga2016-10-202-2/+2
|
* Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-082-0/+2
|\ | | | | Update the stub code of BOSS
| * Update the stub code of BOSSJamePeng2016-10-022-0/+2
| |
* | Common: Remove dangerous Vec[234] array constructorsYuri Kunde Schlesner2016-09-301-3/+0
|/ | | | | They're not currently used, and it's easy to accidentally pass a single pointer argument to them, causing an out-of-bounds read.
* Remove special rules for Windows.h and library includesYuri Kunde Schlesner2016-09-213-1/+3
|
* Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-2110-11/+11
|
* Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-2132-54/+13
| | | | | | | This makes clang-format useful on those. Also add a bunch of forgotten transitive includes, which otherwise prevented compilation.
* Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-1915-61/+32
|
* Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-1851-3389/+4172
|
* microprofile: Double buffer size to 16MB.bunnei2016-09-151-1/+1
|
* Common: readdir_r() is deprecated, switch to readdir().Emmanuel Gil Peyrot2016-09-131-6/+2
|
* Protection against a resize of size 0Alexandre LittleWhite Laurent2016-07-231-4/+3
|
* Remove superfluous std::move in return std::move(local_var)scurest2016-06-251-1/+1
|
* Fix recursive scanning of directoriesYuri Kunde Schlesner2016-06-192-17/+12
| | | | | | ForeachDirectoryEntry didn't actually do anything with the `recursive` parameter, and the corresponding callback parameter was shadowing the actual recursion counters in the user functions.
* Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-114-23/+232
|\ | | | | Refactor input mapping & implement circle pad modifier
| * fixup! fixup! Refactor input systemwwylele2016-05-152-7/+7
| |
| * fixup! Refactor input systemwwylele2016-05-152-20/+24
| |
| * implement circle pad modifierwwylele2016-05-152-4/+22
| |
| * Refactor input subsystemwwylele2016-05-154-23/+210
| |
* | Merge pull request #1751 from linkmauve/no-recursive-readdirbunnei2016-05-312-24/+36
|\ \ | | | | | | Make recursive FileUtil functions take a maximum recursion
| * | Common: Make recursive FileUtil functions take a maximum recursionEmmanuel Gil Peyrot2016-05-212-24/+36
| |/ | | | | | | | | | | | | | | | | | | Fixes #1115. Also improves the performances of DiskArchive’s directory implementation a lot, simply by not going through the entire tree instead of just listing the first level files. Thanks to JayRoxFox for rebasing this on current master!
* / common_funcs: Provide rotr and rotl for MSVCMerryMage2016-05-271-12/+18
|/
* swap: Get rid of pointer casting for swapping structsLioncash2016-05-091-5/+5
| | | | These shouldn't haphazardly convert types
* swap: Get rid of undefined behavior in swapf and swapdLioncash2016-05-091-14/+18
| | | | This isn't well-defined in C++.
* swap: Remove unused methodsLioncash2016-05-091-28/+0
| | | | | | | Also gets rid of pointer data variants as this prevents the use of the regular swapping routines as unary predicates in std lib functions. They also cast to stricter alignment types, which is undefined behavior.
* Merge pull request #1736 from MerryMage/sdl2-sinkbunnei2016-05-072-1/+3
|\ | | | | AudioCore: SDL2 Sink
| * AudioCore: SDL2 SinkMerryMage2016-05-072-1/+3
| |
* | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-306-5/+14
|/
* Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-295-259/+6
| | | | This has been entirely superseded by MicroProfile. The rest of the code can go when a simpler frametime/FPS meter is added to the GUI.
* Make Citra build with MICROPROFILE_ENABLED set to 0 (#1709)Henrik Rydgård2016-04-291-0/+4
| | | | | | | | | | | | * Make Citra build with MICROPROFILE_ENABLED set to 0 * Buildfix with microprofile kept on * moc did not like a dialog to conditionally exist. * Cleanup * Fix end of line
* assert: Allow UNREACHABLE_MSG to have just one argumentSam Spilsbury2016-04-241-1/+1
|
* Merge pull request #1576 from smspillaz/fix-build-errors-03272016bunnei2016-04-241-0/+2
|\ | | | | Fix various build errors encountered on Clang 3.9 on OS X
| * assert: Add _MSG variations for UNREACHABLE and UNIMPLEMENTEDSam Spilsbury2016-04-231-0/+2
| |
* | Protect use of std::is_trivially_copyable to compile with GCC 4.9LittleWhite2016-04-231-0/+4
|/
* Merge pull request #1672 from wwylele/win-driver-fixbunnei2016-04-191-3/+12
|\ | | | | Fix driver root identification on Windows
| * fix driver root identification on Windowswwylele2016-04-151-3/+12
| |
* | Merge pull request #1666 from MerryMage/barrierbunnei2016-04-151-24/+22
|\ \ | | | | | | Thread: Correct Common::Barrier implementation
| * | Thread: Make Barrier reusableMerryMage2016-04-141-5/+5
| | |
| * | common/thread: Correct code styleMerryMage2016-04-141-21/+19
| |/
* | Merge pull request #1665 from lioncash/filebunnei2016-04-142-47/+22
|\ \ | | | | | | IOFile: Minor API changes
| * | file_util: In-class initialize data membersLioncash2016-04-142-6/+4
| | |
| * | file_util: const qualify IOFile's Tell and GetSize functionsLioncash2016-04-142-8/+8
| | |
| * | file_util: Don't expose IOFile internals through the APILioncash2016-04-142-30/+4
| | |
| * | file_util: Check for is_trivially_copyableLioncash2016-04-141-3/+5
| | | | | | | | | | | | Also applies the template checks to ReadArray as well.
| * | file_util: Make IOFile data members privateLioncash2016-04-141-0/+1
| |/
* | emitter: Add CALL that can be fixed up.bunnei2016-04-142-0/+13
| |
* | emitter: Support arbitrary FixupBranch targets.bunnei2016-04-142-0/+17
|/
* FileUtil: Missing #include, Add const to IOFile methodsMerryMage2016-04-121-6/+7
|
* cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-081-1/+1
|
* Merge pull request #1435 from mailwl/frd_ubunnei2016-04-062-0/+2
|\ | | | | frd:u: Initial stub some functions
| * frd:u: Initial stub some functionsmailwl2016-03-272-0/+2
| |
* | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-062-18/+0
|\ \ | | | | | | Common: Remove Common::make_unique, use std::make_unique
| * | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-052-18/+0
| | |
* | | Merge pull request #1620 from LFsWang/pathbunnei2016-04-053-26/+43
|\ \ \ | | | | | | | | Fix filename&path encode problem on Windows
| * | | remove debug codeLFsWang2016-03-311-1/+1
| | | |
| * | | fix unicode url problem on windowsLFsWang2016-03-311-6/+18
| | | |
| * | | Fix encode problem On WindowsLFsWang2016-03-313-21/+26
| | |/ | |/|
* | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-032-0/+2
|\ \ \ | | | | | | | | Dummy implementation dlp:SRVR Service.
| * | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-022-0/+2
| | |/ | |/|
* | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-312-0/+2
| |/ |/|
* | remove unnecessary constwwylele2016-03-261-2/+2
| |
* | implement accel and gyro backendwwylele2016-03-221-0/+48
|/
* vector_math: Add missing member in Vec4's SetZero functionLioncash2016-03-181-1/+4
|
* Reorganize the ndm service path for dummy implement functionJamePeng2016-03-142-0/+2
| | | | | | SuspendDaemons , ResumeDaemons , OverrideDefaultDaemons The NDM file move to /core/hle/service/ndm/ now!
* Merge pull request #1509 from lioncash/noncopybunnei2016-03-131-3/+3
|\ | | | | common: Minor changes to NonCopyable
| * common_types: Make NonCopyable constructor constexprLioncash2016-03-131-1/+1
| |
| * common_types: Specify const in deleted copy constructor/assignment operatorLioncash2016-03-131-2/+2
| |
* | PICA: Align vertex attributesJannik Vogel2016-03-132-0/+23
|/
* Merge pull request #1476 from lioncash/emitbunnei2016-03-101-59/+54
|\ | | | | emitter: constexpr/misc changes
| * emitter: templatize ImmPtrLioncash2016-03-091-2/+6
| |
| * emitter: constexpr-ify helper functionsLioncash2016-03-091-19/+17
| |
| * emitter: Get rid of CanDoOpWithLioncash2016-03-091-7/+0
| | | | | | | | | | This was removed in Dolphin as there were no particular uses for it. I'm sure the same will apply to citra.
| * emitter: constexpr-ify OpArgLioncash2016-03-091-30/+30
| |
| * emitter: friend class OpArg with XEmitterLioncash2016-03-091-3/+4
| |
| * emitter: Remove unimplemented prototypeLioncash2016-03-091-1/+0
| |
* | Common: Get rid of alignment macrosLioncash2016-03-091-9/+1
|/ | | | | The gl rasterizer already uses alignas, so we may as well move everything over.
* Merge pull request #1297 from Subv/savesbunnei2016-03-011-1/+1
|\ | | | | DiskDirectory: Initialize the directory member with valid info.
| * DiskDirectory: Initialize the directory member with valid info.Subv2016-01-161-1/+1
| |
* | Merge pull request #1427 from MerryMage/emit-lbitYuri Kunde Schlesner2016-02-281-2/+2
|\ \ | | | | | | x64 Emitter: Fix L bit in VEX prefix
| * | x64 Emitter: Fix L bit in VEX prefixMerryMage2016-02-271-2/+2
| | |
* | | Initial implementation ir:usermailwl2016-02-262-0/+2
|/ /
* | AudioCore: Skeleton ImplementationMerryMage2016-02-213-1/+5
| | | | | | | | | | | | | | | | | | This commit: * Adds a new subproject, audio_core. * Defines structures that exist in DSP shared memory. * Hooks up various other parts of the emulator into audio core. This sets the foundation for a later HLE DSP implementation.
* | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-122-26/+22
| |
* | backend: defaulted move constructor/assignmentLioncash2016-02-051-18/+2
| |
* | color: Make trivial helpers constexprLioncash2016-01-281-8/+8
| |
* | key_map: Use std::tie for comparisonsLioncash2016-01-251-7/+7
|/
* Add missing return values in ForeachDirectoryEntryLFsWang2015-12-231-4/+14
| | | | | ForeachDirectoryEntry is changed by #1256 ,but return value at last line was missing.
* Merge pull request #1252 from Subv/cambunnei2015-12-042-0/+2
|\ | | | | Services/Cam: Added new log type and camera enums from 3dbrew.
| * Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-232-0/+2
| | | | | | | | | | Followup to #1102 Original author @mailwl
* | Refactor ScanDirectoryTreeAndCallback to separate errors and retvalsarchshift2015-11-272-50/+53
|/ | | | | | | | | ScanDirectoryTreeAndCallback, before this change, coupled error/return codes and actual return values (number of entries found). This caused confusion and difficulty interpreting the precise way the function worked. Supersedes, and closes #1255.
* fix failure on gcc and clangwwylele2015-11-121-3/+3
|
* disable unary minus when the type is not signedwwylele2015-11-121-0/+4
| | | | silent warning C4146 on msvc
* Implement gdbstubpolaris-2015-10-042-0/+2
|
* Merge pull request #1176 from lioncash/vs2015-code-junking-daybunnei2015-10-031-11/+0
|\ | | | | Obligatory "Throw out workarounds VS2013 once limited us to" PR
| * bit_field: Re-enable code on MSVCLioncash2015-10-011-11/+0
| |
* | Merge pull request #1095 from archshift/game-listbunnei2015-10-022-103/+83
|\ \ | | | | | | Initial implementation of a game list
| * | Split up FileUtil::ScanDirectoryTree to be able to use callbacks for custom behaviorarchshift2015-10-012-103/+83
| | | | | | | | | | | | | | | Converted FileUtil::ScanDirectoryTree and FileUtil::DeleteDirRecursively to use the new ScanDirectoryTreeAndCallback function internally.
* | | symbols: Replace an insert call with emplaceLioncash2015-09-301-1/+1
| | |
* | | symbols: Get rid of initial underscores in variable namesLioncash2015-09-302-20/+20
| | |
* | | symbols: Directly initialize TSymbol membersLioncash2015-09-301-8/+3
| | |
* | | symbols: Simplify GetSymbolLioncash2015-09-301-8/+5
| |/ |/|
* | hash: Get rid of unused functionsLioncash2015-09-161-16/+0
| |
* | general: Silence some warnings when using clangLioncash2015-09-161-2/+2
|/
* memory_util: Remove unnecessary assignment in FreeMemoryPagesLioncash2015-09-121-3/+0
|
* memory_util: Remove commented out printf statementsLioncash2015-09-121-10/+0
|
* general: Replace 0 literals with nullptr where applicableLioncash2015-09-122-6/+6
|
* synchronized_wrapper: Add missing return in SynchronizedRef move assignment operatorLioncash2015-09-121-0/+1
|
* Merge pull request #1144 from lioncash/removebunnei2015-09-114-176/+0
|\ | | | | common: Get rid of debug_interface.h
| * common: Get rid of debug_interface.hLioncash2015-09-114-176/+0
| | | | | | | | | | | | This is technically unused. Also removes TMemChecks because it relies on this. Whenever memory breakpoints are implemented for real, it should be designed to match the codebase debugging mechanisms.
* | common: Get rid of a cast in swap.hLioncash2015-09-111-2/+2
|/
* x64: Proper stack alignment in shader JIT function callsaroulin2015-09-013-424/+90
| | | | | Import Dolphin stack handling and register saving routines Also removes the x86 parts from abi files
* Common: Import BitSet from Dolphinaroulin2015-09-012-0/+190
|
* Common: Fix MicroProfile compilation in MSVC2015Yuri Kunde Schlesner2015-08-281-0/+5
|
* Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-254-0/+51
| | | | | This brings goodies such as a configurable user interface and multi-threaded timeline view.
* x64-emitter: add RCPSS SSE instructionaroulin2015-08-232-0/+2
|
* Merge pull request #1058 from lioncash/ptrLioncash2015-08-232-4/+27
|\ | | | | emitter: Remove pointer casts
| * emitter: Remove pointer castsLioncash2015-08-212-4/+27
| | | | | | | | This should also technically silence quite a few ubsan warnings.
* | Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-221-8/+7
|\ \ | |/ |/| Kernel: Correct(er) handling of Heap and Linear Heap allocations
| * VMManager: Make LogLayout log level configurable as a parameterYuri Kunde Schlesner2015-08-161-8/+7
| |
* | emitter: Remove unnecessary definesLioncash2015-08-201-5/+1
| |
* | emitter: Remove unnecessary else keywordsLioncash2015-08-201-7/+7
| |
* | emitter: Remove unused codeLioncash2015-08-202-44/+0
| |
* | emitter: Remove unimplemented JMP prototypeLioncash2015-08-201-1/+0
| |
* | emitter: Pass OpArg by reference where possibleLioncash2015-08-202-763/+763
| |
* | emitter: Remove unnecessary inline specifiersLioncash2015-08-201-33/+33
| | | | | | | | Functions implemented in a class definition are already implicitly inline.
* | Merge pull request #1035 from darkf/mingw-fixbunnei2015-08-202-4/+10
|\ \ | | | | | | Fix building under MinGW
| * | Fix building under MinGWdarkf2015-08-182-4/+10
| |/
* / videocore: Added RG8 texture supportPatrick Martin2015-08-161-0/+18
|/
* Merge pull request #1031 from bbarenblat/masterYuri Kunde Schlesner2015-08-161-1/+2
|\ | | | | Handle invalid `Log::Class`
| * Handle invalid `Log::Class`Benjamin Barenblat2015-08-151-1/+2
| | | | | | | | | | | | Add a case of `Log::Class::Count` to the switch statement that dispatches on `Log::Class`. The case simply calls the `UNREACHABLE` macro.
* | Rename ARCHITECTURE_X64 definition to ARCHITECTURE_x86_64.bunnei2015-08-168-14/+14
| |
* | Common: Cleanup CPU capability detection code.bunnei2015-08-164-198/+141
| |
* | Common: Move cpu_detect to x64 directory.bunnei2015-08-164-5/+5
| |
* | x64: Refactor to remove fake interfaces and general cleanups.bunnei2015-08-1610-516/+26
| |
* | Common: Added MurmurHash3 hash function for general-purpose use.bunnei2015-08-155-2/+158
| |
* | Common: Ported over boilerplate x86 JIT code from Dolphin/PPSSPP.bunnei2015-08-159-4/+4380
| |
* | Common: Ported over Dolphin's code for x86 CPU capability detection.bunnei2015-08-154-17/+273
|/
* Stop defining GCC always_inline attributes as __forceinlinearchshift2015-08-122-7/+8
| | | | | __forceinline is a MSVC extension, which may confuse some people working on the codebase. Furthermore, the C++ standard dictates that all names which contain adjacent underscores are reserved.
* Merge pull request #1018 from bbarenblat/masterbunnei2015-08-052-1/+8
|\ | | | | Handle invalid `Log::Level::Count`
| * Use UNREACHABLE macro for impossible cases in previous commitBenjamin Barenblat2015-08-032-4/+3
| | | | | | | | Use the UNREACHABLE macro instead of `ASSERT(false, ...);`.
| * Handle invalid `Log::Level::Count`Benjamin Barenblat2015-08-022-1/+9
| | | | | | | | | | | | Add a case of `Log::Level::Count` to all switch statements that dispatch on `Log::Level`. The case simply asserts `false` and notes the invalid log level.
* | Common: Work around bug in MSVC2015 standard libraryYuri Kunde Schlesner2015-08-031-0/+14
|/ | | | | | The char16_t/char32_t implementations aren't present in the library and cause linker errors. This is a known issue that wasn't fixed in VS2015 RTM.
* Common : Fix Conversion Warningszawata2015-07-191-1/+1
|
* Common: Remove the unused and commented GetThemeDir prototype from FileUtil.Emmanuel Gil Peyrot2015-07-181-3/+0
|
* Pica: Implement stencil testing.Tony Wasserka2015-07-131-1/+26
|
* FileUtil: Add a WriteObject method for writing a single, POD-type object.Tony Wasserka2015-07-131-0/+10
|
* don´t define snprintf on Visual Studio 2015Apology112015-07-121-2/+4
| | | Visual Studio 2015 defines this in stdio now
* Merge pull request #914 from yuriks/bitfield-maskYuri Kunde Schlesner2015-07-121-2/+2
|\ | | | | Common: Fix mask generation in BitField
| * Common: Remove redundant masking in BitFieldYuri Kunde Schlesner2015-07-101-1/+1
| | | | | | | | | | For the signed case, the shifts already remove the rest of the value, so ANDing by the mask is redundant.
| * Common: Fix mask generation in BitFieldYuri Kunde Schlesner2015-07-101-1/+1
| | | | | | | | Fixes #913
* | Common: Remove thunk.hLioncash2015-07-112-43/+0
| | | | | | | | This isn't used, and there's no implementations of the member functions.
* | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-1126-236/+86
|\ \ | |/ |/| Cleanup includes, mostly in common
| * Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-281-0/+1
| |
| * Core: Cleanup core includes.Emmanuel Gil Peyrot2015-06-281-1/+2
| |
| * CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-282-1/+1
| |
| * Common: Cleanup emu_window includes.Emmanuel Gil Peyrot2015-06-282-3/+15
| |
| * Common: Remove unused ROUND_UP_POW2 macro.Emmanuel Gil Peyrot2015-06-281-7/+0
| |
| * Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-281-0/+1
| |
| * Common: Cleanup memory and misc includes.Emmanuel Gil Peyrot2015-06-287-22/+18
| |
| * Common: Cleanup profiler includes.Emmanuel Gil Peyrot2015-06-284-7/+10
| |
| * Common: Cleanup thread includes.Emmanuel Gil Peyrot2015-06-282-18/+15
| |
| * Common: Fix string_util includes.Emmanuel Gil Peyrot2015-06-282-3/+9
| |
| * Common: Fix FileUtil includes, and everything relying on those.Emmanuel Gil Peyrot2015-06-283-7/+14
| |
| * Common: Remove now-unused EMU_PLATFORM define, fixes issue #373.Emmanuel Gil Peyrot2015-06-271-30/+0
| |
| * Common: Remove unused SSE version checking and a GCC macro.Emmanuel Gil Peyrot2015-06-271-25/+0
| |
| * Common: Remove unused fifo_queue.h.Emmanuel Gil Peyrot2015-06-272-112/+0
| |
* | Common: Remove unused type unions breaking aliasing rules in horrible ways.Emmanuel Gil Peyrot2015-06-281-26/+0
|/
* Merge pull request #855 from purpasmart96/service_rearrangmentbunnei2015-06-212-2/+4
|\ | | | | Services: Continue separation of services into their own folders
| * Services: Continue separation of services into their own folderspurpasmart962015-06-122-2/+4
| |
* | Render-to-texture flush, interval math fixtfarley2015-06-091-1/+1
|/
* Move video_core/color.h to common/color.harchshift2015-05-302-0/+215
|
* Move video_core/math.h to common/vector_math.harchshift2015-05-302-0/+641
| | | | The file only contained vector manipulation code, and such widely-useable code doesn't belong in video_core.
* Remove every trailing whitespace from the project (but externals).Emmanuel Gil Peyrot2015-05-293-3/+3
|
* OpenGL renderertfarley2015-05-231-0/+4
|
* Service::Y2R: Support for grayscale decoding of specific formatsYuri Kunde Schlesner2015-05-222-0/+2
| | | | | | | | | | | | Implements unrotated planar YUV 4:2:0 -> RGB24 conversions in Y2R. Currently only the Y (luma) channel is used, so the results don't contain color. This will be added in a later PR at some point. This is enough to get all currently know Moflex videos to decode. (Some don't display on-screen due to seemingly unrelated reasons.) Thanks to @archshift for doing the initial implementation which I cleaned up and then fixed the 8x8 block mode.
* Merge pull request #758 from yuriks/sync-loggingYuri Kunde Schlesner2015-05-1610-381/+35
|\ | | | | Common: Remove async logging
| * Remove unused concurrent_ring_buffer.hYuri Kunde Schlesner2015-05-162-164/+0
| |
| * Common: Use the log system to print assert messagesYuri Kunde Schlesner2015-05-121-7/+3
| |
| * Common: Remove async loggingYuri Kunde Schlesner2015-05-127-210/+32
| | | | | | | | | | | | | | | | | | | | | | It provided a large increase in complexity of the logging system while having a negligible performance impact: the usage patterns of the ring buffer meant that each log contended with the logging thread, causing it to effectively act as a synchronous extra buffering. Also removed some broken code related to filtering of subclasses which was broken since it was introduced. (Which means no one ever used that feature anyway, since, 8 months later, no one ever complained.)
* | Common: Remove unused cruft from math_util, and remove a duplicated Rect class in common_types.Emmanuel Gil Peyrot2015-05-144-409/+3
|/
* Common: Remove the BIT macroYuri Kunde Schlesner2015-05-091-2/+0
| | | | | | | When the macro was introduced in 326ec51261299e48de97592631c02523da9c8118 it wasn't noticed that it conflicted in name with a heavily used macro inside of dyncom. This causes some compiler warnings. Since it's only lightly used, it was opted to simply remove the new macro.
* Common: Add BIT macroYuri Kunde Schlesner2015-05-091-0/+2
|
* Common: Add StringFromFixedZeroTerminatedBufferYuri Kunde Schlesner2015-05-082-0/+14
|
* Merge pull request #725 from yuriks/remove-common-crapYuri Kunde Schlesner2015-05-085-1009/+0
|\ | | | | Remove unused hash and mem_arena from common
| * Common: Remove mem_arena.cpp/hYuri Kunde Schlesner2015-05-083-466/+0
| | | | | | | | | | | | It is superfluous for Citra. (It's only really necessary if you're doing JIT. We were using it but not taking any advantage from it.) This should make 32-bit builds work again.
| * Common: Remove hash.cpp/hYuri Kunde Schlesner2015-05-073-543/+0
| | | | | | | | Currently unused and the code quality is pretty questionable.
* | Merge pull request #723 from lioncash/commonstrbunnei2015-05-082-127/+0
|\ \ | | | | | | string_util: Get rid of UriDecode/UriEncode
| * | string_util: Get rid of UriDecode/UriEncodeLioncash2015-05-072-127/+0
| | |
* | | Profiler: Fix off-by-one error when computing average.Yuri Kunde Schlesner2015-05-081-2/+1
| |/ |/|
* | Common: Add proper macros to test for architecture pointer sizeYuri Kunde Schlesner2015-05-075-17/+11
|/ | | | | | | The old system of just defining macros available in some other platform was susceptible to silently using the wrong code if you forgot to include a particular header. This fixes a crash on non-Windows platforms introduced by e1fbac3ca13d37d2625c11d30cfdece4327b446b.
* Common: Remove common.hYuri Kunde Schlesner2015-05-0729-56/+43
|
* Common: Move alignment macros to common_funcs.hYuri Kunde Schlesner2015-05-072-21/+21
|
* Common: Move SSE detection ifdefs to platform.hYuri Kunde Schlesner2015-05-073-16/+21
|
* Common: Remove more unused compatibility definesYuri Kunde Schlesner2015-05-071-45/+0
|
* Common: Move IO-specific compatibility macros to file_util.cppYuri Kunde Schlesner2015-05-072-26/+26
|
* Common: Remove many unnecessary cross-platform compatibility macrosYuri Kunde Schlesner2015-05-075-88/+10
|
* Clean-up includesYuri Kunde Schlesner2015-05-071-0/+1
|
* Move typedefs from kernel.h to more appropriate placesYuri Kunde Schlesner2015-05-071-0/+5
|
* Common: Move NonCopyable to common_types.hYuri Kunde Schlesner2015-05-072-10/+10
|
* Common: Use C++11 deleted functions for NonCopyableYuri Kunde Schlesner2015-05-071-8/+6
|
* Common: Remove unused enumsYuri Kunde Schlesner2015-05-071-17/+0
|
* EmuWindow: Clip mouse input coordinates to emulated screen dimensions.Zaneo2015-05-022-6/+21
| | | | | | | If the mouse position for a mouse move/drag would take it outside the emulated screen dimensions, clip the coordinates to the emulated screen dimensions. Qt and GLFW will report negative coordinates for mouse positions to the left, or above citra window. Added restriction to mouse coordinates passed to touchmoved by Qt/GLFW to be greater or equal to zero.
* Common: thread.h cleanupsYuri Kunde Schlesner2015-04-161-65/+16
| | | | | The helper classes are rendered obsolete by C++11 lambdas. Also made formatting conform to our code style.
* Thread: Implement priority boost for starved threads.bunnei2015-04-101-0/+18
| | | | | | SVC: Return correct error code on invalid CreateThread processor ID. SVC: Assert when creating a thread with an invalid userland priority.
* Merge pull request #641 from purpasmart96/service_stubsbunnei2015-04-042-0/+4
|\ | | | | Services: Stubs and minor changes
| * Services: Stubs and minor changespurpasmart962015-04-032-0/+4
| |
* | disassembler: Get rid of a const_castLioncash2015-03-302-4/+4
|/
* Common: Fix logic for setting EMU_DATA_DIR.Emmanuel Gil Peyrot2015-03-161-6/+5
|
* Common: Make a #else more apparent.Emmanuel Gil Peyrot2015-03-161-5/+1
|
* EmuWindow: Fixed a reference to a temporary variableSubv2015-03-141-1/+1
| | | | in GetTouchState()
* Merge pull request #642 from bunnei/touchpadbunnei2015-03-122-19/+101
|\ | | | | Touchpad support
| * HID: Complete refactor of pad/touch input to fix threading issues.bunnei2015-03-112-68/+63
| |
| * EmuWindow: Made pad/touch functions non-static.bunnei2015-03-102-11/+6
| |
| * EmuWindow: Added infrastructure code to enable touchpad support.bunnei2015-03-102-1/+93
| |
* | Merge pull request #629 from archshift/lcdfbbunnei2015-03-102-0/+2
|\ \ | |/ |/| Implement SetLcdForceBlack and add implementation for color filling in the GPU code
| * Added LCD registers, and implementation for color filling in OGL code.archshift2015-03-092-0/+2
| |
* | Merge pull request #634 from linkmauve/logging-performancesbunnei2015-03-095-7/+17
|\ \ | | | | | | Apply the logging filter before sending the message to the queue
| * | Logging: check for filter before sending to the queue, to skip all heavy formatting on the other thread.Emmanuel Gil Peyrot2015-03-065-7/+17
| | |
* | | Merge pull request #584 from yuriks/outline-assertsbunnei2015-03-091-6/+25
|\ \ \ | | | | | | | | Asserts: Use lambdas to keep assertion code away from the main code path
| * | | Asserts: Use lambdas to keep assertion code away from the main code pathYuri Kunde Schlesner2015-02-181-6/+25
| | | |
* | | | Fixed EmuWindow typo (fixes OSX build)bunnei2015-03-082-2/+2
| | | |
* | | | Merge pull request #636 from bunnei/refactor-screen-winbunnei2015-03-082-7/+75
|\ \ \ \ | | | | | | | | | | Set framebuffer layout from EmuWindow.
| * | | | Set framebuffer layout from EmuWindow.bunnei2015-03-072-7/+75
| | |_|/ | |/| |
* | | | Merge pull request #538 from yuriks/perf-statTony Wasserka2015-03-076-0/+534
|\ \ \ \ | |_|_|/ |/| | | Add profiling infrastructure and widget
| * | | Profiler: Implement QPCClock to get better precision on Win32Yuri Kunde Schlesner2015-03-022-1/+42
| | | | | | | | | | | | | | | | | | | | | | | | MSVC 2013 (at least) doesn't use QueryPerformanceCounter to implement std::chrono::high_resolution_clock, so it has bad precision. Manually implementing our own clock type using it works around this for now.
| * | | Add profiling infrastructure and widgetYuri Kunde Schlesner2015-03-026-0/+493
| |/ /
* / / Removed swap code redundancy and moved common swap code to swap.harchshift2015-03-063-127/+97
|/ /
* | Common: Switch to the XDG Base Directory Specification for directory selection.Emmanuel Gil Peyrot2015-02-252-10/+69
| | | | | | | | This allows for easily movable and independent configuration and data directories, using standardized paths.
* | Merge pull request #581 from archshift/tfebunnei2015-02-233-2/+2
|\ \ | | | | | | Added information reporting from ThrowFatalError
| * | Added information reporting from ThrowFatalErrorarchshift2015-02-223-2/+2
| | | | | | | | | | | | This was RE'd from the errdisp applet.
* | | Common: Change names containing “Dolphin” or “PPSSPP” to something more generic.Emmanuel Gil Peyrot2015-02-202-8/+8
| | |
* | | Misc cleanup of common and related functionsarchshift2015-02-203-79/+28
| | |
* | | Remove duplication of INSERT_PADDING_WORDS between pica.h and gpu.harchshift2015-02-202-3/+3
| | |
* | | Remove "super lame/broken" file_search compilation unit that was leftover from Dolphinarchshift2015-02-193-128/+0
| | |
* | | Remove redundant utf8 compilation unit that was leftover from Dolphinarchshift2015-02-193-528/+0
| | |
* | | Remove useless extended_trace compilation unit that was leftover from Dolphinarchshift2015-02-193-480/+0
| | |
* | | Remove the useless msg_handler compilation unit that was left over from Dolphinarchshift2015-02-197-178/+11
|/ /
* | Merge pull request #570 from purpasmart96/config_membunnei2015-02-181-0/+7
|\ \ | |/ |/| ConfigMem: Clean up the Config memory to be more like the shared page
| * ConfigMem: Clean up the Config memory to be more like the shared page and movedpurpasmart962015-02-171-0/+7
| | | | | | | | the helper macro for padding to common_funcs.h
* | Merge pull request #529 from Subv/masterbunnei2015-02-141-3/+3
|\ \ | |/ |/| Build: Fixed some warnings
| * Build: Fixed some warningsSubv2015-02-121-3/+3
| |
* | backend: Add logging subentry for ldrLioncash2015-02-131-0/+1
|/ | | | Fixes an assertion upon executing citra in debug mode.
* Asserts: break/crash program, fit to style guide; log.h->assert.harchshift2015-02-1115-105/+73
| | | | | | | Involves making asserts use printf instead of the log functions (log functions are asynchronous and, as such, the log won't be printed in time) As such, the log type argument was removed (printf obviously can't use it, and it's made obsolete by the file and line printing) Also removed some GEKKO cruft.
* Merge pull request #526 from purpasmart96/citra_stubsbunnei2015-02-111-0/+1
|\ | | | | Services: Stub some functions
| * Services: Stub some functionspurpasmart962015-02-081-0/+1
| |
* | Fix a wrong file name in a commentchinhodado2015-02-071-1/+1
|/
* Common: Fix SCOPE_EXIT to actually create unique identifiers.Yuri Kunde Schlesner2015-01-302-1/+7
|
* Added HID_SPVR service and split HID_U implementation into service/hid/hid.xxxarchshift2015-01-213-10/+10
|
* Logging: Log all called service functions (under trace). Compile out all trace logs under release for performance.archshift2015-01-103-24/+8
|
* Merge pull request #431 from yuriks/thread-queue-cleanupbunnei2015-01-071-144/+74
|\ | | | | Common: Clean up ThreadQueueList
| * Common: Clean up ThreadQueueListYuri Kunde Schlesner2015-01-071-144/+74
| | | | | | | | | | | | | | | | Replace all the C-style complicated buffer management with a std::deque. In addition to making the code easier to understand it also adds support for non-POD IdTypes. Also clean the rest of the code to follow our code style.
* | Merge pull request #425 from Subv/coretimingbunnei2015-01-072-0/+2
|\ \ | |/ |/| Ported the CoreTiming namespace from PPSSPP
| * CoreTiming: Ported the CoreTiming namespace from PPSSPPSubv2015-01-072-0/+2
| | | | | | | | | | | | Implemented the required calls to make it work. CoreTiming: Added a new logging class Core_Timing.
* | Merge pull request #421 from linkmauve/remove-dead-platformsbunnei2015-01-075-101/+2
|\ \ | | | | | | Remove dead platform #ifdefs to make the code more readable.
| * | Common: Remove dead platform #ifdefs to make the code more readable.Emmanuel Gil Peyrot2015-01-065-101/+2
| | | | | | | | | | | | | | | | | | Symbian, Xbox, Blackberry and iOS got removed. FreeBSD and Android kept due to them potentially being able to run Citra in the future. The iOS specific part also got removed from PPSSPP in order to fix a bug there.
* | | Merge pull request #376 from Subv/arc_reorderbunnei2015-01-073-32/+20
|\ \ \ | |/ / |/| | Archives: Change the folder layout of some archives.
| * | Archives: Changed the way paths are built for the archives.Subv2015-01-043-20/+4
| | | | | | | | | | | | Each archive now takes a mount point of either NAND or SDMC, and builds its own directory structure there, trying to simulate an HLE-friendly hardware layout
| * | SaveDataCheck: Move the files to nand/titleSubv2015-01-041-1/+1
| | | | | | | | | | | | under /nand/title/high/low/content/00000000.app.romfs
| * | Archives: Change the folder layout of some archives.Subv2015-01-033-20/+24
| |/ | | | | | | This is to better represent the hardware layout, they are still aren't quite accurate, but this better and will help a bit when implementing the other archives like NAND-RO and NAND-RW
* | Common: Use std::abs instead of abs, using abs with cmath fails on some systems.Emmanuel Gil Peyrot2015-01-051-2/+3
| |
* | Common: Remove the unused x86-specific 128-bit float type.Emmanuel Gil Peyrot2015-01-051-11/+0
|/
* Archives: Reduced duplicate code in RomFS and SaveCheck.Subv2015-01-033-0/+4
| | | | Fixed a few warnings and cleaned up the code
* SOC_U: Preliminary implementation of sockets.Subv2014-12-312-0/+2
| | | | | | | | | | | | | Stubbed CreateMemoryBlock Using Berkeley sockets, and Winsock2.2 on Windows. So far ftpony creates the socket and accepts incoming connections SOC_U: Renamed functions to maintain consistency Also prevents possible scope errors / conflicts with the actual Berkeley socket functions SOCU: Close all the opened sockets when cleaning up SOCU
* Merge pull request #369 from darkf/mingw_bunnei2014-12-317-21/+38
|\ | | | | Fix MinGW build (2)
| * Fix MSVC-related #defines and add CMakeLists commentdarkf2014-12-305-10/+10
| |
| * Fix merge conflictsdarkf2014-12-3059-1092/+1296
| |\
| * | Fix MinGW builddarkf2014-11-297-21/+34
| | |
* | | Archives: Implemented ExtSaveData and SharedExtSaveDataSubv2014-12-303-0/+4
| |/ |/| | | | | | | | | | | | | They will be stored in /extsavedata/SDMC and /extsavedata/NAND respectively. Also redirect some APT_A functions to their APT_U equivalents. Implemented the gamecoin.dat file in SharedExtSaveData in the PTM module. Implemented formatting the savegame. Retake a previous savegame if it exists instead of reporting them as not formatted every time a game is loaded.
* | Merge pull request #322 from chinhodado/masterbunnei2014-12-221-0/+6
|\ \ | | | | | | More warning cleanups
| * | More warning cleanupsChin2014-12-211-0/+6
| | |
* | | Merge pull request #291 from purpasmart96/licensebunnei2014-12-2146-74/+74
|\ \ \ | |/ / |/| | License change
| * | License changepurpasmart962014-12-2146-74/+74
| | |
* | | BitField: Add an explicit Assign method.Tony Wasserka2014-12-201-1/+5
| | | | | | | | | | | | This is useful when doing crazy stuff like inheriting from BitField.
* | | Common: Add a clone of std::make_uniqueYuri Kunde Schlesner2014-12-202-0/+17
|/ /
* | SaveData: Implemented the SystemSaveData archive.Subv2014-12-183-0/+4
| | | | | | | | It will be stored in the /syssavedata folder. This archive is user by various Services and possibly games via the FS:U service.
* | Filesystem/Archives: Implemented the SaveData archiveSubv2014-12-183-0/+4
| | | | | | | | | | | | | | | | | | | | The savedata for each game is stored in /savedata/<ProgramID> for NCCH files. ELF files and 3DSX files use the folder 0 because they have no ID information Got rid of the code duplication in File and Directory Files that deal with the host machine's file system now live in DiskFile, similarly for directories and DiskDirectory and archives with DiskArchive. FS_U: Use the correct error code when a file wasn't found
* | Restore the original console color after logging a message.Yuri Kunde Schlesner2014-12-142-13/+25
| | | | | | | | Fixes #277
* | Remove old logging systemYuri Kunde Schlesner2014-12-136-850/+2
| |
* | Add configurable per-class log filteringYuri Kunde Schlesner2014-12-135-3/+205
| |
* | Convert old logging calls to new logging macrosYuri Kunde Schlesner2014-12-138-71/+94
| |
* | Implement text path trimming for shorter paths.Yuri Kunde Schlesner2014-12-133-1/+53
| |
* | Re-add coloring to the console logging output.Yuri Kunde Schlesner2014-12-131-0/+50
| |
* | New logging systemYuri Kunde Schlesner2014-12-1311-66/+716
| |
* | Add SCOPE_EXIT macro to conveniently execute cleanup actionsYuri Kunde Schlesner2014-12-132-0/+38
| |
* | Added missing include in common_funcs.hYuri Kunde Schlesner2014-12-131-0/+1
| |
* | Remove redundant include from common_funcs.hYuri Kunde Schlesner2014-12-131-2/+0
| |
* | Merge pull request #267 from bunnei/apt-shared-fontbunnei2014-12-133-26/+6
|\ \ | | | | | | APT shared font loading
| * | APT_U: Added GetSharedFont service function.bunnei2014-12-131-0/+3
| | |
| * | Common: Add "sysdata" to GetUserPath and cleanup.bunnei2014-12-123-26/+3
| | |
* | | Merge pull request #261 from neobrain/boostTony Wasserka2014-12-121-3/+3
|\ \ \ | |/ / |/| | Add Boost as a submodule and add some minor cleanups using Boost.Range
| * | StringUtil: Perform some minimal cleanup.Tony Wasserka2014-12-071-3/+3
| | |
* | | Explicitly specify LE strings to iconv, fixes paths in Steel Diverarchshift2014-12-101-2/+2
| | |
* | | Remove unused NDMA moduleYuri Kunde Schlesner2014-12-092-2/+0
| | |
* | | Some code cleanup.Tony Wasserka2014-12-091-0/+2
| | |
* | | Fix some headers to include their dependencies properly.Tony Wasserka2014-12-092-0/+7
|/ /
* / Change NULLs to nullptrs.Rohit Nirmal2014-12-0317-92/+92
|/
* Remove unused includes to common/thread.hEmmanuel Gil Peyrot2014-11-251-1/+0
|
* Remove tabs in all files except in skyeye imports and in generated GL codeEmmanuel Gil Peyrot2014-11-193-100/+100
|
* Remove trailing spaces in every file but the ones imported from SkyEye, AOSP or generatedEmmanuel Gil Peyrot2014-11-1923-160/+160
|
* Merge pull request #165 from neobrain/viewport-scalingbunnei2014-11-194-38/+101
|\ | | | | Stretch emulation output to render window and be display density independent
| * EmuWindow: Add some explicit documentation and set proper minimal client area size.Tony Wasserka2014-11-181-2/+4
| |
| * EmuWindow: Add a TODO.Tony Wasserka2014-11-181-0/+1
| | | | | | | | | | | | Implementing this function currently is not critical, as we don't perform any configuration changes, yet. However, the interface is a good starting point for adding this functionality.
| * MathUtil: Make Rectangle work with unsigned types.Tony Wasserka2014-11-181-4/+5
| |
| * EmuWindow: Better document the purpose of OnMinimalClientAreaChangeRequest.Tony Wasserka2014-11-181-0/+7
| |
| * EmuWindow: Remove window title getters/setters.Tony Wasserka2014-11-181-16/+1
| | | | | | | | | | The window title is none of the emulation core's business. The GUI code is free to put whatever it wants there. Providing properly thread-safe window title getters and setters is a mess anyway.
| * EmuWindow: Add documentation.Tony Wasserka2014-11-181-18/+57
| |
| * EmuWindow: Add support for specifying minimal client area sizes.Tony Wasserka2014-11-181-8/+26
| |
| * Fixup EmuWindow interface and implementations thereof.Tony Wasserka2014-11-181-28/+33
| |
| * Viewport scaling and display density independenceKevin Hartman2014-11-181-2/+5
| | | | | | | | | | The view is scaled to be as large as possible, without changing the aspect, within the bounds of the window. On "retina" displays, or other displays where window units != pixels, the view should no longer draw incorrectly.
| * Add a GUI logging channel.Tony Wasserka2014-11-182-0/+2
| | | | | | | | Replace asserts with _dbg_assert_.
* | Remove extraneous semicolonsLioncash2014-11-182-2/+2
|/
* emu_window: Fix initializer list order.Lioncash2014-11-171-2/+2
| | | | Gets rid of a warning on OSX.
* Use std::u16string for conversion between UTF-8 and UTF-16, FS:USER functionsarchshift2014-11-132-51/+115
|
* Renamed souce files of services to match port namesGareth Poole2014-10-291-1/+1
|
* Add `override` keyword through the code.Yuri Kunde Schlesner2014-10-262-3/+3
| | | | This was automated using `clang-modernize`.
* Fix compile errors in ClangYuri Kunde Schlesner2014-10-261-1/+0
|
* Merge pull request #150 from lioncash/typoTony Wasserka2014-10-251-1/+1
|\ | | | | bit_field: Fix a typo in the sample usage.
| * bit_field: Fix a typo in the sample usage.Lioncash2014-10-251-1/+1
| |
* | Removed uses of raw c-string manipulation functions.archshift2014-10-244-21/+10
|/
* Merge pull request #133 from archshift/sdmc-enabledbunnei2014-10-241-2/+4
|\ | | | | Use config files to store whether SDMC is enabled or not, auto-create SDMC dir.
| * Common: Return from CreateFullPath early if the directory creation failsarchshift2014-10-231-2/+4
| |
* | Use std sized types instead of platform specific typedefsYuri Kunde Schlesner2014-10-232-32/+12
|/
* Merge pull request #108 from archshift/configbunnei2014-10-086-69/+73
|\ | | | | Configuration files
| * Added configuration file system.archshift2014-10-086-69/+73
| | | | | | | | Uses QSettings on citra-qt, and inih on citra-cli.
* | Common: Add a helper function to generate a 8.3 filename from a long one.Emmanuel Gil Peyrot2014-10-062-0/+53
| | | | | | | | Core: Fix the SDMC Directory implementation to make blargSnes work.
* | Fix warnings in core and commonLioncash2014-09-283-15/+5
|/
* Merge pull request #118 from lioncash/chunk-filebunnei2014-09-231-244/+0
|\ | | | | chunk_file: General cleanup
| * chunk_file: General cleanupLioncash2014-09-221-244/+0
| | | | | | | | | | - Remove unnecessary ifdefs - Remove commented out code. Can be retrieved later if needed.
* | Use the citra user path for the sdmc directoryarchshift2014-09-213-0/+4
|/
* Common: Rename the File namespace to FileUtil, to match the filename and prevent collisions.Emmanuel Gil Peyrot2014-09-174-25/+25
|
* Common: Return the number of items read/written in IOFile’s methods instead of a boolean.Emmanuel Gil Peyrot2014-09-171-8/+20
|
* Added support for multiple input device types for KeyMap and connected Qt.Kevin Hartman2014-09-125-40/+61
|
* Initial HID PAD work, with GLFW only.Kevin Hartman2014-09-124-0/+77
|
* Merge pull request #99 from archshift/ext-checkbunnei2014-09-1112-40/+44
|\ | | | | loader.cpp: improved file extension checking, made Upper/LowerStr useful, moved string_util into Common namespace
| * Moved common_types::Rect from common to Common namespacearchshift2014-09-091-1/+1
| |
| * Added string_util to common, small changes in loader.cpparchshift2014-09-0911-32/+39
| |
| * loader.cpp: improved file extension checking, made Upper/LowerStr usefularchshift2014-09-092-12/+9
| | | | | | | | Instead of forcibly taking the last 4 characters, it now finds the last extension separator (the period) and takes a substr of its location.
* | Merge pull request #103 from archshift/prunebunnei2014-09-1110-34/+3
|\ \ | | | | | | Prune redundant includes
| * | common: Prune all redundant includesarchshift2014-09-0910-34/+3
| |/
* | Merge pull request #104 from archshift/removalbunnei2014-09-102-71/+0
|\ \ | | | | | | Removed fixed_size_queue.h
| * | Removed fixed_size_queue.harchshift2014-09-092-71/+0
| |/ | | | | | | It's unused and doesn't look like it compiles anyway :/
* | Merge pull request #101 from lioncash/inf-loopbunnei2014-09-101-3/+8
|\ \ | | | | | | Common: Fix a potential infinite loop in StringUtil's ReplaceAll
| * | Common: Fix a potential infinite loop in StringUtil's ReplaceAllLioncash2014-09-081-3/+8
| |/
* / Common: Remove HAVE_CXX11_SYNTAX define from Common.hLioncash2014-09-081-6/+0
|/
* Removed common/std_xyz, instead using the std headerarchshift2014-09-077-856/+6
|
* Removed common/atomic, instead using std::atomicarchshift2014-09-034-198/+0
|
* Remove hand-crafted Visual Studio solution.Yuri Kunde Schlesner2014-09-014-453/+0
|
* Avoid LOGGING redefinition warnings.Yuri Kunde Schlesner2014-09-011-0/+2
|
* CMake cleanupYuri Kunde Schlesner2014-09-011-7/+16
| | | | | | | | Several cleanups to the buildsystem: - Do better factoring of common libs between platforms. - Add support to building on Windows. - Remove Qt4 support. - Re-sort file lists and add missing headers.
* Merge pull request #58 from lioncash/clampbunnei2014-08-211-0/+7
|\ | | | | Common: Add a clamp function to math_utils.h
| * Common: Add a clamp function to math_utils.hLioncash2014-08-191-0/+7
| |
* | Common: Get rid of an unnecessary forward declaration in symbols.hLioncash2014-08-181-2/+0
|/
* Common: Don't return a reference to a string when calling GetName in symbols.cppLioncash2014-08-182-2/+2
| | | | Returning a copy of the string is what was likely meant to be done.
* Merge pull request #52 from lioncash/memorybunnei2014-08-181-5/+8
|\ | | | | Common: Correctly set ptr to null if mmap fails in memory_util
| * Common: Correctly set ptr to null if mmap fails in memory_utilLioncash2014-08-171-5/+8
| | | | | | | | On POSIX systems mmap will return MAP_FAILED ((void*)-1) instead of a null pointer.
* | Merge pull request #48 from linkmauve/masterbunnei2014-08-181-24/+23
|\ \ | | | | | | Replace insecure temporary file creation with devshm.
| * | mem_arena: Replace insecure temporary file creation with devshm, importing Dolphin’s code.Emmanuel Gil Peyrot2014-08-161-24/+23
| |/
* | Common: Move remaining C header includes over to their C++ equivalentLioncash2014-08-178-21/+20
| |
* | Common: Move header guards over to pragma onceLioncash2014-08-1733-146/+41
|/ | | | Also replaced C headers with the C++ equivalent ones
* Simplified if-tree in extended_trace.cpparchshift2014-08-121-13/+9
|
* Merge pull request #41 from archshift/itrbunnei2014-08-122-78/+67
|\ | | | | Changed iterators to use auto, many of which using range-based loops
| * break_points.cpp: return directly from conditionalsarchshift2014-08-121-6/+2
| |
| * break_points: cleaned up, added `find_if`sarchshift2014-08-122-59/+51
| |
| * Changed iterators to use auto, some of which using range-based loopsarchshift2014-08-121-27/+28
| |
* | Remove the fancy RegisterSet class introduced in 4c2bff61e.Tony Wasserka2014-08-123-165/+0
|/ | | | | While it was some nice and fancy template usage, it ultimately had many practical issues regarding length of involved expressions under regular usage as well as common code completion tools not being able to handle the structures. Instead, we now use a more conventional approach which is a lot more clean to use.
* Use pthread_set_name_np() on OpenBSD.Anthony J. Bentley2014-08-081-1/+3
|
* RegisterSet: Simplify code by using structs for register definition instead of unions.Tony Wasserka2014-07-231-6/+8
|
* [build] Search for the git binary in the default msysgit install dirYuri Kunde Schlesner2014-07-191-1/+8
| | | | | | | | | The Git for Windows installer doesn't add the Git binaries to the path by default. (Due to risk of conflicts with built-in windows commands.) Unless you have configured your system specially this causes the scm_rev_gen.js script to fail to find Git. Added more paths to the script so that it searches in the default msysgit installation directory, eliminating the need to set the PATH for most environments.
* BitField: Cast enum values to proper integer type.Tony Wasserka2014-07-161-1/+1
|
* BitField: Add a static_assert.Tony Wasserka2014-07-161-0/+1
| | | | Being able to store BitField within unions requires BitField to be of standard layout, which in turn is only given if the underlying type is also has standard layout.
* BitField: Delete copy assignment to prevent obscure bugs.Tony Wasserka2014-07-161-0/+16
| | | | Cf. https://github.com/dolphin-emu/dolphin/pull/483
* BitField: Add an explicit evaluation method.Tony Wasserka2014-07-161-0/+5
| | | | Sometimes it can be beneficial to use this in places where an explicit cast needs to happen otherwise. By using the evaluation method, it's not necessary anymore to explicitly write the underlying type in this case.
* Merge branch 'threading' of https://github.com/bunnei/citrabunnei2014-06-144-43/+48
|\ | | | | | | | | | | Conflicts: src/core/hle/function_wrappers.h src/core/hle/service/gsp.cpp
| * log: updated MAX_LOGLEVEL to use correct log level enum typebunnei2014-06-013-5/+5
| |
| * log: updated GenericLog __attribute__ for newly added parameterbunnei2014-06-011-1/+1
| |
| * log: fixed to not print twice, enabled coloring, added OS print logging as its own typebunnei2014-05-304-37/+42
| |
* | Removed definition of MAX_PATH, this is already defined in common_paths.h.bunnei2014-06-121-2/+0
| |
* | Preprocessor: #if's out OSX-specific GL changes on other platformsarchshift2014-06-121-1/+1
| |
* | Common: Removed duplicate "LONG" and "MAX_PATH" definitions.bunnei2014-06-121-2/+0
| |
* | Pica: Use some template magic to define register structures efficiently.Tony Wasserka2014-06-123-3/+166
| |
* | Rename LCD to GPU.Tony Wasserka2014-06-122-2/+2
| |
* | Merge branch 'threading'bunnei2014-05-236-3/+228
|\|
| * added MIN, MAX, and CLAMP macros to common_funcsbunnei2014-05-171-0/+5
| |
| * added ThreadQueueList class to common (taken from PPSSPP)bunnei2014-05-163-0/+218
| |
| * added kernel logger to commonbunnei2014-05-102-3/+5
| |
* | common_types: Changed BasicRect back to Rect, in the common namespacearchshift2014-05-201-4/+6
| | | | | | | | Only Rect is in the namespace for now; the rest of common should be added in the future
* | Improved clarity and whitespacearchshift2014-05-201-0/+1
| | | | | | | | Changed QGL version to 3,2 in order to be less restrictive, yet it should still change up to 4,1 on OSX on Qt5.
* | CMakeLists: rename HEADS, improved commentsarchshift2014-05-201-2/+2
| | | | | | | | Changes for clarity of comments, removed redundant compiler flags.
* | Updated cmakelistsarchshift2014-05-171-0/+1
| |
* | Merge remote-tracking branch 'upstream/master' into issue-7-fixarchshift2014-05-175-5/+179
|\|
| * removed incorrect dolphin copyright linebunnei2014-05-081-1/+0
| |
| * fixed include of common in bit_field.hbunnei2014-05-081-1/+1
| |
| * logger fix for linuxbunnei2014-05-082-3/+3
| |
| * added GSP to loggersbunnei2014-05-082-2/+2
| |
| * added BitField to commonbunnei2014-05-083-0/+175
| |
| * - added better SVC loggingbunnei2014-05-062-5/+5
| | | | | | | | - added stubs for GetResourceLimit and GetResourceLimitCurrentValues SVCs
* | Support for C++11 on OSXarchshift2014-05-011-2/+2
| |
* | Fixed indentsarchshift2014-05-011-1/+1
| |
* | Some more experimentationarchshift2014-04-301-3/+3
| |
* | IT'S ALIVE!archshift2014-04-291-1/+39
| |
* | Fix complaints about functions that could not be foundarchshift2014-04-281-1/+1
| |
* | Problematic class with no current implementationarchshift2014-04-281-2/+2
| |
* | Rect to BasicRectarchshift2014-04-281-4/+4
| | | | | | | | Somewhere along the line an OSX header had already taken the name Rect.
* | add missing bswap functionsbunnei2014-04-281-0/+44
|/
* fix for issue Linux build #9, not sure why this is broken but its unused code I'm just getting rid of itbunnei2014-04-281-13/+0
|
* Merge branch 'hle-interface-updates'bunnei2014-04-281-5/+0
|\
| * removed DISALLOW_COPY_AND_ASSIGN in favor of NonCopyable classbunnei2014-04-281-5/+0
| |
* | Resolved undefined Common::g_scm_branch error.Thomas Edvalson2014-04-251-1/+1
|/
* made qt window title consistentbunnei2014-04-241-1/+1
|
* fixes to scm_rev generation to make it conistent with windows buildbunnei2014-04-242-5/+5
|
* updated windows scm_rev code to use new styleShizZy2014-04-245-66/+53
|
* added scm rev generation on Linux/cmakebunnei2014-04-246-51/+37
|
* fixes to build on linuxbunnei2014-04-232-14/+14
|
* removed duplicate rotl/rotr functionsShizZy2014-04-231-26/+0
|
* updated CMakeLists for missing filesShizZy2014-04-231-0/+1
|
* Merge branch 'hle-interface'bunnei2014-04-184-5/+27
|\
| * added NDMA hardware interfacebunnei2014-04-182-2/+2
| |
| * added helper functions for upper/lowercase stringsbunnei2014-04-152-0/+22
| |
| * added logger for generic HLEbunnei2014-04-112-3/+3
| |
* | Add symbols mapMathieu Vaillancourt2014-04-134-0/+100
|/
* removed scm_rev.h from version controlbunnei2014-04-111-4/+0
|
* added missing const to GetWindowTitlebunnei2014-04-111-1/+1
|
* updated CMakeListsbunnei2014-04-101-16/+17
|
* - removed deprecated version.hbunnei2014-04-094-72/+52
| | | | | - cleaned up window title - cleaned up emu_window_glfw/emu_window
* fixed scm_rev_genbunnei2014-04-092-5/+5
|
* fixed project includes to use new directory structurebunnei2014-04-0944-211/+201
|
* got rid of 'src' folders in each sub-projectbunnei2014-04-0954-0/+0
|
* added "citra" instead of "emu" to title barbunnei2014-04-071-1/+1
|
* added logger option specifically for the rendererbunnei2014-04-062-2/+2
|
* added missing includes to common_types.hbunnei2014-04-051-0/+3
|
* Updated common_types.h to use Gekko's version w/ Rect and some useful unionsbunnei2014-04-051-30/+102
|
* added DISALLOW_COPY_AND_ASSIGN macrobunnei2014-04-051-0/+5
|
* added LCD loggerbunnei2014-04-052-2/+2
|
* added a HW option to loggingbunnei2014-04-052-48/+48
|
* convert tabs to spacesbunnei2014-04-0247-5298/+5298
|
* grabbed ppsspp's MemArenabunnei2014-04-012-221/+428
|
* added TIME logger for core timingShizZy2013-10-022-2/+2
|
* renamed GC_ALIGNED* macros to MEMORY_ALIGNED*ShizZy2013-10-021-12/+12
|
* upgraded proj files to vs 2013ShizZy2013-09-272-2/+16
|
* renamed from citrus to citraShizZy2013-09-264-5/+5
|
* moved file_sys back to coreShizZy2013-09-265-973/+0
|
* removed <windows.h> include from common.h and added it only where neededShizZy2013-09-242-5/+1
|
* moved file_sys to commonShizZy2013-09-245-0/+973
|
* added localtime_r for use on windowsShizZy2013-09-241-0/+8
|
* added utf8 to common module, utils for dealing with utf8ShizZy2013-09-244-0/+534
|
* updated to chunk_file module from ppssppShizZy2013-09-201-133/+623
|
* added a module for loading bootable binariesShizZy2013-09-202-4/+4
|
* added swap types to commonShizZy2013-09-194-0/+549
|
* removed CORE and LOADER from LogTypesShizZy2013-09-191-2/+0
|
* added CORE and LOADER to LogTypesShizZy2013-09-191-0/+2
|
* changed log CPU from PPC to ARM11ShizZy2013-09-182-2/+3
|
* added default windows includeShizZy2013-09-181-0/+4
|
* added file platform.hShizZy2013-09-164-0/+137
|
* renamed project to 'citrus'ShizZy2013-09-143-3/+3
|
* added scm_rev_gen project to automatically create a header with the git revision on buildShizZy2013-09-134-3/+162
|
* cleaned up VS project filesShizZy2013-09-091-11/+9
|
* fixed some code warningsShizZy2013-09-091-1/+1
|
* removed unneeded dolphin paths code, fixed linker problems with common.libShizZy2013-09-093-132/+118
|
* re-enabled GetLastErrorMsgShizZy2013-09-091-19/+23
|
* updated common pathsShizZy2013-09-082-4/+7
|
* start of 3DS memory mapShizZy2013-09-063-12/+3
|
* various fixes to be able to build projectShizZy2013-09-051-17/+13
|
* added emu_window.h to define interface to drawing to a windowShizZy2013-09-053-0/+108
|
* updated CMakeLists.txt file for new common filesShizZy2013-09-051-9/+16
|
* replaced common code with dolphin commonShizZy2013-09-0551-107/+8640
|
* deleted gekko's common filesShizZy2013-09-0428-4543/+0
|
* adding initial project layoutShizZy2013-08-3031-0/+4777