summaryrefslogtreecommitdiffstats
path: root/src
diff options
context:
space:
mode:
Diffstat (limited to 'src')
-rw-r--r--src/AllocationPool.h4
-rw-r--r--src/Bindings/AllToLua.pkg1
-rw-r--r--src/Bindings/CMakeLists.txt2
-rw-r--r--src/Bindings/LuaState.cpp46
-rw-r--r--src/Bindings/LuaState.h3
-rw-r--r--src/Bindings/ManualBindings.cpp167
-rw-r--r--src/Bindings/ManualBindings.h18
-rw-r--r--src/Bindings/ManualBindings_RankManager.cpp1007
-rw-r--r--src/Bindings/Plugin.h3
-rw-r--r--src/Bindings/PluginLua.cpp25
-rw-r--r--src/Bindings/PluginLua.h3
-rw-r--r--src/Bindings/PluginManager.cpp19
-rw-r--r--src/Bindings/PluginManager.h2
-rw-r--r--src/Bindings/gen_LuaState_Call.lua28
-rw-r--r--src/BlockArea.cpp22
-rw-r--r--src/BlockArea.h2
-rw-r--r--src/BlockEntities/CommandBlockEntity.cpp35
-rw-r--r--src/BlockEntities/FurnaceEntity.h2
-rw-r--r--src/Blocks/BlockAnvil.h11
-rw-r--r--src/Blocks/BlockBigFlower.h6
-rw-r--r--src/Blocks/BlockCake.h2
-rw-r--r--src/Blocks/BlockDirt.h2
-rw-r--r--src/Blocks/BlockFarmland.h5
-rw-r--r--src/Blocks/BlockFenceGate.h1
-rw-r--r--src/Blocks/BlockFire.h30
-rw-r--r--src/Blocks/BlockFlower.h2
-rw-r--r--src/Blocks/BlockGlowstone.h6
-rw-r--r--src/Blocks/BlockHandler.cpp6
-rw-r--r--src/Blocks/BlockLeaves.h2
-rw-r--r--src/Blocks/BlockMelon.h4
-rw-r--r--src/Blocks/BlockNewLeaves.h42
-rw-r--r--src/Blocks/BlockNote.h13
-rw-r--r--src/Blocks/BlockOre.h40
-rw-r--r--src/Blocks/BlockPlanks.h3
-rw-r--r--src/Blocks/BlockPortal.h8
-rw-r--r--src/Blocks/BlockPressurePlate.h4
-rw-r--r--src/Blocks/BlockQuartz.h1
-rw-r--r--src/Blocks/BlockRedstone.h4
-rw-r--r--src/Blocks/BlockRedstoneRepeater.h6
-rw-r--r--src/Blocks/BlockStairs.h20
-rw-r--r--src/Blocks/BlockSugarcane.h1
-rw-r--r--src/Blocks/BlockTorch.h4
-rw-r--r--src/Blocks/BlockTrapdoor.h9
-rw-r--r--src/Blocks/BlockTripwireHook.h10
-rw-r--r--src/Blocks/BlockVine.h6
-rw-r--r--src/Blocks/CMakeLists.txt2
-rw-r--r--src/Blocks/ClearMetaOnDrop.h2
-rw-r--r--src/Blocks/MetaRotator.h10
-rw-r--r--src/ByteBuffer.cpp2
-rw-r--r--src/CMakeLists.txt6
-rw-r--r--src/CheckBasicStyle.lua3
-rw-r--r--src/Chunk.cpp11
-rw-r--r--src/Chunk.h2
-rw-r--r--src/ChunkDef.h2
-rw-r--r--src/ChunkMap.cpp66
-rw-r--r--src/ClientHandle.cpp74
-rw-r--r--src/CraftingRecipes.cpp23
-rw-r--r--src/CraftingRecipes.h6
-rw-r--r--src/DeadlockDetect.cpp4
-rw-r--r--src/Defines.h2
-rw-r--r--src/Entities/ItemFrame.cpp1
-rw-r--r--src/Entities/Minecart.cpp94
-rw-r--r--src/Entities/Player.cpp267
-rw-r--r--src/Entities/Player.h54
-rw-r--r--src/FastRandom.h2
-rw-r--r--src/FurnaceRecipe.cpp243
-rw-r--r--src/FurnaceRecipe.h37
-rw-r--r--src/Generating/CMakeLists.txt2
-rw-r--r--src/Generating/Caves.cpp3
-rw-r--r--src/Generating/ChunkGenerator.cpp1
-rw-r--r--src/Generating/ComposableGenerator.cpp9
-rw-r--r--src/Generating/DungeonRoomsFinisher.cpp279
-rw-r--r--src/Generating/DungeonRoomsFinisher.h52
-rw-r--r--src/Generating/HeiGen.cpp10
-rw-r--r--src/Group.cpp41
-rw-r--r--src/Group.h44
-rw-r--r--src/GroupManager.cpp227
-rw-r--r--src/GroupManager.h36
-rw-r--r--src/HTTPServer/HTTPConnection.cpp3
-rw-r--r--src/HTTPServer/HTTPFormParser.cpp8
-rw-r--r--src/Inventory.cpp2
-rw-r--r--src/Items/ItemGoldenApple.h2
-rw-r--r--src/Items/ItemHandler.h2
-rw-r--r--src/Items/ItemShovel.h1
-rw-r--r--src/LightingThread.cpp6
-rw-r--r--src/LinearUpscale.h6
-rw-r--r--src/LoggerListeners.cpp14
-rw-r--r--src/Mobs/Monster.cpp2
-rw-r--r--src/Noise.cpp5
-rw-r--r--src/OSSupport/Queue.h2
-rw-r--r--src/PolarSSL++/SslContext.cpp1
-rw-r--r--src/Protocol/MojangAPI.cpp28
-rw-r--r--src/Protocol/MojangAPI.h26
-rw-r--r--src/Protocol/Protocol17x.cpp104
-rw-r--r--src/Protocol/ProtocolRecognizer.cpp28
-rw-r--r--src/Protocol/ProtocolRecognizer.h2
-rw-r--r--src/RankManager.cpp1837
-rw-r--r--src/RankManager.h246
-rw-r--r--src/Root.cpp31
-rw-r--r--src/Root.h9
-rw-r--r--src/Server.cpp83
-rw-r--r--src/Server.h2
-rw-r--r--src/SetChunkData.cpp36
-rw-r--r--src/SetChunkData.h3
-rw-r--r--src/Simulator/VanillaFluidSimulator.cpp2
-rw-r--r--src/StringUtils.h63
-rw-r--r--src/World.cpp48
-rw-r--r--src/WorldStorage/FastNBT.h4
-rw-r--r--src/WorldStorage/NBTChunkSerializer.cpp1
-rw-r--r--src/WorldStorage/WSSAnvil.cpp438
-rw-r--r--src/WorldStorage/WSSAnvil.h31
111 files changed, 4873 insertions, 1457 deletions
diff --git a/src/AllocationPool.h b/src/AllocationPool.h
index 3c9dbe8c9..61431a548 100644
--- a/src/AllocationPool.h
+++ b/src/AllocationPool.h
@@ -3,7 +3,7 @@
#include <memory>
-template<class T>
+template <class T>
class cAllocationPool
{
public:
@@ -34,7 +34,7 @@ public:
/** Allocates memory storing unused elements in a linked list. Keeps at least NumElementsInReserve
elements in the list unless malloc fails so that the program has a reserve to handle OOM.**/
-template<class T, size_t NumElementsInReserve>
+template <class T, size_t NumElementsInReserve>
class cListAllocationPool : public cAllocationPool<T>
{
public:
diff --git a/src/Bindings/AllToLua.pkg b/src/Bindings/AllToLua.pkg
index 88faa9dfc..37e6aecd2 100644
--- a/src/Bindings/AllToLua.pkg
+++ b/src/Bindings/AllToLua.pkg
@@ -67,7 +67,6 @@ $cfile "../Root.h"
$cfile "../Cuboid.h"
$cfile "../BoundingBox.h"
$cfile "../Tracer.h"
-$cfile "../Group.h"
$cfile "../BlockArea.h"
$cfile "../Generating/ChunkDesc.h"
$cfile "../CraftingRecipes.h"
diff --git a/src/Bindings/CMakeLists.txt b/src/Bindings/CMakeLists.txt
index 54152668a..7a1769e9a 100644
--- a/src/Bindings/CMakeLists.txt
+++ b/src/Bindings/CMakeLists.txt
@@ -11,6 +11,7 @@ SET (SRCS
LuaState.cpp
LuaWindow.cpp
ManualBindings.cpp
+ ManualBindings_RankManager.cpp
Plugin.cpp
PluginLua.cpp
PluginManager.cpp
@@ -96,7 +97,6 @@ set(BINDING_DEPENDENCIES
../Entities/HangingEntity.h
../Entities/ItemFrame.h
../Generating/ChunkDesc.h
- ../Group.h
../Inventory.h
../Item.h
../ItemGrid.h
diff --git a/src/Bindings/LuaState.cpp b/src/Bindings/LuaState.cpp
index e123a87c9..9fe93ccc2 100644
--- a/src/Bindings/LuaState.cpp
+++ b/src/Bindings/LuaState.cpp
@@ -460,7 +460,43 @@ void cLuaState::Push(const Vector3d & a_Vector)
{
ASSERT(IsValid());
- tolua_pushusertype(m_LuaState, (void *)&a_Vector, "Vector3d");
+ tolua_pushusertype(m_LuaState, (void *)&a_Vector, "Vector3<double>");
+ m_NumCurrentFunctionArgs += 1;
+}
+
+
+
+
+
+void cLuaState::Push(const Vector3d * a_Vector)
+{
+ ASSERT(IsValid());
+
+ tolua_pushusertype(m_LuaState, (void *)a_Vector, "Vector3<double>");
+ m_NumCurrentFunctionArgs += 1;
+}
+
+
+
+
+
+void cLuaState::Push(const Vector3i & a_Vector)
+{
+ ASSERT(IsValid());
+
+ tolua_pushusertype(m_LuaState, (void *)&a_Vector, "Vector3<int>");
+ m_NumCurrentFunctionArgs += 1;
+}
+
+
+
+
+
+void cLuaState::Push(const Vector3i * a_Vector)
+{
+ ASSERT(IsValid());
+
+ tolua_pushusertype(m_LuaState, (void *)a_Vector, "Vector3<int>");
m_NumCurrentFunctionArgs += 1;
}
@@ -708,11 +744,11 @@ void cLuaState::Push(TakeDamageInfo * a_TDI)
-void cLuaState::Push(Vector3i * a_Vector)
+void cLuaState::Push(Vector3d * a_Vector)
{
ASSERT(IsValid());
- tolua_pushusertype(m_LuaState, a_Vector, "Vector3i");
+ tolua_pushusertype(m_LuaState, a_Vector, "Vector3<double>");
m_NumCurrentFunctionArgs += 1;
}
@@ -720,11 +756,11 @@ void cLuaState::Push(Vector3i * a_Vector)
-void cLuaState::Push(Vector3d * a_Vector)
+void cLuaState::Push(Vector3i * a_Vector)
{
ASSERT(IsValid());
- tolua_pushusertype(m_LuaState, a_Vector, "Vector3d");
+ tolua_pushusertype(m_LuaState, a_Vector, "Vector3<int>");
m_NumCurrentFunctionArgs += 1;
}
diff --git a/src/Bindings/LuaState.h b/src/Bindings/LuaState.h
index afac77ce8..eeb93fd4d 100644
--- a/src/Bindings/LuaState.h
+++ b/src/Bindings/LuaState.h
@@ -186,6 +186,9 @@ public:
void Push(const HTTPRequest * a_Request);
void Push(const HTTPTemplateRequest * a_Request);
void Push(const Vector3d & a_Vector);
+ void Push(const Vector3d * a_Vector);
+ void Push(const Vector3i & a_Vector);
+ void Push(const Vector3i * a_Vector);
// Push a value onto the stack (keep alpha-sorted):
void Push(bool a_Value);
diff --git a/src/Bindings/ManualBindings.cpp b/src/Bindings/ManualBindings.cpp
index 5aa76eee3..adf10a72f 100644
--- a/src/Bindings/ManualBindings.cpp
+++ b/src/Bindings/ManualBindings.cpp
@@ -301,11 +301,11 @@ static int tolua_cFile_GetFolderContents(lua_State * tolua_S)
-template<
+template <
class Ty1,
class Ty2,
bool (Ty1::*Func1)(const AString &, cItemCallback<Ty2> &)
- >
+>
static int tolua_DoWith(lua_State* tolua_S)
{
int NumArgs = lua_gettop(tolua_S) - 1; /* This includes 'self' */
@@ -395,7 +395,7 @@ static int tolua_DoWith(lua_State* tolua_S)
-template<
+template <
class Ty1,
class Ty2,
bool (Ty1::*Func1)(int, cItemCallback<Ty2> &)
@@ -485,7 +485,7 @@ static int tolua_DoWithID(lua_State* tolua_S)
-template<
+template <
class Ty1,
class Ty2,
bool (Ty1::*Func1)(int, int, int, cItemCallback<Ty2> &)
@@ -580,7 +580,7 @@ static int tolua_DoWithXYZ(lua_State* tolua_S)
-template<
+template <
class Ty1,
class Ty2,
bool (Ty1::*Func1)(int, int, cItemCallback<Ty2> &)
@@ -676,7 +676,7 @@ static int tolua_ForEachInChunk(lua_State * tolua_S)
-template<
+template <
class Ty1,
class Ty2,
bool (Ty1::*Func1)(cItemCallback<Ty2> &)
@@ -1803,49 +1803,30 @@ static int tolua_cWorld_ChunkStay(lua_State * tolua_S)
-static int tolua_cPlayer_GetGroups(lua_State * tolua_S)
+static int tolua_cPlayer_GetPermissions(lua_State * tolua_S)
{
- cPlayer * self = (cPlayer *)tolua_tousertype(tolua_S, 1, NULL);
+ // Function signature: cPlayer:GetPermissions() -> {permissions-array}
- const cPlayer::GroupList & AllGroups = self->GetGroups();
-
- lua_createtable(tolua_S, (int)AllGroups.size(), 0);
- int newTable = lua_gettop(tolua_S);
- int index = 1;
- cPlayer::GroupList::const_iterator iter = AllGroups.begin();
- while (iter != AllGroups.end())
+ // Check the params:
+ cLuaState L(tolua_S);
+ if (
+ !L.CheckParamUserType(1, "cPlayer") ||
+ !L.CheckParamEnd (2)
+ )
{
- const cGroup * Group = *iter;
- tolua_pushusertype(tolua_S, (void *)Group, "const cGroup");
- lua_rawseti(tolua_S, newTable, index);
- ++iter;
- ++index;
+ return 0;
}
- return 1;
-}
-
-
-
-
-
-static int tolua_cPlayer_GetResolvedPermissions(lua_State * tolua_S)
-{
- cPlayer * self = (cPlayer*) tolua_tousertype(tolua_S, 1, NULL);
-
- cPlayer::StringList AllPermissions = self->GetResolvedPermissions();
- lua_createtable(tolua_S, (int)AllPermissions.size(), 0);
- int newTable = lua_gettop(tolua_S);
- int index = 1;
- cPlayer::StringList::iterator iter = AllPermissions.begin();
- while (iter != AllPermissions.end())
+ // Get the params:
+ cPlayer * self = (cPlayer *)tolua_tousertype(tolua_S, 1, NULL);
+ if (self == NULL)
{
- std::string & Permission = *iter;
- lua_pushlstring(tolua_S, Permission.c_str(), Permission.length());
- lua_rawseti(tolua_S, newTable, index);
- ++iter;
- ++index;
+ LOGWARNING("%s: invalid self (%p)", __FUNCTION__, self);
+ return 0;
}
+
+ // Push the permissions:
+ L.Push(self->GetPermissions());
return 1;
}
@@ -1902,6 +1883,40 @@ static int tolua_cPlayer_OpenWindow(lua_State * tolua_S)
+static int tolua_cPlayer_PermissionMatches(lua_State * tolua_S)
+{
+ // Function signature: cPlayer:PermissionMatches(PermissionStr, TemplateStr) -> bool
+
+ // Check the params:
+ cLuaState L(tolua_S);
+ if (
+ !L.CheckParamUserType(1, "cPlayer") ||
+ !L.CheckParamString (2, 3) ||
+ !L.CheckParamEnd (4)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ cPlayer * self = (cPlayer *)tolua_tousertype(tolua_S, 1, NULL);
+ if (self == NULL)
+ {
+ LOGWARNING("%s: invalid self (%p)", __FUNCTION__, self);
+ return 0;
+ }
+ AString Permission, Template;
+ L.GetStackValues(2, Permission, Template);
+
+ // Push the result of the match:
+ L.Push(self->PermissionMatches(StringSplit(Permission, "."), StringSplit(Template, ".")));
+ return 1;
+}
+
+
+
+
+
template <
class OBJTYPE,
void (OBJTYPE::*SetCallback)(cPluginLua * a_Plugin, int a_FnRef)
@@ -2399,6 +2414,62 @@ static int tolua_cMojangAPI_GetUUIDsFromPlayerNames(lua_State * L)
+static int tolua_cMojangAPI_MakeUUIDDashed(lua_State * L)
+{
+ // Function signature: cMojangAPI:MakeUUIDDashed(UUID) -> string
+
+ // Check params:
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cMojangAPI") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString UUID;
+ S.GetStackValue(2, UUID);
+
+ // Push the result:
+ S.Push(cRoot::Get()->GetMojangAPI().MakeUUIDDashed(UUID));
+ return 1;
+}
+
+
+
+
+
+static int tolua_cMojangAPI_MakeUUIDShort(lua_State * L)
+{
+ // Function signature: cMojangAPI:MakeUUIDShort(UUID) -> string
+
+ // Check params:
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cMojangAPI") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString UUID;
+ S.GetStackValue(2, UUID);
+
+ // Push the result:
+ S.Push(cRoot::Get()->GetMojangAPI().MakeUUIDShort(UUID));
+ return 1;
+}
+
+
+
+
+
static int Lua_ItemGrid_GetSlotCoords(lua_State * L)
{
tolua_Error tolua_err;
@@ -2592,7 +2663,7 @@ static int tolua_cRoot_GetFurnaceRecipe(lua_State * tolua_S)
// Get the recipe for the input
cFurnaceRecipe * FR = cRoot::Get()->GetFurnaceRecipe();
- const cFurnaceRecipe::Recipe * Recipe = FR->GetRecipeFrom(*Input);
+ const cFurnaceRecipe::cRecipe * Recipe = FR->GetRecipeFrom(*Input);
if (Recipe == NULL)
{
// There is no such furnace recipe for this input, return no value
@@ -3295,9 +3366,9 @@ void ManualBindings::Bind(lua_State * tolua_S)
tolua_endmodule(tolua_S);
tolua_beginmodule(tolua_S, "cPlayer");
- tolua_function(tolua_S, "GetGroups", tolua_cPlayer_GetGroups);
- tolua_function(tolua_S, "GetResolvedPermissions", tolua_cPlayer_GetResolvedPermissions);
- tolua_function(tolua_S, "OpenWindow", tolua_cPlayer_OpenWindow);
+ tolua_function(tolua_S, "GetPermissions", tolua_cPlayer_GetPermissions);
+ tolua_function(tolua_S, "OpenWindow", tolua_cPlayer_OpenWindow);
+ tolua_function(tolua_S, "PermissionMatches", tolua_cPlayer_PermissionMatches);
tolua_endmodule(tolua_S);
tolua_beginmodule(tolua_S, "cLuaWindow");
@@ -3340,6 +3411,8 @@ void ManualBindings::Bind(lua_State * tolua_S)
tolua_function(tolua_S, "GetPlayerNameFromUUID", tolua_cMojangAPI_GetPlayerNameFromUUID);
tolua_function(tolua_S, "GetUUIDFromPlayerName", tolua_cMojangAPI_GetUUIDFromPlayerName);
tolua_function(tolua_S, "GetUUIDsFromPlayerNames", tolua_cMojangAPI_GetUUIDsFromPlayerNames);
+ tolua_function(tolua_S, "MakeUUIDDashed", tolua_cMojangAPI_MakeUUIDDashed);
+ tolua_function(tolua_S, "MakeUUIDShort", tolua_cMojangAPI_MakeUUIDShort);
tolua_endmodule(tolua_S);
tolua_beginmodule(tolua_S, "cItemGrid");
@@ -3347,6 +3420,8 @@ void ManualBindings::Bind(lua_State * tolua_S)
tolua_endmodule(tolua_S);
tolua_function(tolua_S, "md5", tolua_md5);
+
+ BindRankManager(tolua_S);
tolua_endmodule(tolua_S);
}
diff --git a/src/Bindings/ManualBindings.h b/src/Bindings/ManualBindings.h
index 36161c6a2..1b6e65654 100644
--- a/src/Bindings/ManualBindings.h
+++ b/src/Bindings/ManualBindings.h
@@ -1,8 +1,24 @@
#pragma once
struct lua_State;
+
+
+
+
+
+/** Provides namespace for the bindings. */
class ManualBindings
{
public:
- static void Bind( lua_State* tolua_S);
+ /** Binds all the manually implemented functions to tolua_S. */
+ static void Bind(lua_State * tolua_S);
+
+protected:
+ /** Binds the manually implemented cRankManager glue code to tolua_S.
+ Implemented in ManualBindings_RankManager.cpp. */
+ static void BindRankManager(lua_State * tolua_S);
};
+
+
+
+
diff --git a/src/Bindings/ManualBindings_RankManager.cpp b/src/Bindings/ManualBindings_RankManager.cpp
new file mode 100644
index 000000000..2e93ad264
--- /dev/null
+++ b/src/Bindings/ManualBindings_RankManager.cpp
@@ -0,0 +1,1007 @@
+
+// ManualBindings_RankManager.cpp
+
+// Implements the cRankManager Lua bindings
+
+#include "Globals.h"
+#include "ManualBindings.h"
+#include "../Root.h"
+#include "tolua++/include/tolua++.h"
+#include "LuaState.h"
+
+
+
+
+
+/** Binds cRankManager::AddGroup */
+static int tolua_cRankManager_AddGroup(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:AddGroup(GroupName)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Read the params:
+ AString GroupName;
+ S.GetStackValue(2, GroupName);
+
+ // Add the group:
+ cRoot::Get()->GetRankManager().AddGroup(GroupName);
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::AddGroupToRank */
+static int tolua_cRankManager_AddGroupToRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:AddGroupToRank(GroupName, RankName) -> bool
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 3) ||
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Read the params:
+ AString GroupName, RankName;
+ S.GetStackValues(2, GroupName, RankName);
+
+ // Add the group to the rank:
+ S.Push(cRoot::Get()->GetRankManager().AddGroupToRank(GroupName, RankName));
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::AddPermissionToGroup */
+static int tolua_cRankManager_AddPermissionToGroup(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:AddPermissionToGroup(Permission, GroupName) -> bool
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 3) ||
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Read the params:
+ AString GroupName, Permission;
+ S.GetStackValues(2, Permission, GroupName);
+
+ // Add the group to the rank:
+ S.Push(cRoot::Get()->GetRankManager().AddPermissionToGroup(Permission, GroupName));
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::AddRank */
+static int tolua_cRankManager_AddRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:AddRank(RankName)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 5) ||
+ !S.CheckParamEnd(6)
+ )
+ {
+ return 0;
+ }
+
+ // Read the params:
+ AString RankName, MsgPrefix, MsgSuffix, MsgNameColorCode;
+ S.GetStackValues(2, RankName, MsgPrefix, MsgSuffix, MsgNameColorCode);
+
+ // Add the rank:
+ cRoot::Get()->GetRankManager().AddRank(RankName, MsgPrefix, MsgSuffix, MsgNameColorCode);
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::GetAllGroups */
+static int tolua_cRankManager_GetAllGroups(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetAllGroups() -> arraytable of GroupNames
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamEnd(2)
+ )
+ {
+ return 0;
+ }
+
+ // Get the groups:
+ AStringVector Groups = cRoot::Get()->GetRankManager().GetAllGroups();
+
+ // Push the results:
+ S.Push(Groups);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetAllPermissions */
+static int tolua_cRankManager_GetAllPermissions(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetAllPermissions() -> arraytable of Permissions
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamEnd(2)
+ )
+ {
+ return 0;
+ }
+
+ // Get the permissions:
+ AStringVector Permissions = cRoot::Get()->GetRankManager().GetAllPermissions();
+
+ // Push the results:
+ S.Push(Permissions);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetAllRanks */
+static int tolua_cRankManager_GetAllRanks(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetAllRanks() -> arraytable of RankNames
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamEnd(2)
+ )
+ {
+ return 0;
+ }
+
+ // Get the ranks:
+ AStringVector Ranks = cRoot::Get()->GetRankManager().GetAllRanks();
+
+ // Push the results:
+ S.Push(Ranks);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetDefaultRank */
+static int tolua_cRankManager_GetDefaultRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetDefaultRank() -> string
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamEnd(2)
+ )
+ {
+ return 0;
+ }
+
+ // Return the rank name:
+ S.Push(cRoot::Get()->GetRankManager().GetDefaultRank());
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetGroupPermissions */
+static int tolua_cRankManager_GetGroupPermissions(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetGroupPermissions(GroupName) -> arraytable of permissions
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString GroupName;
+ S.GetStackValue(2, GroupName);
+
+ // Get the permissions:
+ AStringVector Permissions = cRoot::Get()->GetRankManager().GetGroupPermissions(GroupName);
+
+ // Push the results:
+ S.Push(Permissions);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetPlayerGroups */
+static int tolua_cRankManager_GetPlayerGroups(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetPlayerGroups(PlayerUUID) -> arraytable of GroupNames
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString PlayerUUID;
+ S.GetStackValue(2, PlayerUUID);
+
+ // Get the groups:
+ AStringVector Groups = cRoot::Get()->GetRankManager().GetPlayerGroups(PlayerUUID);
+
+ // Push the results:
+ S.Push(Groups);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetPlayerMsgVisuals */
+static int tolua_cRankManager_GetPlayerMsgVisuals(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetPlayerMsgVisuals(PlayerUUID) -> string, string, string
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString PlayerUUID;
+ S.GetStackValue(2, PlayerUUID);
+
+ // Get the permissions:
+ AString MsgPrefix, MsgSuffix, MsgNameColorCode;
+ if (!cRoot::Get()->GetRankManager().GetPlayerMsgVisuals(PlayerUUID, MsgPrefix, MsgSuffix, MsgNameColorCode))
+ {
+ return 0;
+ }
+
+ // Push the results:
+ S.Push(MsgPrefix);
+ S.Push(MsgSuffix);
+ S.Push(MsgNameColorCode);
+ return 3;
+}
+
+
+
+
+
+/** Binds cRankManager::GetPlayerPermissions */
+static int tolua_cRankManager_GetPlayerPermissions(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetPlayerPermissions(PlayerUUID) -> arraytable of permissions
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString PlayerUUID;
+ S.GetStackValue(2, PlayerUUID);
+
+ // Get the permissions:
+ AStringVector Permissions = cRoot::Get()->GetRankManager().GetPlayerPermissions(PlayerUUID);
+
+ // Push the results:
+ S.Push(Permissions);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetPlayerRankName */
+static int tolua_cRankManager_GetPlayerRankName(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetPlayerRankName(PlayerUUID) -> string
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString PlayerUUID;
+ S.GetStackValue(2, PlayerUUID);
+
+ // Get the rank name:
+ AString RankName = cRoot::Get()->GetRankManager().GetPlayerRankName(PlayerUUID);
+
+ // Push the result:
+ S.Push(RankName);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetRankGroups */
+static int tolua_cRankManager_GetRankGroups(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetRankGroups(RankName) -> arraytable of groupnames
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString RankName;
+ S.GetStackValue(2, RankName);
+
+ // Get the groups:
+ AStringVector Groups = cRoot::Get()->GetRankManager().GetRankGroups(RankName);
+
+ // Push the results:
+ S.Push(Groups);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetRankPermissions */
+static int tolua_cRankManager_GetRankPermissions(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetRankPermissions(RankName) -> arraytable of permissions
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString RankName;
+ S.GetStackValue(2, RankName);
+
+ // Get the permissions:
+ AStringVector Permissions = cRoot::Get()->GetRankManager().GetRankPermissions(RankName);
+
+ // Push the results:
+ S.Push(Permissions);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::GetRankVisuals */
+static int tolua_cRankManager_GetRankVisuals(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GetRankVisuals(RankName) -> MsgPrefix, MsgSuffix, MsgNameColorCode
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString RankName;
+ S.GetStackValue(2, RankName);
+
+ // Get the visuals:
+ AString MsgPrefix, MsgSuffix, MsgNameColorCode;
+ if (!cRoot::Get()->GetRankManager().GetRankVisuals(RankName, MsgPrefix, MsgSuffix, MsgNameColorCode))
+ {
+ // No such rank, return nothing:
+ return 0;
+ }
+
+ // Push the results:
+ S.Push(MsgPrefix);
+ S.Push(MsgSuffix);
+ S.Push(MsgNameColorCode);
+ return 3;
+}
+
+
+
+
+
+/** Binds cRankManager::GroupExists */
+static int tolua_cRankManager_GroupExists(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:GroupExists(GroupName) -> bool
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString GroupName;
+ S.GetStackValue(2, GroupName);
+
+ // Get the response:
+ bool res = cRoot::Get()->GetRankManager().GroupExists(GroupName);
+
+ // Push the result:
+ S.Push(res);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::IsGroupInRank */
+static int tolua_cRankManager_IsGroupInRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:IsGroupInRank(GroupName, RankName) -> bool
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 3) ||
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString GroupName, RankName;
+ S.GetStackValues(2, GroupName, RankName);
+
+ // Get the response:
+ bool res = cRoot::Get()->GetRankManager().IsGroupInRank(GroupName, RankName);
+
+ // Push the result:
+ S.Push(res);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::IsPermissionInGroup */
+static int tolua_cRankManager_IsPermissionInGroup(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:IsPermissionInGroup(Permission, GroupName) -> bool
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 3) ||
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString GroupName, Permission;
+ S.GetStackValues(2, Permission, GroupName);
+
+ // Get the response:
+ bool res = cRoot::Get()->GetRankManager().IsPermissionInGroup(Permission, GroupName);
+
+ // Push the result:
+ S.Push(res);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::IsPlayerRankSet */
+static int tolua_cRankManager_IsPlayerRankSet(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:IsPlayerRankSet(PlayerUUID) -> bool
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString PlayerUUID;
+ S.GetStackValue(2, PlayerUUID);
+
+ // Get the response:
+ bool res = cRoot::Get()->GetRankManager().IsPlayerRankSet(PlayerUUID);
+
+ // Push the result:
+ S.Push(res);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::RankExists */
+static int tolua_cRankManager_RankExists(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:RankExists(RankName) -> bool
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString RankName;
+ S.GetStackValue(2, RankName);
+
+ // Get the response:
+ bool res = cRoot::Get()->GetRankManager().RankExists(RankName);
+
+ // Push the result:
+ S.Push(res);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::RemoveGroup */
+static int tolua_cRankManager_RemoveGroup(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:RemoveGroup(GroupName)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString GroupName;
+ S.GetStackValue(2, GroupName);
+
+ // Remove the group:
+ cRoot::Get()->GetRankManager().RemoveGroup(GroupName);
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::RemoveGroupFromRank */
+static int tolua_cRankManager_RemoveGroupFromRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:RemoveGroupFromRank(GroupName, RankName)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 3) ||
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString GroupName, RankName;
+ S.GetStackValues(2, GroupName, RankName);
+
+ // Remove the group:
+ cRoot::Get()->GetRankManager().RemoveGroupFromRank(GroupName, RankName);
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::RemovePermissionFromGroup */
+static int tolua_cRankManager_RemovePermissionFromGroup(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:RemovePermissionFromGroup(Permission, GroupName)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 3) ||
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString GroupName, Permission;
+ S.GetStackValues(2, Permission, GroupName);
+
+ // Remove the group:
+ cRoot::Get()->GetRankManager().RemovePermissionFromGroup(Permission, GroupName);
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::RemovePlayerRank */
+static int tolua_cRankManager_RemovePlayerRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:RemovePlayerRank(PlayerUUID)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString PlayerUUID;
+ S.GetStackValue(2, PlayerUUID);
+
+ // Remove the player's rank:
+ cRoot::Get()->GetRankManager().RemovePlayerRank(PlayerUUID);
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::RemoveRank */
+static int tolua_cRankManager_RemoveRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:RemoveRank(RankName, [ReplacementRankName])
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ // Param 3 is otpional, defaults to nil -> empty string
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString RankName, ReplacementRankName;
+ S.GetStackValues(2, RankName, ReplacementRankName);
+
+ // Remove the rank:
+ cRoot::Get()->GetRankManager().RemoveRank(RankName, ReplacementRankName);
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::RenameGroup */
+static int tolua_cRankManager_RenameGroup(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:RenameGroup(OldName, NewName)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 3) ||
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString OldName, NewName;
+ S.GetStackValues(2, OldName, NewName);
+
+ // Remove the group:
+ bool res = cRoot::Get()->GetRankManager().RenameGroup(OldName, NewName);
+
+ // Push the result:
+ S.Push(res);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::RenameRank */
+static int tolua_cRankManager_RenameRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:RenameRank(OldName, NewName)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 3) ||
+ !S.CheckParamEnd(4)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString OldName, NewName;
+ S.GetStackValues(2, OldName, NewName);
+
+ // Remove the rank:
+ bool res = cRoot::Get()->GetRankManager().RenameRank(OldName, NewName);
+
+ // Push the result:
+ S.Push(res);
+ return 1;
+}
+
+
+
+
+
+/** Binds cRankManager::SetDefaultRank */
+static int tolua_cRankManager_SetDefaultRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:SetDefaultRank(RankName) -> bool
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2) ||
+ !S.CheckParamEnd(3)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString RankName;
+ S.GetStackValue(2, RankName);
+
+ // Set the rank, return the result:
+ S.Push(cRoot::Get()->GetRankManager().SetDefaultRank(RankName));
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::SetPlayerRank */
+static int tolua_cRankManager_SetPlayerRank(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:SetPlayerRank(PlayerUUID, PlayerName, RankName)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 4) ||
+ !S.CheckParamEnd(5)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString PlayerUUID, PlayerName, RankName;
+ S.GetStackValues(2, PlayerUUID, PlayerName, RankName);
+
+ // Set the rank:
+ cRoot::Get()->GetRankManager().SetPlayerRank(PlayerUUID, PlayerName, RankName);
+ return 0;
+}
+
+
+
+
+
+/** Binds cRankManager::SetRankVisuals */
+static int tolua_cRankManager_SetRankVisuals(lua_State * L)
+{
+ // Function signature:
+ // cRankManager:SetRankVisuals(RankName, MsgPrefix, MsgSuffix, MsgNameColorCode)
+
+ cLuaState S(L);
+ if (
+ !S.CheckParamUserTable(1, "cRankManager") ||
+ !S.CheckParamString(2, 5) ||
+ !S.CheckParamEnd(6)
+ )
+ {
+ return 0;
+ }
+
+ // Get the params:
+ AString RankName, MsgPrefix, MsgSuffix, MsgNameColorCode;
+ S.GetStackValues(2, RankName, MsgPrefix, MsgSuffix, MsgNameColorCode);
+
+ // Set the visuals:
+ cRoot::Get()->GetRankManager().SetRankVisuals(RankName, MsgPrefix, MsgSuffix, MsgNameColorCode);
+ return 0;
+}
+
+
+
+
+
+void ManualBindings::BindRankManager(lua_State * tolua_S)
+{
+ // Create the cRankManager class in the API:
+ tolua_usertype(tolua_S, "cRankManager");
+ tolua_cclass(tolua_S, "cRankManager", "cRankManager", "", NULL);
+
+ // Fill in the functions (alpha-sorted):
+ tolua_beginmodule(tolua_S, "cRankManager");
+ tolua_function(tolua_S, "AddGroup", tolua_cRankManager_AddGroup);
+ tolua_function(tolua_S, "AddGroupToRank", tolua_cRankManager_AddGroupToRank);
+ tolua_function(tolua_S, "AddPermissionToGroup", tolua_cRankManager_AddPermissionToGroup);
+ tolua_function(tolua_S, "AddRank", tolua_cRankManager_AddRank);
+ tolua_function(tolua_S, "GetAllGroups", tolua_cRankManager_GetAllGroups);
+ tolua_function(tolua_S, "GetAllPermissions", tolua_cRankManager_GetAllPermissions);
+ tolua_function(tolua_S, "GetAllRanks", tolua_cRankManager_GetAllRanks);
+ tolua_function(tolua_S, "GetDefaultRank", tolua_cRankManager_GetDefaultRank);
+ tolua_function(tolua_S, "GetGroupPermissions", tolua_cRankManager_GetGroupPermissions);
+ tolua_function(tolua_S, "GetPlayerGroups", tolua_cRankManager_GetPlayerGroups);
+ tolua_function(tolua_S, "GetPlayerMsgVisuals", tolua_cRankManager_GetPlayerMsgVisuals);
+ tolua_function(tolua_S, "GetPlayerPermissions", tolua_cRankManager_GetPlayerPermissions);
+ tolua_function(tolua_S, "GetPlayerRankName", tolua_cRankManager_GetPlayerRankName);
+ tolua_function(tolua_S, "GetRankGroups", tolua_cRankManager_GetRankGroups);
+ tolua_function(tolua_S, "GetRankPermissions", tolua_cRankManager_GetRankPermissions);
+ tolua_function(tolua_S, "GetRankVisuals", tolua_cRankManager_GetRankVisuals);
+ tolua_function(tolua_S, "GroupExists", tolua_cRankManager_GroupExists);
+ tolua_function(tolua_S, "IsGroupInRank", tolua_cRankManager_IsGroupInRank);
+ tolua_function(tolua_S, "IsPermissionInGroup", tolua_cRankManager_IsPermissionInGroup);
+ tolua_function(tolua_S, "IsPlayerRankSet", tolua_cRankManager_IsPlayerRankSet);
+ tolua_function(tolua_S, "RankExists", tolua_cRankManager_RankExists);
+ tolua_function(tolua_S, "RemoveGroup", tolua_cRankManager_RemoveGroup);
+ tolua_function(tolua_S, "RemoveGroupFromRank", tolua_cRankManager_RemoveGroupFromRank);
+ tolua_function(tolua_S, "RemovePermissionFromGroup", tolua_cRankManager_RemovePermissionFromGroup);
+ tolua_function(tolua_S, "RemovePlayerRank", tolua_cRankManager_RemovePlayerRank);
+ tolua_function(tolua_S, "RemoveRank", tolua_cRankManager_RemoveRank);
+ tolua_function(tolua_S, "RenameGroup", tolua_cRankManager_RenameGroup);
+ tolua_function(tolua_S, "RenameRank", tolua_cRankManager_RenameRank);
+ tolua_function(tolua_S, "SetDefaultRank", tolua_cRankManager_SetDefaultRank);
+ tolua_function(tolua_S, "SetPlayerRank", tolua_cRankManager_SetPlayerRank);
+ tolua_function(tolua_S, "SetRankVisuals", tolua_cRankManager_SetRankVisuals);
+ tolua_endmodule(tolua_S);
+}
+
+
+
+
diff --git a/src/Bindings/Plugin.h b/src/Bindings/Plugin.h
index 2cc5cade3..c9a53346d 100644
--- a/src/Bindings/Plugin.h
+++ b/src/Bindings/Plugin.h
@@ -73,7 +73,7 @@ public:
virtual bool OnPlayerFoodLevelChange (cPlayer & a_Player, int a_NewFoodLevel) = 0;
virtual bool OnPlayerJoined (cPlayer & a_Player) = 0;
virtual bool OnPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status) = 0;
- virtual bool OnPlayerMoving (cPlayer & a_Player, const Vector3d a_OldPosition, const Vector3d a_NewPosition) = 0;
+ virtual bool OnPlayerMoving (cPlayer & a_Player, const Vector3d & a_OldPosition, const Vector3d & a_NewPosition) = 0;
virtual bool OnPlayerPlacedBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) = 0;
virtual bool OnPlayerPlacingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) = 0;
virtual bool OnPlayerRightClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) = 0;
@@ -91,6 +91,7 @@ public:
virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Face, const Vector3d & a_BlockHitPos) = 0;
virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) = 0;
+ virtual bool OnServerPing (cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon) = 0;
virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) = 0;
virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) = 0;
virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) = 0;
diff --git a/src/Bindings/PluginLua.cpp b/src/Bindings/PluginLua.cpp
index 37db78994..2c2d05547 100644
--- a/src/Bindings/PluginLua.cpp
+++ b/src/Bindings/PluginLua.cpp
@@ -835,14 +835,14 @@ bool cPluginLua::OnPlayerLeftClick(cPlayer & a_Player, int a_BlockX, int a_Block
-bool cPluginLua::OnPlayerMoving(cPlayer & a_Player, const Vector3d a_OldPosition, const Vector3d a_NewPosition)
+bool cPluginLua::OnPlayerMoving(cPlayer & a_Player, const Vector3d & a_OldPosition, const Vector3d & a_NewPosition)
{
cCSLock Lock(m_CriticalSection);
bool res = false;
cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PLAYER_MOVING];
for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
{
- m_LuaState.Call((int)(**itr), &a_Player, &a_OldPosition, &a_NewPosition, cLuaState::Return, res);
+ m_LuaState.Call((int)(**itr), &a_Player, a_OldPosition, a_NewPosition, cLuaState::Return, res);
if (res)
{
return true;
@@ -1193,6 +1193,26 @@ bool cPluginLua::OnProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity
+bool cPluginLua::OnServerPing(cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon)
+{
+ cCSLock Lock(m_CriticalSection);
+ bool res = false;
+ cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_SERVER_PING];
+ for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+ {
+ m_LuaState.Call((int)(**itr), &a_ClientHandle, a_ServerDescription, a_OnlinePlayersCount, a_MaxPlayersCount, a_Favicon, cLuaState::Return, res, a_ServerDescription, a_OnlinePlayersCount, a_MaxPlayersCount, a_Favicon);
+ if (res)
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
bool cPluginLua::OnSpawnedEntity(cWorld & a_World, cEntity & a_Entity)
{
cCSLock Lock(m_CriticalSection);
@@ -1570,6 +1590,7 @@ const char * cPluginLua::GetHookFnName(int a_HookType)
case cPluginManager::HOOK_PLUGINS_LOADED: return "OnPluginsLoaded";
case cPluginManager::HOOK_POST_CRAFTING: return "OnPostCrafting";
case cPluginManager::HOOK_PRE_CRAFTING: return "OnPreCrafting";
+ case cPluginManager::HOOK_SERVER_PING: return "OnServerPing";
case cPluginManager::HOOK_SPAWNED_ENTITY: return "OnSpawnedEntity";
case cPluginManager::HOOK_SPAWNED_MONSTER: return "OnSpawnedMonster";
case cPluginManager::HOOK_SPAWNING_ENTITY: return "OnSpawningEntity";
diff --git a/src/Bindings/PluginLua.h b/src/Bindings/PluginLua.h
index 6df86f7a1..eda65b76c 100644
--- a/src/Bindings/PluginLua.h
+++ b/src/Bindings/PluginLua.h
@@ -98,8 +98,8 @@ public:
virtual bool OnPlayerFishing (cPlayer & a_Player, cItems & a_Reward) override;
virtual bool OnPlayerFoodLevelChange (cPlayer & a_Player, int a_NewFoodLevel) override;
virtual bool OnPlayerJoined (cPlayer & a_Player) override;
- virtual bool OnPlayerMoving (cPlayer & a_Player, const Vector3d a_OldPosition, const Vector3d a_NewPosition) override;
virtual bool OnPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status) override;
+ virtual bool OnPlayerMoving (cPlayer & a_Player, const Vector3d & a_OldPosition, const Vector3d & a_NewPosition) override;
virtual bool OnPlayerPlacedBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override;
virtual bool OnPlayerPlacingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override;
virtual bool OnPlayerRightClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override;
@@ -117,6 +117,7 @@ public:
virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Face, const Vector3d & a_BlockHitPos) override;
virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) override;
+ virtual bool OnServerPing (cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon) override;
virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) override;
virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) override;
virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) override;
diff --git a/src/Bindings/PluginManager.cpp b/src/Bindings/PluginManager.cpp
index dbc359f0e..f62e6ae02 100644
--- a/src/Bindings/PluginManager.cpp
+++ b/src/Bindings/PluginManager.cpp
@@ -1189,6 +1189,25 @@ bool cPluginManager::CallHookProjectileHitEntity(cProjectileEntity & a_Projectil
+bool cPluginManager::CallHookServerPing(cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon)
+{
+ FIND_HOOK(HOOK_SERVER_PING);
+ VERIFY_HOOK;
+
+ for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+ {
+ if ((*itr)->OnServerPing(a_ClientHandle, a_ServerDescription, a_OnlinePlayersCount, a_MaxPlayersCount, a_Favicon))
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
bool cPluginManager::CallHookSpawnedEntity(cWorld & a_World, cEntity & a_Entity)
{
FIND_HOOK(HOOK_SPAWNED_ENTITY);
diff --git a/src/Bindings/PluginManager.h b/src/Bindings/PluginManager.h
index e0573f386..cef6619d7 100644
--- a/src/Bindings/PluginManager.h
+++ b/src/Bindings/PluginManager.h
@@ -120,6 +120,7 @@ public:
HOOK_PRE_CRAFTING,
HOOK_PROJECTILE_HIT_BLOCK,
HOOK_PROJECTILE_HIT_ENTITY,
+ HOOK_SERVER_PING,
HOOK_SPAWNED_ENTITY,
HOOK_SPAWNED_MONSTER,
HOOK_SPAWNING_ENTITY,
@@ -225,6 +226,7 @@ public:
bool CallHookPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
bool CallHookProjectileHitBlock (cProjectileEntity & a_Projectile, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Face, const Vector3d & a_BlockHitPos);
bool CallHookProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity);
+ bool CallHookServerPing (cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon);
bool CallHookSpawnedEntity (cWorld & a_World, cEntity & a_Entity);
bool CallHookSpawnedMonster (cWorld & a_World, cMonster & a_Monster);
bool CallHookSpawningEntity (cWorld & a_World, cEntity & a_Entity);
diff --git a/src/Bindings/gen_LuaState_Call.lua b/src/Bindings/gen_LuaState_Call.lua
index 17bae82b3..2d8630d12 100644
--- a/src/Bindings/gen_LuaState_Call.lua
+++ b/src/Bindings/gen_LuaState_Call.lua
@@ -54,6 +54,7 @@ local Combinations =
{9, 2},
-- Special combinations:
+ {5, 5},
{7, 3},
{8, 3},
{9, 5},
@@ -182,6 +183,33 @@ for _, combination in ipairs(Combinations) do
WriteOverload(f, combination[1], combination[2])
end
+-- Generate the cLuaState::GetStackValues() multi-param templates:
+for i = 2, 6 do
+ f:write("/** Reads ", i, " consecutive values off the stack */\ntemplate <\n")
+
+ -- Write the template function header:
+ local txt = {}
+ for idx = 1, i do
+ table.insert(txt, "\ttypename ArgT" .. idx)
+ end
+ f:write(table.concat(txt, ",\n"))
+
+ -- Write the argument declarations:
+ txt = {}
+ f:write("\n>\nvoid GetStackValues(\n\tint a_BeginPos,\n")
+ for idx = 1, i do
+ table.insert(txt, "\tArgT" .. idx .. " & Arg" .. idx)
+ end
+ f:write(table.concat(txt, ",\n"))
+
+ -- Write the function body:
+ f:write("\n)\n{\n")
+ for idx = 1, i do
+ f:write("\tGetStackValue(a_BeginPos + ", idx - 1, ", Arg", idx, ");\n")
+ end
+ f:write("}\n\n\n\n\n\n")
+end
+
-- Close the generated file
f:close()
diff --git a/src/BlockArea.cpp b/src/BlockArea.cpp
index a0dcb5ec8..ba55528b8 100644
--- a/src/BlockArea.cpp
+++ b/src/BlockArea.cpp
@@ -28,7 +28,7 @@ typedef void (CombinatorFunc)(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLE
// This wild construct allows us to pass a function argument and still have it inlined by the compiler :)
/// Merges two blocktypes and blockmetas of the specified sizes and offsets using the specified combinator function
-template<bool MetasValid, CombinatorFunc Combinator>
+template <bool MetasValid, CombinatorFunc Combinator>
void InternalMergeBlocks(
BLOCKTYPE * a_DstTypes, const BLOCKTYPE * a_SrcTypes,
NIBBLETYPE * a_DstMetas, const NIBBLETYPE * a_SrcMetas,
@@ -74,7 +74,7 @@ void InternalMergeBlocks(
/// Combinator used for cBlockArea::msOverwrite merging
-template<bool MetaValid>
+template <bool MetaValid>
void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
a_DstType = a_SrcType;
@@ -89,7 +89,7 @@ void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLE
/// Combinator used for cBlockArea::msFillAir merging
-template<bool MetaValid>
+template <bool MetaValid>
void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
if (a_DstType == E_BLOCK_AIR)
@@ -108,7 +108,7 @@ void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETY
/// Combinator used for cBlockArea::msImprint merging
-template<bool MetaValid>
+template <bool MetaValid>
void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
if (a_SrcType != E_BLOCK_AIR)
@@ -127,7 +127,7 @@ void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETY
/// Combinator used for cBlockArea::msLake merging
-template<bool MetaValid>
+template <bool MetaValid>
void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
// Sponge is the NOP block
@@ -201,7 +201,7 @@ void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE
/** Combinator used for cBlockArea::msSpongePrint merging */
-template<bool MetaValid>
+template <bool MetaValid>
void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
// Sponge overwrites nothing, everything else overwrites anything
@@ -220,7 +220,7 @@ void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBB
/** Combinator used for cBlockArea::msDifference merging */
-template<bool MetaValid>
+template <bool MetaValid>
void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
if ((a_DstType == a_SrcType) && (!MetaValid || (a_DstMeta == a_SrcMeta)))
@@ -246,7 +246,7 @@ void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBL
/** Combinator used for cBlockArea::msMask merging */
-template<bool MetaValid>
+template <bool MetaValid>
void MergeCombinatorMask(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
// If the blocks are the same, keep the dest; otherwise replace with air
@@ -1764,7 +1764,9 @@ NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBL
cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) :
m_Area(a_Area),
- m_Origin(a_Area.m_Origin.x, a_Area.m_Origin.y, a_Area.m_Origin.z)
+ m_Origin(a_Area.m_Origin.x, a_Area.m_Origin.y, a_Area.m_Origin.z),
+ m_CurrentChunkX(0),
+ m_CurrentChunkZ(0)
{
}
@@ -2119,7 +2121,7 @@ void cBlockArea::RelSetData(
-template<bool MetasValid>
+template <bool MetasValid>
void cBlockArea::MergeByStrategy(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy, const NIBBLETYPE * SrcMetas, NIBBLETYPE * DstMetas)
{
// Block types are compulsory, block metas are voluntary
diff --git a/src/BlockArea.h b/src/BlockArea.h
index a95ba7788..86f7c4f2d 100644
--- a/src/BlockArea.h
+++ b/src/BlockArea.h
@@ -362,7 +362,7 @@ protected:
NIBBLETYPE a_BlockLight, NIBBLETYPE a_BlockSkyLight
);
- template<bool MetasValid>
+ template <bool MetasValid>
void MergeByStrategy(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy, const NIBBLETYPE * SrcMetas, NIBBLETYPE * DstMetas);
// tolua_begin
} ;
diff --git a/src/BlockEntities/CommandBlockEntity.cpp b/src/BlockEntities/CommandBlockEntity.cpp
index 45f8a3e4d..20702a9ac 100644
--- a/src/BlockEntities/CommandBlockEntity.cpp
+++ b/src/BlockEntities/CommandBlockEntity.cpp
@@ -13,6 +13,7 @@
#include "../Root.h"
#include "../Server.h" // ExecuteConsoleCommand()
#include "../Chunk.h"
+#include "../ChatColor.h"
@@ -187,12 +188,11 @@ void cCommandBlockEntity::SaveToJson(Json::Value & a_Value)
void cCommandBlockEntity::Execute()
{
- if (m_World != NULL)
+ ASSERT(m_World != NULL); // Execute should not be called before the command block is attached to a world
+
+ if (!m_World->AreCommandBlocksEnabled())
{
- if (!m_World->AreCommandBlocksEnabled())
- {
- return;
- }
+ return;
}
class CommandBlockOutCb :
@@ -206,15 +206,28 @@ void cCommandBlockEntity::Execute()
virtual void Out(const AString & a_Text)
{
// Overwrite field
- m_CmdBlock->SetLastOutput(a_Text);
+ m_CmdBlock->SetLastOutput(cClientHandle::FormatChatPrefix(m_CmdBlock->GetWorld()->ShouldUseChatPrefixes(), "SUCCESS", cChatColor::Green, cChatColor::White) + a_Text);
}
} CmdBlockOutCb(this);
- LOGD("cCommandBlockEntity: Executing command %s", m_Command.c_str());
-
- cServer * Server = cRoot::Get()->GetServer();
-
- Server->ExecuteConsoleCommand(m_Command, CmdBlockOutCb);
+ // Administrator commands are not executable by command blocks:
+ if (
+ (m_Command != "stop") &&
+ (m_Command != "restart") &&
+ (m_Command != "kick") &&
+ (m_Command != "ban") &&
+ (m_Command != "ipban")
+ )
+ {
+ cServer * Server = cRoot::Get()->GetServer();
+ LOGD("cCommandBlockEntity: Executing command %s", m_Command.c_str());
+ Server->ExecuteConsoleCommand(m_Command, CmdBlockOutCb);
+ }
+ else
+ {
+ SetLastOutput(cClientHandle::FormatChatPrefix(GetWorld()->ShouldUseChatPrefixes(), "FAILURE", cChatColor::Rose, cChatColor::White) + "Adminstration commands can not be executed");
+ LOGD("cCommandBlockEntity: Prevented execution of administration command %s", m_Command.c_str());
+ }
// TODO 2014-01-18 xdot: Update the signal strength.
m_Result = 0;
diff --git a/src/BlockEntities/FurnaceEntity.h b/src/BlockEntities/FurnaceEntity.h
index 4f935a74b..cf1a755e0 100644
--- a/src/BlockEntities/FurnaceEntity.h
+++ b/src/BlockEntities/FurnaceEntity.h
@@ -105,7 +105,7 @@ protected:
NIBBLETYPE m_BlockMeta;
/// The recipe for the current input slot
- const cFurnaceRecipe::Recipe * m_CurrentRecipe;
+ const cFurnaceRecipe::cRecipe * m_CurrentRecipe;
/// The item that is being smelted
cItem m_LastInput;
diff --git a/src/Blocks/BlockAnvil.h b/src/Blocks/BlockAnvil.h
index 5c4661c11..20514580e 100644
--- a/src/Blocks/BlockAnvil.h
+++ b/src/Blocks/BlockAnvil.h
@@ -40,14 +40,15 @@ public:
) override
{
a_BlockType = m_BlockType;
- NIBBLETYPE HighBits = a_BlockMeta & 0x0c; // Only highest two bits are preserved
+ NIBBLETYPE Meta = (NIBBLETYPE)a_Player->GetEquippedItem().m_ItemDamage;
int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 1.5) & 0x3;
+
switch (Direction)
{
- case 0: a_BlockMeta = 0x2 | HighBits; break;
- case 1: a_BlockMeta = 0x3 | HighBits; break;
- case 2: a_BlockMeta = 0x0 | HighBits; break;
- case 3: a_BlockMeta = 0x1 | HighBits; break;
+ case 0: a_BlockMeta = 0x2 | Meta << 2; break;
+ case 1: a_BlockMeta = 0x3 | Meta << 2; break;
+ case 2: a_BlockMeta = 0x0 | Meta << 2; break;
+ case 3: a_BlockMeta = 0x1 | Meta << 2; break;
default:
{
return false;
diff --git a/src/Blocks/BlockBigFlower.h b/src/Blocks/BlockBigFlower.h
index 0b6ac9d8a..72e552dee 100644
--- a/src/Blocks/BlockBigFlower.h
+++ b/src/Blocks/BlockBigFlower.h
@@ -37,7 +37,7 @@ public:
{
NIBBLETYPE Meta = a_BlockMeta & 0x7;
- if ((Meta == 2) || (Meta == 3))
+ if ((Meta == E_META_BIG_FLOWER_DOUBLE_TALL_GRASS) || (Meta == E_META_BIG_FLOWER_LARGE_FERN))
{
return;
}
@@ -63,11 +63,11 @@ public:
if (r1.randInt(10) == 5)
{
cItems Pickups;
- if (FlowerMeta == 2)
+ if (FlowerMeta == E_META_BIG_FLOWER_DOUBLE_TALL_GRASS)
{
Pickups.Add(E_BLOCK_TALL_GRASS, 2, 1);
}
- else if (FlowerMeta == 3)
+ else if (FlowerMeta == E_META_BIG_FLOWER_LARGE_FERN)
{
Pickups.Add(E_BLOCK_TALL_GRASS, 2, 2);
}
diff --git a/src/Blocks/BlockCake.h b/src/Blocks/BlockCake.h
index 36e133388..f05f468e5 100644
--- a/src/Blocks/BlockCake.h
+++ b/src/Blocks/BlockCake.h
@@ -19,7 +19,7 @@ public:
{
NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
- if (!a_Player->Feed(2, 0.1))
+ if (!a_Player->Feed(2, 0.4))
{
return;
}
diff --git a/src/Blocks/BlockDirt.h b/src/Blocks/BlockDirt.h
index 2d4fccbac..d458c6062 100644
--- a/src/Blocks/BlockDirt.h
+++ b/src/Blocks/BlockDirt.h
@@ -81,7 +81,7 @@ public:
Chunk->GetBlockTypeMeta(BlockX, BlockY + 1, BlockZ, AboveDest, AboveMeta);
if (cBlockInfo::GetHandler(AboveDest)->CanDirtGrowGrass(AboveMeta))
{
- if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, BlockX * cChunkDef::Width, BlockY, BlockZ * cChunkDef::Width, ssGrassSpread))
+ if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread(Chunk->GetWorld(), Chunk->GetPosX() * cChunkDef::Width + BlockX, BlockY, Chunk->GetPosZ() * cChunkDef::Width + BlockZ, ssGrassSpread))
{
Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0);
}
diff --git a/src/Blocks/BlockFarmland.h b/src/Blocks/BlockFarmland.h
index ed0592acd..bb624e54f 100644
--- a/src/Blocks/BlockFarmland.h
+++ b/src/Blocks/BlockFarmland.h
@@ -54,10 +54,7 @@ public:
BLOCKTYPE * BlockTypes = Area.GetBlockTypes();
for (size_t i = 0; i < NumBlocks; i++)
{
- if (
- (BlockTypes[i] == E_BLOCK_WATER) ||
- (BlockTypes[i] == E_BLOCK_STATIONARY_WATER)
- )
+ if (IsBlockWater(BlockTypes[i]))
{
Found = true;
break;
diff --git a/src/Blocks/BlockFenceGate.h b/src/Blocks/BlockFenceGate.h
index 433531275..ae99a4f94 100644
--- a/src/Blocks/BlockFenceGate.h
+++ b/src/Blocks/BlockFenceGate.h
@@ -35,6 +35,7 @@ public:
NIBBLETYPE OldMetaData = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
NIBBLETYPE NewMetaData = PlayerYawToMetaData(a_Player->GetYaw());
OldMetaData ^= 4; // Toggle the gate
+
if ((OldMetaData & 1) == (NewMetaData & 1))
{
// Standing in front of the gate - apply new direction
diff --git a/src/Blocks/BlockFire.h b/src/Blocks/BlockFire.h
index f52825362..b9f211042 100644
--- a/src/Blocks/BlockFire.h
+++ b/src/Blocks/BlockFire.h
@@ -40,11 +40,6 @@ public:
FindAndSetPortalFrame(a_BlockX, a_BlockY - 1, a_BlockZ, a_ChunkInterface, a_WorldInterface);
}
- virtual void OnDigging(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override
- {
- a_ChunkInterface.DigBlock(a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ);
- }
-
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
// No pickups from this block
@@ -60,8 +55,8 @@ public:
return "step.wood";
}
- /// Traces along YP until it finds an obsidian block, returns Y difference or 0 if no portal, and -1 for border
- /// Takes the X, Y, and Z of the base block; with an optional MaxY for portal border finding
+ /** Traces along YP until it finds an obsidian block, returns Y difference or 0 if no portal, and -1 for border
+ Takes the X, Y, and Z of the base block; with an optional MaxY for portal border finding */
int FindObsidianCeiling(int X, int Y, int Z, cChunkInterface & a_ChunkInterface, int MaxY = 0)
{
if (a_ChunkInterface.GetBlock(X, Y, Z) != E_BLOCK_OBSIDIAN)
@@ -91,13 +86,12 @@ public:
return newY;
}
}
- else { return 0; }
}
return 0;
}
- /// Evaluates if coords have a valid border on top, based on MaxY
+ /** Evaluates if coords have a valid border on top, based on MaxY */
bool EvaluatePortalBorder(int X, int FoundObsidianY, int Z, int MaxY, cChunkInterface & a_ChunkInterface)
{
for (int checkBorder = FoundObsidianY + 1; checkBorder <= MaxY - 1; checkBorder++) // FoundObsidianY + 1: FoundObsidianY has already been checked in FindObsidianCeiling; MaxY - 1: portal doesn't need corners
@@ -149,8 +143,8 @@ public:
return;
}
- /// Evaluates if coordinates are a portal going XP/XM; returns true if so, and writes boundaries to variable
- /// Takes coordinates of base block and Y coord of target obsidian ceiling
+ /** Evaluates if coordinates are a portal going XP/XM; returns true if so, and writes boundaries to variable
+ Takes coordinates of base block and Y coord of target obsidian ceiling */
bool FindPortalSliceX(int X1, int X2, int Y, int Z, int MaxY, cChunkInterface & a_ChunkInterface)
{
Dir = 1; // Set assumed direction (will change if portal turns out to be facing the other direction)
@@ -168,7 +162,8 @@ public:
{
return false; // Not valid slice, no portal can be formed
}
- } XZP = X1 - 1; // Set boundary of frame interior
+ }
+ XZP = X1 - 1; // Set boundary of frame interior
for (; ((a_ChunkInterface.GetBlock(X2, Y, Z) == E_BLOCK_OBSIDIAN) || (a_ChunkInterface.GetBlock(X2, Y + 1, Z) == E_BLOCK_OBSIDIAN)); X2--) // Go the other direction (XM)
{
int Value = FindObsidianCeiling(X2, Y, Z, a_ChunkInterface, MaxY);
@@ -182,7 +177,9 @@ public:
{
return false;
}
- } XZM = X2 + 1; // Set boundary, see previous
+ }
+ XZM = X2 + 1; // Set boundary, see previous
+
return (FoundFrameXP && FoundFrameXM);
}
@@ -204,7 +201,8 @@ public:
{
return false;
}
- } XZP = Z1 - 1;
+ }
+ XZP = Z1 - 1;
for (; ((a_ChunkInterface.GetBlock(X, Y, Z2) == E_BLOCK_OBSIDIAN) || (a_ChunkInterface.GetBlock(X, Y + 1, Z2) == E_BLOCK_OBSIDIAN)); Z2--)
{
int Value = FindObsidianCeiling(X, Y, Z2, a_ChunkInterface, MaxY);
@@ -218,7 +216,9 @@ public:
{
return false;
}
- } XZM = Z2 + 1;
+ }
+ XZM = Z2 + 1;
+
return (FoundFrameZP && FoundFrameZM);
}
};
diff --git a/src/Blocks/BlockFlower.h b/src/Blocks/BlockFlower.h
index e8fd4c7f6..6f64c062b 100644
--- a/src/Blocks/BlockFlower.h
+++ b/src/Blocks/BlockFlower.h
@@ -19,7 +19,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- // Reset meta to 0
+ // Reset meta to zero
a_Pickups.push_back(cItem(m_BlockType, 1, 0));
}
diff --git a/src/Blocks/BlockGlowstone.h b/src/Blocks/BlockGlowstone.h
index 6c198efc4..d1353e29a 100644
--- a/src/Blocks/BlockGlowstone.h
+++ b/src/Blocks/BlockGlowstone.h
@@ -15,13 +15,13 @@ public:
: cBlockHandler(a_BlockType)
{
}
-
+
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
// Reset meta to 0
- MTRand r1;
- a_Pickups.push_back(cItem(E_ITEM_GLOWSTONE_DUST, (char)(2 + r1.randInt(2)), 0));
+ cFastRandom Random;
+ a_Pickups.push_back(cItem(E_ITEM_GLOWSTONE_DUST, (char)(2 + Random.NextInt(3)), 0));
}
} ;
diff --git a/src/Blocks/BlockHandler.cpp b/src/Blocks/BlockHandler.cpp
index feb024b7f..6767d4de4 100644
--- a/src/Blocks/BlockHandler.cpp
+++ b/src/Blocks/BlockHandler.cpp
@@ -45,13 +45,11 @@
#include "BlockLadder.h"
#include "BlockLeaves.h"
#include "BlockLilypad.h"
-#include "BlockNewLeaves.h"
#include "BlockLever.h"
#include "BlockMelon.h"
#include "BlockMushroom.h"
#include "BlockMycelium.h"
#include "BlockNetherWart.h"
-#include "BlockNote.h"
#include "BlockOre.h"
#include "BlockPiston.h"
#include "BlockPlanks.h"
@@ -251,9 +249,9 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
case E_BLOCK_NETHER_PORTAL: return new cBlockPortalHandler (a_BlockType);
case E_BLOCK_NETHER_WART: return new cBlockNetherWartHandler (a_BlockType);
case E_BLOCK_NETHER_QUARTZ_ORE: return new cBlockOreHandler (a_BlockType);
- case E_BLOCK_NEW_LEAVES: return new cBlockNewLeavesHandler (a_BlockType);
+ case E_BLOCK_NEW_LEAVES: return new cBlockLeavesHandler (a_BlockType);
case E_BLOCK_NEW_LOG: return new cBlockSidewaysHandler (a_BlockType);
- case E_BLOCK_NOTE_BLOCK: return new cBlockNoteHandler (a_BlockType);
+ case E_BLOCK_NOTE_BLOCK: return new cBlockEntityHandler (a_BlockType);
case E_BLOCK_PISTON: return new cBlockPistonHandler (a_BlockType);
case E_BLOCK_PISTON_EXTENSION: return new cBlockPistonHeadHandler;
case E_BLOCK_PLANKS: return new cBlockPlanksHandler (a_BlockType);
diff --git a/src/Blocks/BlockLeaves.h b/src/Blocks/BlockLeaves.h
index 972dd6232..a8aa28a0f 100644
--- a/src/Blocks/BlockLeaves.h
+++ b/src/Blocks/BlockLeaves.h
@@ -152,7 +152,7 @@ bool HasNearLog(cBlockArea & a_Area, int a_BlockX, int a_BlockY, int a_BlockZ)
a_Area.SetBlockType(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_SPONGE);
for (int i = 0; i < LEAVES_CHECK_DISTANCE; i++)
{
- for (int y = a_BlockY - i; y <= a_BlockY + i; y++)
+ for (int y = std::max(a_BlockY - i, 0); y <= std::min(a_BlockY + i, 255); y++)
{
for (int z = a_BlockZ - i; z <= a_BlockZ + i; z++)
{
diff --git a/src/Blocks/BlockMelon.h b/src/Blocks/BlockMelon.h
index 2f7d9a461..60202d66e 100644
--- a/src/Blocks/BlockMelon.h
+++ b/src/Blocks/BlockMelon.h
@@ -19,8 +19,8 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- MTRand r1;
- a_Pickups.push_back(cItem(E_ITEM_MELON_SLICE, (char)(3 + r1.randInt(4)), 0));
+ cFastRandom Random;
+ a_Pickups.push_back(cItem(E_ITEM_MELON_SLICE, (char)(3 + Random.NextInt(5)), 0));
}
diff --git a/src/Blocks/BlockNewLeaves.h b/src/Blocks/BlockNewLeaves.h
deleted file mode 100644
index 5a267e8c6..000000000
--- a/src/Blocks/BlockNewLeaves.h
+++ /dev/null
@@ -1,42 +0,0 @@
-#pragma once
-#include "BlockHandler.h"
-#include "BlockLeaves.h"
-#include "../World.h"
-
-
-
-
-
-
-class cBlockNewLeavesHandler :
- public cBlockLeavesHandler
-{
-public:
- cBlockNewLeavesHandler(BLOCKTYPE a_BlockType)
- : cBlockLeavesHandler(a_BlockType)
- {
- }
-
-
- virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
- {
- MTRand rand;
-
- // Only the first 2 bits contain the display information, the others are for growing
- if (rand.randInt(5) == 0)
- {
- a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, (a_BlockMeta & 3) + 4));
- }
- }
-
-
- void OnDestroyed(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ) override
- {
- cBlockHandler::OnDestroyed(a_ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ);
- }
-} ;
-
-
-
-
-
diff --git a/src/Blocks/BlockNote.h b/src/Blocks/BlockNote.h
deleted file mode 100644
index fef38d845..000000000
--- a/src/Blocks/BlockNote.h
+++ /dev/null
@@ -1,13 +0,0 @@
-#pragma once
-#include "BlockHandler.h"
-#include "BlockEntity.h"
-
-class cBlockNoteHandler : public cBlockEntityHandler
-{
-public:
- cBlockNoteHandler(BLOCKTYPE a_BlockType)
- : cBlockEntityHandler(a_BlockType)
- {
- }
-
-};
diff --git a/src/Blocks/BlockOre.h b/src/Blocks/BlockOre.h
index 9684dbb19..0067d475f 100644
--- a/src/Blocks/BlockOre.h
+++ b/src/Blocks/BlockOre.h
@@ -2,7 +2,6 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
#include "../World.h"
@@ -20,58 +19,41 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- short ItemType = m_BlockType;
- char Count = 1;
- short Meta = 0;
-
- MTRand r1;
+ cFastRandom Random;
+
switch (m_BlockType)
{
case E_BLOCK_LAPIS_ORE:
{
- ItemType = E_ITEM_DYE;
- Count = 4 + (char)r1.randInt(4);
- Meta = 4;
+ a_Pickups.push_back(cItem(E_ITEM_DYE, (char)(4 + Random.NextInt(5)), 4));
break;
}
case E_BLOCK_REDSTONE_ORE:
case E_BLOCK_REDSTONE_ORE_GLOWING:
{
- Count = 4 + (char)r1.randInt(1);
- break;
- }
- default:
- {
- Count = 1;
+ a_Pickups.push_back(cItem(E_ITEM_REDSTONE_DUST, (char)(4 + Random.NextInt(2)), 0));
break;
}
- }
-
- switch (m_BlockType)
- {
case E_BLOCK_DIAMOND_ORE:
{
- ItemType = E_ITEM_DIAMOND;
- break;
- }
- case E_BLOCK_REDSTONE_ORE:
- case E_BLOCK_REDSTONE_ORE_GLOWING:
- {
- ItemType = E_ITEM_REDSTONE_DUST;
+ a_Pickups.push_back(cItem(E_ITEM_DIAMOND));
break;
}
case E_BLOCK_EMERALD_ORE:
{
- ItemType = E_ITEM_EMERALD;
+ a_Pickups.push_back(cItem(E_ITEM_EMERALD));
break;
}
case E_BLOCK_COAL_ORE:
{
- ItemType = E_ITEM_COAL;
+ a_Pickups.push_back(cItem(E_ITEM_COAL));
break;
}
+ default:
+ {
+ ASSERT(!"Unhandled ore!");
+ }
}
- a_Pickups.push_back(cItem(ItemType, Count, Meta));
}
} ;
diff --git a/src/Blocks/BlockPlanks.h b/src/Blocks/BlockPlanks.h
index de84ed319..4c5bb4860 100644
--- a/src/Blocks/BlockPlanks.h
+++ b/src/Blocks/BlockPlanks.h
@@ -24,8 +24,7 @@ public:
) override
{
a_BlockType = m_BlockType;
- NIBBLETYPE Meta = (NIBBLETYPE)(a_Player->GetEquippedItem().m_ItemDamage);
- a_BlockMeta = Meta;
+ a_BlockMeta = (NIBBLETYPE)(a_Player->GetEquippedItem().m_ItemDamage);
return true;
}
diff --git a/src/Blocks/BlockPortal.h b/src/Blocks/BlockPortal.h
index fc74e89d0..8fac2a126 100644
--- a/src/Blocks/BlockPortal.h
+++ b/src/Blocks/BlockPortal.h
@@ -36,7 +36,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- return; // No pickups
+ // No pickups
}
virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override
@@ -47,15 +47,15 @@ public:
return;
}
- int PosX = a_Chunk.GetPosX() * 16 + a_RelX;
- int PosZ = a_Chunk.GetPosZ() * 16 + a_RelZ;
+ int PosX = a_Chunk.GetPosX() * cChunkDef::Width + a_RelX;
+ int PosZ = a_Chunk.GetPosZ() * cChunkDef::Width + a_RelZ;
a_WorldInterface.SpawnMob(PosX, a_RelY, PosZ, cMonster::mtZombiePigman);
}
virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override
{
- if ((a_RelY - 1 < 0) || (a_RelY + 1 > cChunkDef::Height))
+ if ((a_RelY <= 0) || (a_RelY >= cChunkDef::Height))
{
return false; // In case someone places a portal with meta 1 or 2 at boundaries, and server tries to get invalid coords at Y - 1 or Y + 1
}
diff --git a/src/Blocks/BlockPressurePlate.h b/src/Blocks/BlockPressurePlate.h
index adec36eb6..a5c34a776 100644
--- a/src/Blocks/BlockPressurePlate.h
+++ b/src/Blocks/BlockPressurePlate.h
@@ -17,7 +17,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- // Reset meta to 0
+ // Reset meta to zero
a_Pickups.push_back(cItem(m_BlockType, 1, 0));
}
@@ -29,7 +29,7 @@ public:
}
BLOCKTYPE BlockBelow = a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ);
- return ((BlockBelow == E_BLOCK_FENCE_GATE) || (BlockBelow == E_BLOCK_FENCE) || cBlockInfo::IsSolid(BlockBelow));
+ return (cBlockInfo::IsSolid(BlockBelow));
}
} ;
diff --git a/src/Blocks/BlockQuartz.h b/src/Blocks/BlockQuartz.h
index 2ce7e71e4..edc4fb9c5 100644
--- a/src/Blocks/BlockQuartz.h
+++ b/src/Blocks/BlockQuartz.h
@@ -25,6 +25,7 @@ public:
{
a_BlockType = m_BlockType;
NIBBLETYPE Meta = (NIBBLETYPE)(a_Player->GetEquippedItem().m_ItemDamage);
+
if (Meta != E_META_QUARTZ_PILLAR) // Check if the block is a pillar block.
{
a_BlockMeta = Meta;
diff --git a/src/Blocks/BlockRedstone.h b/src/Blocks/BlockRedstone.h
index a898c9acb..37d61ed73 100644
--- a/src/Blocks/BlockRedstone.h
+++ b/src/Blocks/BlockRedstone.h
@@ -26,8 +26,8 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- // Reset meta to 0
- a_Pickups.push_back(cItem(E_ITEM_REDSTONE_DUST, 1));
+ // Reset meta to zero
+ a_Pickups.push_back(cItem(E_ITEM_REDSTONE_DUST, 1, 0));
}
} ;
diff --git a/src/Blocks/BlockRedstoneRepeater.h b/src/Blocks/BlockRedstoneRepeater.h
index 4c8a6a087..4b18add12 100644
--- a/src/Blocks/BlockRedstoneRepeater.h
+++ b/src/Blocks/BlockRedstoneRepeater.h
@@ -23,7 +23,7 @@ public:
int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace,
int a_CursorX, int a_CursorY, int a_CursorZ,
BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta
- ) override
+ ) override
{
a_BlockType = m_BlockType;
a_BlockMeta = RepeaterRotationToMetaData(a_Player->GetYaw());
@@ -46,7 +46,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- // Reset meta to 0
+ // Reset meta to zero
a_Pickups.push_back(cItem(E_ITEM_REDSTONE_REPEATER, 1, 0));
}
@@ -59,7 +59,7 @@ public:
virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override
{
- return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) != E_BLOCK_AIR));
+ return ((a_RelY > 0) && cBlockInfo::IsSolid(a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ)));
}
diff --git a/src/Blocks/BlockStairs.h b/src/Blocks/BlockStairs.h
index a7ccf1714..417969a82 100644
--- a/src/Blocks/BlockStairs.h
+++ b/src/Blocks/BlockStairs.h
@@ -16,8 +16,8 @@ public:
{
}
-
-
+
+
virtual bool GetPlacementBlockTypeMeta(
cChunkInterface & a_ChunkInterface, cPlayer * a_Player,
int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace,
@@ -53,8 +53,8 @@ public:
}
return true;
}
-
-
+
+
virtual const char * GetStepSound(void) override
{
if (
@@ -64,7 +64,7 @@ public:
(m_BlockType == E_BLOCK_ACACIA_WOOD_STAIRS) ||
(m_BlockType == E_BLOCK_BIRCH_WOOD_STAIRS) ||
(m_BlockType == E_BLOCK_DARK_OAK_WOOD_STAIRS)
- )
+ )
{
return "step.wood";
}
@@ -72,17 +72,20 @@ public:
return "step.stone";
}
+
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- // Reset meta to 0
+ // Reset meta to zero
a_Pickups.push_back(cItem(m_BlockType, 1, 0));
}
+
virtual bool CanDirtGrowGrass(NIBBLETYPE a_Meta) override
{
return true;
}
-
+
+
static NIBBLETYPE RotationToMetaData(double a_Rotation)
{
a_Rotation += 90 + 45; // So its not aligned with axis
@@ -108,14 +111,11 @@ public:
}
}
-
virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override
{
// Toggle bit 3:
return (a_Meta & 0x0b) | ((~a_Meta) & 0x04);
}
-
-
} ;
diff --git a/src/Blocks/BlockSugarcane.h b/src/Blocks/BlockSugarcane.h
index 84d3b2e7d..5902c791b 100644
--- a/src/Blocks/BlockSugarcane.h
+++ b/src/Blocks/BlockSugarcane.h
@@ -29,6 +29,7 @@ public:
{
return false;
}
+
switch (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ))
{
case E_BLOCK_DIRT:
diff --git a/src/Blocks/BlockTorch.h b/src/Blocks/BlockTorch.h
index c73118870..df5574d5d 100644
--- a/src/Blocks/BlockTorch.h
+++ b/src/Blocks/BlockTorch.h
@@ -126,7 +126,7 @@ public:
(BlockInQuestion == E_BLOCK_NETHER_BRICK_FENCE) ||
(BlockInQuestion == E_BLOCK_COBBLESTONE_WALL)) &&
(Face == BLOCK_FACE_TOP)
- )
+ )
{
return Face;
}
@@ -162,7 +162,7 @@ public:
(BlockInQuestion == E_BLOCK_END_PORTAL_FRAME) || // Actual vanilla behaviour
(BlockInQuestion == E_BLOCK_NETHER_BRICK_FENCE) ||
(BlockInQuestion == E_BLOCK_COBBLESTONE_WALL)
- )
+ )
{
// Torches can be placed on tops of glass and fences, despite them being 'untorcheable'
// No need to check for upright orientation, it was done when the torch was placed
diff --git a/src/Blocks/BlockTrapdoor.h b/src/Blocks/BlockTrapdoor.h
index 6a36ab874..a6327b5c2 100644
--- a/src/Blocks/BlockTrapdoor.h
+++ b/src/Blocks/BlockTrapdoor.h
@@ -23,7 +23,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- // Reset meta to 0
+ // Reset meta to zero
a_Pickups.push_back(cItem(m_BlockType, 1, 0));
}
@@ -53,7 +53,7 @@ public:
int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace,
int a_CursorX, int a_CursorY, int a_CursorZ,
BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta
- ) override
+ ) override
{
a_BlockType = m_BlockType;
a_BlockMeta = BlockFaceToMetaData(a_BlockFace);
@@ -103,9 +103,10 @@ public:
a_Chunk.UnboundedRelGetBlockMeta(a_RelX, a_RelY, a_RelZ, Meta);
AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true);
- BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
+ BLOCKTYPE BlockIsOn;
+ a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
- return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn);
+ return ((a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn));
}
};
diff --git a/src/Blocks/BlockTripwireHook.h b/src/Blocks/BlockTripwireHook.h
index f849fb8ad..4f9d79483 100644
--- a/src/Blocks/BlockTripwireHook.h
+++ b/src/Blocks/BlockTripwireHook.h
@@ -21,10 +21,9 @@ public:
int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace,
int a_CursorX, int a_CursorY, int a_CursorZ,
BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta
- ) override
+ ) override
{
a_BlockType = m_BlockType;
-
a_BlockMeta = DirectionToMetadata(a_BlockFace);
return true;
@@ -56,7 +55,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- // Reset meta to 0
+ // Reset meta to zero
a_Pickups.push_back(cItem(E_BLOCK_TRIPWIRE_HOOK, 1, 0));
}
@@ -66,9 +65,10 @@ public:
a_Chunk.UnboundedRelGetBlockMeta(a_RelX, a_RelY, a_RelZ, Meta);
AddFaceDirection(a_RelX, a_RelY, a_RelZ, MetadataToDirection(Meta), true);
- BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
+ BLOCKTYPE BlockIsOn;
+ a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn);
- return (a_RelY > 0) && cBlockInfo::FullyOccupiesVoxel(BlockIsOn);
+ return ((a_RelY > 0) && cBlockInfo::FullyOccupiesVoxel(BlockIsOn));
}
virtual const char * GetStepSound(void) override
diff --git a/src/Blocks/BlockVine.h b/src/Blocks/BlockVine.h
index 1e1f6d8d2..578224c61 100644
--- a/src/Blocks/BlockVine.h
+++ b/src/Blocks/BlockVine.h
@@ -46,7 +46,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- // Reset meta to 0
+ // Reset meta to zero
a_Pickups.push_back(cItem(E_BLOCK_VINES, 1, 0));
}
@@ -80,7 +80,7 @@ public:
/// Returns true if the specified block type is good for vines to attach to
static bool IsBlockAttachable(BLOCKTYPE a_BlockType)
{
- return (a_BlockType == E_BLOCK_LEAVES) || (a_BlockType == E_BLOCK_NEW_LEAVES) || cBlockInfo::IsSolid(a_BlockType);
+ return ((a_BlockType == E_BLOCK_LEAVES) || (a_BlockType == E_BLOCK_NEW_LEAVES) || cBlockInfo::IsSolid(a_BlockType));
}
@@ -182,7 +182,7 @@ public:
a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY - 1, a_RelZ, Block);
if (Block == E_BLOCK_AIR)
{
- if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, a_RelX * cChunkDef::Width, a_RelY - 1, a_RelZ * cChunkDef::Width, ssVineSpread))
+ if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, a_RelX + a_Chunk.GetPosX() * cChunkDef::Width, a_RelY - 1, a_RelZ + a_Chunk.GetPosZ() * cChunkDef::Width, ssVineSpread))
{
a_Chunk.UnboundedRelSetBlock(a_RelX, a_RelY - 1, a_RelZ, E_BLOCK_VINES, a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ));
}
diff --git a/src/Blocks/CMakeLists.txt b/src/Blocks/CMakeLists.txt
index 05b7bfab4..9f971a8bd 100644
--- a/src/Blocks/CMakeLists.txt
+++ b/src/Blocks/CMakeLists.txt
@@ -57,8 +57,6 @@ SET (HDRS
BlockMushroom.h
BlockMycelium.h
BlockNetherWart.h
- BlockNewLeaves.h
- BlockNote.h
BlockOre.h
BlockPiston.h
BlockPlanks.h
diff --git a/src/Blocks/ClearMetaOnDrop.h b/src/Blocks/ClearMetaOnDrop.h
index f2afbc6ea..aa4f23848 100644
--- a/src/Blocks/ClearMetaOnDrop.h
+++ b/src/Blocks/ClearMetaOnDrop.h
@@ -7,7 +7,7 @@
// For example to use in class Foo which should inherit Bar use
// class Foo : public cClearMetaOnDrop<Bar>;
-template<class Base>
+template <class Base>
class cClearMetaOnDrop : public Base
{
public:
diff --git a/src/Blocks/MetaRotator.h b/src/Blocks/MetaRotator.h
index 599aa7ef9..4c268077a 100644
--- a/src/Blocks/MetaRotator.h
+++ b/src/Blocks/MetaRotator.h
@@ -20,7 +20,7 @@ Usage:
Inherit from this class providing your base class as Base, the BitMask for the direction bits in bitmask and the masked value for the directions in North, East, South, West. There is also an aptional parameter AssertIfNotMatched. Set this if it is invalid for a block to exist in any other state.
*/
-template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched = false>
+template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched = false>
class cMetaRotator : public Base
{
public:
@@ -41,7 +41,7 @@ public:
-template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
+template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
@@ -63,7 +63,7 @@ NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatc
-template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
+template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
@@ -85,7 +85,7 @@ NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatc
-template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
+template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
@@ -102,7 +102,7 @@ NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatc
-template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
+template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
diff --git a/src/ByteBuffer.cpp b/src/ByteBuffer.cpp
index 64b31c60b..96556bf61 100644
--- a/src/ByteBuffer.cpp
+++ b/src/ByteBuffer.cpp
@@ -27,7 +27,7 @@
)
#define IS_LITTLE_ENDIAN
#elif ( \
- defined (__ARMEB__) || defined(__sparc) \
+ defined (__ARMEB__) || defined(__sparc) || defined(__powerpc__) || defined(__POWERPC__) \
)
#define IS_BIG_ENDIAN
#else
diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt
index 6b5efbd1f..37657ba91 100644
--- a/src/CMakeLists.txt
+++ b/src/CMakeLists.txt
@@ -34,8 +34,6 @@ SET (SRCS
FastRandom.cpp
FurnaceRecipe.cpp
Globals.cpp
- Group.cpp
- GroupManager.cpp
Inventory.cpp
Item.cpp
ItemGrid.cpp
@@ -53,6 +51,7 @@ SET (SRCS
MonsterConfig.cpp
Noise.cpp
ProbabDistrib.cpp
+ RankManager.cpp
RCONServer.cpp
Root.cpp
Scoreboard.cpp
@@ -98,8 +97,6 @@ SET (HDRS
ForEachChunkProvider.h
FurnaceRecipe.h
Globals.h
- Group.h
- GroupManager.h
Inventory.h
Item.h
ItemGrid.h
@@ -122,6 +119,7 @@ SET (HDRS
MonsterConfig.h
Noise.h
ProbabDistrib.h
+ RankManager.h
RCONServer.h
Root.h
Scoreboard.h
diff --git a/src/CheckBasicStyle.lua b/src/CheckBasicStyle.lua
index bf81a7cd5..b244b1fbc 100644
--- a/src/CheckBasicStyle.lua
+++ b/src/CheckBasicStyle.lua
@@ -108,7 +108,7 @@ local g_ViolationPatterns =
-- Check that all commas have spaces after them and not in front of them:
{" ,", "Extra space before a \",\""},
- {",[^%s\"%%]", "Needs a space after a \",\""}, -- Report all except >> "," << needed for splitting and >>,%s<< needed for formatting
+ {",[^%s\"%%\']", "Needs a space after a \",\""}, -- Report all except >> "," << needed for splitting and >>,%s<< needed for formatting
-- Check that opening braces are not at the end of a code line:
{"[^%s].-{\n?$", "Brace should be on a separate line"},
@@ -119,6 +119,7 @@ local g_ViolationPatterns =
{"while%(", "Needs a space after \"while\""},
{"switch%(", "Needs a space after \"switch\""},
{"catch%(", "Needs a space after \"catch\""},
+ {"template<", "Needs a space after \"template\""},
-- No space after keyword's parenthesis:
{"[^%a#]if %( ", "Remove the space after \"(\""},
diff --git a/src/Chunk.cpp b/src/Chunk.cpp
index 7bdf4196d..40ffff834 100644
--- a/src/Chunk.cpp
+++ b/src/Chunk.cpp
@@ -1,3 +1,4 @@
+
#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
#ifndef _WIN32
@@ -295,6 +296,16 @@ void cChunk::SetAllData(cSetChunkData & a_SetChunkData)
}
m_BlockEntities.clear();
std::swap(a_SetChunkData.GetBlockEntities(), m_BlockEntities);
+
+ // Check that all block entities have a valid blocktype at their respective coords (DEBUG-mode only):
+ #ifdef _DEBUG
+ for (cBlockEntityList::iterator itr = m_BlockEntities.begin(); itr != m_BlockEntities.end(); ++itr)
+ {
+ BLOCKTYPE EntityBlockType = (*itr)->GetBlockType();
+ BLOCKTYPE WorldBlockType = GetBlock((*itr)->GetRelX(), (*itr)->GetPosY(), (*itr)->GetRelZ());
+ ASSERT(EntityBlockType == WorldBlockType);
+ } // for itr - m_BlockEntities
+ #endif // _DEBUG
// Set all block entities' World variable:
for (cBlockEntityList::iterator itr = m_BlockEntities.begin(); itr != m_BlockEntities.end(); ++itr)
diff --git a/src/Chunk.h b/src/Chunk.h
index 72a1f6c95..e5de22e3b 100644
--- a/src/Chunk.h
+++ b/src/Chunk.h
@@ -155,7 +155,7 @@ public:
void FastSetBlock(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE a_BlockType, BLOCKTYPE a_BlockMeta, bool a_SendToClients = true); // Doesn't force block updates on neighbors, use for simple changes such as grass growing etc.
BLOCKTYPE GetBlock(int a_RelX, int a_RelY, int a_RelZ) const;
- BLOCKTYPE GetBlock(Vector3i a_cords) const { return GetBlock(a_cords.x, a_cords.y, a_cords.z);}
+ BLOCKTYPE GetBlock(const Vector3i & a_RelCoords) const { return GetBlock(a_RelCoords.x, a_RelCoords.y, a_RelCoords.z); }
void GetBlockTypeMeta(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta);
void GetBlockInfo (int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_Meta, NIBBLETYPE & a_SkyLight, NIBBLETYPE & a_BlockLight);
diff --git a/src/ChunkDef.h b/src/ChunkDef.h
index dbb782d26..51075ab4a 100644
--- a/src/ChunkDef.h
+++ b/src/ChunkDef.h
@@ -419,7 +419,7 @@ public:
X Data;
cCoordWithData(int a_X, int a_Y, int a_Z) :
- x(a_X), y(a_Y), z(a_Z)
+ x(a_X), y(a_Y), z(a_Z), Data()
{
}
diff --git a/src/ChunkMap.cpp b/src/ChunkMap.cpp
index dd8be0631..a3692ef11 100644
--- a/src/ChunkMap.cpp
+++ b/src/ChunkMap.cpp
@@ -1880,21 +1880,19 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
}
else if ((m_World->GetTNTShrapnelLevel() > slNone) && (m_World->GetTickRandomNumber(100) < 20)) // 20% chance of flinging stuff around
{
- if (!cBlockInfo::FullyOccupiesVoxel(Block))
+ // If the block is shrapnel-able, make a falling block entity out of it:
+ if (
+ ((m_World->GetTNTShrapnelLevel() == slAll) && cBlockInfo::FullyOccupiesVoxel(Block)) ||
+ ((m_World->GetTNTShrapnelLevel() == slGravityAffectedOnly) && ((Block == E_BLOCK_SAND) || (Block == E_BLOCK_GRAVEL)))
+ )
{
- break;
+ m_World->SpawnFallingBlock(bx + x, by + y + 5, bz + z, Block, area.GetBlockMeta(bx + x, by + y, bz + z));
}
- else if ((m_World->GetTNTShrapnelLevel() == slGravityAffectedOnly) && ((Block != E_BLOCK_SAND) && (Block != E_BLOCK_GRAVEL)))
- {
- break;
- }
- m_World->SpawnFallingBlock(bx + x, by + y + 5, bz + z, Block, area.GetBlockMeta(bx + x, by + y, bz + z));
}
area.SetBlockTypeMeta(bx + x, by + y, bz + z, E_BLOCK_AIR, 0);
a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
break;
-
}
} // switch (BlockType)
} // for z
@@ -1916,51 +1914,31 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
virtual bool Item(cEntity * a_Entity) override
{
- if (a_Entity->IsPickup())
- {
- if (((cPickup *)a_Entity)->GetAge() < 20) // If pickup age is smaller than one second, it is invincible (so we don't kill pickups that were just spawned)
- {
- return false;
- }
- }
-
- Vector3d EntityPos = a_Entity->GetPosition();
- cBoundingBox bbEntity(EntityPos, a_Entity->GetWidth() / 2, a_Entity->GetHeight());
-
- if (!m_bbTNT.IsInside(bbEntity)) // IsInside actually acts like DoesSurround
+ if (a_Entity->IsPickup() && (a_Entity->GetTicksAlive() < 20))
{
+ // If pickup age is smaller than one second, it is invincible (so we don't kill pickups that were just spawned)
return false;
}
-
- Vector3d AbsoluteEntityPos(abs(EntityPos.x), abs(EntityPos.y), abs(EntityPos.z));
-
- // Work out how far we are from the edge of the TNT's explosive effect
- AbsoluteEntityPos -= m_ExplosionPos;
-
- // All to positive
- AbsoluteEntityPos.x = abs(AbsoluteEntityPos.x);
- AbsoluteEntityPos.y = abs(AbsoluteEntityPos.y);
- AbsoluteEntityPos.z = abs(AbsoluteEntityPos.z);
-
- double FinalDamage = (((1 / AbsoluteEntityPos.x) + (1 / AbsoluteEntityPos.y) + (1 / AbsoluteEntityPos.z)) * 2) * m_ExplosionSize;
-
- // Clip damage values
- FinalDamage = Clamp(FinalDamage, 0.0, (double)a_Entity->GetMaxHealth());
+ Vector3d DistanceFromExplosion = a_Entity->GetPosition() - m_ExplosionPos;
+
if (!a_Entity->IsTNT() && !a_Entity->IsFallingBlock()) // Don't apply damage to other TNT entities and falling blocks, they should be invincible
{
- a_Entity->TakeDamage(dtExplosion, NULL, (int)FinalDamage, 0);
- }
+ cBoundingBox bbEntity(a_Entity->GetPosition(), a_Entity->GetWidth() / 2, a_Entity->GetHeight());
- // Apply force to entities around the explosion - code modified from World.cpp DoExplosionAt()
- Vector3d distance_explosion = a_Entity->GetPosition() - m_ExplosionPos;
- if (distance_explosion.SqrLength() < 4096.0)
- {
- distance_explosion.Normalize();
- distance_explosion *= m_ExplosionSize * m_ExplosionSize;
+ if (!m_bbTNT.IsInside(bbEntity)) // If bbEntity is inside bbTNT, not vice versa!
+ {
+ return false;
+ }
- a_Entity->AddSpeed(distance_explosion);
+ // Ensure that the damage dealt is inversely proportional to the distance to the TNT centre - the closer a player is, the harder they are hit
+ a_Entity->TakeDamage(dtExplosion, NULL, (int)((1 / DistanceFromExplosion.Length()) * 6 * m_ExplosionSize), 0);
}
+
+ // Apply force to entities around the explosion - code modified from World.cpp DoExplosionAt()
+ DistanceFromExplosion.Normalize();
+ DistanceFromExplosion *= m_ExplosionSize * m_ExplosionSize;
+ a_Entity->AddSpeed(DistanceFromExplosion);
return false;
}
diff --git a/src/ClientHandle.cpp b/src/ClientHandle.cpp
index d386f3576..f9c6a664c 100644
--- a/src/ClientHandle.cpp
+++ b/src/ClientHandle.cpp
@@ -75,11 +75,21 @@ cClientHandle::cClientHandle(const cSocket * a_Socket, int a_ViewDistance) :
m_TimeSinceLastPacket(0),
m_Ping(1000),
m_PingID(1),
+ m_PingStartTime(0),
+ m_LastPingTime(1000),
m_BlockDigAnimStage(-1),
+ m_BlockDigAnimSpeed(0),
+ m_BlockDigAnimX(0),
+ m_BlockDigAnimY(256), // Invalid Y, so that the coords don't get picked up
+ m_BlockDigAnimZ(0),
m_HasStartedDigging(false),
+ m_LastDigBlockX(0),
+ m_LastDigBlockY(256), // Invalid Y, so that the coords don't get picked up
+ m_LastDigBlockZ(0),
m_State(csConnected),
m_ShouldCheckDownloaded(false),
m_NumExplosionsThisTick(0),
+ m_NumBlockChangeInteractionsThisTick(0),
m_UniqueID(0),
m_HasSentPlayerChunk(false),
m_Locale("en_GB")
@@ -912,19 +922,36 @@ void cClientHandle::HandleLeftClick(int a_BlockX, int a_BlockY, int a_BlockZ, eB
return;
}
- if (
- ((a_Status == DIG_STATUS_STARTED) || (a_Status == DIG_STATUS_FINISHED)) && // Only do a radius check for block destruction - things like pickup tossing send coordinates that are to be ignored
- ((Diff(m_Player->GetPosX(), (double)a_BlockX) > 6) ||
- (Diff(m_Player->GetPosY(), (double)a_BlockY) > 6) ||
- (Diff(m_Player->GetPosZ(), (double)a_BlockZ) > 6))
- )
+ if ((a_Status == DIG_STATUS_STARTED) || (a_Status == DIG_STATUS_FINISHED))
{
- m_Player->GetWorld()->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player);
- if (cBlockInfo::GetHandler(m_Player->GetWorld()->GetBlock(a_BlockX, a_BlockY + 1, a_BlockZ))->IsClickedThrough())
+ if (a_BlockFace == BLOCK_FACE_NONE)
{
- m_Player->GetWorld()->SendBlockTo(a_BlockX, a_BlockY + 1, a_BlockZ, m_Player);
+ return;
+ }
+
+ /* Check for clickthrough-blocks:
+ When the user breaks a fire block, the client send the wrong block location.
+ We must find the right block with the face direction. */
+ int BlockX = a_BlockX;
+ int BlockY = a_BlockY;
+ int BlockZ = a_BlockZ;
+ AddFaceDirection(BlockX, BlockY, BlockZ, a_BlockFace);
+ if (cBlockInfo::GetHandler(m_Player->GetWorld()->GetBlock(BlockX, BlockY, BlockZ))->IsClickedThrough())
+ {
+ a_BlockX = BlockX;
+ a_BlockY = BlockY;
+ a_BlockZ = BlockZ;
+ }
+
+ if (
+ ((Diff(m_Player->GetPosX(), (double)a_BlockX) > 6) ||
+ (Diff(m_Player->GetPosY(), (double)a_BlockY) > 6) ||
+ (Diff(m_Player->GetPosZ(), (double)a_BlockZ) > 6))
+ )
+ {
+ m_Player->GetWorld()->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player);
+ return;
}
- return;
}
cPluginManager * PlgMgr = cRoot::Get()->GetPluginManager();
@@ -932,10 +959,6 @@ void cClientHandle::HandleLeftClick(int a_BlockX, int a_BlockY, int a_BlockZ, eB
{
// A plugin doesn't agree with the action, replace the block on the client and quit:
m_Player->GetWorld()->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player);
- if (cBlockInfo::GetHandler(m_Player->GetWorld()->GetBlock(a_BlockX, a_BlockY + 1, a_BlockZ))->IsClickedThrough())
- {
- m_Player->GetWorld()->SendBlockTo(a_BlockX, a_BlockY + 1, a_BlockZ, m_Player);
- }
return;
}
@@ -1036,7 +1059,8 @@ void cClientHandle::HandleBlockDigStarted(int a_BlockX, int a_BlockY, int a_Bloc
if (
m_Player->IsGameModeCreative() &&
- ItemCategory::IsSword(m_Player->GetInventory().GetEquippedItem().m_ItemType)
+ ItemCategory::IsSword(m_Player->GetInventory().GetEquippedItem().m_ItemType) &&
+ (m_Player->GetWorld()->GetBlock(a_BlockX, a_BlockY, a_BlockZ) != E_BLOCK_FIRE)
)
{
// Players can't destroy blocks with a Sword in the hand.
@@ -1059,26 +1083,6 @@ void cClientHandle::HandleBlockDigStarted(int a_BlockX, int a_BlockY, int a_Bloc
m_LastDigBlockY = a_BlockY;
m_LastDigBlockZ = a_BlockZ;
- // Check for clickthrough-blocks:
- /* When the user breaks a fire block, the client send the wrong block location.
- We must find the right block with the face direction. */
- if (a_BlockFace != BLOCK_FACE_NONE)
- {
- int pX = a_BlockX;
- int pY = a_BlockY;
- int pZ = a_BlockZ;
-
- AddFaceDirection(pX, pY, pZ, a_BlockFace); // Get the block in front of the clicked coordinates (m_bInverse defaulted to false)
- cBlockHandler * Handler = cBlockInfo::GetHandler(m_Player->GetWorld()->GetBlock(pX, pY, pZ));
-
- if (Handler->IsClickedThrough())
- {
- cChunkInterface ChunkInterface(m_Player->GetWorld()->GetChunkMap());
- Handler->OnDigging(ChunkInterface, *m_Player->GetWorld(), m_Player, pX, pY, pZ);
- return;
- }
- }
-
if (
(m_Player->IsGameModeCreative()) || // In creative mode, digging is done immediately
cBlockInfo::IsOneHitDig(a_OldBlock) // One-hit blocks get destroyed immediately, too
diff --git a/src/CraftingRecipes.cpp b/src/CraftingRecipes.cpp
index 1a31a6e90..ed3409207 100644
--- a/src/CraftingRecipes.cpp
+++ b/src/CraftingRecipes.cpp
@@ -1,4 +1,4 @@
-
+
// CraftingRecipes.cpp
// Interfaces to the cCraftingRecipes class representing the storage of crafting recipes
@@ -83,7 +83,7 @@ cItem & cCraftingGrid::GetItem(int x, int y) const
-void cCraftingGrid::SetItem(int x, int y, ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth)
+void cCraftingGrid::SetItem(int x, int y, ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth)
{
// Accessible through scripting, must verify parameters:
if ((x < 0) || (x >= m_Width) || (y < 0) || (y >= m_Height))
@@ -228,7 +228,7 @@ void cCraftingRecipe::Clear(void)
-void cCraftingRecipe::SetResult(ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth)
+void cCraftingRecipe::SetResult(ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth)
{
m_Result = cItem(a_ItemType, a_ItemCount, a_ItemHealth);
}
@@ -324,7 +324,11 @@ void cCraftingRecipes::LoadRecipes(void)
return;
}
AString Everything;
- f.ReadRestOfFile(Everything);
+ if (!f.ReadRestOfFile(Everything))
+ {
+ LOGWARNING("Cannot read file \"crafting.txt\", no crafting recipes will be available!");
+ return;
+ }
f.Close();
// Split it into lines, then process each line as a single recipe:
@@ -362,7 +366,10 @@ void cCraftingRecipes::ClearRecipes(void)
void cCraftingRecipes::AddRecipeLine(int a_LineNum, const AString & a_RecipeLine)
{
- AStringVector Sides = StringSplit(a_RecipeLine, "=");
+ AString RecipeLine(a_RecipeLine);
+ RecipeLine.erase(std::remove_if(RecipeLine.begin(), RecipeLine.end(), isspace), RecipeLine.end());
+
+ AStringVector Sides = StringSplit(RecipeLine, "=");
if (Sides.size() != 2)
{
LOGWARNING("crafting.txt: line %d: A single '=' was expected, got %d", a_LineNum, (int)Sides.size() - 1);
@@ -388,8 +395,7 @@ void cCraftingRecipes::AddRecipeLine(int a_LineNum, const AString & a_RecipeLine
}
if (ResultSplit.size() > 1)
{
- Recipe->m_Result.m_ItemCount = atoi(ResultSplit[1].c_str());
- if (Recipe->m_Result.m_ItemCount == 0)
+ if (!StringToInteger<char>(ResultSplit[1].c_str(), Recipe->m_Result.m_ItemCount))
{
LOGWARNING("crafting.txt: line %d: Cannot parse result count, ignoring the recipe.", a_LineNum);
LOGINFO("Offending line: \"%s\"", a_RecipeLine.c_str());
@@ -441,8 +447,7 @@ bool cCraftingRecipes::ParseItem(const AString & a_String, cItem & a_Item)
if (Split.size() > 1)
{
AString Damage = TrimString(Split[1]);
- a_Item.m_ItemDamage = atoi(Damage.c_str());
- if ((a_Item.m_ItemDamage == 0) && (Damage.compare("0") != 0))
+ if (!StringToInteger<short>(Damage.c_str(), a_Item.m_ItemDamage))
{
// Parsing the number failed
return false;
diff --git a/src/CraftingRecipes.h b/src/CraftingRecipes.h
index 0250d2f68..fe1e15817 100644
--- a/src/CraftingRecipes.h
+++ b/src/CraftingRecipes.h
@@ -33,7 +33,7 @@ public:
int GetWidth (void) const {return m_Width; }
int GetHeight(void) const {return m_Height; }
cItem & GetItem (int x, int y) const;
- void SetItem (int x, int y, ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth);
+ void SetItem (int x, int y, ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth);
void SetItem (int x, int y, const cItem & a_Item);
void Clear (void);
@@ -72,13 +72,13 @@ public:
int GetIngredientsHeight(void) const {return m_Ingredients.GetHeight(); }
cItem & GetIngredient (int x, int y) const {return m_Ingredients.GetItem(x, y); }
const cItem & GetResult (void) const {return m_Result; }
- void SetResult (ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth);
+ void SetResult (ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth);
void SetResult (const cItem & a_Item)
{
m_Result = a_Item;
}
- void SetIngredient (int x, int y, ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth)
+ void SetIngredient (int x, int y, ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth)
{
m_Ingredients.SetItem(x, y, a_ItemType, a_ItemCount, a_ItemHealth);
}
diff --git a/src/DeadlockDetect.cpp b/src/DeadlockDetect.cpp
index f73a45555..7f703416c 100644
--- a/src/DeadlockDetect.cpp
+++ b/src/DeadlockDetect.cpp
@@ -21,7 +21,8 @@ const int CYCLE_MILLISECONDS = 100;
cDeadlockDetect::cDeadlockDetect(void) :
- super("DeadlockDetect")
+ super("DeadlockDetect"),
+ m_IntervalSec(1000)
{
}
@@ -136,6 +137,7 @@ void cDeadlockDetect::CheckWorldAge(const AString & a_WorldName, Int64 a_Age)
void cDeadlockDetect::DeadlockDetected(void)
{
+ LOGERROR("Deadlock detected, aborting the server");
ASSERT(!"Deadlock detected");
abort();
}
diff --git a/src/Defines.h b/src/Defines.h
index 0981077c4..78c58034e 100644
--- a/src/Defines.h
+++ b/src/Defines.h
@@ -528,7 +528,7 @@ inline float GetSpecialSignf( float a_Val)
-template<class T> inline T Diff(T a_Val1, T a_Val2)
+template <class T> inline T Diff(T a_Val1, T a_Val2)
{
return std::abs(a_Val1 - a_Val2);
}
diff --git a/src/Entities/ItemFrame.cpp b/src/Entities/ItemFrame.cpp
index f0b0c8c65..0bc10ec60 100644
--- a/src/Entities/ItemFrame.cpp
+++ b/src/Entities/ItemFrame.cpp
@@ -55,7 +55,6 @@ void cItemFrame::KilledBy(TakeDamageInfo & a_TDI)
{
if (m_Item.IsEmpty())
{
- SetHealth(0);
super::KilledBy(a_TDI);
Destroy();
return;
diff --git a/src/Entities/Minecart.cpp b/src/Entities/Minecart.cpp
index d4eadc5d5..1501eea84 100644
--- a/src/Entities/Minecart.cpp
+++ b/src/Entities/Minecart.cpp
@@ -871,11 +871,101 @@ bool cMinecart::TestEntityCollision(NIBBLETYPE a_RailMeta)
return true;
}
case E_META_RAIL_CURVED_ZM_XM:
+ case E_META_RAIL_CURVED_ZP_XP:
+ {
+ Vector3d Distance = MinecartCollisionCallback.GetCollidedEntityPosition() - Vector3d(GetPosX(), 0, GetPosZ());
+
+ // Prevent division by small numbers
+ if (abs(Distance.z) < 0.001)
+ {
+ Distance.z = 0.001;
+ }
+
+ /* Check to which side the minecart is to be pushed.
+ Let's consider a z-x-coordinate system where the minecart is the center (0/0).
+ The minecart moves along the line x = -z, the perpendicular line to this is x = z.
+ In order to decide to which side the minecart is to be pushed, it must be checked on what side of the perpendicular line the pushing entity is located. */
+ if (
+ ((Distance.z > 0) && ((Distance.x / Distance.z) >= 1)) ||
+ ((Distance.z < 0) && ((Distance.x / Distance.z) <= 1))
+ )
+ {
+ // Moving -X +Z
+ if ((-GetSpeedX() * 0.4 / sqrt(2.0)) < 0.01)
+ {
+ // ~ SpeedX >= 0 Immobile or not moving in the "right" direction. Give it a bump!
+ AddSpeedX(-4 / sqrt(2.0));
+ AddSpeedZ(4 / sqrt(2.0));
+ }
+ else
+ {
+ // ~ SpeedX < 0 Moving in the "right" direction. Only accelerate it a bit.
+ SetSpeedX(GetSpeedX() * 0.4 / sqrt(2.0));
+ SetSpeedZ(GetSpeedZ() * 0.4 / sqrt(2.0));
+ }
+ }
+ else if ((GetSpeedX() * 0.4 / sqrt(2.0)) < 0.01)
+ {
+ // Moving +X -Z
+ // ~ SpeedX <= 0 Immobile or not moving in the "right" direction
+ AddSpeedX(4 / sqrt(2.0));
+ AddSpeedZ(-4 / sqrt(2.0));
+ }
+ else
+ {
+ // ~ SpeedX > 0 Moving in the "right" direction
+ SetSpeedX(GetSpeedX() * 0.4 / sqrt(2.0));
+ SetSpeedZ(GetSpeedZ() * 0.4 / sqrt(2.0));
+ }
+ break;
+ }
case E_META_RAIL_CURVED_ZM_XP:
case E_META_RAIL_CURVED_ZP_XM:
- case E_META_RAIL_CURVED_ZP_XP:
{
- // TODO - simply can't be bothered right now
+ Vector3d Distance = MinecartCollisionCallback.GetCollidedEntityPosition() - Vector3d(GetPosX(), 0, GetPosZ());
+
+ // Prevent division by small numbers
+ if (abs(Distance.z) < 0.001)
+ {
+ Distance.z = 0.001;
+ }
+
+ /* Check to which side the minecart is to be pushed.
+ Let's consider a z-x-coordinate system where the minecart is the center (0/0).
+ The minecart moves along the line x = z, the perpendicular line to this is x = -z.
+ In order to decide to which side the minecart is to be pushed, it must be checked on what side of the perpendicular line the pushing entity is located. */
+ if (
+ ((Distance.z > 0) && ((Distance.x / Distance.z) <= -1)) ||
+ ((Distance.z < 0) && ((Distance.x / Distance.z) >= -1))
+ )
+ {
+ // Moving +X +Z
+ if ((GetSpeedX() * 0.4) < 0.01)
+ {
+ // ~ SpeedX <= 0 Immobile or not moving in the "right" direction
+ AddSpeedX(4 / sqrt(2.0));
+ AddSpeedZ(4 / sqrt(2.0));
+ }
+ else
+ {
+ // ~ SpeedX > 0 Moving in the "right" direction
+ SetSpeedX(GetSpeedX() * 0.4 / sqrt(2.0));
+ SetSpeedZ(GetSpeedZ() * 0.4 / sqrt(2.0));
+ }
+ }
+ else if ((-GetSpeedX() * 0.4) < 0.01)
+ {
+ // Moving -X -Z
+ // ~ SpeedX >= 0 Immobile or not moving in the "right" direction
+ AddSpeedX(-4 / sqrt(2.0));
+ AddSpeedZ(-4 / sqrt(2.0));
+ }
+ else
+ {
+ // ~ SpeedX < 0 Moving in the "right" direction
+ SetSpeedX(GetSpeedX() * 0.4 / sqrt(2.0));
+ SetSpeedZ(GetSpeedZ() * 0.4 / sqrt(2.0));
+ }
break;
}
default: break;
diff --git a/src/Entities/Player.cpp b/src/Entities/Player.cpp
index 338a87ac1..756410989 100644
--- a/src/Entities/Player.cpp
+++ b/src/Entities/Player.cpp
@@ -10,8 +10,6 @@
#include "../Bindings/PluginManager.h"
#include "../BlockEntities/BlockEntity.h"
#include "../BlockEntities/EnderChestEntity.h"
-#include "../GroupManager.h"
-#include "../Group.h"
#include "../Root.h"
#include "../OSSupport/Timer.h"
#include "../Chunk.h"
@@ -60,7 +58,6 @@ cPlayer::cPlayer(cClientHandle* a_Client, const AString & a_PlayerName) :
m_EnderChestContents(9, 3),
m_CurrentWindow(NULL),
m_InventoryWindow(NULL),
- m_Color('-'),
m_GameMode(eGameMode_NotSet),
m_IP(""),
m_ClientHandle(a_Client),
@@ -893,7 +890,7 @@ void cPlayer::KilledBy(TakeDamageInfo & a_TDI)
Pickups.Add(cItem(E_ITEM_RED_APPLE));
}
- m_Stats.AddValue(statItemsDropped, Pickups.Size());
+ m_Stats.AddValue(statItemsDropped, (StatValue)Pickups.Size());
m_World->SpawnItemPickups(Pickups, GetPosX(), GetPosY(), GetPosZ(), 10);
SaveToDisk(); // Save it, yeah the world is a tough place !
@@ -1368,48 +1365,6 @@ void cPlayer::SetVisible(bool a_bVisible)
-void cPlayer::AddToGroup( const AString & a_GroupName)
-{
- cGroup* Group = cRoot::Get()->GetGroupManager()->GetGroup( a_GroupName);
- m_Groups.push_back( Group);
- LOGD("Added %s to group %s", GetName().c_str(), a_GroupName.c_str());
- ResolveGroups();
- ResolvePermissions();
-}
-
-
-
-
-
-void cPlayer::RemoveFromGroup( const AString & a_GroupName)
-{
- bool bRemoved = false;
- for (GroupList::iterator itr = m_Groups.begin(); itr != m_Groups.end(); ++itr)
- {
- if ((*itr)->GetName().compare(a_GroupName) == 0)
- {
- m_Groups.erase( itr);
- bRemoved = true;
- break;
- }
- }
-
- if (bRemoved)
- {
- LOGD("Removed %s from group %s", GetName().c_str(), a_GroupName.c_str());
- ResolveGroups();
- ResolvePermissions();
- }
- else
- {
- LOGWARN("Tried to remove %s from group %s but was not in that group", GetName().c_str(), a_GroupName.c_str());
- }
-}
-
-
-
-
-
bool cPlayer::HasPermission(const AString & a_Permission)
{
if (a_Permission.empty())
@@ -1418,33 +1373,18 @@ bool cPlayer::HasPermission(const AString & a_Permission)
return true;
}
- AStringVector Split = StringSplit( a_Permission, ".");
- PermissionMap Possibilities = m_ResolvedPermissions;
- // Now search the namespaces
- while (Possibilities.begin() != Possibilities.end())
+ AStringVector Split = StringSplit(a_Permission, ".");
+
+ // Iterate over all granted permissions; if any matches, then return success:
+ for (AStringVectorVector::const_iterator itr = m_SplitPermissions.begin(), end = m_SplitPermissions.end(); itr != end; ++itr)
{
- PermissionMap::iterator itr = Possibilities.begin();
- if (itr->second)
+ if (PermissionMatches(Split, *itr))
{
- AStringVector OtherSplit = StringSplit( itr->first, ".");
- if (OtherSplit.size() <= Split.size())
- {
- unsigned int i;
- for (i = 0; i < OtherSplit.size(); ++i)
- {
- if (OtherSplit[i].compare( Split[i]) != 0)
- {
- if (OtherSplit[i].compare("*") == 0) return true; // WildCard man!! WildCard!
- break;
- }
- }
- if (i == Split.size()) return true;
- }
+ return true;
}
- Possibilities.erase( itr);
- }
+ } // for itr - m_SplitPermissions[]
- // Nothing that matched :(
+ // No granted permission matches
return false;
}
@@ -1452,82 +1392,35 @@ bool cPlayer::HasPermission(const AString & a_Permission)
-bool cPlayer::IsInGroup( const AString & a_Group)
+bool cPlayer::PermissionMatches(const AStringVector & a_Permission, const AStringVector & a_Template)
{
- for (GroupList::iterator itr = m_ResolvedGroups.begin(); itr != m_ResolvedGroups.end(); ++itr)
+ // Check the sub-items if they are the same or there's a wildcard:
+ size_t lenP = a_Permission.size();
+ size_t lenT = a_Template.size();
+ size_t minLen = std::min(lenP, lenT);
+ for (size_t i = 0; i < minLen; i++)
{
- if (a_Group.compare( (*itr)->GetName().c_str()) == 0)
+ if (a_Template[i] == "*")
+ {
+ // Has matched so far and now there's a wildcard in the template, so the permission matches:
return true;
- }
- return false;
-}
-
-
-
-
-
-void cPlayer::ResolvePermissions()
-{
- m_ResolvedPermissions.clear(); // Start with an empty map
-
- // Copy all player specific permissions into the resolved permissions map
- for (PermissionMap::iterator itr = m_Permissions.begin(); itr != m_Permissions.end(); ++itr)
- {
- m_ResolvedPermissions[ itr->first ] = itr->second;
- }
-
- for (GroupList::iterator GroupItr = m_ResolvedGroups.begin(); GroupItr != m_ResolvedGroups.end(); ++GroupItr)
- {
- const cGroup::PermissionMap & Permissions = (*GroupItr)->GetPermissions();
- for (cGroup::PermissionMap::const_iterator itr = Permissions.begin(); itr != Permissions.end(); ++itr)
+ }
+ if (a_Permission[i] != a_Template[i])
{
- m_ResolvedPermissions[ itr->first ] = itr->second;
+ // Found a mismatch
+ return false;
}
}
-}
-
-
-
-
-void cPlayer::ResolveGroups()
-{
- // Clear resolved groups first
- m_ResolvedGroups.clear();
-
- // Get a complete resolved list of all groups the player is in
- std::map< cGroup*, bool > AllGroups; // Use a map, because it's faster than iterating through a list to find duplicates
- GroupList ToIterate;
- for (GroupList::iterator GroupItr = m_Groups.begin(); GroupItr != m_Groups.end(); ++GroupItr)
+ // So far all the sub-items have matched
+ // If the sub-item count is the same, then the permission matches:
+ if (lenP == lenT)
{
- ToIterate.push_back( *GroupItr);
- }
- while (ToIterate.begin() != ToIterate.end())
- {
- cGroup* CurrentGroup = *ToIterate.begin();
- if (AllGroups.find( CurrentGroup) != AllGroups.end())
- {
- LOGWARNING("ERROR: Player \"%s\" is in the group multiple times (\"%s\"). Please fix your settings in users.ini!",
- GetName().c_str(), CurrentGroup->GetName().c_str()
- );
- }
- else
- {
- AllGroups[ CurrentGroup ] = true;
- m_ResolvedGroups.push_back( CurrentGroup); // Add group to resolved list
- const cGroup::GroupList & Inherits = CurrentGroup->GetInherits();
- for (cGroup::GroupList::const_iterator itr = Inherits.begin(); itr != Inherits.end(); ++itr)
- {
- if (AllGroups.find( *itr) != AllGroups.end())
- {
- LOGERROR("ERROR: Player %s is in the same group multiple times due to inheritance (%s). FIX IT!", GetName().c_str(), (*itr)->GetName().c_str());
- continue;
- }
- ToIterate.push_back( *itr);
- }
- }
- ToIterate.erase( ToIterate.begin());
+ return true;
}
+
+ // There are more sub-items in either the permission or the template, not a match:
+ return false;
}
@@ -1536,17 +1429,14 @@ void cPlayer::ResolveGroups()
AString cPlayer::GetColor(void) const
{
- if (m_Color != '-')
+ if (m_MsgNameColorCode.empty() || (m_MsgNameColorCode == "-"))
{
- return cChatColor::Delimiter + m_Color;
+ // Color has not been assigned, return an empty string:
+ return AString();
}
- if (m_Groups.size() < 1)
- {
- return cChatColor::White;
- }
-
- return (*m_Groups.begin())->GetColor();
+ // Return the color, including the delimiter:
+ return cChatColor::Delimiter + m_MsgNameColorCode;
}
@@ -1619,7 +1509,7 @@ void cPlayer::TossPickup(const cItem & a_Item)
void cPlayer::TossItems(const cItems & a_Items)
{
- m_Stats.AddValue(statItemsDropped, a_Items.Size());
+ m_Stats.AddValue(statItemsDropped, (StatValue)a_Items.Size());
double vX = 0, vY = 0, vZ = 0;
EulerToVector(-GetYaw(), GetPitch(), vZ, vX, vY);
@@ -1662,48 +1552,9 @@ bool cPlayer::DoMoveToWorld(cWorld * a_World, bool a_ShouldSendRespawn)
-void cPlayer::LoadPermissionsFromDisk()
-{
- m_Groups.clear();
- m_Permissions.clear();
-
- cIniFile IniFile;
- if (IniFile.ReadFile("users.ini"))
- {
- AString Groups = IniFile.GetValueSet(GetName(), "Groups", "Default");
- AStringVector Split = StringSplitAndTrim(Groups, ",");
-
- for (AStringVector::const_iterator itr = Split.begin(), end = Split.end(); itr != end; ++itr)
- {
- if (!cRoot::Get()->GetGroupManager()->ExistsGroup(*itr))
- {
- LOGWARNING("The group %s for player %s was not found!", itr->c_str(), GetName().c_str());
- }
- AddToGroup(*itr);
- }
-
- AString Color = IniFile.GetValue(GetName(), "Color", "-");
- if (!Color.empty())
- {
- m_Color = Color[0];
- }
- }
- else
- {
- cGroupManager::GenerateDefaultUsersIni(IniFile);
- IniFile.AddValue("Groups", GetName(), "Default");
- AddToGroup("Default");
- }
- IniFile.WriteFile("users.ini");
- ResolvePermissions();
-}
-
-
-
-
bool cPlayer::LoadFromDisk(cWorldPtr & a_World)
{
- LoadPermissionsFromDisk();
+ LoadRank();
// Load from the UUID file:
if (LoadFromFile(GetUUIDFileName(m_UUID), a_World))
@@ -1843,6 +1694,7 @@ bool cPlayer::LoadFromFile(const AString & a_FileName, cWorldPtr & a_World)
bool cPlayer::SaveToDisk()
{
+ cFile::CreateFolder(FILE_IO_PREFIX + AString("players/")); // Create the "players" folder, if it doesn't exist yet (#1268)
cFile::CreateFolder(FILE_IO_PREFIX + AString("players/") + m_UUID.substr(0, 2));
// create the JSON data
@@ -1937,26 +1789,6 @@ bool cPlayer::SaveToDisk()
-cPlayer::StringList cPlayer::GetResolvedPermissions()
-{
- StringList Permissions;
-
- const PermissionMap& ResolvedPermissions = m_ResolvedPermissions;
- for (PermissionMap::const_iterator itr = ResolvedPermissions.begin(); itr != ResolvedPermissions.end(); ++itr)
- {
- if (itr->second)
- {
- Permissions.push_back( itr->first);
- }
- }
-
- return Permissions;
-}
-
-
-
-
-
void cPlayer::UseEquippedItem(int a_Amount)
{
if (IsGameModeCreative()) // No damage in creative
@@ -2237,6 +2069,31 @@ void cPlayer::ApplyFoodExhaustionFromMovement()
+void cPlayer::LoadRank(void)
+{
+ // Load the values from cRankManager:
+ cRankManager & RankMgr = cRoot::Get()->GetRankManager();
+ m_Rank = RankMgr.GetPlayerRankName(m_UUID);
+ if (m_Rank.empty())
+ {
+ m_Rank = RankMgr.GetDefaultRank();
+ }
+ m_Permissions = RankMgr.GetPlayerPermissions(m_UUID);
+ RankMgr.GetRankVisuals(m_Rank, m_MsgPrefix, m_MsgSuffix, m_MsgNameColorCode);
+
+ // Break up the individual permissions on each dot, into m_SplitPermissions:
+ m_SplitPermissions.clear();
+ m_SplitPermissions.reserve(m_Permissions.size());
+ for (AStringVector::const_iterator itr = m_Permissions.begin(), end = m_Permissions.end(); itr != end; ++itr)
+ {
+ m_SplitPermissions.push_back(StringSplit(*itr, "."));
+ } // for itr - m_Permissions[]
+}
+
+
+
+
+
void cPlayer::Detach()
{
super::Detach();
diff --git a/src/Entities/Player.h b/src/Entities/Player.h
index d3ed1ef9d..9821cc6d9 100644
--- a/src/Entities/Player.h
+++ b/src/Entities/Player.h
@@ -13,7 +13,6 @@
-class cGroup;
class cWindow;
class cClientHandle;
class cTeam;
@@ -236,24 +235,20 @@ public:
// tolua_end
- typedef std::list< cGroup* > GroupList;
- typedef std::list< std::string > StringList;
+ bool HasPermission(const AString & a_Permission); // tolua_export
- /** Adds a player to existing group or creates a new group when it doesn't exist */
- void AddToGroup( const AString & a_GroupName); // tolua_export
-
- /** Removes a player from the group, resolves permissions and group inheritance (case sensitive) */
- void RemoveFromGroup( const AString & a_GroupName); // tolua_export
-
- bool HasPermission( const AString & a_Permission); // tolua_export
- const GroupList & GetGroups() { return m_Groups; } // >> EXPORTED IN MANUALBINDINGS <<
- StringList GetResolvedPermissions(); // >> EXPORTED IN MANUALBINDINGS <<
- bool IsInGroup( const AString & a_Group); // tolua_export
+ /** Returns true iff a_Permission matches the a_Template.
+ A match is defined by either being exactly the same, or each sub-item matches until there's a wildcard in a_Template.
+ Ie. {"a", "b", "c"} matches {"a", "b", "*"} but doesn't match {"a", "b"} */
+ static bool PermissionMatches(const AStringVector & a_Permission, const AStringVector & a_Template); // Exported in ManualBindings with AString params
+
+ /** Returns all the permissions that the player has assigned to them. */
+ const AStringVector & GetPermissions(void) { return m_Permissions; } // Exported in ManualBindings.cpp
// tolua_begin
- /** Returns the full color code to use for this player, based on their primary group or set in m_Color.
- The returned value includes the cChatColor::Delimiter. */
+ /** Returns the full color code to use for this player, based on their rank.
+ The returned value either is empty, or includes the cChatColor::Delimiter. */
AString GetColor(void) const;
/** tosses the item in the selected hotbar slot */
@@ -347,8 +342,6 @@ public:
*/
bool LoadFromFile(const AString & a_FileName, cWorldPtr & a_World);
- void LoadPermissionsFromDisk(void); // tolua_export
-
const AString & GetLoadedWorldName() { return m_LoadedWorldName; }
void UseEquippedItem(int a_Amount = 1);
@@ -422,6 +415,11 @@ public:
/** Returns the UUID (short format) that has been read from the client, or empty string if not available. */
const AString & GetUUID(void) const { return m_UUID; }
+ /** (Re)loads the rank and permissions from the cRankManager.
+ Expects the m_UUID member to be valid.
+ Loads the m_Rank, m_Permissions, m_MsgPrefix, m_MsgSuffix and m_MsgNameColorCode members. */
+ void LoadRank(void);
+
// tolua_end
// cEntity overrides:
@@ -432,12 +430,22 @@ public:
virtual void Detach(void);
protected:
- typedef std::map< std::string, bool > PermissionMap;
- PermissionMap m_ResolvedPermissions;
- PermissionMap m_Permissions;
- GroupList m_ResolvedGroups;
- GroupList m_Groups;
+ typedef std::vector<std::vector<AString> > AStringVectorVector;
+
+ /** The name of the rank assigned to this player. */
+ AString m_Rank;
+
+ /** All the permissions that this player has, based on their rank. */
+ AStringVector m_Permissions;
+
+ /** All the permissions that this player has, based on their rank, split into individual dot-delimited parts.
+ This is used mainly by the HasPermission() function to optimize the lookup. */
+ AStringVectorVector m_SplitPermissions;
+
+ // Message visuals:
+ AString m_MsgPrefix, m_MsgSuffix;
+ AString m_MsgNameColorCode;
AString m_PlayerName;
AString m_LoadedWorldName;
@@ -482,8 +490,6 @@ protected:
/** The player's last saved bed position */
Vector3i m_LastBedPos;
- char m_Color;
-
eGameMode m_GameMode;
AString m_IP;
diff --git a/src/FastRandom.h b/src/FastRandom.h
index 2061a3958..cebebad96 100644
--- a/src/FastRandom.h
+++ b/src/FastRandom.h
@@ -45,7 +45,7 @@ public:
float NextFloat(float a_Range, int a_Salt);
/** Returns a random float between 0 and 1. */
- float NextFloat(void) { return NextFloat(1); };
+ float NextFloat(void) { return NextFloat(1); }
/** Returns a random int in the range [a_Begin .. a_End] */
int GenerateRandomInteger(int a_Begin, int a_End);
diff --git a/src/FurnaceRecipe.cpp b/src/FurnaceRecipe.cpp
index ab772e97b..d200ef3d7 100644
--- a/src/FurnaceRecipe.cpp
+++ b/src/FurnaceRecipe.cpp
@@ -12,8 +12,8 @@
-typedef std::list< cFurnaceRecipe::Recipe > RecipeList;
-typedef std::list< cFurnaceRecipe::Fuel > FuelList;
+typedef std::list<cFurnaceRecipe::cRecipe> RecipeList;
+typedef std::list<cFurnaceRecipe::cFuel> FuelList;
@@ -30,7 +30,7 @@ struct cFurnaceRecipe::sFurnaceRecipeState
cFurnaceRecipe::cFurnaceRecipe()
- : m_pState( new sFurnaceRecipeState)
+ : m_pState(new sFurnaceRecipeState)
{
ReloadRecipes();
}
@@ -68,12 +68,18 @@ void cFurnaceRecipe::ReloadRecipes(void)
while (std::getline(f, ParsingLine))
{
LineNum++;
- ParsingLine.erase(std::remove_if(ParsingLine.begin(), ParsingLine.end(), isspace), ParsingLine.end()); // Remove ALL whitespace from the line
if (ParsingLine.empty())
{
continue;
}
+ // Remove comments from the line:
+ size_t FirstCommentSymbol = ParsingLine.find('#');
+ if ((FirstCommentSymbol != AString::npos) && (FirstCommentSymbol != 0))
+ {
+ ParsingLine.erase(ParsingLine.begin() + (const long)FirstCommentSymbol, ParsingLine.end());
+ }
+
switch (ParsingLine[0])
{
case '#':
@@ -103,159 +109,132 @@ void cFurnaceRecipe::ReloadRecipes(void)
-void cFurnaceRecipe::AddFuelFromLine(const AString & a_Line, int a_LineNum)
+void cFurnaceRecipe::AddFuelFromLine(const AString & a_Line, unsigned int a_LineNum)
{
- // Fuel
- int IItemID = 0, IItemCount = 0, IItemHealth = 0, IBurnTime = 0;
- AString::size_type BeginPos = 1; // Begin at one after exclamation mark (bang)
-
- if (
- !ReadMandatoryNumber(BeginPos, ":", a_Line, a_LineNum, IItemID) || // Read item ID
- !ReadOptionalNumbers(BeginPos, ":", "=", a_Line, a_LineNum, IItemCount, IItemHealth) || // Read item count (and optionally health)
- !ReadMandatoryNumber(BeginPos, "0123456789", a_Line, a_LineNum, IBurnTime, true) // Read item burn time - last value
- )
+ AString Line(a_Line);
+ Line.erase(Line.begin()); // Remove the beginning "!"
+ Line.erase(std::remove_if(Line.begin(), Line.end(), isspace), Line.end());
+
+ std::auto_ptr<cItem> Item(new cItem);
+ int BurnTime;
+
+ const AStringVector & Sides = StringSplit(Line, "=");
+ if (Sides.size() != 2)
{
+ LOGWARNING("furnace.txt: line %d: A single '=' was expected, got %d", a_LineNum, (int)Sides.size() - 1);
+ LOGINFO("Offending line: \"%s\"", a_Line.c_str());
return;
}
- // Add to fuel list:
- Fuel F;
- F.In = new cItem((ENUM_ITEM_ID)IItemID, (char)IItemCount, (short)IItemHealth);
- F.BurnTime = IBurnTime;
- m_pState->Fuel.push_back(F);
-}
-
-
-
-
+ if (!ParseItem(Sides[0], *Item))
+ {
+ LOGWARNING("furnace.txt: line %d: Cannot parse item \"%s\".", a_LineNum, Sides[0].c_str());
+ LOGINFO("Offending line: \"%s\"", a_Line.c_str());
+ return;
+ }
-void cFurnaceRecipe::AddRecipeFromLine(const AString & a_Line, int a_LineNum)
-{
- int IItemID = 0, IItemCount = 0, IItemHealth = 0, IBurnTime = 0;
- int OItemID = 0, OItemCount = 0, OItemHealth = 0;
- AString::size_type BeginPos = 0; // Begin at start of line
-
- if (
- !ReadMandatoryNumber(BeginPos, ":", a_Line, a_LineNum, IItemID) || // Read item ID
- !ReadOptionalNumbers(BeginPos, ":", "@", a_Line, a_LineNum, IItemCount, IItemHealth) || // Read item count (and optionally health)
- !ReadMandatoryNumber(BeginPos, "=", a_Line, a_LineNum, IBurnTime) || // Read item burn time
- !ReadMandatoryNumber(BeginPos, ":", a_Line, a_LineNum, OItemID) || // Read result ID
- !ReadOptionalNumbers(BeginPos, ":", "012456789", a_Line, a_LineNum, OItemCount, OItemHealth, true) // Read result count (and optionally health) - last value
- )
+ if (!StringToInteger<int>(Sides[1], BurnTime))
{
+ LOGWARNING("furnace.txt: line %d: Cannot parse burn time.", a_LineNum);
+ LOGINFO("Offending line: \"%s\"", a_Line.c_str());
return;
}
- // Add to recipe list
- Recipe R;
- R.In = new cItem((ENUM_ITEM_ID)IItemID, (char)IItemCount, (short)IItemHealth);
- R.Out = new cItem((ENUM_ITEM_ID)OItemID, (char)OItemCount, (short)OItemHealth);
- R.CookTime = IBurnTime;
- m_pState->Recipes.push_back(R);
+ // Add to fuel list:
+ cFuel Fuel;
+ Fuel.In = Item.release();
+ Fuel.BurnTime = BurnTime;
+ m_pState->Fuel.push_back(Fuel);
}
-void cFurnaceRecipe::PrintParseError(unsigned int a_Line, size_t a_Position, const AString & a_CharactersMissing)
+void cFurnaceRecipe::AddRecipeFromLine(const AString & a_Line, unsigned int a_LineNum)
{
- LOGWARN("Error parsing furnace recipes at line %i pos " SIZE_T_FMT ": missing '%s'", a_Line, a_Position, a_CharactersMissing.c_str());
-}
-
-
+ AString Line(a_Line);
+ Line.erase(std::remove_if(Line.begin(), Line.end(), isspace), Line.end());
+ int CookTime = 200;
+ std::auto_ptr<cItem> InputItem(new cItem());
+ std::auto_ptr<cItem> OutputItem(new cItem());
+ const AStringVector & Sides = StringSplit(Line, "=");
+ if (Sides.size() != 2)
+ {
+ LOGWARNING("furnace.txt: line %d: A single '=' was expected, got %d", a_LineNum, (int)Sides.size() - 1);
+ LOGINFO("Offending line: \"%s\"", a_Line.c_str());
+ return;
+ }
-bool cFurnaceRecipe::ReadMandatoryNumber(AString::size_type & a_Begin, const AString & a_Delimiter, const AString & a_Text, unsigned int a_Line, int & a_Value, bool a_IsLastValue)
-{
- // TODO: replace atoi with std::stoi
- AString::size_type End;
- if (a_IsLastValue)
+ const AStringVector & InputSplit = StringSplit(Sides[0], "@");
+ if (!ParseItem(InputSplit[0], *InputItem))
{
- End = a_Text.find_first_not_of(a_Delimiter, a_Begin);
+ LOGWARNING("furnace.txt: line %d: Cannot parse input item \"%s\".", a_LineNum, InputSplit[0].c_str());
+ LOGINFO("Offending line: \"%s\"", a_Line.c_str());
+ return;
}
- else
+
+ if (InputSplit.size() > 1)
{
- End = a_Text.find_first_of(a_Delimiter, a_Begin);
- if (End == AString::npos)
+ if (!StringToInteger<int>(InputSplit[1], CookTime))
{
- PrintParseError(a_Line, a_Begin, a_Delimiter);
- return false;
+ LOGWARNING("furnace.txt: line %d: Cannot parse cook time \"%s\".", a_LineNum, InputSplit[1].c_str());
+ LOGINFO("Offending line: \"%s\"", a_Line.c_str());
+ return;
}
}
-
- // stoi won't throw an exception if the string is alphanumeric, we should check for this
- if (!DoesStringContainOnlyNumbers(a_Text.substr(a_Begin, End - a_Begin)))
+
+ if (!ParseItem(Sides[1], *OutputItem))
{
- PrintParseError(a_Line, a_Begin, "number");
- return false;
+ LOGWARNING("furnace.txt: line %d: Cannot parse output item \"%s\".", a_LineNum, Sides[1].c_str());
+ LOGINFO("Offending line: \"%s\"", a_Line.c_str());
+ return;
}
- a_Value = atoi(a_Text.substr(a_Begin, End - a_Begin).c_str());
- a_Begin = End + 1; // Jump over delimiter
- return true;
+ cRecipe Recipe;
+ Recipe.In = InputItem.release();
+ Recipe.Out = OutputItem.release();
+ Recipe.CookTime = CookTime;
+ m_pState->Recipes.push_back(Recipe);
}
-bool cFurnaceRecipe::ReadOptionalNumbers(AString::size_type & a_Begin, const AString & a_DelimiterOne, const AString & a_DelimiterTwo, const AString & a_Text, unsigned int a_Line, int & a_ValueOne, int & a_ValueTwo, bool a_IsLastValue)
+bool cFurnaceRecipe::ParseItem(const AString & a_String, cItem & a_Item)
{
- // TODO: replace atoi with std::stoi
- AString::size_type End, Begin = a_Begin;
+ AString ItemString = a_String;
+
+ const AStringVector & SplitAmount = StringSplit(ItemString, ",");
+ ItemString = SplitAmount[0];
- End = a_Text.find_first_of(a_DelimiterOne, Begin);
- if (End != AString::npos)
- {
- if (DoesStringContainOnlyNumbers(a_Text.substr(Begin, End - Begin)))
- {
- a_ValueOne = std::atoi(a_Text.substr(Begin, End - Begin).c_str());
- Begin = End + 1;
+ const AStringVector & SplitMeta = StringSplit(ItemString, ":");
+ ItemString = SplitMeta[0];
- if (a_IsLastValue)
- {
- End = a_Text.find_first_not_of(a_DelimiterTwo, Begin);
- }
- else
- {
- End = a_Text.find_first_of(a_DelimiterTwo, Begin);
- if (End == AString::npos)
- {
- PrintParseError(a_Line, Begin, a_DelimiterTwo);
- return false;
- }
- }
-
- // stoi won't throw an exception if the string is alphanumeric, we should check for this
- if (!DoesStringContainOnlyNumbers(a_Text.substr(Begin, End - Begin)))
- {
- PrintParseError(a_Line, Begin, "number");
- return false;
- }
- a_ValueTwo = atoi(a_Text.substr(Begin, End - Begin).c_str());
+ if (!StringToItem(ItemString, a_Item))
+ {
+ return false;
+ }
- a_Begin = End + 1; // Jump over delimiter
- return true;
- }
- else
+ if (SplitAmount.size() > 1)
+ {
+ if (!StringToInteger<char>(SplitAmount[1].c_str(), a_Item.m_ItemCount))
{
- return ReadMandatoryNumber(a_Begin, a_DelimiterTwo, a_Text, a_Line, a_ValueOne, a_IsLastValue);
+ return false;
}
}
-
- return ReadMandatoryNumber(a_Begin, a_DelimiterTwo, a_Text, a_Line, a_ValueOne, a_IsLastValue);
-}
-
-
-
-
-bool cFurnaceRecipe::DoesStringContainOnlyNumbers(const AString & a_String)
-{
- // TODO: replace this with std::all_of(a_String.begin(), a_String.end(), isdigit)
- return (a_String.find_first_not_of("0123456789") == AString::npos);
+ if (SplitMeta.size() > 1)
+ {
+ if (!StringToInteger<short>(SplitMeta[1].c_str(), a_Item.m_ItemDamage))
+ {
+ return false;
+ }
+ }
+ return true;
}
@@ -266,19 +245,19 @@ void cFurnaceRecipe::ClearRecipes(void)
{
for (RecipeList::iterator itr = m_pState->Recipes.begin(); itr != m_pState->Recipes.end(); ++itr)
{
- Recipe R = *itr;
- delete R.In;
- R.In = NULL;
- delete R.Out;
- R.Out = NULL;
+ cRecipe Recipe = *itr;
+ delete Recipe.In;
+ Recipe.In = NULL;
+ delete Recipe.Out;
+ Recipe.Out = NULL;
}
m_pState->Recipes.clear();
for (FuelList::iterator itr = m_pState->Fuel.begin(); itr != m_pState->Fuel.end(); ++itr)
{
- Fuel F = *itr;
- delete F.In;
- F.In = NULL;
+ cFuel Fuel = *itr;
+ delete Fuel.In;
+ Fuel.In = NULL;
}
m_pState->Fuel.clear();
}
@@ -287,21 +266,21 @@ void cFurnaceRecipe::ClearRecipes(void)
-const cFurnaceRecipe::Recipe * cFurnaceRecipe::GetRecipeFrom(const cItem & a_Ingredient) const
+const cFurnaceRecipe::cRecipe * cFurnaceRecipe::GetRecipeFrom(const cItem & a_Ingredient) const
{
- const Recipe * BestRecipe = 0;
+ const cRecipe * BestRecipe = 0;
for (RecipeList::const_iterator itr = m_pState->Recipes.begin(); itr != m_pState->Recipes.end(); ++itr)
{
- const Recipe & R = *itr;
- if ((R.In->m_ItemType == a_Ingredient.m_ItemType) && (R.In->m_ItemCount <= a_Ingredient.m_ItemCount))
+ const cRecipe & Recipe = *itr;
+ if ((Recipe.In->m_ItemType == a_Ingredient.m_ItemType) && (Recipe.In->m_ItemCount <= a_Ingredient.m_ItemCount))
{
- if (BestRecipe && (BestRecipe->In->m_ItemCount > R.In->m_ItemCount))
+ if (BestRecipe && (BestRecipe->In->m_ItemCount > Recipe.In->m_ItemCount))
{
continue;
}
else
{
- BestRecipe = &R;
+ BestRecipe = &Recipe;
}
}
}
@@ -317,16 +296,16 @@ int cFurnaceRecipe::GetBurnTime(const cItem & a_Fuel) const
int BestFuel = 0;
for (FuelList::const_iterator itr = m_pState->Fuel.begin(); itr != m_pState->Fuel.end(); ++itr)
{
- const Fuel & F = *itr;
- if ((F.In->m_ItemType == a_Fuel.m_ItemType) && (F.In->m_ItemCount <= a_Fuel.m_ItemCount))
+ const cFuel & Fuel = *itr;
+ if ((Fuel.In->m_ItemType == a_Fuel.m_ItemType) && (Fuel.In->m_ItemCount <= a_Fuel.m_ItemCount))
{
- if (BestFuel > 0 && (BestFuel > F.BurnTime))
+ if (BestFuel > 0 && (BestFuel > Fuel.BurnTime))
{
continue;
}
else
{
- BestFuel = F.BurnTime;
+ BestFuel = Fuel.BurnTime;
}
}
}
diff --git a/src/FurnaceRecipe.h b/src/FurnaceRecipe.h
index 77ed35a57..6a1650695 100644
--- a/src/FurnaceRecipe.h
+++ b/src/FurnaceRecipe.h
@@ -19,23 +19,23 @@ public:
void ReloadRecipes(void);
- struct Fuel
+ struct cFuel
{
cItem * In;
int BurnTime; ///< How long this fuel burns, in ticks
};
- struct Recipe
+ struct cRecipe
{
cItem * In;
cItem * Out;
int CookTime; ///< How long this recipe takes to smelt, in ticks
};
- /// Returns a recipe for the specified input, NULL if no recipe found
- const Recipe * GetRecipeFrom(const cItem & a_Ingredient) const;
+ /** Returns a recipe for the specified input, NULL if no recipe found */
+ const cRecipe * GetRecipeFrom(const cItem & a_Ingredient) const;
- /// Returns the amount of time that the specified fuel burns, in ticks
+ /** Returns the amount of time that the specified fuel burns, in ticks */
int GetBurnTime(const cItem & a_Fuel) const;
private:
@@ -43,33 +43,14 @@ private:
/** Parses the fuel contained in the line, adds it to m_pState's fuels.
Logs a warning to the console on input error. */
- void AddFuelFromLine(const AString & a_Line, int a_LineNum);
+ void AddFuelFromLine(const AString & a_Line, unsigned int a_LineNum);
/** Parses the recipe contained in the line, adds it to m_pState's recipes.
Logs a warning to the console on input error. */
- void AddRecipeFromLine(const AString & a_Line, int a_LineNum);
-
- /** Calls LOGWARN with the line, position, and error */
- static void PrintParseError(unsigned int a_Line, size_t a_Position, const AString & a_CharactersMissing);
-
- /** Reads a number from a string given, starting at a given position and ending at a delimiter given
- Updates beginning position to the delimiter found + 1, and updates the value to the one read
- If it encounters a substring that is not fully numeric, it will call SetParseError() and return false; the caller should abort processing
- Otherwise, the function will return true
- */
- static bool ReadMandatoryNumber(AString::size_type & a_Begin, const AString & a_Delimiter, const AString & a_Text, unsigned int a_Line, int & a_Value, bool a_IsLastValue = false);
-
- /** Reads two numbers from a string given, starting at a given position and ending at the first delimiter given, then again (with an updated position) until the second delimiter given
- Updates beginning position to the second delimiter found + 1, and updates the values to the ones read
- If it encounters a substring that is not fully numeric whilst reading the second value, it will call SetParseError() and return false; the caller should abort processing
- If this happens whilst reading the first value, it will call ReadMandatoryNumber() with the appropriate position, as this may legitimately occur with the optional value and AString::find_first_of finding the incorrect delimiter. It will return the result of ReadMandatoryNumber()
- True will be returned definitively for an optional value that is valid
- */
- static bool ReadOptionalNumbers(AString::size_type & a_Begin, const AString & a_DelimiterOne, const AString & a_DelimiterTwo, const AString & a_Text, unsigned int a_Line, int & a_ValueOne, int & a_ValueTwo, bool a_IsLastValue = false);
-
- /** Uses std::all_of to determine if a string contains only digits */
- static bool DoesStringContainOnlyNumbers(const AString & a_String);
+ void AddRecipeFromLine(const AString & a_Line, unsigned int a_LineNum);
+ /** Parses an item string in the format "<ItemType>[: <Damage>][, <Amount>]", returns true if successful. */
+ bool ParseItem(const AString & a_String, cItem & a_Item);
struct sFurnaceRecipeState;
sFurnaceRecipeState * m_pState;
diff --git a/src/Generating/CMakeLists.txt b/src/Generating/CMakeLists.txt
index 58df9d421..33d622b42 100644
--- a/src/Generating/CMakeLists.txt
+++ b/src/Generating/CMakeLists.txt
@@ -12,6 +12,7 @@ SET (SRCS
CompoGen.cpp
ComposableGenerator.cpp
DistortedHeightmap.cpp
+ DungeonRoomsFinisher.cpp
EndGen.cpp
FinishGen.cpp
GridStructGen.cpp
@@ -40,6 +41,7 @@ SET (HDRS
CompoGen.h
ComposableGenerator.h
DistortedHeightmap.h
+ DungeonRoomsFinisher.h
EndGen.h
FinishGen.h
GridStructGen.h
diff --git a/src/Generating/Caves.cpp b/src/Generating/Caves.cpp
index 6fc371958..71154dff9 100644
--- a/src/Generating/Caves.cpp
+++ b/src/Generating/Caves.cpp
@@ -166,6 +166,9 @@ cCaveTunnel::cCaveTunnel(
if ((a_BlockStartY <= 0) && (a_BlockEndY <= 0))
{
// Don't bother detailing this cave, it's under the world anyway
+ m_MinBlockX = m_MaxBlockX = 0;
+ m_MinBlockY = m_MaxBlockY = -1;
+ m_MinBlockZ = m_MaxBlockZ = 0;
return;
}
diff --git a/src/Generating/ChunkGenerator.cpp b/src/Generating/ChunkGenerator.cpp
index 3d5af152c..a1188f984 100644
--- a/src/Generating/ChunkGenerator.cpp
+++ b/src/Generating/ChunkGenerator.cpp
@@ -27,6 +27,7 @@ const unsigned int QUEUE_SKIP_LIMIT = 500;
cChunkGenerator::cChunkGenerator(void) :
super("cChunkGenerator"),
+ m_Seed(0), // Will be overwritten by the actual generator
m_Generator(NULL),
m_PluginInterface(NULL),
m_ChunkSink(NULL)
diff --git a/src/Generating/ComposableGenerator.cpp b/src/Generating/ComposableGenerator.cpp
index 2f575fe27..6f4007d24 100644
--- a/src/Generating/ComposableGenerator.cpp
+++ b/src/Generating/ComposableGenerator.cpp
@@ -19,6 +19,7 @@
#include "Caves.h"
#include "DistortedHeightmap.h"
+#include "DungeonRoomsFinisher.h"
#include "EndGen.h"
#include "MineShafts.h"
#include "NetherFortGen.h"
@@ -343,6 +344,14 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile)
float Threshold = (float)a_IniFile.GetValueSetF("Generator", "DualRidgeCavesThreshold", 0.3);
m_FinishGens.push_back(new cStructGenDualRidgeCaves(Seed, Threshold));
}
+ else if (NoCaseCompare(*itr, "DungeonRooms") == 0)
+ {
+ int GridSize = a_IniFile.GetValueSetI("Generator", "DungeonRoomsGridSize", 48);
+ int MaxSize = a_IniFile.GetValueSetI("Generator", "DungeonRoomsMaxSize", 7);
+ int MinSize = a_IniFile.GetValueSetI("Generator", "DungeonRoomsMinSize", 5);
+ AString HeightDistrib = a_IniFile.GetValueSet ("Generator", "DungeonRoomsHeightDistrib", "0, 0; 10, 10; 11, 500; 40, 500; 60, 40; 90, 1");
+ m_FinishGens.push_back(new cDungeonRoomsFinisher(*m_HeightGen, Seed, GridSize, MaxSize, MinSize, HeightDistrib));
+ }
else if (NoCaseCompare(*itr, "Ice") == 0)
{
m_FinishGens.push_back(new cFinishGenIce);
diff --git a/src/Generating/DungeonRoomsFinisher.cpp b/src/Generating/DungeonRoomsFinisher.cpp
new file mode 100644
index 000000000..f213455d6
--- /dev/null
+++ b/src/Generating/DungeonRoomsFinisher.cpp
@@ -0,0 +1,279 @@
+
+// DungeonRoomsFinisher.cpp
+
+// Declares the cDungeonRoomsFinisher class representing the finisher that generates dungeon rooms
+
+#include "Globals.h"
+#include "DungeonRoomsFinisher.h"
+#include "../FastRandom.h"
+
+
+
+
+
+/** Height, in blocks, of the internal dungeon room open space. This many air blocks Y-wise. */
+static const int ROOM_HEIGHT = 4;
+
+
+
+
+
+////////////////////////////////////////////////////////////////////////////////
+// cDungeonRoom:
+
+class cDungeonRoom :
+ public cGridStructGen::cStructure
+{
+ typedef cGridStructGen::cStructure super;
+
+public:
+
+ cDungeonRoom(
+ int a_GridX, int a_GridZ,
+ int a_OriginX, int a_OriginZ,
+ int a_HalfSizeX, int a_HalfSizeZ,
+ int a_FloorHeight,
+ cNoise & a_Noise
+ ) :
+ super(a_GridX, a_GridZ, a_OriginX, a_OriginZ),
+ m_StartX(a_OriginX - a_HalfSizeX),
+ m_EndX(a_OriginX + a_HalfSizeX),
+ m_StartZ(a_OriginZ - a_HalfSizeZ),
+ m_EndZ(a_OriginZ + a_HalfSizeZ),
+ m_FloorHeight(a_FloorHeight)
+ {
+ /*
+ Pick coords next to the wall for the chests.
+ This is done by indexing the possible coords, picking any one for the first chest
+ and then picking another position for the second chest that is not adjacent to the first pos
+ */
+ int rnd = a_Noise.IntNoise2DInt(a_OriginX, a_OriginZ) / 7;
+ int SizeX = m_EndX - m_StartX - 1;
+ int SizeZ = m_EndZ - m_StartZ - 1;
+ int NumPositions = 2 * SizeX + 2 * SizeZ;
+ int FirstChestPos = rnd % NumPositions; // The corner positions are a bit more likely, but we don't mind
+ rnd = rnd / 512;
+ int SecondChestPos = (FirstChestPos + 2 + (rnd % (NumPositions - 3))) % NumPositions;
+ m_Chest1 = DecodeChestCoords(FirstChestPos, SizeX, SizeZ);
+ m_Chest2 = DecodeChestCoords(SecondChestPos, SizeX, SizeZ);
+ }
+
+protected:
+
+ // The X range of the room, start inclusive, end exclusive:
+ int m_StartX, m_EndX;
+
+ // The Z range of the room, start inclusive, end exclusive:
+ int m_StartZ, m_EndZ;
+
+ /** The Y coord of the floor of the room */
+ int m_FloorHeight;
+
+ /** The (absolute) coords of the first chest. The Y coord represents the chest's Meta value (facing). */
+ Vector3i m_Chest1;
+
+ /** The (absolute) coords of the second chest. The Y coord represents the chest's Meta value (facing). */
+ Vector3i m_Chest2;
+
+
+
+ /** Decodes the position index along the room walls into a proper 2D position for a chest. */
+ Vector3i DecodeChestCoords(int a_PosIdx, int a_SizeX, int a_SizeZ)
+ {
+ if (a_PosIdx < a_SizeX)
+ {
+ // Return a coord on the ZM side of the room:
+ return Vector3i(m_StartX + a_PosIdx + 1, E_META_CHEST_FACING_ZP, m_StartZ + 1);
+ }
+ a_PosIdx -= a_SizeX;
+ if (a_PosIdx < a_SizeZ)
+ {
+ // Return a coord on the XP side of the room:
+ return Vector3i(m_EndX - 1, E_META_CHEST_FACING_XM, m_StartZ + a_PosIdx + 1);
+ }
+ a_PosIdx -= a_SizeZ;
+ if (a_PosIdx < a_SizeX)
+ {
+ // Return a coord on the ZP side of the room:
+ return Vector3i(m_StartX + a_PosIdx + 1, E_META_CHEST_FACING_ZM, m_StartZ + 1);
+ }
+ a_PosIdx -= a_SizeX;
+ // Return a coord on the XM side of the room:
+ return Vector3i(m_StartX + 1, E_META_CHEST_FACING_XP, m_StartZ + a_PosIdx + 1);
+ }
+
+
+
+ /** Fills the specified area of blocks in the chunk with the specified blocktype if they are one of the overwritten block types.
+ The coords are absolute, start coords are inclusive, end coords are exclusive. */
+ void ReplaceCuboid(cChunkDesc & a_ChunkDesc, int a_StartX, int a_StartY, int a_StartZ, int a_EndX, int a_EndY, int a_EndZ, BLOCKTYPE a_DstBlockType)
+ {
+ int BlockX = a_ChunkDesc.GetChunkX() * cChunkDef::Width;
+ int BlockZ = a_ChunkDesc.GetChunkZ() * cChunkDef::Width;
+ int RelStartX = Clamp(a_StartX - BlockX, 0, cChunkDef::Width - 1);
+ int RelStartZ = Clamp(a_StartZ - BlockZ, 0, cChunkDef::Width - 1);
+ int RelEndX = Clamp(a_EndX - BlockX, 0, cChunkDef::Width);
+ int RelEndZ = Clamp(a_EndZ - BlockZ, 0, cChunkDef::Width);
+ for (int y = a_StartY; y < a_EndY; y++)
+ {
+ for (int z = RelStartZ; z < RelEndZ; z++)
+ {
+ for (int x = RelStartX; x < RelEndX; x++)
+ {
+ if (cBlockInfo::CanBeTerraformed(a_ChunkDesc.GetBlockType(x, y, z)))
+ {
+ a_ChunkDesc.SetBlockType(x, y, z, a_DstBlockType);
+ }
+ } // for x
+ } // for z
+ } // for z
+ }
+
+
+
+ /** Fills the specified area of blocks in the chunk with a random pattern of the specified blocktypes, if they are one of the overwritten block types.
+ The coords are absolute, start coords are inclusive, end coords are exclusive. The first blocktype uses 75% chance, the second 25% chance. */
+ void ReplaceCuboidRandom(cChunkDesc & a_ChunkDesc, int a_StartX, int a_StartY, int a_StartZ, int a_EndX, int a_EndY, int a_EndZ, BLOCKTYPE a_DstBlockType1, BLOCKTYPE a_DstBlockType2)
+ {
+ int BlockX = a_ChunkDesc.GetChunkX() * cChunkDef::Width;
+ int BlockZ = a_ChunkDesc.GetChunkZ() * cChunkDef::Width;
+ int RelStartX = Clamp(a_StartX - BlockX, 0, cChunkDef::Width - 1);
+ int RelStartZ = Clamp(a_StartZ - BlockZ, 0, cChunkDef::Width - 1);
+ int RelEndX = Clamp(a_EndX - BlockX, 0, cChunkDef::Width);
+ int RelEndZ = Clamp(a_EndZ - BlockZ, 0, cChunkDef::Width);
+ cFastRandom rnd;
+ for (int y = a_StartY; y < a_EndY; y++)
+ {
+ for (int z = RelStartZ; z < RelEndZ; z++)
+ {
+ for (int x = RelStartX; x < RelEndX; x++)
+ {
+ if (cBlockInfo::CanBeTerraformed(a_ChunkDesc.GetBlockType(x, y, z)))
+ {
+ BLOCKTYPE BlockType = (rnd.NextInt(101) < 75) ? a_DstBlockType1 : a_DstBlockType2;
+ a_ChunkDesc.SetBlockType(x, y, z, BlockType);
+ }
+ } // for x
+ } // for z
+ } // for z
+ }
+
+
+
+ /** Tries to place a chest at the specified (absolute) coords.
+ Does nothing if the coords are outside the chunk. */
+ void TryPlaceChest(cChunkDesc & a_ChunkDesc, const Vector3i & a_Chest)
+ {
+ int RelX = a_Chest.x - a_ChunkDesc.GetChunkX() * cChunkDef::Width;
+ int RelZ = a_Chest.z - a_ChunkDesc.GetChunkZ() * cChunkDef::Width;
+ if (
+ (RelX < 0) || (RelX >= cChunkDef::Width) || // The X coord is not in this chunk
+ (RelZ < 0) || (RelZ >= cChunkDef::Width) // The Z coord is not in this chunk
+ )
+ {
+ return;
+ }
+ a_ChunkDesc.SetBlockTypeMeta(RelX, m_FloorHeight + 1, RelZ, E_BLOCK_CHEST, (NIBBLETYPE)a_Chest.y);
+
+ // TODO: Fill the chest with random loot
+ }
+
+
+
+ // cGridStructGen::cStructure override:
+ virtual void DrawIntoChunk(cChunkDesc & a_ChunkDesc) override
+ {
+ if (
+ (m_EndX < a_ChunkDesc.GetChunkX() * cChunkDef::Width) ||
+ (m_StartX >= a_ChunkDesc.GetChunkX() * cChunkDef::Width + cChunkDef::Width) ||
+ (m_EndZ < a_ChunkDesc.GetChunkZ() * cChunkDef::Width) ||
+ (m_StartZ >= a_ChunkDesc.GetChunkZ() * cChunkDef::Width + cChunkDef::Width)
+ )
+ {
+ // The chunk is not intersecting the room at all, bail out
+ return;
+ }
+ int b = m_FloorHeight + 1; // Bottom
+ int t = m_FloorHeight + 1 + ROOM_HEIGHT; // Top
+ ReplaceCuboidRandom(a_ChunkDesc, m_StartX, m_FloorHeight, m_StartZ, m_EndX + 1, b, m_EndZ + 1, E_BLOCK_MOSSY_COBBLESTONE, E_BLOCK_COBBLESTONE); // Floor
+ ReplaceCuboid(a_ChunkDesc, m_StartX + 1, b, m_StartZ + 1, m_EndX, t, m_EndZ, E_BLOCK_AIR); // Insides
+
+ // Walls:
+ ReplaceCuboid(a_ChunkDesc, m_StartX, b, m_StartZ, m_StartX + 1, t, m_EndZ, E_BLOCK_COBBLESTONE); // XM wall
+ ReplaceCuboid(a_ChunkDesc, m_EndX, b, m_StartZ, m_EndX + 1, t, m_EndZ, E_BLOCK_COBBLESTONE); // XP wall
+ ReplaceCuboid(a_ChunkDesc, m_StartX, b, m_StartZ, m_EndX + 1, t, m_StartZ + 1, E_BLOCK_COBBLESTONE); // ZM wall
+ ReplaceCuboid(a_ChunkDesc, m_StartX, b, m_EndZ, m_EndX + 1, t, m_EndZ + 1, E_BLOCK_COBBLESTONE); // ZP wall
+
+ // Place chests:
+ TryPlaceChest(a_ChunkDesc, m_Chest1);
+ TryPlaceChest(a_ChunkDesc, m_Chest2);
+
+ // Place the spawner:
+ int CenterX = (m_StartX + m_EndX) / 2 - a_ChunkDesc.GetChunkX() * cChunkDef::Width;
+ int CenterZ = (m_StartZ + m_EndZ) / 2 - a_ChunkDesc.GetChunkZ() * cChunkDef::Width;
+ if (
+ (CenterX >= 0) && (CenterX < cChunkDef::Width) &&
+ (CenterZ >= 0) && (CenterZ < cChunkDef::Width)
+ )
+ {
+ a_ChunkDesc.SetBlockTypeMeta(CenterX, b, CenterZ, E_BLOCK_MOB_SPAWNER, 0);
+ // TODO: Set the spawned mob
+ }
+ }
+} ;
+
+
+
+
+
+
+////////////////////////////////////////////////////////////////////////////////
+// cDungeonRoomsFinisher:
+
+cDungeonRoomsFinisher::cDungeonRoomsFinisher(cTerrainHeightGen & a_HeightGen, int a_Seed, int a_GridSize, int a_MaxSize, int a_MinSize, const AString & a_HeightDistrib) :
+ super(a_Seed + 100, a_GridSize, a_GridSize, a_GridSize, a_GridSize, a_MaxSize, a_MaxSize, 1024),
+ m_HeightGen(a_HeightGen),
+ m_MaxHalfSize((a_MaxSize + 1) / 2),
+ m_MinHalfSize((a_MinSize + 1) / 2),
+ m_HeightProbability(cChunkDef::Height)
+{
+ // Initialize the height probability distribution:
+ m_HeightProbability.SetDefString(a_HeightDistrib);
+
+ // Normalize the min and max size:
+ if (m_MinHalfSize > m_MaxHalfSize)
+ {
+ std::swap(m_MinHalfSize, m_MaxHalfSize);
+ }
+}
+
+
+
+
+
+
+cDungeonRoomsFinisher::cStructurePtr cDungeonRoomsFinisher::CreateStructure(int a_GridX, int a_GridZ, int a_OriginX, int a_OriginZ)
+{
+ // Select a random room size in each direction:
+ int rnd = m_Noise.IntNoise2DInt(a_OriginX, a_OriginZ) / 7;
+ int HalfSizeX = m_MinHalfSize + (rnd % (m_MaxHalfSize - m_MinHalfSize + 1));
+ rnd = rnd / 32;
+ int HalfSizeZ = m_MinHalfSize + (rnd % (m_MaxHalfSize - m_MinHalfSize + 1));
+ rnd = rnd / 32;
+
+ // Select a random floor height for the room, based on the height generator:
+ int ChunkX, ChunkZ;
+ int RelX = a_OriginX, RelY = 0, RelZ = a_OriginZ;
+ cChunkDef::AbsoluteToRelative(RelX, RelY, RelZ, ChunkX, ChunkZ);
+ cChunkDef::HeightMap HeightMap;
+ m_HeightGen.GenHeightMap(ChunkX, ChunkZ, HeightMap);
+ int Height = cChunkDef::GetHeight(HeightMap, RelX, RelZ); // Max room height at {a_OriginX, a_OriginZ}
+ Height = Clamp(m_HeightProbability.MapValue(rnd % m_HeightProbability.GetSum()), 10, Height - 5);
+
+ // Create the dungeon room descriptor:
+ return cStructurePtr(new cDungeonRoom(a_GridX, a_GridZ, a_OriginX, a_OriginZ, HalfSizeX, HalfSizeZ, Height, m_Noise));
+}
+
+
+
+
diff --git a/src/Generating/DungeonRoomsFinisher.h b/src/Generating/DungeonRoomsFinisher.h
new file mode 100644
index 000000000..2b52c9de6
--- /dev/null
+++ b/src/Generating/DungeonRoomsFinisher.h
@@ -0,0 +1,52 @@
+
+// DungeonRoomsFinisher.h
+
+// Declares the cDungeonRoomsFinisher class representing the finisher that generates dungeon rooms
+
+
+
+
+
+#pragma once
+
+#include "GridStructGen.h"
+#include "../ProbabDistrib.h"
+
+
+
+
+
+class cDungeonRoomsFinisher :
+ public cGridStructGen
+{
+ typedef cGridStructGen super;
+
+public:
+ /** Creates a new dungeon room finisher.
+ a_HeightGen is the underlying height generator, so that the rooms can always be placed under the terrain.
+ a_MaxSize and a_MinSize are the maximum and minimum sizes of the room's internal (air) area, in blocks across.
+ a_HeightDistrib is the string defining the height distribution for the rooms (cProbabDistrib format). */
+ cDungeonRoomsFinisher(cTerrainHeightGen & a_HeightGen, int a_Seed, int a_GridSize, int a_MaxSize, int a_MinSize, const AString & a_HeightDistrib);
+
+protected:
+
+ /** The height gen that is used for limiting the rooms' Y coords */
+ cTerrainHeightGen & m_HeightGen;
+
+ /** Maximum half-size (from center to wall) of the dungeon room's inner (air) area. Default is 3 (vanilla). */
+ int m_MaxHalfSize;
+
+ /** Minimum half-size (from center to wall) of the dungeon room's inner (air) area. Default is 2 (vanilla). */
+ int m_MinHalfSize;
+
+ /** The height probability distribution to make the spawners more common in layers 10 - 40, less common outside this range. */
+ cProbabDistrib m_HeightProbability;
+
+
+ // cGridStructGen overrides:
+ virtual cStructurePtr CreateStructure(int a_GridX, int a_GridZ, int a_OriginX, int a_OriginZ) override;
+} ;
+
+
+
+
diff --git a/src/Generating/HeiGen.cpp b/src/Generating/HeiGen.cpp
index ba11b31b4..79d529a6a 100644
--- a/src/Generating/HeiGen.cpp
+++ b/src/Generating/HeiGen.cpp
@@ -239,7 +239,13 @@ bool cHeiGenCache::GetHeightAt(int a_ChunkX, int a_ChunkZ, int a_RelX, int a_Rel
cHeiGenClassic::cHeiGenClassic(int a_Seed) :
m_Seed(a_Seed),
- m_Noise(a_Seed)
+ m_Noise(a_Seed),
+ m_HeightFreq1(1.0f),
+ m_HeightAmp1(1.0f),
+ m_HeightFreq2(0.5f),
+ m_HeightAmp2(0.5f),
+ m_HeightFreq3(0.1f),
+ m_HeightAmp3(0.1f)
{
}
@@ -432,7 +438,7 @@ const cHeiGenBiomal::sGenParam cHeiGenBiomal::m_GenParam[256] =
/* biExtremeHillsM */ { 0.1f, 2.0f, 0.05f, 12.0f, 0.01f, 10.0f, 40}, // 131
/* biFlowerForest */ { 0.1f, 2.0f, 0.05f, 12.0f, 0.01f, 10.0f, 40}, // 132
/* biTaigaM */ { 0.1f, 2.0f, 0.05f, 12.0f, 0.01f, 10.0f, 40}, // 133
- /* biSwamplandM */ { 1.0f, 2.0f, 1.10f, 5.0f, 0.01f, 8.0f, 60}, // 134
+ /* biSwamplandM */ { 1.0f, 3.0f, 1.10f, 7.0f, 0.01f, 0.01f, 60}, // 134
// Biomes 135 .. 139 unused, 5 empty placeholders here:
{}, {}, {}, {}, {}, // 135 .. 139
diff --git a/src/Group.cpp b/src/Group.cpp
deleted file mode 100644
index def585618..000000000
--- a/src/Group.cpp
+++ /dev/null
@@ -1,41 +0,0 @@
-
-#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
-
-#include "Group.h"
-
-
-
-
-
-void cGroup::AddCommand( const AString & a_Command)
-{
- m_Commands[ a_Command ] = true;
-}
-
-
-
-
-
-void cGroup::AddPermission( const AString & a_Permission)
-{
- m_Permissions[ a_Permission ] = true;
-}
-
-
-
-
-
-void cGroup::InheritFrom( cGroup* a_Group)
-{
- m_Inherits.remove( a_Group);
- m_Inherits.push_back( a_Group);
-}
-
-
-
-
-
-void cGroup::ClearPermission()
-{
- m_Permissions.clear();
-}
diff --git a/src/Group.h b/src/Group.h
deleted file mode 100644
index 5816f8a06..000000000
--- a/src/Group.h
+++ /dev/null
@@ -1,44 +0,0 @@
-
-#pragma once
-
-
-
-
-
-// tolua_begin
-class cGroup
-{
-public:
- // tolua_end
- cGroup() {}
- ~cGroup() {}
-
- // tolua_begin
- void SetName( const AString & a_Name) { m_Name = a_Name; }
- const AString & GetName() const { return m_Name; }
- void SetColor( const AString & a_Color) { m_Color = a_Color; }
- void AddCommand( const AString & a_Command);
- void AddPermission( const AString & a_Permission);
- void InheritFrom( cGroup* a_Group);
- // tolua_end
-
- typedef std::map< AString, bool > PermissionMap;
- const PermissionMap & GetPermissions() const { return m_Permissions; }
-
- void ClearPermission(void);
-
- typedef std::map< AString, bool > CommandMap;
- const CommandMap & GetCommands() const { return m_Commands; }
-
- const AString & GetColor() const { return m_Color; } // tolua_export
-
- typedef std::list< cGroup* > GroupList;
- const GroupList & GetInherits() const { return m_Inherits; }
-private:
- AString m_Name;
- AString m_Color;
-
- PermissionMap m_Permissions;
- CommandMap m_Commands;
- GroupList m_Inherits;
-}; // tolua_export
diff --git a/src/GroupManager.cpp b/src/GroupManager.cpp
deleted file mode 100644
index 4c3dfc6f0..000000000
--- a/src/GroupManager.cpp
+++ /dev/null
@@ -1,227 +0,0 @@
-#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
-
-#include "GroupManager.h"
-#include "Group.h"
-#include "inifile/iniFile.h"
-#include "ChatColor.h"
-#include "Root.h"
-
-
-
-
-
-typedef std::map< AString, cGroup* > GroupMap;
-
-
-
-
-
-struct cGroupManager::sGroupManagerState
-{
- GroupMap Groups;
-};
-
-
-
-
-
-cGroupManager::~cGroupManager()
-{
- for (GroupMap::iterator itr = m_pState->Groups.begin(); itr != m_pState->Groups.end(); ++itr)
- {
- delete itr->second;
- itr->second = NULL;
- }
- m_pState->Groups.clear();
-
- delete m_pState;
- m_pState = NULL;
-}
-
-
-
-
-
-cGroupManager::cGroupManager()
- : m_pState( new sGroupManagerState)
-{
- LOGD("-- Loading Groups --");
-
- if (!LoadGroups())
- {
- LOGWARNING("ERROR: Groups could not load!");
- }
- if (!CheckUsers())
- {
- LOGWARNING("ERROR: User file could not be found!");
- }
-
- LOGD("-- Groups Successfully Loaded --");
-}
-
-
-
-
-
-void cGroupManager::GenerateDefaultUsersIni(cIniFile & a_IniFile)
-{
- LOGWARN("Regenerating users.ini, all users will be reset");
- a_IniFile.AddHeaderComment(" This file stores the players' groups.");
- a_IniFile.AddHeaderComment(" The format is:");
- a_IniFile.AddHeaderComment(" [PlayerName]");
- a_IniFile.AddHeaderComment(" Groups = GroupName1, GroupName2, ...");
-
- a_IniFile.WriteFile("users.ini");
-}
-
-
-
-
-
-bool cGroupManager::CheckUsers()
-{
- cIniFile IniFile;
- if (!IniFile.ReadFile("users.ini"))
- {
- GenerateDefaultUsersIni(IniFile);
- return true;
- }
-
- int NumKeys = IniFile.GetNumKeys();
- for (int i = 0; i < NumKeys; i++)
- {
- AString Player = IniFile.GetKeyName(i);
- AString Groups = IniFile.GetValue(Player, "Groups", "");
- if (Groups.empty())
- {
- continue;
- }
- AStringVector Split = StringSplitAndTrim(Groups, ",");
- for (AStringVector::const_iterator itr = Split.begin(), end = Split.end(); itr != end; ++itr)
- {
- if (!ExistsGroup(*itr))
- {
- LOGWARNING("The group %s for player %s was not found!", Split[i].c_str(), Player.c_str());
- }
- } // for itr - Split[]
- } // for i - ini file keys
- // Always return true for now, just but we can handle writefile fails later.
- return true;
-}
-
-
-
-
-
-bool cGroupManager::LoadGroups()
-{
- cIniFile IniFile;
- if (!IniFile.ReadFile("groups.ini"))
- {
- LOGWARNING("Regenerating groups.ini, all groups will be reset");
- IniFile.AddHeaderComment(" This is the MCServer permissions manager groups file");
- IniFile.AddHeaderComment(" It stores all defined groups such as Administrators, Players, or Moderators");
-
- IniFile.SetValue("Owner", "Permissions", "*", true);
- IniFile.SetValue("Owner", "Color", "2", true);
-
- IniFile.SetValue("Moderator", "Permissions", "core.time, core.item, core.tpa, core.tpaccept, core.ban, core.unban, core.save-all, core.toggledownfall");
- IniFile.SetValue("Moderator", "Color", "2", true);
- IniFile.SetValue("Moderator", "Inherits", "Player", true);
-
- IniFile.SetValue("Player", "Permissions", "core.portal", true);
- IniFile.SetValue("Player", "Color", "f", true);
- IniFile.SetValue("Player", "Inherits", "Default", true);
-
- IniFile.SetValue("Default", "Permissions", "core.help, core.plugins, core.spawn, core.worlds, core.back, core.motd, core.build, core.locate, core.viewdistance", true);
- IniFile.SetValue("Default", "Color", "f", true);
-
- IniFile.WriteFile("groups.ini");
- }
-
- int NumKeys = IniFile.GetNumKeys();
- for (int i = 0; i < NumKeys; i++)
- {
- AString KeyName = IniFile.GetKeyName(i);
- cGroup * Group = GetGroup(KeyName.c_str());
-
- Group->ClearPermission(); // Needed in case the groups are reloaded.
-
- LOGD("Loading group %s", KeyName.c_str());
-
- Group->SetName(KeyName);
- AString Color = IniFile.GetValue(KeyName, "Color", "-");
- if ((Color != "-") && (Color.length() >= 1))
- {
- Group->SetColor(AString(cChatColor::Delimiter) + Color[0]);
- }
- else
- {
- Group->SetColor(cChatColor::White);
- }
-
- AString Commands = IniFile.GetValue(KeyName, "Commands", "");
- if (!Commands.empty())
- {
- AStringVector Split = StringSplitAndTrim(Commands, ",");
- for (size_t i = 0; i < Split.size(); i++)
- {
- Group->AddCommand(Split[i]);
- }
- }
-
- AString Permissions = IniFile.GetValue(KeyName, "Permissions", "");
- if (!Permissions.empty())
- {
- AStringVector Split = StringSplitAndTrim(Permissions, ",");
- for (size_t i = 0; i < Split.size(); i++)
- {
- Group->AddPermission(Split[i]);
- }
- }
-
- AString Groups = IniFile.GetValue(KeyName, "Inherits", "");
- if (!Groups.empty())
- {
- AStringVector Split = StringSplitAndTrim(Groups, ",");
- for (size_t i = 0; i < Split.size(); i++)
- {
- Group->InheritFrom(GetGroup(Split[i].c_str()));
- }
- }
- }
- // Always return true, we can handle writefile fails later.
- return true;
-}
-
-
-
-
-
-bool cGroupManager::ExistsGroup( const AString & a_Name)
-{
- GroupMap::iterator itr = m_pState->Groups.find( a_Name);
- return ( itr != m_pState->Groups.end());
-}
-
-
-
-
-
-cGroup* cGroupManager::GetGroup( const AString & a_Name)
-{
- GroupMap::iterator itr = m_pState->Groups.find( a_Name);
- if (itr != m_pState->Groups.end())
- {
- return itr->second;
- }
-
- cGroup* Group = new cGroup();
- m_pState->Groups[a_Name] = Group;
-
- return Group;
-}
-
-
-
-
diff --git a/src/GroupManager.h b/src/GroupManager.h
deleted file mode 100644
index d42b55c4a..000000000
--- a/src/GroupManager.h
+++ /dev/null
@@ -1,36 +0,0 @@
-
-#pragma once
-
-
-
-
-
-class cGroup;
-
-
-
-
-
-class cGroupManager
-{
-public:
- bool ExistsGroup(const AString & a_Name);
- cGroup * GetGroup(const AString & a_Name);
- bool LoadGroups();
- bool CheckUsers();
-
- /** Writes the default header to the specified ini file, and saves it as "users.ini". */
- static void GenerateDefaultUsersIni(cIniFile & a_IniFile);
-
-private:
- friend class cRoot;
- cGroupManager();
- ~cGroupManager();
-
- struct sGroupManagerState;
- sGroupManagerState * m_pState;
-} ;
-
-
-
-
diff --git a/src/HTTPServer/HTTPConnection.cpp b/src/HTTPServer/HTTPConnection.cpp
index b9c762e7c..bf46bb241 100644
--- a/src/HTTPServer/HTTPConnection.cpp
+++ b/src/HTTPServer/HTTPConnection.cpp
@@ -15,7 +15,8 @@
cHTTPConnection::cHTTPConnection(cHTTPServer & a_HTTPServer) :
m_HTTPServer(a_HTTPServer),
m_State(wcsRecvHeaders),
- m_CurrentRequest(NULL)
+ m_CurrentRequest(NULL),
+ m_CurrentRequestBodyRemaining(0)
{
// LOGD("HTTP: New connection at %p", this);
}
diff --git a/src/HTTPServer/HTTPFormParser.cpp b/src/HTTPServer/HTTPFormParser.cpp
index 9ddfb82f1..c50c6dcf2 100644
--- a/src/HTTPServer/HTTPFormParser.cpp
+++ b/src/HTTPServer/HTTPFormParser.cpp
@@ -15,7 +15,9 @@
cHTTPFormParser::cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callbacks) :
m_Callbacks(a_Callbacks),
- m_IsValid(true)
+ m_IsValid(true),
+ m_IsCurrentPartFile(false),
+ m_FileHasBeenAnnounced(false)
{
if (a_Request.GetMethod() == "GET")
{
@@ -55,7 +57,9 @@ cHTTPFormParser::cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callba
cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, size_t a_Size, cCallbacks & a_Callbacks) :
m_Callbacks(a_Callbacks),
m_Kind(a_Kind),
- m_IsValid(true)
+ m_IsValid(true),
+ m_IsCurrentPartFile(false),
+ m_FileHasBeenAnnounced(false)
{
Parse(a_Data, a_Size);
}
diff --git a/src/Inventory.cpp b/src/Inventory.cpp
index 8da3dea5f..832a079bc 100644
--- a/src/Inventory.cpp
+++ b/src/Inventory.cpp
@@ -106,7 +106,7 @@ int cInventory::AddItem(const cItem & a_Item, bool a_AllowNewStacks, bool a_tryT
// When the item is a armor, try to set it directly to the armor slot.
if (ItemCategory::IsArmor(a_Item.m_ItemType))
{
- for (size_t i = 0; i < (size_t)m_ArmorSlots.GetNumSlots(); i++)
+ for (int i = 0; i < m_ArmorSlots.GetNumSlots(); i++)
{
if (m_ArmorSlots.GetSlot(i).IsEmpty() && cSlotAreaArmor::CanPlaceArmorInSlot(i, a_Item))
{
diff --git a/src/Items/ItemGoldenApple.h b/src/Items/ItemGoldenApple.h
index 4e1096e65..02ac0202c 100644
--- a/src/Items/ItemGoldenApple.h
+++ b/src/Items/ItemGoldenApple.h
@@ -29,7 +29,7 @@ public:
a_Player->AddEntityEffect(cEntityEffect::effRegeneration, 100, 1);
// When the apple is a 'notch apple', give extra effects:
- if (a_Item->m_ItemDamage > 0)
+ if (a_Item->m_ItemDamage >= E_META_GOLDEN_APPLE_ENCHANTED)
{
a_Player->AddEntityEffect(cEntityEffect::effRegeneration, 600, 4);
a_Player->AddEntityEffect(cEntityEffect::effResistance, 6000, 0);
diff --git a/src/Items/ItemHandler.h b/src/Items/ItemHandler.h
index 8b554ee34..67c250a97 100644
--- a/src/Items/ItemHandler.h
+++ b/src/Items/ItemHandler.h
@@ -75,7 +75,7 @@ public:
int FoodLevel;
double Saturation;
- FoodInfo(int a_FoodLevel, double a_Saturation, int a_PoisonChance = 0) :
+ FoodInfo(int a_FoodLevel, double a_Saturation) :
FoodLevel(a_FoodLevel),
Saturation(a_Saturation)
{
diff --git a/src/Items/ItemShovel.h b/src/Items/ItemShovel.h
index 7d5760fa9..cd235678d 100644
--- a/src/Items/ItemShovel.h
+++ b/src/Items/ItemShovel.h
@@ -19,7 +19,6 @@ public:
cItemShovelHandler(int a_ItemType)
: cItemHandler(a_ItemType)
{
-
}
virtual bool OnDiggingBlock(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Dir) override
diff --git a/src/LightingThread.cpp b/src/LightingThread.cpp
index 3fbbee6b5..652b03e46 100644
--- a/src/LightingThread.cpp
+++ b/src/LightingThread.cpp
@@ -73,6 +73,8 @@ public:
HEIGHTTYPE * m_HeightMap; // 3x3 chunks of height map, organized as a single XZY blob of data (instead of 3x3 XZY blobs)
cReader(BLOCKTYPE * a_BlockTypes, HEIGHTTYPE * a_HeightMap) :
+ m_ReadingChunkX(0),
+ m_ReadingChunkZ(0),
m_MaxHeight(0),
m_BlockTypes(a_BlockTypes),
m_HeightMap(a_HeightMap)
@@ -89,7 +91,9 @@ public:
cLightingThread::cLightingThread(void) :
super("cLightingThread"),
- m_World(NULL)
+ m_World(NULL),
+ m_MaxHeight(0),
+ m_NumSeeds(0)
{
}
diff --git a/src/LinearUpscale.h b/src/LinearUpscale.h
index 0b04408cf..a49f4bdf9 100644
--- a/src/LinearUpscale.h
+++ b/src/LinearUpscale.h
@@ -31,7 +31,7 @@ Linearly interpolates values in the array between the equidistant anchor points
Works in-place (input is already present at the correct output coords)
Uses templates to make it possible for the compiler to further optimizer the loops
*/
-template<
+template <
int SizeX, int SizeY, // Dimensions of the array
int AnchorStepX, int AnchorStepY,
typename TYPE
@@ -83,7 +83,7 @@ void LinearUpscale2DArrayInPlace(TYPE * a_Array)
Linearly interpolates values in the array between the equidistant anchor points (upscales).
Works on two arrays, input is packed and output is to be completely constructed.
*/
-template<typename TYPE> void LinearUpscale2DArray(
+template <typename TYPE> void LinearUpscale2DArray(
TYPE * a_Src, ///< Source array of size a_SrcSizeX x a_SrcSizeY
int a_SrcSizeX, int a_SrcSizeY, ///< Dimensions of the src array
TYPE * a_Dst, ///< Dest array, of size (a_SrcSizeX * a_UpscaleX + 1) x (a_SrcSizeY * a_UpscaleY + 1)
@@ -153,7 +153,7 @@ template<typename TYPE> void LinearUpscale2DArray(
Linearly interpolates values in the array between the equidistant anchor points (upscales).
Works on two arrays, input is packed and output is to be completely constructed.
*/
-template<typename TYPE> void LinearUpscale3DArray(
+template <typename TYPE> void LinearUpscale3DArray(
TYPE * a_Src, ///< Source array of size a_SrcSizeX x a_SrcSizeY x a_SrcSizeZ
int a_SrcSizeX, int a_SrcSizeY, int a_SrcSizeZ, ///< Dimensions of the src array
TYPE * a_Dst, ///< Dest array, of size (a_SrcSizeX * a_UpscaleX + 1) x (a_SrcSizeY * a_UpscaleY + 1) x (a_SrcSizeZ * a_UpscaleZ + 1)
diff --git a/src/LoggerListeners.cpp b/src/LoggerListeners.cpp
index 836536cbd..77e2aaf67 100644
--- a/src/LoggerListeners.cpp
+++ b/src/LoggerListeners.cpp
@@ -65,7 +65,7 @@
{
case cLogger::llRegular:
{
- // Gray on black
+ // Gray on black
Attrib = FOREGROUND_BLUE | FOREGROUND_GREEN | FOREGROUND_RED;
break;
}
@@ -93,7 +93,7 @@
virtual void SetDefaultLogColour() override
- {
+ {
SetConsoleTextAttribute(m_Console, m_DefaultConsoleAttrib);
}
@@ -119,13 +119,13 @@
{
case cLogger::llRegular:
{
- // Whatever the console default is
+ // Whatever the console default is
printf("\x1b[0m");
- break;
+ break;
}
case cLogger::llInfo:
{
- // Yellow on black
+ // Yellow on black
printf("\x1b[33;1m");
break;
}
@@ -133,7 +133,7 @@
{
// Red on black
printf("\x1b[31;1m");
- break;
+ break;
}
case cLogger::llError:
{
@@ -147,7 +147,7 @@
virtual void SetDefaultLogColour() override
{
- // Whatever the console default is
+ // Whatever the console default is
printf("\x1b[0m");
}
};
diff --git a/src/Mobs/Monster.cpp b/src/Mobs/Monster.cpp
index fe8a7346f..f7ee0b0c0 100644
--- a/src/Mobs/Monster.cpp
+++ b/src/Mobs/Monster.cpp
@@ -1024,7 +1024,7 @@ void cMonster::HandleDaylightBurning(cChunk & a_Chunk)
(a_Chunk.GetBlock(RelX, RelY, RelZ) != E_BLOCK_SOULSAND) && // Not on soulsand
(GetWorld()->GetTimeOfDay() < (12000 + 1000)) && // It is nighttime
!IsOnFire() && // Not already burning
- GetWorld()->IsWeatherWetAt(POSX_TOINT, POSZ_TOINT) // Not raining
+ GetWorld()->IsWeatherSunnyAt(POSX_TOINT, POSZ_TOINT) // Not raining
)
{
// Burn for 100 ticks, then decide again
diff --git a/src/Noise.cpp b/src/Noise.cpp
index 507d05ea5..71e801f30 100644
--- a/src/Noise.cpp
+++ b/src/Noise.cpp
@@ -146,6 +146,8 @@ cCubicCell2D::cCubicCell2D(
) :
m_Noise(a_Noise),
m_WorkRnds(&m_Workspace1),
+ m_CurFloorX(0),
+ m_CurFloorY(0),
m_Array(a_Array),
m_SizeX(a_SizeX),
m_SizeY(a_SizeY),
@@ -300,6 +302,9 @@ cCubicCell3D::cCubicCell3D(
) :
m_Noise(a_Noise),
m_WorkRnds(&m_Workspace1),
+ m_CurFloorX(0),
+ m_CurFloorY(0),
+ m_CurFloorZ(0),
m_Array(a_Array),
m_SizeX(a_SizeX),
m_SizeY(a_SizeY),
diff --git a/src/OSSupport/Queue.h b/src/OSSupport/Queue.h
index bf4d7f004..8d096fe29 100644
--- a/src/OSSupport/Queue.h
+++ b/src/OSSupport/Queue.h
@@ -20,7 +20,7 @@ cQueueFuncs and is used as the default behavior.
*/
/// This empty struct allows for the callback functions to be inlined
-template<class T>
+template <class T>
struct cQueueFuncs
{
public:
diff --git a/src/PolarSSL++/SslContext.cpp b/src/PolarSSL++/SslContext.cpp
index c3074f197..482470c3a 100644
--- a/src/PolarSSL++/SslContext.cpp
+++ b/src/PolarSSL++/SslContext.cpp
@@ -16,6 +16,7 @@ cSslContext::cSslContext(void) :
m_IsValid(false),
m_HasHandshaken(false)
{
+ memset(&m_Ssl, 0, sizeof(m_Ssl));
}
diff --git a/src/Protocol/MojangAPI.cpp b/src/Protocol/MojangAPI.cpp
index 823ff5469..28da83c31 100644
--- a/src/Protocol/MojangAPI.cpp
+++ b/src/Protocol/MojangAPI.cpp
@@ -10,6 +10,7 @@
#include "inifile/iniFile.h"
#include "json/json.h"
#include "PolarSSL++/BlockingSslClientSocket.h"
+#include "../RankManager.h"
@@ -157,7 +158,8 @@ cMojangAPI::cMojangAPI(void) :
m_NameToUUIDServer(DEFAULT_NAME_TO_UUID_SERVER),
m_NameToUUIDAddress(DEFAULT_NAME_TO_UUID_ADDRESS),
m_UUIDToProfileServer(DEFAULT_UUID_TO_PROFILE_SERVER),
- m_UUIDToProfileAddress(DEFAULT_UUID_TO_PROFILE_ADDRESS)
+ m_UUIDToProfileAddress(DEFAULT_UUID_TO_PROFILE_ADDRESS),
+ m_RankMgr(NULL)
{
}
@@ -300,6 +302,7 @@ void cMojangAPI::AddPlayerNameToUUIDMapping(const AString & a_PlayerName, const
cCSLock Lock(m_CSUUIDToName);
m_UUIDToName[UUID] = sProfile(a_PlayerName, UUID, "", "", Now);
}
+ NotifyNameUUID(a_PlayerName, a_UUID);
}
@@ -322,6 +325,7 @@ void cMojangAPI::AddPlayerProfile(const AString & a_PlayerName, const AString &
cCSLock Lock(m_CSUUIDToProfile);
m_UUIDToProfile[UUID] = sProfile(a_PlayerName, UUID, a_Properties, Now);
}
+ NotifyNameUUID(a_PlayerName, a_UUID);
}
@@ -655,11 +659,11 @@ void cMojangAPI::CacheNamesToUUIDs(const AStringVector & a_PlayerNames)
}
// Store the returned results into cache:
- size_t JsonCount = root.size();
+ Json::Value::UInt JsonCount = root.size();
Int64 Now = time(NULL);
{
cCSLock Lock(m_CSNameToUUID);
- for (size_t idx = 0; idx < JsonCount; ++idx)
+ for (Json::Value::UInt idx = 0; idx < JsonCount; ++idx)
{
Json::Value & Val = root[idx];
AString JsonName = Val.get("name", "").asString();
@@ -669,13 +673,14 @@ void cMojangAPI::CacheNamesToUUIDs(const AStringVector & a_PlayerNames)
continue;
}
m_NameToUUID[StrToLower(JsonName)] = sProfile(JsonName, JsonUUID, "", "", Now);
+ NotifyNameUUID(JsonName, JsonUUID);
} // for idx - root[]
} // cCSLock (m_CSNameToUUID)
// Also cache the UUIDToName:
{
cCSLock Lock(m_CSUUIDToName);
- for (size_t idx = 0; idx < JsonCount; ++idx)
+ for (Json::Value::UInt idx = 0; idx < JsonCount; ++idx)
{
Json::Value & Val = root[idx];
AString JsonName = Val.get("name", "").asString();
@@ -792,6 +797,21 @@ void cMojangAPI::CacheUUIDToProfile(const AString & a_UUID)
cCSLock Lock(m_CSNameToUUID);
m_NameToUUID[StrToLower(PlayerName)] = sProfile(PlayerName, a_UUID, Properties, Now);
}
+ NotifyNameUUID(PlayerName, a_UUID);
+}
+
+
+
+
+
+void cMojangAPI::NotifyNameUUID(const AString & a_PlayerName, const AString & a_UUID)
+{
+ // Notify the rank manager:
+ cCSLock Lock(m_CSRankMgr);
+ if (m_RankMgr != NULL)
+ {
+ m_RankMgr->NotifyNameUUID(a_PlayerName, a_UUID);
+ }
}
diff --git a/src/Protocol/MojangAPI.h b/src/Protocol/MojangAPI.h
index 6ed37625e..252d32543 100644
--- a/src/Protocol/MojangAPI.h
+++ b/src/Protocol/MojangAPI.h
@@ -11,6 +11,13 @@
#include <time.h>
+
+
+
+
+// fwd: ../RankManager.h"
+class cRankManager;
+
namespace Json
{
class Value;
@@ -38,8 +45,6 @@ public:
Returns true if all was successful, false on failure. */
static bool SecureRequest(const AString & a_ServerName, const AString & a_Request, AString & a_Response);
- // tolua_begin
-
/** Normalizes the given UUID to its short form (32 bytes, no dashes, lowercase).
Logs a warning and returns empty string if not a UUID.
Note: only checks the string's length, not the actual content. */
@@ -50,8 +55,6 @@ public:
Note: only checks the string's length, not the actual content. */
static AString MakeUUIDDashed(const AString & a_UUID);
- // tolua_end
-
/** Converts a player name into a UUID.
The UUID will be empty on error.
If a_UseOnlyCached is true, the function only consults the cached values.
@@ -85,7 +88,10 @@ public:
/** Called by the Authenticator to add a profile that it has received from authenticating a user. Adds
the profile to the respective mapping caches and updtes their datetime stamp to now. */
void AddPlayerProfile(const AString & a_PlayerName, const AString & a_UUID, const Json::Value & a_Properties);
-
+
+ /** Sets the m_RankMgr that is used for name-uuid notifications. Accepts NULL to remove the binding. */
+ void SetRankManager(cRankManager * a_RankManager) { m_RankMgr = a_RankManager; }
+
protected:
/** Holds data for a single player profile. */
struct sProfile
@@ -165,6 +171,12 @@ protected:
/** Protects m_UUIDToProfile against simultaneous multi-threaded access. */
cCriticalSection m_CSUUIDToProfile;
+
+ /** The rank manager that is notified of the name-uuid pairings. May be NULL. Protected by m_CSRankMgr. */
+ cRankManager * m_RankMgr;
+
+ /** Protects m_RankMgr agains simultaneous multi-threaded access. */
+ cCriticalSection m_CSRankMgr;
/** Loads the caches from a disk storage. */
@@ -182,6 +194,10 @@ protected:
UUIDs that are not valid will not be added into the cache.
ASSUMEs that a_UUID is a lowercased short UUID. */
void CacheUUIDToProfile(const AString & a_UUID);
+
+ /** Called for each name-uuid pairing that is discovered.
+ If assigned, notifies the m_RankManager of the event. */
+ void NotifyNameUUID(const AString & a_PlayerName, const AString & a_PlayerUUID);
} ; // tolua_export
diff --git a/src/Protocol/Protocol17x.cpp b/src/Protocol/Protocol17x.cpp
index 56e73c1c1..1091b877f 100644
--- a/src/Protocol/Protocol17x.cpp
+++ b/src/Protocol/Protocol17x.cpp
@@ -41,6 +41,7 @@ Implements the 1.7.x protocol classes:
#include "../BlockEntities/CommandBlockEntity.h"
#include "../BlockEntities/MobHeadEntity.h"
#include "../BlockEntities/FlowerPotEntity.h"
+#include "Bindings/PluginManager.h"
@@ -1720,21 +1721,41 @@ void cProtocol172::HandlePacketStatusPing(cByteBuffer & a_ByteBuffer)
void cProtocol172::HandlePacketStatusRequest(cByteBuffer & a_ByteBuffer)
{
- // Send the response:
- AString Response = "{\"version\":{\"name\":\"1.7.2\", \"protocol\":4}, \"players\":{";
cServer * Server = cRoot::Get()->GetServer();
- AppendPrintf(Response, "\"max\":%u, \"online\":%u, \"sample\":[]},",
- Server->GetMaxPlayers(),
- Server->GetNumPlayers()
- );
- AppendPrintf(Response, "\"description\":{\"text\":\"%s\"},",
- Server->GetDescription().c_str()
- );
- AppendPrintf(Response, "\"favicon\": \"data:image/png;base64,%s\"",
- Server->GetFaviconData().c_str()
- );
- Response.append("}");
-
+ AString ServerDescription = Server->GetDescription();
+ int NumPlayers = Server->GetNumPlayers();
+ int MaxPlayers = Server->GetMaxPlayers();
+ AString Favicon = Server->GetFaviconData();
+ cRoot::Get()->GetPluginManager()->CallHookServerPing(*m_Client, ServerDescription, NumPlayers, MaxPlayers, Favicon);
+
+ // Version:
+ Json::Value Version;
+ Version["name"] = "1.7.2";
+ Version["protocol"] = 4;
+
+ // Players:
+ Json::Value Players;
+ Players["online"] = NumPlayers;
+ Players["max"] = MaxPlayers;
+ // TODO: Add "sample"
+
+ // Description:
+ Json::Value Description;
+ Description["text"] = ServerDescription.c_str();
+
+ // Create the response:
+ Json::Value ResponseValue;
+ ResponseValue["version"] = Version;
+ ResponseValue["players"] = Players;
+ ResponseValue["description"] = Description;
+ if (!Favicon.empty())
+ {
+ ResponseValue["favicon"] = Printf("data:image/png;base64,%s", Favicon.c_str());
+ }
+
+ Json::StyledWriter Writer;
+ AString Response = Writer.write(ResponseValue);
+
cPacketizer Pkt(*this, 0x00); // Response packet
Pkt.WriteString(Response);
}
@@ -1803,7 +1824,11 @@ void cProtocol172::HandlePacketLoginEncryptionResponse(cByteBuffer & a_ByteBuffe
void cProtocol172::HandlePacketLoginStart(cByteBuffer & a_ByteBuffer)
{
AString Username;
- a_ByteBuffer.ReadVarUTF8String(Username);
+ if (!a_ByteBuffer.ReadVarUTF8String(Username))
+ {
+ m_Client->Kick("Bad username");
+ return;
+ }
if (!m_Client->HandleHandshake(Username))
{
@@ -3070,20 +3095,41 @@ void cProtocol176::SendPlayerSpawn(const cPlayer & a_Player)
void cProtocol176::HandlePacketStatusRequest(cByteBuffer & a_ByteBuffer)
{
- // Send the response:
- AString Response = "{\"version\": {\"name\": \"1.7.6\", \"protocol\":5}, \"players\": {";
- AppendPrintf(Response, "\"max\": %u, \"online\": %u, \"sample\": []},",
- cRoot::Get()->GetServer()->GetMaxPlayers(),
- cRoot::Get()->GetServer()->GetNumPlayers()
- );
- AppendPrintf(Response, "\"description\": {\"text\": \"%s\"},",
- cRoot::Get()->GetServer()->GetDescription().c_str()
- );
- AppendPrintf(Response, "\"favicon\": \"data:image/png;base64,%s\"",
- cRoot::Get()->GetServer()->GetFaviconData().c_str()
- );
- Response.append("}");
-
+ cServer * Server = cRoot::Get()->GetServer();
+ AString Motd = Server->GetDescription();
+ int NumPlayers = Server->GetNumPlayers();
+ int MaxPlayers = Server->GetMaxPlayers();
+ AString Favicon = Server->GetFaviconData();
+ cRoot::Get()->GetPluginManager()->CallHookServerPing(*m_Client, Motd, NumPlayers, MaxPlayers, Favicon);
+
+ // Version:
+ Json::Value Version;
+ Version["name"] = "1.7.6";
+ Version["protocol"] = 5;
+
+ // Players:
+ Json::Value Players;
+ Players["online"] = NumPlayers;
+ Players["max"] = MaxPlayers;
+ // TODO: Add "sample"
+
+ // Description:
+ Json::Value Description;
+ Description["text"] = Motd.c_str();
+
+ // Create the response:
+ Json::Value ResponseValue;
+ ResponseValue["version"] = Version;
+ ResponseValue["players"] = Players;
+ ResponseValue["description"] = Description;
+ if (!Favicon.empty())
+ {
+ ResponseValue["favicon"] = Printf("data:image/png;base64,%s", Favicon.c_str());
+ }
+
+ Json::StyledWriter Writer;
+ AString Response = Writer.write(ResponseValue);
+
cPacketizer Pkt(*this, 0x00); // Response packet
Pkt.WriteString(Response);
}
diff --git a/src/Protocol/ProtocolRecognizer.cpp b/src/Protocol/ProtocolRecognizer.cpp
index 18694572a..c831da251 100644
--- a/src/Protocol/ProtocolRecognizer.cpp
+++ b/src/Protocol/ProtocolRecognizer.cpp
@@ -18,6 +18,7 @@
#include "../Server.h"
#include "../World.h"
#include "../ChatColor.h"
+#include "Bindings/PluginManager.h"
@@ -1013,6 +1014,13 @@ void cProtocolRecognizer::SendLengthlessServerPing(void)
{
AString Reply;
cServer * Server = cRoot::Get()->GetServer();
+
+ AString ServerDescription = Server->GetDescription();
+ int NumPlayers = Server->GetNumPlayers();
+ int MaxPlayers = Server->GetMaxPlayers();
+ AString Favicon = Server->GetFaviconData();
+ cRoot::Get()->GetPluginManager()->CallHookServerPing(*m_Client, ServerDescription, NumPlayers, MaxPlayers, Favicon);
+
switch (cRoot::Get()->GetPrimaryServerVersion())
{
case PROTO_VERSION_1_2_5:
@@ -1020,11 +1028,11 @@ void cProtocolRecognizer::SendLengthlessServerPing(void)
{
// http://wiki.vg/wiki/index.php?title=Protocol&oldid=3099#Server_List_Ping_.280xFE.29
Printf(Reply, "%s%s%i%s%i",
- Server->GetDescription().c_str(),
+ ServerDescription.c_str(),
cChatColor::Delimiter,
- Server->GetNumPlayers(),
+ NumPlayers,
cChatColor::Delimiter,
- Server->GetMaxPlayers()
+ MaxPlayers
);
break;
}
@@ -1051,13 +1059,7 @@ void cProtocolRecognizer::SendLengthlessServerPing(void)
m_Buffer.ReadByte(val); // 0x01 magic value
ASSERT(val == 0x01);
}
-
- // http://wiki.vg/wiki/index.php?title=Server_List_Ping&oldid=3100
- AString NumPlayers;
- Printf(NumPlayers, "%d", Server->GetNumPlayers());
- AString MaxPlayers;
- Printf(MaxPlayers, "%d", Server->GetMaxPlayers());
-
+
AString ProtocolVersionNum;
Printf(ProtocolVersionNum, "%d", cRoot::Get()->GetPrimaryServerVersion());
AString ProtocolVersionTxt(GetVersionTextFromInt(cRoot::Get()->GetPrimaryServerVersion()));
@@ -1070,11 +1072,11 @@ void cProtocolRecognizer::SendLengthlessServerPing(void)
Reply.push_back(0);
Reply.append(ProtocolVersionTxt);
Reply.push_back(0);
- Reply.append(Server->GetDescription());
+ Reply.append(ServerDescription);
Reply.push_back(0);
- Reply.append(NumPlayers);
+ Reply.append(Printf("%d", NumPlayers));
Reply.push_back(0);
- Reply.append(MaxPlayers);
+ Reply.append(Printf("%d", MaxPlayers));
break;
}
} // switch (m_PrimaryServerVersion)
diff --git a/src/Protocol/ProtocolRecognizer.h b/src/Protocol/ProtocolRecognizer.h
index 28572a8fd..a05aeda70 100644
--- a/src/Protocol/ProtocolRecognizer.h
+++ b/src/Protocol/ProtocolRecognizer.h
@@ -18,7 +18,7 @@
// Adjust these if a new protocol is added or an old one is removed:
-#define MCS_CLIENT_VERSIONS "1.2.4, 1.2.5, 1.3.1, 1.3.2, 1.4.2, 1.4.4, 1.4.5, 1.4.6, 1.4.7, 1.5, 1.5.1, 1.5.2, 1.6.1, 1.6.2, 1.6.3, 1.6.4, 1.7.2, 1.7.4, 1.7.5, 1.7.6, 1.7.7, 1.7.8, 1.7.9"
+#define MCS_CLIENT_VERSIONS "1.2.4, 1.2.5, 1.3.1, 1.3.2, 1.4.2, 1.4.4, 1.4.5, 1.4.6, 1.4.7, 1.5, 1.5.1, 1.5.2, 1.6.1, 1.6.2, 1.6.3, 1.6.4, 1.7.2, 1.7.4, 1.7.5, 1.7.6, 1.7.7, 1.7.8, 1.7.9, 1.7.10"
#define MCS_PROTOCOL_VERSIONS "29, 39, 47, 49, 51, 60, 61, 73, 74, 77, 78, 4, 5"
diff --git a/src/RankManager.cpp b/src/RankManager.cpp
new file mode 100644
index 000000000..e5896f8f3
--- /dev/null
+++ b/src/RankManager.cpp
@@ -0,0 +1,1837 @@
+
+// RankManager.cpp
+
+// Implements the cRankManager class that represents the rank manager responsible for assigning permissions and message visuals to players
+
+#include "Globals.h"
+#include "RankManager.h"
+#include "inifile/iniFile.h"
+#include "Protocol/MojangAPI.h"
+#include "ClientHandle.h"
+
+
+
+
+
+////////////////////////////////////////////////////////////////////////////////
+// cRankManagerIniMigrator:
+
+/** Migrates from groups.ini and users.ini into the rankmanager DB */
+class cRankManagerIniMigrator
+{
+public:
+ cRankManagerIniMigrator(cRankManager & a_RankManager, cMojangAPI & a_MojangAPI) :
+ m_RankManager(a_RankManager),
+ m_MojangAPI(a_MojangAPI)
+ {
+ }
+
+
+
+ /** Performs the complete migration from INI files to DB. */
+ bool Migrate(void)
+ {
+ cRankManager::cMassChangeLock Lock(m_RankManager);
+
+ LOGD("Reading groups...");
+ if (!ReadGroups())
+ {
+ return false;
+ }
+ LOGD("Cleaning groups inheritance...");
+ CleanGroupInheritance();
+ LOGD("Creating groups...");
+ CreateGroups();
+
+ LOGD("Reading users...");
+ if (!ReadUsers())
+ {
+ return false;
+ }
+ LOGD("Cleaning user groups...");
+ CleanUserGroups();
+ LOGD("Resolving user UUIDs...");
+ ResolveUserUUIDs();
+
+ LOGD("Setting ranks...");
+ SetRanks();
+
+ LOGD("Creating defaults...");
+ CreateDefaults();
+
+ return true;
+ }
+
+protected:
+
+ /** Container for a group read from an INI file. */
+ struct sGroup
+ {
+ AString m_Name;
+ AString m_Color;
+ AStringVector m_Inherits;
+ AStringVector m_Permissions;
+
+ sGroup(void) {}
+
+ sGroup(const AString & a_Name, const AString & a_Color, const AStringVector & a_Inherits, const AStringVector & a_Permissions):
+ m_Name(a_Name),
+ m_Color(a_Color),
+ m_Inherits(a_Inherits),
+ m_Permissions(a_Permissions)
+ {
+ }
+ };
+ typedef std::map<AString, sGroup> sGroupMap;
+
+
+ /** Container for a single user read from an INI file. */
+ struct sUser
+ {
+ AString m_Name;
+ AStringVector m_Groups;
+
+ /** Assigned by ResolveUserUUIDs(), contains the online (Mojang) UUID of the player. */
+ AString m_UUID;
+
+ /** Assigned by ResolveUserUUIDs(), contains the offline (generated) UUID of the player. */
+ AString m_OfflineUUID;
+
+
+ sUser(void) {}
+
+ sUser(const AString & a_Name, const AStringVector & a_Groups):
+ m_Name(a_Name),
+ m_Groups(a_Groups)
+ {
+ }
+ };
+ typedef std::map<AString, sUser> sUserMap;
+
+ typedef std::map<AString, AString> cStringMap;
+
+
+ /** The parent Rank manager where we will create the groups, ranks and players */
+ cRankManager & m_RankManager;
+
+ /** The player name to UUID resolver */
+ cMojangAPI & m_MojangAPI;
+
+ /** List of all groups read from the ini file */
+ sGroupMap m_Groups;
+
+ /** List of all players read from the ini file. */
+ sUserMap m_Users;
+
+ /** Maps lists of groups to rank names.
+ Each group list is either a simple "<Group>" if there's only one group,
+ or "<PrimaryGroup>, <FirstSecondaryGroup>, <SecondSecondaryGroup>...", where the secondary groups are
+ lowercased and alpha-sorted. This makes the group lists comparable for equivalence, simply by comparing
+ their string names.
+ The ranks are named "<Group>" for single-group players, and "AutoMigratedRank_N" for the composite ranks,
+ where N is a unique number. */
+ cStringMap m_GroupsToRanks;
+
+
+
+ /** Reads the groups from the "groups.ini" file into m_Groups */
+ bool ReadGroups(void)
+ {
+ // Read the file:
+ cIniFile Groups;
+ if (!Groups.ReadFile("groups.ini"))
+ {
+ return false;
+ }
+
+ // Read all the groups into a map:
+ int NumGroups = Groups.GetNumKeys();
+ for (int i = 0; i < NumGroups; i++)
+ {
+ AString GroupName = Groups.GetKeyName(i);
+ AString lcGroupName = StrToLower(GroupName);
+ if (m_Groups.find(lcGroupName) != m_Groups.end())
+ {
+ LOGINFO("groups.ini contains a duplicate definition of group %s, ignoring the latter.", GroupName.c_str());
+ continue;
+ }
+ m_Groups[lcGroupName] = sGroup(
+ GroupName,
+ Groups.GetValue(GroupName, "Color", ""),
+ StringSplitAndTrim(Groups.GetValue(GroupName, "Inherits"), ","),
+ StringSplitAndTrim(Groups.GetValue(GroupName, "Permissions"), ",")
+ );
+ } // for i - Groups' keys
+ return true;
+ }
+
+
+
+ /** Removes non-existent groups from all the groups' inheritance */
+ void CleanGroupInheritance(void)
+ {
+ for (sGroupMap::iterator itrG = m_Groups.begin(), endG = m_Groups.end(); itrG != endG; ++itrG)
+ {
+ AStringVector & Inherits = itrG->second.m_Inherits;
+ for (AStringVector::iterator itrI = Inherits.begin(); itrI != Inherits.end();)
+ {
+ AString lcInherits = StrToLower(*itrI);
+ if (m_Groups.find(lcInherits) != m_Groups.end())
+ {
+ // Inherited group exists, continue checking the next one
+ ++itrI;
+ continue;
+ }
+ // Inherited group doesn't exist, remove it from the list:
+ LOGWARNING("RankMigrator: Group \"%s\" inherits from a non-existent group \"%s\", this inheritance will be ignored.",
+ itrG->second.m_Name.c_str(), itrI->c_str()
+ );
+ AStringVector::iterator itrI2 = itrI;
+ ++itrI2;
+ Inherits.erase(itrI);
+ itrI = itrI2;
+ } // for itrI - Inherits[]
+ } // for itrG - m_Groups[]
+ }
+
+
+
+ /** Reads the users from the "users.ini" file into m_Users */
+ bool ReadUsers(void)
+ {
+ // Read the file:
+ cIniFile Users;
+ if (!Users.ReadFile("users.ini"))
+ {
+ return false;
+ }
+
+ // Read all the users into a map:
+ int NumUsers = Users.GetNumKeys();
+ for (int i = 0; i < NumUsers; i++)
+ {
+ AString UserName = Users.GetKeyName(i);
+ AString lcUserName = StrToLower(UserName);
+ if (m_Users.find(lcUserName) != m_Users.end())
+ {
+ LOGINFO("users.ini contains a duplicate definition of user %s, ignoring the latter.", UserName.c_str());
+ continue;
+ }
+ m_Users[lcUserName] = sUser(
+ UserName,
+ StringSplitAndTrim(Users.GetValue(UserName, "Groups", ""), ",")
+ );
+ } // for i - Users' keys
+ return true;
+ }
+
+
+
+ /** Removes non-existent groups from each user's definition. */
+ void CleanUserGroups(void)
+ {
+ for (sUserMap::iterator itrU = m_Users.begin(), endU = m_Users.end(); itrU != endU; ++itrU)
+ {
+ AStringVector & Groups = itrU->second.m_Groups;
+ for (AStringVector::iterator itrG = Groups.begin(); itrG != Groups.end();)
+ {
+ AString lcGroup = StrToLower(*itrG);
+ if (m_Groups.find(lcGroup) != m_Groups.end())
+ {
+ // Assigned group exists, continue checking the next one
+ ++itrG;
+ continue;
+ }
+ // Assigned group doesn't exist, remove it from the list:
+ LOGWARNING("RankMigrator: User \"%s\" is assigned a non-existent group \"%s\", this assignment will be ignored.",
+ itrU->second.m_Name.c_str(), itrG->c_str()
+ );
+ AStringVector::iterator itrG2 = itrG;
+ ++itrG2;
+ Groups.erase(itrG);
+ itrG = itrG2;
+ } // for itrG - Groups[]
+ } // for itrU - m_Users[]
+ }
+
+
+
+ /** Creates groups based on m_Groups.
+ Ignores group inheritance. */
+ void CreateGroups(void)
+ {
+ // Create each group, with its permissions:
+ for (sGroupMap::const_iterator itr = m_Groups.begin(), end = m_Groups.end(); itr != end; ++itr)
+ {
+ m_RankManager.AddGroup(itr->second.m_Name);
+ m_RankManager.AddPermissionsToGroup(itr->second.m_Permissions, itr->second.m_Name);
+ } // for itr - m_Groups[]
+ }
+
+
+ /** Resolves the UUID of each user in m_Users.
+ If a user doesn't resolve, they are removed and logged in the console. */
+ void ResolveUserUUIDs(void)
+ {
+ // Resolve all PlayerNames at once (the API doesn't like single-name queries):
+ AStringVector PlayerNames;
+ for (sUserMap::const_iterator itr = m_Users.begin(), end = m_Users.end(); itr != end; ++itr)
+ {
+ PlayerNames.push_back(itr->second.m_Name);
+ }
+ m_MojangAPI.GetUUIDsFromPlayerNames(PlayerNames);
+
+ // Assign the UUIDs back to players, remove those not resolved:
+ for (sUserMap::iterator itr = m_Users.begin(); itr != m_Users.end(); ++itr)
+ {
+ AString UUID = m_MojangAPI.GetUUIDFromPlayerName(itr->second.m_Name);
+ if (UUID.empty())
+ {
+ LOGWARNING("RankMigrator: Cannot resolve player %s to online UUID, player will be left unranked in online mode", itr->second.m_Name.c_str());
+ }
+ itr->second.m_UUID = UUID;
+ itr->second.m_OfflineUUID = cClientHandle::GenerateOfflineUUID(itr->second.m_Name);
+ }
+ }
+
+
+
+ /** Adds the specified groups to the specified ranks. Recurses on the groups' inheritance. */
+ void AddGroupsToRank(const AStringVector & a_Groups, const AString & a_RankName)
+ {
+ for (AStringVector::const_iterator itr = a_Groups.begin(), end = a_Groups.end(); itr != end; ++itr)
+ {
+ // Normalize the group name:
+ sGroup & Group = m_Groups[StrToLower(*itr)];
+
+ // Avoid loops, check if the group is already added:
+ if (m_RankManager.IsGroupInRank(Group.m_Name, a_RankName))
+ {
+ continue;
+ }
+
+ // Add the group, and all the groups it inherits from recursively:
+ m_RankManager.AddGroupToRank(Group.m_Name, a_RankName);
+ AddGroupsToRank(Group.m_Inherits, a_RankName);
+ } // for itr - a_Groups[]
+ }
+
+
+
+ /** Creates a rank for each player, based on the master groups they are assigned. */
+ void SetRanks(void)
+ {
+ for (sUserMap::const_iterator itr = m_Users.begin(), end = m_Users.end(); itr != end; ++itr)
+ {
+ // Ignore users with no groups:
+ const AStringVector & Groups = itr->second.m_Groups;
+ if (Groups.empty())
+ {
+ LOGWARNING("RankMigrator: Player %s has no groups assigned to them, skipping the player.", itr->second.m_Name.c_str());
+ continue;
+ }
+
+ // Compose the rank name out of group names:
+ AString RankName;
+ for (AStringVector::const_iterator itrG = Groups.begin(), endG = Groups.end(); itrG != endG; ++itrG)
+ {
+ AString GroupName = m_Groups[StrToLower(*itrG)].m_Name; // Normalize group name
+ if (!RankName.empty())
+ {
+ RankName.push_back(',');
+ }
+ RankName.append(GroupName);
+ } // for itrG - Groups[]
+
+ // Create the rank, with al its groups:
+ if (!m_RankManager.RankExists(RankName))
+ {
+ m_RankManager.AddRank(RankName, "", "", m_Groups[StrToLower(Groups[0])].m_Color);
+ AddGroupsToRank(Groups, RankName);
+ }
+
+ // Set the rank to the user, using both the online and offline UUIDs:
+ m_RankManager.SetPlayerRank(itr->second.m_UUID, itr->second.m_Name, RankName);
+ m_RankManager.SetPlayerRank(itr->second.m_OfflineUUID, itr->second.m_Name, RankName);
+ } // for itr - m_Users[]
+ }
+
+
+
+ /** Creates the Default rank that contains the Default group, if it exists.
+ Sets the RankManager's default rank. */
+ void CreateDefaults(void)
+ {
+ if (!m_RankManager.RankExists("Default"))
+ {
+ m_RankManager.AddRank("Default", "", "", "");
+ if (!m_RankManager.IsGroupInRank("Default", "Default"))
+ {
+ m_RankManager.AddGroupToRank("Default", "Default");
+ }
+ }
+ m_RankManager.SetDefaultRank("Default");
+ }
+};
+
+
+
+
+
+////////////////////////////////////////////////////////////////////////////////
+// cRankManager:
+
+cRankManager::cRankManager(void) :
+ m_DB("Ranks.sqlite", SQLITE_OPEN_READWRITE | SQLITE_OPEN_CREATE),
+ m_IsInitialized(false),
+ m_MojangAPI(NULL)
+{
+}
+
+
+
+
+
+cRankManager::~cRankManager()
+{
+ if (m_MojangAPI != NULL)
+ {
+ m_MojangAPI->SetRankManager(NULL);
+ }
+}
+
+
+
+
+
+void cRankManager::Initialize(cMojangAPI & a_MojangAPI)
+{
+ ASSERT(!m_IsInitialized); // Calling Initialize for the second time?
+
+ // Create the DB tables, if they don't exist:
+ m_DB.exec("CREATE TABLE IF NOT EXISTS Rank (RankID INTEGER PRIMARY KEY, Name, MsgPrefix, MsgSuffix, MsgNameColorCode)");
+ m_DB.exec("CREATE TABLE IF NOT EXISTS PlayerRank (PlayerUUID, PlayerName, RankID INTEGER)");
+ m_DB.exec("CREATE TABLE IF NOT EXISTS PermGroup (PermGroupID INTEGER PRIMARY KEY, Name)");
+ m_DB.exec("CREATE TABLE IF NOT EXISTS RankPermGroup (RankID INTEGER, PermGroupID INTEGER)");
+ m_DB.exec("CREATE TABLE IF NOT EXISTS PermissionItem (PermGroupID INTEGER, Permission)");
+ m_DB.exec("CREATE TABLE IF NOT EXISTS DefaultRank (RankID INTEGER)");
+
+ m_IsInitialized = true;
+
+ a_MojangAPI.SetRankManager(this);
+
+ // Check if tables empty, migrate from ini files then
+ if (AreDBTablesEmpty())
+ {
+ LOGINFO("There are no ranks, migrating old-style INI files to new DB ranks...");
+ LOGINFO("(This might take a while)");
+ cRankManagerIniMigrator Migrator(*this, a_MojangAPI);
+ if (Migrator.Migrate())
+ {
+ LOGINFO("Ranks migrated.");
+ // The default rank has been set by the migrator
+ return;
+ }
+
+ // Migration failed. Add some defaults
+ LOGINFO("Rank migration failed, creating default ranks...");
+ CreateDefaults();
+ LOGINFO("Default ranks created.");
+ }
+
+ // Load the default rank:
+ try
+ {
+ SQLite::Statement stmt(m_DB,
+ "SELECT Rank.Name FROM Rank "
+ "LEFT JOIN DefaultRank ON Rank.RankID = DefaultRank.RankID"
+ );
+ if (stmt.executeStep())
+ {
+ m_DefaultRank = stmt.getColumn(0).getText();
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Cannot load default rank: %s", __FUNCTION__, ex.what());
+ return;
+ }
+
+ // If the default rank cannot be loaded, use the first rank:
+ if (m_DefaultRank.empty())
+ {
+ SetDefaultRank(GetAllRanks()[0]);
+ }
+}
+
+
+
+
+
+AString cRankManager::GetPlayerRankName(const AString & a_PlayerUUID)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT Rank.Name FROM Rank LEFT JOIN PlayerRank ON Rank.RankID = PlayerRank.RankID WHERE PlayerRank.PlayerUUID = ?");
+ stmt.bind(1, a_PlayerUUID);
+ // executeStep returns false on no data
+ if (!stmt.executeStep())
+ {
+ // No data returned from the DB
+ return AString();
+ }
+ return stmt.getColumn(0).getText();
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Cannot get player rank name: %s", __FUNCTION__, ex.what());
+ }
+ return AString();
+}
+
+
+
+
+
+AStringVector cRankManager::GetPlayerGroups(const AString & a_PlayerUUID)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ AStringVector res;
+ try
+ {
+ // Prepare the DB statement:
+ SQLite::Statement stmt(m_DB,
+ "SELECT PermGroup.Name FROM PermGroup "
+ "LEFT JOIN RankPermGroup ON PermGroup.PermGroupID = RankPermGroup.PermGroupID "
+ "LEFT JOIN PlayerRank ON PlayerRank.RankID = RankPermGroup.RankID "
+ "WHERE PlayerRank.PlayerUUID = ?"
+ );
+ stmt.bind(1, a_PlayerUUID);
+
+ // Execute and get results:
+ while (stmt.executeStep())
+ {
+ res.push_back(stmt.getColumn(0).getText());
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Cannot get player groups: %s", __FUNCTION__, ex.what());
+ }
+ return res;
+}
+
+
+
+
+
+AStringVector cRankManager::GetPlayerPermissions(const AString & a_PlayerUUID)
+{
+ AString Rank = GetPlayerRankName(a_PlayerUUID);
+ if (Rank.empty())
+ {
+ Rank = m_DefaultRank;
+ }
+ return GetRankPermissions(Rank);
+}
+
+
+
+
+
+AStringVector cRankManager::GetRankGroups(const AString & a_RankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ AStringVector res;
+ try
+ {
+ SQLite::Statement stmt(m_DB,
+ "SELECT PermGroup.Name FROM PermGroup "
+ "LEFT JOIN RankPermGroup ON RankPermGroup.PermGroupID = PermGroup.PermGroupID "
+ "LEFT JOIN Rank ON Rank.RankID = RankPermGroup.RankID "
+ "WHERE Rank.Name = ?"
+ );
+ stmt.bind(1, a_RankName);
+ while (stmt.executeStep())
+ {
+ res.push_back(stmt.getColumn(0).getText());
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to get rank groups from DB: %s", __FUNCTION__, ex.what());
+ }
+ return res;
+}
+
+
+
+
+
+AStringVector cRankManager::GetGroupPermissions(const AString & a_GroupName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ AStringVector res;
+ try
+ {
+ SQLite::Statement stmt(m_DB,
+ "SELECT PermissionItem.Permission FROM PermissionItem "
+ "LEFT JOIN PermGroup ON PermGroup.PermGroupID = PermissionItem.PermGroupID "
+ "WHERE PermGroup.Name = ?"
+ );
+ stmt.bind(1, a_GroupName);
+ while (stmt.executeStep())
+ {
+ res.push_back(stmt.getColumn(0).getText());
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to get group permissions from DB: %s", __FUNCTION__, ex.what());
+ }
+ return res;
+}
+
+
+
+
+
+AStringVector cRankManager::GetRankPermissions(const AString & a_RankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ AStringVector res;
+ try
+ {
+ SQLite::Statement stmt(m_DB,
+ "SELECT PermissionItem.Permission FROM PermissionItem "
+ "LEFT JOIN RankPermGroup ON RankPermGroup.PermGroupID = PermissionItem.PermGroupID "
+ "LEFT JOIN Rank ON Rank.RankID = RankPermGroup.RankID "
+ "WHERE Rank.Name = ?"
+ );
+ stmt.bind(1, a_RankName);
+ while (stmt.executeStep())
+ {
+ res.push_back(stmt.getColumn(0).getText());
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to get rank permissions from DB: %s", __FUNCTION__, ex.what());
+ }
+ return res;
+}
+
+
+
+
+
+AStringVector cRankManager::GetAllRanks(void)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ AStringVector res;
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT Name FROM Rank");
+ while (stmt.executeStep())
+ {
+ res.push_back(stmt.getColumn(0).getText());
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to get ranks from DB: %s", __FUNCTION__, ex.what());
+ }
+ return res;
+}
+
+
+
+
+
+AStringVector cRankManager::GetAllGroups(void)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ AStringVector res;
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT Name FROM PermGroup");
+ while (stmt.executeStep())
+ {
+ res.push_back(stmt.getColumn(0).getText());
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to get groups from DB: %s", __FUNCTION__, ex.what());
+ }
+ return res;
+}
+
+
+
+
+
+AStringVector cRankManager::GetAllPermissions(void)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ AStringVector res;
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT DISTINCT(Permission) FROM PermissionItem");
+ while (stmt.executeStep())
+ {
+ res.push_back(stmt.getColumn(0).getText());
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to get permissions from DB: %s", __FUNCTION__, ex.what());
+ }
+ return res;
+}
+
+
+
+
+
+bool cRankManager::GetPlayerMsgVisuals(
+ const AString & a_PlayerUUID,
+ AString & a_MsgPrefix,
+ AString & a_MsgSuffix,
+ AString & a_MsgNameColorCode
+)
+{
+ AString Rank = GetPlayerRankName(a_PlayerUUID);
+ if (Rank.empty())
+ {
+ // Rank not found, return failure:
+ a_MsgPrefix.clear();
+ a_MsgSuffix.clear();
+ a_MsgNameColorCode.clear();
+ return false;
+ }
+ return GetRankVisuals(Rank, a_MsgPrefix, a_MsgSuffix, a_MsgNameColorCode);
+}
+
+
+
+
+
+void cRankManager::AddRank(
+ const AString & a_RankName,
+ const AString & a_MsgPrefix,
+ const AString & a_MsgSuffix,
+ const AString & a_MsgNameColorCode
+)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Check if such a rank name is already used:
+ {
+ SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_RankName);
+ if (stmt.executeStep())
+ {
+ if (stmt.getColumn(0).getInt() > 0)
+ {
+ // Rank already exists, do nothing:
+ return;
+ }
+ }
+ }
+
+ // Insert a new rank:
+ SQLite::Statement stmt(m_DB, "INSERT INTO Rank (Name, MsgPrefix, MsgSuffix, MsgNameColorCode) VALUES (?, ?, ?, ?)");
+ stmt.bind(1, a_RankName);
+ stmt.bind(2, a_MsgPrefix);
+ stmt.bind(3, a_MsgSuffix);
+ stmt.bind(4, a_MsgNameColorCode);
+ if (stmt.exec() <= 0)
+ {
+ LOGWARNING("%s: Failed to add a new rank \"%s\".", __FUNCTION__, a_RankName.c_str());
+ return;
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to add a new rank \"%s\": %s", __FUNCTION__, a_RankName.c_str(), ex.what());
+ }
+}
+
+
+
+
+
+void cRankManager::AddGroup(const AString & a_GroupName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Check if such a group name is already used:
+ {
+ SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, a_GroupName);
+ if (stmt.executeStep())
+ {
+ if (stmt.getColumn(0).getInt() > 0)
+ {
+ // Group already exists, do nothing:
+ return;
+ }
+ }
+ }
+
+ // Insert a new group:
+ SQLite::Statement stmt(m_DB, "INSERT INTO PermGroup (Name) VALUES (?)");
+ stmt.bind(1, a_GroupName);
+ if (stmt.exec() <= 0)
+ {
+ LOGWARNING("%s: Failed to add a new group \"%s\".", __FUNCTION__, a_GroupName.c_str());
+ return;
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to add a new group \"%s\": %s", __FUNCTION__, a_GroupName.c_str(), ex.what());
+ }
+}
+
+
+
+
+
+void cRankManager::AddGroups(const AStringVector & a_GroupNames)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ for (AStringVector::const_iterator itr = a_GroupNames.begin(), end = a_GroupNames.end(); itr != end; ++itr)
+ {
+ // Check if such the group name is already used:
+ {
+ SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, *itr);
+ if (stmt.executeStep())
+ {
+ if (stmt.getColumn(0).getInt() > 0)
+ {
+ // Group already exists, do nothing:
+ return;
+ }
+ }
+ }
+
+ // Insert a new group:
+ SQLite::Statement stmt(m_DB, "INSERT INTO PermGroup (Name) VALUES (?)");
+ stmt.bind(1, *itr);
+ if (stmt.exec() <= 0)
+ {
+ LOGWARNING("%s: Failed to add a new group \"%s\".", __FUNCTION__, itr->c_str());
+ return;
+ }
+ } // for itr - a_GroupNames[]
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to add new groups: %s", __FUNCTION__, ex.what());
+ }
+}
+
+
+
+
+
+bool cRankManager::AddGroupToRank(const AString & a_GroupName, const AString & a_RankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Get the group's ID:
+ int GroupID;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, a_GroupName);
+ if (!stmt.executeStep())
+ {
+ LOGWARNING("%s: No such group (%s), aborting.", __FUNCTION__, a_GroupName.c_str());
+ return false;
+ }
+ GroupID = stmt.getColumn(0);
+ }
+
+ // Get the rank's ID:
+ int RankID;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_RankName);
+ if (!stmt.executeStep())
+ {
+ LOGWARNING("%s: No such rank (%s), aborting.", __FUNCTION__, a_RankName.c_str());
+ return false;
+ }
+ RankID = stmt.getColumn(0);
+ }
+
+ // Check if the group is already there:
+ {
+ SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM RankPermGroup WHERE RankID = ? AND PermGroupID = ?");
+ stmt.bind(1, RankID);
+ stmt.bind(2, GroupID);
+ if (!stmt.executeStep())
+ {
+ LOGWARNING("%s: Failed to check binding between rank %s and group %s, aborting.", __FUNCTION__, a_RankName.c_str(), a_GroupName.c_str());
+ return false;
+ }
+ if (stmt.getColumn(0).getInt() > 0)
+ {
+ LOGD("%s: Group %s already present in rank %s, skipping and returning success.",
+ __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str()
+ );
+ return true;
+ }
+ }
+
+ // Add the group:
+ {
+ SQLite::Statement stmt(m_DB, "INSERT INTO RankPermGroup (RankID, PermGroupID) VALUES (?, ?)");
+ stmt.bind(1, RankID);
+ stmt.bind(2, GroupID);
+ if (stmt.exec() <= 0)
+ {
+ LOGWARNING("%s: Failed to add group %s to rank %s, aborting.", __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str());
+ return false;
+ }
+ }
+
+ // Adding succeeded:
+ return true;
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to add group %s to rank %s: %s", __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str(), ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+bool cRankManager::AddPermissionToGroup(const AString & a_Permission, const AString & a_GroupName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Get the group's ID:
+ int GroupID;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, a_GroupName);
+ if (!stmt.executeStep())
+ {
+ LOGWARNING("%s: No such group (%s), aborting.", __FUNCTION__, a_GroupName.c_str());
+ return false;
+ }
+ GroupID = stmt.getColumn(0).getInt();
+ }
+
+ // Check if the permission is already present:
+ {
+ SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM PermissionItem WHERE PermGroupID = ? AND Permission = ?");
+ stmt.bind(1, GroupID);
+ stmt.bind(2, a_Permission);
+ if (!stmt.executeStep())
+ {
+ LOGWARNING("%s: Failed to check binding between permission %s and group %s, aborting.", __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str());
+ return false;
+ }
+ if (stmt.getColumn(0).getInt() > 0)
+ {
+ LOGD("%s: Permission %s is already present in group %s, skipping and returning success.",
+ __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str()
+ );
+ return true;
+ }
+ }
+
+ // Add the permission:
+ {
+ SQLite::Statement stmt(m_DB, "INSERT INTO PermissionItem (Permission, PermGroupID) VALUES (?, ?)");
+ stmt.bind(1, a_Permission);
+ stmt.bind(2, GroupID);
+ if (stmt.exec() <= 0)
+ {
+ LOGWARNING("%s: Failed to add permission %s to group %s, aborting.", __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str());
+ return false;
+ }
+ }
+
+ // Adding succeeded:
+ return true;
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to add permission %s to group %s: %s",
+ __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str(), ex.what()
+ );
+ }
+ return false;
+}
+
+
+
+
+
+bool cRankManager::AddPermissionsToGroup(const AStringVector & a_Permissions, const AString & a_GroupName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Get the group's ID:
+ int GroupID;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, a_GroupName);
+ if (!stmt.executeStep())
+ {
+ LOGWARNING("%s: No such group (%s), aborting.", __FUNCTION__, a_GroupName.c_str());
+ return false;
+ }
+ GroupID = stmt.getColumn(0).getInt();
+ }
+
+ for (AStringVector::const_iterator itr = a_Permissions.begin(), end = a_Permissions.end(); itr != end; ++itr)
+ {
+ // Check if the permission is already present:
+ {
+ SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM PermissionItem WHERE PermGroupID = ? AND Permission = ?");
+ stmt.bind(1, GroupID);
+ stmt.bind(2, *itr);
+ if (!stmt.executeStep())
+ {
+ LOGWARNING("%s: Failed to check binding between permission %s and group %s, aborting.", __FUNCTION__, itr->c_str(), a_GroupName.c_str());
+ return false;
+ }
+ if (stmt.getColumn(0).getInt() > 0)
+ {
+ LOGD("%s: Permission %s is already present in group %s, skipping and returning success.",
+ __FUNCTION__, itr->c_str(), a_GroupName.c_str()
+ );
+ continue;
+ }
+ }
+
+ // Add the permission:
+ {
+ SQLite::Statement stmt(m_DB, "INSERT INTO PermissionItem (Permission, PermGroupID) VALUES (?, ?)");
+ stmt.bind(1, *itr);
+ stmt.bind(2, GroupID);
+ if (stmt.exec() <= 0)
+ {
+ LOGWARNING("%s: Failed to add permission %s to group %s, skipping.", __FUNCTION__, itr->c_str(), a_GroupName.c_str());
+ continue;
+ }
+ }
+ } // for itr - a_Permissions[]
+
+ // Adding succeeded:
+ return true;
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to add permissions to group %s: %s",
+ __FUNCTION__, a_GroupName.c_str(), ex.what()
+ );
+ }
+ return false;
+}
+
+
+
+
+
+void cRankManager::RemoveRank(const AString & a_RankName, const AString & a_ReplacementRankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ // Check if the default rank is being removed with a proper replacement:
+ if ((a_RankName == m_DefaultRank) && !RankExists(a_ReplacementRankName))
+ {
+ LOGWARNING("%s: Cannot remove rank %s, it is the default rank and the replacement rank doesn't exist.", __FUNCTION__, a_RankName.c_str());
+ return;
+ }
+
+ AStringVector res;
+ try
+ {
+ // Get the RankID for the rank being removed:
+ int RemoveRankID;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_RankName);
+ if (!stmt.executeStep())
+ {
+ LOGINFO("%s: Rank %s was not found. Skipping.", __FUNCTION__, a_RankName.c_str());
+ return;
+ }
+ RemoveRankID = stmt.getColumn(0).getInt();
+ }
+
+ // Get the RankID for the replacement rank:
+ int ReplacementRankID = -1;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_ReplacementRankName);
+ if (stmt.executeStep())
+ {
+ ReplacementRankID = stmt.getColumn(0).getInt();
+ }
+ }
+
+ // Remove the rank's bindings to groups:
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM RankPermGroup WHERE RankID = ?");
+ stmt.bind(1, RemoveRankID);
+ stmt.exec();
+ }
+
+ // Adjust players:
+ if (ReplacementRankID == -1)
+ {
+ // No replacement, just delete all the players that have the rank:
+ SQLite::Statement stmt(m_DB, "DELETE FROM PlayerRank WHERE RankID = ?");
+ stmt.bind(1, RemoveRankID);
+ stmt.exec();
+ }
+ else
+ {
+ // Replacement available, change all the player records:
+ SQLite::Statement stmt(m_DB, "UPDATE PlayerRank SET RankID = ? WHERE RankID = ?");
+ stmt.bind(1, ReplacementRankID);
+ stmt.bind(2, RemoveRankID);
+ stmt.exec();
+ }
+
+ // Remove the rank from the DB:
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM Rank WHERE RankID = ?");
+ stmt.bind(1, RemoveRankID);
+ stmt.exec();
+ }
+
+ // Update the default rank, if it was the one being removed:
+ if (a_RankName == m_DefaultRank)
+ {
+ m_DefaultRank = a_RankName;
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to remove rank from DB: %s", __FUNCTION__, ex.what());
+ }
+}
+
+
+
+
+
+void cRankManager::RemoveGroup(const AString & a_GroupName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Get the ID of the group:
+ int GroupID;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, a_GroupName);
+ if (!stmt.executeStep())
+ {
+ LOGINFO("%s: Group %s was not found, skipping.", __FUNCTION__, a_GroupName.c_str());
+ return;
+ }
+ GroupID = stmt.getColumn(0).getInt();
+ }
+
+ // Remove all permissions from the group:
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM PermissionItem WHERE PermGroupID = ?");
+ stmt.bind(1, GroupID);
+ stmt.exec();
+ }
+
+ // Remove the group from all ranks that contain it:
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM RankPermGroup WHERE PermGroupID = ?");
+ stmt.bind(1, GroupID);
+ stmt.exec();
+ }
+
+ // Remove the group itself:
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM PermGroup WHERE PermGroupID = ?");
+ stmt.bind(1, GroupID);
+ stmt.exec();
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to remove group %s from DB: %s", __FUNCTION__, a_GroupName.c_str(), ex.what());
+ }
+}
+
+
+
+
+
+void cRankManager::RemoveGroupFromRank(const AString & a_GroupName, const AString & a_RankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Get the IDs of the group and the rank:
+ int GroupID, RankID;
+ {
+ SQLite::Statement stmt(m_DB,
+ "SELECT PermGroup.PermGroupID, Rank.RankID FROM PermGroup "
+ "LEFT JOIN RankPermGroup ON RankPermGroup.PermGroupID = PermGroup.PermGroupID "
+ "LEFT JOIN Rank ON Rank.RankID = RankPermGroup.RankID "
+ "WHERE PermGroup.Name = ? AND Rank.Name = ?"
+ );
+ stmt.bind(1, a_GroupName);
+ stmt.bind(2, a_RankName);
+ if (!stmt.executeStep())
+ {
+ LOGINFO("%s: Group %s was not found in rank %s, skipping.", __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str());
+ return;
+ }
+ GroupID = stmt.getColumn(0).getInt();
+ RankID = stmt.getColumn(1).getInt();
+ }
+
+ // Remove the group from all ranks that contain it:
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM RankPermGroup WHERE PermGroupID = ?");
+ stmt.bind(1, GroupID);
+ stmt.exec();
+ }
+
+ // Remove the group-to-rank binding:
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM RankPermGroup WHERE PermGroupID = ? AND RankID = ?");
+ stmt.bind(1, GroupID);
+ stmt.bind(1, RankID);
+ stmt.exec();
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to remove group %s from rank %s in the DB: %s", __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str(), ex.what());
+ }
+}
+
+
+
+
+
+void cRankManager::RemovePermissionFromGroup(const AString & a_Permission, const AString & a_GroupName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Get the ID of the group:
+ int GroupID;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, a_GroupName);
+ if (!stmt.executeStep())
+ {
+ LOGINFO("%s: Group %s was not found, skipping.", __FUNCTION__, a_GroupName.c_str());
+ return;
+ }
+ GroupID = stmt.getColumn(0).getInt();
+ }
+
+ // Remove the permission from the group:
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM PermissionItem WHERE PermGroupID = ? AND Permission = ?");
+ stmt.bind(1, GroupID);
+ stmt.bind(2, a_Permission);
+ stmt.exec();
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to remove permission %s from group %s in DB: %s",
+ __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str(), ex.what()
+ );
+ }
+}
+
+
+
+
+
+bool cRankManager::RenameRank(const AString & a_OldName, const AString & a_NewName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Check that NewName doesn't exist:
+ {
+ SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_NewName);
+ if (stmt.executeStep())
+ {
+ LOGINFO("%s: Rank %s is already present, cannot rename %s", __FUNCTION__, a_NewName.c_str(), a_OldName.c_str());
+ return false;
+ }
+ }
+
+ // Rename:
+ {
+ SQLite::Statement stmt(m_DB, "UPDATE Rank SET Name = ? WHERE Name = ?");
+ stmt.bind(1, a_NewName);
+ stmt.bind(2, a_OldName);
+ if (stmt.exec() <= 0)
+ {
+ LOGINFO("%s: There is no rank %s, cannot rename to %s.", __FUNCTION__, a_OldName.c_str(), a_NewName.c_str());
+ return false;
+ }
+ }
+
+ // Update the default rank, if it was the one being renamed:
+ if (a_OldName == m_DefaultRank)
+ {
+ m_DefaultRank = a_NewName;
+ }
+
+ return true;
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to rename rank %s to %s in DB: %s",
+ __FUNCTION__, a_OldName.c_str(), a_NewName.c_str(), ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+bool cRankManager::RenameGroup(const AString & a_OldName, const AString & a_NewName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Check that NewName doesn't exist:
+ {
+ SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, a_NewName);
+ if (stmt.executeStep())
+ {
+ LOGD("%s: Group %s is already present, cannot rename %s", __FUNCTION__, a_NewName.c_str(), a_OldName.c_str());
+ return false;
+ }
+ }
+
+ // Rename:
+ bool res;
+ {
+ SQLite::Statement stmt(m_DB, "UPDATE PermGroup SET Name = ? WHERE Name = ?");
+ stmt.bind(1, a_NewName);
+ stmt.bind(2, a_OldName);
+ res = (stmt.exec() > 0);
+ }
+
+ return res;
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to rename group %s to %s in DB: %s",
+ __FUNCTION__, a_OldName.c_str(), a_NewName.c_str(), ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+void cRankManager::SetPlayerRank(const AString & a_PlayerUUID, const AString & a_PlayerName, const AString & a_RankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Get the rank ID:
+ int RankID;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_RankName);
+ if (!stmt.executeStep())
+ {
+ LOGWARNING("%s: There is no rank %s, aborting.", __FUNCTION__, a_RankName.c_str());
+ return;
+ }
+ RankID = stmt.getColumn(0).getInt();
+ }
+
+ // Update the player's rank, if already in DB:
+ {
+ SQLite::Statement stmt(m_DB, "UPDATE PlayerRank SET RankID = ?, PlayerName = ? WHERE PlayerUUID = ?");
+ stmt.bind(1, RankID);
+ stmt.bind(2, a_PlayerName);
+ stmt.bind(3, a_PlayerUUID);
+ if (stmt.exec() > 0)
+ {
+ // Successfully updated the player's rank
+ return;
+ }
+ }
+
+ // The player is not yet in the DB, add them:
+ SQLite::Statement stmt(m_DB, "INSERT INTO PlayerRank (RankID, PlayerUUID, PlayerName) VALUES (?, ?, ?)");
+ stmt.bind(1, RankID);
+ stmt.bind(2, a_PlayerUUID);
+ stmt.bind(3, a_PlayerName);
+ if (stmt.exec() > 0)
+ {
+ // Successfully added the player
+ return;
+ }
+
+ LOGWARNING("%s: Failed to set player UUID %s to rank %s.",
+ __FUNCTION__, a_PlayerUUID.c_str(), a_RankName.c_str()
+ );
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to set player UUID %s to rank %s: %s",
+ __FUNCTION__, a_PlayerUUID.c_str(), a_RankName.c_str(), ex.what()
+ );
+ }
+}
+
+
+
+
+
+void cRankManager::RemovePlayerRank(const AString & a_PlayerUUID)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB, "DELETE FROM PlayerRank WHERE PlayerUUID = ?");
+ stmt.bind(1, a_PlayerUUID);
+ stmt.exec();
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to remove rank from player UUID %s: %s",
+ __FUNCTION__, a_PlayerUUID.c_str(), ex.what()
+ );
+ }
+}
+
+
+
+
+
+void cRankManager::SetRankVisuals(
+ const AString & a_RankName,
+ const AString & a_MsgPrefix,
+ const AString & a_MsgSuffix,
+ const AString & a_MsgNameColorCode
+)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB, "UPDATE Rank SET MsgPrefix = ?, MsgSuffix = ?, MsgNameColorCode = ? WHERE Name = ?");
+ stmt.bind(1, a_MsgPrefix);
+ stmt.bind(2, a_MsgSuffix);
+ stmt.bind(3, a_MsgNameColorCode);
+ stmt.bind(4, a_RankName);
+ if (!stmt.executeStep())
+ {
+ LOGINFO("%s: Rank %s not found, visuals not set.", __FUNCTION__, a_RankName.c_str());
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to get ranks from DB: %s", __FUNCTION__, ex.what());
+ }
+}
+
+
+
+
+
+bool cRankManager::GetRankVisuals(
+ const AString & a_RankName,
+ AString & a_MsgPrefix,
+ AString & a_MsgSuffix,
+ AString & a_MsgNameColorCode
+)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT MsgPrefix, MsgSuffix, MsgNameColorCode FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_RankName);
+ if (!stmt.executeStep())
+ {
+ // Rank not found
+ return false;
+ }
+ a_MsgPrefix = stmt.getColumn(0).getText();
+ a_MsgSuffix = stmt.getColumn(1).getText();
+ a_MsgNameColorCode = stmt.getColumn(2).getText();
+ return true;
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to get ranks from DB: %s", __FUNCTION__, ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+bool cRankManager::RankExists(const AString & a_RankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT * FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_RankName);
+ if (stmt.executeStep())
+ {
+ // The rank was found
+ return true;
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to query DB for rank %s: %s", __FUNCTION__, a_RankName.c_str(), ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+bool cRankManager::GroupExists(const AString & a_GroupName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT * FROM PermGroup WHERE Name = ?");
+ stmt.bind(1, a_GroupName);
+ if (stmt.executeStep())
+ {
+ // The group was found
+ return true;
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to query DB for group %s: %s", __FUNCTION__, a_GroupName.c_str(), ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+bool cRankManager::IsPlayerRankSet(const AString & a_PlayerUUID)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT * FROM PlayerRank WHERE PlayerUUID = ?");
+ stmt.bind(1, a_PlayerUUID);
+ if (stmt.executeStep())
+ {
+ // The player UUID was found, they have a rank
+ return true;
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to query DB for player UUID %s: %s", __FUNCTION__, a_PlayerUUID.c_str(), ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+bool cRankManager::IsGroupInRank(const AString & a_GroupName, const AString & a_RankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB,
+ "SELECT * FROM Rank "
+ "LEFT JOIN RankPermGroup ON Rank.RankID = RankPermGroup.RankID "
+ "LEFT JOIN PermGroup ON PermGroup.PermGroupID = RankPermGroup.PermGroupID "
+ "WHERE Rank.Name = ? AND PermGroup.Name = ?"
+ );
+ stmt.bind(1, a_RankName);
+ stmt.bind(2, a_GroupName);
+ if (stmt.executeStep())
+ {
+ // The group is in the rank
+ return true;
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to query DB: %s", __FUNCTION__, ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+bool cRankManager::IsPermissionInGroup(const AString & a_Permission, const AString & a_GroupName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB,
+ "SELECT * FROM PermissionItem "
+ "LEFT JOIN PermGroup ON PermGroup.PermGroupID = PermissionItem.PermGroupID "
+ "WHERE PermissionItem.Permission = ? AND PermGroup.Name = ?"
+ );
+ stmt.bind(1, a_Permission);
+ stmt.bind(2, a_GroupName);
+ if (stmt.executeStep())
+ {
+ // The permission is in the group
+ return true;
+ }
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to query DB: %s", __FUNCTION__, ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+void cRankManager::NotifyNameUUID(const AString & a_PlayerName, const AString & a_UUID)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ SQLite::Statement stmt(m_DB, "UPDATE PlayerRank SET PlayerName = ? WHERE PlayerUUID = ?");
+ stmt.bind(1, a_PlayerName);
+ stmt.bind(2, a_UUID);
+ stmt.exec();
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to update DB: %s", __FUNCTION__, ex.what());
+ }
+}
+
+
+
+
+
+bool cRankManager::SetDefaultRank(const AString & a_RankName)
+{
+ ASSERT(m_IsInitialized);
+ cCSLock Lock(m_CS);
+
+ try
+ {
+ // Find the rank's ID:
+ int RankID = 0;
+ {
+ SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?");
+ stmt.bind(1, a_RankName);
+ if (!stmt.executeStep())
+ {
+ LOGINFO("%s: Cannot set rank %s as the default, it does not exist.", __FUNCTION__, a_RankName.c_str());
+ return false;
+ }
+ }
+
+ // Set the rank as the default:
+ {
+ SQLite::Statement stmt(m_DB, "UPDATE DefaultRank SET RankID = ?");
+ stmt.bind(1, RankID);
+ if (stmt.exec() < 1)
+ {
+ // Failed to update, there might be none in the DB, try inserting:
+ SQLite::Statement stmt2(m_DB, "INSERT INTO DefaultRank (RankID) VALUES (?)");
+ stmt2.bind(1, RankID);
+ if (stmt2.exec() < 1)
+ {
+ LOGINFO("%s: Cannot update the default rank in the DB to %s.", __FUNCTION__, a_RankName.c_str());
+ return false;
+ }
+ }
+ }
+
+ // Set the internal cache:
+ m_DefaultRank = a_RankName;
+ return true;
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to update DB: %s", __FUNCTION__, ex.what());
+ return false;
+ }
+}
+
+
+
+
+
+bool cRankManager::AreDBTablesEmpty(void)
+{
+ return (
+ IsDBTableEmpty("Rank") &&
+ IsDBTableEmpty("PlayerRank") &&
+ IsDBTableEmpty("PermGroup") &&
+ IsDBTableEmpty("RankPermGroup") &&
+ IsDBTableEmpty("PermissionItem") &&
+ IsDBTableEmpty("DefaultRank")
+ );
+}
+
+
+
+
+
+bool cRankManager::IsDBTableEmpty(const AString & a_TableName)
+{
+ try
+ {
+ SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM " + a_TableName);
+ return (stmt.executeStep() && (stmt.getColumn(0).getInt() == 0));
+ }
+ catch (const SQLite::Exception & ex)
+ {
+ LOGWARNING("%s: Failed to query DB: %s", __FUNCTION__, ex.what());
+ }
+ return false;
+}
+
+
+
+
+
+void cRankManager::CreateDefaults(void)
+{
+ // Wrap everything in a big transaction to speed things up:
+ cMassChangeLock Lock(*this);
+
+ // Create ranks:
+ AddRank("Default", "", "", "");
+ AddRank("VIP", "", "", "");
+ AddRank("Operator", "", "", "");
+ AddRank("Admin", "", "", "");
+
+ // Create groups:
+ AddGroup("Default");
+ AddGroup("Kick");
+ AddGroup("Teleport");
+ AddGroup("Everything");
+
+ // Add groups to ranks:
+ AddGroupToRank("Default", "Default");
+ AddGroupToRank("Teleport", "VIP");
+ AddGroupToRank("Teleport", "Operator");
+ AddGroupToRank("Kick", "Operator");
+ AddGroupToRank("Everything", "Admin");
+
+ // Add permissions to groups:
+ AddPermissionToGroup("core.build", "Default");
+ AddPermissionToGroup("core.tp", "Teleport");
+ AddPermissionToGroup("core.kick", "Kick");
+ AddPermissionToGroup("*", "Everything");
+
+ // Set the default rank:
+ SetDefaultRank("Default");
+}
+
+
+
+
diff --git a/src/RankManager.h b/src/RankManager.h
new file mode 100644
index 000000000..f364bba6a
--- /dev/null
+++ b/src/RankManager.h
@@ -0,0 +1,246 @@
+
+// RankManager.h
+
+// Declares the cRankManager class that represents the rank manager responsible for assigning permissions and message visuals to players
+
+
+
+
+#pragma once
+
+#include "SQLiteCpp/Database.h"
+#include "SQLiteCpp/Transaction.h"
+
+
+
+
+
+class cMojangAPI;
+
+
+
+
+
+class cRankManager
+{
+public:
+ /** Acquire this lock to perform mass changes.
+ Improves performance by wrapping everything into a transaction.
+ Makes sure that no other thread is accessing the DB. */
+ class cMassChangeLock
+ {
+ public:
+ cMassChangeLock(cRankManager & a_RankManager) :
+ m_Lock(a_RankManager.m_CS),
+ m_Transaction(a_RankManager.m_DB)
+ {
+ }
+
+ ~cMassChangeLock()
+ {
+ m_Transaction.commit();
+ }
+
+ protected:
+ cCSLock m_Lock;
+ SQLite::Transaction m_Transaction;
+ };
+
+
+ /** Creates the rank manager. Needs to be initialized before other use. */
+ cRankManager(void);
+
+ ~cRankManager();
+
+ /** Initializes the rank manager. Performs migration and default-setting if no data is found in the DB.
+ The a_MojangAPI param is used when migrating from old ini files, to look up player UUIDs. */
+ void Initialize(cMojangAPI & a_MojangAPI);
+
+ /** Returns the name of the rank that the specified player has assigned to them.
+ If the player has no rank assigned, returns an empty string (NOT the default rank). */
+ AString GetPlayerRankName(const AString & a_PlayerUUID);
+
+ /** Returns the names of Groups that the specified player has assigned to them. */
+ AStringVector GetPlayerGroups(const AString & a_PlayerUUID);
+
+ /** Returns the permissions that the specified player has assigned to them.
+ If the player has no rank assigned to them, returns the default rank's permissions. */
+ AStringVector GetPlayerPermissions(const AString & a_PlayerUUID);
+
+ /** Returns the names of groups that the specified rank has assigned to it.
+ Returns an empty vector if the rank doesn't exist. */
+ AStringVector GetRankGroups(const AString & a_RankName);
+
+ /** Returns the permissions that the specified group has assigned to it.
+ Returns an empty vector if the group doesn't exist. */
+ AStringVector GetGroupPermissions(const AString & a_GroupName);
+
+ /** Returns all permissions that the specified rank has assigned to it, through all its groups.
+ Returns an empty vector if the rank doesn't exist. Any non-existent groups are ignored. */
+ AStringVector GetRankPermissions(const AString & a_RankName);
+
+ /** Returns the names of all defined ranks. */
+ AStringVector GetAllRanks(void);
+
+ /** Returns the names of all permission groups. */
+ AStringVector GetAllGroups(void);
+
+ /** Returns all the distinct permissions that are stored in the DB. */
+ AStringVector GetAllPermissions(void);
+
+ /** Returns the message visuals (prefix, postfix, color) for the specified player.
+ Returns true if the visuals were read from the DB, false if not (player not found etc). */
+ bool GetPlayerMsgVisuals(
+ const AString & a_PlayerUUID,
+ AString & a_MsgPrefix,
+ AString & a_MsgSuffix,
+ AString & a_MsgNameColorCode
+ );
+
+ /** Adds a new rank. No action if the rank already exists. */
+ void AddRank(
+ const AString & a_RankName,
+ const AString & a_MsgPrefix,
+ const AString & a_MsgSuffix,
+ const AString & a_MsgNameColorCode
+ );
+
+ /** Adds a new permission group. No action if such a group already exists. */
+ void AddGroup(const AString & a_GroupName);
+
+ /** Bulk-adds groups. Group names that already exist are silently skipped. */
+ void AddGroups(const AStringVector & a_GroupNames);
+
+ /** Adds the specified permission group to the specified rank.
+ Fails if the rank or group names are not found.
+ Returns true if successful, false on error. */
+ bool AddGroupToRank(const AString & a_GroupName, const AString & a_RankName);
+
+ /** Adds the specified permission to the specified permission group.
+ Fails if the permission group name is not found.
+ Returns true if successful, false on error. */
+ bool AddPermissionToGroup(const AString & a_Permission, const AString & a_GroupName);
+
+ /** Adds the specified permissions to the specified permission group.
+ Fails if the permission group name is not found.
+ Returns true if successful, false on error. */
+ bool AddPermissionsToGroup(const AStringVector & a_Permissions, const AString & a_GroupName);
+
+ /** Removes the specified rank.
+ All players assigned to that rank will be re-assigned to a_ReplacementRankName.
+ If a_ReplacementRankName is empty or not a valid rank, the player will be removed from the DB,
+ which means they will receive the default rank the next time they are queried.
+ If the rank being removed is the default rank, the default will be changed to the replacement
+ rank; the operation fails if there's no replacement. */
+ void RemoveRank(const AString & a_RankName, const AString & a_ReplacementRankName);
+
+ /** Removes the specified group completely.
+ The group will first be removed from all ranks using it, and then removed itself. */
+ void RemoveGroup(const AString & a_GroupName);
+
+ /** Removes the specified group from the specified rank.
+ The group will stay defined, even if no rank is using it. */
+ void RemoveGroupFromRank(const AString & a_GroupName, const AString & a_RankName);
+
+ /** Removes the specified permission from the specified group. */
+ void RemovePermissionFromGroup(const AString & a_Permission, const AString & a_GroupName);
+
+ /** Renames the specified rank. No action if the rank name is not found.
+ Fails if the new name is already used.
+ Updates the cached m_DefaultRank if the default rank is being renamed.
+ Returns true on success, false on failure. */
+ bool RenameRank(const AString & a_OldName, const AString & a_NewName);
+
+ /** Renames the specified group. No action if the rank name is not found.
+ Fails if the new name is already used.
+ Returns true on success, false on failure. */
+ bool RenameGroup(const AString & a_OldName, const AString & a_NewName);
+
+ /** Sets the specified player's rank.
+ If the player already had rank assigned to them, it is overwritten with the new rank and name.
+ Note that this doesn't change the cPlayer if the player is already connected, you need to update all the
+ cPlayer instances manually.
+ The PlayerName is provided for reference, so that GetRankPlayerNames() can work. */
+ void SetPlayerRank(const AString & a_PlayerUUID, const AString & a_PlayerName, const AString & a_RankName);
+
+ /** Removes the player's rank assignment. The player is left without a rank.
+ Note that this doesn't change the cPlayer instances for the already connected players, you need to update
+ all the instances manually.
+ No action if the player has no rank assigned to them already. */
+ void RemovePlayerRank(const AString & a_PlayerUUID);
+
+ /** Sets the message visuals of an existing rank. No action if the rank name is not found. */
+ void SetRankVisuals(
+ const AString & a_RankName,
+ const AString & a_MsgPrefix,
+ const AString & a_MsgSuffix,
+ const AString & a_MsgNameColorCode
+ );
+
+ /** Returns the message visuals of an existing rank.
+ Returns true if successful, false on error (rank doesn't exist). */
+ bool GetRankVisuals(
+ const AString & a_RankName,
+ AString & a_MsgPrefix,
+ AString & a_MsgSuffix,
+ AString & a_MsgNameColorCode
+ );
+
+ /** Returns true iff the specified rank exists in the DB. */
+ bool RankExists(const AString & a_RankName);
+
+ /** Returns true iff the specified group exists in the DB. */
+ bool GroupExists(const AString & a_GroupName);
+
+ /** Returns true iff the specified player has a rank assigned to them in the DB. */
+ bool IsPlayerRankSet(const AString & a_PlayerUUID);
+
+ /** Returns true iff the specified rank contains the specified group. */
+ bool IsGroupInRank(const AString & a_GroupName, const AString & a_RankName);
+
+ /** Returns true iff the specified group contains the specified permission. */
+ bool IsPermissionInGroup(const AString & a_Permission, const AString & a_GroupName);
+
+ /** Called by cMojangAPI whenever the playername-uuid pairing is discovered. Updates the DB. */
+ void NotifyNameUUID(const AString & a_PlayerName, const AString & a_UUID);
+
+ /** Sets the specified rank as the default rank.
+ Returns true on success, false on failure (rank not found). */
+ bool SetDefaultRank(const AString & a_RankName);
+
+ /** Returns the name of the default rank. */
+ const AString & GetDefaultRank(void) const { return m_DefaultRank; }
+
+protected:
+
+ /** The database storage for all the data. Protected by m_CS. */
+ SQLite::Database m_DB;
+
+ /** The name of the default rank. Kept as a cache so that queries for it don't need to go through the DB. */
+ AString m_DefaultRank;
+
+ /** The mutex protecting m_DB and m_DefaultRank against multi-threaded access. */
+ cCriticalSection m_CS;
+
+ /** Set to true once the manager is initialized. */
+ bool m_IsInitialized;
+
+ /** The MojangAPI instance that is used for translating playernames to UUIDs.
+ Set in Initialize(), may be NULL. */
+ cMojangAPI * m_MojangAPI;
+
+
+ /** Returns true if all the DB tables are empty, indicating a fresh new install. */
+ bool AreDBTablesEmpty(void);
+
+ /** Returns true iff the specified DB table is empty.
+ If there's an error while querying, returns false. */
+ bool IsDBTableEmpty(const AString & a_TableName);
+
+ /** Creates a default set of ranks / groups / permissions. */
+ void CreateDefaults(void);
+} ;
+
+
+
+
diff --git a/src/Root.cpp b/src/Root.cpp
index ee0d9b835..f04cbf08b 100644
--- a/src/Root.cpp
+++ b/src/Root.cpp
@@ -6,7 +6,6 @@
#include "World.h"
#include "WebAdmin.h"
#include "FurnaceRecipe.h"
-#include "GroupManager.h"
#include "CraftingRecipes.h"
#include "Bindings/PluginManager.h"
#include "MonsterConfig.h"
@@ -47,7 +46,6 @@ cRoot::cRoot(void) :
m_InputThread(NULL),
m_Server(NULL),
m_MonsterConfig(NULL),
- m_GroupManager(NULL),
m_CraftingRecipes(NULL),
m_FurnaceRecipe(NULL),
m_WebAdmin(NULL),
@@ -161,7 +159,7 @@ void cRoot::Start(void)
m_WebAdmin->Init();
LOGD("Loading settings...");
- m_GroupManager = new cGroupManager();
+ m_RankManager.Initialize(m_MojangAPI);
m_CraftingRecipes = new cCraftingRecipes;
m_FurnaceRecipe = new cFurnaceRecipe();
@@ -240,8 +238,6 @@ void cRoot::Start(void)
LOGD("Unloading recipes...");
delete m_FurnaceRecipe; m_FurnaceRecipe = NULL;
delete m_CraftingRecipes; m_CraftingRecipes = NULL;
- LOGD("Forgetting groups...");
- delete m_GroupManager; m_GroupManager = NULL;
LOGD("Unloading worlds...");
UnloadWorlds();
@@ -472,16 +468,6 @@ void cRoot::QueueExecuteConsoleCommand(const AString & a_Cmd, cCommandOutputCall
void cRoot::QueueExecuteConsoleCommand(const AString & a_Cmd)
{
- // Some commands are built-in:
- if (a_Cmd == "stop")
- {
- m_bStop = true;
- }
- else if (a_Cmd == "restart")
- {
- m_bRestart = true;
- }
-
// Put the command into a queue (Alleviates FS #363):
cCSLock Lock(m_CSPendingCommands);
m_PendingCommands.push_back(cCommand(a_Cmd, new cLogCommandDeleteSelfOutputCallback));
@@ -493,14 +479,16 @@ void cRoot::QueueExecuteConsoleCommand(const AString & a_Cmd)
void cRoot::ExecuteConsoleCommand(const AString & a_Cmd, cCommandOutputCallback & a_Output)
{
- // Some commands are built-in:
+ // cRoot handles stopping and restarting due to our access to controlling variables
if (a_Cmd == "stop")
{
m_bStop = true;
+ return;
}
else if (a_Cmd == "restart")
{
m_bRestart = true;
+ return;
}
LOG("Executing console command: \"%s\"", a_Cmd.c_str());
@@ -555,17 +543,6 @@ void cRoot::SaveAllChunks(void)
-void cRoot::ReloadGroups(void)
-{
- LOG("Reload groups ...");
- m_GroupManager->LoadGroups();
- m_GroupManager->CheckUsers();
-}
-
-
-
-
-
void cRoot::BroadcastChat(const AString & a_Message, eMessageType a_ChatPrefix)
{
for (WorldMap::iterator itr = m_WorldsByName.begin(), end = m_WorldsByName.end(); itr != end; ++itr)
diff --git a/src/Root.h b/src/Root.h
index 6840efcbe..9bc975889 100644
--- a/src/Root.h
+++ b/src/Root.h
@@ -5,6 +5,7 @@
#include "Protocol/MojangAPI.h"
#include "HTTPServer/HTTPServer.h"
#include "Defines.h"
+#include "RankManager.h"
@@ -13,7 +14,6 @@
// fwd:
class cThread;
class cMonsterConfig;
-class cGroupManager;
class cCraftingRecipes;
class cFurnaceRecipe;
class cWebAdmin;
@@ -78,7 +78,6 @@ public:
cMonsterConfig * GetMonsterConfig(void) { return m_MonsterConfig; }
- cGroupManager * GetGroupManager (void) { return m_GroupManager; } // tolua_export
cCraftingRecipes * GetCraftingRecipes(void) { return m_CraftingRecipes; } // tolua_export
cFurnaceRecipe * GetFurnaceRecipe (void) { return m_FurnaceRecipe; } // Exported in ManualBindings.cpp with quite a different signature
@@ -89,6 +88,7 @@ public:
cPluginManager * GetPluginManager (void) { return m_PluginManager; } // tolua_export
cAuthenticator & GetAuthenticator (void) { return m_Authenticator; }
cMojangAPI & GetMojangAPI (void) { return m_MojangAPI; }
+ cRankManager & GetRankManager (void) { return m_RankManager; }
/** Queues a console command for execution through the cServer class.
The command will be executed in the tick thread
@@ -122,9 +122,6 @@ public:
/// Saves all chunks in all worlds
void SaveAllChunks(void); // tolua_export
- /// Reloads all the groups
- void ReloadGroups(void); // tolua_export
-
/// Calls the callback for each player in all worlds
bool ForEachPlayer(cPlayerListCallback & a_Callback); // >> EXPORTED IN MANUALBINDINGS <<
@@ -187,13 +184,13 @@ private:
cServer * m_Server;
cMonsterConfig * m_MonsterConfig;
- cGroupManager * m_GroupManager;
cCraftingRecipes * m_CraftingRecipes;
cFurnaceRecipe * m_FurnaceRecipe;
cWebAdmin * m_WebAdmin;
cPluginManager * m_PluginManager;
cAuthenticator m_Authenticator;
cMojangAPI m_MojangAPI;
+ cRankManager m_RankManager;
cHTTPServer m_HTTPServer;
bool m_bStop;
diff --git a/src/Server.cpp b/src/Server.cpp
index 42ad133f1..069e2a169 100644
--- a/src/Server.cpp
+++ b/src/Server.cpp
@@ -11,7 +11,6 @@
#include "World.h"
#include "ChunkDef.h"
#include "Bindings/PluginManager.h"
-#include "GroupManager.h"
#include "ChatColor.h"
#include "Entities/Player.h"
#include "Inventory.h"
@@ -117,7 +116,9 @@ cServer::cServer(void) :
m_MaxPlayers(0),
m_bIsHardcore(false),
m_TickThread(*this),
- m_ShouldAuthenticate(false)
+ m_ShouldAuthenticate(false),
+ m_ShouldLoadOfflinePlayerData(false),
+ m_ShouldLoadNamedPlayerData(true)
{
}
@@ -457,83 +458,98 @@ void cServer::ExecuteConsoleCommand(const AString & a_Cmd, cCommandOutputCallbac
return;
}
- // Special handling: "stop" and "restart" are built in
- if ((split[0].compare("stop") == 0) || (split[0].compare("restart") == 0))
- {
- return;
- }
+ // "stop" and "restart" are handled in cRoot::ExecuteConsoleCommand, our caller, due to its access to controlling variables
// "help" and "reload" are to be handled by MCS, so that they work no matter what
if (split[0] == "help")
{
PrintHelp(split, a_Output);
+ a_Output.Finished();
return;
}
- if (split[0] == "reload")
+ else if (split[0] == "reload")
{
cPluginManager::Get()->ReloadPlugins();
- cRoot::Get()->ReloadGroups();
+ a_Output.Finished();
return;
}
- if (split[0] == "reloadplugins")
+ else if (split[0] == "reloadplugins")
{
cPluginManager::Get()->ReloadPlugins();
- return;
- }
- if (split[0] == "reloadgroups")
- {
- cRoot::Get()->ReloadGroups();
- a_Output.Out("Groups reloaded!");
+ a_Output.Out("Plugins reloaded");
a_Output.Finished();
return;
}
- if (split[0] == "load")
+ else if (split[0] == "load")
{
if (split.size() > 1)
{
- cPluginManager::Get()->LoadPlugin(split[1]);
-
- return;
+ a_Output.Out(cPluginManager::Get()->LoadPlugin(split[1]) ? "Plugin loaded" : "Error occurred loading plugin");
}
else
{
- a_Output.Out("No plugin given! Command: load <pluginname>");
- a_Output.Finished();
- return;
+ a_Output.Out("Usage: load <pluginname>");
}
+ a_Output.Finished();
+ return;
}
-
- if (split[0] == "unload")
+ else if (split[0] == "unload")
{
if (split.size() > 1)
{
cPluginManager::Get()->RemovePlugin(cPluginManager::Get()->GetPlugin(split[1]));
- return;
+ a_Output.Out("Plugin unloaded");
}
else
{
- a_Output.Out("No plugin given! Command: unload <pluginname>");
- a_Output.Finished();
- return;
+ a_Output.Out("Usage: unload <pluginname>");
}
+ a_Output.Finished();
+ return;
+ }
+ if (split[0] == "destroyentities")
+ {
+ class WorldCallback : public cWorldListCallback
+ {
+ virtual bool Item(cWorld * a_World) override
+ {
+ class EntityCallback : public cEntityCallback
+ {
+ virtual bool Item(cEntity * a_Entity) override
+ {
+ if (!a_Entity->IsPlayer())
+ {
+ a_Entity->Destroy();
+ }
+ return false;
+ }
+ } EC;
+ a_World->ForEachEntity(EC);
+ return false;
+ }
+ } WC;
+ cRoot::Get()->ForEachWorld(WC);
+ a_Output.Out("Destroyed all entities");
+ a_Output.Finished();
+ return;
}
// There is currently no way a plugin can do these (and probably won't ever be):
- if (split[0].compare("chunkstats") == 0)
+ else if (split[0].compare("chunkstats") == 0)
{
cRoot::Get()->LogChunkStats(a_Output);
a_Output.Finished();
return;
}
#if defined(_MSC_VER) && defined(_DEBUG) && defined(ENABLE_LEAK_FINDER)
- if (split[0].compare("dumpmem") == 0)
+ else if (split[0].compare("dumpmem") == 0)
{
LeakFinderXmlOutput Output("memdump.xml");
DumpUsedMemory(&Output);
return;
}
- if (split[0].compare("killmem") == 0)
+ else if (split[0].compare("killmem") == 0)
{
for (;;)
{
@@ -542,7 +558,7 @@ void cServer::ExecuteConsoleCommand(const AString & a_Cmd, cCommandOutputCallbac
}
#endif
- if (cPluginManager::Get()->ExecuteConsoleCommand(split, a_Output))
+ else if (cPluginManager::Get()->ExecuteConsoleCommand(split, a_Output))
{
a_Output.Finished();
return;
@@ -610,6 +626,7 @@ void cServer::BindBuiltInConsoleCommands(void)
PlgMgr->BindConsoleCommand("chunkstats", NULL, " - Displays detailed chunk memory statistics");
PlgMgr->BindConsoleCommand("load <pluginname>", NULL, " - Adds and enables the specified plugin");
PlgMgr->BindConsoleCommand("unload <pluginname>", NULL, " - Disables the specified plugin");
+ PlgMgr->BindConsoleCommand("destroyentities", NULL, " - Destroys all entities in all worlds");
#if defined(_MSC_VER) && defined(_DEBUG) && defined(ENABLE_LEAK_FINDER)
PlgMgr->BindConsoleCommand("dumpmem", NULL, " - Dumps all used memory blocks together with their callstacks into memdump.xml");
diff --git a/src/Server.h b/src/Server.h
index c1640b388..f20e6932f 100644
--- a/src/Server.h
+++ b/src/Server.h
@@ -120,7 +120,7 @@ public: // tolua_export
const AString & GetPublicKeyDER(void) const { return m_PublicKeyDER; }
/** Returns true if authentication has been turned on in server settings. */
- bool ShouldAuthenticate(void) const { return m_ShouldAuthenticate; }
+ bool ShouldAuthenticate(void) const { return m_ShouldAuthenticate; } // tolua_export
/** Returns true if offline UUIDs should be used to load data for players whose normal UUIDs cannot be found.
Loaded from the settings.ini [PlayerData].LoadOfflinePlayerData setting. */
diff --git a/src/SetChunkData.cpp b/src/SetChunkData.cpp
index 6e0c2733e..bfe59fbcb 100644
--- a/src/SetChunkData.cpp
+++ b/src/SetChunkData.cpp
@@ -5,6 +5,7 @@
#include "Globals.h"
#include "SetChunkData.h"
+#include "BlockEntities/BlockEntity.h"
@@ -13,6 +14,9 @@
cSetChunkData::cSetChunkData(int a_ChunkX, int a_ChunkZ, bool a_ShouldMarkDirty) :
m_ChunkX(a_ChunkX),
m_ChunkZ(a_ChunkZ),
+ m_IsLightValid(false),
+ m_IsHeightMapValid(false),
+ m_AreBiomesValid(false),
m_ShouldMarkDirty(a_ShouldMarkDirty)
{
}
@@ -113,3 +117,35 @@ void cSetChunkData::CalculateHeightMap(void)
+
+void cSetChunkData::RemoveInvalidBlockEntities(void)
+{
+ for (cBlockEntityList::iterator itr = m_BlockEntities.begin(); itr != m_BlockEntities.end();)
+ {
+ BLOCKTYPE EntityBlockType = (*itr)->GetBlockType();
+ BLOCKTYPE WorldBlockType = cChunkDef::GetBlock(m_BlockTypes, (*itr)->GetRelX(), (*itr)->GetPosY(), (*itr)->GetRelZ());
+ if (EntityBlockType != WorldBlockType)
+ {
+ // Bad blocktype, remove the block entity:
+ LOGD("Block entity blocktype mismatch at {%d, %d, %d}: entity for blocktype %s(%d) in block %s(%d). Deleting the block entity.",
+ (*itr)->GetPosX(), (*itr)->GetPosY(), (*itr)->GetPosZ(),
+ ItemTypeToString(EntityBlockType).c_str(), EntityBlockType,
+ ItemTypeToString(WorldBlockType).c_str(), WorldBlockType
+ );
+ cBlockEntityList::iterator itr2 = itr;
+ itr2++;
+ delete *itr;
+ m_BlockEntities.erase(itr);
+ itr = itr2;
+ }
+ else
+ {
+ // Good blocktype, keep the block entity:
+ ++itr;
+ }
+ } // for itr - m_BlockEntities[]
+}
+
+
+
+
diff --git a/src/SetChunkData.h b/src/SetChunkData.h
index a2f776f6b..03e9ef4d9 100644
--- a/src/SetChunkData.h
+++ b/src/SetChunkData.h
@@ -92,6 +92,9 @@ public:
/** Calculates the heightmap based on the contained blocktypes and marks it valid. */
void CalculateHeightMap(void);
+ /** Removes the block entities that don't have a proper blocktype at their corresponding coords. */
+ void RemoveInvalidBlockEntities(void);
+
protected:
int m_ChunkX;
int m_ChunkZ;
diff --git a/src/Simulator/VanillaFluidSimulator.cpp b/src/Simulator/VanillaFluidSimulator.cpp
index 18d9b07e1..6df75eebb 100644
--- a/src/Simulator/VanillaFluidSimulator.cpp
+++ b/src/Simulator/VanillaFluidSimulator.cpp
@@ -98,7 +98,7 @@ int cVanillaFluidSimulator::CalculateFlowCost(cChunk * a_Chunk, int a_RelX, int
}
// Check if block below is passable
- if (!a_Chunk->UnboundedRelGetBlock(a_RelX, a_RelY - 1, a_RelZ, BlockType, BlockMeta))
+ if ((a_RelY > 0) && !a_Chunk->UnboundedRelGetBlock(a_RelX, a_RelY - 1, a_RelZ, BlockType, BlockMeta))
{
return Cost;
}
diff --git a/src/StringUtils.h b/src/StringUtils.h
index 3d4379352..72a90a8c2 100644
--- a/src/StringUtils.h
+++ b/src/StringUtils.h
@@ -9,6 +9,7 @@
#pragma once
#include <string>
+#include <limits>
@@ -98,6 +99,68 @@ extern int GetBEInt(const char * a_Mem);
/// Writes four bytes to the specified memory location so that they interpret as BigEndian int
extern void SetBEInt(char * a_Mem, Int32 a_Value);
+/// Parses any integer type. Checks bounds and returns errors out of band.
+template <class T>
+bool StringToInteger(const AString & a_str, T & a_Num)
+{
+ size_t i = 0;
+ bool positive = true;
+ T result = 0;
+ if (a_str[0] == '+')
+ {
+ i++;
+ }
+ else if (a_str[0] == '-')
+ {
+ i++;
+ positive = false;
+ }
+ if (positive)
+ {
+ for (size_t size = a_str.size(); i < size; i++)
+ {
+ if ((a_str[i] < '0') || (a_str[i] > '9'))
+ {
+ return false;
+ }
+ if (std::numeric_limits<T>::max() / 10 < result)
+ {
+ return false;
+ }
+ result *= 10;
+ T digit = a_str[i] - '0';
+ if (std::numeric_limits<T>::max() - digit < result)
+ {
+ return false;
+ }
+ result += digit;
+ }
+ }
+ else
+ {
+ for (size_t size = a_str.size(); i < size; i++)
+ {
+ if ((a_str[i] < '0') || (a_str[i] > '9'))
+ {
+ return false;
+ }
+ if (std::numeric_limits<T>::min() / 10 > result)
+ {
+ return false;
+ }
+ result *= 10;
+ T digit = a_str[i] - '0';
+ if (std::numeric_limits<T>::min() + digit > result)
+ {
+ return false;
+ }
+ result -= digit;
+ }
+ }
+ a_Num = result;
+ return true;
+}
+
// If you have any other string helper functions, declare them here
diff --git a/src/World.cpp b/src/World.cpp
index b357b8a23..99e09c658 100644
--- a/src/World.cpp
+++ b/src/World.cpp
@@ -1,3 +1,4 @@
+
#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
#include "BlockID.h"
@@ -250,8 +251,38 @@ cWorld::cWorld(const AString & a_WorldName, eDimension a_Dimension, const AStrin
m_TimeOfDay(0),
m_LastTimeUpdate(0),
m_SkyDarkness(0),
+ m_GameMode(gmNotSet),
+ m_bEnabledPVP(false),
+ m_IsDeepSnowEnabled(false),
+ m_ShouldLavaSpawnFire(true),
+ m_VillagersShouldHarvestCrops(true),
+ m_SimulatorManager(NULL),
+ m_SandSimulator(NULL),
+ m_WaterSimulator(NULL),
+ m_LavaSimulator(NULL),
+ m_FireSimulator(NULL),
+ m_RedstoneSimulator(NULL),
+ m_MaxPlayers(10),
+ m_ChunkMap(NULL),
+ m_bAnimals(true),
m_Weather(eWeather_Sunny),
m_WeatherInterval(24000), // Guaranteed 1 day of sunshine at server start :)
+ m_MaxCactusHeight(3),
+ m_MaxSugarcaneHeight(4),
+ m_IsCactusBonemealable(false),
+ m_IsCarrotsBonemealable(true),
+ m_IsCropsBonemealable(true),
+ m_IsGrassBonemealable(true),
+ m_IsMelonStemBonemealable(true),
+ m_IsMelonBonemealable(true),
+ m_IsPotatoesBonemealable(true),
+ m_IsPumpkinStemBonemealable(true),
+ m_IsPumpkinBonemealable(true),
+ m_IsSaplingBonemealable(true),
+ m_IsSugarcaneBonemealable(false),
+ m_bCommandBlocksEnabled(true),
+ m_bUseChatPrefixes(false),
+ m_TNTShrapnelLevel(slNone),
m_Scoreboard(this),
m_MapManager(this),
m_GeneratorCallbacks(*this),
@@ -406,7 +437,7 @@ void cWorld::InitializeSpawn(void)
int ViewDist = IniFile.GetValueSetI("SpawnPosition", "PregenerateDistance", DefaultViewDist);
IniFile.WriteFile(m_IniFileName);
- LOG("Preparing spawn area in world \"%s\"...", m_WorldName.c_str());
+ LOG("Preparing spawn area in world \"%s\", %d x %d chunks, total %d chunks...", m_WorldName.c_str(), ViewDist, ViewDist, ViewDist * ViewDist);
for (int x = 0; x < ViewDist; x++)
{
for (int z = 0; z < ViewDist; z++)
@@ -1195,24 +1226,26 @@ void cWorld::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_Blo
return;
}
- // TODO: Add damage to entities and implement block hardiness
+ // TODO: Implement block hardiness
Vector3d explosion_pos = Vector3d(a_BlockX, a_BlockY, a_BlockZ);
cVector3iArray BlocksAffected;
m_ChunkMap->DoExplosionAt(a_ExplosionSize, a_BlockX, a_BlockY, a_BlockZ, BlocksAffected);
BroadcastSoundEffect("random.explode", (double)a_BlockX, (double)a_BlockY, (double)a_BlockZ, 1.0f, 0.6f);
+
{
cCSLock Lock(m_CSPlayers);
for (cPlayerList::iterator itr = m_Players.begin(); itr != m_Players.end(); ++itr)
{
cClientHandle * ch = (*itr)->GetClientHandle();
- if ((ch == NULL) || !ch->IsLoggedIn() || ch->IsDestroyed())
+ if (ch == NULL)
{
continue;
}
+
Vector3d distance_explosion = (*itr)->GetPosition() - explosion_pos;
if (distance_explosion.SqrLength() < 4096.0)
{
- double real_distance = std::max(0.004, sqrt(distance_explosion.SqrLength()));
+ double real_distance = std::max(0.004, distance_explosion.Length());
double power = a_ExplosionSize / real_distance;
if (power <= 1)
{
@@ -1224,6 +1257,7 @@ void cWorld::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_Blo
}
}
}
+
cPluginManager::Get()->CallHookExploded(*this, a_ExplosionSize, a_CanCauseFire, a_BlockX, a_BlockY, a_BlockZ, a_Source, a_SourceData);
}
@@ -3453,14 +3487,16 @@ void cWorld::cChunkGeneratorCallbacks::OnChunkGenerated(cChunkDesc & a_ChunkDesc
cChunkDef::BlockNibbles BlockMetas;
a_ChunkDesc.CompressBlockMetas(BlockMetas);
- m_World->QueueSetChunkData(cSetChunkDataPtr(new cSetChunkData(
+ cSetChunkDataPtr SetChunkData(new cSetChunkData(
a_ChunkDesc.GetChunkX(), a_ChunkDesc.GetChunkZ(),
a_ChunkDesc.GetBlockTypes(), BlockMetas,
NULL, NULL, // We don't have lighting, chunk will be lighted when needed
&a_ChunkDesc.GetHeightMap(), &a_ChunkDesc.GetBiomeMap(),
a_ChunkDesc.GetEntities(), a_ChunkDesc.GetBlockEntities(),
true
- )));
+ ));
+ SetChunkData->RemoveInvalidBlockEntities();
+ m_World->QueueSetChunkData(SetChunkData);
}
diff --git a/src/WorldStorage/FastNBT.h b/src/WorldStorage/FastNBT.h
index 4ef72e379..ebf99103f 100644
--- a/src/WorldStorage/FastNBT.h
+++ b/src/WorldStorage/FastNBT.h
@@ -76,7 +76,9 @@ public:
cFastNBTTag(eTagType a_Type, int a_Parent) :
m_Type(a_Type),
+ m_NameStart(0),
m_NameLength(0),
+ m_DataStart(0),
m_DataLength(0),
m_Parent(a_Parent),
m_PrevSibling(-1),
@@ -88,7 +90,9 @@ public:
cFastNBTTag(eTagType a_Type, int a_Parent, int a_PrevSibling) :
m_Type(a_Type),
+ m_NameStart(0),
m_NameLength(0),
+ m_DataStart(0),
m_DataLength(0),
m_Parent(a_Parent),
m_PrevSibling(a_PrevSibling),
diff --git a/src/WorldStorage/NBTChunkSerializer.cpp b/src/WorldStorage/NBTChunkSerializer.cpp
index e435a1b1f..68e541eba 100644
--- a/src/WorldStorage/NBTChunkSerializer.cpp
+++ b/src/WorldStorage/NBTChunkSerializer.cpp
@@ -615,7 +615,6 @@ void cNBTChunkSerializer::AddProjectileEntity(cProjectileEntity * a_Projectile)
{
m_Writer.BeginCompound("");
AddBasicEntity(a_Projectile, a_Projectile->GetMCAClassName());
- Vector3d Pos = a_Projectile->GetPosition();
m_Writer.AddByte("inGround", a_Projectile->IsInGround() ? 1 : 0);
switch (a_Projectile->GetProjectileKind())
diff --git a/src/WorldStorage/WSSAnvil.cpp b/src/WorldStorage/WSSAnvil.cpp
index a9c9ae4b5..e79cc291d 100644
--- a/src/WorldStorage/WSSAnvil.cpp
+++ b/src/WorldStorage/WSSAnvil.cpp
@@ -396,7 +396,7 @@ bool cWSSAnvil::LoadChunkFromNBT(const cChunkCoords & a_Chunk, const cParsedNBT
} // for y
//*/
- m_World->QueueSetChunkData(cSetChunkDataPtr(new cSetChunkData(
+ cSetChunkDataPtr SetChunkData(new cSetChunkData(
a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ,
BlockTypes, MetaData,
IsLightValid ? BlockLight : NULL,
@@ -404,7 +404,8 @@ bool cWSSAnvil::LoadChunkFromNBT(const cChunkCoords & a_Chunk, const cParsedNBT
NULL, Biomes,
Entities, BlockEntities,
false
- )));
+ ));
+ m_World->QueueSetChunkData(SetChunkData);
return true;
}
@@ -581,64 +582,28 @@ void cWSSAnvil::LoadBlockEntitiesFromNBT(cBlockEntityList & a_BlockEntities, con
{
continue;
}
- int sID = a_NBT.FindChildByName(Child, "id");
- if (sID < 0)
+
+ // Get the BlockEntity's position
+ int x, y, z;
+ if (!GetBlockEntityNBTPos(a_NBT, Child, x, y, z))
{
+ LOGWARNING("Bad block entity, missing the coords. Will be ignored.");
continue;
}
- if (strncmp(a_NBT.GetData(sID), "Beacon", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadBeaconFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "Chest", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadChestFromNBT(a_BlockEntities, a_NBT, Child, E_BLOCK_CHEST);
- }
- else if (strncmp(a_NBT.GetData(sID), "Control", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadCommandBlockFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "Dropper", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadDropperFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "FlowerPot", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadFlowerPotFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "Furnace", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadFurnaceFromNBT(a_BlockEntities, a_NBT, Child, a_BlockTypes, a_BlockMetas);
- }
- else if (strncmp(a_NBT.GetData(sID), "Hopper", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadHopperFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "Music", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadNoteFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "RecordPlayer", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadJukeboxFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "Sign", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadSignFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "Skull", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadMobHeadFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "Trap", a_NBT.GetDataLength(sID)) == 0)
- {
- LoadDispenserFromNBT(a_BlockEntities, a_NBT, Child);
- }
- else if (strncmp(a_NBT.GetData(sID), "TrappedChest", a_NBT.GetDataLength(sID)) == 0)
+ int RelX = x, RelY = y, RelZ = z, ChunkX, ChunkZ;
+ cChunkDef::AbsoluteToRelative(RelX, RelY, RelZ, ChunkX, ChunkZ);
+
+ // Load the proper BlockEntity type based on the block type:
+ BLOCKTYPE BlockType = cChunkDef::GetBlock(a_BlockTypes, RelX, RelY, RelZ);
+ NIBBLETYPE BlockMeta = cChunkDef::GetNibble(a_BlockMetas, RelX, RelY, RelZ);
+ std::auto_ptr<cBlockEntity> be(LoadBlockEntityFromNBT(a_NBT, Child, x, y, z, BlockType, BlockMeta));
+ if (be.get() == NULL)
{
- LoadChestFromNBT(a_BlockEntities, a_NBT, Child, E_BLOCK_TRAPPED_CHEST);
+ continue;
}
- // TODO: Other block entities
+
+ // Add the BlockEntity to the loaded data:
+ a_BlockEntities.push_back(be.release());
} // for Child - tag children
}
@@ -646,6 +611,52 @@ void cWSSAnvil::LoadBlockEntitiesFromNBT(cBlockEntityList & a_BlockEntities, con
+cBlockEntity * cWSSAnvil::LoadBlockEntityFromNBT(const cParsedNBT & a_NBT, int a_Tag, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta)
+{
+ // Load the specific BlockEntity type:
+ switch (a_BlockType)
+ {
+ // Specific entity loaders:
+ case E_BLOCK_BEACON: return LoadBeaconFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_CHEST: return LoadChestFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_CHEST);
+ case E_BLOCK_COMMAND_BLOCK: return LoadCommandBlockFromNBT(a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_DISPENSER: return LoadDispenserFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_DROPPER: return LoadDropperFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_FLOWER_POT: return LoadFlowerPotFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_FURNACE: return LoadFurnaceFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_FURNACE, a_BlockMeta);
+ case E_BLOCK_HEAD: return LoadMobHeadFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_HOPPER: return LoadHopperFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_JUKEBOX: return LoadJukeboxFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_LIT_FURNACE: return LoadFurnaceFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_LIT_FURNACE, a_BlockMeta);
+ case E_BLOCK_NOTE_BLOCK: return LoadNoteBlockFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ);
+ case E_BLOCK_SIGN_POST: return LoadSignFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_SIGN_POST);
+ case E_BLOCK_TRAPPED_CHEST: return LoadChestFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_TRAPPED_CHEST);
+ case E_BLOCK_WALLSIGN: return LoadSignFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_WALLSIGN);
+
+ // Blocktypes that have block entities but don't load their contents from disk:
+ case E_BLOCK_ENDER_CHEST: return NULL;
+ }
+
+ // All the other blocktypes should have no entities assigned to them. Report an error:
+ // Get the "id" tag:
+ int TagID = a_NBT.FindChildByName(a_Tag, "id");
+ AString TypeName("<unknown>");
+ if (TagID >= 0)
+ {
+ TypeName.assign(a_NBT.GetData(TagID), (size_t)a_NBT.GetDataLength(TagID));
+ }
+ LOGINFO("WorldLoader(%s): Block entity mismatch: block type %s (%d), type \"%s\", at {%d, %d, %d}; the entity will be lost.",
+ m_World->GetName().c_str(),
+ ItemTypeToString(a_BlockType).c_str(), a_BlockType, TypeName.c_str(),
+ a_BlockX, a_BlockY, a_BlockZ
+ );
+ return NULL;
+}
+
+
+
+
+
bool cWSSAnvil::LoadItemFromNBT(cItem & a_Item, const cParsedNBT & a_NBT, int a_TagIdx)
{
int Type = a_NBT.FindChildByName(a_TagIdx, "id");
@@ -656,7 +667,6 @@ bool cWSSAnvil::LoadItemFromNBT(cItem & a_Item, const cParsedNBT & a_NBT, int a_
a_Item.m_ItemType = a_NBT.GetShort(Type);
if (a_Item.m_ItemType < 0)
{
- LOGD("Encountered an item with negative type (%d). Replacing with an empty item.", a_NBT.GetShort(Type));
a_Item.Empty();
return true;
}
@@ -754,16 +764,46 @@ void cWSSAnvil::LoadItemGridFromNBT(cItemGrid & a_ItemGrid, const cParsedNBT & a
-void cWSSAnvil::LoadBeaconFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+bool cWSSAnvil::CheckBlockEntityType(const cParsedNBT & a_NBT, int a_TagIdx, const char * a_ExpectedType)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the given tag is a compound:
+ if (a_NBT.GetType(a_TagIdx) != TAG_Compound)
{
- return;
+ return false;
+ }
+
+ // Get the "id" tag:
+ int TagID = a_NBT.FindChildByName(a_TagIdx, "id");
+ if (TagID < 0)
+ {
+ return false;
}
- std::auto_ptr<cBeaconEntity> Beacon(new cBeaconEntity(x, y, z, m_World));
+ // Compare the value:
+ if (strncmp(a_NBT.GetData(TagID), a_ExpectedType, (size_t)a_NBT.GetDataLength(TagID)) == 0)
+ {
+ return true;
+ }
+ LOGWARNING("Block entity type mismatch: exp \"%s\", got \"%s\".",
+ a_ExpectedType,
+ AString(a_NBT.GetData(TagID), (size_t)a_NBT.GetDataLength(TagID)).c_str()
+ );
+ return false;
+}
+
+
+
+
+
+cBlockEntity * cWSSAnvil::LoadBeaconFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
+{
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Beacon"))
+ {
+ return NULL;
+ }
+
+ std::auto_ptr<cBeaconEntity> Beacon(new cBeaconEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
int CurrentLine = a_NBT.FindChildByName(a_TagIdx, "Levels");
if (CurrentLine >= 0)
@@ -790,88 +830,128 @@ void cWSSAnvil::LoadBeaconFromNBT(cBlockEntityList & a_BlockEntities, const cPar
LoadItemGridFromNBT(Beacon->GetContents(), a_NBT, Items);
}
- a_BlockEntities.push_back(Beacon.release());
+ return Beacon.release();
}
-void cWSSAnvil::LoadChestFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx, BLOCKTYPE a_ChestType)
+cBlockEntity * cWSSAnvil::LoadChestFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_ChestBlockType)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ // TODO: Does vanilla use "TrappedChest" or not? MCWiki says no, but previous code says yes
+ // Ref.: http://minecraft.gamepedia.com/Trapped_Chest
+ // https://github.com/mc-server/MCServer/blob/d0551e2e0a98a28f31a88d489d17b408e4a7d38d/src/WorldStorage/WSSAnvil.cpp#L637
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Chest") && !CheckBlockEntityType(a_NBT, a_TagIdx, "TrappedChest"))
{
- return;
+ return NULL;
}
+
int Items = a_NBT.FindChildByName(a_TagIdx, "Items");
if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List))
{
- return; // Make it an empty chest - the chunk loader will provide an empty cChestEntity for this
+ return NULL; // Make it an empty chest - the chunk loader will provide an empty cChestEntity for this
}
- std::auto_ptr<cChestEntity> Chest(new cChestEntity(x, y, z, m_World, a_ChestType));
+ std::auto_ptr<cChestEntity> Chest(new cChestEntity(a_BlockX, a_BlockY, a_BlockZ, m_World, a_ChestBlockType));
LoadItemGridFromNBT(Chest->GetContents(), a_NBT, Items);
- a_BlockEntities.push_back(Chest.release());
+ return Chest.release();
}
-void cWSSAnvil::LoadDispenserFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+cBlockEntity * cWSSAnvil::LoadCommandBlockFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Control"))
{
- return;
+ return NULL;
+ }
+
+ std::auto_ptr<cCommandBlockEntity> CmdBlock(new cCommandBlockEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
+
+ int currentLine = a_NBT.FindChildByName(a_TagIdx, "Command");
+ if (currentLine >= 0)
+ {
+ CmdBlock->SetCommand(a_NBT.GetString(currentLine));
+ }
+
+ currentLine = a_NBT.FindChildByName(a_TagIdx, "SuccessCount");
+ if (currentLine >= 0)
+ {
+ CmdBlock->SetResult(a_NBT.GetInt(currentLine));
+ }
+
+ currentLine = a_NBT.FindChildByName(a_TagIdx, "LastOutput");
+ if (currentLine >= 0)
+ {
+ CmdBlock->SetLastOutput(a_NBT.GetString(currentLine));
}
+
+ // TODO 2014-01-18 xdot: Figure out what TrackOutput is and parse it.
+
+ return CmdBlock.release();
+}
+
+
+
+
+
+cBlockEntity * cWSSAnvil::LoadDispenserFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
+{
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Trap"))
+ {
+ return NULL;
+ }
+
int Items = a_NBT.FindChildByName(a_TagIdx, "Items");
if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List))
{
- return; // Make it an empty dispenser - the chunk loader will provide an empty cDispenserEntity for this
+ return NULL; // Make it an empty dispenser - the chunk loader will provide an empty cDispenserEntity for this
}
- std::auto_ptr<cDispenserEntity> Dispenser(new cDispenserEntity(x, y, z, m_World));
+ std::auto_ptr<cDispenserEntity> Dispenser(new cDispenserEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
LoadItemGridFromNBT(Dispenser->GetContents(), a_NBT, Items);
- a_BlockEntities.push_back(Dispenser.release());
+ return Dispenser.release();
}
-void cWSSAnvil::LoadDropperFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+cBlockEntity * cWSSAnvil::LoadDropperFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Dropper"))
{
- return;
+ return NULL;
}
+
int Items = a_NBT.FindChildByName(a_TagIdx, "Items");
if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List))
{
- return; // Make it an empty dropper - the chunk loader will provide an empty cDropperEntity for this
+ return NULL; // Make it an empty dropper - the chunk loader will provide an empty cDropperEntity for this
}
- std::auto_ptr<cDropperEntity> Dropper(new cDropperEntity(x, y, z, m_World));
+ std::auto_ptr<cDropperEntity> Dropper(new cDropperEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
LoadItemGridFromNBT(Dropper->GetContents(), a_NBT, Items);
- a_BlockEntities.push_back(Dropper.release());
+ return Dropper.release();
}
-void cWSSAnvil::LoadFlowerPotFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+cBlockEntity * cWSSAnvil::LoadFlowerPotFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "FlowerPot"))
{
- return;
+ return NULL;
}
- std::auto_ptr<cFlowerPotEntity> FlowerPot(new cFlowerPotEntity(x, y, z, m_World));
+
+ std::auto_ptr<cFlowerPotEntity> FlowerPot(new cFlowerPotEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
short ItemType = 0, ItemData = 0;
int currentLine = a_NBT.FindChildByName(a_TagIdx, "Item");
@@ -887,37 +967,28 @@ void cWSSAnvil::LoadFlowerPotFromNBT(cBlockEntityList & a_BlockEntities, const c
}
FlowerPot->SetItem(cItem(ItemType, 1, ItemData));
- a_BlockEntities.push_back(FlowerPot.release());
+ return FlowerPot.release();
}
-void cWSSAnvil::LoadFurnaceFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx, BLOCKTYPE * a_BlockTypes, NIBBLETYPE * a_BlockMetas)
+cBlockEntity * cWSSAnvil::LoadFurnaceFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Furnace"))
{
- return;
+ return NULL;
}
+
int Items = a_NBT.FindChildByName(a_TagIdx, "Items");
if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List))
{
- return; // Make it an empty furnace - the chunk loader will provide an empty cFurnaceEntity for this
+ return NULL; // Make it an empty furnace - the chunk loader will provide an empty cFurnaceEntity for this
}
- // Convert coords to relative:
- int RelX = x;
- int RelZ = z;
- int ChunkX, ChunkZ;
- cChunkDef::AbsoluteToRelative(RelX, y, RelZ, ChunkX, ChunkZ);
-
- // Create the furnace entity, with proper BlockType and BlockMeta info:
- BLOCKTYPE BlockType = cChunkDef::GetBlock(a_BlockTypes, RelX, y, RelZ);
- NIBBLETYPE BlockMeta = cChunkDef::GetNibble(a_BlockMetas, RelX, y, RelZ);
- std::auto_ptr<cFurnaceEntity> Furnace(new cFurnaceEntity(x, y, z, BlockType, BlockMeta, m_World));
+ std::auto_ptr<cFurnaceEntity> Furnace(new cFurnaceEntity(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, m_World));
// Load slots:
for (int Child = a_NBT.GetFirstChild(Items); Child != -1; Child = a_NBT.GetNextSibling(Child))
@@ -954,184 +1025,147 @@ void cWSSAnvil::LoadFurnaceFromNBT(cBlockEntityList & a_BlockEntities, const cPa
// Restart cooking:
Furnace->ContinueCooking();
- a_BlockEntities.push_back(Furnace.release());
+ return Furnace.release();
}
-void cWSSAnvil::LoadHopperFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+cBlockEntity * cWSSAnvil::LoadHopperFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Hopper"))
{
- return;
+ return NULL;
}
+
int Items = a_NBT.FindChildByName(a_TagIdx, "Items");
if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List))
{
- return; // Make it an empty hopper - the chunk loader will provide an empty cHopperEntity for this
+ return NULL; // Make it an empty hopper - the chunk loader will provide an empty cHopperEntity for this
}
- std::auto_ptr<cHopperEntity> Hopper(new cHopperEntity(x, y, z, m_World));
+ std::auto_ptr<cHopperEntity> Hopper(new cHopperEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
LoadItemGridFromNBT(Hopper->GetContents(), a_NBT, Items);
- a_BlockEntities.push_back(Hopper.release());
+ return Hopper.release();
}
-void cWSSAnvil::LoadJukeboxFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+cBlockEntity * cWSSAnvil::LoadJukeboxFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "RecordPlayer"))
{
- return;
+ return NULL;
}
- std::auto_ptr<cJukeboxEntity> Jukebox(new cJukeboxEntity(x, y, z, m_World));
+
+ std::auto_ptr<cJukeboxEntity> Jukebox(new cJukeboxEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
int Record = a_NBT.FindChildByName(a_TagIdx, "Record");
if (Record >= 0)
{
Jukebox->SetRecord(a_NBT.GetInt(Record));
}
- a_BlockEntities.push_back(Jukebox.release());
-}
-
-
-
-
-
-void cWSSAnvil::LoadNoteFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
-{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
- {
- return;
- }
- std::auto_ptr<cNoteEntity> Note(new cNoteEntity(x, y, z, m_World));
- int note = a_NBT.FindChildByName(a_TagIdx, "note");
- if (note >= 0)
- {
- Note->SetPitch(a_NBT.GetByte(note));
- }
- a_BlockEntities.push_back(Note.release());
+ return Jukebox.release();
}
-void cWSSAnvil::LoadSignFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+cBlockEntity * cWSSAnvil::LoadMobHeadFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Skull"))
{
- return;
+ return NULL;
}
- std::auto_ptr<cSignEntity> Sign(new cSignEntity(E_BLOCK_SIGN_POST, x, y, z, m_World));
- int currentLine = a_NBT.FindChildByName(a_TagIdx, "Text1");
- if (currentLine >= 0)
- {
- Sign->SetLine(0, a_NBT.GetString(currentLine));
- }
+ std::auto_ptr<cMobHeadEntity> MobHead(new cMobHeadEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
- currentLine = a_NBT.FindChildByName(a_TagIdx, "Text2");
+ int currentLine = a_NBT.FindChildByName(a_TagIdx, "SkullType");
if (currentLine >= 0)
{
- Sign->SetLine(1, a_NBT.GetString(currentLine));
+ MobHead->SetType(static_cast<eMobHeadType>(a_NBT.GetByte(currentLine)));
}
- currentLine = a_NBT.FindChildByName(a_TagIdx, "Text3");
+ currentLine = a_NBT.FindChildByName(a_TagIdx, "Rot");
if (currentLine >= 0)
{
- Sign->SetLine(2, a_NBT.GetString(currentLine));
+ MobHead->SetRotation(static_cast<eMobHeadRotation>(a_NBT.GetByte(currentLine)));
}
- currentLine = a_NBT.FindChildByName(a_TagIdx, "Text4");
+ currentLine = a_NBT.FindChildByName(a_TagIdx, "ExtraType");
if (currentLine >= 0)
{
- Sign->SetLine(3, a_NBT.GetString(currentLine));
+ MobHead->SetOwner(a_NBT.GetString(currentLine));
}
- a_BlockEntities.push_back(Sign.release());
+ return MobHead.release();
}
-void cWSSAnvil::LoadMobHeadFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+cBlockEntity * cWSSAnvil::LoadNoteBlockFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
- {
- return;
- }
- std::auto_ptr<cMobHeadEntity> MobHead(new cMobHeadEntity(x, y, z, m_World));
-
- int currentLine = a_NBT.FindChildByName(a_TagIdx, "SkullType");
- if (currentLine >= 0)
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Music"))
{
- MobHead->SetType(static_cast<eMobHeadType>(a_NBT.GetByte(currentLine)));
+ return NULL;
}
- currentLine = a_NBT.FindChildByName(a_TagIdx, "Rot");
- if (currentLine >= 0)
+ std::auto_ptr<cNoteEntity> NoteBlock(new cNoteEntity(a_BlockX, a_BlockY, a_BlockZ, m_World));
+ int note = a_NBT.FindChildByName(a_TagIdx, "note");
+ if (note >= 0)
{
- MobHead->SetRotation(static_cast<eMobHeadRotation>(a_NBT.GetByte(currentLine)));
+ NoteBlock->SetPitch(a_NBT.GetByte(note));
}
-
- currentLine = a_NBT.FindChildByName(a_TagIdx, "ExtraType");
- if (currentLine >= 0)
- {
- MobHead->SetOwner(a_NBT.GetString(currentLine));
- }
-
- a_BlockEntities.push_back(MobHead.release());
+ return NoteBlock.release();
}
-void cWSSAnvil::LoadCommandBlockFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx)
+cBlockEntity * cWSSAnvil::LoadSignFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType)
{
- ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound);
- int x, y, z;
- if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z))
+ // Check if the data has a proper type:
+ if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Sign"))
{
- return;
+ return NULL;
}
- std::auto_ptr<cCommandBlockEntity> CmdBlock(new cCommandBlockEntity(x, y, z, m_World));
- int currentLine = a_NBT.FindChildByName(a_TagIdx, "Command");
+ std::auto_ptr<cSignEntity> Sign(new cSignEntity(a_BlockType, a_BlockX, a_BlockY, a_BlockZ, m_World));
+
+ int currentLine = a_NBT.FindChildByName(a_TagIdx, "Text1");
if (currentLine >= 0)
{
- CmdBlock->SetCommand(a_NBT.GetString(currentLine));
+ Sign->SetLine(0, a_NBT.GetString(currentLine));
}
- currentLine = a_NBT.FindChildByName(a_TagIdx, "SuccessCount");
+ currentLine = a_NBT.FindChildByName(a_TagIdx, "Text2");
if (currentLine >= 0)
{
- CmdBlock->SetResult(a_NBT.GetInt(currentLine));
+ Sign->SetLine(1, a_NBT.GetString(currentLine));
}
- currentLine = a_NBT.FindChildByName(a_TagIdx, "LastOutput");
+ currentLine = a_NBT.FindChildByName(a_TagIdx, "Text3");
if (currentLine >= 0)
{
- CmdBlock->SetLastOutput(a_NBT.GetString(currentLine));
+ Sign->SetLine(2, a_NBT.GetString(currentLine));
}
- // TODO 2014-01-18 xdot: Figure out what TrackOutput is and parse it.
+ currentLine = a_NBT.FindChildByName(a_TagIdx, "Text4");
+ if (currentLine >= 0)
+ {
+ Sign->SetLine(3, a_NBT.GetString(currentLine));
+ }
- a_BlockEntities.push_back(CmdBlock.release());
+ return Sign.release();
}
diff --git a/src/WorldStorage/WSSAnvil.h b/src/WorldStorage/WSSAnvil.h
index a41268f4c..591ec6757 100644
--- a/src/WorldStorage/WSSAnvil.h
+++ b/src/WorldStorage/WSSAnvil.h
@@ -125,6 +125,10 @@ protected:
/// Loads the chunk's BlockEntities from NBT data (a_Tag is the Level\\TileEntities list tag; may be -1)
void LoadBlockEntitiesFromNBT(cBlockEntityList & a_BlockEntitites, const cParsedNBT & a_NBT, int a_Tag, BLOCKTYPE * a_BlockTypes, NIBBLETYPE * a_BlockMetas);
+ /** Loads the data for a block entity from the specified NBT tag.
+ Returns the loaded block entity, or NULL upon failure. */
+ cBlockEntity * LoadBlockEntityFromNBT(const cParsedNBT & a_NBT, int a_Tag, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta);
+
/// Loads a cItem contents from the specified NBT tag; returns true if successful. Doesn't load the Slot tag
bool LoadItemFromNBT(cItem & a_Item, const cParsedNBT & a_NBT, int a_TagIdx);
@@ -134,18 +138,21 @@ protected:
*/
void LoadItemGridFromNBT(cItemGrid & a_ItemGrid, const cParsedNBT & a_NBT, int a_ItemsTagIdx, int s_SlotOffset = 0);
- void LoadBeaconFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadChestFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx, BLOCKTYPE a_ChestType);
- void LoadDispenserFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadDropperFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadFlowerPotFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadFurnaceFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx, BLOCKTYPE * a_BlockTypes, NIBBLETYPE * a_BlockMetas);
- void LoadHopperFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadJukeboxFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadNoteFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadSignFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadMobHeadFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
- void LoadCommandBlockFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx);
+ /** Returns true iff the "id" child tag inside the specified tag equals the specified expected type. */
+ bool CheckBlockEntityType(const cParsedNBT & a_NBT, int a_TagIdx, const char * a_ExpectedType);
+
+ cBlockEntity * LoadBeaconFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadChestFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_ChestBlockType);
+ cBlockEntity * LoadCommandBlockFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadDispenserFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadDropperFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadFlowerPotFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadFurnaceFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta);
+ cBlockEntity * LoadHopperFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadJukeboxFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadMobHeadFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadNoteBlockFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ);
+ cBlockEntity * LoadSignFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_SignBlockType);
void LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_EntityTagIdx, const char * a_IDTag, size_t a_IDTagLength);